From 3e8b34be2fdeccf16c8b46f1ee518f970853768d Mon Sep 17 00:00:00 2001 From: Mitch Riedstra Date: Tue, 24 Oct 2017 16:59:48 -0400 Subject: Adding in materialize source and templates --- app/dispatch/migrations/0007_invoice_paid.py | 20 + app/dispatch/migrations/0008_invoiceitem_date.py | 22 + .../materialize.scssc | Bin 0 -> 5429 bytes .../_badges.scssc | Bin 0 -> 14164 bytes .../_buttons.scssc | Bin 0 -> 59468 bytes .../_cards.scssc | Bin 0 -> 38901 bytes .../_carousel.scssc | Bin 0 -> 19207 bytes .../_chips.scssc | Bin 0 -> 21380 bytes .../_collapsible.scssc | Bin 0 -> 25132 bytes .../_color.scssc | Bin 0 -> 85522 bytes .../_dropdown.scssc | Bin 0 -> 16741 bytes .../_global.scssc | Bin 0 -> 162354 bytes .../_grid.scssc | Bin 0 -> 35529 bytes .../_icons-material-design.scssc | Bin 0 -> 2085 bytes .../_materialbox.scssc | Bin 0 -> 9833 bytes .../_modal.scssc | Bin 0 -> 19552 bytes .../_navbar.scssc | Bin 0 -> 43371 bytes .../_normalize.scssc | Bin 0 -> 50916 bytes .../_preloader.scssc | Bin 0 -> 105030 bytes .../_pulse.scssc | Bin 0 -> 8705 bytes .../_roboto.scssc | Bin 0 -> 14970 bytes .../_sideNav.scssc | Bin 0 -> 50702 bytes .../_slider.scssc | Bin 0 -> 18422 bytes .../_table_of_contents.scssc | Bin 0 -> 8300 bytes .../_tabs.scssc | Bin 0 -> 19692 bytes .../_tapTarget.scssc | Bin 0 -> 27476 bytes .../_toast.scssc | Bin 0 -> 13431 bytes .../_tooltip.scssc | Bin 0 -> 8273 bytes .../_transitions.scssc | Bin 0 -> 4337 bytes .../_typography.scssc | Bin 0 -> 24976 bytes .../_variables.scssc | Bin 0 -> 69419 bytes .../_waves.scssc | Bin 0 -> 27236 bytes .../_checkboxes.scssc | Bin 0 -> 51662 bytes .../_file-input.scssc | Bin 0 -> 9579 bytes .../_forms.scssc | Bin 0 -> 4352 bytes .../_input-fields.scssc | Bin 0 -> 73483 bytes .../_radio-buttons.scssc | Bin 0 -> 30746 bytes .../_range.scssc | Bin 0 -> 32375 bytes .../_select.scssc | Bin 0 -> 37571 bytes .../_switches.scssc | Bin 0 -> 26207 bytes .../_default.date.scssc | Bin 0 -> 85275 bytes .../_default.scssc | Bin 0 -> 41658 bytes .../_default.time.scssc | Bin 0 -> 61977 bytes .../static/materialize/css/materialize.min.css.map | 7 + app/dispatch/static/materialize/js/animation.js | 8 + .../static/materialize/js/bin/materialize.js | 10021 +++++++++++++++++++ .../static/materialize/js/bin/materialize.min.js | 6 + app/dispatch/static/materialize/js/buttons.js | 267 + app/dispatch/static/materialize/js/cards.js | 36 + app/dispatch/static/materialize/js/carousel.js | 565 ++ .../static/materialize/js/character_counter.js | 72 + app/dispatch/static/materialize/js/chips.js | 318 + app/dispatch/static/materialize/js/collapsible.js | 183 + .../materialize/js/date_picker/picker.date.js | 1429 +++ .../static/materialize/js/date_picker/picker.js | 1121 +++ .../materialize/js/date_picker/picker.time.js | 695 ++ app/dispatch/static/materialize/js/dropdown.js | 274 + app/dispatch/static/materialize/js/forms.js | 811 ++ app/dispatch/static/materialize/js/global.js | 177 + app/dispatch/static/materialize/js/hammer.min.js | 1 + app/dispatch/static/materialize/js/initial.js | 10 + .../static/materialize/js/jquery.easing.1.4.js | 166 + .../static/materialize/js/jquery.hammer.js | 33 + app/dispatch/static/materialize/js/materialbox.js | 289 + app/dispatch/static/materialize/js/modal.js | 371 + app/dispatch/static/materialize/js/parallax.js | 58 + app/dispatch/static/materialize/js/pushpin.js | 71 + app/dispatch/static/materialize/js/scrollFire.js | 51 + app/dispatch/static/materialize/js/scrollspy.js | 238 + app/dispatch/static/materialize/js/sideNav.js | 414 + app/dispatch/static/materialize/js/slider.js | 324 + app/dispatch/static/materialize/js/tabs.js | 246 + app/dispatch/static/materialize/js/tapTarget.js | 187 + app/dispatch/static/materialize/js/toasts.js | 320 + app/dispatch/static/materialize/js/tooltip.js | 239 + app/dispatch/static/materialize/js/transitions.js | 169 + app/dispatch/static/materialize/js/velocity.min.js | 5 + app/dispatch/static/materialize/js/waves.js | 335 + .../materialize.scssc | Bin 0 -> 5434 bytes .../_badges.scssc | Bin 0 -> 14169 bytes .../_buttons.scssc | Bin 0 -> 59473 bytes .../_cards.scssc | Bin 0 -> 38906 bytes .../_carousel.scssc | Bin 0 -> 19212 bytes .../_chips.scssc | Bin 0 -> 21385 bytes .../_collapsible.scssc | Bin 0 -> 25137 bytes .../_color.scssc | Bin 0 -> 85547 bytes .../_dropdown.scssc | Bin 0 -> 16746 bytes .../_global.scssc | Bin 0 -> 162359 bytes .../_grid.scssc | Bin 0 -> 35534 bytes .../_icons-material-design.scssc | Bin 0 -> 2090 bytes .../_materialbox.scssc | Bin 0 -> 9838 bytes .../_modal.scssc | Bin 0 -> 19557 bytes .../_navbar.scssc | Bin 0 -> 43376 bytes .../_normalize.scssc | Bin 0 -> 50921 bytes .../_preloader.scssc | Bin 0 -> 105035 bytes .../_pulse.scssc | Bin 0 -> 8710 bytes .../_roboto.scssc | Bin 0 -> 14975 bytes .../_sideNav.scssc | Bin 0 -> 50707 bytes .../_slider.scssc | Bin 0 -> 18427 bytes .../_table_of_contents.scssc | Bin 0 -> 8305 bytes .../_tabs.scssc | Bin 0 -> 19697 bytes .../_tapTarget.scssc | Bin 0 -> 27481 bytes .../_toast.scssc | Bin 0 -> 13436 bytes .../_tooltip.scssc | Bin 0 -> 8278 bytes .../_transitions.scssc | Bin 0 -> 4342 bytes .../_typography.scssc | Bin 0 -> 24981 bytes .../_variables.scssc | Bin 0 -> 67720 bytes .../_waves.scssc | Bin 0 -> 27241 bytes .../_checkboxes.scssc | Bin 0 -> 51667 bytes .../_file-input.scssc | Bin 0 -> 9584 bytes .../_forms.scssc | Bin 0 -> 4357 bytes .../_input-fields.scssc | Bin 0 -> 73488 bytes .../_radio-buttons.scssc | Bin 0 -> 30751 bytes .../_range.scssc | Bin 0 -> 32380 bytes .../_select.scssc | Bin 0 -> 37576 bytes .../_switches.scssc | Bin 0 -> 26212 bytes .../_default.date.scssc | Bin 0 -> 85280 bytes .../_default.scssc | Bin 0 -> 41663 bytes .../_default.time.scssc | Bin 0 -> 61982 bytes .../materialize/sass/components/_badges.scss | 47 + .../materialize/sass/components/_buttons.scss | 291 + .../static/materialize/sass/components/_cards.scss | 196 + .../materialize/sass/components/_carousel.scss | 90 + .../static/materialize/sass/components/_chips.scss | 89 + .../materialize/sass/components/_collapsible.scss | 84 + .../static/materialize/sass/components/_color.scss | 412 + .../materialize/sass/components/_dropdown.scss | 68 + .../materialize/sass/components/_global.scss | 734 ++ .../static/materialize/sass/components/_grid.scss | 156 + .../sass/components/_icons-material-design.scss | 5 + .../materialize/sass/components/_materialbox.scss | 43 + .../static/materialize/sass/components/_modal.scss | 90 + .../materialize/sass/components/_navbar.scss | 208 + .../materialize/sass/components/_normalize.scss | 424 + .../materialize/sass/components/_preloader.scss | 334 + .../static/materialize/sass/components/_pulse.scss | 34 + .../materialize/sass/components/_roboto.scss | 39 + .../materialize/sass/components/_sideNav.scss | 214 + .../materialize/sass/components/_slider.scss | 92 + .../sass/components/_table_of_contents.scss | 33 + .../static/materialize/sass/components/_tabs.scss | 93 + .../materialize/sass/components/_tapTarget.scss | 103 + .../static/materialize/sass/components/_toast.scss | 59 + .../materialize/sass/components/_tooltip.scss | 31 + .../materialize/sass/components/_transitions.scss | 13 + .../materialize/sass/components/_typography.scss | 61 + .../materialize/sass/components/_variables.scss | 353 + .../static/materialize/sass/components/_waves.scss | 114 + .../sass/components/date_picker/_default.date.scss | 456 + .../sass/components/date_picker/_default.scss | 212 + .../sass/components/date_picker/_default.time.scss | 267 + .../sass/components/forms/_checkboxes.scss | 210 + .../sass/components/forms/_file-input.scss | 44 + .../materialize/sass/components/forms/_forms.scss | 22 + .../sass/components/forms/_input-fields.scss | 333 + .../sass/components/forms/_radio-buttons.scss | 115 + .../materialize/sass/components/forms/_range.scss | 160 + .../materialize/sass/components/forms/_select.scss | 182 + .../sass/components/forms/_switches.scss | 89 + .../static/materialize/sass/materialize.scss | 42 + app/dispatch/static/print.css | 18 + .../templates/dispatch/invoice/detail-table.html | 89 + .../templates/dispatch/invoice/detail.html | 38 + app/dispatch/templates/dispatch/invoice/list.html | 41 + app/dispatch/templates/dispatch/printable.html | 112 + 165 files changed, 26499 insertions(+) create mode 100644 app/dispatch/migrations/0007_invoice_paid.py create mode 100644 app/dispatch/migrations/0008_invoiceitem_date.py create mode 100644 app/dispatch/static/materialize/.sass-cache/219915314f96ba592393ee0f91ebc5ca040988d6/materialize.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_badges.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_buttons.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_cards.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_carousel.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_chips.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_collapsible.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_color.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_dropdown.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_global.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_grid.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_icons-material-design.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_materialbox.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_modal.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_navbar.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_normalize.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_preloader.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_pulse.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_roboto.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_sideNav.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_slider.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_table_of_contents.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tabs.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tapTarget.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_toast.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tooltip.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_transitions.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_typography.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_variables.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_waves.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_checkboxes.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_file-input.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_forms.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_input-fields.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_radio-buttons.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_range.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_select.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_switches.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.date.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.scssc create mode 100644 app/dispatch/static/materialize/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.time.scssc create mode 100644 app/dispatch/static/materialize/css/materialize.min.css.map create mode 100644 app/dispatch/static/materialize/js/animation.js create mode 100644 app/dispatch/static/materialize/js/bin/materialize.js create mode 100644 app/dispatch/static/materialize/js/bin/materialize.min.js create mode 100644 app/dispatch/static/materialize/js/buttons.js create mode 100644 app/dispatch/static/materialize/js/cards.js create mode 100644 app/dispatch/static/materialize/js/carousel.js create mode 100644 app/dispatch/static/materialize/js/character_counter.js create mode 100644 app/dispatch/static/materialize/js/chips.js create mode 100644 app/dispatch/static/materialize/js/collapsible.js create mode 100644 app/dispatch/static/materialize/js/date_picker/picker.date.js create mode 100644 app/dispatch/static/materialize/js/date_picker/picker.js create mode 100644 app/dispatch/static/materialize/js/date_picker/picker.time.js create mode 100644 app/dispatch/static/materialize/js/dropdown.js create mode 100644 app/dispatch/static/materialize/js/forms.js create mode 100644 app/dispatch/static/materialize/js/global.js create mode 100644 app/dispatch/static/materialize/js/hammer.min.js create mode 100644 app/dispatch/static/materialize/js/initial.js create mode 100644 app/dispatch/static/materialize/js/jquery.easing.1.4.js create mode 100644 app/dispatch/static/materialize/js/jquery.hammer.js create mode 100644 app/dispatch/static/materialize/js/materialbox.js create mode 100644 app/dispatch/static/materialize/js/modal.js create mode 100644 app/dispatch/static/materialize/js/parallax.js create mode 100644 app/dispatch/static/materialize/js/pushpin.js create mode 100644 app/dispatch/static/materialize/js/scrollFire.js create mode 100644 app/dispatch/static/materialize/js/scrollspy.js create mode 100644 app/dispatch/static/materialize/js/sideNav.js create mode 100644 app/dispatch/static/materialize/js/slider.js create mode 100644 app/dispatch/static/materialize/js/tabs.js create mode 100644 app/dispatch/static/materialize/js/tapTarget.js create mode 100644 app/dispatch/static/materialize/js/toasts.js create mode 100644 app/dispatch/static/materialize/js/tooltip.js create mode 100644 app/dispatch/static/materialize/js/transitions.js create mode 100644 app/dispatch/static/materialize/js/velocity.min.js create mode 100644 app/dispatch/static/materialize/js/waves.js create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/219915314f96ba592393ee0f91ebc5ca040988d6/materialize.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_badges.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_buttons.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_cards.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_carousel.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_chips.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_collapsible.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_color.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_dropdown.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_global.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_grid.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_icons-material-design.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_materialbox.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_modal.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_navbar.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_normalize.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_preloader.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_pulse.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_roboto.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_sideNav.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_slider.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_table_of_contents.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tabs.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tapTarget.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_toast.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tooltip.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_transitions.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_typography.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_variables.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_waves.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_checkboxes.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_file-input.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_forms.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_input-fields.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_radio-buttons.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_range.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_select.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_switches.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.date.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.scssc create mode 100644 app/dispatch/static/materialize/sass/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.time.scssc create mode 100644 app/dispatch/static/materialize/sass/components/_badges.scss create mode 100644 app/dispatch/static/materialize/sass/components/_buttons.scss create mode 100644 app/dispatch/static/materialize/sass/components/_cards.scss create mode 100644 app/dispatch/static/materialize/sass/components/_carousel.scss create mode 100644 app/dispatch/static/materialize/sass/components/_chips.scss create mode 100644 app/dispatch/static/materialize/sass/components/_collapsible.scss create mode 100644 app/dispatch/static/materialize/sass/components/_color.scss create mode 100644 app/dispatch/static/materialize/sass/components/_dropdown.scss create mode 100644 app/dispatch/static/materialize/sass/components/_global.scss create mode 100644 app/dispatch/static/materialize/sass/components/_grid.scss create mode 100644 app/dispatch/static/materialize/sass/components/_icons-material-design.scss create mode 100644 app/dispatch/static/materialize/sass/components/_materialbox.scss create mode 100644 app/dispatch/static/materialize/sass/components/_modal.scss create mode 100644 app/dispatch/static/materialize/sass/components/_navbar.scss create mode 100644 app/dispatch/static/materialize/sass/components/_normalize.scss create mode 100644 app/dispatch/static/materialize/sass/components/_preloader.scss create mode 100644 app/dispatch/static/materialize/sass/components/_pulse.scss create mode 100644 app/dispatch/static/materialize/sass/components/_roboto.scss create mode 100644 app/dispatch/static/materialize/sass/components/_sideNav.scss create mode 100644 app/dispatch/static/materialize/sass/components/_slider.scss create mode 100644 app/dispatch/static/materialize/sass/components/_table_of_contents.scss create mode 100644 app/dispatch/static/materialize/sass/components/_tabs.scss create mode 100644 app/dispatch/static/materialize/sass/components/_tapTarget.scss create mode 100644 app/dispatch/static/materialize/sass/components/_toast.scss create mode 100644 app/dispatch/static/materialize/sass/components/_tooltip.scss create mode 100644 app/dispatch/static/materialize/sass/components/_transitions.scss create mode 100644 app/dispatch/static/materialize/sass/components/_typography.scss create mode 100644 app/dispatch/static/materialize/sass/components/_variables.scss create mode 100644 app/dispatch/static/materialize/sass/components/_waves.scss create mode 100644 app/dispatch/static/materialize/sass/components/date_picker/_default.date.scss create mode 100644 app/dispatch/static/materialize/sass/components/date_picker/_default.scss create mode 100644 app/dispatch/static/materialize/sass/components/date_picker/_default.time.scss create mode 100644 app/dispatch/static/materialize/sass/components/forms/_checkboxes.scss create mode 100644 app/dispatch/static/materialize/sass/components/forms/_file-input.scss create mode 100644 app/dispatch/static/materialize/sass/components/forms/_forms.scss create mode 100644 app/dispatch/static/materialize/sass/components/forms/_input-fields.scss create mode 100644 app/dispatch/static/materialize/sass/components/forms/_radio-buttons.scss create mode 100644 app/dispatch/static/materialize/sass/components/forms/_range.scss create mode 100644 app/dispatch/static/materialize/sass/components/forms/_select.scss create mode 100644 app/dispatch/static/materialize/sass/components/forms/_switches.scss create mode 100644 app/dispatch/static/materialize/sass/materialize.scss create mode 100644 app/dispatch/static/print.css create mode 100644 app/dispatch/templates/dispatch/invoice/detail-table.html create mode 100644 app/dispatch/templates/dispatch/invoice/detail.html create mode 100644 app/dispatch/templates/dispatch/invoice/list.html create mode 100644 app/dispatch/templates/dispatch/printable.html (limited to 'app/dispatch') diff --git a/app/dispatch/migrations/0007_invoice_paid.py b/app/dispatch/migrations/0007_invoice_paid.py new file mode 100644 index 0000000..d8fcd81 --- /dev/null +++ b/app/dispatch/migrations/0007_invoice_paid.py @@ -0,0 +1,20 @@ +# -*- coding: utf-8 -*- +# Generated by Django 1.11.5 on 2017-10-24 14:20 +from __future__ import unicode_literals + +from django.db import migrations, models + + +class Migration(migrations.Migration): + + dependencies = [ + ('dispatch', '0006_auto_20171023_2049'), + ] + + operations = [ + migrations.AddField( + model_name='invoice', + name='paid', + field=models.BooleanField(default=False), + ), + ] diff --git a/app/dispatch/migrations/0008_invoiceitem_date.py b/app/dispatch/migrations/0008_invoiceitem_date.py new file mode 100644 index 0000000..892adfe --- /dev/null +++ b/app/dispatch/migrations/0008_invoiceitem_date.py @@ -0,0 +1,22 @@ +# -*- coding: utf-8 -*- +# Generated by Django 1.11.5 on 2017-10-24 15:02 +from __future__ import unicode_literals + +from django.db import migrations, models +import django.utils.timezone + + +class Migration(migrations.Migration): + + dependencies = [ + ('dispatch', '0007_invoice_paid'), + ] + + operations = [ + migrations.AddField( + model_name='invoiceitem', + name='date', + field=models.DateField(default=django.utils.timezone.now), + preserve_default=False, + ), + ] diff --git a/app/dispatch/static/materialize/.sass-cache/219915314f96ba592393ee0f91ebc5ca040988d6/materialize.scssc b/app/dispatch/static/materialize/.sass-cache/219915314f96ba592393ee0f91ebc5ca040988d6/materialize.scssc new file mode 100644 index 0000000..6eeb811 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/219915314f96ba592393ee0f91ebc5ca040988d6/materialize.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_badges.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_badges.scssc new file mode 100644 index 0000000..9dd273c Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_badges.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_buttons.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_buttons.scssc new file mode 100644 index 0000000..f406aa2 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_buttons.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_cards.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_cards.scssc new file mode 100644 index 0000000..360efd1 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_cards.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_carousel.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_carousel.scssc new file mode 100644 index 0000000..6b68919 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_carousel.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_chips.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_chips.scssc new file mode 100644 index 0000000..40ed812 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_chips.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_collapsible.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_collapsible.scssc new file mode 100644 index 0000000..f045762 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_collapsible.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_color.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_color.scssc new file mode 100644 index 0000000..0e6fc12 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_color.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_dropdown.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_dropdown.scssc new file mode 100644 index 0000000..316cc93 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_dropdown.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_global.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_global.scssc new file mode 100644 index 0000000..a39d2c2 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_global.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_grid.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_grid.scssc new file mode 100644 index 0000000..e2dc378 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_grid.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_icons-material-design.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_icons-material-design.scssc new file mode 100644 index 0000000..0ee9872 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_icons-material-design.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_materialbox.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_materialbox.scssc new file mode 100644 index 0000000..897028b Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_materialbox.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_modal.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_modal.scssc new file mode 100644 index 0000000..43dcec6 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_modal.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_navbar.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_navbar.scssc new file mode 100644 index 0000000..c41240d Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_navbar.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_normalize.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_normalize.scssc new file mode 100644 index 0000000..89ab27d Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_normalize.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_preloader.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_preloader.scssc new file mode 100644 index 0000000..7d5da2c Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_preloader.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_pulse.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_pulse.scssc new file mode 100644 index 0000000..d0591b7 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_pulse.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_roboto.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_roboto.scssc new file mode 100644 index 0000000..91d4ed8 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_roboto.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_sideNav.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_sideNav.scssc new file mode 100644 index 0000000..c78a431 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_sideNav.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_slider.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_slider.scssc new file mode 100644 index 0000000..c9809e4 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_slider.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_table_of_contents.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_table_of_contents.scssc new file mode 100644 index 0000000..9cb15fb Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_table_of_contents.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tabs.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tabs.scssc new file mode 100644 index 0000000..1d3ba87 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tabs.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tapTarget.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tapTarget.scssc new file mode 100644 index 0000000..94da382 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tapTarget.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_toast.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_toast.scssc new file mode 100644 index 0000000..a5abca2 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_toast.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tooltip.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tooltip.scssc new file mode 100644 index 0000000..6dfe50d Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tooltip.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_transitions.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_transitions.scssc new file mode 100644 index 0000000..633c052 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_transitions.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_typography.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_typography.scssc new file mode 100644 index 0000000..b5bfe0b Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_typography.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_variables.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_variables.scssc new file mode 100644 index 0000000..d22bf00 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_variables.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_waves.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_waves.scssc new file mode 100644 index 0000000..54684f6 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_waves.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_checkboxes.scssc b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_checkboxes.scssc new file mode 100644 index 0000000..899c061 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_checkboxes.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_file-input.scssc b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_file-input.scssc new file mode 100644 index 0000000..1122c19 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_file-input.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_forms.scssc b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_forms.scssc new file mode 100644 index 0000000..3ee6f0e Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_forms.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_input-fields.scssc b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_input-fields.scssc new file mode 100644 index 0000000..c0dbb39 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_input-fields.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_radio-buttons.scssc b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_radio-buttons.scssc new file mode 100644 index 0000000..df5efbc Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_radio-buttons.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_range.scssc b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_range.scssc new file mode 100644 index 0000000..e188d04 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_range.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_select.scssc b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_select.scssc new file mode 100644 index 0000000..2974159 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_select.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_switches.scssc b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_switches.scssc new file mode 100644 index 0000000..e776d02 Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_switches.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.date.scssc b/app/dispatch/static/materialize/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.date.scssc new file mode 100644 index 0000000..607e4dc Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.date.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.scssc b/app/dispatch/static/materialize/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.scssc new file mode 100644 index 0000000..145330c Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.scssc differ diff --git a/app/dispatch/static/materialize/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.time.scssc b/app/dispatch/static/materialize/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.time.scssc new file mode 100644 index 0000000..0335a0d Binary files /dev/null and b/app/dispatch/static/materialize/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.time.scssc differ diff --git a/app/dispatch/static/materialize/css/materialize.min.css.map b/app/dispatch/static/materialize/css/materialize.min.css.map new file mode 100644 index 0000000..4b48694 --- /dev/null +++ b/app/dispatch/static/materialize/css/materialize.min.css.map @@ -0,0 +1,7 @@ +{ +"version": 3, +"mappings": "AAiXM,gBAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,qBAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,0BAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,oCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,0BAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,oCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,0BAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,oCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,0BAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,oCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,0BAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,oCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,yBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,mCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,yBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,mCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,yBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,mCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,yBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,mCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,IAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,SAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,aAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,uBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,aAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,uBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,aAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,uBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,aAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,uBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,aAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,uBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,aAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,uBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,aAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,uBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,aAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,uBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,KAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,UAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,OAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,YAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,eAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,eAAuB,CAZhC,YAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,iBAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,OAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,YAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,KAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,UAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,WAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,gBAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,KAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,UAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,KAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,UAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,MAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,WAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,YAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,iBAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,KAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,UAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,OAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,YAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,eAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,eAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,MAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,WAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,OAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,YAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,YAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,iBAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,MAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,WAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,UAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,eAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,mBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,6BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,mBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,6BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,mBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,6BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,mBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,6BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,KAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,UAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,eAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,eAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAQpC,MAAW,CACT,gBAAgB,CAAE,eAAuB,CAE3C,WAAgB,CACd,KAAK,CAAE,eAAuB,CAJhC,MAAW,CACT,gBAAgB,CAAE,eAAuB,CAE3C,WAAgB,CACd,KAAK,CAAE,eAAuB,CAJhC,YAAW,CACT,gBAAgB,CAAE,sBAAuB,CAE3C,iBAAgB,CACd,KAAK,CAAE,sBAAuB,CCzYlC,4EAA4E,AAQ5E,IAAK,CACH,WAAW,CAAE,UAAU,CACvB,oBAAoB,CAAE,IAAI,CAC1B,wBAAwB,CAAE,IAAI,CAOhC,IAAK,CACH,MAAM,CAAE,CAAC,CAaX,0FAYQ,CACN,OAAO,CAAE,KAAK,CAQhB,2BAGM,CACJ,OAAO,CAAE,YAAY,CACrB,cAAc,CAAE,QAAQ,CAQ1B,qBAAsB,CACpB,OAAO,CAAE,IAAI,CACb,MAAM,CAAE,CAAC,CAQX,iBACS,CACP,OAAO,CAAE,IAAI,CAUf,CAAE,CACA,gBAAgB,CAAE,WAAW,CAQ/B,gBACQ,CACN,OAAO,CAAE,CAAC,CAUZ,WAAY,CACV,aAAa,CAAE,UAAU,CAO3B,QACO,CACL,WAAW,CAAE,IAAI,CAOnB,GAAI,CACF,UAAU,CAAE,MAAM,CAQpB,EAAG,CACD,SAAS,CAAE,GAAG,CACd,MAAM,CAAE,QAAQ,CAOlB,IAAK,CACH,UAAU,CAAE,IAAI,CAChB,KAAK,CAAE,IAAI,CAOb,KAAM,CACJ,SAAS,CAAE,GAAG,CAOhB,OACI,CACF,SAAS,CAAE,GAAG,CACd,WAAW,CAAE,CAAC,CACd,QAAQ,CAAE,QAAQ,CAClB,cAAc,CAAE,QAAQ,CAG1B,GAAI,CACF,GAAG,CAAE,MAAM,CAGb,GAAI,CACF,MAAM,CAAE,OAAO,CAUjB,GAAI,CACF,MAAM,CAAE,CAAC,CAOX,cAAe,CACb,QAAQ,CAAE,MAAM,CAUlB,MAAO,CACL,MAAM,CAAE,QAAQ,CAOlB,EAAG,CACD,UAAU,CAAE,WAAW,CACvB,MAAM,CAAE,CAAC,CAOX,GAAI,CACF,QAAQ,CAAE,IAAI,CAOhB,iBAGK,CACH,WAAW,CAAE,oBAAoB,CACjC,SAAS,CAAE,GAAG,CAkBhB,qCAIS,CACP,KAAK,CAAE,OAAO,CACd,IAAI,CAAE,OAAO,CACb,MAAM,CAAE,CAAC,CAOX,MAAO,CACL,QAAQ,CAAE,OAAO,CAUnB,aACO,CACL,cAAc,CAAE,IAAI,CAWtB,yEAGqB,CACnB,kBAAkB,CAAE,MAAM,CAC1B,MAAM,CAAE,OAAO,CAOjB,qCACqB,CACnB,MAAM,CAAE,OAAO,CAOjB,gDACwB,CACtB,MAAM,CAAE,CAAC,CACT,OAAO,CAAE,CAAC,CAQZ,KAAM,CACJ,WAAW,CAAE,MAAM,CAWrB,0CACoB,CAClB,UAAU,CAAE,UAAU,CACtB,OAAO,CAAE,CAAC,CASZ,+FACgD,CAC9C,MAAM,CAAE,IAAI,CAQd,oBAAqB,CACnB,kBAAkB,CAAE,SAAS,CAC7B,UAAU,CAAE,WAAW,CASzB,kGACgD,CAC9C,kBAAkB,CAAE,IAAI,CAO1B,QAAS,CACP,MAAM,CAAE,iBAAiB,CACzB,MAAM,CAAE,KAAK,CACb,OAAO,CAAE,qBAAqB,CAQhC,MAAO,CACL,MAAM,CAAE,CAAC,CACT,OAAO,CAAE,CAAC,CAOZ,QAAS,CACP,QAAQ,CAAE,IAAI,CAQhB,QAAS,CACP,WAAW,CAAE,IAAI,CAUnB,KAAM,CACJ,eAAe,CAAE,QAAQ,CACzB,cAAc,CAAE,CAAC,CAGnB,KACG,CACD,OAAO,CAAE,CAAC,CCpaZ,IAAK,CACJ,UAAU,CAAE,UAAU,CAEvB,kBAAqB,CACpB,UAAU,CAAE,OAAO,CAclB,wBAAwB,CACtB,YAAY,CAAE,CAAC,CACf,eAAe,CAAE,IAAI,CAErB,2BAAO,CACL,eAAe,CAAE,IAAI,CAK3B,CAAE,CACD,KAAK,CCaO,OAA+B,CDZ3C,eAAe,CAAE,IAAI,CAGpB,2BAA2B,CAAE,WAAW,CAK1C,eAAgB,CACd,OAAO,CAAE,IAAI,CACb,WAAW,CAAE,MAAM,CAKrB,SAAU,CACR,KAAK,CAAE,IAAI,CAKb,UAAW,CACT,UAAU,CAAE,eAAe,CAE7B,8GAAW,CACT,UAAU,CAAE,wFAAmG,CAEjH,+DAAgB,CACd,UAAU,CAAE,wFAAmG,CAEjH,UAAW,CACT,UAAU,CAAE,yFAAoG,CAElH,UAAW,CACT,UAAU,CAAE,0FAAqG,CAEnH,iBAAW,CACT,UAAU,CAAE,8FAAyG,CAEvH,UAAW,CACT,UAAU,CAAE,gGAA2G,CAGzH,UAAW,CACT,UAAU,CAAE,eAAe,CAE3B,gBAAQ,CACN,UAAU,CAAE,0DAAiE,CAMjF,QAAS,CACP,MAAM,CAAE,GAAG,CACX,QAAQ,CAAE,MAAM,CAChB,gBAAgB,CCyLM,OAA0B,CDnLlD,UAAW,CACT,MAAM,CAAE,MAAM,CACd,YAAY,CAAE,MAAM,CACpB,WAAW,CAAE,iBAAwB,CAKvC,CAAE,CACA,WAAW,CAAE,OAAO,CAEpB,MAAO,CACL,KAAK,CAAE,IAAI,CACX,YAAY,CAAE,IAAI,CAEpB,OAAQ,CACN,KAAK,CAAE,KAAK,CACZ,WAAW,CAAE,IAAI,CAEnB,MAAO,CACL,SAAS,CAAE,IAAI,CAEjB,OAAQ,CACN,SAAS,CAAE,IAAI,CAEjB,QAAS,CACP,SAAS,CAAE,IAAI,CAEjB,OAAQ,CACN,SAAS,CAAE,IAAI,CAKnB,yCACuB,CACrB,SAAS,CAAE,IAAI,CACf,MAAM,CAAE,IAAI,CAQZ,cAAG,CACD,OAAO,CAAE,YAAY,CACrB,aAAa,CAAE,GAAG,CAClB,UAAU,CAAE,MAAM,CAClB,cAAc,CAAE,GAAG,CACnB,MAAM,CAAE,IAAI,CAEZ,gBAAE,CACA,KAAK,CAAE,IAAI,CACX,OAAO,CAAE,YAAY,CACrB,SAAS,CAAE,MAAM,CACjB,OAAO,CAAE,MAAM,CACf,WAAW,CAAE,IAAI,CAGnB,uBAAW,CAAE,KAAK,CAAE,IAAI,CAExB,qBAAS,CAAE,gBAAgB,CCwKb,OAAc,CDtK5B,yBAAa,CACX,MAAM,CAAE,OAAO,CACf,KAAK,CAAE,IAAI,CAGb,gBAAE,CACA,SAAS,CAAE,IAAI,CAKnB,0BAAe,CACb,OAAO,CAAE,YAAY,CACrB,KAAK,CAAE,IAAI,CAGf,yBAA2B,CACzB,WAAY,CACV,KAAK,CAAE,IAAI,CAEX,uCACQ,CACN,KAAK,CAAE,GAAG,CAGZ,oBAAS,CACP,KAAK,CAAE,GAAG,CACV,QAAQ,CAAE,MAAM,CAChB,WAAW,CAAE,MAAM,EAMzB,WAAY,CACV,SAAS,CAAE,IAAI,CACf,KAAK,CAAE,qBAAqB,CAE5B,kGAEiB,CACf,OAAO,CAAE,YAAY,CACrB,KAAK,CAAE,IAAI,CACX,SAAS,CAAE,IAAI,CAGjB,kBAAS,CACP,OAAO,CAAE,OAAO,CAChB,KAAK,CAAE,qBAAqB,CAC5B,cAAc,CAAE,GAAG,CACnB,OAAO,CAAE,YAAY,CACrB,WAAW,CAAE,gBAAgB,CAC7B,WAAW,CAAE,MAAM,CACnB,UAAU,CAAE,MAAM,CAClB,SAAS,CAAE,IAAI,CACf,MAAM,CAAE,YAAY,CACpB,sBAAsB,CAAE,WAAW,CAGrC,8BAAqB,CACnB,OAAO,CAAE,IAAI,CAGf,sBAAa,CACX,KAAK,CAAE,IAAI,CAKf,mBAAoB,CAClB,QAAQ,CAAE,QAAQ,CAClB,QAAQ,CAAE,MAAM,CAChB,MAAM,CAAE,KAAK,CAEb,6BAAU,CACR,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,CAAC,CACT,OAAO,CAAE,EAAE,CAEX,iCAAI,CACF,OAAO,CAAE,IAAI,CACb,QAAQ,CAAE,QAAQ,CAClB,IAAI,CAAE,GAAG,CACT,MAAM,CAAE,CAAC,CACT,SAAS,CAAE,IAAI,CACf,UAAU,CAAE,IAAI,CAChB,SAAS,CAAE,oBAAkB,CAC7B,SAAS,CAAE,gBAAgB,CAMjC,oBAAsB,CACpB,QAAQ,CAAE,QAAQ,CAEpB,OAAQ,CACN,QAAQ,CAAE,gBAAgB,CAO5B,oBAAqB,CACnB,OAAO,CAAE,CAAC,CAGZ,QAAS,CACP,OAAO,CAAE,CAAC,CACV,gBAAgB,CAAE,KAAK,CAQvB,yBAA0B,CAD5B,2CAA6C,CAEzC,OAAO,CAAE,eAAe,EAI1B,yBAA2B,CAD7B,qBAAsB,CAElB,OAAO,CAAE,eAAe,EAI1B,yBAAyB,CAD3B,mBAAoB,CAEhB,OAAO,CAAE,eAAe,EAI1B,gEAAkF,CADpF,iBAAkB,CAEd,OAAO,CAAE,eAAe,EAI1B,yBAAwB,CAD1B,mBAAoB,CAEhB,OAAO,CAAE,eAAe,EAI1B,yBAAwB,CAD1B,cAAe,CAEX,OAAO,CAAE,gBAAgB,EAI3B,gEAAkF,CADpF,eAAgB,CAEZ,OAAO,CAAE,gBAAgB,EAI3B,yBAA0B,CAD5B,cAAe,CAEX,OAAO,CAAE,gBAAgB,EAI3B,yBAAyB,CAD3B,sBAAuB,CAEnB,OAAO,CAAE,gBAAgB,EAI3B,yBAA2B,CAD7B,wBAAyB,CAErB,OAAO,CAAE,gBAAgB,EAO3B,yBAA0B,CAD5B,qBAAsB,CAElB,UAAU,CAAE,MAAM,EAKtB,YAAa,CACX,WAAW,CAAE,IAAI,CACjB,KAAK,CCjBa,IAAI,CDkBtB,gBAAgB,CCjBA,OAAc,CDmB9B,8BAAkB,CAChB,QAAQ,CAAE,MAAM,CAChB,UAAU,CAAE,IAAI,CAChB,OAAO,CAAE,IAAI,CACb,WAAW,CAAE,MAAM,CACnB,OAAO,CAAE,QAAQ,CACjB,KAAK,CCxBqB,qBAAoB,CDyB9C,gBAAgB,CCxBQ,mBAAkB,CD8B9C,WAAc,CACX,MAAM,CAAE,IAAI,CAGf,KAAM,CACJ,KAAK,CAAC,IAAI,CACV,OAAO,CAAE,KAAK,CAEd,+CACwB,CACtB,aAAa,CAAE,iBAA6B,CAI5C,qCAAoB,CAClB,gBAAgB,CC5EA,OAAO,CD+EzB,yBAAU,CACR,aAAa,CAAE,CAAC,CAIpB,wBAAyB,CACvB,UAAU,CAAE,0BAA0B,CACtC,8BAAQ,CACN,gBAAgB,CCvFA,OAAO,CD4FzB,qDAAyB,CACvB,UAAU,CAAE,MAAM,CAMxB,KAAM,CACJ,aAAa,CAAE,iBAA6B,CAG9C,KAAM,CACJ,OAAO,CAAE,QAAQ,CACjB,OAAO,CAAE,UAAU,CACnB,UAAU,CAAE,IAAI,CAChB,cAAc,CAAE,MAAM,CACtB,aAAa,CAAE,GAAG,CAIpB,yBAA2B,CAEzB,sBAAuB,CACrB,KAAK,CAAE,IAAI,CACX,eAAe,CAAE,QAAQ,CACzB,cAAc,CAAE,CAAC,CACjB,OAAO,CAAE,KAAK,CACd,QAAQ,CAAE,QAAQ,CAElB,sCAAgB,CACd,OAAO,CAAE,OAAO,CAGlB,mDACG,CACD,MAAM,CAAE,CAAC,CACT,cAAc,CAAE,GAAG,CAGrB,yBAAG,CAAE,UAAU,CAAE,IAAI,CACrB,4BAAM,CACJ,OAAO,CAAE,KAAK,CACd,KAAK,CAAE,IAAI,CAEX,+BAAG,CACD,OAAO,CAAE,KAAK,CACd,OAAO,CAAE,UAAU,CAEnB,0CAAW,CACT,OAAO,CAAE,OAAO,CAItB,4BAAM,CACJ,OAAO,CAAE,KAAK,CACd,KAAK,CAAE,IAAI,CACX,QAAQ,CAAE,QAAQ,CAClB,UAAU,CAAE,IAAI,CAChB,WAAW,CAAE,MAAM,CAEnB,+BAAG,CACD,OAAO,CAAE,YAAY,CACrB,cAAc,CAAE,GAAG,CAGvB,yBAAG,CACD,OAAO,CAAE,KAAK,CACd,UAAU,CAAE,KAAK,CAEnB,yBAAG,CACD,OAAO,CAAE,KAAK,CACd,UAAU,CAAE,MAAM,CAClB,UAAU,CAAE,IAAI,CAElB,yBAAG,CAAE,OAAO,CAAE,MAAM,CAGpB,4BAAM,CACJ,MAAM,CAAE,CAAC,CACT,YAAY,CAAE,iBAA6B,CAI3C,kCAAG,CAAE,aAAa,CAAE,CAAC,CAAE,WAAW,CAAE,CAAC,CACrC,kCAAG,CAAE,WAAW,CAAE,CAAC,CAAE,YAAY,CAAE,CAAC,CAAE,aAAa,CAAE,CAAC,CACtD,kCAAG,CAAE,MAAM,CAAE,CAAC,CACd,wCAAS,CAAE,YAAY,CAAE,iBAA6B,EAS5D,WAAY,CACV,MAAM,CAAE,cAA8C,CACtD,MAAM,CAAE,iBAAkC,CAC1C,aAAa,CAAE,GAAG,CAClB,QAAQ,CAAE,MAAM,CAChB,QAAQ,CAAE,QAAQ,CAElB,4BAAiB,CACf,gBAAgB,CCrJE,IAAI,CDsJtB,WAAW,CCjJU,MAAM,CDkJ3B,OAAO,CAAE,SAAS,CAClB,MAAM,CAAE,CAAC,CACT,aAAa,CAAE,iBAAkC,CAGjD,mCAAS,CACP,UAAU,CAAE,IAAI,CAChB,YAAY,CAAE,IAAI,CAClB,QAAQ,CAAE,QAAQ,CAGlB,kIACgC,CAC9B,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,QAAQ,CAAE,MAAM,CAChB,IAAI,CAAE,IAAI,CACV,OAAO,CAAE,YAAY,CACrB,cAAc,CAAE,MAAM,CAExB,4CAAS,CACP,SAAS,CAAE,IAAI,CACf,WAAW,CAAE,IAAI,CACjB,KAAK,CAAE,IAAI,CACX,gBAAgB,CAAE,IAAI,CACtB,UAAU,CAAE,MAAM,CAIpB,0CAAO,CACL,SAAS,CAAE,IAAI,CAGjB,qCAAE,CACA,MAAM,CAAE,CAAC,CAGX,sDAAmB,CACjB,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,IAAI,CACT,KAAK,CAAE,IAAI,CAMf,uCAAa,CACX,aAAa,CAAE,IAAI,CAGrB,mCAAS,CACP,gBAAgB,CChMD,OAAgB,CDiM/B,KAAK,CC1Me,OAA8B,CD4MlD,sDAAmB,CACjB,KAAK,CAAE,IAAI,CAIjB,6BAAiB,CACf,OAAO,CAAE,KAAK,CACd,UAAU,CAAE,IAAI,CAChB,KAAK,CC3MY,OAAgB,CD6M/B,gDAAQ,CACN,gBAAgB,CCtNI,IAAI,CD4N5B,0CAAmB,CACjB,gBAAgB,CChOA,IAAI,CDiOpB,aAAa,CAAE,iBAAkC,CACjD,OAAO,CAAE,SAAS,CAEpB,wCAAiB,CACf,YAAY,CAAE,IAAI,CAEpB,+CAAwB,CACtB,YAAY,CAAE,IAAI,CAMxB,kBAAmB,CACjB,KAAK,CAAE,KAAK,CACZ,KAAK,CCrOc,OAAgB,CDuOrC,wBAAyB,CACvB,MAAM,CAAE,CAAC,CACT,MAAM,CAAE,IAAI,CAMd,gBAAiB,CACb,QAAQ,CAAE,QAAQ,CAClB,cAAc,CAAE,MAAM,CACtB,MAAM,CAAE,CAAC,CACT,QAAQ,CAAE,MAAM,CAEhB,sEAAsB,CACpB,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CAKlB,SAAU,CACN,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,GAAG,CACX,OAAO,CAAE,KAAK,CACd,KAAK,CAAE,IAAI,CACX,gBAAgB,CAAE,OAAiC,CACnD,aAAa,CAAE,GAAG,CAClB,MAAM,CAAE,cAA8C,CACtD,QAAQ,CAAE,MAAM,CAClB,sBAAa,CACX,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,MAAM,CAAE,CAAC,CACT,gBAAgB,CC7QC,OAAgB,CD8QjC,UAAU,CAAE,gBAAgB,CAE9B,wBAAe,CACb,gBAAgB,CCjRC,OAAgB,CDkRjC,+BAAS,CACP,OAAO,CAAE,EAAE,CACX,QAAQ,CAAE,QAAQ,CAClB,gBAAgB,CAAE,OAAO,CACzB,GAAG,CAAE,CAAC,CACN,IAAI,CAAC,CAAC,CACN,MAAM,CAAE,CAAC,CACT,WAAW,CAAE,WAAW,CAExB,SAAS,CAAE,mEAAoE,CAGjF,8BAAQ,CACN,OAAO,CAAE,EAAE,CACX,QAAQ,CAAE,QAAQ,CAClB,gBAAgB,CAAE,OAAO,CACzB,GAAG,CAAE,CAAC,CACN,IAAI,CAAC,CAAC,CACN,MAAM,CAAE,CAAC,CACT,WAAW,CAAE,WAAW,CAExB,SAAS,CAAE,oEAA0E,CACrF,eAAe,CAAE,KAAK,CAI5B,wBAaC,CAZG,EAAG,CACD,IAAI,CAAE,IAAI,CACV,KAAK,CAAC,IAAI,CAEZ,GAAI,CACF,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAEb,IAAK,CACH,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,EAIjB,8BAaC,CAZG,EAAG,CACD,IAAI,CAAE,KAAK,CACX,KAAK,CAAE,IAAI,CAEb,GAAI,CACF,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,GAAG,CAEZ,IAAK,CACH,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,GAAG,EAShB,KAAM,CACJ,OAAO,CAAE,eAAe,CAI1B,WAAY,CACV,UAAU,CAAE,IAAI,CAElB,YAAa,CACX,UAAU,CAAE,KAAK,CAEnB,qBAAuB,CACrB,UAAU,CAAE,MAAM,CAGpB,KAAM,CACJ,KAAK,CAAE,eAAe,CAExB,MAAO,CACL,KAAK,CAAE,gBAAgB,CAIzB,qDAAW,CACT,WAAW,CAAE,IAAI,CAGnB,OAAQ,CACN,aAAa,CAAE,GAAG,CAGpB,aAAc,CACZ,OAAO,CAAE,KAAK,CACd,WAAW,CAAE,IAAI,CACjB,YAAY,CAAE,IAAI,CAGpB,SAAU,CACR,OAAO,CAAE,KAAK,CACd,WAAW,CAAE,MAAM,CACnB,QAAQ,CAAE,MAAM,CAChB,aAAa,CAAE,QAAQ,CAGzB,WAAY,CACV,OAAO,CAAE,YAAY,CE3tBvB,UAAW,CACT,SAAS,CAAE,IAAI,CACf,OAAO,CAAE,KAAK,CACd,WAAW,CAAE,IAAI,CACjB,UAAU,CAAE,MAAM,CAClB,SAAS,CAAE,IAAI,CACf,WAAW,CD4CE,IAAI,CC3CjB,MAAM,CD2CO,IAAI,CC1CjB,KAAK,CJ8TS,OAAO,CI7TrB,KAAK,CAAE,KAAK,CACZ,UAAU,CAAE,UAAU,CAEtB,cAAM,CACJ,WAAW,CAAE,GAAG,CAChB,SAAS,CAAE,MAAM,CACjB,KAAK,CAAE,IAAI,CACX,gBAAgB,CD+UC,OAAgB,CC9UjC,aAAa,CAAE,GAAG,CAEpB,oBAAY,CACV,OAAO,CAAE,MAAM,CAGjB,qCAA6B,CAC3B,OAAO,CAAE,4BAA4B,CAGzC,mBAAoB,CAClB,OAAO,CAAE,YAAY,CACrB,KAAK,CAAE,IAAI,CACX,WAAW,CAAE,GAAG,CAChB,WAAW,CDmBE,IAAI,CClBjB,MAAM,CDkBO,IAAI,CCjBjB,sBAAsB,CAAE,IAAI,CAI9B,2BAA4B,CAC1B,UAAU,CAAE,mBAA2D,CAEzE,uBAAwB,CACtB,WAAW,CAAE,IAAI,CAEnB,oBAAqB,CACnB,UAAU,CAAE,iBAAwD,CC5CtE,eAAgB,CACd,cAAc,CAAE,kBAAkB,CAClC,qBAAqB,CAAE,MAAM,CCH/B,UAAW,CACT,MAAM,CAAE,MAAM,CACd,SAAS,CAAE,MAAM,CACjB,KAAK,CAAE,GAAG,CAEZ,yBAAyB,CACvB,UAAW,CACT,KAAK,CAAE,GAAG,EAGd,yBAAwB,CACtB,UAAW,CACT,KAAK,CAAE,GAAG,EAGd,eAAgB,CACd,WAAW,CAAE,OAAwB,CACrC,YAAY,CAAE,OAAwB,CAGxC,QAAS,CACP,WAAW,CAAE,IAAI,CACjB,cAAc,CAAE,IAAI,CAEpB,eAAS,CACP,OAAO,CAAE,CAAC,CAEZ,mBAAa,CACX,cAAc,CAAE,CAAC,CAEnB,mBAAa,CACX,WAAW,CAAE,CAAC,CAwBlB,IAAK,CACH,WAAW,CAAE,IAAI,CACjB,YAAY,CAAE,IAAI,CAClB,aAAa,CAAE,IAAI,CAGnB,UAAQ,CACN,OAAO,CAAE,EAAE,CACX,OAAO,CAAE,KAAK,CACd,KAAK,CAAE,IAAI,CAGb,SAAK,CACH,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,UAAU,CACtB,OAAO,CAAE,QAAmB,CAC5B,UAAU,CAAE,GAAG,CAEf,mDACkB,CAChB,QAAQ,CAAE,QAAQ,CAMlB,YAAS,CACP,KAAK,CAFA,QAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAyCP,YAAS,CACP,KAAK,CAFA,SAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAyCP,YAAS,CACP,KAAK,CAFA,GAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAyCP,YAAS,CACP,KAAK,CAFA,SAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAyCP,YAAS,CACP,KAAK,CAFA,SAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAyCP,YAAS,CACP,KAAK,CAFA,GAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAyCP,YAAS,CACP,KAAK,CAFA,SAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAyCP,YAAS,CACP,KAAK,CAFA,SAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAyCP,YAAS,CACP,KAAK,CAFA,GAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAyCP,aAAS,CACP,KAAK,CAFA,SAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAyCP,aAAS,CACP,KAAK,CAFA,SAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAyCP,aAAS,CACP,KAAK,CAFA,IAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAGX,mBAAuB,CACrB,WAAW,CA8CF,QAAuC,CA5ClD,iBAAqB,CACnB,KAAK,CA2CI,QAAuC,CAzClD,iBAAqB,CACnB,IAAI,CAwCK,QAAuC,CA/ClD,mBAAuB,CACrB,WAAW,CA8CF,SAAuC,CA5ClD,iBAAqB,CACnB,KAAK,CA2CI,SAAuC,CAzClD,iBAAqB,CACnB,IAAI,CAwCK,SAAuC,CA/ClD,mBAAuB,CACrB,WAAW,CA8CF,GAAuC,CA5ClD,iBAAqB,CACnB,KAAK,CA2CI,GAAuC,CAzClD,iBAAqB,CACnB,IAAI,CAwCK,GAAuC,CA/ClD,mBAAuB,CACrB,WAAW,CA8CF,SAAuC,CA5ClD,iBAAqB,CACnB,KAAK,CA2CI,SAAuC,CAzClD,iBAAqB,CACnB,IAAI,CAwCK,SAAuC,CA/ClD,mBAAuB,CACrB,WAAW,CA8CF,SAAuC,CA5ClD,iBAAqB,CACnB,KAAK,CA2CI,SAAuC,CAzClD,iBAAqB,CACnB,IAAI,CAwCK,SAAuC,CA/ClD,mBAAuB,CACrB,WAAW,CA8CF,GAAuC,CA5ClD,iBAAqB,CACnB,KAAK,CA2CI,GAAuC,CAzClD,iBAAqB,CACnB,IAAI,CAwCK,GAAuC,CA/ClD,mBAAuB,CACrB,WAAW,CA8CF,SAAuC,CA5ClD,iBAAqB,CACnB,KAAK,CA2CI,SAAuC,CAzClD,iBAAqB,CACnB,IAAI,CAwCK,SAAuC,CA/ClD,mBAAuB,CACrB,WAAW,CA8CF,SAAuC,CA5ClD,iBAAqB,CACnB,KAAK,CA2CI,SAAuC,CAzClD,iBAAqB,CACnB,IAAI,CAwCK,SAAuC,CA/ClD,mBAAuB,CACrB,WAAW,CA8CF,GAAuC,CA5ClD,iBAAqB,CACnB,KAAK,CA2CI,GAAuC,CAzClD,iBAAqB,CACnB,IAAI,CAwCK,GAAuC,CA/ClD,oBAAuB,CACrB,WAAW,CA8CF,SAAuC,CA5ClD,kBAAqB,CACnB,KAAK,CA2CI,SAAuC,CAzClD,kBAAqB,CACnB,IAAI,CAwCK,SAAuC,CA/ClD,oBAAuB,CACrB,WAAW,CA8CF,SAAuC,CA5ClD,kBAAqB,CACnB,KAAK,CA2CI,SAAuC,CAzClD,kBAAqB,CACnB,IAAI,CAwCK,SAAuC,CA/ClD,oBAAuB,CACrB,WAAW,CA8CF,IAAuC,CA5ClD,kBAAqB,CACnB,KAAK,CA2CI,IAAuC,CAzClD,kBAAqB,CACnB,IAAI,CAwCK,IAAuC,CAKhD,yBAAyB,CAKrB,YAAS,CACP,KAAK,CAFA,QAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CA4DL,YAAS,CACP,KAAK,CAFA,SAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CA4DL,YAAS,CACP,KAAK,CAFA,GAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CA4DL,YAAS,CACP,KAAK,CAFA,SAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CA4DL,YAAS,CACP,KAAK,CAFA,SAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CA4DL,YAAS,CACP,KAAK,CAFA,GAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CA4DL,YAAS,CACP,KAAK,CAFA,SAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CA4DL,YAAS,CACP,KAAK,CAFA,SAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CA4DL,YAAS,CACP,KAAK,CAFA,GAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CA4DL,aAAS,CACP,KAAK,CAFA,SAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CA4DL,aAAS,CACP,KAAK,CAFA,SAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CA4DL,aAAS,CACP,KAAK,CAFA,IAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAGX,mBAAuB,CACrB,WAAW,CAiEA,QAAuC,CA/DpD,iBAAqB,CACnB,KAAK,CA8DM,QAAuC,CA5DpD,iBAAqB,CACnB,IAAI,CA2DO,QAAuC,CAlEpD,mBAAuB,CACrB,WAAW,CAiEA,SAAuC,CA/DpD,iBAAqB,CACnB,KAAK,CA8DM,SAAuC,CA5DpD,iBAAqB,CACnB,IAAI,CA2DO,SAAuC,CAlEpD,mBAAuB,CACrB,WAAW,CAiEA,GAAuC,CA/DpD,iBAAqB,CACnB,KAAK,CA8DM,GAAuC,CA5DpD,iBAAqB,CACnB,IAAI,CA2DO,GAAuC,CAlEpD,mBAAuB,CACrB,WAAW,CAiEA,SAAuC,CA/DpD,iBAAqB,CACnB,KAAK,CA8DM,SAAuC,CA5DpD,iBAAqB,CACnB,IAAI,CA2DO,SAAuC,CAlEpD,mBAAuB,CACrB,WAAW,CAiEA,SAAuC,CA/DpD,iBAAqB,CACnB,KAAK,CA8DM,SAAuC,CA5DpD,iBAAqB,CACnB,IAAI,CA2DO,SAAuC,CAlEpD,mBAAuB,CACrB,WAAW,CAiEA,GAAuC,CA/DpD,iBAAqB,CACnB,KAAK,CA8DM,GAAuC,CA5DpD,iBAAqB,CACnB,IAAI,CA2DO,GAAuC,CAlEpD,mBAAuB,CACrB,WAAW,CAiEA,SAAuC,CA/DpD,iBAAqB,CACnB,KAAK,CA8DM,SAAuC,CA5DpD,iBAAqB,CACnB,IAAI,CA2DO,SAAuC,CAlEpD,mBAAuB,CACrB,WAAW,CAiEA,SAAuC,CA/DpD,iBAAqB,CACnB,KAAK,CA8DM,SAAuC,CA5DpD,iBAAqB,CACnB,IAAI,CA2DO,SAAuC,CAlEpD,mBAAuB,CACrB,WAAW,CAiEA,GAAuC,CA/DpD,iBAAqB,CACnB,KAAK,CA8DM,GAAuC,CA5DpD,iBAAqB,CACnB,IAAI,CA2DO,GAAuC,CAlEpD,oBAAuB,CACrB,WAAW,CAiEA,SAAuC,CA/DpD,kBAAqB,CACnB,KAAK,CA8DM,SAAuC,CA5DpD,kBAAqB,CACnB,IAAI,CA2DO,SAAuC,CAlEpD,oBAAuB,CACrB,WAAW,CAiEA,SAAuC,CA/DpD,kBAAqB,CACnB,KAAK,CA8DM,SAAuC,CA5DpD,kBAAqB,CACnB,IAAI,CA2DO,SAAuC,CAlEpD,oBAAuB,CACrB,WAAW,CAiEA,IAAuC,CA/DpD,kBAAqB,CACnB,KAAK,CA8DM,IAAuC,CA5DpD,kBAAqB,CACnB,IAAI,CA2DO,IAAuC,EAMlD,yBAAwB,CAKpB,YAAS,CACP,KAAK,CAFA,QAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAgFL,YAAS,CACP,KAAK,CAFA,SAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAgFL,YAAS,CACP,KAAK,CAFA,GAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAgFL,YAAS,CACP,KAAK,CAFA,SAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAgFL,YAAS,CACP,KAAK,CAFA,SAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAgFL,YAAS,CACP,KAAK,CAFA,GAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAgFL,YAAS,CACP,KAAK,CAFA,SAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAgFL,YAAS,CACP,KAAK,CAFA,SAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAgFL,YAAS,CACP,KAAK,CAFA,GAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAgFL,aAAS,CACP,KAAK,CAFA,SAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAgFL,aAAS,CACP,KAAK,CAFA,SAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAgFL,aAAS,CACP,KAAK,CAFA,IAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAGX,mBAAuB,CACrB,WAAW,CAqFA,QAAuC,CAnFpD,iBAAqB,CACnB,KAAK,CAkFM,QAAuC,CAhFpD,iBAAqB,CACnB,IAAI,CA+EO,QAAuC,CAtFpD,mBAAuB,CACrB,WAAW,CAqFA,SAAuC,CAnFpD,iBAAqB,CACnB,KAAK,CAkFM,SAAuC,CAhFpD,iBAAqB,CACnB,IAAI,CA+EO,SAAuC,CAtFpD,mBAAuB,CACrB,WAAW,CAqFA,GAAuC,CAnFpD,iBAAqB,CACnB,KAAK,CAkFM,GAAuC,CAhFpD,iBAAqB,CACnB,IAAI,CA+EO,GAAuC,CAtFpD,mBAAuB,CACrB,WAAW,CAqFA,SAAuC,CAnFpD,iBAAqB,CACnB,KAAK,CAkFM,SAAuC,CAhFpD,iBAAqB,CACnB,IAAI,CA+EO,SAAuC,CAtFpD,mBAAuB,CACrB,WAAW,CAqFA,SAAuC,CAnFpD,iBAAqB,CACnB,KAAK,CAkFM,SAAuC,CAhFpD,iBAAqB,CACnB,IAAI,CA+EO,SAAuC,CAtFpD,mBAAuB,CACrB,WAAW,CAqFA,GAAuC,CAnFpD,iBAAqB,CACnB,KAAK,CAkFM,GAAuC,CAhFpD,iBAAqB,CACnB,IAAI,CA+EO,GAAuC,CAtFpD,mBAAuB,CACrB,WAAW,CAqFA,SAAuC,CAnFpD,iBAAqB,CACnB,KAAK,CAkFM,SAAuC,CAhFpD,iBAAqB,CACnB,IAAI,CA+EO,SAAuC,CAtFpD,mBAAuB,CACrB,WAAW,CAqFA,SAAuC,CAnFpD,iBAAqB,CACnB,KAAK,CAkFM,SAAuC,CAhFpD,iBAAqB,CACnB,IAAI,CA+EO,SAAuC,CAtFpD,mBAAuB,CACrB,WAAW,CAqFA,GAAuC,CAnFpD,iBAAqB,CACnB,KAAK,CAkFM,GAAuC,CAhFpD,iBAAqB,CACnB,IAAI,CA+EO,GAAuC,CAtFpD,oBAAuB,CACrB,WAAW,CAqFA,SAAuC,CAnFpD,kBAAqB,CACnB,KAAK,CAkFM,SAAuC,CAhFpD,kBAAqB,CACnB,IAAI,CA+EO,SAAuC,CAtFpD,oBAAuB,CACrB,WAAW,CAqFA,SAAuC,CAnFpD,kBAAqB,CACnB,KAAK,CAkFM,SAAuC,CAhFpD,kBAAqB,CACnB,IAAI,CA+EO,SAAuC,CAtFpD,oBAAuB,CACrB,WAAW,CAqFA,IAAuC,CAnFpD,kBAAqB,CACnB,KAAK,CAkFM,IAAuC,CAhFpD,kBAAqB,CACnB,IAAI,CA+EO,IAAuC,EAMlD,0BAA8B,CAK1B,aAAU,CACR,KAAK,CAFA,QAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAoGL,aAAU,CACR,KAAK,CAFA,SAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAoGL,aAAU,CACR,KAAK,CAFA,GAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAoGL,aAAU,CACR,KAAK,CAFA,SAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAoGL,aAAU,CACR,KAAK,CAFA,SAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAoGL,aAAU,CACR,KAAK,CAFA,GAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAoGL,aAAU,CACR,KAAK,CAFA,SAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAoGL,aAAU,CACR,KAAK,CAFA,SAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAoGL,aAAU,CACR,KAAK,CAFA,GAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAoGL,cAAU,CACR,KAAK,CAFA,SAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAoGL,cAAU,CACR,KAAK,CAFA,SAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAoGL,cAAU,CACR,KAAK,CAFA,IAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAGX,oBAAuB,CACrB,WAAW,CAyGA,QAAuC,CAvGpD,kBAAqB,CACnB,KAAK,CAsGM,QAAuC,CApGpD,kBAAqB,CACnB,IAAI,CAmGO,QAAuC,CA1GpD,oBAAuB,CACrB,WAAW,CAyGA,SAAuC,CAvGpD,kBAAqB,CACnB,KAAK,CAsGM,SAAuC,CApGpD,kBAAqB,CACnB,IAAI,CAmGO,SAAuC,CA1GpD,oBAAuB,CACrB,WAAW,CAyGA,GAAuC,CAvGpD,kBAAqB,CACnB,KAAK,CAsGM,GAAuC,CApGpD,kBAAqB,CACnB,IAAI,CAmGO,GAAuC,CA1GpD,oBAAuB,CACrB,WAAW,CAyGA,SAAuC,CAvGpD,kBAAqB,CACnB,KAAK,CAsGM,SAAuC,CApGpD,kBAAqB,CACnB,IAAI,CAmGO,SAAuC,CA1GpD,oBAAuB,CACrB,WAAW,CAyGA,SAAuC,CAvGpD,kBAAqB,CACnB,KAAK,CAsGM,SAAuC,CApGpD,kBAAqB,CACnB,IAAI,CAmGO,SAAuC,CA1GpD,oBAAuB,CACrB,WAAW,CAyGA,GAAuC,CAvGpD,kBAAqB,CACnB,KAAK,CAsGM,GAAuC,CApGpD,kBAAqB,CACnB,IAAI,CAmGO,GAAuC,CA1GpD,oBAAuB,CACrB,WAAW,CAyGA,SAAuC,CAvGpD,kBAAqB,CACnB,KAAK,CAsGM,SAAuC,CApGpD,kBAAqB,CACnB,IAAI,CAmGO,SAAuC,CA1GpD,oBAAuB,CACrB,WAAW,CAyGA,SAAuC,CAvGpD,kBAAqB,CACnB,KAAK,CAsGM,SAAuC,CApGpD,kBAAqB,CACnB,IAAI,CAmGO,SAAuC,CA1GpD,oBAAuB,CACrB,WAAW,CAyGA,GAAuC,CAvGpD,kBAAqB,CACnB,KAAK,CAsGM,GAAuC,CApGpD,kBAAqB,CACnB,IAAI,CAmGO,GAAuC,CA1GpD,qBAAuB,CACrB,WAAW,CAyGA,SAAuC,CAvGpD,mBAAqB,CACnB,KAAK,CAsGM,SAAuC,CApGpD,mBAAqB,CACnB,IAAI,CAmGO,SAAuC,CA1GpD,qBAAuB,CACrB,WAAW,CAyGA,SAAuC,CAvGpD,mBAAqB,CACnB,KAAK,CAsGM,SAAuC,CApGpD,mBAAqB,CACnB,IAAI,CAmGO,SAAuC,CA1GpD,qBAAuB,CACrB,WAAW,CAyGA,IAAuC,CAvGpD,mBAAqB,CACnB,KAAK,CAsGM,IAAuC,CApGpD,mBAAqB,CACnB,IAAI,CAmGO,IAAuC,ECrJtD,GAAI,CAeF,KAAK,CJgPa,IAAI,CI9OtB,gBAAgB,CJmTA,OAAc,CIlT9B,KAAK,CAAE,IAAI,CACX,MAAM,CJyOe,IAAI,CIxOzB,WAAW,CJyOe,IAAqB,CI5P/C,gBAAe,CACb,MAAM,CAAE,IAAI,CAEZ,6BAAa,CACX,UAAU,CJuPO,IAAI,CItPrB,MAAM,CAAE,IAAI,CAGd,6BAAa,CACX,QAAQ,CAAE,QAAQ,CAClB,WAAW,CAAE,MAAM,CAWvB,KAAE,CAAE,KAAK,CJyOS,IAAI,CIvOtB,kEAEiB,CACf,OAAO,CAAE,KAAK,CACd,SAAS,CAAE,IAAI,CACf,MAAM,CJ+Na,IAAI,CI9NvB,WAAW,CJ+Na,IAAqB,CI5N/C,gBAAa,CACX,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,IAAI,CAGd,yBAAwB,CACtB,qBAAkB,CAAE,OAAO,CAAE,IAAI,EAKnC,oBAAiB,CACf,KAAK,CAAE,IAAI,CACX,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,CAAC,CACV,MAAM,CJ4Ma,IAAI,CI3MvB,MAAM,CAAE,MAAM,CAEd,sBAAE,CACA,MAAM,CJwMW,IAAI,CIvMrB,WAAW,CJwMW,IAAqB,CIlM/C,eAAY,CACV,QAAQ,CAAE,QAAQ,CAClB,KAAK,CJkMW,IAAI,CIjMpB,OAAO,CAAE,YAAY,CACrB,SAAS,CJiMY,MAAM,CIhM3B,OAAO,CAAE,CAAC,CAEV,sBAAS,CACP,IAAI,CAAE,GAAG,CACT,SAAS,CAAE,gBAAgB,CAG7B,yBAA2B,CAZ7B,eAAY,CAaR,IAAI,CAAE,GAAG,CACT,SAAS,CAAE,gBAAgB,CAE3B,0CAAgB,CACd,OAAO,CAAE,CAAC,CACV,SAAS,CAAE,IAAI,CAGjB,oBAAO,CAAE,IAAI,CAAE,MAAM,CACrB,qBAAQ,CACN,KAAK,CAAE,MAAM,CACb,IAAI,CAAE,IAAI,EAId,qBAAQ,CACN,KAAK,CAAE,MAAM,CACb,OAAO,CAAE,CAAC,CAGZ,kHAEiB,CACf,KAAK,CAAE,IAAI,CACX,YAAY,CAAE,IAAI,CAMtB,cAAW,CACT,OAAO,CAAE,YAAY,CACrB,SAAS,CAAE,IAAI,CACf,OAAO,CAAE,MAAM,CAKjB,MAAG,CACD,MAAM,CAAE,CAAC,CAET,SAAG,CACD,UAAU,CAAE,oBAAoB,CAChC,KAAK,CAAE,IAAI,CACX,OAAO,CAAE,CAAC,CAEV,gBAAS,CACP,gBAAgB,CAAE,eAAc,CAGpC,QAAE,CACA,UAAU,CAAE,oBAAoB,CAChC,SAAS,CJkII,IAAI,CIjIjB,KAAK,CJkIS,IAAI,CIjIlB,OAAO,CAAE,KAAK,CACd,OAAO,CAAE,MAAM,CACf,MAAM,CAAE,OAAO,CAEf,0FAA+C,CAC7C,UAAU,CAAE,IAAI,CAChB,WAAW,CAAE,IAAI,CACjB,YAAY,CAAE,IAAI,CAElB,0KAAoB,CAClB,MAAM,CAAE,OAAO,CACf,WAAW,CAAE,OAAO,CAIxB,cAAQ,CACN,gBAAgB,CAAE,eAAc,CAIpC,WAAO,CACL,KAAK,CAAE,IAAI,CAKf,QAAK,CACH,MAAM,CAAE,IAAI,CAGd,gBAAa,CACX,MAAM,CAAE,CAAC,CACT,MAAM,CAAE,IAAI,CAEZ,sBAAM,CACJ,MAAM,CAAE,IAAI,CACZ,SAAS,CAAE,MAAM,CACjB,MAAM,CAAE,IAAI,CACZ,YAAY,CAAE,IAAI,CAElB,wOAC2D,CACzD,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,IAAI,CAIpB,sBAAM,CACJ,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CAEP,wBAAE,CACA,KAAK,CAAE,qBAAoB,CAC3B,UAAU,CAAE,SAAS,CAEvB,+BAAW,CAAE,KAAK,CJ0EJ,IAAI,CIpExB,aAAc,CACZ,QAAQ,CAAE,QAAQ,CAClB,MAAM,CJ+De,IAAI,CI9DzB,OAAO,CAAE,GAAG,CAEZ,iBAAI,CACF,QAAQ,CAAE,KAAK,CAGnB,yBAAyB,CACvB,6BAA8B,CAC5B,UAAU,CJoDE,IAAI,CIlDlB,oEAAwE,CACtE,MAAM,CJiDM,IAAI,CIhDhB,WAAW,CJiDM,IAAc,CI/CjC,aAAc,CACZ,MAAM,CJ6CM,IAAI,EK1PpB,UAOC,CANG,WAAW,CAAE,QAAQ,CACrB,GAAG,CAAE,kIAEyD,CAE9D,WAAW,CAAE,GAAG,CAEpB,UAMC,CALG,WAAW,CAAE,QAAQ,CACrB,GAAG,CAAE,qIAE0D,CAC/D,WAAW,CAAE,GAAG,CAGpB,UAMC,CALG,WAAW,CAAE,QAAQ,CACrB,GAAG,CAAE,2IAE4D,CACjE,WAAW,CAAE,GAAG,CAGpB,UAMC,CALG,WAAW,CAAE,QAAQ,CACrB,GAAG,CAAE,wIAE2D,CAChE,WAAW,CAAE,GAAG,CAGpB,UAMC,CALG,WAAW,CAAE,QAAQ,CACrB,GAAG,CAAE,kIAEyD,CAC9D,WAAW,CAAE,GAAG,CCpCpB,CAAE,CACA,eAAe,CAAE,IAAI,CAGvB,IAAI,CACF,WAAW,CAAE,GAAG,CAchB,WAAW,CAAE,oBAAoB,CACjC,WAAW,CAAE,MAAM,CACnB,KAAK,CNgSK,gBAAmB,CM9S7B,qCAAsC,CAHxC,IAAI,CAIA,SAAS,CAAE,IAAI,EAGjB,yCAAmD,CAPrD,IAAI,CAQA,SAAS,CAAE,MAAM,EAGnB,0CAAkD,CAXpD,IAAI,CAYA,SAAS,CAAE,IAAI,EAOnB,iBAAuB,CACtB,WAAW,CAAE,GAAG,CAChB,WAAW,CAAE,GAAG,CAIjB,6BAAmC,CAAE,WAAW,CAAE,OAAO,CACzD,EAAG,CAAE,SAAS,CNyRA,MAAM,CMzRU,WAAW,CAAE,IAAI,CAAE,MAAM,CAAE,kBAA2C,CACpG,EAAG,CAAE,SAAS,CNyRA,OAAO,CMzRS,WAAW,CAAE,IAAI,CAAE,MAAM,CAAE,oBAA2C,CACpG,EAAG,CAAE,SAAS,CNyRA,OAAO,CMzRS,WAAW,CAAE,IAAI,CAAE,MAAM,CAAE,oBAA2C,CACpG,EAAG,CAAE,SAAS,CNyRA,OAAO,CMzRS,WAAW,CAAE,IAAI,CAAE,MAAM,CAAE,mBAA2C,CACpG,EAAG,CAAE,SAAS,CNyRA,OAAO,CMzRS,WAAW,CAAE,IAAI,CAAE,MAAM,CAAE,kBAA2C,CACpG,EAAG,CAAE,SAAS,CNyRA,IAAI,CMzRY,WAAW,CAAE,IAAI,CAAE,MAAM,CAAE,eAA2C,CAGpG,EAAG,CAAE,UAAU,CAAE,MAAM,CACvB,MAAO,CAAE,WAAW,CAAE,GAAG,CACzB,KAAM,CAAE,SAAS,CAAE,GAAG,CACtB,qCAAO,CAAE,WAAW,CAAE,GAAG,CACzB,KAAM,CAAE,WAAW,CAAE,GAAG,CAGxB,UAAU,CACR,WAAW,CAAE,GAAG,CAGd,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,MAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,OAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,OAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,OAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,OAAyB,EAMxC,yCAA0C,CAX5C,UAAU,CAYN,SAAS,CAAE,MAAM,ECzDrB,iBAAkB,CAUhB,UAAU,CAAE,8DAA6D,CATzE,2BAAY,CACV,SAAS,CAAE,QAAQ,CACnB,UAAU,CAAE,wBAAwB,CAGtC,0BAAW,CACT,SAAS,CAAE,QAAQ,CCNvB,WAAY,CACV,UAAU,CAAE,eAAe,CAC3B,OAAO,CR2FM,IAAI,CQ1FjB,MAAM,CAAE,cAA8C,CACtD,aAAa,CAAE,GAAG,CAElB,gBAAgB,CRwFF,IAAI,CQrFpB,KAAM,CACJ,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,cAA8C,CACtD,gBAAgB,CRkFF,IAAI,CQjFlB,UAAU,CAAE,eAAe,CAC3B,aAAa,CAAE,GAAG,CAIlB,iBAAY,CACV,SAAS,CAAE,IAAI,CACf,WAAW,CAAE,GAAG,CAChB,2BAAY,CACV,MAAM,CAAE,OAAO,CAKnB,oCAA2B,CACzB,QAAQ,CAAE,QAAQ,CAElB,wEAAY,CACV,UAAU,CAAE,GAAG,CACf,QAAQ,CAAE,MAAM,CAElB,kHAA4B,CAC1B,UAAU,CAAE,GAAG,CAEjB,8EAAc,CACZ,UAAU,CAAE,IAAI,CAChB,QAAQ,CAAE,MAAM,CAElB,2EAAa,CACX,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,CAAC,CACT,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,CAAC,CAIZ,WAAQ,CACN,MAAM,CAAE,KAAK,CAGf,YAAS,CACP,MAAM,CAAE,KAAK,CAGf,WAAQ,CACN,MAAM,CAAE,KAAK,CAIf,gBAAa,CAaX,OAAO,CAAE,IAAI,CAXX,yGAAY,CACV,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,IAAI,CAChB,QAAQ,CAAE,OAAO,CAEjB,qHAAI,CACF,MAAM,CAAE,IAAI,CAOlB,4BAAY,CACV,SAAS,CAAE,GAAG,CACd,gCAAI,CACF,aAAa,CAAE,WAAW,CAC1B,SAAS,CAAE,IAAI,CACf,KAAK,CAAE,IAAI,CAIf,8BAAc,CACZ,OAAO,CAAE,IAAI,CACb,cAAc,CAAE,MAAM,CACtB,IAAI,CAAE,CAAC,CACP,QAAQ,CAAE,QAAQ,CAElB,4CAAc,CACZ,SAAS,CAAE,CAAC,CAOhB,gCAAa,CACX,OAAO,CAAE,CAAC,CAGZ,gCAAa,CACX,OAAO,CAAE,CAAC,CACV,cAAc,CAAE,IAAI,CAOxB,iBAAY,CACV,QAAQ,CAAE,QAAQ,CAGlB,qBAAI,CACF,OAAO,CAAE,KAAK,CACd,aAAa,CAAE,WAAW,CAC1B,QAAQ,CAAE,QAAQ,CAClB,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,CAAC,CACR,GAAG,CAAE,CAAC,CACN,MAAM,CAAE,CAAC,CACT,KAAK,CAAE,IAAI,CAGb,6BAAY,CACV,KAAK,CRnCK,IAAI,CQoCd,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,CAAC,CACT,IAAI,CAAE,CAAC,CACP,SAAS,CAAE,IAAI,CACf,OAAO,CRzCE,IAAI,CQ6CjB,mBAAc,CACZ,OAAO,CR9CI,IAAI,CQ+Cf,aAAa,CAAE,WAAW,CAE1B,qBAAE,CACA,MAAM,CAAE,CAAC,CACT,KAAK,CAAE,OAAO,CAEhB,+BAAY,CACV,OAAO,CAAE,KAAK,CACd,WAAW,CAAE,IAAI,CACjB,aAAa,CAAE,GAAG,CAElB,iCAAE,CACA,WAAW,CAAE,IAAI,CAKvB,kBAAa,CAIX,QAAQ,CAAE,QAAQ,CAClB,gBAAgB,CAAE,OAAO,CACzB,UAAU,CAAE,+BAA8B,CAC1C,OAAO,CAAE,SAAkB,CAN3B,6BAAa,CACX,aAAa,CAAE,WAAW,CAO5B,iFAA+C,CAC7C,KAAK,CRxEO,OAA2B,CQyEvC,YAAY,CR3EH,IAAI,CQ4Eb,UAAU,CAAE,cAAc,CAC1B,cAAc,CAAE,SAAS,CAEzB,uFAAQ,CAAE,KAAK,CR5EG,OAA8B,CQgFpD,kBAAa,CACX,OAAO,CRpFI,IAAI,CQqFf,QAAQ,CAAE,QAAQ,CAClB,gBAAgB,CRrFJ,IAAI,CQsFhB,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,IAAI,CAChB,IAAI,CAAE,CAAC,CACP,GAAG,CAAE,IAAI,CACT,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,CAAC,CACV,OAAO,CAAE,IAAI,CAEb,8BAAY,CACV,MAAM,CAAE,OAAO,CACf,OAAO,CAAE,KAAK,CChMpB,gBAAiB,CACf,OAAO,CAAC,KAAK,CACb,QAAQ,CAAE,KAAK,CACf,OAAO,CAAE,KAAK,CAEd,yBAA0B,CAL5B,gBAAiB,CAMb,SAAS,CAAE,IAAI,CACf,MAAM,CAAE,EAAE,EAEZ,gDAAuB,CATzB,gBAAiB,CAUb,IAAI,CAAE,EAAE,CACR,MAAM,CAAE,EAAE,CACV,SAAS,CAAE,GAAG,EAEhB,yBAAwB,CAd1B,gBAAiB,CAeb,GAAG,CAAE,GAAG,CACR,KAAK,CAAE,EAAE,CACT,SAAS,CAAE,GAAG,EAIlB,MAAO,CAEL,aAAa,CAAE,GAAG,CAClB,GAAG,CAAE,IAAI,CACT,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,IAAI,CAChB,QAAQ,CAAE,QAAQ,CAClB,SAAS,CAAC,IAAI,CACd,MAAM,CAAE,IAAI,CACZ,UAAU,CT+QG,IAAI,CS9QjB,WAAW,CAAE,KAAK,CAClB,UAAU,CAAE,SAAS,CACrB,gBAAgB,CT6QJ,OAAO,CS5QnB,OAAO,CAAE,SAAS,CAClB,SAAS,CAAE,MAAM,CACjB,WAAW,CAAE,GAAG,CAChB,KAAK,CT0QY,IAAI,CSzQrB,OAAO,CAAE,IAAI,CACb,WAAW,CAAE,MAAM,CACnB,eAAe,CAAE,aAAa,CAC9B,MAAM,CAAE,OAAO,CAEf,oBAAc,CACZ,KAAK,CToQY,OAAO,CSnQxB,WAAW,CAAE,GAAG,CAChB,YAAY,CAAE,KAAK,CACnB,WAAW,CAAE,IAAI,CAGnB,cAAS,CACP,aAAa,CAAE,IAAI,CAGrB,yBAA0B,CAjC5B,MAAO,CAkCH,KAAK,CAAE,IAAI,CACX,aAAa,CAAE,CAAC,ECxDpB,KAAM,CA4BJ,QAAQ,CAAE,QAAQ,CAClB,UAAU,CAAE,IAAI,CAChB,UAAU,CAAE,MAAM,CAClB,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,gBAAgB,CV+PF,IAAI,CU9PlB,MAAM,CAAE,MAAM,CACd,WAAW,CAAE,MAAM,CAlCnB,sBAAmB,CACjB,gBAAgB,CAAE,WAAW,CAE7B,iHAEsB,CACpB,KAAK,CAAE,qBAAqB,CAG9B,wEACc,CACZ,KAAK,CAAE,IAAI,CAGb,iCAAW,CACT,gBAAgB,CAAE,IAAI,CAI1B,sBAAmB,CACjB,OAAO,CAAE,IAAI,CAEb,2BAAK,CACH,SAAS,CAAE,CAAC,CAahB,UAAK,CACH,OAAO,CAAE,YAAY,CACrB,UAAU,CAAE,MAAM,CAClB,WAAW,CAAE,IAAI,CACjB,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,CAAC,CACV,MAAM,CAAE,CAAC,CACT,cAAc,CAAE,SAAS,CAEzB,YAAE,CAOA,KAAK,CAAE,qBAA0B,CACjC,OAAO,CAAE,KAAK,CACd,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,MAAM,CACf,SAAS,CAAE,IAAI,CACf,aAAa,CAAE,QAAQ,CACvB,QAAQ,CAAE,MAAM,CAChB,UAAU,CAAE,eAAe,CAd3B,sCACS,CACP,gBAAgB,CAAE,WAAW,CAC7B,KAAK,CVkRK,OAAc,CUpQ5B,iDACmB,CACjB,KAAK,CAAE,qBAA0B,CACjC,MAAM,CAAE,OAAO,CAGnB,gBAAW,CACT,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,CAAC,CACT,MAAM,CAAE,GAAG,CACX,gBAAgB,CVoNG,OAAoB,CUnNvC,WAAW,CAAE,WAAW,CAK5B,yBAA2B,CACzB,KAAM,CACJ,OAAO,CAAE,IAAI,CAEb,UAAK,CACH,SAAS,CAAE,CAAC,CAEZ,YAAE,CACA,OAAO,CAAE,MAAM,ECxFvB,iBAAkB,CAChB,OAAO,CAAE,QAAQ,CACjB,SAAS,CAAE,IAAI,CACf,OAAO,CAAE,IAAI,CACb,gBAAgB,CAAE,WAAW,CAC7B,aAAa,CAAE,GAAG,CAClB,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,IAAI,CAChB,WAAW,CAAE,IAAI,CACjB,OAAO,CAAE,CAAC,CACV,QAAQ,CAAE,QAAQ,CAClB,UAAU,CAAE,MAAM,CAClB,SAAS,CAAE,gBAAgB,CAC3B,QAAQ,CAAE,MAAM,CAChB,IAAI,CAAE,CAAC,CACP,GAAG,CAAE,CAAC,CACN,cAAc,CAAE,IAAI,CACpB,UAAU,CAAE,MAAM,CAGpB,SAAU,CACR,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,CAAC,CACV,MAAM,CAAE,GAAG,CACX,KAAK,CAAE,IAAI,CACX,aAAa,CAAE,WAAW,CAC1B,gBAAgB,CAAE,OAAO,CACzB,OAAO,CAAE,EAAE,CACX,gBAAgB,CAAE,MAAM,CACxB,UAAU,CAAE,MAAM,CC5BpB,yBACU,CACR,MAAM,CZuDQ,IAAI,CYtDlB,aAAa,CZ4DC,GAAG,CY3DjB,OAAO,CAAE,YAAY,CACrB,MAAM,CZwDQ,IAAI,CYvDlB,WAAW,CZuDG,IAAI,CYtDlB,OAAO,CZuDQ,MAAO,CYtDtB,cAAc,CAAE,SAAS,CACzB,cAAc,CAAE,MAAM,CAEtB,2BAA2B,CAAE,WAAW,CAI1C,oSAWoB,CAClB,cAAc,CAAE,IAAI,CACpB,gBAAgB,CAAE,kBAAsC,CACxD,UAAU,CAAE,IAAI,CAChB,KAAK,CAAE,kBAAiC,CACxC,MAAM,CAAE,OAAO,CAEf,8XAAQ,CACN,gBAAgB,CAAE,kBAAsC,CACxD,KAAK,CAAE,kBAAiC,CAK5C,kDAGU,CACR,SAAS,CZeQ,IAAI,CYdrB,OAAO,CAAE,CAAC,CAEV,4DAAE,CACA,SAAS,CZYW,MAAM,CYX1B,WAAW,CAAE,OAAO,CAOtB,+CAAQ,CACN,gBAAgB,CAAE,OAAsC,CAK5D,eAAK,CACH,eAAe,CAAE,IAAI,CACrB,KAAK,CZQe,IAAI,CYPxB,gBAAgB,CZ8RG,OAAgB,CY7RnC,UAAU,CAAE,MAAM,CAClB,cAAc,CAAE,IAAI,CAEpB,UAAU,CAAE,YAAY,CACxB,MAAM,CAAE,OAAO,CAEf,2BAAQ,CACN,gBAAgB,CZFa,OAAsC,CYQvE,aAAc,CAiCZ,OAAO,CAAE,YAAY,CACrB,KAAK,CZ5BiB,IAAI,CY6B1B,QAAQ,CAAE,QAAQ,CAClB,QAAQ,CAAE,MAAM,CAChB,OAAO,CAAE,CAAC,CACV,KAAK,CZ/BgB,IAAI,CYgCzB,MAAM,CZhCe,IAAI,CYiCzB,WAAW,CZjCU,IAAI,CYkCzB,OAAO,CAAE,CAAC,CACV,gBAAgB,CZsOG,OAAgB,CYrOnC,aAAa,CZlCU,GAAG,CYoC1B,UAAU,CAAE,GAAG,CACf,MAAM,CAAE,OAAO,CACf,cAAc,CAAE,MAAM,CA9CtB,mBAAQ,CACN,gBAAgB,CZ8QC,OAAgB,CY1QnC,oBAAS,CACP,aAAa,CAAE,CAAC,CAGlB,uBAAY,CAKV,KAAK,CZPoB,IAAI,CYQ7B,MAAM,CZRmB,IAAI,CYG7B,mCAAc,CACZ,MAAM,CAAE,KAAgC,CAK1C,yBAAE,CACA,WAAW,CZVY,IAAI,CYc/B,yBAAc,CAMZ,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,KAA0B,CAPlC,8BAAO,CACL,KAAK,CAAE,IAAI,CACX,IAAI,CAAE,IAAI,CAwBd,eAAE,CACA,KAAK,CAAE,OAAO,CACd,OAAO,CAAE,YAAY,CACrB,UAAU,CAAE,MAAM,CAClB,KAAK,CZ/Ce,IAAI,CYgDxB,SAAS,CZ1DiB,MAAM,CY2DhC,WAAW,CZhDQ,IAAI,CYqD3B,mBAAoB,CAClB,MAAM,CZnFQ,IAAI,CYuFpB,iBAAkB,CAqEhB,QAAQ,CAAE,KAAK,CACf,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,WAAW,CAAE,IAAI,CACjB,aAAa,CAAE,CAAC,CAChB,OAAO,CAAE,GAAG,CAxEV,2BAAG,CACF,UAAU,CAAE,OAAO,CAItB,4BAAa,CACX,OAAO,CAAE,UAAU,CAEnB,+BAAG,CACD,UAAU,CAAE,KAAK,CACjB,KAAK,CAAE,IAAI,CACX,GAAG,CAAE,GAAG,CACR,SAAS,CAAE,gBAAgB,CAC3B,MAAM,CAAE,IAAI,CACZ,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,KAAK,CAEZ,kCAAG,CACD,OAAO,CAAE,YAAY,CACrB,MAAM,CAAE,aAAa,CAK3B,yBAAU,CAOR,OAAO,CAAE,CAAC,CACV,MAAM,CZ3FmB,IAAI,CYqF3B,oCAAQ,CACN,OAAO,CAAE,CAAC,CAOd,4BAAG,CACD,OAAO,CAAE,IAAI,CACb,GAAG,CAAE,CAAC,CACN,MAAM,CAAE,CAAC,CACT,OAAO,CAAE,CAAC,CAEV,+BAAG,CACD,IAAI,CAAE,CAAC,CACP,OAAO,CAAE,YAAY,CACrB,MAAM,CAAE,CAAC,CACT,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,IAAI,CAEhB,iCAAE,CACA,OAAO,CAAE,KAAK,CACd,QAAQ,CAAE,MAAM,CAChB,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,gBAAgB,CAAE,WAAW,CAC7B,UAAU,CAAE,IAAI,CAChB,KAAK,CAAE,IAAI,CACX,WAAW,CZnHQ,IAAI,CYoHvB,OAAO,CAAE,CAAC,CAEV,mCAAE,CACA,WAAW,CAAE,OAAO,CAc9B,oBAAG,CACD,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,CAAC,CACR,UAAU,CAAE,MAAM,CAClB,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,IAAI,CACZ,MAAM,CAAE,CAAC,CACT,UAAU,CAAE,MAAM,CAElB,uBAAG,CACD,aAAa,CAAE,IAAI,CAGrB,mCAAe,CACb,OAAO,CAAE,CAAC,CAId,+BAAc,CACZ,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,OAAO,CAAE,EAAE,CACX,KAAK,CZ7Jc,IAAI,CY8JvB,MAAM,CZ9Ja,IAAI,CY+JvB,gBAAgB,CZ0GC,OAAgB,CYzGjC,aAAa,CZ9JQ,GAAG,CY+JxB,SAAS,CAAE,QAAQ,CAKvB,SAAU,CACR,UAAU,CAAE,IAAI,CAChB,gBAAgB,CAAE,WAAW,CAC7B,KAAK,CZhLa,OAAO,CYiLzB,MAAM,CAAE,OAAO,CACf,UAAU,CAAE,oBAAoB,CAEhC,+BACQ,CACN,UAAU,CAAE,IAAI,CAGlB,eAAQ,CACN,gBAAgB,CAAE,eAAc,CAGlC,kBAAW,CACT,gBAAgB,CAAE,sBAAsB,CACxC,KAAK,CAAE,kBAAsC,CAC7C,MAAM,CAAE,OAAO,CAKnB,UAAW,CAET,MAAM,CZ1Mc,IAAoB,CY2MxC,WAAW,CZ3MS,IAAoB,CY6MxC,YAAE,CACA,SAAS,CZ/MiB,MAAM,CYoNpC,UAAW,CACT,OAAO,CAAE,KAAK,CCjShB,iBAAkB,CAEhB,gBAAgB,CbgJE,IAAI,Ca/ItB,MAAM,CAAE,CAAC,CACT,OAAO,CAAE,IAAI,CACb,SAAS,CAAE,KAAK,CAChB,UAAU,CAAE,KAAK,CACjB,UAAU,CAAE,IAAI,CAChB,OAAO,CAAE,CAAC,CACV,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,GAAG,CACZ,WAAW,CAAE,aAAa,CAE1B,oBAAG,CACD,KAAK,CAAE,IAAI,CACX,KAAK,CbuSG,gBAAmB,CatS3B,MAAM,CAAE,OAAO,CACf,UAAU,CboIS,IAAI,CanIvB,WAAW,CAAE,MAAM,CACnB,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,IAAI,CAChB,cAAc,CAAE,IAAI,CAEpB,oFAA8B,CAC5B,gBAAgB,Cb2HI,IAAI,CaxH1B,oCAAkB,CAChB,gBAAgB,CAAE,OAAoC,CAGxD,4BAAU,CACR,UAAU,CAAE,CAAC,CACb,MAAM,CAAE,GAAG,CAGb,gDAAgB,CACd,SAAS,CAAE,IAAI,CACf,KAAK,Cb0TU,OAAgB,CazT/B,OAAO,CAAE,KAAK,CACd,WAAW,CAAE,IAAI,CACjB,OAAO,CAAE,SAAuC,CAGlD,+BAAiB,CACf,GAAG,CAAE,GAAG,CACR,IAAI,CAAE,CAAC,CACP,MAAM,CAAE,IAAI,CAId,wBAAU,CACR,MAAM,CAAE,OAAO,CACf,WAAW,CAAE,OAAO,CACpB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,UAAU,CAClB,KAAK,CAAE,IAAI,CAMjB,0DAA6D,CAC3D,GAAG,CAAE,GAAG,CACR,IAAI,CAAE,CAAC,CACP,MAAM,CAAE,IAAI,CChEd;;;;;;;GAOG,AAGH,aAAc,CACZ,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,OAAO,CACf,OAAO,CAAE,YAAY,CACrB,QAAQ,CAAE,MAAM,CAChB,WAAW,CAAE,IAAI,CACjB,2BAA2B,CAAE,WAAW,CACxC,cAAc,CAAE,MAAM,CACtB,OAAO,CAAE,CAAC,CACV,UAAU,CAAE,YAAY,CAExB,2BAAc,CACZ,QAAQ,CAAE,QAAQ,CAClB,aAAa,CAAE,GAAG,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,UAAU,CAAC,KAAK,CAChB,WAAW,CAAC,KAAK,CACjB,OAAO,CAAE,CAAC,CAEV,UAAU,CAAE,eAAe,CAC3B,UAAU,CAAE,iBAAiB,CAC7B,mBAAmB,CAAE,kBAAkB,CACvC,SAAS,CAAE,QAAQ,CACnB,cAAc,CAAE,IAAI,CAItB,uCAA4B,CAC1B,gBAAgB,CAAE,sBAAyB,CAE7C,qCAA0B,CACxB,gBAAgB,CAAE,mBAAsB,CAE1C,wCAA6B,CAC3B,gBAAgB,CAAE,oBAAuB,CAE3C,wCAA6B,CAC3B,gBAAgB,CAAE,mBAAsB,CAE1C,wCAA6B,CAC3B,gBAAgB,CAAE,oBAAwB,CAE5C,uCAA4B,CAC1B,gBAAgB,CAAE,mBAAuB,CAE3C,sCAA2B,CACzB,gBAAgB,CAAE,mBAAuB,CAI3C,uGAAgE,CAC9D,MAAM,CAAE,CAAC,CACT,UAAU,CAAE,MAAM,CAClB,SAAS,CAAE,OAAO,CAClB,cAAc,CAAE,OAAO,CACvB,UAAU,CAAE,IAAI,CAGlB,iBAAI,CACF,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,EAAE,CAIf,mBAAoB,CAClB,UAAU,CAAE,eAAoB,CAGlC,aAAc,CACZ,SAAS,CAAE,aAAa,CACxB,kBAAkB,CAAE,qDAAuD,CAG7E,oBAAqB,CACnB,aAAa,CAAE,KAAK,CACpB,cAAc,CAAE,MAAM,CAEtB,wCAAoB,CAClB,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,OAAO,CAAE,CAAC,CAId,aAAc,CACZ,UAAU,CAAE,MAAM,CAClB,KAAK,CAAE,KAAK,CACZ,MAAM,CAAE,KAAK,CACb,WAAW,CAAE,KAAK,CAClB,aAAa,CAAE,GAAG,CAClB,kBAAkB,CAAE,IAAI,CAG1B,YAAa,CACX,OAAO,CAAE,KAAK,CAIhB,2BAA4B,CAC1B,OAAO,CAAE,EAAE,CChHb,MAAO,CAGL,OAAO,CAAE,IAAI,CACb,QAAQ,CAAE,KAAK,CACf,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,CAAC,CACR,gBAAgB,CAAE,OAAO,CACzB,OAAO,CAAE,CAAC,CACV,UAAU,CAAE,GAAG,CACf,KAAK,CAAE,GAAG,CACV,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,IAAI,CAEhB,aAAa,CAAE,GAAG,CAClB,WAAW,CAAE,YAAY,CAEzB,yBAA2B,CAjB7B,MAAO,CAkBJ,KAAK,CAAE,GAAG,EAGX,uCAAY,CACV,UAAU,CAAE,CAAC,CAGf,qBAAe,CACb,OAAO,CAAE,IAAI,CAEf,mBAAa,CACX,MAAM,CAAE,OAAO,CAGjB,oBAAc,CACZ,aAAa,CAAE,WAAW,CAC1B,gBAAgB,CAAE,OAAO,CACzB,OAAO,CAAE,OAAO,CAChB,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,KAAK,CAEjB,wFAAgB,CACd,MAAM,CAAE,KAAK,CAInB,cAAe,CACb,QAAQ,CAAE,KAAK,CACf,OAAO,CAAE,GAAG,CACZ,GAAG,CAAE,IAAI,CACT,IAAI,CAAE,CAAC,CACP,MAAM,CAAE,CAAC,CACT,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,IAAI,CAChB,OAAO,CAAE,IAAI,CAEb,WAAW,CAAE,OAAO,CAItB,yBAA0B,CACxB,OAAO,CAAE,CAAC,CACV,MAAM,CAAE,GAAG,CAEX,wCAAe,CACb,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,iBAAiB,CACzB,UAAU,CAAE,IAAI,CAChB,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,IAAI,CAGlB,uCAAc,CACZ,UAAU,CAAE,yBAAwB,CACpC,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,CAAC,CAKb,mBAAoB,CAClB,GAAG,CAAE,IAAI,CACT,MAAM,CAAE,KAAK,CACb,MAAM,CAAE,CAAC,CACT,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,GAAG,CACf,aAAa,CAAE,CAAC,CAChB,WAAW,CAAE,eAAe,CCxF9B,YAAa,CACX,UAAU,CAAE,cAAmC,CAC/C,YAAY,CAAE,cAAmC,CACjD,WAAW,CAAE,cAAmC,CAChD,MAAM,CAAE,cAA8C,CAIxD,mBAAoB,CAClB,OAAO,CAAE,IAAI,CACb,MAAM,CAAE,OAAO,CACf,2BAA2B,CAAE,WAAW,CACxC,WAAW,CAAE,GAAG,CAChB,OAAO,CAAE,IAAI,CACb,gBAAgB,ChBoGS,IAAI,CgBnG7B,aAAa,CAAE,cAAmC,CAElD,qBAAE,CACA,KAAK,CAAE,IAAI,CACX,SAAS,CAAE,MAAM,CACjB,OAAO,CAAE,YAAY,CACrB,UAAU,CAAE,MAAM,CAClB,YAAY,CAAE,IAAI,CAItB,iBAAkB,CAChB,OAAO,CAAE,IAAI,CACb,aAAa,CAAE,cAAmC,CAClD,UAAU,CAAE,UAAU,CACtB,OAAO,CAAE,IAAI,CAOb,mDAAa,CACX,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,IAAI,CAEhB,yDAAG,CAAE,OAAO,CAAE,CAAC,CAGjB,iEAAoB,CAClB,gBAAgB,CAAE,WAAW,CAC7B,MAAM,CAAE,IAAI,CACZ,WAAW,CAAE,OAAO,CACpB,MAAM,CAAE,OAAO,CACf,OAAO,CAAE,MAAkB,CAE3B,6EAAQ,CAAE,gBAAgB,CAAE,gBAAe,CAC3C,qEAAE,CAAE,WAAW,CAAE,OAAO,CAG1B,6DAAkB,CAChB,MAAM,CAAE,CAAC,CACT,gBAAgB,ChByDO,IAAI,CgBvD3B,uEAAK,CACH,OAAO,CAAE,eAC2B,CAQ1C,mBAAoB,CAClB,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,IAAI,CAChB,sBAAK,CACH,UAAU,CAAE,0DAAiE,CAE7E,MAAM,CAAE,MAAM,CACd,UAAU,CAAE,iDAAoD,CAElE,6BAAY,CACV,UAAU,CAAE,2DAAkE,CAC9E,MAAM,CAAE,MAAM,CChFlB,KAAM,CACJ,OAAO,CAAE,YAAY,CACrB,MAAM,CAAE,IAAI,CACZ,SAAS,CAAE,IAAI,CACf,WAAW,CAAE,GAAG,CAChB,KAAK,CAAE,eAAc,CACrB,WAAW,CAAE,IAAI,CACjB,OAAO,CAAE,MAAM,CACf,aAAa,CAAE,IAAI,CACnB,gBAAgB,CjBgHF,OAAO,CiB/GrB,aAAa,CjBkHD,GAAG,CiBjHf,YAAY,CjBiHA,GAAG,CiB/Gf,SAAM,CACJ,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,aAAa,CACrB,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,aAAa,CAAE,GAAG,CAGpB,YAAO,CACL,MAAM,CAAE,OAAO,CACf,KAAK,CAAE,KAAK,CACZ,SAAS,CAAE,IAAI,CACf,WAAW,CAAE,IAAI,CACjB,YAAY,CAAE,GAAG,CAIrB,MAAO,CACL,MAAM,CAAE,IAAI,CACZ,aAAa,CAAE,iBAA4B,CAC3C,UAAU,CAAE,IAAI,CAChB,MAAM,CjByIO,UAA2B,CiBxIxC,UAAU,CAAE,IAAI,CAChB,OAAO,CAAE,IAAI,CACb,UAAU,CAAE,OAAO,CAEnB,YAAQ,CACN,aAAa,CAAE,iBAA8B,CAC7C,UAAU,CAAE,iBAA8B,CAG5C,YAAQ,CACN,MAAM,CAAE,IAAI,CAGd,qBAAe,CACb,gBAAgB,CjB0EE,OAAO,CiBzEzB,KAAK,CAAE,IAAI,CAGb,aAAO,CACL,UAAU,CAAE,IAAI,CAChB,MAAM,CAAE,CAAC,CACT,KAAK,CAAE,eAAc,CACrB,OAAO,CAAE,YAAY,CACrB,SAAS,CjB+GK,IAAI,CiB9GlB,MAAM,CjBuGK,IAAI,CiBtGf,WAAW,CAAE,IAAI,CACjB,OAAO,CAAE,CAAC,CACV,MAAM,CAAE,CAAC,CACT,OAAO,CAAE,YAAY,CACrB,KAAK,CAAE,gBAAgB,CAGzB,mBAAa,CACX,MAAM,CAAE,YAAY,CACpB,UAAU,CAAE,eAAe,CAI7B,4BAAsB,CACpB,UAAU,CAAE,CAAC,CACb,aAAa,CAAE,CAAC,CAKpB,gBAAiB,CACf,WAAW,CAAE,IAAI,CACjB,KAAK,CAAE,GAAG,CACV,KAAK,CAAE,iBAAiB,CAE1B,oBAAsB,CACpB,SAAS,CAAE,MAAM,CACjB,SAAS,CAAE,iBAAiB,CCvF9B,cAAe,CAOb,OAAO,CAAE,KAAK,CACd,MAAM,CAAE,OAAO,CACf,QAAQ,CAAE,QAAQ,CAClB,UAAU,CAAE,WAAW,CACvB,2BAA2B,CAAE,MAAM,CATjC,iCAAe,CACb,OAAO,CAAE,EAAE,CAUf,qBAAS,CACP,MAAM,CAAE,QAAQ,CAIpB,oBAAqB,CACnB,QAAQ,CAAC,KAAK,CACd,GAAG,CAAE,CAAC,CACN,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,CAAC,CACT,IAAI,CAAE,CAAC,CACP,gBAAgB,CAAE,OAAO,CACzB,OAAO,CAAE,IAAI,CACb,WAAW,CAAE,OAAO,CAGtB,oBAAqB,CACnB,QAAQ,CAAE,KAAK,CACf,OAAO,CAAE,IAAI,CACb,KAAK,CAAE,IAAI,CACX,WAAW,CAAE,IAAI,CACjB,MAAM,CAAE,CAAC,CACT,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,MAAM,CAClB,OAAO,CAAE,MAAM,CACf,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,IAAI,CACb,sBAAsB,CAAE,WAAW,CCxCrC,YAAa,CACX,OAAO,CnBgMM,iBAAyC,CmB7LxD,YAAa,CACX,OAAO,CAAE,IAAI,CACb,gBAAgB,CnBoDQ,OAA6B,CmBjDvD,KAAM,CACJ,SAAS,CnBmKO,KAAK,CmBlKrB,KAAK,CnBoQW,OAAqB,CoB3QvC,aAAc,CACZ,KAAK,CpB6KkB,OAAiC,CoBxK1D,ifAY8B,CAG5B,gBAAgB,CAAE,WAAW,CAC7B,MAAM,CAAE,IAAI,CACZ,aAAa,CpBwIA,iBAA8B,CoBvI3C,aAAa,CAAE,CAAC,CAChB,OAAO,CAAE,IAAI,CACb,MAAM,CpBmIO,IAAI,CoBlIjB,KAAK,CAAE,IAAI,CACX,SAAS,CpBwIO,IAAI,CoBvIpB,MAAM,CpByIO,UAA2B,CoBxIxC,OAAO,CpByIO,CAAC,CoBxIf,UAAU,CAAE,IAAI,CAChB,UAAU,CAAE,WAAW,CACvB,UAAU,CpBuIO,QAAQ,CoBpIzB,y2CACuB,CACrB,KAAK,CpBoIc,gBAAgB,CoBnInC,aAAa,CpBqIO,2BAAiC,CoBjIvD,qgDAC6B,CAC3B,KAAK,CpB6Hc,gBAAgB,CoBzHrC,+wBAAwB,CACtB,aAAa,CAAE,iBAA4B,CAC3C,UAAU,CAAE,iBAA4B,CAI1C,61BAA8B,CAC5B,KAAK,CpBmSY,OAAgB,CoBvQnC,orBAAmB,CACjB,KAAK,CAAE,IAAI,CASb,i9CACqB,CACnB,OAAO,CAAE,IAAI,CAGf,uoDAC4B,CAC1B,OAAO,CAAE,KAAK,CAMlB,yvCAAmB,CACjB,aAAa,CAAE,iBAA8B,CAC7C,UAAU,CAAE,iBAA8B,CAE5C,+yCAAqB,CACnB,aAAa,CpB6DQ,iBAA6B,CoB5DlD,UAAU,CAAE,iBAA4B,CAE1C,uiDAAwB,CACtB,OAAO,CAAE,kBAAkB,CAC3B,KAAK,CpBwJkB,OAAsB,CoBvJ7C,OAAO,CAAE,CAAC,CACV,SAAS,CAAE,eAAe,CAE5B,6lDAAsB,CACpB,OAAO,CAAE,gBAAgB,CACzB,KAAK,CpBsCa,OAAY,CoBrC9B,OAAO,CAAE,CAAC,CACV,SAAS,CAAE,eAAe,CAE5B,yqBAAmB,CACjB,OAAO,CAAE,KAAK,CACd,OAAO,CAAE,EAAE,CACX,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,IAAI,CACT,IAAI,CAAE,CAAC,CACP,OAAO,CAAE,CAAC,CACV,UAAU,CAAE,wCAAwC,CAKtD,YAAa,CAyBX,QAAQ,CAAE,QAAQ,CAClB,UAAU,CAAE,IAAI,CAxBhB,mBAAS,CACP,OAAO,CAAE,YAAY,CACrB,cAAc,CAAE,MAAM,CACtB,WAAW,CAAE,GAAG,CAEhB,8DACiB,CACf,aAAa,CAAE,IAAI,CAMrB,sBAAM,CACJ,IAAI,CAAE,MAAiB,CAGzB,6EAC4B,CAC1B,KAAK,CAAE,0BAAoC,CAO/C,kBAAM,CACJ,KAAK,CpBmGS,OAAqB,CoBlGnC,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,MAAM,CAAE,IAAI,CACZ,SAAS,CAAE,IAAI,CACf,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,sBAAsB,CAClC,gBAAgB,CAAE,OAAO,CACzB,UAAU,CAAE,OAAO,CACnB,SAAS,CAAE,gBAAgB,CAC3B,cAAc,CAAE,IAAI,CAEpB,0CAA0B,CACxB,SAAS,CAAE,4BAA2B,CACtC,gBAAgB,CAAE,GAAG,CAKzB,oBAAQ,CACN,QAAQ,CAAE,QAAQ,CAClB,KAAK,CpBjCM,IAAI,CoBkCf,SAAS,CAAE,IAAI,CACf,UAAU,CAAE,SAAS,CAErB,2BAAS,CAAE,KAAK,CpByJC,OAAgB,CoBtJnC,+KAIgC,CAC9B,WAAW,CAAE,IAAI,CACjB,KAAK,CAAE,GAAG,CACV,KAAK,CAAE,iBAAiB,CAG1B,4BAAgB,CAAE,WAAW,CAAE,IAAI,CAEnC,yBAA2B,CACzB,4BAAgB,CACd,KAAK,CAAE,GAAG,CACV,KAAK,CAAE,iBAAiB,EAI5B,yBAA0B,CACxB,4BAAgB,CACd,KAAK,CAAE,GAAG,CACV,KAAK,CAAE,iBAAiB,EAQ9B,+BAAgC,CAC9B,OAAO,CAAE,KAAK,CACd,WAAW,CAAE,OAAO,CAEpB,4CAAe,CACb,MAAM,CAAE,OAAO,CACf,YAAY,CAAE,IAAI,CAClB,KAAK,CAAE,iBAAiB,CACxB,MAAM,CAAE,CAAC,CACT,UAAU,CAAE,IAAI,CAGlB,qCAAQ,CACN,gBAAgB,CpBhFD,IAAI,CoBiFnB,MAAM,CAAE,CAAC,CACT,UAAU,CAAE,IAAI,CAChB,KAAK,CAAE,IAAI,CAEX,mKAEoB,CAClB,KAAK,CAAE,IAAI,CAIf,qCAAU,CACR,IAAI,CAAE,IAAI,CAGZ,yGACoB,CAClB,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,KAAK,CAAE,IAAI,CACX,KAAK,CAAE,WAAW,CAClB,MAAM,CAAE,OAAO,CACf,SAAS,CAAE,IAAI,CACf,UAAU,CAAE,SAAS,CAQzB,QAAS,CACP,KAAK,CAAE,IAAI,CACX,MAAM,CpBrHO,IAAI,CoBsHjB,gBAAgB,CAAE,WAAW,CAE7B,6BAAuB,CAYrB,UAAU,CAAE,MAAM,CAClB,OAAO,CAAE,gBAAgB,CACzB,MAAM,CAAE,IAAI,CACZ,UAAU,CpBvIC,IAAI,CoB0Hf,4CAAmB,CAOjB,MAAM,CAAE,IAAI,CANZ,mDAAS,CACP,GAAG,CAAE,iBAAiB,CAExB,oEAA0B,CACxB,SAAS,CAAE,iBAAiB,CAapC,UAAW,CACT,OAAO,CAAE,IAAI,CACb,WAAW,CAAE,QAAQ,CACrB,SAAS,CAAE,UAAU,CACrB,aAAa,CAAE,UAAU,CACzB,WAAW,CAAE,MAAM,CAGnB,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CAKR,qBAAsB,CACpB,UAAU,CAAE,KAAyB,CACrC,aAAa,CpBpJO,IAAI,CoBqJxB,OAAO,CAAE,KAAK,CACd,OAAO,CAAE,CAAC,CACV,QAAQ,CAAE,MAAM,CAGd,mCAAW,CAAE,KAAK,CAAE,IAAI,CAExB,4BAAI,CACF,MAAM,CAAE,IAA0B,CAClC,KAAK,CAAE,IAA0B,CACjC,MAAM,CAAE,QAAQ,CCrUtB,mDACuB,CACrB,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,CAAC,CACV,cAAc,CAAE,IAAI,CAGtB,+DAC+B,CAC7B,QAAQ,CAAE,QAAQ,CAClB,YAAY,CAAE,IAAI,CAClB,MAAM,CAAE,OAAO,CACf,OAAO,CAAE,YAAY,CACrB,MAAM,CAAE,IAAI,CACZ,WAAW,CAAE,IAAI,CACjB,SAAS,CAAE,IAAI,CACf,UAAU,CAAE,SAAS,CACrB,WAAW,CAAE,IAAI,CAGnB,sDAC6B,CAC3B,OAAO,CAAE,EAAE,CACX,QAAQ,CAAE,QAAQ,CAClB,IAAI,CAAE,CAAC,CACP,GAAG,CAAE,CAAC,CACN,MAAM,CAAE,GAAG,CACX,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,CAAC,CACV,UAAU,CAAE,SAAS,CAIvB,kPAK8C,CAC5C,aAAa,CAAE,GAAG,CAGpB,kFAC2C,CACzC,MAAM,CAAE,iBAA4B,CAGtC,wCAA2C,CACzC,SAAS,CAAE,QAAQ,CAIrB,mCAAsC,CACpC,MAAM,CAAE,qBAAqB,CAG/B,2HAE8C,CAC5C,MAAM,CrBwHO,iBAA4B,CqBrH3C,8EAC8C,CAC5C,gBAAgB,CrB2RG,OAAgB,CqBxRrC,kCAAqC,CACnC,SAAS,CAAE,WAAW,CAIxB,2CAA8C,CAC5C,SAAS,CAAE,UAAS,CAItB,wCAA2C,CACzC,UAAU,CAAE,0BAAyB,CAIvC,qDAAwD,CACtD,MAAM,CAAE,0BAA+B,CAGzC,oDAAuD,CACrD,MAAM,CAAE,IAAI,CACZ,gBAAgB,CrBkFK,gBAAgB,CqB9EvC,+FAC+C,CAC7C,gBAAgB,CAAE,WAAW,CAC7B,YAAY,CrB2ES,gBAAgB,CqBxEvC,6BAAgC,CAC9B,KAAK,CrBuEgB,gBAAgB,CqBpEvC,kDAAqD,CACnD,YAAY,CrBmES,gBAAgB,CqBhEvC,2CAA8C,CAC5C,gBAAgB,CrB+DK,gBAAgB,CqB9DrC,YAAY,CrB+De,OAAO,CsB5KpC,MAAO,CACL,aAAa,CAAE,IAAI,CACnB,UAAU,CAAE,IAAI,CAGlB,iBAAkB,CAChB,aAAa,CAAE,CAAC,CAIlB,yDAC0B,CACxB,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,CAAC,CACV,cAAc,CAAE,IAAI,CAMpB,uBAAQ,CACN,QAAQ,CAAE,QAAQ,CAClB,YAAY,CAAE,IAAI,CAClB,MAAM,CAAE,OAAO,CACf,OAAO,CAAE,YAAY,CACrB,MAAM,CAAE,IAAI,CACZ,WAAW,CAAE,IAAI,CACjB,SAAS,CAAE,IAAI,CACf,WAAW,CAAE,IAAI,CAInB,4EACgC,CAC9B,OAAO,CAAE,EAAE,CACX,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,CAAC,CACV,MAAM,CAAE,iBAA4B,CACpC,aAAa,CAAE,GAAG,CAClB,UAAU,CAAE,GAAG,CACf,UAAU,CAAE,GAAG,CAGjB,6CAAgC,CAC9B,MAAM,CAAE,CAAC,CACT,SAAS,CAAE,QAAQ,CAGrB,qDAAwC,CACtC,MAAM,CAAE,IAAI,CACZ,gBAAgB,CtBqHG,gBAAgB,CsBjHrC,0CAA6B,CAC3B,SAAS,CAAE,QAAQ,CACnB,MAAM,CAAE,CAAC,CACT,aAAa,CAAE,GAAG,CAClB,UAAU,CAAE,0BAAyB,CACrC,gBAAgB,CAAE,eAAc,CAKlC,sCAAe,CACb,GAAG,CAAE,IAAI,CACT,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,qBAAqB,CACjC,WAAW,CAAE,qBAAqB,CAClC,YAAY,CtByGD,iBAA4B,CsBxGvC,aAAa,CtBwGF,iBAA4B,CsBvGvC,SAAS,CAAE,aAAa,CACxB,mBAAmB,CAAE,MAAM,CAC3B,gBAAgB,CAAE,SAAS,CAG7B,+CAA0B,CACxB,YAAY,CAAE,0BAA+B,CAC7C,aAAa,CAAE,0BAA+B,CAMhD,4CAAc,CACZ,GAAG,CAAE,KAAK,CACV,IAAI,CAAE,KAAK,CACX,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,IAAI,CAChB,WAAW,CAAE,IAAI,CACjB,YAAY,CtBmFD,iBAA4B,CsBlFvC,aAAa,CAAE,IAAI,CACnB,SAAS,CAAE,aAAa,CACxB,mBAAmB,CAAE,MAAM,CAC3B,gBAAgB,CAAE,SAAS,CAI7B,qDAA0B,CACxB,YAAY,CAAE,0BAA+B,CAC7C,gBAAgB,CAAE,WAAW,CAO/B,uCAAc,CACZ,aAAa,CAAE,GAAG,CAGpB,gFACc,CACZ,OAAO,CAAE,EAAE,CACX,IAAI,CAAE,CAAC,CACP,QAAQ,CAAE,QAAQ,CAElB,UAAU,CAAE,gGAAgG,CAC5G,OAAO,CAAE,CAAC,CAIZ,sDAA+B,CAC7B,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,CAAC,CACT,MAAM,CAAE,qBAAqB,CAC7B,IAAI,CAAE,GAAG,CACT,GAAG,CAAE,IAAI,CACT,SAAS,CAAE,cAAc,CACzB,gBAAgB,CAAE,SAAS,CAG7B,qDAA8B,CAC5B,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,gBAAgB,CAAE,WAAW,CAC7B,MAAM,CAAE,iBAA4B,CACpC,GAAG,CAAE,GAAG,CACR,OAAO,CAAE,CAAC,CAKV,gDAAe,CACb,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,GAAG,CACT,KAAK,CAAE,GAAG,CACV,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,qBAAqB,CACjC,WAAW,CAAE,qBAAqB,CAClC,YAAY,CAAE,cAA2B,CACzC,aAAa,CAAE,cAA2B,CAC1C,SAAS,CAAE,cAAc,CACzB,gBAAgB,CAAE,SAAS,CAG7B,+CAAc,CACZ,GAAG,CAAE,CAAC,CACN,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,MAAM,CAAE,iBAA0B,CAClC,gBAAgB,CtBoLD,OAAgB,CsBnL/B,OAAO,CAAE,CAAC,CAKd,oDAA6B,CAC3B,aAAa,CAAE,GAAG,CAClB,YAAY,CtBGI,OAAO,CsBFvB,gBAAgB,CAAE,eAAc,CAGlC,4DAAqC,CACnC,aAAa,CAAE,GAAG,CAClB,gBAAgB,CtBsKC,OAAgB,CsBrKjC,YAAY,CtBqKK,OAAgB,CsBjKnC,+DAAwC,CACtC,gBAAgB,CAAE,WAAW,CAC7B,MAAM,CAAE,qBAAqB,CAG/B,8DAAuC,CACrC,YAAY,CAAE,WAAW,CACzB,gBAAgB,CtBtBS,OAAO,CsByBlC,yDAAkC,CAChC,gBAAgB,CAAE,WAAW,CAG/B,wDAAiC,CAC/B,gBAAgB,CtB9BS,OAAO,CsB+BhC,YAAY,CtB/Ba,OAAO,CuB7KpC,iBACU,CACR,2BAA2B,CAAE,WAAW,CACxC,WAAW,CAAE,IAAI,CAGnB,aAAc,CACZ,MAAM,CAAE,OAAO,CAGjB,kCAAmC,CACjC,OAAO,CAAE,CAAC,CACV,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,CAAC,CAET,iDAAmB,CACjB,gBAAgB,CvBwLM,OAA+C,CuBtLrE,gHAAkB,CAChB,IAAI,CAAE,IAAI,CAGZ,uDAAQ,CACN,gBAAgB,CvBsUD,OAAgB,CuBjUrC,oBAAqB,CACnB,OAAO,CAAE,EAAE,CACX,OAAO,CAAE,YAAY,CACrB,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,gBAAgB,CvBwKU,gBAAe,CuBvKzC,aAAa,CvBwKC,IAAI,CuBvKlB,YAAY,CAAE,IAAI,CAClB,UAAU,CAAE,oBAAoB,CAChC,cAAc,CAAE,MAAM,CACtB,MAAM,CAAE,MAAM,CAEd,sDAAkB,CAChB,OAAO,CAAE,EAAE,CACX,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,YAAY,CACrB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,aAAa,CAAE,GAAG,CAClB,IAAI,CAAE,CAAC,CACP,GAAG,CAAE,IAAI,CACT,UAAU,CAAE,6EAA6E,CAG3F,2BAAS,CACP,gBAAgB,CAAE,qBAAqC,CAGzD,0BAAQ,CACN,gBAAgB,CvB+IE,OAAO,CuB9IzB,UAAU,CAAE,kGAA6G,CAK7H,6IAC0E,CACxE,SAAS,CAAE,UAAU,CACrB,gBAAgB,CAAE,qBAAqC,CAGzD,4HACkE,CAChE,SAAS,CAAE,UAAU,CACrB,gBAAgB,CAAE,gBAAe,CAInC,6CAAgD,CAC9C,MAAM,CAAE,OAAO,CACf,gBAAgB,CAAE,gBAAe,CAGnC,2HACoE,CAClE,gBAAgB,CvByFW,OAAO,CwB7KpC,MAAO,CAAE,OAAO,CAAE,IAAI,CACtB,sBAAuB,CAAE,OAAO,CAAE,KAAK,CAEvC,MAAO,CACL,gBAAgB,CxB0LE,qBAAyB,CwBzL3C,KAAK,CAAE,IAAI,CACX,OAAO,CxB4LQ,GAAG,CwB3LlB,MAAM,CxBsLQ,iBAAkB,CwBrLhC,aAAa,CxB2LC,GAAG,CwB1LjB,MAAM,CxBsJO,IAAI,CwBjJjB,mBAAW,CACT,OAAO,CAAE,KAAK,CACd,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,CAAC,CACR,cAAc,CAAE,IAAI,CACpB,MAAM,CAAE,CAAC,CACT,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,OAAO,CAAE,CAAC,CAId,aAAc,CACZ,QAAQ,CAAE,QAAQ,CAGpB,eAAgB,CA+Bd,QAAQ,CAAE,QAAQ,CAVlB,yDACkB,CAChB,KAAK,CAAE,IAAI,CACX,cAAc,CAAE,IAAI,CAStB,qCAAsB,CACpB,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,OAAO,CACf,gBAAgB,CAAE,WAAW,CAC7B,MAAM,CAAE,IAAI,CACZ,aAAa,CxB6FF,iBAA8B,CwB5FzC,OAAO,CAAE,IAAI,CACb,MAAM,CxByFK,IAAI,CwBxFf,WAAW,CxBwFA,IAAI,CwBvFf,KAAK,CAAE,IAAI,CACX,SAAS,CxB6FK,IAAI,CwB5FlB,MAAM,CxB8FK,UAA2B,CwB7FtC,OAAO,CAAE,CAAC,CACV,OAAO,CAAE,KAAK,CACd,WAAW,CAAC,IAAI,CAGlB,0BAAW,CACT,KAAK,CAAE,OAAO,CACd,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,CAAC,CACR,GAAG,CAAE,CAAC,CACN,MAAM,CAAE,CAAC,CACT,MAAM,CAAE,IAAI,CACZ,MAAM,CAAE,MAAM,CACd,SAAS,CAAE,IAAI,CACf,WAAW,CAAE,IAAI,CAGnB,qBAAU,CACR,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,KAAK,CACV,SAAS,CxB4EK,KAAK,CwBvEvB,eAAgB,CACd,KAAK,CxBuEgB,gBAAgB,CwBnErC,kEACU,CACR,KAAK,CxBiEc,gBAAgB,CwB7DvC,8CAA+C,CAC7C,KAAK,CxB4DgB,gBAAgB,CwB3DrC,MAAM,CAAE,OAAO,CACf,WAAW,CAAE,IAAI,CAGnB,iBAAkB,CAChB,KAAK,CxB8EiB,eAAc,CwB3EtC,2FAE6B,CAC3B,KAAK,CxBwEiB,eAAc,CwBvEpC,gBAAgB,CAAE,WAAW,CAK3B,2CAAS,CACP,gBAAgB,CAAE,WAAW,CAG/B,0CAAQ,CACN,gBAAgB,CxByDA,gBAAe,CwBtDjC,6CAAW,CACT,gBAAgB,CxBsDA,gBAAe,CwBhDrC,yBAA0B,CACxB,WAAW,CAAE,IAAI,CACjB,KAAK,CAAE,GAAG,CACV,KAAK,CAAE,iBAAiB,CAG1B,eAAgB,CAAE,WAAW,CAAE,IAAI,CAIjC,uBAAI,CACF,MAAM,CAAE,IAA0B,CAClC,KAAK,CAAE,IAA0B,CACjC,MAAM,CAAE,QAAQ,CAChB,KAAK,CAAE,KAAK,CAKhB,4BAA6B,CAC3B,UAAU,CAAE,cAAkC,CAE9C,0CAAkB,CAChB,KAAK,CAAE,eAAiB,CAG1B,iCAAS,CACP,KAAK,CAAE,eAAiB,CAG1B,iDAAuB,CACrB,YAAY,CAAE,IAAI,CChLtB,WAAY,CACV,QAAQ,CAAE,QAAQ,CAElB,8BAAmB,CACjB,QAAQ,CAAE,MAAM,CAChB,YAAY,CAAE,IAAI,CAGpB,2BAAgB,CAAE,KAAK,CAAE,IAAI,CAE7B,uCAAK,CACH,KAAK,CAAE,IAAI,CACX,MAAM,CzBmJK,IAAI,CyBlJf,WAAW,CzBkJA,IAAI,CyB/IjB,gBAAK,CACH,MAAM,CAAE,OAAO,CAGjB,4BAAiB,CAOf,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,KAAK,CAAE,CAAC,CACR,IAAI,CAAE,CAAC,CACP,MAAM,CAAE,CAAC,CACT,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,CAAC,CACT,OAAO,CAAE,CAAC,CACV,SAAS,CAAE,IAAI,CACf,MAAM,CAAE,OAAO,CACf,OAAO,CAAE,CAAC,CACV,MAAM,CAAE,gBAAgB,CAfxB,wDAA8B,CAC5B,OAAO,CAAE,IAAI,CCxBnB,YAAa,CACX,QAAQ,CAAE,QAAQ,CAGpB,0CAC2B,CAEzB,MAAM,CAAE,OAAO,CAGjB,iBAAkB,CAChB,QAAQ,CAAE,QAAQ,CAClB,gBAAgB,CAAE,WAAW,CAC7B,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,IAAI,CACb,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,MAAM,CACd,OAAO,CAAE,CAAC,CAEV,uBAAQ,CACN,OAAO,CAAE,IAAI,CAIjB,wBAA2B,CACzB,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,IAAI,CACT,IAAI,CAAE,CAAC,CACP,MAAM,CAAE,IAAI,CACZ,MAAM,CAAE,CAAC,CACT,KAAK,CAAE,CAAC,CACR,aAAa,CAAE,GAAG,CAClB,gBAAgB,C1B6TG,OAAgB,C0B5TnC,WAAW,CAAE,GAAG,CAEhB,gBAAgB,CAAE,OAAO,CACzB,SAAS,CAAE,cAAc,CAEzB,+BAAO,CACL,OAAO,CAAE,KAAK,CACd,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,MAAM,CAClB,KAAK,C1BmTY,OAAgB,C0BlTjC,SAAS,CAAE,CAAC,CACZ,SAAS,CAAE,aAAa,CAG1B,+BAAS,CACP,aAAa,CAAE,aAAa,CAE5B,sCAAO,CACL,KAAK,C1B+GQ,IAAI,C0B9GjB,WAAW,CAAE,IAAI,CACjB,UAAU,CAAE,GAAG,CACf,SAAS,CAAE,IAAI,CAMrB,iBAAkB,CAChB,kBAAkB,CAAE,IAAI,CAG1B,gDAAiD,CAC/C,MAAM,C1ByHO,GAAG,C0BxHhB,UAAU,CAAE,OAAO,CACnB,MAAM,CAAE,IAAI,CAGd,uCAAwC,CACtC,kBAAkB,CAAE,IAAI,CACxB,MAAM,CAAE,IAAI,CACZ,MAAM,C1B+GO,IAAI,C0B9GjB,KAAK,C1B+GO,IAAI,C0B9GhB,aAAa,CAAE,GAAG,CAClB,gBAAgB,C1BiRG,OAAgB,C0BhRnC,gBAAgB,CAAE,OAAO,CACzB,MAAM,CAAE,UAAU,CAClB,UAAU,CAAE,GAAG,CAGjB,sDAAuD,CACrD,UAAU,CAAE,IAAI,CAIlB,iBAAkB,CAEhB,MAAM,CAAE,eAAe,CAKzB,mCAAoC,CAClC,MAAM,C1B2FO,GAAG,C0B1FhB,UAAU,CAAE,IAAI,CAChB,MAAM,CAAE,IAAI,CAGd,mCAAoC,CAClC,MAAM,CAAE,IAAI,CACZ,MAAM,C1BkFO,IAAI,C0BjFjB,KAAK,C1BkFO,IAAI,C0BjFhB,aAAa,CAAE,GAAG,CAClB,UAAU,C1BoPS,OAAgB,C0BnPnC,UAAU,CAAE,IAAI,CAIlB,gCAAiC,CAC/B,OAAO,CAAE,cAAc,CACvB,cAAc,CAAE,IAAI,CAGtB,yCAA0C,CACxC,UAAU,CAAE,IAAI,CAIlB,4BAA6B,CAC3B,MAAM,C1BiEO,GAAG,C0B9DhB,UAAU,CAAE,WAAW,CAGvB,YAAY,CAAE,WAAW,CACzB,YAAY,CAAE,KAAK,CAGnB,KAAK,CAAE,WAAW,CAGpB,iCAAkC,CAChC,UAAU,CAAE,IAAI,CAGlB,iCAAkC,CAChC,UAAU,CAAE,IAAI,CAGlB,4BAA6B,CAC3B,MAAM,CAAE,IAAI,CACZ,MAAM,C1BwCO,IAAI,C0BvCjB,KAAK,C1BwCO,IAAI,C0BvChB,aAAa,CAAE,GAAG,CAClB,UAAU,C1B0MS,OAAgB,C0BvMrC,uCAAwC,CACtC,UAAU,CAAE,IAAI,CAGlB,uCAAwC,CACtC,UAAU,CAAE,IAAI,CC1JhB,wBAAQ,CACJ,QAAQ,CAAE,KAAK,CAGnB,qBAAG,CACD,OAAO,CAAE,KAAK,CAEhB,oBAAE,CACA,OAAO,CAAE,YAAY,CACrB,WAAW,CAAE,GAAG,CAChB,KAAK,CAAE,OAAO,CACd,YAAY,CAAE,IAAI,CAClB,MAAM,CAAE,MAAM,CACd,WAAW,CAAE,MAAM,CACnB,cAAc,CAAE,EAAE,CAClB,OAAO,CAAE,YAAY,CAErB,0BAAQ,CACN,KAAK,CAAE,OAAqB,CAC5B,YAAY,CAAE,IAAI,CAClB,WAAW,CAAE,iBAAwB,CAEvC,2BAAS,CACP,WAAW,CAAE,GAAG,CAChB,YAAY,CAAE,IAAI,CAClB,WAAW,CAAE,iBAAwB,CC7B3C,SAAU,CACR,QAAQ,CAAE,KAAK,CACf,KAAK,CAAE,KAAK,CACZ,IAAI,CAAE,CAAC,CACP,GAAG,CAAE,CAAC,CACN,MAAM,CAAE,CAAC,CACT,SAAS,CAAE,iBAAiB,CAC5B,MAAM,CAAE,IAAI,CACZ,MAAM,CAAE,iBAAiB,CACzB,MAAM,CAAE,eAAe,CACvB,cAAc,CAAE,IAAI,CACpB,gBAAgB,C5B4PC,IAAI,C4B3PrB,OAAO,CAAE,GAAG,CACZ,UAAU,CAAE,IAAI,CAChB,WAAW,CAAE,SAAS,CACtB,mBAAmB,CAAE,MAAM,CAC3B,SAAS,CAAE,iBAAiB,CAK5B,uBAAgB,CACd,KAAK,CAAE,CAAC,CACR,SAAS,CAAE,gBAAgB,CAC3B,IAAI,CAAE,IAAI,CACV,SAAS,CAAE,gBAAgB,CAG7B,sBAAa,CACX,MAAM,CAAE,CAAC,CAIX,YAAG,CACD,KAAK,CAAE,IAAI,CACX,WAAW,C5BuOO,IAAoB,C4BrOtC,mBAAS,CAAE,gBAAgB,CAAE,gBAAe,CAG9C,cAAO,CACL,KAAK,C5B6NY,gBAAe,C4B5NhC,OAAO,CAAE,KAAK,CACd,SAAS,C5B0NO,IAAI,C4BzNpB,WAAW,CAAE,GAAG,CAChB,MAAM,C5B4NY,IAAI,C4B3NtB,WAAW,C5B4NO,IAAoB,C4B3NtC,OAAO,CAAE,MAAwB,CAEjC,oBAAQ,CAAE,gBAAgB,CAAE,gBAAe,CAE3C,wHAA+C,CAC7C,MAAM,CAAE,SAAS,CAGnB,gGAEe,CAAE,KAAK,C5BgBJ,IAAI,C4BftB,uBAAW,CAAE,KAAK,C5BsBF,OAAO,C4BpBvB,sFACkB,CAAE,gBAAgB,CAAE,OAAsC,CAC5E,iCAAqB,CAAE,gBAAgB,C5BkStB,OAAgB,C4BhSjC,mHAEqB,CACnB,KAAK,CAAE,IAAI,CACX,MAAM,C5BqMU,IAAI,C4BpMpB,WAAW,C5BqMK,IAAoB,C4BpMpC,MAAM,CAAE,UAA4B,CACpC,KAAK,CAAE,IAAwB,CAC/B,KAAK,CAAE,gBAAe,CAK1B,kBAAS,CACP,MAAM,CAAE,SAA4B,CAGtC,oBAAW,CAKT,MAAM,CAAE,OAAO,CACf,cAAc,CAAE,IAAI,CACpB,KAAK,CAAE,gBAAe,CACtB,SAAS,C5B4KO,IAAI,C4B3KpB,WAAW,CAAE,GAAG,CAChB,WAAW,C5B+KO,IAAoB,C4BxLtC,0BAAQ,CACN,gBAAgB,CAAE,WAAW,CAWjC,wCACU,CACR,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,WAA+C,CACxD,aAAa,CAAE,GAAoB,CAEnC,4CAAM,CAEJ,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,CAAC,CAFV,wDAAQ,CAAE,gBAAgB,CAAE,WAAW,CAKzC,gEAAY,CACV,QAAQ,CAAE,MAAM,CAChB,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,CAAC,CACT,IAAI,CAAE,CAAC,CACP,OAAO,CAAE,EAAE,CAGb,oKAAuB,CACrB,OAAO,CAAE,KAAK,CAGhB,wDAAQ,CACN,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CAGb,2GACO,CACL,SAAS,C5BsIK,IAAI,C4BrIlB,WAAW,CAAE,IAAwB,CAGvC,oDAAM,CACJ,UAAU,CAAE,IAAI,CAChB,WAAW,CAAE,GAAG,CAGlB,sDAAO,CACL,cAAc,CAAE,IAAI,CACpB,WAAW,CAAE,GAAG,CAOtB,YAAa,CACX,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,QAAQ,CAAE,KAAK,CACf,GAAG,CAAE,CAAC,CACN,OAAO,CAAE,GAAG,CAKd,eAAgB,CACd,IAAI,CAAE,CAAC,CACP,SAAS,CAAE,aAAa,CACxB,QAAQ,CAAE,KAAK,CAGf,6BAAgB,CACd,KAAK,CAAE,CAAC,CACR,IAAI,CAAE,IAAI,CAKd,yBAA2B,CAEvB,eAAQ,CACN,SAAS,CAAE,iBAAiB,CAE5B,6BAAgB,CACd,SAAS,CAAE,gBAAgB,CAI/B,WAAE,CACA,OAAO,CAAE,MAAkB,CAG7B,wCACU,CACR,OAAO,CAAE,WAAmC,EAMlD,2HACqE,CACnE,gBAAgB,C5BoIA,OAAc,C4BnI9B,+HAAE,CACA,KAAK,C5BqEU,IAAI,C4BlEvB,2BAA4B,CAC1B,OAAO,CAAE,CAAC,CAIZ,gBAAiB,CACf,QAAQ,CAAE,KAAK,CACf,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,CAAC,CAER,MAAM,CAAE,KAAK,CACb,gBAAgB,CAAE,eAAc,CAChC,OAAO,CAAE,GAAG,CAEZ,WAAW,CAAE,OAAO,CCvLtB,kBAAmB,CACjB,OAAO,CAAE,YAAY,CACrB,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CAEZ,wBAAQ,CACN,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CAGd,sBAAM,CACJ,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CAGd,yBAAS,CAEP,iBAAiB,CAAE,uCAAuC,CAC1D,SAAS,CAAE,uCAAuC,CAItD,mCAEC,CADC,EAAG,CAAE,iBAAiB,CAAE,cAAe,EAGzC,2BAEC,CADC,EAAG,CAAE,SAAS,CAAE,cAAe,EAGjC,cAAe,CACb,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,CAAC,CACV,YAAY,C7B+RO,OAAgB,C6B5RrC,gCACmB,CACjB,YAAY,CAAE,OAAO,CAGvB,8BACkB,CAChB,YAAY,CAAE,OAAO,CAGvB,oCACqB,CACnB,YAAY,CAAE,OAAO,CAGvB,kCACoB,CAClB,YAAY,CAAE,OAAO,CAgBvB,mCAAoC,CAElC,iBAAiB,CAAE,uIAA4I,CAC/J,SAAS,CAAE,uIAA4I,CAGzJ,kCAAmC,CAEjC,iBAAiB,CAAE,sIAA2I,CAC9J,SAAS,CAAE,sIAA2I,CAGxJ,qCAAsC,CAEpC,iBAAiB,CAAE,yIAA8I,CACjK,SAAS,CAAE,yIAA8I,CAG3J,oCAAqC,CAEnC,iBAAiB,CAAE,wIAA6I,CAChK,SAAS,CAAE,wIAA6I,CAG1J,4LAI0C,CAExC,OAAO,CAAE,CAAC,CACV,iBAAiB,CAAE,oEAAsE,CACzF,SAAS,CAAE,oEAAsE,CAGnF,qCASC,CARC,KAAM,CAAE,iBAAiB,CAAE,cAAc,CACzC,GAAM,CAAE,iBAAiB,CAAE,cAAc,CACzC,KAAM,CAAE,iBAAiB,CAAE,cAAc,CACzC,GAAM,CAAE,iBAAiB,CAAE,cAAc,CACzC,KAAM,CAAE,iBAAiB,CAAE,cAAc,CACzC,GAAM,CAAE,iBAAiB,CAAE,cAAc,CACzC,KAAM,CAAE,iBAAiB,CAAE,cAAc,CACzC,EAAM,CAAE,iBAAiB,CAAE,eAAe,EAG5C,6BASC,CARC,KAAM,CAAE,SAAS,CAAE,cAAc,CACjC,GAAM,CAAE,SAAS,CAAE,cAAc,CACjC,KAAM,CAAE,SAAS,CAAE,cAAc,CACjC,GAAM,CAAE,SAAS,CAAE,cAAc,CACjC,KAAM,CAAE,SAAS,CAAE,cAAc,CACjC,GAAM,CAAE,SAAS,CAAE,cAAc,CACjC,KAAM,CAAE,SAAS,CAAE,cAAc,CACjC,EAAM,CAAE,SAAS,CAAE,eAAe,EAGpC,mCAOC,CANC,IAAK,CAAE,OAAO,CAAE,CAAC,CACjB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,IAAK,CAAE,OAAO,CAAE,CAAC,EAGnB,2BAOC,CANC,IAAK,CAAE,OAAO,CAAE,CAAC,CACjB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,IAAK,CAAE,OAAO,CAAE,CAAC,EAGnB,kCAMC,CALC,IAAK,CAAE,OAAO,CAAE,CAAC,CACjB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,EAGlB,0BAMC,CALC,IAAK,CAAE,OAAO,CAAE,CAAC,CACjB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,EAGlB,qCAMC,CALC,IAAK,CAAE,OAAO,CAAE,CAAC,CACjB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,EAGlB,6BAMC,CALC,IAAK,CAAE,OAAO,CAAE,CAAC,CACjB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,EAGlB,oCAMC,CALC,IAAK,CAAE,OAAO,CAAE,CAAC,CACjB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,IAAK,CAAE,OAAO,CAAE,CAAC,EAGnB,4BAMC,CALC,IAAK,CAAE,OAAO,CAAE,CAAC,CACjB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,IAAK,CAAE,OAAO,CAAE,CAAC,EAOnB,UAAW,CACT,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,GAAG,CACT,KAAK,CAAE,GAAG,CACV,MAAM,CAAE,IAAI,CACZ,QAAQ,CAAE,MAAM,CAChB,YAAY,CAAE,OAAO,CAGvB,kBAAmB,CACjB,KAAK,CAAE,KAAK,CACZ,IAAI,CAAE,KAAK,CAGb,eAAgB,CACd,OAAO,CAAE,YAAY,CACrB,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,GAAG,CACV,MAAM,CAAE,IAAI,CACZ,QAAQ,CAAE,MAAM,CAChB,YAAY,CAAE,OAAO,CAErB,uBAAQ,CACN,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,YAAY,CAAE,GAAG,CACjB,YAAY,CAAE,KAAK,CACnB,YAAY,CAAE,OAAO,CACrB,mBAAmB,CAAE,sBAAsB,CAC3C,aAAa,CAAE,GAAG,CAClB,iBAAiB,CAAE,IAAI,CACvB,SAAS,CAAE,IAAI,CACf,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,CAAC,CAGX,4BAAe,CACb,IAAI,CAAE,CAAC,CACP,kBAAkB,CAAE,sBAAsB,CAC1C,iBAAiB,CAAE,cAAc,CACjC,SAAS,CAAE,cAAc,CAE3B,6BAAgB,CACd,IAAI,CAAE,KAAK,CACX,iBAAiB,CAAE,sBAAsB,CACzC,iBAAiB,CAAE,eAAe,CAClC,SAAS,CAAE,eAAe,CAM9B,oCAAqC,CAEnC,iBAAiB,CAAE,2DAA6D,CAChF,SAAS,CAAE,2DAA6D,CAG1E,qCAAsC,CAEpC,iBAAiB,CAAE,4DAA8D,CACjF,SAAS,CAAE,4DAA8D,CAG3E,4BAIC,CAHC,IAAK,CAAE,iBAAiB,CAAE,cAAc,CACxC,GAAI,CAAE,iBAAiB,CAAE,aAAa,CACtC,EAAG,CAAE,iBAAiB,CAAE,cAAc,EAGxC,oBAIC,CAHC,IAAK,CAAE,SAAS,CAAE,cAAc,CAChC,GAAI,CAAE,SAAS,CAAE,aAAa,CAC9B,EAAG,CAAE,SAAS,CAAE,cAAc,EAGhC,6BAIC,CAHC,IAAK,CAAE,iBAAiB,CAAE,eAAe,CACzC,GAAI,CAAE,iBAAiB,CAAE,YAAY,CACrC,EAAG,CAAE,iBAAiB,CAAE,eAAe,EAGzC,qBAIC,CAHC,IAAK,CAAE,SAAS,CAAE,eAAe,CACjC,GAAI,CAAE,SAAS,CAAE,YAAY,CAC7B,EAAG,CAAE,SAAS,CAAE,eAAe,EAGjC,0BAA2B,CAEzB,iBAAiB,CAAE,mFAAsF,CACzG,SAAS,CAAE,mFAAsF,CAGnG,2BAGC,CAFC,IAAK,CAAE,OAAO,CAAE,CAAC,CACjB,EAAG,CAAE,OAAO,CAAE,CAAC,EAGjB,mBAGC,CAFC,IAAK,CAAE,OAAO,CAAE,CAAC,CACjB,EAAG,CAAE,OAAO,CAAE,CAAC,EC5UjB,OAAQ,CACN,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,KAAK,CACb,KAAK,CAAE,IAAI,CAGX,kBAAa,CACX,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,CAAC,CAET,4BAAU,CACR,MAAM,CAAE,IAAI,CAGd,gCAAc,CACZ,OAAO,CAAE,CAAC,CACV,MAAM,CAAE,IAAI,CAIhB,eAAQ,CACN,gBAAgB,C9BsPF,OAAqB,C8BrPnC,MAAM,CAAE,CAAC,CACT,MAAM,CAAE,KAAK,CAEb,kBAAG,CACD,OAAO,CAAE,CAAC,CACV,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,OAAO,CAAE,CAAC,CACV,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,OAAO,CACf,QAAQ,CAAE,MAAM,CAEhB,sBAAI,CACF,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,eAAe,CAAE,KAAK,CACtB,mBAAmB,CAAE,MAAM,CAG7B,2BAAS,CACP,KAAK,CAAE,IAAI,CACX,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,GAAG,CACR,IAAI,CAAE,GAAG,CACT,KAAK,CAAE,GAAG,CACV,OAAO,CAAE,CAAC,CAEV,6BAAE,CAAE,KAAK,C9B0NO,OAA0B,C8BvN5C,yBAAS,CACP,OAAO,CAAE,CAAC,CAMhB,mBAAY,CACV,QAAQ,CAAE,QAAQ,CAClB,UAAU,CAAE,MAAM,CAClB,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,CAAC,CACT,MAAM,CAAE,CAAC,CAET,mCAAgB,CACd,OAAO,CAAE,YAAY,CACrB,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,OAAO,CACf,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,MAAM,CACd,gBAAgB,C9BiME,OAA0B,C8B/L5C,UAAU,CAAE,oBAAoB,CAChC,aAAa,CAAE,GAAG,CAElB,0CAAS,CACP,gBAAgB,C9B4LC,OAAsB,C+BlR/C,SAAU,CAqCR,QAAQ,CAAE,MAAM,CAChB,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,C/BgEU,KAAK,C+B/DrB,WAAW,CAAE,KAAK,CAClB,eAAe,CAAE,WAAW,CAC5B,gBAAgB,CAAE,MAAM,CA1CxB,yBAAkB,CAChB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CAEP,8CAAqB,CAKnB,QAAQ,CAAE,QAAQ,CAClB,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,CAAC,CARV,8DAAkB,CAChB,MAAM,CAAE,IAAI,CAUhB,wCAAe,CACb,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,UAAU,C/BoFE,KAAK,C+BnFjB,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CAEP,2CAAG,CACD,SAAS,CAAE,IAAI,CACf,WAAW,CAAE,GAAG,CAChB,WAAW,CAAE,IAAI,CAGnB,0CAAE,CACA,SAAS,CAAE,IAAI,CAarB,wBAAe,CACb,OAAO,CAAE,IAAI,CACb,KAAK,C/B2Da,KAAqB,C+B1DvC,MAAM,C/B0DY,KAAqB,C+BzDvC,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CAEP,4BAAQ,CACN,KAAK,CAAE,IAAI,CAIf,qBAAY,CACV,QAAQ,CAAE,QAAQ,CAClB,UAAU,CAAE,MAAM,CAClB,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,CAAC,CACT,MAAM,CAAE,CAAC,CAET,qCAAgB,CAKd,OAAO,CAAE,YAAY,CACrB,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,OAAO,CACf,MAAM,CAAE,GAAG,CACX,KAAK,CAAE,GAAG,CACV,MAAM,CAAE,QAAQ,CAChB,gBAAgB,CAAE,qBAAoB,CAEtC,UAAU,CAAE,oBAAoB,CAChC,aAAa,CAAE,GAAG,CAblB,4CAAS,CACP,gBAAgB,CAAE,IAAI,CAiB5B,sGAC2C,CACzC,cAAc,CAAE,IAAI,CCvFxB,mBAAoB,CAClB,KAAK,CAAE,KAAK,CACZ,MAAM,CAAE,KAAK,CACb,QAAQ,CAAE,KAAK,CACf,OAAO,CAAE,IAAI,CACb,UAAU,CAAE,MAAM,CAClB,UAAU,CAAE,iBAAiB,CAG/B,wBAAyB,CACvB,UAAU,CAAE,OAAO,CACnB,UAAU,CAAE,aAAa,CAEzB,oCAAY,CACV,SAAS,CAAE,QAAQ,CACnB,OAAO,CAAE,GAAG,CACZ,UAAU,CACR,yFACqC,CAGzC,iDAAyB,CACvB,SAAS,CAAE,QAAQ,CAErB,gDAAwB,CACtB,UAAU,CAAE,OAAO,CACnB,SAAS,CAAE,0DAA0D,CACrE,UAAU,CACR,4CAEgB,CAItB,WAAY,CACV,QAAQ,CAAE,QAAQ,CAClB,SAAS,CAAE,IAAI,CACf,aAAa,CAAE,GAAG,CAClB,gBAAgB,ChC8RA,OAAc,CgC7R9B,UAAU,CAAE,+FAAiG,CAC7G,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,CAAC,CACV,SAAS,CAAE,QAAQ,CACnB,UAAU,CACR,yFACqC,CAGzC,mBAAoB,CAClB,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,UAAU,CAGrB,gBAAiB,CAwBf,QAAQ,CAAE,QAAQ,CAClB,aAAa,CAAE,GAAG,CAClB,OAAO,CAAE,KAAK,CAzBd,gDACS,CACP,OAAO,CAAE,EAAE,CACX,OAAO,CAAE,KAAK,CACd,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,aAAa,CAAE,GAAG,CAClB,gBAAgB,CAAE,OAAO,CAE3B,wBAAU,CACR,SAAS,CAAE,QAAQ,CACnB,UAAU,CAAE,aAAa,CAE3B,uBAAS,CACP,UAAU,CAAE,MAAM,CAClB,UAAU,CACR,yCAEa,CACf,OAAO,CAAE,EAAE,CAQf,kBAAmB,CAMjB,GAAG,CAAE,GAAG,CACR,IAAI,CAAE,GAAG,CACT,SAAS,CAAE,qBAAoB,CAE/B,OAAO,CAAE,KAAK,CACd,QAAQ,CAAE,mBAAmB,CAV7B,+FACkB,CAChB,UAAU,CAAE,IAAI,CAWpB,yCAA0C,CACxC,+BAAiC,CAC/B,KAAK,CAAE,KAAK,CACZ,MAAM,CAAE,KAAK,ECpGjB,MAAO,CAgBL,QAAQ,CAAE,OAAO,CACjB,QAAQ,CAAE,QAAQ,CAhBlB,cAAU,CACR,OAAO,CAAE,EAAE,CACX,OAAO,CAAE,KAAK,CACd,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,gBAAgB,CAAE,OAAO,CACzB,aAAa,CAAE,OAAO,CACtB,UAAU,CAAE,0BAA0B,CACtC,SAAS,CAAE,0DAA0D,CACrE,OAAO,CAAE,EAAE,CAOf,0BAaC,CAZC,EAAG,CACD,OAAO,CAAE,CAAC,CACV,SAAS,CAAE,QAAQ,CAErB,GAAI,CACF,OAAO,CAAE,CAAC,CACV,SAAS,CAAE,UAAU,CAEvB,IAAK,CACH,OAAO,CAAE,CAAC,CACV,SAAS,CAAE,UAAU,ECzBzB,OAAQ,CACN,SAAS,CAAE,IAAI,CACf,UAAU,CAAE,IAAI,CAChB,WAAW,CAAE,GAAG,CAChB,KAAK,CAAE,OAAO,CACd,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,KAAK,CACd,mBAAmB,CAAE,IAAI,CACzB,gBAAgB,CAAE,IAAI,CACtB,eAAe,CAAE,IAAI,CACrB,WAAW,CAAE,IAAI,CACjB,OAAO,CAAE,IAAI,CAKf,cAAe,CACb,MAAM,CAAE,OAAO,CAKjB,oCAAqC,CACnC,YAAY,CAAE,OAAO,CAKvB,eAAgB,CACd,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,IAAI,CAChB,0BAA0B,CAAE,KAAK,CAGnC;;;GAGG,AAOH,8BACe,CACb,MAAM,CAAE,CAAC,CACT,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,CAAC,CACR,GAAG,CAAE,IAAI,CAKX,eAAgB,CACd,QAAQ,CAAE,KAAK,CACf,kBAAkB,CAAE,uCAAuC,CAC3D,eAAe,CAAE,uCAAuC,CACxD,UAAU,CAAE,uCAAuC,CACnD,2BAA2B,CAAE,MAAM,CAKrC,cAAe,CACb,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,MAAM,CACd,SAAS,CAAE,KAAK,CAGhB,KAAK,CAAE,KAAK,CACZ,UAAU,CAAE,KAAK,CAEjB,UAAU,CAAE,oDAAoD,CAChE,MAAM,CAAE,gBAAgB,CACxB,YAAY,CAAE,CAAC,CACf,OAAO,CAAE,CAAC,CACV,kBAAkB,CAAE,kBAAkB,CACtC,eAAe,CAAE,kBAAkB,CACnC,UAAU,CAAE,kBAAkB,CAEhC,6BAA8B,CAC5B,cAAe,CACb,QAAQ,CAAE,OAAO,CACjB,GAAG,CAAE,IAAI,CACT,MAAM,CAAE,KAAK,CACb,UAAU,CAAE,GAAG,EAGnB,6BAA8B,CAC5B,cAAe,CACb,aAAa,CAAE,IAAI,EAMvB,aAAc,CACZ,OAAO,CAAE,KAAK,CACd,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CAEd,6BAA8B,CAC5B,aAAc,CACZ,OAAO,CAAE,KAAK,EAMlB,YAAa,CACX,UAAU,CAAE,OAAO,CACnB,OAAO,CAAE,UAAU,CACnB,cAAc,CAAE,MAAM,CAOxB,6BAA8B,CAC5B,YAAa,CACX,OAAO,CAAE,KAAK,CAKd,MAAM,CAAE,iBAAiB,CACzB,gBAAgB,CAAE,OAAO,CACzB,mBAAmB,CAAE,CAAC,CACtB,qBAAqB,CAAE,WAAW,CAClC,kBAAkB,CAAE,WAAW,CAC/B,aAAa,CAAE,WAAW,CAC1B,kBAAkB,CAAE,iCAAoC,CACxD,eAAe,CAAE,iCAAoC,CACrD,UAAU,CAAE,iCAAoC,EAepD,+BAAgC,CAC9B,GAAG,CAAE,CAAC,CACN,UAAU,CAAE,WAAW,CACvB,UAAU,CAAE,2FAA2F,CACvG,IAAI,CAAE,CAAC,CACP,UAAU,CAAE,gBAAmB,CAC/B,kBAAkB,CAAE,yBAAyB,CAC7C,eAAe,CAAE,yBAAyB,CAC1C,UAAU,CAAE,yBAAyB,CAEvC,8BAA+B,CAC7B,GAAG,CAAE,CAAC,CACN,UAAU,CAAE,sDAAsD,CAClE,MAAM,CAAE,kBAAkB,CAC1B,YAAY,CAAE,CAAC,CACf,OAAO,CAAE,CAAC,CAEZ,6BAA8B,CAC5B,8BAA+B,CAC7B,GAAG,CAAE,GAAG,CACR,MAAM,CAAE,IAAI,EAWhB,oCAAqC,CACnC,YAAY,CrC/EE,OAAO,CqCkFvB,cAAe,CACb,MAAM,CAAE,MAAM,CACd,SAAS,CAAE,KAAK,CAGlB,6BAA8B,CAC5B,8BAA+B,CAC7B,GAAG,CAAE,GAAG,CACR,MAAM,CAAE,IAAI,EAIhB,yCAA0C,CACzC,YAAa,CACZ,OAAO,CAAC,IAAI,CAEb,cAAe,CACd,KAAK,CAAE,GAAG,CACV,SAAS,CAAC,KAAK,EC3MjB,YAAa,CACX,OAAO,CAAE,CAAC,CACV,aAAa,CAAE,GAAG,CAClB,QAAQ,CAAE,MAAM,CAKlB,eAAgB,CACd,UAAU,CAAE,MAAM,CAClB,QAAQ,CAAE,QAAQ,CAClB,UAAU,CAAE,KAAK,CAKnB,4BACc,CAEZ,OAAO,CAAE,YAAY,CACrB,WAAW,CAAE,KAAK,CAClB,YAAY,CAAE,KAAK,CAKrB,4CACsB,CAEpB,MAAM,CAAE,GAAG,CACX,OAAO,CAAE,CAAC,CACV,WAAW,CAAE,KAAK,CAClB,YAAY,CAAE,KAAK,CAIrB,sCAAuC,CACrC,OAAO,CAAE,MAAM,CACf,gBAAgB,CAAE,OAAO,CACzB,KAAK,CAAE,GAAG,CAEZ,qCAAsC,CACpC,OAAO,CAAE,MAAM,CACf,gBAAgB,CAAE,OAAO,CACzB,KAAK,CAAE,GAAG,CAEZ,wDAC4B,CAC1B,YAAY,CnCiFK,gBAAgB,CmC5EnC,qCACmB,CACjB,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,WAAW,CACpB,KAAK,CAAE,GAAG,CACV,MAAM,CAAE,GAAG,CACX,UAAU,CAAE,WAAW,CACvB,GAAG,CAAE,OAAO,CAQd,kBAAmB,CACjB,IAAI,CAAE,IAAI,CACV,aAAa,CAAE,MAAM,CAOvB,kBAAmB,CACjB,KAAK,CAAE,IAAI,CACX,YAAY,CAAE,MAAM,CAQtB,qHAGoC,CAClC,MAAM,CAAE,OAAO,CACf,UAAU,CAAE,IAAI,CAChB,kBAAkB,CAAE,OAAO,CAC3B,iBAAiB,CAAE,OAAO,CAK5B,cAAe,CACb,UAAU,CAAE,MAAM,CAClB,eAAe,CAAE,QAAQ,CACzB,cAAc,CAAE,CAAC,CACjB,YAAY,CAAE,KAAK,CACnB,SAAS,CAAE,IAAI,CACf,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,KAAK,CACjB,aAAa,CAAE,IAAI,CAKrB,mCAAqC,CACnC,UAAU,CAAE,MAAM,CAQpB,iBAAkB,CAChB,MAAM,CAAE,CAAC,CACT,OAAO,CAAE,CAAC,CAKZ,gBAAiB,CACf,KAAK,CAAE,aAAa,CACpB,SAAS,CAAE,KAAK,CAChB,cAAc,CAAE,KAAK,CACrB,KAAK,CAAE,OAAO,CACd,WAAW,CAAE,GAAG,CAGlB,6BAA8B,CAC5B,gBAAiB,CACf,cAAc,CAAE,IAAI,EAOxB,mBAAoB,CAClB,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,OAAO,CACd,cAAc,CAAE,GAAG,CACnB,OAAO,CAAE,QAAQ,CACjB,WAAW,CAAE,GAAG,CAChB,MAAM,CAAE,qBAAqB,CAc/B,6BAA8B,CAC5B,gBAAgB,CAAE,OAAO,CAI3B,2BAA2B,CACzB,MAAM,CAAE,OAAO,CACf,KAAK,CAAE,IAAI,CACX,WAAW,CAAE,GAAG,CAGlB,sBAAuB,CACrB,OAAO,CAAE,IAAI,CACb,OAAO,CAAE,QAAQ,CACjB,KAAK,CAAE,IAAI,CAGb,4BAA6B,CAC3B,MAAM,CAAE,OAAO,CACf,KAAK,CAAE,OAAO,CAEd,WAAW,CAAE,GAAG,CAOlB,0EAC2C,CACzC,MAAM,CAAE,OAAO,CAKjB,2FAEwC,CAIrC,aAAa,CAAE,GAAG,CACnB,SAAS,CAAE,WAAU,CACrB,UAAU,CAAE,OAAO,CACnB,KAAK,CAAE,OAAO,CAEhB,2FAEwC,CACtC,UAAU,CAAE,OAAO,CACnB,YAAY,CAAE,OAAO,CACrB,KAAK,CAAE,OAAO,CACd,MAAM,CAAE,OAAO,CAEjB,qGACsD,CACpD,UAAU,CAAE,OAAO,CAKrB,eAAgB,CACd,UAAU,CAAE,KAAK,CAEnB,oEAEuB,CACrB,MAAM,CAAE,iBAAiB,CACzB,UAAU,CAAE,OAAO,CACnB,SAAS,CAAE,IAAI,CACf,OAAO,CAAE,OAAO,CAChB,WAAW,CAAE,IAAI,CACjB,KAAK,CAAE,GAAG,CACV,OAAO,CAAE,YAAY,CACrB,cAAc,CAAE,MAAM,CAExB,sFAE6B,CAC3B,MAAM,CAAE,OAAO,CACf,KAAK,CAAE,OAAO,CACd,UAAU,CAAE,OAAO,CACnB,mBAAmB,CAAE,OAAO,CAE9B,sFAE6B,CAC3B,UAAU,CAAE,OAAO,CACnB,YAAY,CnC5HK,gBAAgB,CmC6HjC,OAAO,CAAE,IAAI,CAEf,yFAE8B,CAC5B,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,YAAY,CACrB,MAAM,CAAE,CAAC,CAEX,2DAC8B,CAC5B,OAAO,CAAE,GAAG,CACZ,YAAY,CAAE,KAAK,CAErB,6BAA8B,CAC5B,GAAG,CAAE,OAAO,CACZ,KAAK,CAAE,CAAC,CACR,UAAU,CAAE,oBAAoB,CAChC,WAAW,CAAE,uBAAuB,CAEtC,6BAA8B,CAC5B,GAAG,CAAE,OAAO,CACZ,KAAK,CAAE,KAAK,CACZ,UAAU,CAAE,iBAAiB,CAE/B,6BAA8B,CAC5B,OAAO,CAAE,KAAK,CACd,GAAG,CAAE,MAAM,CACX,cAAc,CAAE,GAAG,CACnB,SAAS,CAAE,KAAK,CAChB,YAAY,CAAE,KAAK,CACnB,KAAK,CAAE,OAAO,CAEhB,uEACuC,CACrC,UAAU,CAAE,OAAO,CACnB,YAAY,CAAE,OAAO,CACrB,KAAK,CAAE,OAAO,CACd,MAAM,CAAE,OAAO,CAEjB,uCAAwC,CACtC,gBAAgB,CAAE,OAAO,CAW3B,qBAAsB,CACpB,UAAU,CAAE,IAAI,CAChB,gBAAgB,CnCsCG,OAAgB,CmCrCnC,KAAK,CAAE,IAAI,CACX,OAAO,CAAE,IAAI,CACb,WAAW,CAAE,GAAG,CAGlB,yCAA0C,CACzC,qBAAsB,CACrB,IAAI,CAAC,CAAC,CAEP,wBAAyB,CACxB,OAAO,CAAC,KAAK,CAEd,2BAA4B,CAC3B,IAAI,CAAC,CAAC,EAIR,iDACyB,CACvB,MAAM,CAAE,OAAO,CACf,KAAK,CAAE,OAAO,CACd,UAAU,CnCvMmB,OAA+C,CmC0M9E,wBAAyB,CACvB,WAAW,CAAE,GAAG,CAChB,SAAS,CnCnNoB,MAAM,CmCoNnC,YAAY,CAAE,GAAG,CACjB,UAAU,CAAE,GAAG,CAGjB,sBAAuB,CAErB,SAAS,CnC1NoB,MAAM,CmC2NnC,WAAW,CAAE,GAAG,CAElB,oBAAqB,CACnB,SAAS,CnC9NoB,MAAM,CmC+NnC,WAAW,CAAE,GAAG,CAChB,YAAY,CAAE,GAAG,CAEnB,qBAAsB,CACpB,SAAS,CAAE,MAAM,CACjB,WAAW,CAAE,GAAG,CAChB,KAAK,CnCjOW,qBAAuB,CmCuOzC,2BAA4B,CAC1B,OAAO,CAAE,MAAM,CAEf,iCAAM,CACJ,MAAM,CAAE,IAAI,CAKhB,cAAe,CACb,UAAU,CAAE,CAAC,CACb,aAAa,CAAE,IAAI,CAGrB,qBAAsB,CACpB,KAAK,CnCzPoB,gBAAkB,CmC0P3C,cAAc,CAAE,KAAK,CACrB,OAAO,CAAE,SAAS,CAClB,WAAW,CAAE,GAAG,CAChB,MAAM,CAAE,qBAAqB,CAE/B,yCAA0C,CACzC,qBAAsB,CACrB,OAAO,CAAE,QAAQ,EAMnB,+BAAgC,CAC9B,KAAK,CnC3Cc,OAAgB,CmC8CrC,qDAAsD,CACpD,KAAK,CAAE,IAAI,CAIb,gBAAiB,CACf,SAAS,CAAE,KAAK,CAIlB,2FAEwC,CAEtC,aAAa,CAAE,GAAG,CAClB,SAAS,CAAE,UAAS,CACpB,gBAAgB,CnC9DG,OAAgB,CmCkEnC,KAAK,CAAE,OAAO,CAHd,6JAAwB,CACtB,gBAAgB,CnCvRW,OAA+C,CmC4R9E,eAAgB,CACd,UAAU,CAAE,KAAK,CACjB,OAAO,CAAE,QAAQ,CAInB,4CAA+C,CAC7C,SAAS,CAAE,MAAM,CACjB,OAAO,CAAE,MAAM,CACf,KAAK,CnC9Ec,OAAgB,CmCgFrC,cAAe,CACd,KAAK,CAAC,OAAO,CACb,KAAK,CAAC,IAAI,CAIX,mDAC0B,CACxB,OAAO,CAAE,GAAG,CACZ,UAAU,CAAE,sBAAsB,CAClC,aAAa,CAAE,sBAAsB,CACrC,YAAY,CAAE,oBAAoB,CAClC,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,CAAC,CACT,OAAO,CAAE,KAAK,CACd,MAAM,CAAE,MAAM,CAEhB,yBAA0B,CACxB,YAAY,CAAE,CAAC,CACf,WAAW,CAAE,oBAAoB,CAEnC,gFAAmF,CACjF,gBAAgB,CnC7Ta,OAA+C,CoCnI9E,aAAc,CACZ,UAAU,CAAE,IAAI,CAChB,OAAO,CAAE,cAAc,CACvB,MAAM,CAAE,CAAC,CAKX,kBAAmB,CACjB,aAAa,CAAE,cAAc,CAC7B,UAAU,CAAE,cAAc,CAC1B,aAAa,CAAE,IAAI,CACnB,QAAQ,CAAE,QAAQ,CAClB,UAAU,CAAE,IAAI,CAChB,OAAO,CAAE,YAAY,CAEvB,4BAA6B,CAC3B,kBAAmB,CACjB,OAAO,CAAE,QAAQ,EAIrB,wBAAyB,CACvB,MAAM,CAAE,OAAO,CACf,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,OAAO,CACnB,YAAY,CAAE,OAAO,CACrB,OAAO,CAAE,EAAE,CAGb,+BAAgC,CAC9B,YAAY,CAAE,OAAO,CACrB,OAAO,CAAE,EAAE,CAEb,sFACiD,CAC/C,MAAM,CAAE,OAAO,CACf,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,OAAO,CAGrB,6GAE8C,CAC5C,UAAU,CAAE,OAAO,CACnB,KAAK,CAAE,IAAI,CACX,OAAO,CAAE,EAAE,CAGb,6GAE8C,CAC5C,UAAU,CAAE,OAAO,CACnB,YAAY,CAAE,OAAO,CACrB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,OAAO,CACf,YAAY,CAAE,IAAI,CAClB,OAAO,CAAE,IAAI,CAKf,oCAAqC,CACnC,OAAO,CAAE,KAAK,CACd,KAAK,CAAE,GAAG,CACV,MAAM,CAAE,UAAU,CAClB,OAAO,CAAE,UAAU,CACnB,UAAU,CAAE,IAAI,CAChB,MAAM,CAAE,CAAC,CACT,WAAW,CAAE,GAAG,CAChB,SAAS,CAAE,KAAK,CAChB,UAAU,CAAE,MAAM,CAClB,cAAc,CAAE,SAAS,CACzB,KAAK,CpC4DkB,gBAAkB,CoC1D3C,qFAC2C,CACzC,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,OAAO,CACnB,UAAU,CAAE,OAAO,CACnB,YAAY,CAAE,OAAO,CACrB,MAAM,CAAE,OAAO,CACf,KAAK,CAAE,IAAI,CACX,OAAO,CAAE,IAAI,CAEf,2CAA4C,CAC1C,GAAG,CAAE,OAAO,CACZ,KAAK,CpC8CkB,gBAAkB,CoC7CzC,SAAS,CAAE,MAAM,CACjB,WAAW,CAAE,IAAI,CAEnB,mGACkD,CAChD,KAAK,CAAE,IAAI,CASb,4BAA6B,CAC3B,SAAS,CAAE,KAAK,CAChB,SAAS,CAAE,KAAK,CAKlB,0BAA2B,CACzB,SAAS,CAAE,GAAG,CACd,UAAU,CAAE,OAAO,CACnB,OAAO,CAAE,CAAC,CAEZ,6BAA8B,CAC5B,0BAA2B,CACzB,aAAa,CAAE,GAAG,EAOtB,oBAAqB,CACpB,SAAS,CAAE,IAAI,CACf,WAAW,CAAE,IAAI,CACjB,UAAU,CAAE,MAAM,CAClB,KAAK,CAAE,qBAAwB,CAC9B,WAAW,CAAE,GAAG,CACjB,KAAK,CAAE,IAAI,CACX,QAAQ,CAAE,QAAQ,CAGnB,uBAAwB,CACtB,SAAS,CAAE,MAAM,CACjB,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,MAAM,CACd,WAAW,CAAE,IAAI,CACjB,WAAW,CAAE,GAAG,CAElB,yCAA0C,CACzC,oBAAqB,CACpB,GAAG,CAAE,GAAG,CAET,uBAAwB,CACtB,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,MAAM,CAClB,UAAU,CAAE,MAAM,EAKrB,aAAa,CACZ,KAAK,CAAE,IACR,CACA,uBAAwB,CACtB,YAAY,CAAE,GAAG,CAEnB,yBAA0B,CACxB,WAAW,CAAE,GAAG,CAGlB,6EAE4B,CAC3B,MAAM,CAAE,OAAO,CAEhB,mBAAoB,CACnB,MAAM,CAAE,IAAI,CAEb,kBAAmB,CAClB,gBAAgB,CpCxCW,IAAI,CoCyC/B,aAAa,CAAE,GAAG,CAClB,KAAK,CAAE,KAAK,CACZ,MAAM,CAAE,KAAK,CACb,QAAQ,CAAE,OAAO,CACjB,QAAQ,CAAE,QAAQ,CACjB,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,IAAI,CAChB,aAAa,CAAE,GAAG,CACnB,WAAW,CAAE,IAAI,CAElB,qCACkB,CACjB,KAAK,CAAE,KAAK,CACZ,MAAM,CAAE,KAAK,CACb,QAAQ,CAAE,QAAQ,CAClB,IAAI,CAAE,IAAI,CACV,GAAG,CAAE,IAAI,CAEV,oBAAqB,CACpB,UAAU,CAAE,MAAM,CAEnB,iBAAkB,CACjB,aAAa,CAAE,GAAG,CAClB,KAAK,CpCjEmB,gBAAkB,CoCkE1C,WAAW,CAAE,IAAI,CACjB,UAAU,CAAE,MAAM,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,OAAO,CAEhB,gDACwB,CACvB,gBAAgB,CAAE,qBAAqC,CAExD,iBAAkB,CACjB,kBAAkB,CAAE,sCAAsC,CAC1D,eAAe,CAAE,mCAAmC,CACpD,cAAc,CAAE,kCAAkC,CAClD,aAAa,CAAE,iCAAiC,CAChD,UAAU,CAAE,8BAA8B,CAE3C,qBAAsB,CACrB,OAAO,CAAE,CAAC,CAEX,uCAAwC,CACvC,iBAAiB,CAAE,eAAe,CAClC,cAAc,CAAE,eAAe,CAC/B,aAAa,CAAE,eAAe,CAC9B,YAAY,CAAE,eAAe,CAC7B,SAAS,CAAE,eAAe,CAE3B,yCAA0C,CACzC,iBAAiB,CAAE,eAAa,CAChC,cAAc,CAAE,eAAa,CAC7B,aAAa,CAAE,eAAa,CAC5B,YAAY,CAAE,eAAa,CAC3B,SAAS,CAAE,eAAa,CAEzB,mBAAoB,CACnB,kBAAkB,CAAE,aAAa,CACjC,eAAe,CAAE,aAAa,CAC9B,cAAc,CAAE,aAAa,CAC7B,aAAa,CAAE,aAAa,CAC5B,UAAU,CAAE,aAAa,CAE1B,uBAAwB,CACvB,OAAO,CAAE,IAAI,CAEd,2BAA4B,CAC3B,MAAM,CAAE,IAAI,CACZ,IAAI,CpCoGgB,OAAgB,CoClGrC,sBAAuB,CACtB,MAAM,CAAE,IAAI,CACZ,IAAI,CpCgGgB,OAAgB,CoC9FrC,4BAA6B,CAC5B,IAAI,CpC6FgB,OAAgB,CoC3FrC,wBAAyB,CACxB,MAAM,CpC0Fc,OAAgB,CoCzFpC,YAAY,CAAE,CAAC,CACf,cAAc,CAAE,KAAK", +"sources": ["../sass/components/_color.scss","../sass/components/_normalize.scss","../sass/components/_global.scss","../sass/components/_variables.scss","../sass/components/_badges.scss","../sass/components/_icons-material-design.scss","../sass/components/_grid.scss","../sass/components/_navbar.scss","../sass/components/_roboto.scss","../sass/components/_typography.scss","../sass/components/_transitions.scss","../sass/components/_cards.scss","../sass/components/_toast.scss","../sass/components/_tabs.scss","../sass/components/_tooltip.scss","../sass/components/_buttons.scss","../sass/components/_dropdown.scss","../sass/components/_waves.scss","../sass/components/_modal.scss","../sass/components/_collapsible.scss","../sass/components/_chips.scss","../sass/components/_materialbox.scss","../sass/components/forms/_forms.scss","../sass/components/forms/_input-fields.scss","../sass/components/forms/_radio-buttons.scss","../sass/components/forms/_checkboxes.scss","../sass/components/forms/_switches.scss","../sass/components/forms/_select.scss","../sass/components/forms/_file-input.scss","../sass/components/forms/_range.scss","../sass/components/_table_of_contents.scss","../sass/components/_sideNav.scss","../sass/components/_preloader.scss","../sass/components/_slider.scss","../sass/components/_carousel.scss","../sass/components/_tapTarget.scss","../sass/components/_pulse.scss","../sass/components/date_picker/_default.scss","../sass/components/date_picker/_default.date.scss","../sass/components/date_picker/_default.time.scss"], +"names": [], +"file": "materialize.min.css" +} \ No newline at end of file diff --git a/app/dispatch/static/materialize/js/animation.js b/app/dispatch/static/materialize/js/animation.js new file mode 100644 index 0000000..b8a532a --- /dev/null +++ b/app/dispatch/static/materialize/js/animation.js @@ -0,0 +1,8 @@ +// Custom Easing +jQuery.extend( jQuery.easing, +{ + easeInOutMaterial: function (x, t, b, c, d) { + if ((t/=d/2) < 1) return c/2*t*t + b; + return c/4*((t-=2)*t*t + 2) + b; + } +}); \ No newline at end of file diff --git a/app/dispatch/static/materialize/js/bin/materialize.js b/app/dispatch/static/materialize/js/bin/materialize.js new file mode 100644 index 0000000..10df8db --- /dev/null +++ b/app/dispatch/static/materialize/js/bin/materialize.js @@ -0,0 +1,10021 @@ +/*! + * Materialize v0.100.2 (http://materializecss.com) + * Copyright 2014-2017 Materialize + * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE) + */ +var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +// Check for jQuery. +if (typeof jQuery === 'undefined') { + // Check if require is a defined function. + if (typeof require === 'function') { + jQuery = $ = require('jquery'); + // Else use the dollar sign alias. + } else { + jQuery = $; + } +} +; /* + * jQuery Easing v1.4.0 - http://gsgd.co.uk/sandbox/jquery/easing/ + * Open source under the BSD License. + * Copyright © 2008 George McGinley Smith + * All rights reserved. + * https://raw.github.com/gdsmith/jquery-easing/master/LICENSE + */ + +(function (factory) { + if (typeof define === "function" && define.amd) { + define(['jquery'], function ($) { + return factory($); + }); + } else if (typeof module === "object" && typeof module.exports === "object") { + exports = factory(require('jquery')); + } else { + factory(jQuery); + } +})(function ($) { + + // Preserve the original jQuery "swing" easing as "jswing" + $.easing['jswing'] = $.easing['swing']; + + var pow = Math.pow, + sqrt = Math.sqrt, + sin = Math.sin, + cos = Math.cos, + PI = Math.PI, + c1 = 1.70158, + c2 = c1 * 1.525, + c3 = c1 + 1, + c4 = 2 * PI / 3, + c5 = 2 * PI / 4.5; + + // x is the fraction of animation progress, in the range 0..1 + function bounceOut(x) { + var n1 = 7.5625, + d1 = 2.75; + if (x < 1 / d1) { + return n1 * x * x; + } else if (x < 2 / d1) { + return n1 * (x -= 1.5 / d1) * x + .75; + } else if (x < 2.5 / d1) { + return n1 * (x -= 2.25 / d1) * x + .9375; + } else { + return n1 * (x -= 2.625 / d1) * x + .984375; + } + } + + $.extend($.easing, { + def: 'easeOutQuad', + swing: function (x) { + return $.easing[$.easing.def](x); + }, + easeInQuad: function (x) { + return x * x; + }, + easeOutQuad: function (x) { + return 1 - (1 - x) * (1 - x); + }, + easeInOutQuad: function (x) { + return x < 0.5 ? 2 * x * x : 1 - pow(-2 * x + 2, 2) / 2; + }, + easeInCubic: function (x) { + return x * x * x; + }, + easeOutCubic: function (x) { + return 1 - pow(1 - x, 3); + }, + easeInOutCubic: function (x) { + return x < 0.5 ? 4 * x * x * x : 1 - pow(-2 * x + 2, 3) / 2; + }, + easeInQuart: function (x) { + return x * x * x * x; + }, + easeOutQuart: function (x) { + return 1 - pow(1 - x, 4); + }, + easeInOutQuart: function (x) { + return x < 0.5 ? 8 * x * x * x * x : 1 - pow(-2 * x + 2, 4) / 2; + }, + easeInQuint: function (x) { + return x * x * x * x * x; + }, + easeOutQuint: function (x) { + return 1 - pow(1 - x, 5); + }, + easeInOutQuint: function (x) { + return x < 0.5 ? 16 * x * x * x * x * x : 1 - pow(-2 * x + 2, 5) / 2; + }, + easeInSine: function (x) { + return 1 - cos(x * PI / 2); + }, + easeOutSine: function (x) { + return sin(x * PI / 2); + }, + easeInOutSine: function (x) { + return -(cos(PI * x) - 1) / 2; + }, + easeInExpo: function (x) { + return x === 0 ? 0 : pow(2, 10 * x - 10); + }, + easeOutExpo: function (x) { + return x === 1 ? 1 : 1 - pow(2, -10 * x); + }, + easeInOutExpo: function (x) { + return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? pow(2, 20 * x - 10) / 2 : (2 - pow(2, -20 * x + 10)) / 2; + }, + easeInCirc: function (x) { + return 1 - sqrt(1 - pow(x, 2)); + }, + easeOutCirc: function (x) { + return sqrt(1 - pow(x - 1, 2)); + }, + easeInOutCirc: function (x) { + return x < 0.5 ? (1 - sqrt(1 - pow(2 * x, 2))) / 2 : (sqrt(1 - pow(-2 * x + 2, 2)) + 1) / 2; + }, + easeInElastic: function (x) { + return x === 0 ? 0 : x === 1 ? 1 : -pow(2, 10 * x - 10) * sin((x * 10 - 10.75) * c4); + }, + easeOutElastic: function (x) { + return x === 0 ? 0 : x === 1 ? 1 : pow(2, -10 * x) * sin((x * 10 - 0.75) * c4) + 1; + }, + easeInOutElastic: function (x) { + return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? -(pow(2, 20 * x - 10) * sin((20 * x - 11.125) * c5)) / 2 : pow(2, -20 * x + 10) * sin((20 * x - 11.125) * c5) / 2 + 1; + }, + easeInBack: function (x) { + return c3 * x * x * x - c1 * x * x; + }, + easeOutBack: function (x) { + return 1 + c3 * pow(x - 1, 3) + c1 * pow(x - 1, 2); + }, + easeInOutBack: function (x) { + return x < 0.5 ? pow(2 * x, 2) * ((c2 + 1) * 2 * x - c2) / 2 : (pow(2 * x - 2, 2) * ((c2 + 1) * (x * 2 - 2) + c2) + 2) / 2; + }, + easeInBounce: function (x) { + return 1 - bounceOut(1 - x); + }, + easeOutBounce: bounceOut, + easeInOutBounce: function (x) { + return x < 0.5 ? (1 - bounceOut(1 - 2 * x)) / 2 : (1 + bounceOut(2 * x - 1)) / 2; + } + }); +});; // Custom Easing +jQuery.extend(jQuery.easing, { + easeInOutMaterial: function (x, t, b, c, d) { + if ((t /= d / 2) < 1) return c / 2 * t * t + b; + return c / 4 * ((t -= 2) * t * t + 2) + b; + } +});; /*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */ +/*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */ +/*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */ +jQuery.Velocity ? console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity.") : (!function (e) { + function t(e) { + var t = e.length, + a = r.type(e);return "function" === a || r.isWindow(e) ? !1 : 1 === e.nodeType && t ? !0 : "array" === a || 0 === t || "number" == typeof t && t > 0 && t - 1 in e; + }if (!e.jQuery) { + var r = function (e, t) { + return new r.fn.init(e, t); + };r.isWindow = function (e) { + return null != e && e == e.window; + }, r.type = function (e) { + return null == e ? e + "" : "object" == typeof e || "function" == typeof e ? n[i.call(e)] || "object" : typeof e; + }, r.isArray = Array.isArray || function (e) { + return "array" === r.type(e); + }, r.isPlainObject = function (e) { + var t;if (!e || "object" !== r.type(e) || e.nodeType || r.isWindow(e)) return !1;try { + if (e.constructor && !o.call(e, "constructor") && !o.call(e.constructor.prototype, "isPrototypeOf")) return !1; + } catch (a) { + return !1; + }for (t in e) {}return void 0 === t || o.call(e, t); + }, r.each = function (e, r, a) { + var n, + o = 0, + i = e.length, + s = t(e);if (a) { + if (s) for (; i > o && (n = r.apply(e[o], a), n !== !1); o++) {} else for (o in e) { + if (n = r.apply(e[o], a), n === !1) break; + } + } else if (s) for (; i > o && (n = r.call(e[o], o, e[o]), n !== !1); o++) {} else for (o in e) { + if (n = r.call(e[o], o, e[o]), n === !1) break; + }return e; + }, r.data = function (e, t, n) { + if (void 0 === n) { + var o = e[r.expando], + i = o && a[o];if (void 0 === t) return i;if (i && t in i) return i[t]; + } else if (void 0 !== t) { + var o = e[r.expando] || (e[r.expando] = ++r.uuid);return a[o] = a[o] || {}, a[o][t] = n, n; + } + }, r.removeData = function (e, t) { + var n = e[r.expando], + o = n && a[n];o && r.each(t, function (e, t) { + delete o[t]; + }); + }, r.extend = function () { + var e, + t, + a, + n, + o, + i, + s = arguments[0] || {}, + l = 1, + u = arguments.length, + c = !1;for ("boolean" == typeof s && (c = s, s = arguments[l] || {}, l++), "object" != typeof s && "function" !== r.type(s) && (s = {}), l === u && (s = this, l--); u > l; l++) { + if (null != (o = arguments[l])) for (n in o) { + e = s[n], a = o[n], s !== a && (c && a && (r.isPlainObject(a) || (t = r.isArray(a))) ? (t ? (t = !1, i = e && r.isArray(e) ? e : []) : i = e && r.isPlainObject(e) ? e : {}, s[n] = r.extend(c, i, a)) : void 0 !== a && (s[n] = a)); + } + }return s; + }, r.queue = function (e, a, n) { + function o(e, r) { + var a = r || [];return null != e && (t(Object(e)) ? !function (e, t) { + for (var r = +t.length, a = 0, n = e.length; r > a;) { + e[n++] = t[a++]; + }if (r !== r) for (; void 0 !== t[a];) { + e[n++] = t[a++]; + }return e.length = n, e; + }(a, "string" == typeof e ? [e] : e) : [].push.call(a, e)), a; + }if (e) { + a = (a || "fx") + "queue";var i = r.data(e, a);return n ? (!i || r.isArray(n) ? i = r.data(e, a, o(n)) : i.push(n), i) : i || []; + } + }, r.dequeue = function (e, t) { + r.each(e.nodeType ? [e] : e, function (e, a) { + t = t || "fx";var n = r.queue(a, t), + o = n.shift();"inprogress" === o && (o = n.shift()), o && ("fx" === t && n.unshift("inprogress"), o.call(a, function () { + r.dequeue(a, t); + })); + }); + }, r.fn = r.prototype = { init: function (e) { + if (e.nodeType) return this[0] = e, this;throw new Error("Not a DOM node."); + }, offset: function () { + var t = this[0].getBoundingClientRect ? this[0].getBoundingClientRect() : { top: 0, left: 0 };return { top: t.top + (e.pageYOffset || document.scrollTop || 0) - (document.clientTop || 0), left: t.left + (e.pageXOffset || document.scrollLeft || 0) - (document.clientLeft || 0) }; + }, position: function () { + function e() { + for (var e = this.offsetParent || document; e && "html" === !e.nodeType.toLowerCase && "static" === e.style.position;) { + e = e.offsetParent; + }return e || document; + }var t = this[0], + e = e.apply(t), + a = this.offset(), + n = /^(?:body|html)$/i.test(e.nodeName) ? { top: 0, left: 0 } : r(e).offset();return a.top -= parseFloat(t.style.marginTop) || 0, a.left -= parseFloat(t.style.marginLeft) || 0, e.style && (n.top += parseFloat(e.style.borderTopWidth) || 0, n.left += parseFloat(e.style.borderLeftWidth) || 0), { top: a.top - n.top, left: a.left - n.left }; + } };var a = {};r.expando = "velocity" + new Date().getTime(), r.uuid = 0;for (var n = {}, o = n.hasOwnProperty, i = n.toString, s = "Boolean Number String Function Array Date RegExp Object Error".split(" "), l = 0; l < s.length; l++) { + n["[object " + s[l] + "]"] = s[l].toLowerCase(); + }r.fn.init.prototype = r.fn, e.Velocity = { Utilities: r }; + } +}(window), function (e) { + "object" == typeof module && "object" == typeof module.exports ? module.exports = e() : "function" == typeof define && define.amd ? define(e) : e(); +}(function () { + return function (e, t, r, a) { + function n(e) { + for (var t = -1, r = e ? e.length : 0, a = []; ++t < r;) { + var n = e[t];n && a.push(n); + }return a; + }function o(e) { + return m.isWrapped(e) ? e = [].slice.call(e) : m.isNode(e) && (e = [e]), e; + }function i(e) { + var t = f.data(e, "velocity");return null === t ? a : t; + }function s(e) { + return function (t) { + return Math.round(t * e) * (1 / e); + }; + }function l(e, r, a, n) { + function o(e, t) { + return 1 - 3 * t + 3 * e; + }function i(e, t) { + return 3 * t - 6 * e; + }function s(e) { + return 3 * e; + }function l(e, t, r) { + return ((o(t, r) * e + i(t, r)) * e + s(t)) * e; + }function u(e, t, r) { + return 3 * o(t, r) * e * e + 2 * i(t, r) * e + s(t); + }function c(t, r) { + for (var n = 0; m > n; ++n) { + var o = u(r, e, a);if (0 === o) return r;var i = l(r, e, a) - t;r -= i / o; + }return r; + }function p() { + for (var t = 0; b > t; ++t) { + w[t] = l(t * x, e, a); + } + }function f(t, r, n) { + var o, + i, + s = 0;do { + i = r + (n - r) / 2, o = l(i, e, a) - t, o > 0 ? n = i : r = i; + } while (Math.abs(o) > h && ++s < v);return i; + }function d(t) { + for (var r = 0, n = 1, o = b - 1; n != o && w[n] <= t; ++n) { + r += x; + }--n;var i = (t - w[n]) / (w[n + 1] - w[n]), + s = r + i * x, + l = u(s, e, a);return l >= y ? c(t, s) : 0 == l ? s : f(t, r, r + x); + }function g() { + V = !0, (e != r || a != n) && p(); + }var m = 4, + y = .001, + h = 1e-7, + v = 10, + b = 11, + x = 1 / (b - 1), + S = "Float32Array" in t;if (4 !== arguments.length) return !1;for (var P = 0; 4 > P; ++P) { + if ("number" != typeof arguments[P] || isNaN(arguments[P]) || !isFinite(arguments[P])) return !1; + }e = Math.min(e, 1), a = Math.min(a, 1), e = Math.max(e, 0), a = Math.max(a, 0);var w = S ? new Float32Array(b) : new Array(b), + V = !1, + C = function (t) { + return V || g(), e === r && a === n ? t : 0 === t ? 0 : 1 === t ? 1 : l(d(t), r, n); + };C.getControlPoints = function () { + return [{ x: e, y: r }, { x: a, y: n }]; + };var T = "generateBezier(" + [e, r, a, n] + ")";return C.toString = function () { + return T; + }, C; + }function u(e, t) { + var r = e;return m.isString(e) ? b.Easings[e] || (r = !1) : r = m.isArray(e) && 1 === e.length ? s.apply(null, e) : m.isArray(e) && 2 === e.length ? x.apply(null, e.concat([t])) : m.isArray(e) && 4 === e.length ? l.apply(null, e) : !1, r === !1 && (r = b.Easings[b.defaults.easing] ? b.defaults.easing : v), r; + }function c(e) { + if (e) { + var t = new Date().getTime(), + r = b.State.calls.length;r > 1e4 && (b.State.calls = n(b.State.calls));for (var o = 0; r > o; o++) { + if (b.State.calls[o]) { + var s = b.State.calls[o], + l = s[0], + u = s[2], + d = s[3], + g = !!d, + y = null;d || (d = b.State.calls[o][3] = t - 16);for (var h = Math.min((t - d) / u.duration, 1), v = 0, x = l.length; x > v; v++) { + var P = l[v], + V = P.element;if (i(V)) { + var C = !1;if (u.display !== a && null !== u.display && "none" !== u.display) { + if ("flex" === u.display) { + var T = ["-webkit-box", "-moz-box", "-ms-flexbox", "-webkit-flex"];f.each(T, function (e, t) { + S.setPropertyValue(V, "display", t); + }); + }S.setPropertyValue(V, "display", u.display); + }u.visibility !== a && "hidden" !== u.visibility && S.setPropertyValue(V, "visibility", u.visibility);for (var k in P) { + if ("element" !== k) { + var A, + F = P[k], + j = m.isString(F.easing) ? b.Easings[F.easing] : F.easing;if (1 === h) A = F.endValue;else { + var E = F.endValue - F.startValue;if (A = F.startValue + E * j(h, u, E), !g && A === F.currentValue) continue; + }if (F.currentValue = A, "tween" === k) y = A;else { + if (S.Hooks.registered[k]) { + var H = S.Hooks.getRoot(k), + N = i(V).rootPropertyValueCache[H];N && (F.rootPropertyValue = N); + }var L = S.setPropertyValue(V, k, F.currentValue + (0 === parseFloat(A) ? "" : F.unitType), F.rootPropertyValue, F.scrollData);S.Hooks.registered[k] && (i(V).rootPropertyValueCache[H] = S.Normalizations.registered[H] ? S.Normalizations.registered[H]("extract", null, L[1]) : L[1]), "transform" === L[0] && (C = !0); + } + } + }u.mobileHA && i(V).transformCache.translate3d === a && (i(V).transformCache.translate3d = "(0px, 0px, 0px)", C = !0), C && S.flushTransformCache(V); + } + }u.display !== a && "none" !== u.display && (b.State.calls[o][2].display = !1), u.visibility !== a && "hidden" !== u.visibility && (b.State.calls[o][2].visibility = !1), u.progress && u.progress.call(s[1], s[1], h, Math.max(0, d + u.duration - t), d, y), 1 === h && p(o); + } + } + }b.State.isTicking && w(c); + }function p(e, t) { + if (!b.State.calls[e]) return !1;for (var r = b.State.calls[e][0], n = b.State.calls[e][1], o = b.State.calls[e][2], s = b.State.calls[e][4], l = !1, u = 0, c = r.length; c > u; u++) { + var p = r[u].element;if (t || o.loop || ("none" === o.display && S.setPropertyValue(p, "display", o.display), "hidden" === o.visibility && S.setPropertyValue(p, "visibility", o.visibility)), o.loop !== !0 && (f.queue(p)[1] === a || !/\.velocityQueueEntryFlag/i.test(f.queue(p)[1])) && i(p)) { + i(p).isAnimating = !1, i(p).rootPropertyValueCache = {};var d = !1;f.each(S.Lists.transforms3D, function (e, t) { + var r = /^scale/.test(t) ? 1 : 0, + n = i(p).transformCache[t];i(p).transformCache[t] !== a && new RegExp("^\\(" + r + "[^.]").test(n) && (d = !0, delete i(p).transformCache[t]); + }), o.mobileHA && (d = !0, delete i(p).transformCache.translate3d), d && S.flushTransformCache(p), S.Values.removeClass(p, "velocity-animating"); + }if (!t && o.complete && !o.loop && u === c - 1) try { + o.complete.call(n, n); + } catch (g) { + setTimeout(function () { + throw g; + }, 1); + }s && o.loop !== !0 && s(n), i(p) && o.loop === !0 && !t && (f.each(i(p).tweensContainer, function (e, t) { + /^rotate/.test(e) && 360 === parseFloat(t.endValue) && (t.endValue = 0, t.startValue = 360), /^backgroundPosition/.test(e) && 100 === parseFloat(t.endValue) && "%" === t.unitType && (t.endValue = 0, t.startValue = 100); + }), b(p, "reverse", { loop: !0, delay: o.delay })), o.queue !== !1 && f.dequeue(p, o.queue); + }b.State.calls[e] = !1;for (var m = 0, y = b.State.calls.length; y > m; m++) { + if (b.State.calls[m] !== !1) { + l = !0;break; + } + }l === !1 && (b.State.isTicking = !1, delete b.State.calls, b.State.calls = []); + }var f, + d = function () { + if (r.documentMode) return r.documentMode;for (var e = 7; e > 4; e--) { + var t = r.createElement("div");if (t.innerHTML = "", t.getElementsByTagName("span").length) return t = null, e; + }return a; + }(), + g = function () { + var e = 0;return t.webkitRequestAnimationFrame || t.mozRequestAnimationFrame || function (t) { + var r, + a = new Date().getTime();return r = Math.max(0, 16 - (a - e)), e = a + r, setTimeout(function () { + t(a + r); + }, r); + }; + }(), + m = { isString: function (e) { + return "string" == typeof e; + }, isArray: Array.isArray || function (e) { + return "[object Array]" === Object.prototype.toString.call(e); + }, isFunction: function (e) { + return "[object Function]" === Object.prototype.toString.call(e); + }, isNode: function (e) { + return e && e.nodeType; + }, isNodeList: function (e) { + return "object" == typeof e && /^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e)) && e.length !== a && (0 === e.length || "object" == typeof e[0] && e[0].nodeType > 0); + }, isWrapped: function (e) { + return e && (e.jquery || t.Zepto && t.Zepto.zepto.isZ(e)); + }, isSVG: function (e) { + return t.SVGElement && e instanceof t.SVGElement; + }, isEmptyObject: function (e) { + for (var t in e) { + return !1; + }return !0; + } }, + y = !1;if (e.fn && e.fn.jquery ? (f = e, y = !0) : f = t.Velocity.Utilities, 8 >= d && !y) throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if (7 >= d) return void (jQuery.fn.velocity = jQuery.fn.animate);var h = 400, + v = "swing", + b = { State: { isMobile: /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent), isAndroid: /Android/i.test(navigator.userAgent), isGingerbread: /Android 2\.3\.[3-7]/i.test(navigator.userAgent), isChrome: t.chrome, isFirefox: /Firefox/i.test(navigator.userAgent), prefixElement: r.createElement("div"), prefixMatches: {}, scrollAnchor: null, scrollPropertyLeft: null, scrollPropertyTop: null, isTicking: !1, calls: [] }, CSS: {}, Utilities: f, Redirects: {}, Easings: {}, Promise: t.Promise, defaults: { queue: "", duration: h, easing: v, begin: a, complete: a, progress: a, display: a, visibility: a, loop: !1, delay: !1, mobileHA: !0, _cacheValues: !0 }, init: function (e) { + f.data(e, "velocity", { isSVG: m.isSVG(e), isAnimating: !1, computedStyle: null, tweensContainer: null, rootPropertyValueCache: {}, transformCache: {} }); + }, hook: null, mock: !1, version: { major: 1, minor: 2, patch: 2 }, debug: !1 };t.pageYOffset !== a ? (b.State.scrollAnchor = t, b.State.scrollPropertyLeft = "pageXOffset", b.State.scrollPropertyTop = "pageYOffset") : (b.State.scrollAnchor = r.documentElement || r.body.parentNode || r.body, b.State.scrollPropertyLeft = "scrollLeft", b.State.scrollPropertyTop = "scrollTop");var x = function () { + function e(e) { + return -e.tension * e.x - e.friction * e.v; + }function t(t, r, a) { + var n = { x: t.x + a.dx * r, v: t.v + a.dv * r, tension: t.tension, friction: t.friction };return { dx: n.v, dv: e(n) }; + }function r(r, a) { + var n = { dx: r.v, dv: e(r) }, + o = t(r, .5 * a, n), + i = t(r, .5 * a, o), + s = t(r, a, i), + l = 1 / 6 * (n.dx + 2 * (o.dx + i.dx) + s.dx), + u = 1 / 6 * (n.dv + 2 * (o.dv + i.dv) + s.dv);return r.x = r.x + l * a, r.v = r.v + u * a, r; + }return function a(e, t, n) { + var o, + i, + s, + l = { x: -1, v: 0, tension: null, friction: null }, + u = [0], + c = 0, + p = 1e-4, + f = .016;for (e = parseFloat(e) || 500, t = parseFloat(t) || 20, n = n || null, l.tension = e, l.friction = t, o = null !== n, o ? (c = a(e, t), i = c / n * f) : i = f; s = r(s || l, i), u.push(1 + s.x), c += 16, Math.abs(s.x) > p && Math.abs(s.v) > p;) {}return o ? function (e) { + return u[e * (u.length - 1) | 0]; + } : c; + }; + }();b.Easings = { linear: function (e) { + return e; + }, swing: function (e) { + return .5 - Math.cos(e * Math.PI) / 2; + }, spring: function (e) { + return 1 - Math.cos(4.5 * e * Math.PI) * Math.exp(6 * -e); + } }, f.each([["ease", [.25, .1, .25, 1]], ["ease-in", [.42, 0, 1, 1]], ["ease-out", [0, 0, .58, 1]], ["ease-in-out", [.42, 0, .58, 1]], ["easeInSine", [.47, 0, .745, .715]], ["easeOutSine", [.39, .575, .565, 1]], ["easeInOutSine", [.445, .05, .55, .95]], ["easeInQuad", [.55, .085, .68, .53]], ["easeOutQuad", [.25, .46, .45, .94]], ["easeInOutQuad", [.455, .03, .515, .955]], ["easeInCubic", [.55, .055, .675, .19]], ["easeOutCubic", [.215, .61, .355, 1]], ["easeInOutCubic", [.645, .045, .355, 1]], ["easeInQuart", [.895, .03, .685, .22]], ["easeOutQuart", [.165, .84, .44, 1]], ["easeInOutQuart", [.77, 0, .175, 1]], ["easeInQuint", [.755, .05, .855, .06]], ["easeOutQuint", [.23, 1, .32, 1]], ["easeInOutQuint", [.86, 0, .07, 1]], ["easeInExpo", [.95, .05, .795, .035]], ["easeOutExpo", [.19, 1, .22, 1]], ["easeInOutExpo", [1, 0, 0, 1]], ["easeInCirc", [.6, .04, .98, .335]], ["easeOutCirc", [.075, .82, .165, 1]], ["easeInOutCirc", [.785, .135, .15, .86]]], function (e, t) { + b.Easings[t[0]] = l.apply(null, t[1]); + });var S = b.CSS = { RegEx: { isHex: /^#([A-f\d]{3}){1,2}$/i, valueUnwrap: /^[A-z]+\((.*)\)$/i, wrappedValueAlreadyExtracted: /[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/, valueSplit: /([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi }, Lists: { colors: ["fill", "stroke", "stopColor", "color", "backgroundColor", "borderColor", "borderTopColor", "borderRightColor", "borderBottomColor", "borderLeftColor", "outlineColor"], transformsBase: ["translateX", "translateY", "scale", "scaleX", "scaleY", "skewX", "skewY", "rotateZ"], transforms3D: ["transformPerspective", "translateZ", "scaleZ", "rotateX", "rotateY"] }, Hooks: { templates: { textShadow: ["Color X Y Blur", "black 0px 0px 0px"], boxShadow: ["Color X Y Blur Spread", "black 0px 0px 0px 0px"], clip: ["Top Right Bottom Left", "0px 0px 0px 0px"], backgroundPosition: ["X Y", "0% 0%"], transformOrigin: ["X Y Z", "50% 50% 0px"], perspectiveOrigin: ["X Y", "50% 50%"] }, registered: {}, register: function () { + for (var e = 0; e < S.Lists.colors.length; e++) { + var t = "color" === S.Lists.colors[e] ? "0 0 0 1" : "255 255 255 1";S.Hooks.templates[S.Lists.colors[e]] = ["Red Green Blue Alpha", t]; + }var r, a, n;if (d) for (r in S.Hooks.templates) { + a = S.Hooks.templates[r], n = a[0].split(" ");var o = a[1].match(S.RegEx.valueSplit);"Color" === n[0] && (n.push(n.shift()), o.push(o.shift()), S.Hooks.templates[r] = [n.join(" "), o.join(" ")]); + }for (r in S.Hooks.templates) { + a = S.Hooks.templates[r], n = a[0].split(" ");for (var e in n) { + var i = r + n[e], + s = e;S.Hooks.registered[i] = [r, s]; + } + } + }, getRoot: function (e) { + var t = S.Hooks.registered[e];return t ? t[0] : e; + }, cleanRootPropertyValue: function (e, t) { + return S.RegEx.valueUnwrap.test(t) && (t = t.match(S.RegEx.valueUnwrap)[1]), S.Values.isCSSNullValue(t) && (t = S.Hooks.templates[e][1]), t; + }, extractValue: function (e, t) { + var r = S.Hooks.registered[e];if (r) { + var a = r[0], + n = r[1];return t = S.Hooks.cleanRootPropertyValue(a, t), t.toString().match(S.RegEx.valueSplit)[n]; + }return t; + }, injectValue: function (e, t, r) { + var a = S.Hooks.registered[e];if (a) { + var n, + o, + i = a[0], + s = a[1];return r = S.Hooks.cleanRootPropertyValue(i, r), n = r.toString().match(S.RegEx.valueSplit), n[s] = t, o = n.join(" "); + }return r; + } }, Normalizations: { registered: { clip: function (e, t, r) { + switch (e) {case "name": + return "clip";case "extract": + var a;return S.RegEx.wrappedValueAlreadyExtracted.test(r) ? a = r : (a = r.toString().match(S.RegEx.valueUnwrap), a = a ? a[1].replace(/,(\s+)?/g, " ") : r), a;case "inject": + return "rect(" + r + ")";} + }, blur: function (e, t, r) { + switch (e) {case "name": + return b.State.isFirefox ? "filter" : "-webkit-filter";case "extract": + var a = parseFloat(r);if (!a && 0 !== a) { + var n = r.toString().match(/blur\(([0-9]+[A-z]+)\)/i);a = n ? n[1] : 0; + }return a;case "inject": + return parseFloat(r) ? "blur(" + r + ")" : "none";} + }, opacity: function (e, t, r) { + if (8 >= d) switch (e) {case "name": + return "filter";case "extract": + var a = r.toString().match(/alpha\(opacity=(.*)\)/i);return r = a ? a[1] / 100 : 1;case "inject": + return t.style.zoom = 1, parseFloat(r) >= 1 ? "" : "alpha(opacity=" + parseInt(100 * parseFloat(r), 10) + ")";} else switch (e) {case "name": + return "opacity";case "extract": + return r;case "inject": + return r;} + } }, register: function () { + 9 >= d || b.State.isGingerbread || (S.Lists.transformsBase = S.Lists.transformsBase.concat(S.Lists.transforms3D));for (var e = 0; e < S.Lists.transformsBase.length; e++) { + !function () { + var t = S.Lists.transformsBase[e];S.Normalizations.registered[t] = function (e, r, n) { + switch (e) {case "name": + return "transform";case "extract": + return i(r) === a || i(r).transformCache[t] === a ? /^scale/i.test(t) ? 1 : 0 : i(r).transformCache[t].replace(/[()]/g, "");case "inject": + var o = !1;switch (t.substr(0, t.length - 1)) {case "translate": + o = !/(%|px|em|rem|vw|vh|\d)$/i.test(n);break;case "scal":case "scale": + b.State.isAndroid && i(r).transformCache[t] === a && 1 > n && (n = 1), o = !/(\d)$/i.test(n);break;case "skew": + o = !/(deg|\d)$/i.test(n);break;case "rotate": + o = !/(deg|\d)$/i.test(n);}return o || (i(r).transformCache[t] = "(" + n + ")"), i(r).transformCache[t];} + }; + }(); + }for (var e = 0; e < S.Lists.colors.length; e++) { + !function () { + var t = S.Lists.colors[e];S.Normalizations.registered[t] = function (e, r, n) { + switch (e) {case "name": + return t;case "extract": + var o;if (S.RegEx.wrappedValueAlreadyExtracted.test(n)) o = n;else { + var i, + s = { black: "rgb(0, 0, 0)", blue: "rgb(0, 0, 255)", gray: "rgb(128, 128, 128)", green: "rgb(0, 128, 0)", red: "rgb(255, 0, 0)", white: "rgb(255, 255, 255)" };/^[A-z]+$/i.test(n) ? i = s[n] !== a ? s[n] : s.black : S.RegEx.isHex.test(n) ? i = "rgb(" + S.Values.hexToRgb(n).join(" ") + ")" : /^rgba?\(/i.test(n) || (i = s.black), o = (i || n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g, " "); + }return 8 >= d || 3 !== o.split(" ").length || (o += " 1"), o;case "inject": + return 8 >= d ? 4 === n.split(" ").length && (n = n.split(/\s+/).slice(0, 3).join(" ")) : 3 === n.split(" ").length && (n += " 1"), (8 >= d ? "rgb" : "rgba") + "(" + n.replace(/\s+/g, ",").replace(/\.(\d)+(?=,)/g, "") + ")";} + }; + }(); + } + } }, Names: { camelCase: function (e) { + return e.replace(/-(\w)/g, function (e, t) { + return t.toUpperCase(); + }); + }, SVGAttribute: function (e) { + var t = "width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return (d || b.State.isAndroid && !b.State.isChrome) && (t += "|transform"), new RegExp("^(" + t + ")$", "i").test(e); + }, prefixCheck: function (e) { + if (b.State.prefixMatches[e]) return [b.State.prefixMatches[e], !0];for (var t = ["", "Webkit", "Moz", "ms", "O"], r = 0, a = t.length; a > r; r++) { + var n;if (n = 0 === r ? e : t[r] + e.replace(/^\w/, function (e) { + return e.toUpperCase(); + }), m.isString(b.State.prefixElement.style[n])) return b.State.prefixMatches[e] = n, [n, !0]; + }return [e, !1]; + } }, Values: { hexToRgb: function (e) { + var t, + r = /^#?([a-f\d])([a-f\d])([a-f\d])$/i, + a = /^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return e = e.replace(r, function (e, t, r, a) { + return t + t + r + r + a + a; + }), t = a.exec(e), t ? [parseInt(t[1], 16), parseInt(t[2], 16), parseInt(t[3], 16)] : [0, 0, 0]; + }, isCSSNullValue: function (e) { + return 0 == e || /^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e); + }, getUnitType: function (e) { + return (/^(rotate|skew)/i.test(e) ? "deg" : /(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e) ? "" : "px" + ); + }, getDisplayType: function (e) { + var t = e && e.tagName.toString().toLowerCase();return (/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t) ? "inline" : /^(li)$/i.test(t) ? "list-item" : /^(tr)$/i.test(t) ? "table-row" : /^(table)$/i.test(t) ? "table" : /^(tbody)$/i.test(t) ? "table-row-group" : "block" + ); + }, addClass: function (e, t) { + e.classList ? e.classList.add(t) : e.className += (e.className.length ? " " : "") + t; + }, removeClass: function (e, t) { + e.classList ? e.classList.remove(t) : e.className = e.className.toString().replace(new RegExp("(^|\\s)" + t.split(" ").join("|") + "(\\s|$)", "gi"), " "); + } }, getPropertyValue: function (e, r, n, o) { + function s(e, r) { + function n() { + u && S.setPropertyValue(e, "display", "none"); + }var l = 0;if (8 >= d) l = f.css(e, r);else { + var u = !1;if (/^(width|height)$/.test(r) && 0 === S.getPropertyValue(e, "display") && (u = !0, S.setPropertyValue(e, "display", S.Values.getDisplayType(e))), !o) { + if ("height" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) { + var c = e.offsetHeight - (parseFloat(S.getPropertyValue(e, "borderTopWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderBottomWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingTop")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingBottom")) || 0);return n(), c; + }if ("width" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) { + var p = e.offsetWidth - (parseFloat(S.getPropertyValue(e, "borderLeftWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderRightWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingLeft")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingRight")) || 0);return n(), p; + } + }var g;g = i(e) === a ? t.getComputedStyle(e, null) : i(e).computedStyle ? i(e).computedStyle : i(e).computedStyle = t.getComputedStyle(e, null), "borderColor" === r && (r = "borderTopColor"), l = 9 === d && "filter" === r ? g.getPropertyValue(r) : g[r], ("" === l || null === l) && (l = e.style[r]), n(); + }if ("auto" === l && /^(top|right|bottom|left)$/i.test(r)) { + var m = s(e, "position");("fixed" === m || "absolute" === m && /top|left/i.test(r)) && (l = f(e).position()[r] + "px"); + }return l; + }var l;if (S.Hooks.registered[r]) { + var u = r, + c = S.Hooks.getRoot(u);n === a && (n = S.getPropertyValue(e, S.Names.prefixCheck(c)[0])), S.Normalizations.registered[c] && (n = S.Normalizations.registered[c]("extract", e, n)), l = S.Hooks.extractValue(u, n); + } else if (S.Normalizations.registered[r]) { + var p, g;p = S.Normalizations.registered[r]("name", e), "transform" !== p && (g = s(e, S.Names.prefixCheck(p)[0]), S.Values.isCSSNullValue(g) && S.Hooks.templates[r] && (g = S.Hooks.templates[r][1])), l = S.Normalizations.registered[r]("extract", e, g); + }if (!/^[\d-]/.test(l)) if (i(e) && i(e).isSVG && S.Names.SVGAttribute(r)) { + if (/^(height|width)$/i.test(r)) try { + l = e.getBBox()[r]; + } catch (m) { + l = 0; + } else l = e.getAttribute(r); + } else l = s(e, S.Names.prefixCheck(r)[0]);return S.Values.isCSSNullValue(l) && (l = 0), b.debug >= 2 && console.log("Get " + r + ": " + l), l; + }, setPropertyValue: function (e, r, a, n, o) { + var s = r;if ("scroll" === r) o.container ? o.container["scroll" + o.direction] = a : "Left" === o.direction ? t.scrollTo(a, o.alternateValue) : t.scrollTo(o.alternateValue, a);else if (S.Normalizations.registered[r] && "transform" === S.Normalizations.registered[r]("name", e)) S.Normalizations.registered[r]("inject", e, a), s = "transform", a = i(e).transformCache[r];else { + if (S.Hooks.registered[r]) { + var l = r, + u = S.Hooks.getRoot(r);n = n || S.getPropertyValue(e, u), a = S.Hooks.injectValue(l, a, n), r = u; + }if (S.Normalizations.registered[r] && (a = S.Normalizations.registered[r]("inject", e, a), r = S.Normalizations.registered[r]("name", e)), s = S.Names.prefixCheck(r)[0], 8 >= d) try { + e.style[s] = a; + } catch (c) { + b.debug && console.log("Browser does not support [" + a + "] for [" + s + "]"); + } else i(e) && i(e).isSVG && S.Names.SVGAttribute(r) ? e.setAttribute(r, a) : e.style[s] = a;b.debug >= 2 && console.log("Set " + r + " (" + s + "): " + a); + }return [s, a]; + }, flushTransformCache: function (e) { + function t(t) { + return parseFloat(S.getPropertyValue(e, t)); + }var r = "";if ((d || b.State.isAndroid && !b.State.isChrome) && i(e).isSVG) { + var a = { translate: [t("translateX"), t("translateY")], skewX: [t("skewX")], skewY: [t("skewY")], scale: 1 !== t("scale") ? [t("scale"), t("scale")] : [t("scaleX"), t("scaleY")], rotate: [t("rotateZ"), 0, 0] };f.each(i(e).transformCache, function (e) { + /^translate/i.test(e) ? e = "translate" : /^scale/i.test(e) ? e = "scale" : /^rotate/i.test(e) && (e = "rotate"), a[e] && (r += e + "(" + a[e].join(" ") + ") ", delete a[e]); + }); + } else { + var n, o;f.each(i(e).transformCache, function (t) { + return n = i(e).transformCache[t], "transformPerspective" === t ? (o = n, !0) : (9 === d && "rotateZ" === t && (t = "rotate"), void (r += t + n + " ")); + }), o && (r = "perspective" + o + " " + r); + }S.setPropertyValue(e, "transform", r); + } };S.Hooks.register(), S.Normalizations.register(), b.hook = function (e, t, r) { + var n = a;return e = o(e), f.each(e, function (e, o) { + if (i(o) === a && b.init(o), r === a) n === a && (n = b.CSS.getPropertyValue(o, t));else { + var s = b.CSS.setPropertyValue(o, t, r);"transform" === s[0] && b.CSS.flushTransformCache(o), n = s; + } + }), n; + };var P = function () { + function e() { + return s ? k.promise || null : l; + }function n() { + function e(e) { + function p(e, t) { + var r = a, + n = a, + i = a;return m.isArray(e) ? (r = e[0], !m.isArray(e[1]) && /^[\d-]/.test(e[1]) || m.isFunction(e[1]) || S.RegEx.isHex.test(e[1]) ? i = e[1] : (m.isString(e[1]) && !S.RegEx.isHex.test(e[1]) || m.isArray(e[1])) && (n = t ? e[1] : u(e[1], s.duration), e[2] !== a && (i = e[2]))) : r = e, t || (n = n || s.easing), m.isFunction(r) && (r = r.call(o, V, w)), m.isFunction(i) && (i = i.call(o, V, w)), [r || 0, n, i]; + }function d(e, t) { + var r, a;return a = (t || "0").toString().toLowerCase().replace(/[%A-z]+$/, function (e) { + return r = e, ""; + }), r || (r = S.Values.getUnitType(e)), [a, r]; + }function h() { + var e = { myParent: o.parentNode || r.body, position: S.getPropertyValue(o, "position"), fontSize: S.getPropertyValue(o, "fontSize") }, + a = e.position === L.lastPosition && e.myParent === L.lastParent, + n = e.fontSize === L.lastFontSize;L.lastParent = e.myParent, L.lastPosition = e.position, L.lastFontSize = e.fontSize;var s = 100, + l = {};if (n && a) l.emToPx = L.lastEmToPx, l.percentToPxWidth = L.lastPercentToPxWidth, l.percentToPxHeight = L.lastPercentToPxHeight;else { + var u = i(o).isSVG ? r.createElementNS("http://www.w3.org/2000/svg", "rect") : r.createElement("div");b.init(u), e.myParent.appendChild(u), f.each(["overflow", "overflowX", "overflowY"], function (e, t) { + b.CSS.setPropertyValue(u, t, "hidden"); + }), b.CSS.setPropertyValue(u, "position", e.position), b.CSS.setPropertyValue(u, "fontSize", e.fontSize), b.CSS.setPropertyValue(u, "boxSizing", "content-box"), f.each(["minWidth", "maxWidth", "width", "minHeight", "maxHeight", "height"], function (e, t) { + b.CSS.setPropertyValue(u, t, s + "%"); + }), b.CSS.setPropertyValue(u, "paddingLeft", s + "em"), l.percentToPxWidth = L.lastPercentToPxWidth = (parseFloat(S.getPropertyValue(u, "width", null, !0)) || 1) / s, l.percentToPxHeight = L.lastPercentToPxHeight = (parseFloat(S.getPropertyValue(u, "height", null, !0)) || 1) / s, l.emToPx = L.lastEmToPx = (parseFloat(S.getPropertyValue(u, "paddingLeft")) || 1) / s, e.myParent.removeChild(u); + }return null === L.remToPx && (L.remToPx = parseFloat(S.getPropertyValue(r.body, "fontSize")) || 16), null === L.vwToPx && (L.vwToPx = parseFloat(t.innerWidth) / 100, L.vhToPx = parseFloat(t.innerHeight) / 100), l.remToPx = L.remToPx, l.vwToPx = L.vwToPx, l.vhToPx = L.vhToPx, b.debug >= 1 && console.log("Unit ratios: " + JSON.stringify(l), o), l; + }if (s.begin && 0 === V) try { + s.begin.call(g, g); + } catch (x) { + setTimeout(function () { + throw x; + }, 1); + }if ("scroll" === A) { + var P, + C, + T, + F = /^x$/i.test(s.axis) ? "Left" : "Top", + j = parseFloat(s.offset) || 0;s.container ? m.isWrapped(s.container) || m.isNode(s.container) ? (s.container = s.container[0] || s.container, P = s.container["scroll" + F], T = P + f(o).position()[F.toLowerCase()] + j) : s.container = null : (P = b.State.scrollAnchor[b.State["scrollProperty" + F]], C = b.State.scrollAnchor[b.State["scrollProperty" + ("Left" === F ? "Top" : "Left")]], T = f(o).offset()[F.toLowerCase()] + j), l = { scroll: { rootPropertyValue: !1, startValue: P, currentValue: P, endValue: T, unitType: "", easing: s.easing, scrollData: { container: s.container, direction: F, alternateValue: C } }, element: o }, b.debug && console.log("tweensContainer (scroll): ", l.scroll, o); + } else if ("reverse" === A) { + if (!i(o).tweensContainer) return void f.dequeue(o, s.queue);"none" === i(o).opts.display && (i(o).opts.display = "auto"), "hidden" === i(o).opts.visibility && (i(o).opts.visibility = "visible"), i(o).opts.loop = !1, i(o).opts.begin = null, i(o).opts.complete = null, v.easing || delete s.easing, v.duration || delete s.duration, s = f.extend({}, i(o).opts, s);var E = f.extend(!0, {}, i(o).tweensContainer);for (var H in E) { + if ("element" !== H) { + var N = E[H].startValue;E[H].startValue = E[H].currentValue = E[H].endValue, E[H].endValue = N, m.isEmptyObject(v) || (E[H].easing = s.easing), b.debug && console.log("reverse tweensContainer (" + H + "): " + JSON.stringify(E[H]), o); + } + }l = E; + } else if ("start" === A) { + var E;i(o).tweensContainer && i(o).isAnimating === !0 && (E = i(o).tweensContainer), f.each(y, function (e, t) { + if (RegExp("^" + S.Lists.colors.join("$|^") + "$").test(e)) { + var r = p(t, !0), + n = r[0], + o = r[1], + i = r[2];if (S.RegEx.isHex.test(n)) { + for (var s = ["Red", "Green", "Blue"], l = S.Values.hexToRgb(n), u = i ? S.Values.hexToRgb(i) : a, c = 0; c < s.length; c++) { + var f = [l[c]];o && f.push(o), u !== a && f.push(u[c]), y[e + s[c]] = f; + }delete y[e]; + } + } + });for (var z in y) { + var O = p(y[z]), + q = O[0], + $ = O[1], + M = O[2];z = S.Names.camelCase(z);var I = S.Hooks.getRoot(z), + B = !1;if (i(o).isSVG || "tween" === I || S.Names.prefixCheck(I)[1] !== !1 || S.Normalizations.registered[I] !== a) { + (s.display !== a && null !== s.display && "none" !== s.display || s.visibility !== a && "hidden" !== s.visibility) && /opacity|filter/.test(z) && !M && 0 !== q && (M = 0), s._cacheValues && E && E[z] ? (M === a && (M = E[z].endValue + E[z].unitType), B = i(o).rootPropertyValueCache[I]) : S.Hooks.registered[z] ? M === a ? (B = S.getPropertyValue(o, I), M = S.getPropertyValue(o, z, B)) : B = S.Hooks.templates[I][1] : M === a && (M = S.getPropertyValue(o, z));var W, + G, + Y, + D = !1;if (W = d(z, M), M = W[0], Y = W[1], W = d(z, q), q = W[0].replace(/^([+-\/*])=/, function (e, t) { + return D = t, ""; + }), G = W[1], M = parseFloat(M) || 0, q = parseFloat(q) || 0, "%" === G && (/^(fontSize|lineHeight)$/.test(z) ? (q /= 100, G = "em") : /^scale/.test(z) ? (q /= 100, G = "") : /(Red|Green|Blue)$/i.test(z) && (q = q / 100 * 255, G = "")), /[\/*]/.test(D)) G = Y;else if (Y !== G && 0 !== M) if (0 === q) G = Y;else { + n = n || h();var Q = /margin|padding|left|right|width|text|word|letter/i.test(z) || /X$/.test(z) || "x" === z ? "x" : "y";switch (Y) {case "%": + M *= "x" === Q ? n.percentToPxWidth : n.percentToPxHeight;break;case "px": + break;default: + M *= n[Y + "ToPx"];}switch (G) {case "%": + M *= 1 / ("x" === Q ? n.percentToPxWidth : n.percentToPxHeight);break;case "px": + break;default: + M *= 1 / n[G + "ToPx"];} + }switch (D) {case "+": + q = M + q;break;case "-": + q = M - q;break;case "*": + q = M * q;break;case "/": + q = M / q;}l[z] = { rootPropertyValue: B, startValue: M, currentValue: M, endValue: q, unitType: G, easing: $ }, b.debug && console.log("tweensContainer (" + z + "): " + JSON.stringify(l[z]), o); + } else b.debug && console.log("Skipping [" + I + "] due to a lack of browser support."); + }l.element = o; + }l.element && (S.Values.addClass(o, "velocity-animating"), R.push(l), "" === s.queue && (i(o).tweensContainer = l, i(o).opts = s), i(o).isAnimating = !0, V === w - 1 ? (b.State.calls.push([R, g, s, null, k.resolver]), b.State.isTicking === !1 && (b.State.isTicking = !0, c())) : V++); + }var n, + o = this, + s = f.extend({}, b.defaults, v), + l = {};switch (i(o) === a && b.init(o), parseFloat(s.delay) && s.queue !== !1 && f.queue(o, s.queue, function (e) { + b.velocityQueueEntryFlag = !0, i(o).delayTimer = { setTimeout: setTimeout(e, parseFloat(s.delay)), next: e }; + }), s.duration.toString().toLowerCase()) {case "fast": + s.duration = 200;break;case "normal": + s.duration = h;break;case "slow": + s.duration = 600;break;default: + s.duration = parseFloat(s.duration) || 1;}b.mock !== !1 && (b.mock === !0 ? s.duration = s.delay = 1 : (s.duration *= parseFloat(b.mock) || 1, s.delay *= parseFloat(b.mock) || 1)), s.easing = u(s.easing, s.duration), s.begin && !m.isFunction(s.begin) && (s.begin = null), s.progress && !m.isFunction(s.progress) && (s.progress = null), s.complete && !m.isFunction(s.complete) && (s.complete = null), s.display !== a && null !== s.display && (s.display = s.display.toString().toLowerCase(), "auto" === s.display && (s.display = b.CSS.Values.getDisplayType(o))), s.visibility !== a && null !== s.visibility && (s.visibility = s.visibility.toString().toLowerCase()), s.mobileHA = s.mobileHA && b.State.isMobile && !b.State.isGingerbread, s.queue === !1 ? s.delay ? setTimeout(e, s.delay) : e() : f.queue(o, s.queue, function (t, r) { + return r === !0 ? (k.promise && k.resolver(g), !0) : (b.velocityQueueEntryFlag = !0, void e(t)); + }), "" !== s.queue && "fx" !== s.queue || "inprogress" === f.queue(o)[0] || f.dequeue(o); + }var s, + l, + d, + g, + y, + v, + x = arguments[0] && (arguments[0].p || f.isPlainObject(arguments[0].properties) && !arguments[0].properties.names || m.isString(arguments[0].properties));if (m.isWrapped(this) ? (s = !1, d = 0, g = this, l = this) : (s = !0, d = 1, g = x ? arguments[0].elements || arguments[0].e : arguments[0]), g = o(g)) { + x ? (y = arguments[0].properties || arguments[0].p, v = arguments[0].options || arguments[0].o) : (y = arguments[d], v = arguments[d + 1]);var w = g.length, + V = 0;if (!/^(stop|finish)$/i.test(y) && !f.isPlainObject(v)) { + var C = d + 1;v = {};for (var T = C; T < arguments.length; T++) { + m.isArray(arguments[T]) || !/^(fast|normal|slow)$/i.test(arguments[T]) && !/^\d/.test(arguments[T]) ? m.isString(arguments[T]) || m.isArray(arguments[T]) ? v.easing = arguments[T] : m.isFunction(arguments[T]) && (v.complete = arguments[T]) : v.duration = arguments[T]; + } + }var k = { promise: null, resolver: null, rejecter: null };s && b.Promise && (k.promise = new b.Promise(function (e, t) { + k.resolver = e, k.rejecter = t; + }));var A;switch (y) {case "scroll": + A = "scroll";break;case "reverse": + A = "reverse";break;case "finish":case "stop": + f.each(g, function (e, t) { + i(t) && i(t).delayTimer && (clearTimeout(i(t).delayTimer.setTimeout), i(t).delayTimer.next && i(t).delayTimer.next(), delete i(t).delayTimer); + });var F = [];return f.each(b.State.calls, function (e, t) { + t && f.each(t[1], function (r, n) { + var o = v === a ? "" : v;return o === !0 || t[2].queue === o || v === a && t[2].queue === !1 ? void f.each(g, function (r, a) { + a === n && ((v === !0 || m.isString(v)) && (f.each(f.queue(a, m.isString(v) ? v : ""), function (e, t) { + m.isFunction(t) && t(null, !0); + }), f.queue(a, m.isString(v) ? v : "", [])), "stop" === y ? (i(a) && i(a).tweensContainer && o !== !1 && f.each(i(a).tweensContainer, function (e, t) { + t.endValue = t.currentValue; + }), F.push(e)) : "finish" === y && (t[2].duration = 1)); + }) : !0; + }); + }), "stop" === y && (f.each(F, function (e, t) { + p(t, !0); + }), k.promise && k.resolver(g)), e();default: + if (!f.isPlainObject(y) || m.isEmptyObject(y)) { + if (m.isString(y) && b.Redirects[y]) { + var j = f.extend({}, v), + E = j.duration, + H = j.delay || 0;return j.backwards === !0 && (g = f.extend(!0, [], g).reverse()), f.each(g, function (e, t) { + parseFloat(j.stagger) ? j.delay = H + parseFloat(j.stagger) * e : m.isFunction(j.stagger) && (j.delay = H + j.stagger.call(t, e, w)), j.drag && (j.duration = parseFloat(E) || (/^(callout|transition)/.test(y) ? 1e3 : h), j.duration = Math.max(j.duration * (j.backwards ? 1 - e / w : (e + 1) / w), .75 * j.duration, 200)), b.Redirects[y].call(t, t, j || {}, e, w, g, k.promise ? k : a); + }), e(); + }var N = "Velocity: First argument (" + y + ") was not a property map, a known action, or a registered redirect. Aborting.";return k.promise ? k.rejecter(new Error(N)) : console.log(N), e(); + }A = "start";}var L = { lastParent: null, lastPosition: null, lastFontSize: null, lastPercentToPxWidth: null, lastPercentToPxHeight: null, lastEmToPx: null, remToPx: null, vwToPx: null, vhToPx: null }, + R = [];f.each(g, function (e, t) { + m.isNode(t) && n.call(t); + });var z, + j = f.extend({}, b.defaults, v);if (j.loop = parseInt(j.loop), z = 2 * j.loop - 1, j.loop) for (var O = 0; z > O; O++) { + var q = { delay: j.delay, progress: j.progress };O === z - 1 && (q.display = j.display, q.visibility = j.visibility, q.complete = j.complete), P(g, "reverse", q); + }return e(); + } + };b = f.extend(P, b), b.animate = P;var w = t.requestAnimationFrame || g;return b.State.isMobile || r.hidden === a || r.addEventListener("visibilitychange", function () { + r.hidden ? (w = function (e) { + return setTimeout(function () { + e(!0); + }, 16); + }, c()) : w = t.requestAnimationFrame || g; + }), e.Velocity = b, e !== t && (e.fn.velocity = P, e.fn.velocity.defaults = b.defaults), f.each(["Down", "Up"], function (e, t) { + b.Redirects["slide" + t] = function (e, r, n, o, i, s) { + var l = f.extend({}, r), + u = l.begin, + c = l.complete, + p = { height: "", marginTop: "", marginBottom: "", paddingTop: "", paddingBottom: "" }, + d = {};l.display === a && (l.display = "Down" === t ? "inline" === b.CSS.Values.getDisplayType(e) ? "inline-block" : "block" : "none"), l.begin = function () { + u && u.call(i, i);for (var r in p) { + d[r] = e.style[r];var a = b.CSS.getPropertyValue(e, r);p[r] = "Down" === t ? [a, 0] : [0, a]; + }d.overflow = e.style.overflow, e.style.overflow = "hidden"; + }, l.complete = function () { + for (var t in d) { + e.style[t] = d[t]; + }c && c.call(i, i), s && s.resolver(i); + }, b(e, p, l); + }; + }), f.each(["In", "Out"], function (e, t) { + b.Redirects["fade" + t] = function (e, r, n, o, i, s) { + var l = f.extend({}, r), + u = { opacity: "In" === t ? 1 : 0 }, + c = l.complete;l.complete = n !== o - 1 ? l.begin = null : function () { + c && c.call(i, i), s && s.resolver(i); + }, l.display === a && (l.display = "In" === t ? "auto" : "none"), b(this, u, l); + }; + }), b; + }(window.jQuery || window.Zepto || window, window, document); +})); +;!function (a, b, c, d) { + "use strict"; + function k(a, b, c) { + return setTimeout(q(a, c), b); + }function l(a, b, c) { + return Array.isArray(a) ? (m(a, c[b], c), !0) : !1; + }function m(a, b, c) { + var e;if (a) if (a.forEach) a.forEach(b, c);else if (a.length !== d) for (e = 0; e < a.length;) { + b.call(c, a[e], e, a), e++; + } else for (e in a) { + a.hasOwnProperty(e) && b.call(c, a[e], e, a); + } + }function n(a, b, c) { + for (var e = Object.keys(b), f = 0; f < e.length;) { + (!c || c && a[e[f]] === d) && (a[e[f]] = b[e[f]]), f++; + }return a; + }function o(a, b) { + return n(a, b, !0); + }function p(a, b, c) { + var e, + d = b.prototype;e = a.prototype = Object.create(d), e.constructor = a, e._super = d, c && n(e, c); + }function q(a, b) { + return function () { + return a.apply(b, arguments); + }; + }function r(a, b) { + return typeof a == g ? a.apply(b ? b[0] || d : d, b) : a; + }function s(a, b) { + return a === d ? b : a; + }function t(a, b, c) { + m(x(b), function (b) { + a.addEventListener(b, c, !1); + }); + }function u(a, b, c) { + m(x(b), function (b) { + a.removeEventListener(b, c, !1); + }); + }function v(a, b) { + for (; a;) { + if (a == b) return !0;a = a.parentNode; + }return !1; + }function w(a, b) { + return a.indexOf(b) > -1; + }function x(a) { + return a.trim().split(/\s+/g); + }function y(a, b, c) { + if (a.indexOf && !c) return a.indexOf(b);for (var d = 0; d < a.length;) { + if (c && a[d][c] == b || !c && a[d] === b) return d;d++; + }return -1; + }function z(a) { + return Array.prototype.slice.call(a, 0); + }function A(a, b, c) { + for (var d = [], e = [], f = 0; f < a.length;) { + var g = b ? a[f][b] : a[f];y(e, g) < 0 && d.push(a[f]), e[f] = g, f++; + }return c && (d = b ? d.sort(function (a, c) { + return a[b] > c[b]; + }) : d.sort()), d; + }function B(a, b) { + for (var c, f, g = b[0].toUpperCase() + b.slice(1), h = 0; h < e.length;) { + if (c = e[h], f = c ? c + g : b, f in a) return f;h++; + }return d; + }function D() { + return C++; + }function E(a) { + var b = a.ownerDocument;return b.defaultView || b.parentWindow; + }function ab(a, b) { + var c = this;this.manager = a, this.callback = b, this.element = a.element, this.target = a.options.inputTarget, this.domHandler = function (b) { + r(a.options.enable, [a]) && c.handler(b); + }, this.init(); + }function bb(a) { + var b, + c = a.options.inputClass;return b = c ? c : H ? wb : I ? Eb : G ? Gb : rb, new b(a, cb); + }function cb(a, b, c) { + var d = c.pointers.length, + e = c.changedPointers.length, + f = b & O && 0 === d - e, + g = b & (Q | R) && 0 === d - e;c.isFirst = !!f, c.isFinal = !!g, f && (a.session = {}), c.eventType = b, db(a, c), a.emit("hammer.input", c), a.recognize(c), a.session.prevInput = c; + }function db(a, b) { + var c = a.session, + d = b.pointers, + e = d.length;c.firstInput || (c.firstInput = gb(b)), e > 1 && !c.firstMultiple ? c.firstMultiple = gb(b) : 1 === e && (c.firstMultiple = !1);var f = c.firstInput, + g = c.firstMultiple, + h = g ? g.center : f.center, + i = b.center = hb(d);b.timeStamp = j(), b.deltaTime = b.timeStamp - f.timeStamp, b.angle = lb(h, i), b.distance = kb(h, i), eb(c, b), b.offsetDirection = jb(b.deltaX, b.deltaY), b.scale = g ? nb(g.pointers, d) : 1, b.rotation = g ? mb(g.pointers, d) : 0, fb(c, b);var k = a.element;v(b.srcEvent.target, k) && (k = b.srcEvent.target), b.target = k; + }function eb(a, b) { + var c = b.center, + d = a.offsetDelta || {}, + e = a.prevDelta || {}, + f = a.prevInput || {};(b.eventType === O || f.eventType === Q) && (e = a.prevDelta = { x: f.deltaX || 0, y: f.deltaY || 0 }, d = a.offsetDelta = { x: c.x, y: c.y }), b.deltaX = e.x + (c.x - d.x), b.deltaY = e.y + (c.y - d.y); + }function fb(a, b) { + var f, + g, + h, + j, + c = a.lastInterval || b, + e = b.timeStamp - c.timeStamp;if (b.eventType != R && (e > N || c.velocity === d)) { + var k = c.deltaX - b.deltaX, + l = c.deltaY - b.deltaY, + m = ib(e, k, l);g = m.x, h = m.y, f = i(m.x) > i(m.y) ? m.x : m.y, j = jb(k, l), a.lastInterval = b; + } else f = c.velocity, g = c.velocityX, h = c.velocityY, j = c.direction;b.velocity = f, b.velocityX = g, b.velocityY = h, b.direction = j; + }function gb(a) { + for (var b = [], c = 0; c < a.pointers.length;) { + b[c] = { clientX: h(a.pointers[c].clientX), clientY: h(a.pointers[c].clientY) }, c++; + }return { timeStamp: j(), pointers: b, center: hb(b), deltaX: a.deltaX, deltaY: a.deltaY }; + }function hb(a) { + var b = a.length;if (1 === b) return { x: h(a[0].clientX), y: h(a[0].clientY) };for (var c = 0, d = 0, e = 0; b > e;) { + c += a[e].clientX, d += a[e].clientY, e++; + }return { x: h(c / b), y: h(d / b) }; + }function ib(a, b, c) { + return { x: b / a || 0, y: c / a || 0 }; + }function jb(a, b) { + return a === b ? S : i(a) >= i(b) ? a > 0 ? T : U : b > 0 ? V : W; + }function kb(a, b, c) { + c || (c = $);var d = b[c[0]] - a[c[0]], + e = b[c[1]] - a[c[1]];return Math.sqrt(d * d + e * e); + }function lb(a, b, c) { + c || (c = $);var d = b[c[0]] - a[c[0]], + e = b[c[1]] - a[c[1]];return 180 * Math.atan2(e, d) / Math.PI; + }function mb(a, b) { + return lb(b[1], b[0], _) - lb(a[1], a[0], _); + }function nb(a, b) { + return kb(b[0], b[1], _) / kb(a[0], a[1], _); + }function rb() { + this.evEl = pb, this.evWin = qb, this.allow = !0, this.pressed = !1, ab.apply(this, arguments); + }function wb() { + this.evEl = ub, this.evWin = vb, ab.apply(this, arguments), this.store = this.manager.session.pointerEvents = []; + }function Ab() { + this.evTarget = yb, this.evWin = zb, this.started = !1, ab.apply(this, arguments); + }function Bb(a, b) { + var c = z(a.touches), + d = z(a.changedTouches);return b & (Q | R) && (c = A(c.concat(d), "identifier", !0)), [c, d]; + }function Eb() { + this.evTarget = Db, this.targetIds = {}, ab.apply(this, arguments); + }function Fb(a, b) { + var c = z(a.touches), + d = this.targetIds;if (b & (O | P) && 1 === c.length) return d[c[0].identifier] = !0, [c, c];var e, + f, + g = z(a.changedTouches), + h = [], + i = this.target;if (f = c.filter(function (a) { + return v(a.target, i); + }), b === O) for (e = 0; e < f.length;) { + d[f[e].identifier] = !0, e++; + }for (e = 0; e < g.length;) { + d[g[e].identifier] && h.push(g[e]), b & (Q | R) && delete d[g[e].identifier], e++; + }return h.length ? [A(f.concat(h), "identifier", !0), h] : void 0; + }function Gb() { + ab.apply(this, arguments);var a = q(this.handler, this);this.touch = new Eb(this.manager, a), this.mouse = new rb(this.manager, a); + }function Pb(a, b) { + this.manager = a, this.set(b); + }function Qb(a) { + if (w(a, Mb)) return Mb;var b = w(a, Nb), + c = w(a, Ob);return b && c ? Nb + " " + Ob : b || c ? b ? Nb : Ob : w(a, Lb) ? Lb : Kb; + }function Yb(a) { + this.id = D(), this.manager = null, this.options = o(a || {}, this.defaults), this.options.enable = s(this.options.enable, !0), this.state = Rb, this.simultaneous = {}, this.requireFail = []; + }function Zb(a) { + return a & Wb ? "cancel" : a & Ub ? "end" : a & Tb ? "move" : a & Sb ? "start" : ""; + }function $b(a) { + return a == W ? "down" : a == V ? "up" : a == T ? "left" : a == U ? "right" : ""; + }function _b(a, b) { + var c = b.manager;return c ? c.get(a) : a; + }function ac() { + Yb.apply(this, arguments); + }function bc() { + ac.apply(this, arguments), this.pX = null, this.pY = null; + }function cc() { + ac.apply(this, arguments); + }function dc() { + Yb.apply(this, arguments), this._timer = null, this._input = null; + }function ec() { + ac.apply(this, arguments); + }function fc() { + ac.apply(this, arguments); + }function gc() { + Yb.apply(this, arguments), this.pTime = !1, this.pCenter = !1, this._timer = null, this._input = null, this.count = 0; + }function hc(a, b) { + return b = b || {}, b.recognizers = s(b.recognizers, hc.defaults.preset), new kc(a, b); + }function kc(a, b) { + b = b || {}, this.options = o(b, hc.defaults), this.options.inputTarget = this.options.inputTarget || a, this.handlers = {}, this.session = {}, this.recognizers = [], this.element = a, this.input = bb(this), this.touchAction = new Pb(this, this.options.touchAction), lc(this, !0), m(b.recognizers, function (a) { + var b = this.add(new a[0](a[1]));a[2] && b.recognizeWith(a[2]), a[3] && b.requireFailure(a[3]); + }, this); + }function lc(a, b) { + var c = a.element;m(a.options.cssProps, function (a, d) { + c.style[B(c.style, d)] = b ? a : ""; + }); + }function mc(a, c) { + var d = b.createEvent("Event");d.initEvent(a, !0, !0), d.gesture = c, c.target.dispatchEvent(d); + }var e = ["", "webkit", "moz", "MS", "ms", "o"], + f = b.createElement("div"), + g = "function", + h = Math.round, + i = Math.abs, + j = Date.now, + C = 1, + F = /mobile|tablet|ip(ad|hone|od)|android/i, + G = "ontouchstart" in a, + H = B(a, "PointerEvent") !== d, + I = G && F.test(navigator.userAgent), + J = "touch", + K = "pen", + L = "mouse", + M = "kinect", + N = 25, + O = 1, + P = 2, + Q = 4, + R = 8, + S = 1, + T = 2, + U = 4, + V = 8, + W = 16, + X = T | U, + Y = V | W, + Z = X | Y, + $ = ["x", "y"], + _ = ["clientX", "clientY"];ab.prototype = { handler: function () {}, init: function () { + this.evEl && t(this.element, this.evEl, this.domHandler), this.evTarget && t(this.target, this.evTarget, this.domHandler), this.evWin && t(E(this.element), this.evWin, this.domHandler); + }, destroy: function () { + this.evEl && u(this.element, this.evEl, this.domHandler), this.evTarget && u(this.target, this.evTarget, this.domHandler), this.evWin && u(E(this.element), this.evWin, this.domHandler); + } };var ob = { mousedown: O, mousemove: P, mouseup: Q }, + pb = "mousedown", + qb = "mousemove mouseup";p(rb, ab, { handler: function (a) { + var b = ob[a.type];b & O && 0 === a.button && (this.pressed = !0), b & P && 1 !== a.which && (b = Q), this.pressed && this.allow && (b & Q && (this.pressed = !1), this.callback(this.manager, b, { pointers: [a], changedPointers: [a], pointerType: L, srcEvent: a })); + } });var sb = { pointerdown: O, pointermove: P, pointerup: Q, pointercancel: R, pointerout: R }, + tb = { 2: J, 3: K, 4: L, 5: M }, + ub = "pointerdown", + vb = "pointermove pointerup pointercancel";a.MSPointerEvent && (ub = "MSPointerDown", vb = "MSPointerMove MSPointerUp MSPointerCancel"), p(wb, ab, { handler: function (a) { + var b = this.store, + c = !1, + d = a.type.toLowerCase().replace("ms", ""), + e = sb[d], + f = tb[a.pointerType] || a.pointerType, + g = f == J, + h = y(b, a.pointerId, "pointerId");e & O && (0 === a.button || g) ? 0 > h && (b.push(a), h = b.length - 1) : e & (Q | R) && (c = !0), 0 > h || (b[h] = a, this.callback(this.manager, e, { pointers: b, changedPointers: [a], pointerType: f, srcEvent: a }), c && b.splice(h, 1)); + } });var xb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R }, + yb = "touchstart", + zb = "touchstart touchmove touchend touchcancel";p(Ab, ab, { handler: function (a) { + var b = xb[a.type];if (b === O && (this.started = !0), this.started) { + var c = Bb.call(this, a, b);b & (Q | R) && 0 === c[0].length - c[1].length && (this.started = !1), this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a }); + } + } });var Cb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R }, + Db = "touchstart touchmove touchend touchcancel";p(Eb, ab, { handler: function (a) { + var b = Cb[a.type], + c = Fb.call(this, a, b);c && this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a }); + } }), p(Gb, ab, { handler: function (a, b, c) { + var d = c.pointerType == J, + e = c.pointerType == L;if (d) this.mouse.allow = !1;else if (e && !this.mouse.allow) return;b & (Q | R) && (this.mouse.allow = !0), this.callback(a, b, c); + }, destroy: function () { + this.touch.destroy(), this.mouse.destroy(); + } });var Hb = B(f.style, "touchAction"), + Ib = Hb !== d, + Jb = "compute", + Kb = "auto", + Lb = "manipulation", + Mb = "none", + Nb = "pan-x", + Ob = "pan-y";Pb.prototype = { set: function (a) { + a == Jb && (a = this.compute()), Ib && (this.manager.element.style[Hb] = a), this.actions = a.toLowerCase().trim(); + }, update: function () { + this.set(this.manager.options.touchAction); + }, compute: function () { + var a = [];return m(this.manager.recognizers, function (b) { + r(b.options.enable, [b]) && (a = a.concat(b.getTouchAction())); + }), Qb(a.join(" ")); + }, preventDefaults: function (a) { + if (!Ib) { + var b = a.srcEvent, + c = a.offsetDirection;if (this.manager.session.prevented) return b.preventDefault(), void 0;var d = this.actions, + e = w(d, Mb), + f = w(d, Ob), + g = w(d, Nb);return e || f && c & X || g && c & Y ? this.preventSrc(b) : void 0; + } + }, preventSrc: function (a) { + this.manager.session.prevented = !0, a.preventDefault(); + } };var Rb = 1, + Sb = 2, + Tb = 4, + Ub = 8, + Vb = Ub, + Wb = 16, + Xb = 32;Yb.prototype = { defaults: {}, set: function (a) { + return n(this.options, a), this.manager && this.manager.touchAction.update(), this; + }, recognizeWith: function (a) { + if (l(a, "recognizeWith", this)) return this;var b = this.simultaneous;return a = _b(a, this), b[a.id] || (b[a.id] = a, a.recognizeWith(this)), this; + }, dropRecognizeWith: function (a) { + return l(a, "dropRecognizeWith", this) ? this : (a = _b(a, this), delete this.simultaneous[a.id], this); + }, requireFailure: function (a) { + if (l(a, "requireFailure", this)) return this;var b = this.requireFail;return a = _b(a, this), -1 === y(b, a) && (b.push(a), a.requireFailure(this)), this; + }, dropRequireFailure: function (a) { + if (l(a, "dropRequireFailure", this)) return this;a = _b(a, this);var b = y(this.requireFail, a);return b > -1 && this.requireFail.splice(b, 1), this; + }, hasRequireFailures: function () { + return this.requireFail.length > 0; + }, canRecognizeWith: function (a) { + return !!this.simultaneous[a.id]; + }, emit: function (a) { + function d(d) { + b.manager.emit(b.options.event + (d ? Zb(c) : ""), a); + }var b = this, + c = this.state;Ub > c && d(!0), d(), c >= Ub && d(!0); + }, tryEmit: function (a) { + return this.canEmit() ? this.emit(a) : (this.state = Xb, void 0); + }, canEmit: function () { + for (var a = 0; a < this.requireFail.length;) { + if (!(this.requireFail[a].state & (Xb | Rb))) return !1;a++; + }return !0; + }, recognize: function (a) { + var b = n({}, a);return r(this.options.enable, [this, b]) ? (this.state & (Vb | Wb | Xb) && (this.state = Rb), this.state = this.process(b), this.state & (Sb | Tb | Ub | Wb) && this.tryEmit(b), void 0) : (this.reset(), this.state = Xb, void 0); + }, process: function () {}, getTouchAction: function () {}, reset: function () {} }, p(ac, Yb, { defaults: { pointers: 1 }, attrTest: function (a) { + var b = this.options.pointers;return 0 === b || a.pointers.length === b; + }, process: function (a) { + var b = this.state, + c = a.eventType, + d = b & (Sb | Tb), + e = this.attrTest(a);return d && (c & R || !e) ? b | Wb : d || e ? c & Q ? b | Ub : b & Sb ? b | Tb : Sb : Xb; + } }), p(bc, ac, { defaults: { event: "pan", threshold: 10, pointers: 1, direction: Z }, getTouchAction: function () { + var a = this.options.direction, + b = [];return a & X && b.push(Ob), a & Y && b.push(Nb), b; + }, directionTest: function (a) { + var b = this.options, + c = !0, + d = a.distance, + e = a.direction, + f = a.deltaX, + g = a.deltaY;return e & b.direction || (b.direction & X ? (e = 0 === f ? S : 0 > f ? T : U, c = f != this.pX, d = Math.abs(a.deltaX)) : (e = 0 === g ? S : 0 > g ? V : W, c = g != this.pY, d = Math.abs(a.deltaY))), a.direction = e, c && d > b.threshold && e & b.direction; + }, attrTest: function (a) { + return ac.prototype.attrTest.call(this, a) && (this.state & Sb || !(this.state & Sb) && this.directionTest(a)); + }, emit: function (a) { + this.pX = a.deltaX, this.pY = a.deltaY;var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this._super.emit.call(this, a); + } }), p(cc, ac, { defaults: { event: "pinch", threshold: 0, pointers: 2 }, getTouchAction: function () { + return [Mb]; + }, attrTest: function (a) { + return this._super.attrTest.call(this, a) && (Math.abs(a.scale - 1) > this.options.threshold || this.state & Sb); + }, emit: function (a) { + if (this._super.emit.call(this, a), 1 !== a.scale) { + var b = a.scale < 1 ? "in" : "out";this.manager.emit(this.options.event + b, a); + } + } }), p(dc, Yb, { defaults: { event: "press", pointers: 1, time: 500, threshold: 5 }, getTouchAction: function () { + return [Kb]; + }, process: function (a) { + var b = this.options, + c = a.pointers.length === b.pointers, + d = a.distance < b.threshold, + e = a.deltaTime > b.time;if (this._input = a, !d || !c || a.eventType & (Q | R) && !e) this.reset();else if (a.eventType & O) this.reset(), this._timer = k(function () { + this.state = Vb, this.tryEmit(); + }, b.time, this);else if (a.eventType & Q) return Vb;return Xb; + }, reset: function () { + clearTimeout(this._timer); + }, emit: function (a) { + this.state === Vb && (a && a.eventType & Q ? this.manager.emit(this.options.event + "up", a) : (this._input.timeStamp = j(), this.manager.emit(this.options.event, this._input))); + } }), p(ec, ac, { defaults: { event: "rotate", threshold: 0, pointers: 2 }, getTouchAction: function () { + return [Mb]; + }, attrTest: function (a) { + return this._super.attrTest.call(this, a) && (Math.abs(a.rotation) > this.options.threshold || this.state & Sb); + } }), p(fc, ac, { defaults: { event: "swipe", threshold: 10, velocity: .65, direction: X | Y, pointers: 1 }, getTouchAction: function () { + return bc.prototype.getTouchAction.call(this); + }, attrTest: function (a) { + var c, + b = this.options.direction;return b & (X | Y) ? c = a.velocity : b & X ? c = a.velocityX : b & Y && (c = a.velocityY), this._super.attrTest.call(this, a) && b & a.direction && a.distance > this.options.threshold && i(c) > this.options.velocity && a.eventType & Q; + }, emit: function (a) { + var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this.manager.emit(this.options.event, a); + } }), p(gc, Yb, { defaults: { event: "tap", pointers: 1, taps: 1, interval: 300, time: 250, threshold: 2, posThreshold: 10 }, getTouchAction: function () { + return [Lb]; + }, process: function (a) { + var b = this.options, + c = a.pointers.length === b.pointers, + d = a.distance < b.threshold, + e = a.deltaTime < b.time;if (this.reset(), a.eventType & O && 0 === this.count) return this.failTimeout();if (d && e && c) { + if (a.eventType != Q) return this.failTimeout();var f = this.pTime ? a.timeStamp - this.pTime < b.interval : !0, + g = !this.pCenter || kb(this.pCenter, a.center) < b.posThreshold;this.pTime = a.timeStamp, this.pCenter = a.center, g && f ? this.count += 1 : this.count = 1, this._input = a;var h = this.count % b.taps;if (0 === h) return this.hasRequireFailures() ? (this._timer = k(function () { + this.state = Vb, this.tryEmit(); + }, b.interval, this), Sb) : Vb; + }return Xb; + }, failTimeout: function () { + return this._timer = k(function () { + this.state = Xb; + }, this.options.interval, this), Xb; + }, reset: function () { + clearTimeout(this._timer); + }, emit: function () { + this.state == Vb && (this._input.tapCount = this.count, this.manager.emit(this.options.event, this._input)); + } }), hc.VERSION = "2.0.4", hc.defaults = { domEvents: !1, touchAction: Jb, enable: !0, inputTarget: null, inputClass: null, preset: [[ec, { enable: !1 }], [cc, { enable: !1 }, ["rotate"]], [fc, { direction: X }], [bc, { direction: X }, ["swipe"]], [gc], [gc, { event: "doubletap", taps: 2 }, ["tap"]], [dc]], cssProps: { userSelect: "default", touchSelect: "none", touchCallout: "none", contentZooming: "none", userDrag: "none", tapHighlightColor: "rgba(0,0,0,0)" } };var ic = 1, + jc = 2;kc.prototype = { set: function (a) { + return n(this.options, a), a.touchAction && this.touchAction.update(), a.inputTarget && (this.input.destroy(), this.input.target = a.inputTarget, this.input.init()), this; + }, stop: function (a) { + this.session.stopped = a ? jc : ic; + }, recognize: function (a) { + var b = this.session;if (!b.stopped) { + this.touchAction.preventDefaults(a);var c, + d = this.recognizers, + e = b.curRecognizer;(!e || e && e.state & Vb) && (e = b.curRecognizer = null);for (var f = 0; f < d.length;) { + c = d[f], b.stopped === jc || e && c != e && !c.canRecognizeWith(e) ? c.reset() : c.recognize(a), !e && c.state & (Sb | Tb | Ub) && (e = b.curRecognizer = c), f++; + } + } + }, get: function (a) { + if (a instanceof Yb) return a;for (var b = this.recognizers, c = 0; c < b.length; c++) { + if (b[c].options.event == a) return b[c]; + }return null; + }, add: function (a) { + if (l(a, "add", this)) return this;var b = this.get(a.options.event);return b && this.remove(b), this.recognizers.push(a), a.manager = this, this.touchAction.update(), a; + }, remove: function (a) { + if (l(a, "remove", this)) return this;var b = this.recognizers;return a = this.get(a), b.splice(y(b, a), 1), this.touchAction.update(), this; + }, on: function (a, b) { + var c = this.handlers;return m(x(a), function (a) { + c[a] = c[a] || [], c[a].push(b); + }), this; + }, off: function (a, b) { + var c = this.handlers;return m(x(a), function (a) { + b ? c[a].splice(y(c[a], b), 1) : delete c[a]; + }), this; + }, emit: function (a, b) { + this.options.domEvents && mc(a, b);var c = this.handlers[a] && this.handlers[a].slice();if (c && c.length) { + b.type = a, b.preventDefault = function () { + b.srcEvent.preventDefault(); + };for (var d = 0; d < c.length;) { + c[d](b), d++; + } + } + }, destroy: function () { + this.element && lc(this, !1), this.handlers = {}, this.session = {}, this.input.destroy(), this.element = null; + } }, n(hc, { INPUT_START: O, INPUT_MOVE: P, INPUT_END: Q, INPUT_CANCEL: R, STATE_POSSIBLE: Rb, STATE_BEGAN: Sb, STATE_CHANGED: Tb, STATE_ENDED: Ub, STATE_RECOGNIZED: Vb, STATE_CANCELLED: Wb, STATE_FAILED: Xb, DIRECTION_NONE: S, DIRECTION_LEFT: T, DIRECTION_RIGHT: U, DIRECTION_UP: V, DIRECTION_DOWN: W, DIRECTION_HORIZONTAL: X, DIRECTION_VERTICAL: Y, DIRECTION_ALL: Z, Manager: kc, Input: ab, TouchAction: Pb, TouchInput: Eb, MouseInput: rb, PointerEventInput: wb, TouchMouseInput: Gb, SingleTouchInput: Ab, Recognizer: Yb, AttrRecognizer: ac, Tap: gc, Pan: bc, Swipe: fc, Pinch: cc, Rotate: ec, Press: dc, on: t, off: u, each: m, merge: o, extend: n, inherit: p, bindFn: q, prefixed: B }), typeof define == g && define.amd ? define(function () { + return hc; + }) : "undefined" != typeof module && module.exports ? module.exports = hc : a[c] = hc; +}(window, document, "Hammer");;(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['jquery', 'hammerjs'], factory); + } else if (typeof exports === 'object') { + factory(require('jquery'), require('hammerjs')); + } else { + factory(jQuery, Hammer); + } +})(function ($, Hammer) { + function hammerify(el, options) { + var $el = $(el); + if (!$el.data("hammer")) { + $el.data("hammer", new Hammer($el[0], options)); + } + } + + $.fn.hammer = function (options) { + return this.each(function () { + hammerify(this, options); + }); + }; + + // extend the emit method to also trigger jQuery events + Hammer.Manager.prototype.emit = function (originalEmit) { + return function (type, data) { + originalEmit.call(this, type, data); + $(this.element).trigger({ + type: type, + gesture: data + }); + }; + }(Hammer.Manager.prototype.emit); +}); +; // Required for Meteor package, the use of window prevents export by Meteor +(function (window) { + if (window.Package) { + Materialize = {}; + } else { + window.Materialize = {}; + } +})(window); + +if (typeof exports !== 'undefined' && !exports.nodeType) { + if (typeof module !== 'undefined' && !module.nodeType && module.exports) { + exports = module.exports = Materialize; + } + exports.default = Materialize; +} + +/* + * raf.js + * https://github.com/ngryman/raf.js + * + * original requestAnimationFrame polyfill by Erik Möller + * inspired from paul_irish gist and post + * + * Copyright (c) 2013 ngryman + * Licensed under the MIT license. + */ +(function (window) { + var lastTime = 0, + vendors = ['webkit', 'moz'], + requestAnimationFrame = window.requestAnimationFrame, + cancelAnimationFrame = window.cancelAnimationFrame, + i = vendors.length; + + // try to un-prefix existing raf + while (--i >= 0 && !requestAnimationFrame) { + requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame']; + cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame']; + } + + // polyfill with setTimeout fallback + // heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945 + if (!requestAnimationFrame || !cancelAnimationFrame) { + requestAnimationFrame = function (callback) { + var now = +Date.now(), + nextTime = Math.max(lastTime + 16, now); + return setTimeout(function () { + callback(lastTime = nextTime); + }, nextTime - now); + }; + + cancelAnimationFrame = clearTimeout; + } + + // export to window + window.requestAnimationFrame = requestAnimationFrame; + window.cancelAnimationFrame = cancelAnimationFrame; +})(window); + +/** + * Generate approximated selector string for a jQuery object + * @param {jQuery} obj jQuery object to be parsed + * @returns {string} + */ +Materialize.objectSelectorString = function (obj) { + var tagStr = obj.prop('tagName') || ''; + var idStr = obj.attr('id') || ''; + var classStr = obj.attr('class') || ''; + return (tagStr + idStr + classStr).replace(/\s/g, ''); +}; + +// Unique Random ID +Materialize.guid = function () { + function s4() { + return Math.floor((1 + Math.random()) * 0x10000).toString(16).substring(1); + } + return function () { + return s4() + s4() + '-' + s4() + '-' + s4() + '-' + s4() + '-' + s4() + s4() + s4(); + }; +}(); + +/** + * Escapes hash from special characters + * @param {string} hash String returned from this.hash + * @returns {string} + */ +Materialize.escapeHash = function (hash) { + return hash.replace(/(:|\.|\[|\]|,|=)/g, "\\$1"); +}; + +Materialize.elementOrParentIsFixed = function (element) { + var $element = $(element); + var $checkElements = $element.add($element.parents()); + var isFixed = false; + $checkElements.each(function () { + if ($(this).css("position") === "fixed") { + isFixed = true; + return false; + } + }); + return isFixed; +}; + +/** + * Get time in ms + * @license https://raw.github.com/jashkenas/underscore/master/LICENSE + * @type {function} + * @return {number} + */ +var getTime = Date.now || function () { + return new Date().getTime(); +}; + +/** + * Returns a function, that, when invoked, will only be triggered at most once + * during a given window of time. Normally, the throttled function will run + * as much as it can, without ever going more than once per `wait` duration; + * but if you'd like to disable the execution on the leading edge, pass + * `{leading: false}`. To disable execution on the trailing edge, ditto. + * @license https://raw.github.com/jashkenas/underscore/master/LICENSE + * @param {function} func + * @param {number} wait + * @param {Object=} options + * @returns {Function} + */ +Materialize.throttle = function (func, wait, options) { + var context, args, result; + var timeout = null; + var previous = 0; + options || (options = {}); + var later = function () { + previous = options.leading === false ? 0 : getTime(); + timeout = null; + result = func.apply(context, args); + context = args = null; + }; + return function () { + var now = getTime(); + if (!previous && options.leading === false) previous = now; + var remaining = wait - (now - previous); + context = this; + args = arguments; + if (remaining <= 0) { + clearTimeout(timeout); + timeout = null; + previous = now; + result = func.apply(context, args); + context = args = null; + } else if (!timeout && options.trailing !== false) { + timeout = setTimeout(later, remaining); + } + return result; + }; +}; + +// Velocity has conflicts when loaded with jQuery, this will check for it +// First, check if in noConflict mode +var Vel; +if (jQuery) { + Vel = jQuery.Velocity; +} else if ($) { + Vel = $.Velocity; +} else { + Vel = Velocity; +} + +if (Vel) { + Materialize.Vel = Vel; +} else { + Materialize.Vel = Velocity; +} +;(function ($) { + $.fn.collapsible = function (options, methodParam) { + var defaults = { + accordion: undefined, + onOpen: undefined, + onClose: undefined + }; + + var methodName = options; + options = $.extend(defaults, options); + + return this.each(function () { + + var $this = $(this); + + var $panel_headers = $(this).find('> li > .collapsible-header'); + + var collapsible_type = $this.data("collapsible"); + + /**************** + Helper Functions + ****************/ + + // Accordion Open + function accordionOpen(object) { + $panel_headers = $this.find('> li > .collapsible-header'); + if (object.hasClass('active')) { + object.parent().addClass('active'); + } else { + object.parent().removeClass('active'); + } + if (object.parent().hasClass('active')) { + object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () { + $(this).css('height', ''); + } }); + } else { + object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () { + $(this).css('height', ''); + } }); + } + + $panel_headers.not(object).removeClass('active').parent().removeClass('active'); + + // Close previously open accordion elements. + $panel_headers.not(object).parent().children('.collapsible-body').stop(true, false).each(function () { + if ($(this).is(':visible')) { + $(this).slideUp({ + duration: 350, + easing: "easeOutQuart", + queue: false, + complete: function () { + $(this).css('height', ''); + execCallbacks($(this).siblings('.collapsible-header')); + } + }); + } + }); + } + + // Expandable Open + function expandableOpen(object) { + if (object.hasClass('active')) { + object.parent().addClass('active'); + } else { + object.parent().removeClass('active'); + } + if (object.parent().hasClass('active')) { + object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () { + $(this).css('height', ''); + } }); + } else { + object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () { + $(this).css('height', ''); + } }); + } + } + + // Open collapsible. object: .collapsible-header + function collapsibleOpen(object, noToggle) { + if (!noToggle) { + object.toggleClass('active'); + } + + if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { + // Handle Accordion + accordionOpen(object); + } else { + // Handle Expandables + expandableOpen(object); + } + + execCallbacks(object); + } + + // Handle callbacks + function execCallbacks(object) { + if (object.hasClass('active')) { + if (typeof options.onOpen === "function") { + options.onOpen.call(this, object.parent()); + } + } else { + if (typeof options.onClose === "function") { + options.onClose.call(this, object.parent()); + } + } + } + + /** + * Check if object is children of panel header + * @param {Object} object Jquery object + * @return {Boolean} true if it is children + */ + function isChildrenOfPanelHeader(object) { + + var panelHeader = getPanelHeader(object); + + return panelHeader.length > 0; + } + + /** + * Get panel header from a children element + * @param {Object} object Jquery object + * @return {Object} panel header object + */ + function getPanelHeader(object) { + + return object.closest('li > .collapsible-header'); + } + + // Turn off any existing event handlers + function removeEventHandlers() { + $this.off('click.collapse', '> li > .collapsible-header'); + } + + /***** End Helper Functions *****/ + + // Methods + if (methodName === 'destroy') { + removeEventHandlers(); + return; + } else if (methodParam >= 0 && methodParam < $panel_headers.length) { + var $curr_header = $panel_headers.eq(methodParam); + if ($curr_header.length && (methodName === 'open' || methodName === 'close' && $curr_header.hasClass('active'))) { + collapsibleOpen($curr_header); + } + return; + } + + removeEventHandlers(); + + // Add click handler to only direct collapsible header children + $this.on('click.collapse', '> li > .collapsible-header', function (e) { + var element = $(e.target); + + if (isChildrenOfPanelHeader(element)) { + element = getPanelHeader(element); + } + + collapsibleOpen(element); + }); + + // Open first active + if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { + // Handle Accordion + collapsibleOpen($panel_headers.filter('.active').first(), true); + } else { + // Handle Expandables + $panel_headers.filter('.active').each(function () { + collapsibleOpen($(this), true); + }); + } + }); + }; + + $(document).ready(function () { + $('.collapsible').collapsible(); + }); +})(jQuery);;(function ($) { + + // Add posibility to scroll to selected option + // usefull for select for example + $.fn.scrollTo = function (elem) { + $(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top); + return this; + }; + + $.fn.dropdown = function (options) { + var defaults = { + inDuration: 300, + outDuration: 225, + constrainWidth: true, // Constrains width of dropdown to the activator + hover: false, + gutter: 0, // Spacing from edge + belowOrigin: false, + alignment: 'left', + stopPropagation: false + }; + + // Open dropdown. + if (options === "open") { + this.each(function () { + $(this).trigger('open'); + }); + return false; + } + + // Close dropdown. + if (options === "close") { + this.each(function () { + $(this).trigger('close'); + }); + return false; + } + + this.each(function () { + var origin = $(this); + var curr_options = $.extend({}, defaults, options); + var isFocused = false; + + // Dropdown menu + var activates = $("#" + origin.attr('data-activates')); + + function updateOptions() { + if (origin.data('induration') !== undefined) curr_options.inDuration = origin.data('induration'); + if (origin.data('outduration') !== undefined) curr_options.outDuration = origin.data('outduration'); + if (origin.data('constrainwidth') !== undefined) curr_options.constrainWidth = origin.data('constrainwidth'); + if (origin.data('hover') !== undefined) curr_options.hover = origin.data('hover'); + if (origin.data('gutter') !== undefined) curr_options.gutter = origin.data('gutter'); + if (origin.data('beloworigin') !== undefined) curr_options.belowOrigin = origin.data('beloworigin'); + if (origin.data('alignment') !== undefined) curr_options.alignment = origin.data('alignment'); + if (origin.data('stoppropagation') !== undefined) curr_options.stopPropagation = origin.data('stoppropagation'); + } + + updateOptions(); + + // Attach dropdown to its activator + origin.after(activates); + + /* + Helper function to position and resize dropdown. + Used in hover and click handler. + */ + function placeDropdown(eventType) { + // Check for simultaneous focus and click events. + if (eventType === 'focus') { + isFocused = true; + } + + // Check html data attributes + updateOptions(); + + // Set Dropdown state + activates.addClass('active'); + origin.addClass('active'); + + var originWidth = origin[0].getBoundingClientRect().width; + + // Constrain width + if (curr_options.constrainWidth === true) { + activates.css('width', originWidth); + } else { + activates.css('white-space', 'nowrap'); + } + + // Offscreen detection + var windowHeight = window.innerHeight; + var originHeight = origin.innerHeight(); + var offsetLeft = origin.offset().left; + var offsetTop = origin.offset().top - $(window).scrollTop(); + var currAlignment = curr_options.alignment; + var gutterSpacing = 0; + var leftPosition = 0; + + // Below Origin + var verticalOffset = 0; + if (curr_options.belowOrigin === true) { + verticalOffset = originHeight; + } + + // Check for scrolling positioned container. + var scrollYOffset = 0; + var scrollXOffset = 0; + var wrapper = origin.parent(); + if (!wrapper.is('body')) { + if (wrapper[0].scrollHeight > wrapper[0].clientHeight) { + scrollYOffset = wrapper[0].scrollTop; + } + if (wrapper[0].scrollWidth > wrapper[0].clientWidth) { + scrollXOffset = wrapper[0].scrollLeft; + } + } + + if (offsetLeft + activates.innerWidth() > $(window).width()) { + // Dropdown goes past screen on right, force right alignment + currAlignment = 'right'; + } else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) { + // Dropdown goes past screen on left, force left alignment + currAlignment = 'left'; + } + // Vertical bottom offscreen detection + if (offsetTop + activates.innerHeight() > windowHeight) { + // If going upwards still goes offscreen, just crop height of dropdown. + if (offsetTop + originHeight - activates.innerHeight() < 0) { + var adjustedHeight = windowHeight - offsetTop - verticalOffset; + activates.css('max-height', adjustedHeight); + } else { + // Flow upwards. + if (!verticalOffset) { + verticalOffset += originHeight; + } + verticalOffset -= activates.innerHeight(); + } + } + + // Handle edge alignment + if (currAlignment === 'left') { + gutterSpacing = curr_options.gutter; + leftPosition = origin.position().left + gutterSpacing; + } else if (currAlignment === 'right') { + // Material icons fix + activates.stop(true, true).css({ + opacity: 0, + left: 0 + }); + + var offsetRight = origin.position().left + originWidth - activates.width(); + gutterSpacing = -curr_options.gutter; + leftPosition = offsetRight + gutterSpacing; + } + + // Position dropdown + activates.css({ + position: 'absolute', + top: origin.position().top + verticalOffset + scrollYOffset, + left: leftPosition + scrollXOffset + }); + + // Show dropdown + activates.slideDown({ + queue: false, + duration: curr_options.inDuration, + easing: 'easeOutCubic', + complete: function () { + $(this).css('height', ''); + } + }).animate({ opacity: 1 }, { queue: false, duration: curr_options.inDuration, easing: 'easeOutSine' }); + + // Add click close handler to document + setTimeout(function () { + $(document).on('click.' + activates.attr('id'), function (e) { + hideDropdown(); + $(document).off('click.' + activates.attr('id')); + }); + }, 0); + } + + function hideDropdown() { + // Check for simultaneous focus and click events. + isFocused = false; + activates.fadeOut(curr_options.outDuration); + activates.removeClass('active'); + origin.removeClass('active'); + $(document).off('click.' + activates.attr('id')); + setTimeout(function () { + activates.css('max-height', ''); + }, curr_options.outDuration); + } + + // Hover + if (curr_options.hover) { + var open = false; + origin.off('click.' + origin.attr('id')); + // Hover handler to show dropdown + origin.on('mouseenter', function (e) { + // Mouse over + if (open === false) { + placeDropdown(); + open = true; + } + }); + origin.on('mouseleave', function (e) { + // If hover on origin then to something other than dropdown content, then close + var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element + if (!$(toEl).closest('.dropdown-content').is(activates)) { + activates.stop(true, true); + hideDropdown(); + open = false; + } + }); + + activates.on('mouseleave', function (e) { + // Mouse out + var toEl = e.toElement || e.relatedTarget; + if (!$(toEl).closest('.dropdown-button').is(origin)) { + activates.stop(true, true); + hideDropdown(); + open = false; + } + }); + + // Click + } else { + // Click handler to show dropdown + origin.off('click.' + origin.attr('id')); + origin.on('click.' + origin.attr('id'), function (e) { + if (!isFocused) { + if (origin[0] == e.currentTarget && !origin.hasClass('active') && $(e.target).closest('.dropdown-content').length === 0) { + e.preventDefault(); // Prevents button click from moving window + if (curr_options.stopPropagation) { + e.stopPropagation(); + } + placeDropdown('click'); + } + // If origin is clicked and menu is open, close menu + else if (origin.hasClass('active')) { + hideDropdown(); + $(document).off('click.' + activates.attr('id')); + } + } + }); + } // End else + + // Listen to open and close event - useful for select component + origin.on('open', function (e, eventType) { + placeDropdown(eventType); + }); + origin.on('close', hideDropdown); + }); + }; // End dropdown plugin + + $(document).ready(function () { + $('.dropdown-button').dropdown(); + }); +})(jQuery); +;(function ($, Vel) { + 'use strict'; + + var _defaults = { + opacity: 0.5, + inDuration: 250, + outDuration: 250, + ready: undefined, + complete: undefined, + dismissible: true, + startingTop: '4%', + endingTop: '10%' + }; + + /** + * @class + * + */ + + var Modal = function () { + /** + * Construct Modal instance and set up overlay + * @constructor + * @param {jQuery} $el + * @param {Object} options + */ + function Modal($el, options) { + _classCallCheck(this, Modal); + + // If exists, destroy and reinitialize + if (!!$el[0].M_Modal) { + $el[0].M_Modal.destroy(); + } + + /** + * The jQuery element + * @type {jQuery} + */ + this.$el = $el; + + /** + * Options for the modal + * @member Modal#options + * @prop {Number} [opacity=0.5] - Opacity of the modal overlay + * @prop {Number} [inDuration=250] - Length in ms of enter transition + * @prop {Number} [outDuration=250] - Length in ms of exit transition + * @prop {Function} ready - Callback function called when modal is finished entering + * @prop {Function} complete - Callback function called when modal is finished exiting + * @prop {Boolean} [dismissible=true] - Allow modal to be dismissed by keyboard or overlay click + * @prop {String} [startingTop='4%'] - startingTop + * @prop {String} [endingTop='10%'] - endingTop + */ + this.options = $.extend({}, Modal.defaults, options); + + /** + * Describes open/close state of modal + * @type {Boolean} + */ + this.isOpen = false; + + this.$el[0].M_Modal = this; + this.id = $el.attr('id'); + this.openingTrigger = undefined; + this.$overlay = $(''); + + Modal._increment++; + Modal._count++; + this.$overlay[0].style.zIndex = 1000 + Modal._increment * 2; + this.$el[0].style.zIndex = 1000 + Modal._increment * 2 + 1; + this.setupEventHandlers(); + } + + _createClass(Modal, [{ + key: 'getInstance', + + + /** + * Get Instance + */ + value: function getInstance() { + return this; + } + + /** + * Teardown component + */ + + }, { + key: 'destroy', + value: function destroy() { + this.removeEventHandlers(); + this.$el[0].removeAttribute('style'); + if (!!this.$overlay[0].parentNode) { + this.$overlay[0].parentNode.removeChild(this.$overlay[0]); + } + this.$el[0].M_Modal = undefined; + Modal._count--; + } + + /** + * Setup Event Handlers + */ + + }, { + key: 'setupEventHandlers', + value: function setupEventHandlers() { + this.handleOverlayClickBound = this.handleOverlayClick.bind(this); + this.handleModalCloseClickBound = this.handleModalCloseClick.bind(this); + + if (Modal._count === 1) { + document.body.addEventListener('click', this.handleTriggerClick); + } + this.$overlay[0].addEventListener('click', this.handleOverlayClickBound); + this.$el[0].addEventListener('click', this.handleModalCloseClickBound); + } + + /** + * Remove Event Handlers + */ + + }, { + key: 'removeEventHandlers', + value: function removeEventHandlers() { + if (Modal._count === 0) { + document.body.removeEventListener('click', this.handleTriggerClick); + } + this.$overlay[0].removeEventListener('click', this.handleOverlayClickBound); + this.$el[0].removeEventListener('click', this.handleModalCloseClickBound); + } + + /** + * Handle Trigger Click + * @param {Event} e + */ + + }, { + key: 'handleTriggerClick', + value: function handleTriggerClick(e) { + var $trigger = $(e.target).closest('.modal-trigger'); + if (e.target && $trigger.length) { + var modalId = $trigger[0].getAttribute('href'); + if (modalId) { + modalId = modalId.slice(1); + } else { + modalId = $trigger[0].getAttribute('data-target'); + } + var modalInstance = document.getElementById(modalId).M_Modal; + if (modalInstance) { + modalInstance.open($trigger); + } + e.preventDefault(); + } + } + + /** + * Handle Overlay Click + */ + + }, { + key: 'handleOverlayClick', + value: function handleOverlayClick() { + if (this.options.dismissible) { + this.close(); + } + } + + /** + * Handle Modal Close Click + * @param {Event} e + */ + + }, { + key: 'handleModalCloseClick', + value: function handleModalCloseClick(e) { + var $closeTrigger = $(e.target).closest('.modal-close'); + if (e.target && $closeTrigger.length) { + this.close(); + } + } + + /** + * Handle Keydown + * @param {Event} e + */ + + }, { + key: 'handleKeydown', + value: function handleKeydown(e) { + // ESC key + if (e.keyCode === 27 && this.options.dismissible) { + this.close(); + } + } + + /** + * Animate in modal + */ + + }, { + key: 'animateIn', + value: function animateIn() { + var _this = this; + + // Set initial styles + $.extend(this.$el[0].style, { + display: 'block', + opacity: 0 + }); + $.extend(this.$overlay[0].style, { + display: 'block', + opacity: 0 + }); + + // Animate overlay + Vel(this.$overlay[0], { opacity: this.options.opacity }, { duration: this.options.inDuration, queue: false, ease: 'easeOutCubic' }); + + // Define modal animation options + var enterVelocityOptions = { + duration: this.options.inDuration, + queue: false, + ease: 'easeOutCubic', + // Handle modal ready callback + complete: function () { + if (typeof _this.options.ready === 'function') { + _this.options.ready.call(_this, _this.$el, _this.openingTrigger); + } + } + }; + + // Bottom sheet animation + if (this.$el[0].classList.contains('bottom-sheet')) { + Vel(this.$el[0], { bottom: 0, opacity: 1 }, enterVelocityOptions); + + // Normal modal animation + } else { + Vel.hook(this.$el[0], 'scaleX', 0.7); + this.$el[0].style.top = this.options.startingTop; + Vel(this.$el[0], { top: this.options.endingTop, opacity: 1, scaleX: 1 }, enterVelocityOptions); + } + } + + /** + * Animate out modal + */ + + }, { + key: 'animateOut', + value: function animateOut() { + var _this2 = this; + + // Animate overlay + Vel(this.$overlay[0], { opacity: 0 }, { duration: this.options.outDuration, queue: false, ease: 'easeOutQuart' }); + + // Define modal animation options + var exitVelocityOptions = { + duration: this.options.outDuration, + queue: false, + ease: 'easeOutCubic', + // Handle modal ready callback + complete: function () { + _this2.$el[0].style.display = 'none'; + // Call complete callback + if (typeof _this2.options.complete === 'function') { + _this2.options.complete.call(_this2, _this2.$el); + } + _this2.$overlay[0].parentNode.removeChild(_this2.$overlay[0]); + } + }; + + // Bottom sheet animation + if (this.$el[0].classList.contains('bottom-sheet')) { + Vel(this.$el[0], { bottom: '-100%', opacity: 0 }, exitVelocityOptions); + + // Normal modal animation + } else { + Vel(this.$el[0], { top: this.options.startingTop, opacity: 0, scaleX: 0.7 }, exitVelocityOptions); + } + } + + /** + * Open Modal + * @param {jQuery} [$trigger] + */ + + }, { + key: 'open', + value: function open($trigger) { + if (this.isOpen) { + return; + } + + this.isOpen = true; + var body = document.body; + body.style.overflow = 'hidden'; + this.$el[0].classList.add('open'); + body.appendChild(this.$overlay[0]); + + // Set opening trigger, undefined indicates modal was opened by javascript + this.openingTrigger = !!$trigger ? $trigger : undefined; + + if (this.options.dismissible) { + this.handleKeydownBound = this.handleKeydown.bind(this); + document.addEventListener('keydown', this.handleKeydownBound); + } + + this.animateIn(); + + return this; + } + + /** + * Close Modal + */ + + }, { + key: 'close', + value: function close() { + if (!this.isOpen) { + return; + } + + this.isOpen = false; + this.$el[0].classList.remove('open'); + document.body.style.overflow = ''; + + if (this.options.dismissible) { + document.removeEventListener('keydown', this.handleKeydownBound); + } + + this.animateOut(); + + return this; + } + }], [{ + key: 'init', + value: function init($els, options) { + var arr = []; + $els.each(function () { + arr.push(new Modal($(this), options)); + }); + return arr; + } + }, { + key: 'defaults', + get: function () { + return _defaults; + } + }]); + + return Modal; + }(); + + /** + * @static + * @memberof Modal + */ + + + Modal._increment = 0; + + /** + * @static + * @memberof Modal + */ + Modal._count = 0; + + Materialize.Modal = Modal; + + $.fn.modal = function (methodOrOptions) { + // Call plugin method if valid method name is passed in + if (Modal.prototype[methodOrOptions]) { + // Getter methods + if (methodOrOptions.slice(0, 3) === 'get') { + return this.first()[0].M_Modal[methodOrOptions](); + + // Void methods + } else { + return this.each(function () { + this.M_Modal[methodOrOptions](); + }); + } + + // Initialize plugin if options or no argument is passed in + } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { + Modal.init(this, arguments[0]); + return this; + + // Return error if an unrecognized method name is passed in + } else { + $.error('Method ' + methodOrOptions + ' does not exist on jQuery.modal'); + } + }; +})(jQuery, Materialize.Vel); +;(function ($) { + + $.fn.materialbox = function () { + + return this.each(function () { + + if ($(this).hasClass('initialized')) { + return; + } + + $(this).addClass('initialized'); + + var overlayActive = false; + var doneAnimating = true; + var inDuration = 275; + var outDuration = 200; + var origin = $(this); + var placeholder = $('
').addClass('material-placeholder'); + var originalWidth = 0; + var originalHeight = 0; + var ancestorsChanged; + var ancestor; + var originInlineStyles = origin.attr('style'); + origin.wrap(placeholder); + + // Start click handler + origin.on('click', function () { + var placeholder = origin.parent('.material-placeholder'); + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var originalWidth = origin.width(); + var originalHeight = origin.height(); + + // If already modal, return to original + if (doneAnimating === false) { + returnToOriginal(); + return false; + } else if (overlayActive && doneAnimating === true) { + returnToOriginal(); + return false; + } + + // Set states + doneAnimating = false; + origin.addClass('active'); + overlayActive = true; + + // Set positioning for placeholder + placeholder.css({ + width: placeholder[0].getBoundingClientRect().width, + height: placeholder[0].getBoundingClientRect().height, + position: 'relative', + top: 0, + left: 0 + }); + + // Find ancestor with overflow: hidden; and remove it + ancestorsChanged = undefined; + ancestor = placeholder[0].parentNode; + var count = 0; + while (ancestor !== null && !$(ancestor).is(document)) { + var curr = $(ancestor); + if (curr.css('overflow') !== 'visible') { + curr.css('overflow', 'visible'); + if (ancestorsChanged === undefined) { + ancestorsChanged = curr; + } else { + ancestorsChanged = ancestorsChanged.add(curr); + } + } + ancestor = ancestor.parentNode; + } + + // Set css on origin + origin.css({ + position: 'absolute', + 'z-index': 1000, + 'will-change': 'left, top, width, height' + }).data('width', originalWidth).data('height', originalHeight); + + // Add overlay + var overlay = $('
').css({ + opacity: 0 + }).click(function () { + if (doneAnimating === true) returnToOriginal(); + }); + + // Put before in origin image to preserve z-index layering. + origin.before(overlay); + + // Set dimensions if needed + var overlayOffset = overlay[0].getBoundingClientRect(); + overlay.css({ + width: windowWidth, + height: windowHeight, + left: -1 * overlayOffset.left, + top: -1 * overlayOffset.top + }); + + // Animate Overlay + overlay.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' }); + + // Add and animate caption if it exists + if (origin.data('caption') !== "") { + var $photo_caption = $('
'); + $photo_caption.text(origin.data('caption')); + $('body').append($photo_caption); + $photo_caption.css({ "display": "inline" }); + $photo_caption.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' }); + } + + // Resize Image + var ratio = 0; + var widthPercent = originalWidth / windowWidth; + var heightPercent = originalHeight / windowHeight; + var newWidth = 0; + var newHeight = 0; + + if (widthPercent > heightPercent) { + ratio = originalHeight / originalWidth; + newWidth = windowWidth * 0.9; + newHeight = windowWidth * 0.9 * ratio; + } else { + ratio = originalWidth / originalHeight; + newWidth = windowHeight * 0.9 * ratio; + newHeight = windowHeight * 0.9; + } + + // Animate image + set z-index + if (origin.hasClass('responsive-img')) { + origin.velocity({ 'max-width': newWidth, 'width': originalWidth }, { duration: 0, queue: false, + complete: function () { + origin.css({ left: 0, top: 0 }).velocity({ + height: newHeight, + width: newWidth, + left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2, + top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2 + }, { + duration: inDuration, + queue: false, + easing: 'easeOutQuad', + complete: function () { + doneAnimating = true; + } + }); + } // End Complete + }); // End Velocity + } else { + origin.css('left', 0).css('top', 0).velocity({ + height: newHeight, + width: newWidth, + left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2, + top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2 + }, { + duration: inDuration, + queue: false, + easing: 'easeOutQuad', + complete: function () { + doneAnimating = true; + } + }); // End Velocity + } + + // Handle Exit triggers + $(window).on('scroll.materialbox', function () { + if (overlayActive) { + returnToOriginal(); + } + }); + + $(window).on('resize.materialbox', function () { + if (overlayActive) { + returnToOriginal(); + } + }); + + $(document).on('keyup.materialbox', function (e) { + // ESC key + if (e.keyCode === 27 && doneAnimating === true && overlayActive) { + returnToOriginal(); + } + }); + }); // End click handler + + + // This function returns the modaled image to the original spot + function returnToOriginal() { + + doneAnimating = false; + + var placeholder = origin.parent('.material-placeholder'); + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var originalWidth = origin.data('width'); + var originalHeight = origin.data('height'); + + origin.velocity("stop", true); + $('#materialbox-overlay').velocity("stop", true); + $('.materialbox-caption').velocity("stop", true); + + // disable exit handlers + $(window).off('scroll.materialbox'); + $(document).off('keyup.materialbox'); + $(window).off('resize.materialbox'); + + $('#materialbox-overlay').velocity({ opacity: 0 }, { + duration: outDuration, // Delay prevents animation overlapping + queue: false, easing: 'easeOutQuad', + complete: function () { + // Remove Overlay + overlayActive = false; + $(this).remove(); + } + }); + + // Resize Image + origin.velocity({ + width: originalWidth, + height: originalHeight, + left: 0, + top: 0 + }, { + duration: outDuration, + queue: false, easing: 'easeOutQuad', + complete: function () { + placeholder.css({ + height: '', + width: '', + position: '', + top: '', + left: '' + }); + + origin.removeAttr('style'); + origin.attr('style', originInlineStyles); + + // Remove class + origin.removeClass('active'); + doneAnimating = true; + + // Remove overflow overrides on ancestors + if (ancestorsChanged) { + ancestorsChanged.css('overflow', ''); + } + } + }); + + // Remove Caption + reset css settings on image + $('.materialbox-caption').velocity({ opacity: 0 }, { + duration: outDuration, // Delay prevents animation overlapping + queue: false, easing: 'easeOutQuad', + complete: function () { + $(this).remove(); + } + }); + } + }); + }; + + $(document).ready(function () { + $('.materialboxed').materialbox(); + }); +})(jQuery); +;(function ($) { + + $.fn.parallax = function () { + var window_width = $(window).width(); + // Parallax Scripts + return this.each(function (i) { + var $this = $(this); + $this.addClass('parallax'); + + function updateParallax(initial) { + var container_height; + if (window_width < 601) { + container_height = $this.height() > 0 ? $this.height() : $this.children("img").height(); + } else { + container_height = $this.height() > 0 ? $this.height() : 500; + } + var $img = $this.children("img").first(); + var img_height = $img.height(); + var parallax_dist = img_height - container_height; + var bottom = $this.offset().top + container_height; + var top = $this.offset().top; + var scrollTop = $(window).scrollTop(); + var windowHeight = window.innerHeight; + var windowBottom = scrollTop + windowHeight; + var percentScrolled = (windowBottom - top) / (container_height + windowHeight); + var parallax = Math.round(parallax_dist * percentScrolled); + + if (initial) { + $img.css('display', 'block'); + } + if (bottom > scrollTop && top < scrollTop + windowHeight) { + $img.css('transform', "translate3D(-50%," + parallax + "px, 0)"); + } + } + + // Wait for image load + $this.children("img").one("load", function () { + updateParallax(true); + }).each(function () { + if (this.complete) $(this).trigger("load"); + }); + + $(window).scroll(function () { + window_width = $(window).width(); + updateParallax(false); + }); + + $(window).resize(function () { + window_width = $(window).width(); + updateParallax(false); + }); + }); + }; +})(jQuery); +;(function ($) { + + var methods = { + init: function (options) { + var defaults = { + onShow: null, + swipeable: false, + responsiveThreshold: Infinity // breakpoint for swipeable + }; + options = $.extend(defaults, options); + var namespace = Materialize.objectSelectorString($(this)); + + return this.each(function (i) { + + var uniqueNamespace = namespace + i; + + // For each set of tabs, we want to keep track of + // which tab is active and its associated content + var $this = $(this), + window_width = $(window).width(); + + var $active, + $content, + $links = $this.find('li.tab a'), + $tabs_width = $this.width(), + $tabs_content = $(), + $tabs_wrapper, + $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length, + $indicator, + index = 0, + prev_index = 0, + clicked = false, + clickedTimeout, + transition = 300; + + // Finds right attribute for indicator based on active tab. + // el: jQuery Object + var calcRightPos = function (el) { + return Math.ceil($tabs_width - el.position().left - el[0].getBoundingClientRect().width - $this.scrollLeft()); + }; + + // Finds left attribute for indicator based on active tab. + // el: jQuery Object + var calcLeftPos = function (el) { + return Math.floor(el.position().left + $this.scrollLeft()); + }; + + // Animates Indicator to active tab. + // prev_index: Number + var animateIndicator = function (prev_index) { + if (index - prev_index >= 0) { + $indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' }); + $indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 }); + } else { + $indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' }); + $indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 }); + } + }; + + // Change swipeable according to responsive threshold + if (options.swipeable) { + if (window_width > options.responsiveThreshold) { + options.swipeable = false; + } + } + + // If the location.hash matches one of the links, use that as the active tab. + $active = $($links.filter('[href="' + location.hash + '"]')); + + // If no match is found, use the first link or any with class 'active' as the initial active tab. + if ($active.length === 0) { + $active = $(this).find('li.tab a.active').first(); + } + if ($active.length === 0) { + $active = $(this).find('li.tab a').first(); + } + + $active.addClass('active'); + index = $links.index($active); + if (index < 0) { + index = 0; + } + + if ($active[0] !== undefined) { + $content = $($active[0].hash); + $content.addClass('active'); + } + + // append indicator then set indicator width to tab width + if (!$this.find('.indicator').length) { + $this.append('
  • '); + } + $indicator = $this.find('.indicator'); + + // we make sure that the indicator is at the end of the tabs + $this.append($indicator); + + if ($this.is(":visible")) { + // $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)}); + // $indicator.css({"left": index * $tab_width}); + setTimeout(function () { + $indicator.css({ "right": calcRightPos($active) }); + $indicator.css({ "left": calcLeftPos($active) }); + }, 0); + } + $(window).off('resize.tabs-' + uniqueNamespace).on('resize.tabs-' + uniqueNamespace, function () { + $tabs_width = $this.width(); + $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length; + if (index < 0) { + index = 0; + } + if ($tab_width !== 0 && $tabs_width !== 0) { + $indicator.css({ "right": calcRightPos($active) }); + $indicator.css({ "left": calcLeftPos($active) }); + } + }); + + // Initialize Tabs Content. + if (options.swipeable) { + // TODO: Duplicate calls with swipeable? handle multiple div wrapping. + $links.each(function () { + var $curr_content = $(Materialize.escapeHash(this.hash)); + $curr_content.addClass('carousel-item'); + $tabs_content = $tabs_content.add($curr_content); + }); + $tabs_wrapper = $tabs_content.wrapAll(''); + $tabs_content.css('display', ''); + $('.tabs-content.carousel').carousel({ + fullWidth: true, + noWrap: true, + onCycleTo: function (item) { + if (!clicked) { + var prev_index = index; + index = $tabs_wrapper.index(item); + $active.removeClass('active'); + $active = $links.eq(index); + $active.addClass('active'); + animateIndicator(prev_index); + if (typeof options.onShow === "function") { + options.onShow.call($this[0], $content); + } + } + } + }); + } else { + // Hide the remaining content + $links.not($active).each(function () { + $(Materialize.escapeHash(this.hash)).hide(); + }); + } + + // Bind the click event handler + $this.off('click.tabs').on('click.tabs', 'a', function (e) { + if ($(this).parent().hasClass('disabled')) { + e.preventDefault(); + return; + } + + // Act as regular link if target attribute is specified. + if (!!$(this).attr("target")) { + return; + } + + clicked = true; + $tabs_width = $this.width(); + $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length; + + // Make the old tab inactive. + $active.removeClass('active'); + var $oldContent = $content; + + // Update the variables with the new link and content + $active = $(this); + $content = $(Materialize.escapeHash(this.hash)); + $links = $this.find('li.tab a'); + var activeRect = $active.position(); + + // Make the tab active. + $active.addClass('active'); + prev_index = index; + index = $links.index($(this)); + if (index < 0) { + index = 0; + } + // Change url to current tab + // window.location.hash = $active.attr('href'); + + // Swap content + if (options.swipeable) { + if ($tabs_content.length) { + $tabs_content.carousel('set', index, function () { + if (typeof options.onShow === "function") { + options.onShow.call($this[0], $content); + } + }); + } + } else { + if ($content !== undefined) { + $content.show(); + $content.addClass('active'); + if (typeof options.onShow === "function") { + options.onShow.call(this, $content); + } + } + + if ($oldContent !== undefined && !$oldContent.is($content)) { + $oldContent.hide(); + $oldContent.removeClass('active'); + } + } + + // Reset clicked state + clickedTimeout = setTimeout(function () { + clicked = false; + }, transition); + + // Update indicator + animateIndicator(prev_index); + + // Prevent the anchor's default click action + e.preventDefault(); + }); + }); + }, + select_tab: function (id) { + this.find('a[href="#' + id + '"]').trigger('click'); + } + }; + + $.fn.tabs = function (methodOrOptions) { + if (methods[methodOrOptions]) { + return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1)); + } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { + // Default to "init" + return methods.init.apply(this, arguments); + } else { + $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tabs'); + } + }; + + $(document).ready(function () { + $('ul.tabs').tabs(); + }); +})(jQuery); +;(function ($) { + $.fn.tooltip = function (options) { + var timeout = null, + margin = 5; + + // Defaults + var defaults = { + delay: 350, + tooltip: '', + position: 'bottom', + html: false + }; + + // Remove tooltip from the activator + if (options === "remove") { + this.each(function () { + $('#' + $(this).attr('data-tooltip-id')).remove(); + $(this).removeAttr('data-tooltip-id'); + $(this).off('mouseenter.tooltip mouseleave.tooltip'); + }); + return false; + } + + options = $.extend(defaults, options); + + return this.each(function () { + var tooltipId = Materialize.guid(); + var origin = $(this); + + // Destroy old tooltip + if (origin.attr('data-tooltip-id')) { + $('#' + origin.attr('data-tooltip-id')).remove(); + } + + origin.attr('data-tooltip-id', tooltipId); + + // Get attributes. + var allowHtml, tooltipDelay, tooltipPosition, tooltipText, tooltipEl, backdrop; + var setAttributes = function () { + allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html; + tooltipDelay = origin.attr('data-delay'); + tooltipDelay = tooltipDelay === undefined || tooltipDelay === '' ? options.delay : tooltipDelay; + tooltipPosition = origin.attr('data-position'); + tooltipPosition = tooltipPosition === undefined || tooltipPosition === '' ? options.position : tooltipPosition; + tooltipText = origin.attr('data-tooltip'); + tooltipText = tooltipText === undefined || tooltipText === '' ? options.tooltip : tooltipText; + }; + setAttributes(); + + var renderTooltipEl = function () { + var tooltip = $('
    '); + + // Create Text span + if (allowHtml) { + tooltipText = $('').html(tooltipText); + } else { + tooltipText = $('').text(tooltipText); + } + + // Create tooltip + tooltip.append(tooltipText).appendTo($('body')).attr('id', tooltipId); + + // Create backdrop + backdrop = $('
    '); + backdrop.appendTo(tooltip); + return tooltip; + }; + tooltipEl = renderTooltipEl(); + + // Destroy previously binded events + origin.off('mouseenter.tooltip mouseleave.tooltip'); + // Mouse In + var started = false, + timeoutRef; + origin.on({ 'mouseenter.tooltip': function (e) { + var showTooltip = function () { + setAttributes(); + started = true; + tooltipEl.velocity('stop'); + backdrop.velocity('stop'); + tooltipEl.css({ visibility: 'visible', left: '0px', top: '0px' }); + + // Tooltip positioning + var originWidth = origin.outerWidth(); + var originHeight = origin.outerHeight(); + var tooltipHeight = tooltipEl.outerHeight(); + var tooltipWidth = tooltipEl.outerWidth(); + var tooltipVerticalMovement = '0px'; + var tooltipHorizontalMovement = '0px'; + var backdropOffsetWidth = backdrop[0].offsetWidth; + var backdropOffsetHeight = backdrop[0].offsetHeight; + var scaleXFactor = 8; + var scaleYFactor = 8; + var scaleFactor = 0; + var targetTop, targetLeft, newCoordinates; + + if (tooltipPosition === "top") { + // Top Position + targetTop = origin.offset().top - tooltipHeight - margin; + targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + tooltipVerticalMovement = '-10px'; + backdrop.css({ + bottom: 0, + left: 0, + borderRadius: '14px 14px 0 0', + transformOrigin: '50% 100%', + marginTop: tooltipHeight, + marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2 + }); + } + // Left Position + else if (tooltipPosition === "left") { + targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2; + targetLeft = origin.offset().left - tooltipWidth - margin; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + + tooltipHorizontalMovement = '-10px'; + backdrop.css({ + top: '-7px', + right: 0, + width: '14px', + height: '14px', + borderRadius: '14px 0 0 14px', + transformOrigin: '95% 50%', + marginTop: tooltipHeight / 2, + marginLeft: tooltipWidth + }); + } + // Right Position + else if (tooltipPosition === "right") { + targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2; + targetLeft = origin.offset().left + originWidth + margin; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + + tooltipHorizontalMovement = '+10px'; + backdrop.css({ + top: '-7px', + left: 0, + width: '14px', + height: '14px', + borderRadius: '0 14px 14px 0', + transformOrigin: '5% 50%', + marginTop: tooltipHeight / 2, + marginLeft: '0px' + }); + } else { + // Bottom Position + targetTop = origin.offset().top + origin.outerHeight() + margin; + targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + tooltipVerticalMovement = '+10px'; + backdrop.css({ + top: 0, + left: 0, + marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2 + }); + } + + // Set tooptip css placement + tooltipEl.css({ + top: newCoordinates.y, + left: newCoordinates.x + }); + + // Calculate Scale to fill + scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth); + scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight); + scaleFactor = Math.max(scaleXFactor, scaleYFactor); + + tooltipEl.velocity({ translateY: tooltipVerticalMovement, translateX: tooltipHorizontalMovement }, { duration: 350, queue: false }).velocity({ opacity: 1 }, { duration: 300, delay: 50, queue: false }); + backdrop.css({ visibility: 'visible' }).velocity({ opacity: 1 }, { duration: 55, delay: 0, queue: false }).velocity({ scaleX: scaleFactor, scaleY: scaleFactor }, { duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad' }); + }; + + timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval + + // Mouse Out + }, + 'mouseleave.tooltip': function () { + // Reset State + started = false; + clearTimeout(timeoutRef); + + // Animate back + setTimeout(function () { + if (started !== true) { + tooltipEl.velocity({ + opacity: 0, translateY: 0, translateX: 0 }, { duration: 225, queue: false }); + backdrop.velocity({ opacity: 0, scaleX: 1, scaleY: 1 }, { + duration: 225, + queue: false, + complete: function () { + backdrop.css({ visibility: 'hidden' }); + tooltipEl.css({ visibility: 'hidden' }); + started = false; + } + }); + } + }, 225); + } + }); + }); + }; + + var repositionWithinScreen = function (x, y, width, height) { + var newX = x; + var newY = y; + + if (newX < 0) { + newX = 4; + } else if (newX + width > window.innerWidth) { + newX -= newX + width - window.innerWidth; + } + + if (newY < 0) { + newY = 4; + } else if (newY + height > window.innerHeight + $(window).scrollTop) { + newY -= newY + height - window.innerHeight; + } + + return { x: newX, y: newY }; + }; + + $(document).ready(function () { + $('.tooltipped').tooltip(); + }); +})(jQuery); +; /*! + * Waves v0.6.4 + * http://fian.my.id/Waves + * + * Copyright 2014 Alfiana E. Sibuea and other contributors + * Released under the MIT license + * https://github.com/fians/Waves/blob/master/LICENSE + */ + +;(function (window) { + 'use strict'; + + var Waves = Waves || {}; + var $$ = document.querySelectorAll.bind(document); + + // Find exact position of element + function isWindow(obj) { + return obj !== null && obj === obj.window; + } + + function getWindow(elem) { + return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView; + } + + function offset(elem) { + var docElem, + win, + box = { top: 0, left: 0 }, + doc = elem && elem.ownerDocument; + + docElem = doc.documentElement; + + if (typeof elem.getBoundingClientRect !== typeof undefined) { + box = elem.getBoundingClientRect(); + } + win = getWindow(doc); + return { + top: box.top + win.pageYOffset - docElem.clientTop, + left: box.left + win.pageXOffset - docElem.clientLeft + }; + } + + function convertStyle(obj) { + var style = ''; + + for (var a in obj) { + if (obj.hasOwnProperty(a)) { + style += a + ':' + obj[a] + ';'; + } + } + + return style; + } + + var Effect = { + + // Effect delay + duration: 750, + + show: function (e, element) { + + // Disable right click + if (e.button === 2) { + return false; + } + + var el = element || this; + + // Create ripple + var ripple = document.createElement('div'); + ripple.className = 'waves-ripple'; + el.appendChild(ripple); + + // Get click coordinate and element witdh + var pos = offset(el); + var relativeY = e.pageY - pos.top; + var relativeX = e.pageX - pos.left; + var scale = 'scale(' + el.clientWidth / 100 * 10 + ')'; + + // Support for touch devices + if ('touches' in e) { + relativeY = e.touches[0].pageY - pos.top; + relativeX = e.touches[0].pageX - pos.left; + } + + // Attach data to element + ripple.setAttribute('data-hold', Date.now()); + ripple.setAttribute('data-scale', scale); + ripple.setAttribute('data-x', relativeX); + ripple.setAttribute('data-y', relativeY); + + // Set ripple position + var rippleStyle = { + 'top': relativeY + 'px', + 'left': relativeX + 'px' + }; + + ripple.className = ripple.className + ' waves-notransition'; + ripple.setAttribute('style', convertStyle(rippleStyle)); + ripple.className = ripple.className.replace('waves-notransition', ''); + + // Scale the ripple + rippleStyle['-webkit-transform'] = scale; + rippleStyle['-moz-transform'] = scale; + rippleStyle['-ms-transform'] = scale; + rippleStyle['-o-transform'] = scale; + rippleStyle.transform = scale; + rippleStyle.opacity = '1'; + + rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms'; + rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms'; + rippleStyle['-o-transition-duration'] = Effect.duration + 'ms'; + rippleStyle['transition-duration'] = Effect.duration + 'ms'; + + rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + + ripple.setAttribute('style', convertStyle(rippleStyle)); + }, + + hide: function (e) { + TouchHandler.touchup(e); + + var el = this; + var width = el.clientWidth * 1.4; + + // Get first ripple + var ripple = null; + var ripples = el.getElementsByClassName('waves-ripple'); + if (ripples.length > 0) { + ripple = ripples[ripples.length - 1]; + } else { + return false; + } + + var relativeX = ripple.getAttribute('data-x'); + var relativeY = ripple.getAttribute('data-y'); + var scale = ripple.getAttribute('data-scale'); + + // Get delay beetween mousedown and mouse leave + var diff = Date.now() - Number(ripple.getAttribute('data-hold')); + var delay = 350 - diff; + + if (delay < 0) { + delay = 0; + } + + // Fade out ripple after delay + setTimeout(function () { + var style = { + 'top': relativeY + 'px', + 'left': relativeX + 'px', + 'opacity': '0', + + // Duration + '-webkit-transition-duration': Effect.duration + 'ms', + '-moz-transition-duration': Effect.duration + 'ms', + '-o-transition-duration': Effect.duration + 'ms', + 'transition-duration': Effect.duration + 'ms', + '-webkit-transform': scale, + '-moz-transform': scale, + '-ms-transform': scale, + '-o-transform': scale, + 'transform': scale + }; + + ripple.setAttribute('style', convertStyle(style)); + + setTimeout(function () { + try { + el.removeChild(ripple); + } catch (e) { + return false; + } + }, Effect.duration); + }, delay); + }, + + // Little hack to make can perform waves effect + wrapInput: function (elements) { + for (var a = 0; a < elements.length; a++) { + var el = elements[a]; + + if (el.tagName.toLowerCase() === 'input') { + var parent = el.parentNode; + + // If input already have parent just pass through + if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) { + continue; + } + + // Put element class and style to the specified parent + var wrapper = document.createElement('i'); + wrapper.className = el.className + ' waves-input-wrapper'; + + var elementStyle = el.getAttribute('style'); + + if (!elementStyle) { + elementStyle = ''; + } + + wrapper.setAttribute('style', elementStyle); + + el.className = 'waves-button-input'; + el.removeAttribute('style'); + + // Put element as child + parent.replaceChild(wrapper, el); + wrapper.appendChild(el); + } + } + } + }; + + /** + * Disable mousedown event for 500ms during and after touch + */ + var TouchHandler = { + /* uses an integer rather than bool so there's no issues with + * needing to clear timeouts if another touch event occurred + * within the 500ms. Cannot mouseup between touchstart and + * touchend, nor in the 500ms after touchend. */ + touches: 0, + allowEvent: function (e) { + var allow = true; + + if (e.type === 'touchstart') { + TouchHandler.touches += 1; //push + } else if (e.type === 'touchend' || e.type === 'touchcancel') { + setTimeout(function () { + if (TouchHandler.touches > 0) { + TouchHandler.touches -= 1; //pop after 500ms + } + }, 500); + } else if (e.type === 'mousedown' && TouchHandler.touches > 0) { + allow = false; + } + + return allow; + }, + touchup: function (e) { + TouchHandler.allowEvent(e); + } + }; + + /** + * Delegated click handler for .waves-effect element. + * returns null when .waves-effect element not in "click tree" + */ + function getWavesEffectElement(e) { + if (TouchHandler.allowEvent(e) === false) { + return null; + } + + var element = null; + var target = e.target || e.srcElement; + + while (target.parentNode !== null) { + if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) { + element = target; + break; + } + target = target.parentNode; + } + return element; + } + + /** + * Bubble the click and show effect if .waves-effect elem was found + */ + function showEffect(e) { + var element = getWavesEffectElement(e); + + if (element !== null) { + Effect.show(e, element); + + if ('ontouchstart' in window) { + element.addEventListener('touchend', Effect.hide, false); + element.addEventListener('touchcancel', Effect.hide, false); + } + + element.addEventListener('mouseup', Effect.hide, false); + element.addEventListener('mouseleave', Effect.hide, false); + element.addEventListener('dragend', Effect.hide, false); + } + } + + Waves.displayEffect = function (options) { + options = options || {}; + + if ('duration' in options) { + Effect.duration = options.duration; + } + + //Wrap input inside tag + Effect.wrapInput($$('.waves-effect')); + + if ('ontouchstart' in window) { + document.body.addEventListener('touchstart', showEffect, false); + } + + document.body.addEventListener('mousedown', showEffect, false); + }; + + /** + * Attach Waves to an input element (or any element which doesn't + * bubble mouseup/mousedown events). + * Intended to be used with dynamically loaded forms/inputs, or + * where the user doesn't want a delegated click handler. + */ + Waves.attach = function (element) { + //FUTURE: automatically add waves classes and allow users + // to specify them with an options param? Eg. light/classic/button + if (element.tagName.toLowerCase() === 'input') { + Effect.wrapInput([element]); + element = element.parentNode; + } + + if ('ontouchstart' in window) { + element.addEventListener('touchstart', showEffect, false); + } + + element.addEventListener('mousedown', showEffect, false); + }; + + window.Waves = Waves; + + document.addEventListener('DOMContentLoaded', function () { + Waves.displayEffect(); + }, false); +})(window); +;(function ($, Vel) { + 'use strict'; + + var _defaults = { + displayLength: Infinity, + inDuration: 300, + outDuration: 375, + className: undefined, + completeCallback: undefined, + activationPercent: 0.8 + }; + + var Toast = function () { + function Toast(message, displayLength, className, completeCallback) { + _classCallCheck(this, Toast); + + if (!message) { + return; + } + + /** + * Options for the toast + * @member Toast#options + */ + this.options = { + displayLength: displayLength, + className: className, + completeCallback: completeCallback + }; + + this.options = $.extend({}, Toast.defaults, this.options); + this.message = message; + + /** + * Describes current pan state toast + * @type {Boolean} + */ + this.panning = false; + + /** + * Time remaining until toast is removed + */ + this.timeRemaining = this.options.displayLength; + + if (Toast._toasts.length === 0) { + Toast._createContainer(); + } + + // Create new toast + Toast._toasts.push(this); + var toastElement = this.createToast(); + toastElement.M_Toast = this; + this.el = toastElement; + this._animateIn(); + this.setTimer(); + } + + _createClass(Toast, [{ + key: 'createToast', + + + /** + * Create toast and append it to toast container + */ + value: function createToast() { + var toast = document.createElement('div'); + toast.classList.add('toast'); + + // Add custom classes onto toast + if (this.options.className) { + var classes = this.options.className.split(' '); + var i = void 0, + count = void 0; + for (i = 0, count = classes.length; i < count; i++) { + toast.classList.add(classes[i]); + } + } + + // Set content + if (typeof HTMLElement === 'object' ? this.message instanceof HTMLElement : this.message && typeof this.message === 'object' && this.message !== null && this.message.nodeType === 1 && typeof this.message.nodeName === 'string') { + toast.appendChild(this.message); + + // Check if it is jQuery object + } else if (this.message instanceof jQuery) { + $(toast).append(this.message); + + // Insert as text; + } else { + toast.innerHTML = this.message; + } + + // Append toasft + Toast._container.appendChild(toast); + return toast; + } + + /** + * Animate in toast + */ + + }, { + key: '_animateIn', + value: function _animateIn() { + // Animate toast in + Vel(this.el, { top: 0, opacity: 1 }, { + duration: 300, + easing: 'easeOutCubic', + queue: false + }); + } + + /** + * Create setInterval which automatically removes toast when timeRemaining >= 0 + * has been reached + */ + + }, { + key: 'setTimer', + value: function setTimer() { + var _this3 = this; + + if (this.timeRemaining !== Infinity) { + this.counterInterval = setInterval(function () { + // If toast is not being dragged, decrease its time remaining + if (!_this3.panning) { + _this3.timeRemaining -= 20; + } + + // Animate toast out + if (_this3.timeRemaining <= 0) { + _this3.remove(); + } + }, 20); + } + } + + /** + * Dismiss toast with animation + */ + + }, { + key: 'remove', + value: function remove() { + var _this4 = this; + + window.clearInterval(this.counterInterval); + var activationDistance = this.el.offsetWidth * this.options.activationPercent; + + if (this.wasSwiped) { + this.el.style.transition = 'transform .05s, opacity .05s'; + this.el.style.transform = 'translateX(' + activationDistance + 'px)'; + this.el.style.opacity = 0; + } + + Vel(this.el, { opacity: 0, marginTop: '-40px' }, { + duration: this.options.outDuration, + easing: 'easeOutExpo', + queue: false, + complete: function () { + // Call the optional callback + if (typeof _this4.options.completeCallback === 'function') { + _this4.options.completeCallback(); + } + // Remove toast from DOM + _this4.el.parentNode.removeChild(_this4.el); + Toast._toasts.splice(Toast._toasts.indexOf(_this4), 1); + if (Toast._toasts.length === 0) { + Toast._removeContainer(); + } + } + }); + } + }], [{ + key: '_createContainer', + + + /** + * Append toast container and add event handlers + */ + value: function _createContainer() { + var container = document.createElement('div'); + container.setAttribute('id', 'toast-container'); + + // Add event handler + container.addEventListener('touchstart', Toast._onDragStart); + container.addEventListener('touchmove', Toast._onDragMove); + container.addEventListener('touchend', Toast._onDragEnd); + + container.addEventListener('mousedown', Toast._onDragStart); + document.addEventListener('mousemove', Toast._onDragMove); + document.addEventListener('mouseup', Toast._onDragEnd); + + document.body.appendChild(container); + Toast._container = container; + } + + /** + * Remove toast container and event handlers + */ + + }, { + key: '_removeContainer', + value: function _removeContainer() { + // Add event handler + document.removeEventListener('mousemove', Toast._onDragMove); + document.removeEventListener('mouseup', Toast._onDragEnd); + + Toast._container.parentNode.removeChild(Toast._container); + Toast._container = null; + } + + /** + * Begin drag handler + * @param {Event} e + */ + + }, { + key: '_onDragStart', + value: function _onDragStart(e) { + if (e.target && $(e.target).closest('.toast').length) { + var $toast = $(e.target).closest('.toast'); + var toast = $toast[0].M_Toast; + toast.panning = true; + Toast._draggedToast = toast; + toast.el.classList.add('panning'); + toast.el.style.transition = ''; + toast.startingXPos = Toast._xPos(e); + toast.time = Date.now(); + toast.xPos = Toast._xPos(e); + } + } + + /** + * Drag move handler + * @param {Event} e + */ + + }, { + key: '_onDragMove', + value: function _onDragMove(e) { + if (!!Toast._draggedToast) { + e.preventDefault(); + var toast = Toast._draggedToast; + toast.deltaX = Math.abs(toast.xPos - Toast._xPos(e)); + toast.xPos = Toast._xPos(e); + toast.velocityX = toast.deltaX / (Date.now() - toast.time); + toast.time = Date.now(); + + var totalDeltaX = toast.xPos - toast.startingXPos; + var activationDistance = toast.el.offsetWidth * toast.options.activationPercent; + toast.el.style.transform = 'translateX(' + totalDeltaX + 'px)'; + toast.el.style.opacity = 1 - Math.abs(totalDeltaX / activationDistance); + } + } + + /** + * End drag handler + * @param {Event} e + */ + + }, { + key: '_onDragEnd', + value: function _onDragEnd(e) { + if (!!Toast._draggedToast) { + var toast = Toast._draggedToast; + toast.panning = false; + toast.el.classList.remove('panning'); + + var totalDeltaX = toast.xPos - toast.startingXPos; + var activationDistance = toast.el.offsetWidth * toast.options.activationPercent; + var shouldBeDismissed = Math.abs(totalDeltaX) > activationDistance || toast.velocityX > 1; + + // Remove toast + if (shouldBeDismissed) { + toast.wasSwiped = true; + toast.remove(); + + // Animate toast back to original position + } else { + toast.el.style.transition = 'transform .2s, opacity .2s'; + toast.el.style.transform = ''; + toast.el.style.opacity = ''; + } + Toast._draggedToast = null; + } + } + + /** + * Get x position of mouse or touch event + * @param {Event} e + */ + + }, { + key: '_xPos', + value: function _xPos(e) { + if (e.targetTouches && e.targetTouches.length >= 1) { + return e.targetTouches[0].clientX; + } + // mouse event + return e.clientX; + } + + /** + * Remove all toasts + */ + + }, { + key: 'removeAll', + value: function removeAll() { + for (var toastIndex in Toast._toasts) { + Toast._toasts[toastIndex].remove(); + } + } + }, { + key: 'defaults', + get: function () { + return _defaults; + } + }]); + + return Toast; + }(); + + /** + * @static + * @memberof Toast + * @type {Array.} + */ + + + Toast._toasts = []; + + /** + * @static + * @memberof Toast + */ + Toast._container = null; + + /** + * @static + * @memberof Toast + * @type {Toast} + */ + Toast._draggedToast = null; + + Materialize.Toast = Toast; + Materialize.toast = function (message, displayLength, className, completeCallback) { + return new Toast(message, displayLength, className, completeCallback); + }; +})(jQuery, Materialize.Vel); +;(function ($) { + + var methods = { + init: function (options) { + var defaults = { + menuWidth: 300, + edge: 'left', + closeOnClick: false, + draggable: true, + onOpen: null, + onClose: null + }; + options = $.extend(defaults, options); + + $(this).each(function () { + var $this = $(this); + var menuId = $this.attr('data-activates'); + var menu = $("#" + menuId); + + // Set to width + if (options.menuWidth != 300) { + menu.css('width', options.menuWidth); + } + + // Add Touch Area + var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]'); + if (options.draggable) { + // Regenerate dragTarget + if ($dragTarget.length) { + $dragTarget.remove(); + } + + $dragTarget = $('
    ').attr('data-sidenav', menuId); + $('body').append($dragTarget); + } else { + $dragTarget = $(); + } + + if (options.edge == 'left') { + menu.css('transform', 'translateX(-100%)'); + $dragTarget.css({ 'left': 0 }); // Add Touch Area + } else { + menu.addClass('right-aligned') // Change text-alignment to right + .css('transform', 'translateX(100%)'); + $dragTarget.css({ 'right': 0 }); // Add Touch Area + } + + // If fixed sidenav, bring menu out + if (menu.hasClass('fixed')) { + if (window.innerWidth > 992) { + menu.css('transform', 'translateX(0)'); + } + } + + // Window resize to reset on large screens fixed + if (menu.hasClass('fixed')) { + $(window).resize(function () { + if (window.innerWidth > 992) { + // Close menu if window is resized bigger than 992 and user has fixed sidenav + if ($('#sidenav-overlay').length !== 0 && menuOut) { + removeMenu(true); + } else { + // menu.removeAttr('style'); + menu.css('transform', 'translateX(0%)'); + // menu.css('width', options.menuWidth); + } + } else if (menuOut === false) { + if (options.edge === 'left') { + menu.css('transform', 'translateX(-100%)'); + } else { + menu.css('transform', 'translateX(100%)'); + } + } + }); + } + + // if closeOnClick, then add close event for all a tags in side sideNav + if (options.closeOnClick === true) { + menu.on("click.itemclick", "a:not(.collapsible-header)", function () { + if (!(window.innerWidth > 992 && menu.hasClass('fixed'))) { + removeMenu(); + } + }); + } + + var removeMenu = function (restoreNav) { + panning = false; + menuOut = false; + // Reenable scrolling + $('body').css({ + overflow: '', + width: '' + }); + + $('#sidenav-overlay').velocity({ opacity: 0 }, { duration: 200, + queue: false, easing: 'easeOutQuad', + complete: function () { + $(this).remove(); + } }); + if (options.edge === 'left') { + // Reset phantom div + $dragTarget.css({ width: '', right: '', left: '0' }); + menu.velocity({ 'translateX': '-100%' }, { duration: 200, + queue: false, + easing: 'easeOutCubic', + complete: function () { + if (restoreNav === true) { + // Restore Fixed sidenav + menu.removeAttr('style'); + menu.css('width', options.menuWidth); + } + } + + }); + } else { + // Reset phantom div + $dragTarget.css({ width: '', right: '0', left: '' }); + menu.velocity({ 'translateX': '100%' }, { duration: 200, + queue: false, + easing: 'easeOutCubic', + complete: function () { + if (restoreNav === true) { + // Restore Fixed sidenav + menu.removeAttr('style'); + menu.css('width', options.menuWidth); + } + } + }); + } + + // Callback + if (typeof options.onClose === 'function') { + options.onClose.call(this, menu); + } + }; + + // Touch Event + var panning = false; + var menuOut = false; + + if (options.draggable) { + $dragTarget.on('click', function () { + if (menuOut) { + removeMenu(); + } + }); + + $dragTarget.hammer({ + prevent_default: false + }).on('pan', function (e) { + + if (e.gesture.pointerType == "touch") { + + var direction = e.gesture.direction; + var x = e.gesture.center.x; + var y = e.gesture.center.y; + var velocityX = e.gesture.velocityX; + + // Vertical scroll bugfix + if (x === 0 && y === 0) { + return; + } + + // Disable Scrolling + var $body = $('body'); + var $overlay = $('#sidenav-overlay'); + var oldWidth = $body.innerWidth(); + $body.css('overflow', 'hidden'); + $body.width(oldWidth); + + // If overlay does not exist, create one and if it is clicked, close menu + if ($overlay.length === 0) { + $overlay = $('
    '); + $overlay.css('opacity', 0).click(function () { + removeMenu(); + }); + + // Run 'onOpen' when sidenav is opened via touch/swipe if applicable + if (typeof options.onOpen === 'function') { + options.onOpen.call(this, menu); + } + + $('body').append($overlay); + } + + // Keep within boundaries + if (options.edge === 'left') { + if (x > options.menuWidth) { + x = options.menuWidth; + } else if (x < 0) { + x = 0; + } + } + + if (options.edge === 'left') { + // Left Direction + if (x < options.menuWidth / 2) { + menuOut = false; + } + // Right Direction + else if (x >= options.menuWidth / 2) { + menuOut = true; + } + menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)'); + } else { + // Left Direction + if (x < window.innerWidth - options.menuWidth / 2) { + menuOut = true; + } + // Right Direction + else if (x >= window.innerWidth - options.menuWidth / 2) { + menuOut = false; + } + var rightPos = x - options.menuWidth / 2; + if (rightPos < 0) { + rightPos = 0; + } + + menu.css('transform', 'translateX(' + rightPos + 'px)'); + } + + // Percentage overlay + var overlayPerc; + if (options.edge === 'left') { + overlayPerc = x / options.menuWidth; + $overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' }); + } else { + overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth); + $overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' }); + } + } + }).on('panend', function (e) { + + if (e.gesture.pointerType == "touch") { + var $overlay = $('#sidenav-overlay'); + var velocityX = e.gesture.velocityX; + var x = e.gesture.center.x; + var leftPos = x - options.menuWidth; + var rightPos = x - options.menuWidth / 2; + if (leftPos > 0) { + leftPos = 0; + } + if (rightPos < 0) { + rightPos = 0; + } + panning = false; + + if (options.edge === 'left') { + // If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut + if (menuOut && velocityX <= 0.3 || velocityX < -0.5) { + // Return menu to open + if (leftPos !== 0) { + menu.velocity({ 'translateX': [0, leftPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' }); + } + + $overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' }); + $dragTarget.css({ width: '50%', right: 0, left: '' }); + menuOut = true; + } else if (!menuOut || velocityX > 0.3) { + // Enable Scrolling + $('body').css({ + overflow: '', + width: '' + }); + // Slide menu closed + menu.velocity({ 'translateX': [-1 * options.menuWidth - 10, leftPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' }); + $overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad', + complete: function () { + // Run 'onClose' when sidenav is closed via touch/swipe if applicable + if (typeof options.onClose === 'function') { + options.onClose.call(this, menu); + } + + $(this).remove(); + } }); + $dragTarget.css({ width: '10px', right: '', left: 0 }); + } + } else { + if (menuOut && velocityX >= -0.3 || velocityX > 0.5) { + // Return menu to open + if (rightPos !== 0) { + menu.velocity({ 'translateX': [0, rightPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' }); + } + + $overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' }); + $dragTarget.css({ width: '50%', right: '', left: 0 }); + menuOut = true; + } else if (!menuOut || velocityX < -0.3) { + // Enable Scrolling + $('body').css({ + overflow: '', + width: '' + }); + + // Slide menu closed + menu.velocity({ 'translateX': [options.menuWidth + 10, rightPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' }); + $overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad', + complete: function () { + // Run 'onClose' when sidenav is closed via touch/swipe if applicable + if (typeof options.onClose === 'function') { + options.onClose.call(this, menu); + } + + $(this).remove(); + } }); + $dragTarget.css({ width: '10px', right: 0, left: '' }); + } + } + } + }); + } + + $this.off('click.sidenav').on('click.sidenav', function () { + if (menuOut === true) { + menuOut = false; + panning = false; + removeMenu(); + } else { + + // Disable Scrolling + var $body = $('body'); + var $overlay = $('
    '); + var oldWidth = $body.innerWidth(); + $body.css('overflow', 'hidden'); + $body.width(oldWidth); + + // Push current drag target on top of DOM tree + $('body').append($dragTarget); + + if (options.edge === 'left') { + $dragTarget.css({ width: '50%', right: 0, left: '' }); + menu.velocity({ 'translateX': [0, -1 * options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' }); + } else { + $dragTarget.css({ width: '50%', right: '', left: 0 }); + menu.velocity({ 'translateX': [0, options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' }); + } + + // Overlay close on click + $overlay.css('opacity', 0).click(function () { + menuOut = false; + panning = false; + removeMenu(); + $overlay.velocity({ opacity: 0 }, { duration: 300, queue: false, easing: 'easeOutQuad', + complete: function () { + $(this).remove(); + } + }); + }); + + // Append body + $('body').append($overlay); + $overlay.velocity({ opacity: 1 }, { duration: 300, queue: false, easing: 'easeOutQuad', + complete: function () { + menuOut = true; + panning = false; + } + }); + + // Callback + if (typeof options.onOpen === 'function') { + options.onOpen.call(this, menu); + } + } + + return false; + }); + }); + }, + destroy: function () { + var $overlay = $('#sidenav-overlay'); + var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]'); + $overlay.trigger('click'); + $dragTarget.remove(); + $(this).off('click'); + $overlay.remove(); + }, + show: function () { + this.trigger('click'); + }, + hide: function () { + $('#sidenav-overlay').trigger('click'); + } + }; + + $.fn.sideNav = function (methodOrOptions) { + if (methods[methodOrOptions]) { + return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1)); + } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { + // Default to "init" + return methods.init.apply(this, arguments); + } else { + $.error('Method ' + methodOrOptions + ' does not exist on jQuery.sideNav'); + } + }; // Plugin end +})(jQuery); +; /** + * Extend jquery with a scrollspy plugin. + * This watches the window scroll and fires events when elements are scrolled into viewport. + * + * throttle() and getTime() taken from Underscore.js + * https://github.com/jashkenas/underscore + * + * @author Copyright 2013 John Smart + * @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE + * @see https://github.com/thesmart + * @version 0.1.2 + */ +(function ($) { + + var jWindow = $(window); + var elements = []; + var elementsInView = []; + var isSpying = false; + var ticks = 0; + var unique_id = 1; + var offset = { + top: 0, + right: 0, + bottom: 0, + left: 0 + + /** + * Find elements that are within the boundary + * @param {number} top + * @param {number} right + * @param {number} bottom + * @param {number} left + * @return {jQuery} A collection of elements + */ + };function findElements(top, right, bottom, left) { + var hits = $(); + $.each(elements, function (i, element) { + if (element.height() > 0) { + var elTop = element.offset().top, + elLeft = element.offset().left, + elRight = elLeft + element.width(), + elBottom = elTop + element.height(); + + var isIntersect = !(elLeft > right || elRight < left || elTop > bottom || elBottom < top); + + if (isIntersect) { + hits.push(element); + } + } + }); + + return hits; + } + + /** + * Called when the user scrolls the window + */ + function onScroll(scrollOffset) { + // unique tick id + ++ticks; + + // viewport rectangle + var top = jWindow.scrollTop(), + left = jWindow.scrollLeft(), + right = left + jWindow.width(), + bottom = top + jWindow.height(); + + // determine which elements are in view + var intersections = findElements(top + offset.top + scrollOffset || 200, right + offset.right, bottom + offset.bottom, left + offset.left); + $.each(intersections, function (i, element) { + + var lastTick = element.data('scrollSpy:ticks'); + if (typeof lastTick != 'number') { + // entered into view + element.triggerHandler('scrollSpy:enter'); + } + + // update tick id + element.data('scrollSpy:ticks', ticks); + }); + + // determine which elements are no longer in view + $.each(elementsInView, function (i, element) { + var lastTick = element.data('scrollSpy:ticks'); + if (typeof lastTick == 'number' && lastTick !== ticks) { + // exited from view + element.triggerHandler('scrollSpy:exit'); + element.data('scrollSpy:ticks', null); + } + }); + + // remember elements in view for next tick + elementsInView = intersections; + } + + /** + * Called when window is resized + */ + function onWinSize() { + jWindow.trigger('scrollSpy:winSize'); + } + + /** + * Enables ScrollSpy using a selector + * @param {jQuery|string} selector The elements collection, or a selector + * @param {Object=} options Optional. + throttle : number -> scrollspy throttling. Default: 100 ms + offsetTop : number -> offset from top. Default: 0 + offsetRight : number -> offset from right. Default: 0 + offsetBottom : number -> offset from bottom. Default: 0 + offsetLeft : number -> offset from left. Default: 0 + activeClass : string -> Class name to be added to the active link. Default: active + * @returns {jQuery} + */ + $.scrollSpy = function (selector, options) { + var defaults = { + throttle: 100, + scrollOffset: 200, // offset - 200 allows elements near bottom of page to scroll + activeClass: 'active', + getActiveElement: function (id) { + return 'a[href="#' + id + '"]'; + } + }; + options = $.extend(defaults, options); + + var visible = []; + selector = $(selector); + selector.each(function (i, element) { + elements.push($(element)); + $(element).data("scrollSpy:id", i); + // Smooth scroll to section + $('a[href="#' + $(element).attr('id') + '"]').click(function (e) { + e.preventDefault(); + var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1; + $('html, body').animate({ scrollTop: offset - options.scrollOffset }, { duration: 400, queue: false, easing: 'easeOutCubic' }); + }); + }); + + offset.top = options.offsetTop || 0; + offset.right = options.offsetRight || 0; + offset.bottom = options.offsetBottom || 0; + offset.left = options.offsetLeft || 0; + + var throttledScroll = Materialize.throttle(function () { + onScroll(options.scrollOffset); + }, options.throttle || 100); + var readyScroll = function () { + $(document).ready(throttledScroll); + }; + + if (!isSpying) { + jWindow.on('scroll', readyScroll); + jWindow.on('resize', readyScroll); + isSpying = true; + } + + // perform a scan once, after current execution context, and after dom is ready + setTimeout(readyScroll, 0); + + selector.on('scrollSpy:enter', function () { + visible = $.grep(visible, function (value) { + return value.height() != 0; + }); + + var $this = $(this); + + if (visible[0]) { + $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass); + if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) { + visible.unshift($(this)); + } else { + visible.push($(this)); + } + } else { + visible.push($(this)); + } + + $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass); + }); + selector.on('scrollSpy:exit', function () { + visible = $.grep(visible, function (value) { + return value.height() != 0; + }); + + if (visible[0]) { + $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass); + var $this = $(this); + visible = $.grep(visible, function (value) { + return value.attr('id') != $this.attr('id'); + }); + if (visible[0]) { + // Check if empty + $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass); + } + } + }); + + return selector; + }; + + /** + * Listen for window resize events + * @param {Object=} options Optional. Set { throttle: number } to change throttling. Default: 100 ms + * @returns {jQuery} $(window) + */ + $.winSizeSpy = function (options) { + $.winSizeSpy = function () { + return jWindow; + }; // lock from multiple calls + options = options || { + throttle: 100 + }; + return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100)); + }; + + /** + * Enables ScrollSpy on a collection of elements + * e.g. $('.scrollSpy').scrollSpy() + * @param {Object=} options Optional. + throttle : number -> scrollspy throttling. Default: 100 ms + offsetTop : number -> offset from top. Default: 0 + offsetRight : number -> offset from right. Default: 0 + offsetBottom : number -> offset from bottom. Default: 0 + offsetLeft : number -> offset from left. Default: 0 + * @returns {jQuery} + */ + $.fn.scrollSpy = function (options) { + return $.scrollSpy($(this), options); + }; +})(jQuery); +;(function ($) { + $(document).ready(function () { + + // Function to update labels of text fields + Materialize.updateTextFields = function () { + var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea'; + $(input_selector).each(function (index, element) { + var $this = $(this); + if ($(element).val().length > 0 || $(element).is(':focus') || element.autofocus || $this.attr('placeholder') !== undefined) { + $this.siblings('label').addClass('active'); + } else if ($(element)[0].validity) { + $this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true); + } else { + $this.siblings('label').removeClass('active'); + } + }); + }; + + // Text based inputs + var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea'; + + // Add active if form auto complete + $(document).on('change', input_selector, function () { + if ($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) { + $(this).siblings('label').addClass('active'); + } + validate_field($(this)); + }); + + // Add active if input element has been pre-populated on document ready + $(document).ready(function () { + Materialize.updateTextFields(); + }); + + // HTML DOM FORM RESET handling + $(document).on('reset', function (e) { + var formReset = $(e.target); + if (formReset.is('form')) { + formReset.find(input_selector).removeClass('valid').removeClass('invalid'); + formReset.find(input_selector).each(function () { + if ($(this).attr('value') === '') { + $(this).siblings('label').removeClass('active'); + } + }); + + // Reset select + formReset.find('select.initialized').each(function () { + var reset_text = formReset.find('option[selected]').text(); + formReset.siblings('input.select-dropdown').val(reset_text); + }); + } + }); + + // Add active when element has focus + $(document).on('focus', input_selector, function () { + $(this).siblings('label, .prefix').addClass('active'); + }); + + $(document).on('blur', input_selector, function () { + var $inputElement = $(this); + var selector = ".prefix"; + + if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) { + selector += ", label"; + } + + $inputElement.siblings(selector).removeClass('active'); + + validate_field($inputElement); + }); + + window.validate_field = function (object) { + var hasLength = object.attr('data-length') !== undefined; + var lenAttr = parseInt(object.attr('data-length')); + var len = object.val().length; + + if (object.val().length === 0 && object[0].validity.badInput === false && !object.is(':required')) { + if (object.hasClass('validate')) { + object.removeClass('valid'); + object.removeClass('invalid'); + } + } else { + if (object.hasClass('validate')) { + // Check for character counter attributes + if (object.is(':valid') && hasLength && len <= lenAttr || object.is(':valid') && !hasLength) { + object.removeClass('invalid'); + object.addClass('valid'); + } else { + object.removeClass('valid'); + object.addClass('invalid'); + } + } + } + }; + + // Radio and Checkbox focus class + var radio_checkbox = 'input[type=radio], input[type=checkbox]'; + $(document).on('keyup.radio', radio_checkbox, function (e) { + // TAB, check if tabbing to radio or checkbox. + if (e.which === 9) { + $(this).addClass('tabbed'); + var $this = $(this); + $this.one('blur', function (e) { + + $(this).removeClass('tabbed'); + }); + return; + } + }); + + // Textarea Auto Resize + var hiddenDiv = $('.hiddendiv').first(); + if (!hiddenDiv.length) { + hiddenDiv = $('
    '); + $('body').append(hiddenDiv); + } + var text_area_selector = '.materialize-textarea'; + + function textareaAutoResize($textarea) { + // Set font properties of hiddenDiv + + var fontFamily = $textarea.css('font-family'); + var fontSize = $textarea.css('font-size'); + var lineHeight = $textarea.css('line-height'); + var padding = $textarea.css('padding'); + + if (fontSize) { + hiddenDiv.css('font-size', fontSize); + } + if (fontFamily) { + hiddenDiv.css('font-family', fontFamily); + } + if (lineHeight) { + hiddenDiv.css('line-height', lineHeight); + } + if (padding) { + hiddenDiv.css('padding', padding); + } + + // Set original-height, if none + if (!$textarea.data('original-height')) { + $textarea.data('original-height', $textarea.height()); + } + + if ($textarea.attr('wrap') === 'off') { + hiddenDiv.css('overflow-wrap', 'normal').css('white-space', 'pre'); + } + + hiddenDiv.text($textarea.val() + '\n'); + var content = hiddenDiv.html().replace(/\n/g, '
    '); + hiddenDiv.html(content); + + // When textarea is hidden, width goes crazy. + // Approximate with half of window size + + if ($textarea.is(':visible')) { + hiddenDiv.css('width', $textarea.width()); + } else { + hiddenDiv.css('width', $(window).width() / 2); + } + + /** + * Resize if the new height is greater than the + * original height of the textarea + */ + if ($textarea.data('original-height') <= hiddenDiv.height()) { + $textarea.css('height', hiddenDiv.height()); + } else if ($textarea.val().length < $textarea.data('previous-length')) { + /** + * In case the new height is less than original height, it + * means the textarea has less text than before + * So we set the height to the original one + */ + $textarea.css('height', $textarea.data('original-height')); + } + $textarea.data('previous-length', $textarea.val().length); + } + + $(text_area_selector).each(function () { + var $textarea = $(this); + /** + * Instead of resizing textarea on document load, + * store the original height and the original length + */ + $textarea.data('original-height', $textarea.height()); + $textarea.data('previous-length', $textarea.val().length); + }); + + $('body').on('keyup keydown autoresize', text_area_selector, function () { + textareaAutoResize($(this)); + }); + + // File Input Path + $(document).on('change', '.file-field input[type="file"]', function () { + var file_field = $(this).closest('.file-field'); + var path_input = file_field.find('input.file-path'); + var files = $(this)[0].files; + var file_names = []; + for (var i = 0; i < files.length; i++) { + file_names.push(files[i].name); + } + path_input.val(file_names.join(", ")); + path_input.trigger('change'); + }); + + /**************** + * Range Input * + ****************/ + + var range_type = 'input[type=range]'; + var range_mousedown = false; + var left; + + $(range_type).each(function () { + var thumb = $(''); + $(this).after(thumb); + }); + + var showRangeBubble = function (thumb) { + var paddingLeft = parseInt(thumb.parent().css('padding-left')); + var marginLeft = -7 + paddingLeft + 'px'; + thumb.velocity({ height: "30px", width: "30px", top: "-30px", marginLeft: marginLeft }, { duration: 300, easing: 'easeOutExpo' }); + }; + + var calcRangeOffset = function (range) { + var width = range.width() - 15; + var max = parseFloat(range.attr('max')); + var min = parseFloat(range.attr('min')); + var percent = (parseFloat(range.val()) - min) / (max - min); + return percent * width; + }; + + var range_wrapper = '.range-field'; + $(document).on('change', range_type, function (e) { + var thumb = $(this).siblings('.thumb'); + thumb.find('.value').html($(this).val()); + + if (!thumb.hasClass('active')) { + showRangeBubble(thumb); + } + + var offsetLeft = calcRangeOffset($(this)); + thumb.addClass('active').css('left', offsetLeft); + }); + + $(document).on('mousedown touchstart', range_type, function (e) { + var thumb = $(this).siblings('.thumb'); + + // If thumb indicator does not exist yet, create it + if (thumb.length <= 0) { + thumb = $(''); + $(this).after(thumb); + } + + // Set indicator value + thumb.find('.value').html($(this).val()); + + range_mousedown = true; + $(this).addClass('active'); + + if (!thumb.hasClass('active')) { + showRangeBubble(thumb); + } + + if (e.type !== 'input') { + var offsetLeft = calcRangeOffset($(this)); + thumb.addClass('active').css('left', offsetLeft); + } + }); + + $(document).on('mouseup touchend', range_wrapper, function () { + range_mousedown = false; + $(this).removeClass('active'); + }); + + $(document).on('input mousemove touchmove', range_wrapper, function (e) { + var thumb = $(this).children('.thumb'); + var left; + var input = $(this).find(range_type); + + if (range_mousedown) { + if (!thumb.hasClass('active')) { + showRangeBubble(thumb); + } + + var offsetLeft = calcRangeOffset(input); + thumb.addClass('active').css('left', offsetLeft); + thumb.find('.value').html(thumb.siblings(range_type).val()); + } + }); + + $(document).on('mouseout touchleave', range_wrapper, function () { + if (!range_mousedown) { + + var thumb = $(this).children('.thumb'); + var paddingLeft = parseInt($(this).css('padding-left')); + var marginLeft = 7 + paddingLeft + 'px'; + + if (thumb.hasClass('active')) { + thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: marginLeft }, { duration: 100 }); + } + thumb.removeClass('active'); + } + }); + + /************************** + * Auto complete plugin * + *************************/ + $.fn.autocomplete = function (options) { + // Defaults + var defaults = { + data: {}, + limit: Infinity, + onAutocomplete: null, + minLength: 1 + }; + + options = $.extend(defaults, options); + + return this.each(function () { + var $input = $(this); + var data = options.data, + count = 0, + activeIndex = -1, + oldVal, + $inputDiv = $input.closest('.input-field'); // Div to append on + + // Check if data isn't empty + if (!$.isEmptyObject(data)) { + var $autocomplete = $(''); + var $oldAutocomplete; + + // Append autocomplete element. + // Prevent double structure init. + if ($inputDiv.length) { + $oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first(); + if (!$oldAutocomplete.length) { + $inputDiv.append($autocomplete); // Set ul in body + } + } else { + $oldAutocomplete = $input.next('.autocomplete-content.dropdown-content'); + if (!$oldAutocomplete.length) { + $input.after($autocomplete); + } + } + if ($oldAutocomplete.length) { + $autocomplete = $oldAutocomplete; + } + + // Highlight partial match. + var highlight = function (string, $el) { + var img = $el.find('img'); + var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""), + matchEnd = matchStart + string.length - 1, + beforeMatch = $el.text().slice(0, matchStart), + matchText = $el.text().slice(matchStart, matchEnd + 1), + afterMatch = $el.text().slice(matchEnd + 1); + $el.html("" + beforeMatch + "" + matchText + "" + afterMatch + ""); + if (img.length) { + $el.prepend(img); + } + }; + + // Reset current element position + var resetCurrentElement = function () { + activeIndex = -1; + $autocomplete.find('.active').removeClass('active'); + }; + + // Remove autocomplete elements + var removeAutocomplete = function () { + $autocomplete.empty(); + resetCurrentElement(); + oldVal = undefined; + }; + + $input.off('blur.autocomplete').on('blur.autocomplete', function () { + removeAutocomplete(); + }); + + // Perform search + $input.off('keyup.autocomplete focus.autocomplete').on('keyup.autocomplete focus.autocomplete', function (e) { + // Reset count. + count = 0; + var val = $input.val().toLowerCase(); + + // Don't capture enter or arrow key usage. + if (e.which === 13 || e.which === 38 || e.which === 40) { + return; + } + + // Check if the input isn't empty + if (oldVal !== val) { + removeAutocomplete(); + + if (val.length >= options.minLength) { + for (var key in data) { + if (data.hasOwnProperty(key) && key.toLowerCase().indexOf(val) !== -1) { + // Break if past limit + if (count >= options.limit) { + break; + } + + var autocompleteOption = $('
  • '); + if (!!data[key]) { + autocompleteOption.append('' + key + ''); + } else { + autocompleteOption.append('' + key + ''); + } + + $autocomplete.append(autocompleteOption); + highlight(val, autocompleteOption); + count++; + } + } + } + } + + // Update oldVal + oldVal = val; + }); + + $input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) { + // Arrow keys and enter key usage + var keyCode = e.which, + liElement, + numItems = $autocomplete.children('li').length, + $active = $autocomplete.children('.active').first(); + + // select element on Enter + if (keyCode === 13 && activeIndex >= 0) { + liElement = $autocomplete.children('li').eq(activeIndex); + if (liElement.length) { + liElement.trigger('mousedown.autocomplete'); + e.preventDefault(); + } + return; + } + + // Capture up and down key + if (keyCode === 38 || keyCode === 40) { + e.preventDefault(); + + if (keyCode === 38 && activeIndex > 0) { + activeIndex--; + } + + if (keyCode === 40 && activeIndex < numItems - 1) { + activeIndex++; + } + + $active.removeClass('active'); + if (activeIndex >= 0) { + $autocomplete.children('li').eq(activeIndex).addClass('active'); + } + } + }); + + // Set input value + $autocomplete.off('mousedown.autocomplete touchstart.autocomplete').on('mousedown.autocomplete touchstart.autocomplete', 'li', function () { + var text = $(this).text().trim(); + $input.val(text); + $input.trigger('change'); + removeAutocomplete(); + + // Handle onAutocomplete callback. + if (typeof options.onAutocomplete === "function") { + options.onAutocomplete.call(this, text); + } + }); + + // Empty data + } else { + $input.off('keyup.autocomplete focus.autocomplete'); + } + }); + }; + }); // End of $(document).ready + + /******************* + * Select Plugin * + ******************/ + $.fn.material_select = function (callback) { + $(this).each(function () { + var $select = $(this); + + if ($select.hasClass('browser-default')) { + return; // Continue to next (return false breaks out of entire loop) + } + + var multiple = $select.attr('multiple') ? true : false, + lastID = $select.attr('data-select-id'); // Tear down structure if Select needs to be rebuilt + + if (lastID) { + $select.parent().find('span.caret').remove(); + $select.parent().find('input').remove(); + + $select.unwrap(); + $('ul#select-options-' + lastID).remove(); + } + + // If destroying the select, remove the selelct-id and reset it to it's uninitialized state. + if (callback === 'destroy') { + $select.removeAttr('data-select-id').removeClass('initialized'); + $(window).off('click.select'); + return; + } + + var uniqueID = Materialize.guid(); + $select.attr('data-select-id', uniqueID); + var wrapper = $('
    '); + wrapper.addClass($select.attr('class')); + if ($select.is(':disabled')) wrapper.addClass('disabled'); + var options = $(''), + selectChildren = $select.children('option, optgroup'), + valuesSelected = [], + optionsHover = false; + + var label = $select.find('option:selected').html() || $select.find('option:first').html() || ""; + + // Function that renders and appends the option taking into + // account type and possible image icon. + var appendOptionWithIcon = function (select, option, type) { + // Add disabled attr if disabled + var disabledClass = option.is(':disabled') ? 'disabled ' : ''; + var optgroupClass = type === 'optgroup-option' ? 'optgroup-option ' : ''; + var multipleCheckbox = multiple ? '' : ''; + + // add icons + var icon_url = option.data('icon'); + var classes = option.attr('class'); + if (!!icon_url) { + var classString = ''; + if (!!classes) classString = ' class="' + classes + '"'; + + // Check for multiple type. + options.append($('
  • ' + multipleCheckbox + option.html() + '
  • ')); + return true; + } + + // Check for multiple type. + options.append($('
  • ' + multipleCheckbox + option.html() + '
  • ')); + }; + + /* Create dropdown structure. */ + if (selectChildren.length) { + selectChildren.each(function () { + if ($(this).is('option')) { + // Direct descendant option. + if (multiple) { + appendOptionWithIcon($select, $(this), 'multiple'); + } else { + appendOptionWithIcon($select, $(this)); + } + } else if ($(this).is('optgroup')) { + // Optgroup. + var selectOptions = $(this).children('option'); + options.append($('
  • ' + $(this).attr('label') + '
  • ')); + + selectOptions.each(function () { + appendOptionWithIcon($select, $(this), 'optgroup-option'); + }); + } + }); + } + + options.find('li:not(.optgroup)').each(function (i) { + $(this).click(function (e) { + // Check if option element is disabled + if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) { + var selected = true; + + if (multiple) { + $('input[type="checkbox"]', this).prop('checked', function (i, v) { + return !v; + }); + selected = toggleEntryFromArray(valuesSelected, i, $select); + $newSelect.trigger('focus'); + } else { + options.find('li').removeClass('active'); + $(this).toggleClass('active'); + $newSelect.val($(this).text()); + } + + activateOption(options, $(this)); + $select.find('option').eq(i).prop('selected', selected); + // Trigger onchange() event + $select.trigger('change'); + if (typeof callback !== 'undefined') callback(); + } + + e.stopPropagation(); + }); + }); + + // Wrap Elements + $select.wrap(wrapper); + // Add Select Display Element + var dropdownIcon = $(''); + + // escape double quotes + var sanitizedLabelHtml = label.replace(/"/g, '"'); + + var $newSelect = $(''); + $select.before($newSelect); + $newSelect.before(dropdownIcon); + + $newSelect.after(options); + // Check if section element is disabled + if (!$select.is(':disabled')) { + $newSelect.dropdown({ 'hover': false }); + } + + // Copy tabindex + if ($select.attr('tabindex')) { + $($newSelect[0]).attr('tabindex', $select.attr('tabindex')); + } + + $select.addClass('initialized'); + + $newSelect.on({ + 'focus': function () { + if ($('ul.select-dropdown').not(options[0]).is(':visible')) { + $('input.select-dropdown').trigger('close'); + $(window).off('click.select'); + } + if (!options.is(':visible')) { + $(this).trigger('open', ['focus']); + var label = $(this).val(); + if (multiple && label.indexOf(',') >= 0) { + label = label.split(',')[0]; + } + + var selectedOption = options.find('li').filter(function () { + return $(this).text().toLowerCase() === label.toLowerCase(); + })[0]; + activateOption(options, selectedOption, true); + + $(window).off('click.select').on('click.select', function () { + multiple && (optionsHover || $newSelect.trigger('close')); + $(window).off('click.select'); + }); + } + }, + 'click': function (e) { + e.stopPropagation(); + } + }); + + $newSelect.on('blur', function () { + if (!multiple) { + $(this).trigger('close'); + $(window).off('click.select'); + } + options.find('li.selected').removeClass('selected'); + }); + + options.hover(function () { + optionsHover = true; + }, function () { + optionsHover = false; + }); + + // Add initial multiple selections. + if (multiple) { + $select.find("option:selected:not(:disabled)").each(function () { + var index = this.index; + + toggleEntryFromArray(valuesSelected, index, $select); + options.find("li:not(.optgroup)").eq(index).find(":checkbox").prop("checked", true); + }); + } + + /** + * Make option as selected and scroll to selected position + * @param {jQuery} collection Select options jQuery element + * @param {Element} newOption element of the new option + * @param {Boolean} firstActivation If on first activation of select + */ + var activateOption = function (collection, newOption, firstActivation) { + if (newOption) { + collection.find('li.selected').removeClass('selected'); + var option = $(newOption); + option.addClass('selected'); + if (!multiple || !!firstActivation) { + options.scrollTo(option); + } + } + }; + + // Allow user to search by typing + // this array is cleared after 1 second + var filterQuery = [], + onKeyDown = function (e) { + // TAB - switch to another input + if (e.which == 9) { + $newSelect.trigger('close'); + return; + } + + // ARROW DOWN WHEN SELECT IS CLOSED - open select options + if (e.which == 40 && !options.is(':visible')) { + $newSelect.trigger('open'); + return; + } + + // ENTER WHEN SELECT IS CLOSED - submit form + if (e.which == 13 && !options.is(':visible')) { + return; + } + + e.preventDefault(); + + // CASE WHEN USER TYPE LETTERS + var letter = String.fromCharCode(e.which).toLowerCase(), + nonLetters = [9, 13, 27, 38, 40]; + if (letter && nonLetters.indexOf(e.which) === -1) { + filterQuery.push(letter); + + var string = filterQuery.join(''), + newOption = options.find('li').filter(function () { + return $(this).text().toLowerCase().indexOf(string) === 0; + })[0]; + + if (newOption) { + activateOption(options, newOption); + } + } + + // ENTER - select option and close when select options are opened + if (e.which == 13) { + var activeOption = options.find('li.selected:not(.disabled)')[0]; + if (activeOption) { + $(activeOption).trigger('click'); + if (!multiple) { + $newSelect.trigger('close'); + } + } + } + + // ARROW DOWN - move to next not disabled option + if (e.which == 40) { + if (options.find('li.selected').length) { + newOption = options.find('li.selected').next('li:not(.disabled)')[0]; + } else { + newOption = options.find('li:not(.disabled)')[0]; + } + activateOption(options, newOption); + } + + // ESC - close options + if (e.which == 27) { + $newSelect.trigger('close'); + } + + // ARROW UP - move to previous not disabled option + if (e.which == 38) { + newOption = options.find('li.selected').prev('li:not(.disabled)')[0]; + if (newOption) activateOption(options, newOption); + } + + // Automaticaly clean filter query so user can search again by starting letters + setTimeout(function () { + filterQuery = []; + }, 1000); + }; + + $newSelect.on('keydown', onKeyDown); + }); + + function toggleEntryFromArray(entriesArray, entryIndex, select) { + var index = entriesArray.indexOf(entryIndex), + notAdded = index === -1; + + if (notAdded) { + entriesArray.push(entryIndex); + } else { + entriesArray.splice(index, 1); + } + + select.siblings('ul.dropdown-content').find('li:not(.optgroup)').eq(entryIndex).toggleClass('active'); + + // use notAdded instead of true (to detect if the option is selected or not) + select.find('option').eq(entryIndex).prop('selected', notAdded); + setValueToInput(entriesArray, select); + + return notAdded; + } + + function setValueToInput(entriesArray, select) { + var value = ''; + + for (var i = 0, count = entriesArray.length; i < count; i++) { + var text = select.find('option').eq(entriesArray[i]).text(); + + i === 0 ? value += text : value += ', ' + text; + } + + if (value === '') { + value = select.find('option:disabled').eq(0).text(); + } + + select.siblings('input.select-dropdown').val(value); + } + }; +})(jQuery); +;(function ($) { + + var methods = { + + init: function (options) { + var defaults = { + indicators: true, + height: 400, + transition: 500, + interval: 6000 + }; + options = $.extend(defaults, options); + + return this.each(function () { + + // For each slider, we want to keep track of + // which slide is active and its associated content + var $this = $(this); + var $slider = $this.find('ul.slides').first(); + var $slides = $slider.find('> li'); + var $active_index = $slider.find('.active').index(); + var $active, $indicators, $interval; + if ($active_index != -1) { + $active = $slides.eq($active_index); + } + + // Transitions the caption depending on alignment + function captionTransition(caption, duration) { + if (caption.hasClass("center-align")) { + caption.velocity({ opacity: 0, translateY: -100 }, { duration: duration, queue: false }); + } else if (caption.hasClass("right-align")) { + caption.velocity({ opacity: 0, translateX: 100 }, { duration: duration, queue: false }); + } else if (caption.hasClass("left-align")) { + caption.velocity({ opacity: 0, translateX: -100 }, { duration: duration, queue: false }); + } + } + + // This function will transition the slide to any index of the next slide + function moveToSlide(index) { + // Wrap around indices. + if (index >= $slides.length) index = 0;else if (index < 0) index = $slides.length - 1; + + $active_index = $slider.find('.active').index(); + + // Only do if index changes + if ($active_index != index) { + $active = $slides.eq($active_index); + $caption = $active.find('.caption'); + + $active.removeClass('active'); + $active.velocity({ opacity: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad', + complete: function () { + $slides.not('.active').velocity({ opacity: 0, translateX: 0, translateY: 0 }, { duration: 0, queue: false }); + } }); + captionTransition($caption, options.transition); + + // Update indicators + if (options.indicators) { + $indicators.eq($active_index).removeClass('active'); + } + + $slides.eq(index).velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' }); + $slides.eq(index).find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad' }); + $slides.eq(index).addClass('active'); + + // Update indicators + if (options.indicators) { + $indicators.eq(index).addClass('active'); + } + } + } + + // Set height of slider + // If fullscreen, do nothing + if (!$this.hasClass('fullscreen')) { + if (options.indicators) { + // Add height if indicators are present + $this.height(options.height + 40); + } else { + $this.height(options.height); + } + $slider.height(options.height); + } + + // Set initial positions of captions + $slides.find('.caption').each(function () { + captionTransition($(this), 0); + }); + + // Move img src into background-image + $slides.find('img').each(function () { + var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw=='; + if ($(this).attr('src') !== placeholderBase64) { + $(this).css('background-image', 'url("' + $(this).attr('src') + '")'); + $(this).attr('src', placeholderBase64); + } + }); + + // dynamically add indicators + if (options.indicators) { + $indicators = $('
      '); + $slides.each(function (index) { + var $indicator = $('
    • '); + + // Handle clicks on indicators + $indicator.click(function () { + var $parent = $slider.parent(); + var curr_index = $parent.find($(this)).index(); + moveToSlide(curr_index); + + // reset interval + clearInterval($interval); + $interval = setInterval(function () { + $active_index = $slider.find('.active').index(); + if ($slides.length == $active_index + 1) $active_index = 0; // loop to start + else $active_index += 1; + + moveToSlide($active_index); + }, options.transition + options.interval); + }); + $indicators.append($indicator); + }); + $this.append($indicators); + $indicators = $this.find('ul.indicators').find('li.indicator-item'); + } + + if ($active) { + $active.show(); + } else { + $slides.first().addClass('active').velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' }); + + $active_index = 0; + $active = $slides.eq($active_index); + + // Update indicators + if (options.indicators) { + $indicators.eq($active_index).addClass('active'); + } + } + + // Adjust height to current slide + $active.find('img').each(function () { + $active.find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' }); + }); + + // auto scroll + $interval = setInterval(function () { + $active_index = $slider.find('.active').index(); + moveToSlide($active_index + 1); + }, options.transition + options.interval); + + // HammerJS, Swipe navigation + + // Touch Event + var panning = false; + var swipeLeft = false; + var swipeRight = false; + + $this.hammer({ + prevent_default: false + }).on('pan', function (e) { + if (e.gesture.pointerType === "touch") { + + // reset interval + clearInterval($interval); + + var direction = e.gesture.direction; + var x = e.gesture.deltaX; + var velocityX = e.gesture.velocityX; + var velocityY = e.gesture.velocityY; + + $curr_slide = $slider.find('.active'); + if (Math.abs(velocityX) > Math.abs(velocityY)) { + $curr_slide.velocity({ translateX: x + }, { duration: 50, queue: false, easing: 'easeOutQuad' }); + } + + // Swipe Left + if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.65)) { + swipeRight = true; + } + // Swipe Right + else if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.65)) { + swipeLeft = true; + } + + // Make Slide Behind active slide visible + var next_slide; + if (swipeLeft) { + next_slide = $curr_slide.next(); + if (next_slide.length === 0) { + next_slide = $slides.first(); + } + next_slide.velocity({ opacity: 1 + }, { duration: 300, queue: false, easing: 'easeOutQuad' }); + } + if (swipeRight) { + next_slide = $curr_slide.prev(); + if (next_slide.length === 0) { + next_slide = $slides.last(); + } + next_slide.velocity({ opacity: 1 + }, { duration: 300, queue: false, easing: 'easeOutQuad' }); + } + } + }).on('panend', function (e) { + if (e.gesture.pointerType === "touch") { + + $curr_slide = $slider.find('.active'); + panning = false; + curr_index = $slider.find('.active').index(); + + if (!swipeRight && !swipeLeft || $slides.length <= 1) { + // Return to original spot + $curr_slide.velocity({ translateX: 0 + }, { duration: 300, queue: false, easing: 'easeOutQuad' }); + } else if (swipeLeft) { + moveToSlide(curr_index + 1); + $curr_slide.velocity({ translateX: -1 * $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad', + complete: function () { + $curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false }); + } }); + } else if (swipeRight) { + moveToSlide(curr_index - 1); + $curr_slide.velocity({ translateX: $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad', + complete: function () { + $curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false }); + } }); + } + swipeLeft = false; + swipeRight = false; + + // Restart interval + clearInterval($interval); + $interval = setInterval(function () { + $active_index = $slider.find('.active').index(); + if ($slides.length == $active_index + 1) $active_index = 0; // loop to start + else $active_index += 1; + + moveToSlide($active_index); + }, options.transition + options.interval); + } + }); + + $this.on('sliderPause', function () { + clearInterval($interval); + }); + + $this.on('sliderStart', function () { + clearInterval($interval); + $interval = setInterval(function () { + $active_index = $slider.find('.active').index(); + if ($slides.length == $active_index + 1) $active_index = 0; // loop to start + else $active_index += 1; + + moveToSlide($active_index); + }, options.transition + options.interval); + }); + + $this.on('sliderNext', function () { + $active_index = $slider.find('.active').index(); + moveToSlide($active_index + 1); + }); + + $this.on('sliderPrev', function () { + $active_index = $slider.find('.active').index(); + moveToSlide($active_index - 1); + }); + }); + }, + pause: function () { + $(this).trigger('sliderPause'); + }, + start: function () { + $(this).trigger('sliderStart'); + }, + next: function () { + $(this).trigger('sliderNext'); + }, + prev: function () { + $(this).trigger('sliderPrev'); + } + }; + + $.fn.slider = function (methodOrOptions) { + if (methods[methodOrOptions]) { + return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1)); + } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { + // Default to "init" + return methods.init.apply(this, arguments); + } else { + $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tooltip'); + } + }; // Plugin end +})(jQuery); +;(function ($) { + $(document).ready(function () { + + $(document).on('click.card', '.card', function (e) { + if ($(this).find('> .card-reveal').length) { + var $card = $(e.target).closest('.card'); + if ($card.data('initialOverflow') === undefined) { + $card.data('initialOverflow', $card.css('overflow') === undefined ? '' : $card.css('overflow')); + } + if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) { + // Make Reveal animate down and display none + $(this).find('.card-reveal').velocity({ translateY: 0 }, { + duration: 225, + queue: false, + easing: 'easeInOutQuad', + complete: function () { + $(this).css({ display: 'none' }); + $card.css('overflow', $card.data('initialOverflow')); + } + }); + } else if ($(e.target).is($('.card .activator')) || $(e.target).is($('.card .activator i'))) { + $card.css('overflow', 'hidden'); + $(this).find('.card-reveal').css({ display: 'block' }).velocity("stop", false).velocity({ translateY: '-100%' }, { duration: 300, queue: false, easing: 'easeInOutQuad' }); + } + } + }); + }); +})(jQuery); +;(function ($) { + var materialChipsDefaults = { + data: [], + placeholder: '', + secondaryPlaceholder: '', + autocompleteOptions: {} + }; + + $(document).ready(function () { + // Handle removal of static chips. + $(document).on('click', '.chip .close', function (e) { + var $chips = $(this).closest('.chips'); + if ($chips.attr('data-initialized')) { + return; + } + $(this).closest('.chip').remove(); + }); + }); + + $.fn.material_chip = function (options) { + var self = this; + this.$el = $(this); + this.$document = $(document); + this.SELS = { + CHIPS: '.chips', + CHIP: '.chip', + INPUT: 'input', + DELETE: '.material-icons', + SELECTED_CHIP: '.selected' + }; + + if ('data' === options) { + return this.$el.data('chips'); + } + + var curr_options = $.extend({}, materialChipsDefaults, options); + self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteOptions.data); + + // Initialize + this.init = function () { + var i = 0; + var chips; + self.$el.each(function () { + var $chips = $(this); + var chipId = Materialize.guid(); + self.chipId = chipId; + + if (!curr_options.data || !(curr_options.data instanceof Array)) { + curr_options.data = []; + } + $chips.data('chips', curr_options.data); + $chips.attr('data-index', i); + $chips.attr('data-initialized', true); + + if (!$chips.hasClass(self.SELS.CHIPS)) { + $chips.addClass('chips'); + } + + self.chips($chips, chipId); + i++; + }); + }; + + this.handleEvents = function () { + var SELS = self.SELS; + + self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function (e) { + $(e.target).find(SELS.INPUT).focus(); + }); + + self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function (e) { + var $chip = $(e.target); + if ($chip.length) { + var wasSelected = $chip.hasClass('selected'); + var $chips = $chip.closest(SELS.CHIPS); + $(SELS.CHIP).removeClass('selected'); + + if (!wasSelected) { + self.selectChip($chip.index(), $chips); + } + } + }); + + self.$document.off('keydown.chips').on('keydown.chips', function (e) { + if ($(e.target).is('input, textarea')) { + return; + } + + // delete + var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP); + var $chips = $chip.closest(SELS.CHIPS); + var length = $chip.siblings(SELS.CHIP).length; + var index; + + if (!$chip.length) { + return; + } + + if (e.which === 8 || e.which === 46) { + e.preventDefault(); + + index = $chip.index(); + self.deleteChip(index, $chips); + + var selectIndex = null; + if (index + 1 < length) { + selectIndex = index; + } else if (index === length || index + 1 === length) { + selectIndex = length - 1; + } + + if (selectIndex < 0) selectIndex = null; + + if (null !== selectIndex) { + self.selectChip(selectIndex, $chips); + } + if (!length) $chips.find('input').focus(); + + // left + } else if (e.which === 37) { + index = $chip.index() - 1; + if (index < 0) { + return; + } + $(SELS.CHIP).removeClass('selected'); + self.selectChip(index, $chips); + + // right + } else if (e.which === 39) { + index = $chip.index() + 1; + $(SELS.CHIP).removeClass('selected'); + if (index > length) { + $chips.find('input').focus(); + return; + } + self.selectChip(index, $chips); + } + }); + + self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) { + var $currChips = $(e.target).closest(SELS.CHIPS); + $currChips.addClass('focus'); + $currChips.siblings('label, .prefix').addClass('active'); + $(SELS.CHIP).removeClass('selected'); + }); + + self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) { + var $currChips = $(e.target).closest(SELS.CHIPS); + $currChips.removeClass('focus'); + + // Remove active if empty + if ($currChips.data('chips') === undefined || !$currChips.data('chips').length) { + $currChips.siblings('label').removeClass('active'); + } + $currChips.siblings('.prefix').removeClass('active'); + }); + + self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function (e) { + var $target = $(e.target); + var $chips = $target.closest(SELS.CHIPS); + var chipsLength = $chips.children(SELS.CHIP).length; + + // enter + if (13 === e.which) { + // Override enter if autocompleting. + if (self.hasAutocomplete && $chips.find('.autocomplete-content.dropdown-content').length && $chips.find('.autocomplete-content.dropdown-content').children().length) { + return; + } + + e.preventDefault(); + self.addChip({ tag: $target.val() }, $chips); + $target.val(''); + return; + } + + // delete or left + if ((8 === e.keyCode || 37 === e.keyCode) && '' === $target.val() && chipsLength) { + e.preventDefault(); + self.selectChip(chipsLength - 1, $chips); + $target.blur(); + return; + } + }); + + // Click on delete icon in chip. + self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function (e) { + var $target = $(e.target); + var $chips = $target.closest(SELS.CHIPS); + var $chip = $target.closest(SELS.CHIP); + e.stopPropagation(); + self.deleteChip($chip.index(), $chips); + $chips.find('input').focus(); + }); + }; + + this.chips = function ($chips, chipId) { + $chips.empty(); + $chips.data('chips').forEach(function (elem) { + $chips.append(self.renderChip(elem)); + }); + $chips.append($('')); + self.setPlaceholder($chips); + + // Set for attribute for label + var label = $chips.next('label'); + if (label.length) { + label.attr('for', chipId); + + if ($chips.data('chips') !== undefined && $chips.data('chips').length) { + label.addClass('active'); + } + } + + // Setup autocomplete if needed. + var input = $('#' + chipId); + if (self.hasAutocomplete) { + curr_options.autocompleteOptions.onAutocomplete = function (val) { + self.addChip({ tag: val }, $chips); + input.val(''); + input.focus(); + }; + input.autocomplete(curr_options.autocompleteOptions); + } + }; + + /** + * Render chip jQuery element. + * @param {Object} elem + * @return {jQuery} + */ + this.renderChip = function (elem) { + if (!elem.tag) return; + + var $renderedChip = $('
      '); + $renderedChip.text(elem.tag); + if (elem.image) { + $renderedChip.prepend($('').attr('src', elem.image)); + } + $renderedChip.append($('close')); + return $renderedChip; + }; + + this.setPlaceholder = function ($chips) { + if ($chips.data('chips') !== undefined && !$chips.data('chips').length && curr_options.placeholder) { + $chips.find('input').prop('placeholder', curr_options.placeholder); + } else if (($chips.data('chips') === undefined || !!$chips.data('chips').length) && curr_options.secondaryPlaceholder) { + $chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder); + } + }; + + this.isValid = function ($chips, elem) { + var chips = $chips.data('chips'); + var exists = false; + for (var i = 0; i < chips.length; i++) { + if (chips[i].tag === elem.tag) { + exists = true; + return; + } + } + return '' !== elem.tag && !exists; + }; + + this.addChip = function (elem, $chips) { + if (!self.isValid($chips, elem)) { + return; + } + var $renderedChip = self.renderChip(elem); + var newData = []; + var oldData = $chips.data('chips'); + for (var i = 0; i < oldData.length; i++) { + newData.push(oldData[i]); + } + newData.push(elem); + + $chips.data('chips', newData); + $renderedChip.insertBefore($chips.find('input')); + $chips.trigger('chip.add', elem); + self.setPlaceholder($chips); + }; + + this.deleteChip = function (chipIndex, $chips) { + var chip = $chips.data('chips')[chipIndex]; + $chips.find('.chip').eq(chipIndex).remove(); + + var newData = []; + var oldData = $chips.data('chips'); + for (var i = 0; i < oldData.length; i++) { + if (i !== chipIndex) { + newData.push(oldData[i]); + } + } + + $chips.data('chips', newData); + $chips.trigger('chip.delete', chip); + self.setPlaceholder($chips); + }; + + this.selectChip = function (chipIndex, $chips) { + var $chip = $chips.find('.chip').eq(chipIndex); + if ($chip && false === $chip.hasClass('selected')) { + $chip.addClass('selected'); + $chips.trigger('chip.select', $chips.data('chips')[chipIndex]); + } + }; + + this.getChipsElement = function (index, $chips) { + return $chips.eq(index); + }; + + // init + this.init(); + + this.handleEvents(); + }; +})(jQuery); +;(function ($) { + $.fn.pushpin = function (options) { + // Defaults + var defaults = { + top: 0, + bottom: Infinity, + offset: 0 + }; + + // Remove pushpin event and classes + if (options === "remove") { + this.each(function () { + if (id = $(this).data('pushpin-id')) { + $(window).off('scroll.' + id); + $(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style'); + } + }); + return false; + } + + options = $.extend(defaults, options); + + $index = 0; + return this.each(function () { + var $uniqueId = Materialize.guid(), + $this = $(this), + $original_offset = $(this).offset().top; + + function removePinClasses(object) { + object.removeClass('pin-top'); + object.removeClass('pinned'); + object.removeClass('pin-bottom'); + } + + function updateElements(objects, scrolled) { + objects.each(function () { + // Add position fixed (because its between top and bottom) + if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) { + removePinClasses($(this)); + $(this).css('top', options.offset); + $(this).addClass('pinned'); + } + + // Add pin-top (when scrolled position is above top) + if (scrolled < options.top && !$(this).hasClass('pin-top')) { + removePinClasses($(this)); + $(this).css('top', 0); + $(this).addClass('pin-top'); + } + + // Add pin-bottom (when scrolled position is below bottom) + if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) { + removePinClasses($(this)); + $(this).addClass('pin-bottom'); + $(this).css('top', options.bottom - $original_offset); + } + }); + } + + $(this).data('pushpin-id', $uniqueId); + updateElements($this, $(window).scrollTop()); + $(window).on('scroll.' + $uniqueId, function () { + var $scrolled = $(window).scrollTop() + options.offset; + updateElements($this, $scrolled); + }); + }); + }; +})(jQuery);;(function ($) { + $(document).ready(function () { + + // jQuery reverse + $.fn.reverse = [].reverse; + + // Hover behaviour: make sure this doesn't work on .click-to-toggle FABs! + $(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) { + var $this = $(this); + openFABMenu($this); + }); + $(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) { + var $this = $(this); + closeFABMenu($this); + }); + + // Toggle-on-click behaviour. + $(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function (e) { + var $this = $(this); + var $menu = $this.parent(); + if ($menu.hasClass('active')) { + closeFABMenu($menu); + } else { + openFABMenu($menu); + } + }); + + // Toolbar transition behaviour. + $(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function (e) { + var $this = $(this); + var $menu = $this.parent(); + FABtoToolbar($menu); + }); + }); + + $.fn.extend({ + openFAB: function () { + openFABMenu($(this)); + }, + closeFAB: function () { + closeFABMenu($(this)); + }, + openToolbar: function () { + FABtoToolbar($(this)); + }, + closeToolbar: function () { + toolbarToFAB($(this)); + } + }); + + var openFABMenu = function (btn) { + var $this = btn; + if ($this.hasClass('active') === false) { + + // Get direction option + var horizontal = $this.hasClass('horizontal'); + var offsetY, offsetX; + + if (horizontal === true) { + offsetX = 40; + } else { + offsetY = 40; + } + + $this.addClass('active'); + $this.find('ul .btn-floating').velocity({ scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 0 }); + + var time = 0; + $this.find('ul .btn-floating').reverse().each(function () { + $(this).velocity({ opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0' }, { duration: 80, delay: time }); + time += 40; + }); + } + }; + + var closeFABMenu = function (btn) { + var $this = btn; + // Get direction option + var horizontal = $this.hasClass('horizontal'); + var offsetY, offsetX; + + if (horizontal === true) { + offsetX = 40; + } else { + offsetY = 40; + } + + $this.removeClass('active'); + var time = 0; + $this.find('ul .btn-floating').velocity("stop", true); + $this.find('ul .btn-floating').velocity({ opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 80 }); + }; + + /** + * Transform FAB into toolbar + * @param {Object} object jQuery object + */ + var FABtoToolbar = function (btn) { + if (btn.attr('data-open') === "true") { + return; + } + + var offsetX, offsetY, scaleFactor; + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var btnRect = btn[0].getBoundingClientRect(); + var anchor = btn.find('> a').first(); + var menu = btn.find('> ul').first(); + var backdrop = $('
      '); + var fabColor = anchor.css('background-color'); + anchor.append(backdrop); + + offsetX = btnRect.left - windowWidth / 2 + btnRect.width / 2; + offsetY = windowHeight - btnRect.bottom; + scaleFactor = windowWidth / backdrop.width(); + btn.attr('data-origin-bottom', btnRect.bottom); + btn.attr('data-origin-left', btnRect.left); + btn.attr('data-origin-width', btnRect.width); + + // Set initial state + btn.addClass('active'); + btn.attr('data-open', true); + btn.css({ + 'text-align': 'center', + width: '100%', + bottom: 0, + left: 0, + transform: 'translateX(' + offsetX + 'px)', + transition: 'none' + }); + anchor.css({ + transform: 'translateY(' + -offsetY + 'px)', + transition: 'none' + }); + backdrop.css({ + 'background-color': fabColor + }); + + setTimeout(function () { + btn.css({ + transform: '', + transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s' + }); + anchor.css({ + overflow: 'visible', + transform: '', + transition: 'transform .2s' + }); + + setTimeout(function () { + btn.css({ + overflow: 'hidden', + 'background-color': fabColor + }); + backdrop.css({ + transform: 'scale(' + scaleFactor + ')', + transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)' + }); + menu.find('> li > a').css({ + opacity: 1 + }); + + // Scroll to close. + $(window).on('scroll.fabToolbarClose', function () { + toolbarToFAB(btn); + $(window).off('scroll.fabToolbarClose'); + $(document).off('click.fabToolbarClose'); + }); + + $(document).on('click.fabToolbarClose', function (e) { + if (!$(e.target).closest(menu).length) { + toolbarToFAB(btn); + $(window).off('scroll.fabToolbarClose'); + $(document).off('click.fabToolbarClose'); + } + }); + }, 100); + }, 0); + }; + + /** + * Transform toolbar back into FAB + * @param {Object} object jQuery object + */ + var toolbarToFAB = function (btn) { + if (btn.attr('data-open') !== "true") { + return; + } + + var offsetX, offsetY, scaleFactor; + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var btnWidth = btn.attr('data-origin-width'); + var btnBottom = btn.attr('data-origin-bottom'); + var btnLeft = btn.attr('data-origin-left'); + var anchor = btn.find('> .btn-floating').first(); + var menu = btn.find('> ul').first(); + var backdrop = btn.find('.fab-backdrop'); + var fabColor = anchor.css('background-color'); + + offsetX = btnLeft - windowWidth / 2 + btnWidth / 2; + offsetY = windowHeight - btnBottom; + scaleFactor = windowWidth / backdrop.width(); + + // Hide backdrop + btn.removeClass('active'); + btn.attr('data-open', false); + btn.css({ + 'background-color': 'transparent', + transition: 'none' + }); + anchor.css({ + transition: 'none' + }); + backdrop.css({ + transform: 'scale(0)', + 'background-color': fabColor + }); + menu.find('> li > a').css({ + opacity: '' + }); + + setTimeout(function () { + backdrop.remove(); + + // Set initial state. + btn.css({ + 'text-align': '', + width: '', + bottom: '', + left: '', + overflow: '', + 'background-color': '', + transform: 'translate3d(' + -offsetX + 'px,0,0)' + }); + anchor.css({ + overflow: '', + transform: 'translate3d(0,' + offsetY + 'px,0)' + }); + + setTimeout(function () { + btn.css({ + transform: 'translate3d(0,0,0)', + transition: 'transform .2s' + }); + anchor.css({ + transform: 'translate3d(0,0,0)', + transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)' + }); + }, 20); + }, 200); + }; +})(jQuery); +;(function ($) { + // Image transition function + Materialize.fadeInImage = function (selectorOrEl) { + var element; + if (typeof selectorOrEl === 'string') { + element = $(selectorOrEl); + } else if (typeof selectorOrEl === 'object') { + element = selectorOrEl; + } else { + return; + } + element.css({ opacity: 0 }); + $(element).velocity({ opacity: 1 }, { + duration: 650, + queue: false, + easing: 'easeOutSine' + }); + $(element).velocity({ opacity: 1 }, { + duration: 1300, + queue: false, + easing: 'swing', + step: function (now, fx) { + fx.start = 100; + var grayscale_setting = now / 100; + var brightness_setting = 150 - (100 - now) / 1.75; + + if (brightness_setting < 100) { + brightness_setting = 100; + } + if (now >= 0) { + $(this).css({ + "-webkit-filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)", + "filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)" + }); + } + } + }); + }; + + // Horizontal staggered list + Materialize.showStaggeredList = function (selectorOrEl) { + var element; + if (typeof selectorOrEl === 'string') { + element = $(selectorOrEl); + } else if (typeof selectorOrEl === 'object') { + element = selectorOrEl; + } else { + return; + } + var time = 0; + element.find('li').velocity({ translateX: "-100px" }, { duration: 0 }); + + element.find('li').each(function () { + $(this).velocity({ opacity: "1", translateX: "0" }, { duration: 800, delay: time, easing: [60, 10] }); + time += 120; + }); + }; + + $(document).ready(function () { + // Hardcoded .staggered-list scrollFire + // var staggeredListOptions = []; + // $('ul.staggered-list').each(function (i) { + + // var label = 'scrollFire-' + i; + // $(this).addClass(label); + // staggeredListOptions.push( + // {selector: 'ul.staggered-list.' + label, + // offset: 200, + // callback: 'showStaggeredList("ul.staggered-list.' + label + '")'}); + // }); + // scrollFire(staggeredListOptions); + + // HammerJS, Swipe navigation + + // Touch Event + var swipeLeft = false; + var swipeRight = false; + + // Dismissible Collections + $('.dismissable').each(function () { + $(this).hammer({ + prevent_default: false + }).on('pan', function (e) { + if (e.gesture.pointerType === "touch") { + var $this = $(this); + var direction = e.gesture.direction; + var x = e.gesture.deltaX; + var velocityX = e.gesture.velocityX; + + $this.velocity({ translateX: x + }, { duration: 50, queue: false, easing: 'easeOutQuad' }); + + // Swipe Left + if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.75)) { + swipeLeft = true; + } + + // Swipe Right + if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.75)) { + swipeRight = true; + } + } + }).on('panend', function (e) { + // Reset if collection is moved back into original position + if (Math.abs(e.gesture.deltaX) < $(this).innerWidth() / 2) { + swipeRight = false; + swipeLeft = false; + } + + if (e.gesture.pointerType === "touch") { + var $this = $(this); + if (swipeLeft || swipeRight) { + var fullWidth; + if (swipeLeft) { + fullWidth = $this.innerWidth(); + } else { + fullWidth = -1 * $this.innerWidth(); + } + + $this.velocity({ translateX: fullWidth + }, { duration: 100, queue: false, easing: 'easeOutQuad', complete: function () { + $this.css('border', 'none'); + $this.velocity({ height: 0, padding: 0 + }, { duration: 200, queue: false, easing: 'easeOutQuad', complete: function () { + $this.remove(); + } + }); + } + }); + } else { + $this.velocity({ translateX: 0 + }, { duration: 100, queue: false, easing: 'easeOutQuad' }); + } + swipeLeft = false; + swipeRight = false; + } + }); + }); + + // time = 0 + // // Vertical Staggered list + // $('ul.staggered-list.vertical li').velocity( + // { translateY: "100px"}, + // { duration: 0 }); + + // $('ul.staggered-list.vertical li').each(function() { + // $(this).velocity( + // { opacity: "1", translateY: "0"}, + // { duration: 800, delay: time, easing: [60, 25] }); + // time += 120; + // }); + + // // Fade in and Scale + // $('.fade-in.scale').velocity( + // { scaleX: .4, scaleY: .4, translateX: -600}, + // { duration: 0}); + // $('.fade-in').each(function() { + // $(this).velocity( + // { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0}, + // { duration: 800, easing: [60, 10] }); + // }); + }); +})(jQuery); +;(function ($) { + + var scrollFireEventsHandled = false; + + // Input: Array of JSON objects {selector, offset, callback} + Materialize.scrollFire = function (options) { + var onScroll = function () { + var windowScroll = window.pageYOffset + window.innerHeight; + + for (var i = 0; i < options.length; i++) { + // Get options from each line + var value = options[i]; + var selector = value.selector, + offset = value.offset, + callback = value.callback; + + var currentElement = document.querySelector(selector); + if (currentElement !== null) { + var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset; + + if (windowScroll > elementOffset + offset) { + if (value.done !== true) { + if (typeof callback === 'function') { + callback.call(this, currentElement); + } else if (typeof callback === 'string') { + var callbackFunc = new Function(callback); + callbackFunc(currentElement); + } + value.done = true; + } + } + } + } + }; + + var throttledScroll = Materialize.throttle(function () { + onScroll(); + }, options.throttle || 100); + + if (!scrollFireEventsHandled) { + window.addEventListener("scroll", throttledScroll); + window.addEventListener("resize", throttledScroll); + scrollFireEventsHandled = true; + } + + // perform a scan once, after current execution context, and after dom is ready + setTimeout(throttledScroll, 0); + }; +})(jQuery); +; /*! + * pickadate.js v3.5.0, 2014/04/13 + * By Amsul, http://amsul.ca + * Hosted on http://amsul.github.io/pickadate.js + * Licensed under MIT + */ + +(function (factory) { + + Materialize.Picker = factory(jQuery); +})(function ($) { + + var $window = $(window); + var $document = $(document); + var $html = $(document.documentElement); + + /** + * The picker constructor that creates a blank picker. + */ + function PickerConstructor(ELEMENT, NAME, COMPONENT, OPTIONS) { + + // If there’s no element, return the picker constructor. + if (!ELEMENT) return PickerConstructor; + + var IS_DEFAULT_THEME = false, + + + // The state of the picker. + STATE = { + id: ELEMENT.id || 'P' + Math.abs(~~(Math.random() * new Date())) + }, + + + // Merge the defaults and options passed. + SETTINGS = COMPONENT ? $.extend(true, {}, COMPONENT.defaults, OPTIONS) : OPTIONS || {}, + + + // Merge the default classes with the settings classes. + CLASSES = $.extend({}, PickerConstructor.klasses(), SETTINGS.klass), + + + // The element node wrapper into a jQuery object. + $ELEMENT = $(ELEMENT), + + + // Pseudo picker constructor. + PickerInstance = function () { + return this.start(); + }, + + + // The picker prototype. + P = PickerInstance.prototype = { + + constructor: PickerInstance, + + $node: $ELEMENT, + + /** + * Initialize everything + */ + start: function () { + + // If it’s already started, do nothing. + if (STATE && STATE.start) return P; + + // Update the picker states. + STATE.methods = {}; + STATE.start = true; + STATE.open = false; + STATE.type = ELEMENT.type; + + // Confirm focus state, convert into text input to remove UA stylings, + // and set as readonly to prevent keyboard popup. + ELEMENT.autofocus = ELEMENT == getActiveElement(); + ELEMENT.readOnly = !SETTINGS.editable; + ELEMENT.id = ELEMENT.id || STATE.id; + if (ELEMENT.type != 'text') { + ELEMENT.type = 'text'; + } + + // Create a new picker component with the settings. + P.component = new COMPONENT(P, SETTINGS); + + // Create the picker root with a holder and then prepare it. + P.$root = $(PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"')); + prepareElementRoot(); + + // If there’s a format for the hidden input element, create the element. + if (SETTINGS.formatSubmit) { + prepareElementHidden(); + } + + // Prepare the input element. + prepareElement(); + + // Insert the root as specified in the settings. + if (SETTINGS.container) $(SETTINGS.container).append(P.$root);else $ELEMENT.before(P.$root); + + // Bind the default component and settings events. + P.on({ + start: P.component.onStart, + render: P.component.onRender, + stop: P.component.onStop, + open: P.component.onOpen, + close: P.component.onClose, + set: P.component.onSet + }).on({ + start: SETTINGS.onStart, + render: SETTINGS.onRender, + stop: SETTINGS.onStop, + open: SETTINGS.onOpen, + close: SETTINGS.onClose, + set: SETTINGS.onSet + }); + + // Once we’re all set, check the theme in use. + IS_DEFAULT_THEME = isUsingDefaultTheme(P.$root.children()[0]); + + // If the element has autofocus, open the picker. + if (ELEMENT.autofocus) { + P.open(); + } + + // Trigger queued the “start” and “render” events. + return P.trigger('start').trigger('render'); + }, //start + + + /** + * Render a new picker + */ + render: function (entireComponent) { + + // Insert a new component holder in the root or box. + if (entireComponent) P.$root.html(createWrappedComponent());else P.$root.find('.' + CLASSES.box).html(P.component.nodes(STATE.open)); + + // Trigger the queued “render” events. + return P.trigger('render'); + }, //render + + + /** + * Destroy everything + */ + stop: function () { + + // If it’s already stopped, do nothing. + if (!STATE.start) return P; + + // Then close the picker. + P.close(); + + // Remove the hidden field. + if (P._hidden) { + P._hidden.parentNode.removeChild(P._hidden); + } + + // Remove the root. + P.$root.remove(); + + // Remove the input class, remove the stored data, and unbind + // the events (after a tick for IE - see `P.close`). + $ELEMENT.removeClass(CLASSES.input).removeData(NAME); + setTimeout(function () { + $ELEMENT.off('.' + STATE.id); + }, 0); + + // Restore the element state + ELEMENT.type = STATE.type; + ELEMENT.readOnly = false; + + // Trigger the queued “stop” events. + P.trigger('stop'); + + // Reset the picker states. + STATE.methods = {}; + STATE.start = false; + + return P; + }, //stop + + + /** + * Open up the picker + */ + open: function (dontGiveFocus) { + + // If it’s already open, do nothing. + if (STATE.open) return P; + + // Add the “active” class. + $ELEMENT.addClass(CLASSES.active); + aria(ELEMENT, 'expanded', true); + + // * A Firefox bug, when `html` has `overflow:hidden`, results in + // killing transitions :(. So add the “opened” state on the next tick. + // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289 + setTimeout(function () { + + // Add the “opened” class to the picker root. + P.$root.addClass(CLASSES.opened); + aria(P.$root[0], 'hidden', false); + }, 0); + + // If we have to give focus, bind the element and doc events. + if (dontGiveFocus !== false) { + + // Set it as open. + STATE.open = true; + + // Prevent the page from scrolling. + if (IS_DEFAULT_THEME) { + $html.css('overflow', 'hidden').css('padding-right', '+=' + getScrollbarWidth()); + } + + // Pass focus to the root element’s jQuery object. + // * Workaround for iOS8 to bring the picker’s root into view. + P.$root.eq(0).focus(); + + // Bind the document events. + $document.on('click.' + STATE.id + ' focusin.' + STATE.id, function (event) { + + var target = event.target; + + // If the target of the event is not the element, close the picker picker. + // * Don’t worry about clicks or focusins on the root because those don’t bubble up. + // Also, for Firefox, a click on an `option` element bubbles up directly + // to the doc. So make sure the target wasn't the doc. + // * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling, + // which causes the picker to unexpectedly close when right-clicking it. So make + // sure the event wasn’t a right-click. + if (target != ELEMENT && target != document && event.which != 3) { + + // If the target was the holder that covers the screen, + // keep the element focused to maintain tabindex. + P.close(target === P.$root.children()[0]); + } + }).on('keydown.' + STATE.id, function (event) { + + var + // Get the keycode. + keycode = event.keyCode, + + + // Translate that to a selection change. + keycodeToMove = P.component.key[keycode], + + + // Grab the target. + target = event.target; + + // On escape, close the picker and give focus. + if (keycode == 27) { + P.close(true); + } + + // Check if there is a key movement or “enter” keypress on the element. + else if (target == P.$root[0] && (keycodeToMove || keycode == 13)) { + + // Prevent the default action to stop page movement. + event.preventDefault(); + + // Trigger the key movement action. + if (keycodeToMove) { + PickerConstructor._.trigger(P.component.key.go, P, [PickerConstructor._.trigger(keycodeToMove)]); + } + + // On “enter”, if the highlighted item isn’t disabled, set the value and close. + else if (!P.$root.find('.' + CLASSES.highlighted).hasClass(CLASSES.disabled)) { + P.set('select', P.component.item.highlight); + if (SETTINGS.closeOnSelect) { + P.close(true); + } + } + } + + // If the target is within the root and “enter” is pressed, + // prevent the default action and trigger a click on the target instead. + else if ($.contains(P.$root[0], target) && keycode == 13) { + event.preventDefault(); + target.click(); + } + }); + } + + // Trigger the queued “open” events. + return P.trigger('open'); + }, //open + + + /** + * Close the picker + */ + close: function (giveFocus) { + + // If we need to give focus, do it before changing states. + if (giveFocus) { + // ....ah yes! It would’ve been incomplete without a crazy workaround for IE :| + // The focus is triggered *after* the close has completed - causing it + // to open again. So unbind and rebind the event at the next tick. + P.$root.off('focus.toOpen').eq(0).focus(); + setTimeout(function () { + P.$root.on('focus.toOpen', handleFocusToOpenEvent); + }, 0); + } + + // Remove the “active” class. + $ELEMENT.removeClass(CLASSES.active); + aria(ELEMENT, 'expanded', false); + + // * A Firefox bug, when `html` has `overflow:hidden`, results in + // killing transitions :(. So remove the “opened” state on the next tick. + // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289 + setTimeout(function () { + + // Remove the “opened” and “focused” class from the picker root. + P.$root.removeClass(CLASSES.opened + ' ' + CLASSES.focused); + aria(P.$root[0], 'hidden', true); + }, 0); + + // If it’s already closed, do nothing more. + if (!STATE.open) return P; + + // Set it as closed. + STATE.open = false; + + // Allow the page to scroll. + if (IS_DEFAULT_THEME) { + $html.css('overflow', '').css('padding-right', '-=' + getScrollbarWidth()); + } + + // Unbind the document events. + $document.off('.' + STATE.id); + + // Trigger the queued “close” events. + return P.trigger('close'); + }, //close + + + /** + * Clear the values + */ + clear: function (options) { + return P.set('clear', null, options); + }, //clear + + + /** + * Set something + */ + set: function (thing, value, options) { + + var thingItem, + thingValue, + thingIsObject = $.isPlainObject(thing), + thingObject = thingIsObject ? thing : {}; + + // Make sure we have usable options. + options = thingIsObject && $.isPlainObject(value) ? value : options || {}; + + if (thing) { + + // If the thing isn’t an object, make it one. + if (!thingIsObject) { + thingObject[thing] = value; + } + + // Go through the things of items to set. + for (thingItem in thingObject) { + + // Grab the value of the thing. + thingValue = thingObject[thingItem]; + + // First, if the item exists and there’s a value, set it. + if (thingItem in P.component.item) { + if (thingValue === undefined) thingValue = null; + P.component.set(thingItem, thingValue, options); + } + + // Then, check to update the element value and broadcast a change. + if (thingItem == 'select' || thingItem == 'clear') { + $ELEMENT.val(thingItem == 'clear' ? '' : P.get(thingItem, SETTINGS.format)).trigger('change'); + } + } + + // Render a new picker. + P.render(); + } + + // When the method isn’t muted, trigger queued “set” events and pass the `thingObject`. + return options.muted ? P : P.trigger('set', thingObject); + }, //set + + + /** + * Get something + */ + get: function (thing, format) { + + // Make sure there’s something to get. + thing = thing || 'value'; + + // If a picker state exists, return that. + if (STATE[thing] != null) { + return STATE[thing]; + } + + // Return the submission value, if that. + if (thing == 'valueSubmit') { + if (P._hidden) { + return P._hidden.value; + } + thing = 'value'; + } + + // Return the value, if that. + if (thing == 'value') { + return ELEMENT.value; + } + + // Check if a component item exists, return that. + if (thing in P.component.item) { + if (typeof format == 'string') { + var thingValue = P.component.get(thing); + return thingValue ? PickerConstructor._.trigger(P.component.formats.toString, P.component, [format, thingValue]) : ''; + } + return P.component.get(thing); + } + }, //get + + + /** + * Bind events on the things. + */ + on: function (thing, method, internal) { + + var thingName, + thingMethod, + thingIsObject = $.isPlainObject(thing), + thingObject = thingIsObject ? thing : {}; + + if (thing) { + + // If the thing isn’t an object, make it one. + if (!thingIsObject) { + thingObject[thing] = method; + } + + // Go through the things to bind to. + for (thingName in thingObject) { + + // Grab the method of the thing. + thingMethod = thingObject[thingName]; + + // If it was an internal binding, prefix it. + if (internal) { + thingName = '_' + thingName; + } + + // Make sure the thing methods collection exists. + STATE.methods[thingName] = STATE.methods[thingName] || []; + + // Add the method to the relative method collection. + STATE.methods[thingName].push(thingMethod); + } + } + + return P; + }, //on + + + /** + * Unbind events on the things. + */ + off: function () { + var i, + thingName, + names = arguments; + for (i = 0, namesCount = names.length; i < namesCount; i += 1) { + thingName = names[i]; + if (thingName in STATE.methods) { + delete STATE.methods[thingName]; + } + } + return P; + }, + + /** + * Fire off method events. + */ + trigger: function (name, data) { + var _trigger = function (name) { + var methodList = STATE.methods[name]; + if (methodList) { + methodList.map(function (method) { + PickerConstructor._.trigger(method, P, [data]); + }); + } + }; + _trigger('_' + name); + _trigger(name); + return P; + } //trigger + //PickerInstance.prototype + + + /** + * Wrap the picker holder components together. + */ + };function createWrappedComponent() { + + // Create a picker wrapper holder + return PickerConstructor._.node('div', + + // Create a picker wrapper node + PickerConstructor._.node('div', + + // Create a picker frame + PickerConstructor._.node('div', + + // Create a picker box node + PickerConstructor._.node('div', + + // Create the components nodes. + P.component.nodes(STATE.open), + + // The picker box class + CLASSES.box), + + // Picker wrap class + CLASSES.wrap), + + // Picker frame class + CLASSES.frame), + + // Picker holder class + CLASSES.holder); //endreturn + } //createWrappedComponent + + + /** + * Prepare the input element with all bindings. + */ + function prepareElement() { + + $ELEMENT. + + // Store the picker data by component name. + data(NAME, P). + + // Add the “input” class name. + addClass(CLASSES.input). + + // Remove the tabindex. + attr('tabindex', -1). + + // If there’s a `data-value`, update the value of the element. + val($ELEMENT.data('value') ? P.get('select', SETTINGS.format) : ELEMENT.value); + + // Only bind keydown events if the element isn’t editable. + if (!SETTINGS.editable) { + + $ELEMENT. + + // On focus/click, focus onto the root to open it up. + on('focus.' + STATE.id + ' click.' + STATE.id, function (event) { + event.preventDefault(); + P.$root.eq(0).focus(); + }). + + // Handle keyboard event based on the picker being opened or not. + on('keydown.' + STATE.id, handleKeydownEvent); + } + + // Update the aria attributes. + aria(ELEMENT, { + haspopup: true, + expanded: false, + readonly: false, + owns: ELEMENT.id + '_root' + }); + } + + /** + * Prepare the root picker element with all bindings. + */ + function prepareElementRoot() { + + P.$root.on({ + + // For iOS8. + keydown: handleKeydownEvent, + + // When something within the root is focused, stop from bubbling + // to the doc and remove the “focused” state from the root. + focusin: function (event) { + P.$root.removeClass(CLASSES.focused); + event.stopPropagation(); + }, + + // When something within the root holder is clicked, stop it + // from bubbling to the doc. + 'mousedown click': function (event) { + + var target = event.target; + + // Make sure the target isn’t the root holder so it can bubble up. + if (target != P.$root.children()[0]) { + + event.stopPropagation(); + + // * For mousedown events, cancel the default action in order to + // prevent cases where focus is shifted onto external elements + // when using things like jQuery mobile or MagnificPopup (ref: #249 & #120). + // Also, for Firefox, don’t prevent action on the `option` element. + if (event.type == 'mousedown' && !$(target).is('input, select, textarea, button, option')) { + + event.preventDefault(); + + // Re-focus onto the root so that users can click away + // from elements focused within the picker. + P.$root.eq(0).focus(); + } + } + } + }). + + // Add/remove the “target” class on focus and blur. + on({ + focus: function () { + $ELEMENT.addClass(CLASSES.target); + }, + blur: function () { + $ELEMENT.removeClass(CLASSES.target); + } + }). + + // Open the picker and adjust the root “focused” state + on('focus.toOpen', handleFocusToOpenEvent). + + // If there’s a click on an actionable element, carry out the actions. + on('click', '[data-pick], [data-nav], [data-clear], [data-close]', function () { + + var $target = $(this), + targetData = $target.data(), + targetDisabled = $target.hasClass(CLASSES.navDisabled) || $target.hasClass(CLASSES.disabled), + + + // * For IE, non-focusable elements can be active elements as well + // (http://stackoverflow.com/a/2684561). + activeElement = getActiveElement(); + activeElement = activeElement && (activeElement.type || activeElement.href) && activeElement; + + // If it’s disabled or nothing inside is actively focused, re-focus the element. + if (targetDisabled || activeElement && !$.contains(P.$root[0], activeElement)) { + P.$root.eq(0).focus(); + } + + // If something is superficially changed, update the `highlight` based on the `nav`. + if (!targetDisabled && targetData.nav) { + P.set('highlight', P.component.item.highlight, { nav: targetData.nav }); + } + + // If something is picked, set `select` then close with focus. + else if (!targetDisabled && 'pick' in targetData) { + P.set('select', targetData.pick); + if (SETTINGS.closeOnSelect) { + P.close(true); + } + } + + // If a “clear” button is pressed, empty the values and close with focus. + else if (targetData.clear) { + P.clear(); + if (SETTINGS.closeOnSelect) { + P.close(true); + } + } else if (targetData.close) { + P.close(true); + } + }); //P.$root + + aria(P.$root[0], 'hidden', true); + } + + /** + * Prepare the hidden input element along with all bindings. + */ + function prepareElementHidden() { + + var name; + + if (SETTINGS.hiddenName === true) { + name = ELEMENT.name; + ELEMENT.name = ''; + } else { + name = [typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : '', typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit']; + name = name[0] + ELEMENT.name + name[1]; + } + + P._hidden = $('')[0]; + + $ELEMENT. + + // If the value changes, update the hidden input with the correct format. + on('change.' + STATE.id, function () { + P._hidden.value = ELEMENT.value ? P.get('select', SETTINGS.formatSubmit) : ''; + }); + + // Insert the hidden input as specified in the settings. + if (SETTINGS.container) $(SETTINGS.container).append(P._hidden);else $ELEMENT.before(P._hidden); + } + + // For iOS8. + function handleKeydownEvent(event) { + + var keycode = event.keyCode, + + + // Check if one of the delete keys was pressed. + isKeycodeDelete = /^(8|46)$/.test(keycode); + + // For some reason IE clears the input value on “escape”. + if (keycode == 27) { + P.close(); + return false; + } + + // Check if `space` or `delete` was pressed or the picker is closed with a key movement. + if (keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode]) { + + // Prevent it from moving the page and bubbling to doc. + event.preventDefault(); + event.stopPropagation(); + + // If `delete` was pressed, clear the values and close the picker. + // Otherwise open the picker. + if (isKeycodeDelete) { + P.clear().close(); + } else { + P.open(); + } + } + } + + // Separated for IE + function handleFocusToOpenEvent(event) { + + // Stop the event from propagating to the doc. + event.stopPropagation(); + + // If it’s a focus event, add the “focused” class to the root. + if (event.type == 'focus') { + P.$root.addClass(CLASSES.focused); + } + + // And then finally open the picker. + P.open(); + } + + // Return a new picker instance. + return new PickerInstance(); + } //PickerConstructor + + + /** + * The default classes and prefix to use for the HTML classes. + */ + PickerConstructor.klasses = function (prefix) { + prefix = prefix || 'picker'; + return { + + picker: prefix, + opened: prefix + '--opened', + focused: prefix + '--focused', + + input: prefix + '__input', + active: prefix + '__input--active', + target: prefix + '__input--target', + + holder: prefix + '__holder', + + frame: prefix + '__frame', + wrap: prefix + '__wrap', + + box: prefix + '__box' + }; + }; //PickerConstructor.klasses + + + /** + * Check if the default theme is being used. + */ + function isUsingDefaultTheme(element) { + + var theme, + prop = 'position'; + + // For IE. + if (element.currentStyle) { + theme = element.currentStyle[prop]; + } + + // For normal browsers. + else if (window.getComputedStyle) { + theme = getComputedStyle(element)[prop]; + } + + return theme == 'fixed'; + } + + /** + * Get the width of the browser’s scrollbar. + * Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js + */ + function getScrollbarWidth() { + + if ($html.height() <= $window.height()) { + return 0; + } + + var $outer = $('
      ').appendTo('body'); + + // Get the width without scrollbars. + var widthWithoutScroll = $outer[0].offsetWidth; + + // Force adding scrollbars. + $outer.css('overflow', 'scroll'); + + // Add the inner div. + var $inner = $('
      ').appendTo($outer); + + // Get the width with scrollbars. + var widthWithScroll = $inner[0].offsetWidth; + + // Remove the divs. + $outer.remove(); + + // Return the difference between the widths. + return widthWithoutScroll - widthWithScroll; + } + + /** + * PickerConstructor helper methods. + */ + PickerConstructor._ = { + + /** + * Create a group of nodes. Expects: + * ` + { + min: {Integer}, + max: {Integer}, + i: {Integer}, + node: {String}, + item: {Function} + } + * ` + */ + group: function (groupObject) { + + var + // Scope for the looped object + loopObjectScope, + + + // Create the nodes list + nodesList = '', + + + // The counter starts from the `min` + counter = PickerConstructor._.trigger(groupObject.min, groupObject); + + // Loop from the `min` to `max`, incrementing by `i` + for (; counter <= PickerConstructor._.trigger(groupObject.max, groupObject, [counter]); counter += groupObject.i) { + + // Trigger the `item` function within scope of the object + loopObjectScope = PickerConstructor._.trigger(groupObject.item, groupObject, [counter]); + + // Splice the subgroup and create nodes out of the sub nodes + nodesList += PickerConstructor._.node(groupObject.node, loopObjectScope[0], // the node + loopObjectScope[1], // the classes + loopObjectScope[2] // the attributes + ); + } + + // Return the list of nodes + return nodesList; + }, //group + + + /** + * Create a dom node string + */ + node: function (wrapper, item, klass, attribute) { + + // If the item is false-y, just return an empty string + if (!item) return ''; + + // If the item is an array, do a join + item = $.isArray(item) ? item.join('') : item; + + // Check for the class + klass = klass ? ' class="' + klass + '"' : ''; + + // Check for any attributes + attribute = attribute ? ' ' + attribute : ''; + + // Return the wrapped item + return '<' + wrapper + klass + attribute + '>' + item + ''; + }, //node + + + /** + * Lead numbers below 10 with a zero. + */ + lead: function (number) { + return (number < 10 ? '0' : '') + number; + }, + + /** + * Trigger a function otherwise return the value. + */ + trigger: function (callback, scope, args) { + return typeof callback == 'function' ? callback.apply(scope, args || []) : callback; + }, + + /** + * If the second character is a digit, length is 2 otherwise 1. + */ + digits: function (string) { + return (/\d/.test(string[1]) ? 2 : 1 + ); + }, + + /** + * Tell if something is a date object. + */ + isDate: function (value) { + return {}.toString.call(value).indexOf('Date') > -1 && this.isInteger(value.getDate()); + }, + + /** + * Tell if something is an integer. + */ + isInteger: function (value) { + return {}.toString.call(value).indexOf('Number') > -1 && value % 1 === 0; + }, + + /** + * Create ARIA attribute strings. + */ + ariaAttr: ariaAttr //PickerConstructor._ + + + /** + * Extend the picker with a component and defaults. + */ + };PickerConstructor.extend = function (name, Component) { + + // Extend jQuery. + $.fn[name] = function (options, action) { + + // Grab the component data. + var componentData = this.data(name); + + // If the picker is requested, return the data object. + if (options == 'picker') { + return componentData; + } + + // If the component data exists and `options` is a string, carry out the action. + if (componentData && typeof options == 'string') { + return PickerConstructor._.trigger(componentData[options], componentData, [action]); + } + + // Otherwise go through each matched element and if the component + // doesn’t exist, create a new picker using `this` element + // and merging the defaults and options with a deep copy. + return this.each(function () { + var $this = $(this); + if (!$this.data(name)) { + new PickerConstructor(this, name, Component, options); + } + }); + }; + + // Set the defaults. + $.fn[name].defaults = Component.defaults; + }; //PickerConstructor.extend + + + function aria(element, attribute, value) { + if ($.isPlainObject(attribute)) { + for (var key in attribute) { + ariaSet(element, key, attribute[key]); + } + } else { + ariaSet(element, attribute, value); + } + } + function ariaSet(element, attribute, value) { + element.setAttribute((attribute == 'role' ? '' : 'aria-') + attribute, value); + } + function ariaAttr(attribute, data) { + if (!$.isPlainObject(attribute)) { + attribute = { attribute: data }; + } + data = ''; + for (var key in attribute) { + var attr = (key == 'role' ? '' : 'aria-') + key, + attrVal = attribute[key]; + data += attrVal == null ? '' : attr + '="' + attribute[key] + '"'; + } + return data; + } + + // IE8 bug throws an error for activeElements within iframes. + function getActiveElement() { + try { + return document.activeElement; + } catch (err) {} + } + + // Expose the picker constructor. + return PickerConstructor; +}); +; /*! + * Date picker for pickadate.js v3.5.0 + * http://amsul.github.io/pickadate.js/date.htm + */ + +(function (factory) { + factory(Materialize.Picker, jQuery); +})(function (Picker, $) { + + /** + * Globals and constants + */ + var DAYS_IN_WEEK = 7, + WEEKS_IN_CALENDAR = 6, + _ = Picker._; + + /** + * The date picker constructor + */ + function DatePicker(picker, settings) { + + var calendar = this, + element = picker.$node[0], + elementValue = element.value, + elementDataValue = picker.$node.data('value'), + valueString = elementDataValue || elementValue, + formatString = elementDataValue ? settings.formatSubmit : settings.format, + isRTL = function () { + + return element.currentStyle ? + + // For IE. + element.currentStyle.direction == 'rtl' : + + // For normal browsers. + getComputedStyle(picker.$root[0]).direction == 'rtl'; + }; + + calendar.settings = settings; + calendar.$node = picker.$node; + + // The queue of methods that will be used to build item objects. + calendar.queue = { + min: 'measure create', + max: 'measure create', + now: 'now create', + select: 'parse create validate', + highlight: 'parse navigate create validate', + view: 'parse create validate viewset', + disable: 'deactivate', + enable: 'activate' + + // The component's item object. + };calendar.item = {}; + + calendar.item.clear = null; + calendar.item.disable = (settings.disable || []).slice(0); + calendar.item.enable = -function (collectionDisabled) { + return collectionDisabled[0] === true ? collectionDisabled.shift() : -1; + }(calendar.item.disable); + + calendar.set('min', settings.min).set('max', settings.max).set('now'); + + // When there’s a value, set the `select`, which in turn + // also sets the `highlight` and `view`. + if (valueString) { + calendar.set('select', valueString, { format: formatString }); + } + + // If there’s no value, default to highlighting “today”. + else { + calendar.set('select', null).set('highlight', calendar.item.now); + } + + // The keycode to movement mapping. + calendar.key = { + 40: 7, // Down + 38: -7, // Up + 39: function () { + return isRTL() ? -1 : 1; + }, // Right + 37: function () { + return isRTL() ? 1 : -1; + }, // Left + go: function (timeChange) { + var highlightedObject = calendar.item.highlight, + targetDate = new Date(highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange); + calendar.set('highlight', targetDate, { interval: timeChange }); + this.render(); + } + + // Bind some picker events. + };picker.on('render', function () { + picker.$root.find('.' + settings.klass.selectMonth).on('change', function () { + var value = this.value; + if (value) { + picker.set('highlight', [picker.get('view').year, value, picker.get('highlight').date]); + picker.$root.find('.' + settings.klass.selectMonth).trigger('focus'); + } + }); + picker.$root.find('.' + settings.klass.selectYear).on('change', function () { + var value = this.value; + if (value) { + picker.set('highlight', [value, picker.get('view').month, picker.get('highlight').date]); + picker.$root.find('.' + settings.klass.selectYear).trigger('focus'); + } + }); + }, 1).on('open', function () { + var includeToday = ''; + if (calendar.disabled(calendar.get('now'))) { + includeToday = ':not(.' + settings.klass.buttonToday + ')'; + } + picker.$root.find('button' + includeToday + ', select').attr('disabled', false); + }, 1).on('close', function () { + picker.$root.find('button, select').attr('disabled', true); + }, 1); + } //DatePicker + + + /** + * Set a datepicker item object. + */ + DatePicker.prototype.set = function (type, value, options) { + + var calendar = this, + calendarItem = calendar.item; + + // If the value is `null` just set it immediately. + if (value === null) { + if (type == 'clear') type = 'select'; + calendarItem[type] = value; + return calendar; + } + + // Otherwise go through the queue of methods, and invoke the functions. + // Update this as the time unit, and set the final value as this item. + // * In the case of `enable`, keep the queue but set `disable` instead. + // And in the case of `flip`, keep the queue but set `enable` instead. + calendarItem[type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type] = calendar.queue[type].split(' ').map(function (method) { + value = calendar[method](type, value, options); + return value; + }).pop(); + + // Check if we need to cascade through more updates. + if (type == 'select') { + calendar.set('highlight', calendarItem.select, options); + } else if (type == 'highlight') { + calendar.set('view', calendarItem.highlight, options); + } else if (type.match(/^(flip|min|max|disable|enable)$/)) { + if (calendarItem.select && calendar.disabled(calendarItem.select)) { + calendar.set('select', calendarItem.select, options); + } + if (calendarItem.highlight && calendar.disabled(calendarItem.highlight)) { + calendar.set('highlight', calendarItem.highlight, options); + } + } + + return calendar; + }; //DatePicker.prototype.set + + + /** + * Get a datepicker item object. + */ + DatePicker.prototype.get = function (type) { + return this.item[type]; + }; //DatePicker.prototype.get + + + /** + * Create a picker date object. + */ + DatePicker.prototype.create = function (type, value, options) { + + var isInfiniteValue, + calendar = this; + + // If there’s no value, use the type as the value. + value = value === undefined ? type : value; + + // If it’s infinity, update the value. + if (value == -Infinity || value == Infinity) { + isInfiniteValue = value; + } + + // If it’s an object, use the native date object. + else if ($.isPlainObject(value) && _.isInteger(value.pick)) { + value = value.obj; + } + + // If it’s an array, convert it into a date and make sure + // that it’s a valid date – otherwise default to today. + else if ($.isArray(value)) { + value = new Date(value[0], value[1], value[2]); + value = _.isDate(value) ? value : calendar.create().obj; + } + + // If it’s a number or date object, make a normalized date. + else if (_.isInteger(value) || _.isDate(value)) { + value = calendar.normalize(new Date(value), options); + } + + // If it’s a literal true or any other case, set it to now. + else /*if ( value === true )*/{ + value = calendar.now(type, value, options); + } + + // Return the compiled object. + return { + year: isInfiniteValue || value.getFullYear(), + month: isInfiniteValue || value.getMonth(), + date: isInfiniteValue || value.getDate(), + day: isInfiniteValue || value.getDay(), + obj: isInfiniteValue || value, + pick: isInfiniteValue || value.getTime() + }; + }; //DatePicker.prototype.create + + + /** + * Create a range limit object using an array, date object, + * literal “true”, or integer relative to another time. + */ + DatePicker.prototype.createRange = function (from, to) { + + var calendar = this, + createDate = function (date) { + if (date === true || $.isArray(date) || _.isDate(date)) { + return calendar.create(date); + } + return date; + }; + + // Create objects if possible. + if (!_.isInteger(from)) { + from = createDate(from); + } + if (!_.isInteger(to)) { + to = createDate(to); + } + + // Create relative dates. + if (_.isInteger(from) && $.isPlainObject(to)) { + from = [to.year, to.month, to.date + from]; + } else if (_.isInteger(to) && $.isPlainObject(from)) { + to = [from.year, from.month, from.date + to]; + } + + return { + from: createDate(from), + to: createDate(to) + }; + }; //DatePicker.prototype.createRange + + + /** + * Check if a date unit falls within a date range object. + */ + DatePicker.prototype.withinRange = function (range, dateUnit) { + range = this.createRange(range.from, range.to); + return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick; + }; + + /** + * Check if two date range objects overlap. + */ + DatePicker.prototype.overlapRanges = function (one, two) { + + var calendar = this; + + // Convert the ranges into comparable dates. + one = calendar.createRange(one.from, one.to); + two = calendar.createRange(two.from, two.to); + + return calendar.withinRange(one, two.from) || calendar.withinRange(one, two.to) || calendar.withinRange(two, one.from) || calendar.withinRange(two, one.to); + }; + + /** + * Get the date today. + */ + DatePicker.prototype.now = function (type, value, options) { + value = new Date(); + if (options && options.rel) { + value.setDate(value.getDate() + options.rel); + } + return this.normalize(value, options); + }; + + /** + * Navigate to next/prev month. + */ + DatePicker.prototype.navigate = function (type, value, options) { + + var targetDateObject, + targetYear, + targetMonth, + targetDate, + isTargetArray = $.isArray(value), + isTargetObject = $.isPlainObject(value), + viewsetObject = this.item.view; /*, + safety = 100*/ + + if (isTargetArray || isTargetObject) { + + if (isTargetObject) { + targetYear = value.year; + targetMonth = value.month; + targetDate = value.date; + } else { + targetYear = +value[0]; + targetMonth = +value[1]; + targetDate = +value[2]; + } + + // If we’re navigating months but the view is in a different + // month, navigate to the view’s year and month. + if (options && options.nav && viewsetObject && viewsetObject.month !== targetMonth) { + targetYear = viewsetObject.year; + targetMonth = viewsetObject.month; + } + + // Figure out the expected target year and month. + targetDateObject = new Date(targetYear, targetMonth + (options && options.nav ? options.nav : 0), 1); + targetYear = targetDateObject.getFullYear(); + targetMonth = targetDateObject.getMonth(); + + // If the month we’re going to doesn’t have enough days, + // keep decreasing the date until we reach the month’s last date. + while ( /*safety &&*/new Date(targetYear, targetMonth, targetDate).getMonth() !== targetMonth) { + targetDate -= 1; + /*safety -= 1 + if ( !safety ) { + throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.' + }*/ + } + + value = [targetYear, targetMonth, targetDate]; + } + + return value; + }; //DatePicker.prototype.navigate + + + /** + * Normalize a date by setting the hours to midnight. + */ + DatePicker.prototype.normalize = function (value /*, options*/) { + value.setHours(0, 0, 0, 0); + return value; + }; + + /** + * Measure the range of dates. + */ + DatePicker.prototype.measure = function (type, value /*, options*/) { + + var calendar = this; + + // If it’s anything false-y, remove the limits. + if (!value) { + value = type == 'min' ? -Infinity : Infinity; + } + + // If it’s a string, parse it. + else if (typeof value == 'string') { + value = calendar.parse(type, value); + } + + // If it's an integer, get a date relative to today. + else if (_.isInteger(value)) { + value = calendar.now(type, value, { rel: value }); + } + + return value; + }; ///DatePicker.prototype.measure + + + /** + * Create a viewset object based on navigation. + */ + DatePicker.prototype.viewset = function (type, dateObject /*, options*/) { + return this.create([dateObject.year, dateObject.month, 1]); + }; + + /** + * Validate a date as enabled and shift if needed. + */ + DatePicker.prototype.validate = function (type, dateObject, options) { + + var calendar = this, + + + // Keep a reference to the original date. + originalDateObject = dateObject, + + + // Make sure we have an interval. + interval = options && options.interval ? options.interval : 1, + + + // Check if the calendar enabled dates are inverted. + isFlippedBase = calendar.item.enable === -1, + + + // Check if we have any enabled dates after/before now. + hasEnabledBeforeTarget, + hasEnabledAfterTarget, + + + // The min & max limits. + minLimitObject = calendar.item.min, + maxLimitObject = calendar.item.max, + + + // Check if we’ve reached the limit during shifting. + reachedMin, + reachedMax, + + + // Check if the calendar is inverted and at least one weekday is enabled. + hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter(function (value) { + + // If there’s a date, check where it is relative to the target. + if ($.isArray(value)) { + var dateTime = calendar.create(value).pick; + if (dateTime < dateObject.pick) hasEnabledBeforeTarget = true;else if (dateTime > dateObject.pick) hasEnabledAfterTarget = true; + } + + // Return only integers for enabled weekdays. + return _.isInteger(value); + }).length; /*, + safety = 100*/ + + // Cases to validate for: + // [1] Not inverted and date disabled. + // [2] Inverted and some dates enabled. + // [3] Not inverted and out of range. + // + // Cases to **not** validate for: + // • Navigating months. + // • Not inverted and date enabled. + // • Inverted and all dates disabled. + // • ..and anything else. + if (!options || !options.nav) if ( + /* 1 */!isFlippedBase && calendar.disabled(dateObject) || + /* 2 */isFlippedBase && calendar.disabled(dateObject) && (hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget) || + /* 3 */!isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick)) { + + // When inverted, flip the direction if there aren’t any enabled weekdays + // and there are no enabled dates in the direction of the interval. + if (isFlippedBase && !hasEnabledWeekdays && (!hasEnabledAfterTarget && interval > 0 || !hasEnabledBeforeTarget && interval < 0)) { + interval *= -1; + } + + // Keep looping until we reach an enabled date. + while ( /*safety &&*/calendar.disabled(dateObject)) { + + /*safety -= 1 + if ( !safety ) { + throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.' + }*/ + + // If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval. + if (Math.abs(interval) > 1 && (dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month)) { + dateObject = originalDateObject; + interval = interval > 0 ? 1 : -1; + } + + // If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit. + if (dateObject.pick <= minLimitObject.pick) { + reachedMin = true; + interval = 1; + dateObject = calendar.create([minLimitObject.year, minLimitObject.month, minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1)]); + } else if (dateObject.pick >= maxLimitObject.pick) { + reachedMax = true; + interval = -1; + dateObject = calendar.create([maxLimitObject.year, maxLimitObject.month, maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1)]); + } + + // If we’ve reached both limits, just break out of the loop. + if (reachedMin && reachedMax) { + break; + } + + // Finally, create the shifted date using the interval and keep looping. + dateObject = calendar.create([dateObject.year, dateObject.month, dateObject.date + interval]); + } + } //endif + + + // Return the date object settled on. + return dateObject; + }; //DatePicker.prototype.validate + + + /** + * Check if a date is disabled. + */ + DatePicker.prototype.disabled = function (dateToVerify) { + + var calendar = this, + + + // Filter through the disabled dates to check if this is one. + isDisabledMatch = calendar.item.disable.filter(function (dateToDisable) { + + // If the date is a number, match the weekday with 0index and `firstDay` check. + if (_.isInteger(dateToDisable)) { + return dateToVerify.day === (calendar.settings.firstDay ? dateToDisable : dateToDisable - 1) % 7; + } + + // If it’s an array or a native JS date, create and match the exact date. + if ($.isArray(dateToDisable) || _.isDate(dateToDisable)) { + return dateToVerify.pick === calendar.create(dateToDisable).pick; + } + + // If it’s an object, match a date within the “from” and “to” range. + if ($.isPlainObject(dateToDisable)) { + return calendar.withinRange(dateToDisable, dateToVerify); + } + }); + + // If this date matches a disabled date, confirm it’s not inverted. + isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function (dateToDisable) { + return $.isArray(dateToDisable) && dateToDisable[3] == 'inverted' || $.isPlainObject(dateToDisable) && dateToDisable.inverted; + }).length; + + // Check the calendar “enabled” flag and respectively flip the + // disabled state. Then also check if it’s beyond the min/max limits. + return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch || dateToVerify.pick < calendar.item.min.pick || dateToVerify.pick > calendar.item.max.pick; + }; //DatePicker.prototype.disabled + + + /** + * Parse a string into a usable type. + */ + DatePicker.prototype.parse = function (type, value, options) { + + var calendar = this, + parsingObject = {}; + + // If it’s already parsed, we’re good. + if (!value || typeof value != 'string') { + return value; + } + + // We need a `.format` to parse the value with. + if (!(options && options.format)) { + options = options || {}; + options.format = calendar.settings.format; + } + + // Convert the format into an array and then map through it. + calendar.formats.toArray(options.format).map(function (label) { + + var + // Grab the formatting label. + formattingLabel = calendar.formats[label], + + + // The format length is from the formatting label function or the + // label length without the escaping exclamation (!) mark. + formatLength = formattingLabel ? _.trigger(formattingLabel, calendar, [value, parsingObject]) : label.replace(/^!/, '').length; + + // If there's a format label, split the value up to the format length. + // Then add it to the parsing object with appropriate label. + if (formattingLabel) { + parsingObject[label] = value.substr(0, formatLength); + } + + // Update the value as the substring from format length to end. + value = value.substr(formatLength); + }); + + // Compensate for month 0index. + return [parsingObject.yyyy || parsingObject.yy, +(parsingObject.mm || parsingObject.m) - 1, parsingObject.dd || parsingObject.d]; + }; //DatePicker.prototype.parse + + + /** + * Various formats to display the object in. + */ + DatePicker.prototype.formats = function () { + + // Return the length of the first word in a collection. + function getWordLengthFromCollection(string, collection, dateObject) { + + // Grab the first word from the string. + var word = string.match(/\w+/)[0]; + + // If there's no month index, add it to the date object + if (!dateObject.mm && !dateObject.m) { + dateObject.m = collection.indexOf(word) + 1; + } + + // Return the length of the word. + return word.length; + } + + // Get the length of the first word in a string. + function getFirstWordLength(string) { + return string.match(/\w+/)[0].length; + } + + return { + + d: function (string, dateObject) { + + // If there's string, then get the digits length. + // Otherwise return the selected date. + return string ? _.digits(string) : dateObject.date; + }, + dd: function (string, dateObject) { + + // If there's a string, then the length is always 2. + // Otherwise return the selected date with a leading zero. + return string ? 2 : _.lead(dateObject.date); + }, + ddd: function (string, dateObject) { + + // If there's a string, then get the length of the first word. + // Otherwise return the short selected weekday. + return string ? getFirstWordLength(string) : this.settings.weekdaysShort[dateObject.day]; + }, + dddd: function (string, dateObject) { + + // If there's a string, then get the length of the first word. + // Otherwise return the full selected weekday. + return string ? getFirstWordLength(string) : this.settings.weekdaysFull[dateObject.day]; + }, + m: function (string, dateObject) { + + // If there's a string, then get the length of the digits + // Otherwise return the selected month with 0index compensation. + return string ? _.digits(string) : dateObject.month + 1; + }, + mm: function (string, dateObject) { + + // If there's a string, then the length is always 2. + // Otherwise return the selected month with 0index and leading zero. + return string ? 2 : _.lead(dateObject.month + 1); + }, + mmm: function (string, dateObject) { + + var collection = this.settings.monthsShort; + + // If there's a string, get length of the relevant month from the short + // months collection. Otherwise return the selected month from that collection. + return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month]; + }, + mmmm: function (string, dateObject) { + + var collection = this.settings.monthsFull; + + // If there's a string, get length of the relevant month from the full + // months collection. Otherwise return the selected month from that collection. + return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month]; + }, + yy: function (string, dateObject) { + + // If there's a string, then the length is always 2. + // Otherwise return the selected year by slicing out the first 2 digits. + return string ? 2 : ('' + dateObject.year).slice(2); + }, + yyyy: function (string, dateObject) { + + // If there's a string, then the length is always 4. + // Otherwise return the selected year. + return string ? 4 : dateObject.year; + }, + + // Create an array by splitting the formatting string passed. + toArray: function (formatString) { + return formatString.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g); + }, + + // Format an object into a string using the formatting options. + toString: function (formatString, itemObject) { + var calendar = this; + return calendar.formats.toArray(formatString).map(function (label) { + return _.trigger(calendar.formats[label], calendar, [0, itemObject]) || label.replace(/^!/, ''); + }).join(''); + } + }; + }(); //DatePicker.prototype.formats + + + /** + * Check if two date units are the exact. + */ + DatePicker.prototype.isDateExact = function (one, two) { + + var calendar = this; + + // When we’re working with weekdays, do a direct comparison. + if (_.isInteger(one) && _.isInteger(two) || typeof one == 'boolean' && typeof two == 'boolean') { + return one === two; + } + + // When we’re working with date representations, compare the “pick” value. + if ((_.isDate(one) || $.isArray(one)) && (_.isDate(two) || $.isArray(two))) { + return calendar.create(one).pick === calendar.create(two).pick; + } + + // When we’re working with range objects, compare the “from” and “to”. + if ($.isPlainObject(one) && $.isPlainObject(two)) { + return calendar.isDateExact(one.from, two.from) && calendar.isDateExact(one.to, two.to); + } + + return false; + }; + + /** + * Check if two date units overlap. + */ + DatePicker.prototype.isDateOverlap = function (one, two) { + + var calendar = this, + firstDay = calendar.settings.firstDay ? 1 : 0; + + // When we’re working with a weekday index, compare the days. + if (_.isInteger(one) && (_.isDate(two) || $.isArray(two))) { + one = one % 7 + firstDay; + return one === calendar.create(two).day + 1; + } + if (_.isInteger(two) && (_.isDate(one) || $.isArray(one))) { + two = two % 7 + firstDay; + return two === calendar.create(one).day + 1; + } + + // When we’re working with range objects, check if the ranges overlap. + if ($.isPlainObject(one) && $.isPlainObject(two)) { + return calendar.overlapRanges(one, two); + } + + return false; + }; + + /** + * Flip the “enabled” state. + */ + DatePicker.prototype.flipEnable = function (val) { + var itemObject = this.item; + itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1); + }; + + /** + * Mark a collection of dates as “disabled”. + */ + DatePicker.prototype.deactivate = function (type, datesToDisable) { + + var calendar = this, + disabledItems = calendar.item.disable.slice(0); + + // If we’re flipping, that’s all we need to do. + if (datesToDisable == 'flip') { + calendar.flipEnable(); + } else if (datesToDisable === false) { + calendar.flipEnable(1); + disabledItems = []; + } else if (datesToDisable === true) { + calendar.flipEnable(-1); + disabledItems = []; + } + + // Otherwise go through the dates to disable. + else { + + datesToDisable.map(function (unitToDisable) { + + var matchFound; + + // When we have disabled items, check for matches. + // If something is matched, immediately break out. + for (var index = 0; index < disabledItems.length; index += 1) { + if (calendar.isDateExact(unitToDisable, disabledItems[index])) { + matchFound = true; + break; + } + } + + // If nothing was found, add the validated unit to the collection. + if (!matchFound) { + if (_.isInteger(unitToDisable) || _.isDate(unitToDisable) || $.isArray(unitToDisable) || $.isPlainObject(unitToDisable) && unitToDisable.from && unitToDisable.to) { + disabledItems.push(unitToDisable); + } + } + }); + } + + // Return the updated collection. + return disabledItems; + }; //DatePicker.prototype.deactivate + + + /** + * Mark a collection of dates as “enabled”. + */ + DatePicker.prototype.activate = function (type, datesToEnable) { + + var calendar = this, + disabledItems = calendar.item.disable, + disabledItemsCount = disabledItems.length; + + // If we’re flipping, that’s all we need to do. + if (datesToEnable == 'flip') { + calendar.flipEnable(); + } else if (datesToEnable === true) { + calendar.flipEnable(1); + disabledItems = []; + } else if (datesToEnable === false) { + calendar.flipEnable(-1); + disabledItems = []; + } + + // Otherwise go through the disabled dates. + else { + + datesToEnable.map(function (unitToEnable) { + + var matchFound, disabledUnit, index, isExactRange; + + // Go through the disabled items and try to find a match. + for (index = 0; index < disabledItemsCount; index += 1) { + + disabledUnit = disabledItems[index]; + + // When an exact match is found, remove it from the collection. + if (calendar.isDateExact(disabledUnit, unitToEnable)) { + matchFound = disabledItems[index] = null; + isExactRange = true; + break; + } + + // When an overlapped match is found, add the “inverted” state to it. + else if (calendar.isDateOverlap(disabledUnit, unitToEnable)) { + if ($.isPlainObject(unitToEnable)) { + unitToEnable.inverted = true; + matchFound = unitToEnable; + } else if ($.isArray(unitToEnable)) { + matchFound = unitToEnable; + if (!matchFound[3]) matchFound.push('inverted'); + } else if (_.isDate(unitToEnable)) { + matchFound = [unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted']; + } + break; + } + } + + // If a match was found, remove a previous duplicate entry. + if (matchFound) for (index = 0; index < disabledItemsCount; index += 1) { + if (calendar.isDateExact(disabledItems[index], unitToEnable)) { + disabledItems[index] = null; + break; + } + } + + // In the event that we’re dealing with an exact range of dates, + // make sure there are no “inverted” dates because of it. + if (isExactRange) for (index = 0; index < disabledItemsCount; index += 1) { + if (calendar.isDateOverlap(disabledItems[index], unitToEnable)) { + disabledItems[index] = null; + break; + } + } + + // If something is still matched, add it into the collection. + if (matchFound) { + disabledItems.push(matchFound); + } + }); + } + + // Return the updated collection. + return disabledItems.filter(function (val) { + return val != null; + }); + }; //DatePicker.prototype.activate + + + /** + * Create a string for the nodes in the picker. + */ + DatePicker.prototype.nodes = function (isOpen) { + + var calendar = this, + settings = calendar.settings, + calendarItem = calendar.item, + nowObject = calendarItem.now, + selectedObject = calendarItem.select, + highlightedObject = calendarItem.highlight, + viewsetObject = calendarItem.view, + disabledCollection = calendarItem.disable, + minLimitObject = calendarItem.min, + maxLimitObject = calendarItem.max, + + + // Create the calendar table head using a copy of weekday labels collection. + // * We do a copy so we don't mutate the original array. + tableHead = function (collection, fullCollection) { + + // If the first day should be Monday, move Sunday to the end. + if (settings.firstDay) { + collection.push(collection.shift()); + fullCollection.push(fullCollection.shift()); + } + + // Create and return the table head group. + return _.node('thead', _.node('tr', _.group({ + min: 0, + max: DAYS_IN_WEEK - 1, + i: 1, + node: 'th', + item: function (counter) { + return [collection[counter], settings.klass.weekdays, 'scope=col title="' + fullCollection[counter] + '"']; + } + }))); //endreturn + + // Materialize modified + }((settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter).slice(0), settings.weekdaysFull.slice(0)), + //tableHead + + + // Create the nav for next/prev month. + createMonthNav = function (next) { + + // Otherwise, return the created month tag. + return _.node('div', ' ', settings.klass['nav' + (next ? 'Next' : 'Prev')] + ( + + // If the focused month is outside the range, disabled the button. + next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month || !next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month ? ' ' + settings.klass.navDisabled : ''), 'data-nav=' + (next || -1) + ' ' + _.ariaAttr({ + role: 'button', + controls: calendar.$node[0].id + '_table' + }) + ' ' + 'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev) + '"'); //endreturn + }, + //createMonthNav + + + // Create the month label. + //Materialize modified + createMonthLabel = function (override) { + + var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull; + + // Materialize modified + if (override == "short_months") { + monthsCollection = settings.monthsShort; + } + + // If there are months to select, add a dropdown menu. + if (settings.selectMonths && override == undefined) { + + return _.node('select', _.group({ + min: 0, + max: 11, + i: 1, + node: 'option', + item: function (loopedMonth) { + + return [ + + // The looped month and no classes. + monthsCollection[loopedMonth], 0, + + // Set the value and selected index. + 'value=' + loopedMonth + (viewsetObject.month == loopedMonth ? ' selected' : '') + (viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month || viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month ? ' disabled' : '')]; + } + }), settings.klass.selectMonth + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelMonthSelect + '"'); + } + + // Materialize modified + if (override == "short_months") if (selectedObject != null) return monthsCollection[selectedObject.month];else return monthsCollection[viewsetObject.month]; + + // If there's a need for a month selector + return _.node('div', monthsCollection[viewsetObject.month], settings.klass.month); + }, + //createMonthLabel + + + // Create the year label. + // Materialize modified + createYearLabel = function (override) { + + var focusedYear = viewsetObject.year, + + + // If years selector is set to a literal "true", set it to 5. Otherwise + // divide in half to get half before and half after focused year. + numberYears = settings.selectYears === true ? 5 : ~~(settings.selectYears / 2); + + // If there are years to select, add a dropdown menu. + if (numberYears) { + + var minYear = minLimitObject.year, + maxYear = maxLimitObject.year, + lowestYear = focusedYear - numberYears, + highestYear = focusedYear + numberYears; + + // If the min year is greater than the lowest year, increase the highest year + // by the difference and set the lowest year to the min year. + if (minYear > lowestYear) { + highestYear += minYear - lowestYear; + lowestYear = minYear; + } + + // If the max year is less than the highest year, decrease the lowest year + // by the lower of the two: available and needed years. Then set the + // highest year to the max year. + if (maxYear < highestYear) { + + var availableYears = lowestYear - minYear, + neededYears = highestYear - maxYear; + + lowestYear -= availableYears > neededYears ? neededYears : availableYears; + highestYear = maxYear; + } + + if (settings.selectYears && override == undefined) { + return _.node('select', _.group({ + min: lowestYear, + max: highestYear, + i: 1, + node: 'option', + item: function (loopedYear) { + return [ + + // The looped year and no classes. + loopedYear, 0, + + // Set the value and selected index. + 'value=' + loopedYear + (focusedYear == loopedYear ? ' selected' : '')]; + } + }), settings.klass.selectYear + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelYearSelect + '"'); + } + } + + // Materialize modified + if (override === 'raw' && selectedObject != null) { + return _.node('div', selectedObject.year); + } + + // Otherwise just return the year focused + return _.node('div', focusedYear, settings.klass.year); + }; //createYearLabel + + + // Materialize modified + createDayLabel = function () { + if (selectedObject != null) return selectedObject.date;else return nowObject.date; + }; + createWeekdayLabel = function () { + var display_day; + + if (selectedObject != null) display_day = selectedObject.day;else display_day = nowObject.day; + var weekday = settings.weekdaysShort[display_day]; + return weekday; + }; + + // Create and return the entire calendar. + + return _.node( + // Date presentation View + 'div', _.node( + // Div for Year + 'div', createYearLabel("raw"), settings.klass.year_display) + _.node('span', createWeekdayLabel() + ', ', "picker__weekday-display") + _.node( + // Div for short Month + 'span', createMonthLabel("short_months") + ' ', settings.klass.month_display) + _.node( + // Div for Day + 'span', createDayLabel(), settings.klass.day_display), settings.klass.date_display) + + // Calendar container + _.node('div', _.node('div', _.node('div', (settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel()) + createMonthNav() + createMonthNav(1), settings.klass.header) + _.node('table', tableHead + _.node('tbody', _.group({ + min: 0, + max: WEEKS_IN_CALENDAR - 1, + i: 1, + node: 'tr', + item: function (rowCounter) { + + // If Monday is the first day and the month starts on Sunday, shift the date back a week. + var shiftDateBy = settings.firstDay && calendar.create([viewsetObject.year, viewsetObject.month, 1]).day === 0 ? -7 : 0; + + return [_.group({ + min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index + max: function () { + return this.min + DAYS_IN_WEEK - 1; + }, + i: 1, + node: 'td', + item: function (targetDate) { + + // Convert the time date from a relative date to a target date. + targetDate = calendar.create([viewsetObject.year, viewsetObject.month, targetDate + (settings.firstDay ? 1 : 0)]); + + var isSelected = selectedObject && selectedObject.pick == targetDate.pick, + isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick, + isDisabled = disabledCollection && calendar.disabled(targetDate) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick, + formattedDate = _.trigger(calendar.formats.toString, calendar, [settings.format, targetDate]); + + return [_.node('div', targetDate.date, function (klasses) { + + // Add the `infocus` or `outfocus` classes based on month in view. + klasses.push(viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus); + + // Add the `today` class if needed. + if (nowObject.pick == targetDate.pick) { + klasses.push(settings.klass.now); + } + + // Add the `selected` class if something's selected and the time matches. + if (isSelected) { + klasses.push(settings.klass.selected); + } + + // Add the `highlighted` class if something's highlighted and the time matches. + if (isHighlighted) { + klasses.push(settings.klass.highlighted); + } + + // Add the `disabled` class if something's disabled and the object matches. + if (isDisabled) { + klasses.push(settings.klass.disabled); + } + + return klasses.join(' '); + }([settings.klass.day]), 'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({ + role: 'gridcell', + label: formattedDate, + selected: isSelected && calendar.$node.val() === formattedDate ? true : null, + activedescendant: isHighlighted ? true : null, + disabled: isDisabled ? true : null + }) + ' ' + (isDisabled ? '' : 'tabindex="0"')), '', _.ariaAttr({ role: 'presentation' })]; //endreturn + } + })]; //endreturn + } + })), settings.klass.table, 'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({ + role: 'grid', + controls: calendar.$node[0].id, + readonly: true + })), settings.klass.calendar_container) // end calendar + + + + + // * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”. + _.node('div', _.node('button', settings.today, "btn-flat picker__today waves-effect", 'type=button data-pick=' + nowObject.pick + (isOpen && !calendar.disabled(nowObject) ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.clear, "btn-flat picker__clear waves-effect", 'type=button data-clear=1' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.close, "btn-flat picker__close waves-effect", 'type=button data-close=true ' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })), settings.klass.footer), 'picker__container__wrapper'); //endreturn + }; //DatePicker.prototype.nodes + + + /** + * The date picker defaults. + */ + DatePicker.defaults = function (prefix) { + + return { + + // The title label to use for the month nav buttons + labelMonthNext: 'Next month', + labelMonthPrev: 'Previous month', + + // The title label to use for the dropdown selectors + labelMonthSelect: 'Select a month', + labelYearSelect: 'Select a year', + + // Months and weekdays + monthsFull: ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'], + monthsShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], + weekdaysFull: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], + weekdaysShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], + + // Materialize modified + weekdaysLetter: ['S', 'M', 'T', 'W', 'T', 'F', 'S'], + + // Today and clear + today: 'Today', + clear: 'Clear', + close: 'Ok', + + // Picker close behavior (Prevent a change in behaviour for backwards compatibility) + closeOnSelect: false, + + // The format to show on the `input` element + format: 'd mmmm, yyyy', + + // Classes + klass: { + + table: prefix + 'table', + + header: prefix + 'header', + + // Materialize Added klasses + date_display: prefix + 'date-display', + day_display: prefix + 'day-display', + month_display: prefix + 'month-display', + year_display: prefix + 'year-display', + calendar_container: prefix + 'calendar-container', + // end + + + navPrev: prefix + 'nav--prev', + navNext: prefix + 'nav--next', + navDisabled: prefix + 'nav--disabled', + + month: prefix + 'month', + year: prefix + 'year', + + selectMonth: prefix + 'select--month', + selectYear: prefix + 'select--year', + + weekdays: prefix + 'weekday', + + day: prefix + 'day', + disabled: prefix + 'day--disabled', + selected: prefix + 'day--selected', + highlighted: prefix + 'day--highlighted', + now: prefix + 'day--today', + infocus: prefix + 'day--infocus', + outfocus: prefix + 'day--outfocus', + + footer: prefix + 'footer', + + buttonClear: prefix + 'button--clear', + buttonToday: prefix + 'button--today', + buttonClose: prefix + 'button--close' + } + }; + }(Picker.klasses().picker + '__'); + + /** + * Extend the picker to add the date picker. + */ + Picker.extend('pickadate', DatePicker); +}); +; /*! + * ClockPicker v0.0.7 (http://weareoutman.github.io/clockpicker/) + * Copyright 2014 Wang Shenwei. + * Licensed under MIT (https://github.com/weareoutman/clockpicker/blob/gh-pages/LICENSE) + * + * Further modified + * Copyright 2015 Ching Yaw Hao. + */ + +(function ($) { + var $win = $(window), + $doc = $(document); + + // Can I use inline svg ? + var svgNS = 'http://www.w3.org/2000/svg', + svgSupported = 'SVGAngle' in window && function () { + var supported, + el = document.createElement('div'); + el.innerHTML = ''; + supported = (el.firstChild && el.firstChild.namespaceURI) == svgNS; + el.innerHTML = ''; + return supported; + }(); + + // Can I use transition ? + var transitionSupported = function () { + var style = document.createElement('div').style; + return 'transition' in style || 'WebkitTransition' in style || 'MozTransition' in style || 'msTransition' in style || 'OTransition' in style; + }(); + + // Listen touch events in touch screen device, instead of mouse events in desktop. + var touchSupported = 'ontouchstart' in window, + mousedownEvent = 'mousedown' + (touchSupported ? ' touchstart' : ''), + mousemoveEvent = 'mousemove.clockpicker' + (touchSupported ? ' touchmove.clockpicker' : ''), + mouseupEvent = 'mouseup.clockpicker' + (touchSupported ? ' touchend.clockpicker' : ''); + + // Vibrate the device if supported + var vibrate = navigator.vibrate ? 'vibrate' : navigator.webkitVibrate ? 'webkitVibrate' : null; + + function createSvgElement(name) { + return document.createElementNS(svgNS, name); + } + + function leadingZero(num) { + return (num < 10 ? '0' : '') + num; + } + + // Get a unique id + var idCounter = 0; + function uniqueId(prefix) { + var id = ++idCounter + ''; + return prefix ? prefix + id : id; + } + + // Clock size + var dialRadius = 135, + outerRadius = 105, + + // innerRadius = 80 on 12 hour clock + innerRadius = 70, + tickRadius = 20, + diameter = dialRadius * 2, + duration = transitionSupported ? 350 : 1; + + // Popover template + var tpl = ['
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '', ':', '', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '
      ', '', '
      ', '
      ', '
      ', '
      ', '
      ', '
      '].join(''); + + // ClockPicker + function ClockPicker(element, options) { + var popover = $(tpl), + plate = popover.find('.clockpicker-plate'), + holder = popover.find('.picker__holder'), + hoursView = popover.find('.clockpicker-hours'), + minutesView = popover.find('.clockpicker-minutes'), + amPmBlock = popover.find('.clockpicker-am-pm-block'), + isInput = element.prop('tagName') === 'INPUT', + input = isInput ? element : element.find('input'), + label = $("label[for=" + input.attr("id") + "]"), + self = this; + + this.id = uniqueId('cp'); + this.element = element; + this.holder = holder; + this.options = options; + this.isAppended = false; + this.isShown = false; + this.currentView = 'hours'; + this.isInput = isInput; + this.input = input; + this.label = label; + this.popover = popover; + this.plate = plate; + this.hoursView = hoursView; + this.minutesView = minutesView; + this.amPmBlock = amPmBlock; + this.spanHours = popover.find('.clockpicker-span-hours'); + this.spanMinutes = popover.find('.clockpicker-span-minutes'); + this.spanAmPm = popover.find('.clockpicker-span-am-pm'); + this.footer = popover.find('.picker__footer'); + this.amOrPm = "PM"; + + // Setup for for 12 hour clock if option is selected + if (options.twelvehour) { + if (!options.ampmclickable) { + this.spanAmPm.empty(); + $('
      AM
      ').appendTo(this.spanAmPm); + $('
      PM
      ').appendTo(this.spanAmPm); + } else { + this.spanAmPm.empty(); + $('
      AM
      ').on("click", function () { + self.spanAmPm.children('#click-am').addClass("text-primary"); + self.spanAmPm.children('#click-pm').removeClass("text-primary"); + self.amOrPm = "AM"; + }).appendTo(this.spanAmPm); + $('
      PM
      ').on("click", function () { + self.spanAmPm.children('#click-pm').addClass("text-primary"); + self.spanAmPm.children('#click-am').removeClass("text-primary"); + self.amOrPm = 'PM'; + }).appendTo(this.spanAmPm); + } + } + + // Add buttons to footer + $('').click($.proxy(this.clear, this)).appendTo(this.footer); + $('').click($.proxy(this.hide, this)).appendTo(this.footer); + $('').click($.proxy(this.done, this)).appendTo(this.footer); + + this.spanHours.click($.proxy(this.toggleView, this, 'hours')); + this.spanMinutes.click($.proxy(this.toggleView, this, 'minutes')); + + // Show or toggle + input.on('focus.clockpicker click.clockpicker', $.proxy(this.show, this)); + + // Build ticks + var tickTpl = $('
      '), + i, + tick, + radian, + radius; + + // Hours view + if (options.twelvehour) { + for (i = 1; i < 13; i += 1) { + tick = tickTpl.clone(); + radian = i / 6 * Math.PI; + radius = outerRadius; + tick.css({ + left: dialRadius + Math.sin(radian) * radius - tickRadius, + top: dialRadius - Math.cos(radian) * radius - tickRadius + }); + tick.html(i === 0 ? '00' : i); + hoursView.append(tick); + tick.on(mousedownEvent, mousedown); + } + } else { + for (i = 0; i < 24; i += 1) { + tick = tickTpl.clone(); + radian = i / 6 * Math.PI; + var inner = i > 0 && i < 13; + radius = inner ? innerRadius : outerRadius; + tick.css({ + left: dialRadius + Math.sin(radian) * radius - tickRadius, + top: dialRadius - Math.cos(radian) * radius - tickRadius + }); + tick.html(i === 0 ? '00' : i); + hoursView.append(tick); + tick.on(mousedownEvent, mousedown); + } + } + + // Minutes view + for (i = 0; i < 60; i += 5) { + tick = tickTpl.clone(); + radian = i / 30 * Math.PI; + tick.css({ + left: dialRadius + Math.sin(radian) * outerRadius - tickRadius, + top: dialRadius - Math.cos(radian) * outerRadius - tickRadius + }); + tick.html(leadingZero(i)); + minutesView.append(tick); + tick.on(mousedownEvent, mousedown); + } + + // Clicking on minutes view space + plate.on(mousedownEvent, function (e) { + if ($(e.target).closest('.clockpicker-tick').length === 0) { + mousedown(e, true); + } + }); + + // Mousedown or touchstart + function mousedown(e, space) { + var offset = plate.offset(), + isTouch = /^touch/.test(e.type), + x0 = offset.left + dialRadius, + y0 = offset.top + dialRadius, + dx = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0, + dy = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0, + z = Math.sqrt(dx * dx + dy * dy), + moved = false; + + // When clicking on minutes view space, check the mouse position + if (space && (z < outerRadius - tickRadius || z > outerRadius + tickRadius)) { + return; + } + e.preventDefault(); + + // Set cursor style of body after 200ms + var movingTimer = setTimeout(function () { + self.popover.addClass('clockpicker-moving'); + }, 200); + + // Clock + self.setHand(dx, dy, !space, true); + + // Mousemove on document + $doc.off(mousemoveEvent).on(mousemoveEvent, function (e) { + e.preventDefault(); + var isTouch = /^touch/.test(e.type), + x = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0, + y = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0; + if (!moved && x === dx && y === dy) { + // Clicking in chrome on windows will trigger a mousemove event + return; + } + moved = true; + self.setHand(x, y, false, true); + }); + + // Mouseup on document + $doc.off(mouseupEvent).on(mouseupEvent, function (e) { + $doc.off(mouseupEvent); + e.preventDefault(); + var isTouch = /^touch/.test(e.type), + x = (isTouch ? e.originalEvent.changedTouches[0] : e).pageX - x0, + y = (isTouch ? e.originalEvent.changedTouches[0] : e).pageY - y0; + if ((space || moved) && x === dx && y === dy) { + self.setHand(x, y); + } + + if (self.currentView === 'hours') { + self.toggleView('minutes', duration / 2); + } else if (options.autoclose) { + self.minutesView.addClass('clockpicker-dial-out'); + setTimeout(function () { + self.done(); + }, duration / 2); + } + plate.prepend(canvas); + + // Reset cursor style of body + clearTimeout(movingTimer); + self.popover.removeClass('clockpicker-moving'); + + // Unbind mousemove event + $doc.off(mousemoveEvent); + }); + } + + if (svgSupported) { + // Draw clock hands and others + var canvas = popover.find('.clockpicker-canvas'), + svg = createSvgElement('svg'); + svg.setAttribute('class', 'clockpicker-svg'); + svg.setAttribute('width', diameter); + svg.setAttribute('height', diameter); + var g = createSvgElement('g'); + g.setAttribute('transform', 'translate(' + dialRadius + ',' + dialRadius + ')'); + var bearing = createSvgElement('circle'); + bearing.setAttribute('class', 'clockpicker-canvas-bearing'); + bearing.setAttribute('cx', 0); + bearing.setAttribute('cy', 0); + bearing.setAttribute('r', 4); + var hand = createSvgElement('line'); + hand.setAttribute('x1', 0); + hand.setAttribute('y1', 0); + var bg = createSvgElement('circle'); + bg.setAttribute('class', 'clockpicker-canvas-bg'); + bg.setAttribute('r', tickRadius); + g.appendChild(hand); + g.appendChild(bg); + g.appendChild(bearing); + svg.appendChild(g); + canvas.append(svg); + + this.hand = hand; + this.bg = bg; + this.bearing = bearing; + this.g = g; + this.canvas = canvas; + } + + raiseCallback(this.options.init); + } + + function raiseCallback(callbackFunction) { + if (callbackFunction && typeof callbackFunction === "function") callbackFunction(); + } + + // Default options + ClockPicker.DEFAULTS = { + 'default': '', // default time, 'now' or '13:14' e.g. + fromnow: 0, // set default time to * milliseconds from now (using with default = 'now') + donetext: 'Ok', // done button text + cleartext: 'Clear', + canceltext: 'Cancel', + autoclose: false, // auto close when minute is selected + ampmclickable: true, // set am/pm button on itself + darktheme: false, // set to dark theme + twelvehour: true, // change to 12 hour AM/PM clock from 24 hour + vibrate: true // vibrate the device when dragging clock hand + }; + + // Show or hide popover + ClockPicker.prototype.toggle = function () { + this[this.isShown ? 'hide' : 'show'](); + }; + + // Set popover position + ClockPicker.prototype.locate = function () { + var element = this.element, + popover = this.popover, + offset = element.offset(), + width = element.outerWidth(), + height = element.outerHeight(), + align = this.options.align, + self = this; + + popover.show(); + }; + + // Show popover + ClockPicker.prototype.show = function (e) { + // Not show again + if (this.isShown) { + return; + } + raiseCallback(this.options.beforeShow); + $(':input').each(function () { + $(this).attr('tabindex', -1); + }); + var self = this; + // Initialize + this.input.blur(); + this.popover.addClass('picker--opened'); + this.input.addClass('picker__input picker__input--active'); + $(document.body).css('overflow', 'hidden'); + // Get the time + var value = ((this.input.prop('value') || this.options['default'] || '') + '').split(':'); + if (this.options.twelvehour && !(typeof value[1] === 'undefined')) { + if (value[1].indexOf("AM") > 0) { + this.amOrPm = 'AM'; + } else { + this.amOrPm = 'PM'; + } + value[1] = value[1].replace("AM", "").replace("PM", ""); + } + if (value[0] === 'now') { + var now = new Date(+new Date() + this.options.fromnow); + value = [now.getHours(), now.getMinutes()]; + if (this.options.twelvehour) { + this.amOrPm = value[0] >= 12 && value[0] < 24 ? 'PM' : 'AM'; + } + } + this.hours = +value[0] || 0; + this.minutes = +value[1] || 0; + this.spanHours.html(this.hours); + this.spanMinutes.html(leadingZero(this.minutes)); + if (!this.isAppended) { + + // Append popover to input by default + var containerEl = document.querySelector(this.options.container); + if (this.options.container && containerEl) { + containerEl.appendChild(this.popover[0]); + } else { + this.popover.insertAfter(this.input); + } + + if (this.options.twelvehour) { + if (this.amOrPm === 'PM') { + this.spanAmPm.children('#click-pm').addClass("text-primary"); + this.spanAmPm.children('#click-am').removeClass("text-primary"); + } else { + this.spanAmPm.children('#click-am').addClass("text-primary"); + this.spanAmPm.children('#click-pm').removeClass("text-primary"); + } + } + // Reset position when resize + $win.on('resize.clockpicker' + this.id, function () { + if (self.isShown) { + self.locate(); + } + }); + this.isAppended = true; + } + // Toggle to hours view + this.toggleView('hours'); + // Set position + this.locate(); + this.isShown = true; + // Hide when clicking or tabbing on any element except the clock and input + $doc.on('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id, function (e) { + var target = $(e.target); + if (target.closest(self.popover.find('.picker__wrap')).length === 0 && target.closest(self.input).length === 0) { + self.hide(); + } + }); + // Hide when ESC is pressed + $doc.on('keyup.clockpicker.' + this.id, function (e) { + if (e.keyCode === 27) { + self.hide(); + } + }); + raiseCallback(this.options.afterShow); + }; + // Hide popover + ClockPicker.prototype.hide = function () { + raiseCallback(this.options.beforeHide); + this.input.removeClass('picker__input picker__input--active'); + this.popover.removeClass('picker--opened'); + $(document.body).css('overflow', 'visible'); + this.isShown = false; + $(':input').each(function (index) { + $(this).attr('tabindex', index + 1); + }); + // Unbinding events on document + $doc.off('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id); + $doc.off('keyup.clockpicker.' + this.id); + this.popover.hide(); + raiseCallback(this.options.afterHide); + }; + // Toggle to hours or minutes view + ClockPicker.prototype.toggleView = function (view, delay) { + var raiseAfterHourSelect = false; + if (view === 'minutes' && $(this.hoursView).css("visibility") === "visible") { + raiseCallback(this.options.beforeHourSelect); + raiseAfterHourSelect = true; + } + var isHours = view === 'hours', + nextView = isHours ? this.hoursView : this.minutesView, + hideView = isHours ? this.minutesView : this.hoursView; + this.currentView = view; + + this.spanHours.toggleClass('text-primary', isHours); + this.spanMinutes.toggleClass('text-primary', !isHours); + + // Let's make transitions + hideView.addClass('clockpicker-dial-out'); + nextView.css('visibility', 'visible').removeClass('clockpicker-dial-out'); + + // Reset clock hand + this.resetClock(delay); + + // After transitions ended + clearTimeout(this.toggleViewTimer); + this.toggleViewTimer = setTimeout(function () { + hideView.css('visibility', 'hidden'); + }, duration); + + if (raiseAfterHourSelect) { + raiseCallback(this.options.afterHourSelect); + } + }; + + // Reset clock hand + ClockPicker.prototype.resetClock = function (delay) { + var view = this.currentView, + value = this[view], + isHours = view === 'hours', + unit = Math.PI / (isHours ? 6 : 30), + radian = value * unit, + radius = isHours && value > 0 && value < 13 ? innerRadius : outerRadius, + x = Math.sin(radian) * radius, + y = -Math.cos(radian) * radius, + self = this; + + if (svgSupported && delay) { + self.canvas.addClass('clockpicker-canvas-out'); + setTimeout(function () { + self.canvas.removeClass('clockpicker-canvas-out'); + self.setHand(x, y); + }, delay); + } else this.setHand(x, y); + }; + + // Set clock hand to (x, y) + ClockPicker.prototype.setHand = function (x, y, roundBy5, dragging) { + var radian = Math.atan2(x, -y), + isHours = this.currentView === 'hours', + unit = Math.PI / (isHours || roundBy5 ? 6 : 30), + z = Math.sqrt(x * x + y * y), + options = this.options, + inner = isHours && z < (outerRadius + innerRadius) / 2, + radius = inner ? innerRadius : outerRadius, + value; + + if (options.twelvehour) { + radius = outerRadius; + } + + // Radian should in range [0, 2PI] + if (radian < 0) { + radian = Math.PI * 2 + radian; + } + + // Get the round value + value = Math.round(radian / unit); + + // Get the round radian + radian = value * unit; + + // Correct the hours or minutes + if (options.twelvehour) { + if (isHours) { + if (value === 0) value = 12; + } else { + if (roundBy5) value *= 5; + if (value === 60) value = 0; + } + } else { + if (isHours) { + if (value === 12) value = 0; + value = inner ? value === 0 ? 12 : value : value === 0 ? 0 : value + 12; + } else { + if (roundBy5) value *= 5; + if (value === 60) value = 0; + } + } + + // Once hours or minutes changed, vibrate the device + if (this[this.currentView] !== value) { + if (vibrate && this.options.vibrate) { + // Do not vibrate too frequently + if (!this.vibrateTimer) { + navigator[vibrate](10); + this.vibrateTimer = setTimeout($.proxy(function () { + this.vibrateTimer = null; + }, this), 100); + } + } + } + + this[this.currentView] = value; + if (isHours) { + this['spanHours'].html(value); + } else { + this['spanMinutes'].html(leadingZero(value)); + } + + // If svg is not supported, just add an active class to the tick + if (!svgSupported) { + this[isHours ? 'hoursView' : 'minutesView'].find('.clockpicker-tick').each(function () { + var tick = $(this); + tick.toggleClass('active', value === +tick.html()); + }); + return; + } + + // Set clock hand and others' position + var cx1 = Math.sin(radian) * (radius - tickRadius), + cy1 = -Math.cos(radian) * (radius - tickRadius), + cx2 = Math.sin(radian) * radius, + cy2 = -Math.cos(radian) * radius; + this.hand.setAttribute('x2', cx1); + this.hand.setAttribute('y2', cy1); + this.bg.setAttribute('cx', cx2); + this.bg.setAttribute('cy', cy2); + }; + + // Hours and minutes are selected + ClockPicker.prototype.done = function () { + raiseCallback(this.options.beforeDone); + this.hide(); + this.label.addClass('active'); + + var last = this.input.prop('value'), + value = leadingZero(this.hours) + ':' + leadingZero(this.minutes); + if (this.options.twelvehour) { + value = value + this.amOrPm; + } + + this.input.prop('value', value); + if (value !== last) { + this.input.triggerHandler('change'); + if (!this.isInput) { + this.element.trigger('change'); + } + } + + if (this.options.autoclose) this.input.trigger('blur'); + + raiseCallback(this.options.afterDone); + }; + + // Clear input field + ClockPicker.prototype.clear = function () { + this.hide(); + this.label.removeClass('active'); + + var last = this.input.prop('value'), + value = ''; + + this.input.prop('value', value); + if (value !== last) { + this.input.triggerHandler('change'); + if (!this.isInput) { + this.element.trigger('change'); + } + } + + if (this.options.autoclose) { + this.input.trigger('blur'); + } + }; + + // Remove clockpicker from input + ClockPicker.prototype.remove = function () { + this.element.removeData('clockpicker'); + this.input.off('focus.clockpicker click.clockpicker'); + if (this.isShown) { + this.hide(); + } + if (this.isAppended) { + $win.off('resize.clockpicker' + this.id); + this.popover.remove(); + } + }; + + // Extends $.fn.clockpicker + $.fn.pickatime = function (option) { + var args = Array.prototype.slice.call(arguments, 1); + return this.each(function () { + var $this = $(this), + data = $this.data('clockpicker'); + if (!data) { + var options = $.extend({}, ClockPicker.DEFAULTS, $this.data(), typeof option == 'object' && option); + $this.data('clockpicker', new ClockPicker($this, options)); + } else { + // Manual operatsions. show, hide, remove, e.g. + if (typeof data[option] === 'function') { + data[option].apply(data, args); + } + } + }); + }; +})(jQuery); +;(function ($) { + + $.fn.characterCounter = function () { + return this.each(function () { + var $input = $(this); + var $counterElement = $input.parent().find('span[class="character-counter"]'); + + // character counter has already been added appended to the parent container + if ($counterElement.length) { + return; + } + + var itHasLengthAttribute = $input.attr('data-length') !== undefined; + + if (itHasLengthAttribute) { + $input.on('input', updateCounter); + $input.on('focus', updateCounter); + $input.on('blur', removeCounterElement); + + addCounterElement($input); + } + }); + }; + + function updateCounter() { + var maxLength = +$(this).attr('data-length'), + actualLength = +$(this).val().length, + isValidLength = actualLength <= maxLength; + + $(this).parent().find('span[class="character-counter"]').html(actualLength + '/' + maxLength); + + addInputStyle(isValidLength, $(this)); + } + + function addCounterElement($input) { + var $counterElement = $input.parent().find('span[class="character-counter"]'); + + if ($counterElement.length) { + return; + } + + $counterElement = $('').addClass('character-counter').css('float', 'right').css('font-size', '12px').css('height', 1); + + $input.parent().append($counterElement); + } + + function removeCounterElement() { + $(this).parent().find('span[class="character-counter"]').html(''); + } + + function addInputStyle(isValidLength, $input) { + var inputHasInvalidClass = $input.hasClass('invalid'); + if (isValidLength && inputHasInvalidClass) { + $input.removeClass('invalid'); + } else if (!isValidLength && !inputHasInvalidClass) { + $input.removeClass('valid'); + $input.addClass('invalid'); + } + } + + $(document).ready(function () { + $('input, textarea').characterCounter(); + }); +})(jQuery); +;(function ($) { + + var methods = { + + init: function (options) { + var defaults = { + duration: 200, // ms + dist: -100, // zoom scale TODO: make this more intuitive as an option + shift: 0, // spacing for center image + padding: 0, // Padding between non center items + fullWidth: false, // Change to full width styles + indicators: false, // Toggle indicators + noWrap: false, // Don't wrap around and cycle through items. + onCycleTo: null // Callback for when a new slide is cycled to. + }; + options = $.extend(defaults, options); + var namespace = Materialize.objectSelectorString($(this)); + + return this.each(function (i) { + + var images, item_width, item_height, offset, center, pressed, dim, count, reference, referenceY, amplitude, target, velocity, scrolling, xform, frame, timestamp, ticker, dragged, vertical_dragged; + var $indicators = $('
        '); + var scrollingTimeout = null; + var oneTimeCallback = null; + + // Initialize + var view = $(this); + var hasMultipleSlides = view.find('.carousel-item').length > 1; + var showIndicators = (view.attr('data-indicators') || options.indicators) && hasMultipleSlides; + var noWrap = view.attr('data-no-wrap') || options.noWrap || !hasMultipleSlides; + var uniqueNamespace = view.attr('data-namespace') || namespace + i; + view.attr('data-namespace', uniqueNamespace); + + // Options + var setCarouselHeight = function (imageOnly) { + var firstSlide = view.find('.carousel-item.active').length ? view.find('.carousel-item.active').first() : view.find('.carousel-item').first(); + var firstImage = firstSlide.find('img').first(); + if (firstImage.length) { + if (firstImage[0].complete) { + // If image won't trigger the load event + var imageHeight = firstImage.height(); + if (imageHeight > 0) { + view.css('height', firstImage.height()); + } else { + // If image still has no height, use the natural dimensions to calculate + var naturalWidth = firstImage[0].naturalWidth; + var naturalHeight = firstImage[0].naturalHeight; + var adjustedHeight = view.width() / naturalWidth * naturalHeight; + view.css('height', adjustedHeight); + } + } else { + // Get height when image is loaded normally + firstImage.on('load', function () { + view.css('height', $(this).height()); + }); + } + } else if (!imageOnly) { + var slideHeight = firstSlide.height(); + view.css('height', slideHeight); + } + }; + + if (options.fullWidth) { + options.dist = 0; + setCarouselHeight(); + + // Offset fixed items when indicators. + if (showIndicators) { + view.find('.carousel-fixed-item').addClass('with-indicators'); + } + } + + // Don't double initialize. + if (view.hasClass('initialized')) { + // Recalculate variables + $(window).trigger('resize'); + + // Redraw carousel. + view.trigger('carouselNext', [0.000001]); + return true; + } + + view.addClass('initialized'); + pressed = false; + offset = target = 0; + images = []; + item_width = view.find('.carousel-item').first().innerWidth(); + item_height = view.find('.carousel-item').first().innerHeight(); + dim = item_width * 2 + options.padding; + + view.find('.carousel-item').each(function (i) { + images.push($(this)[0]); + if (showIndicators) { + var $indicator = $('
      • '); + + // Add active to first by default. + if (i === 0) { + $indicator.addClass('active'); + } + + // Handle clicks on indicators. + $indicator.click(function (e) { + e.stopPropagation(); + + var index = $(this).index(); + cycleTo(index); + }); + $indicators.append($indicator); + } + }); + + if (showIndicators) { + view.append($indicators); + } + count = images.length; + + function setupEvents() { + if (typeof window.ontouchstart !== 'undefined') { + view.on('touchstart.carousel', tap); + view.on('touchmove.carousel', drag); + view.on('touchend.carousel', release); + } + view.on('mousedown.carousel', tap); + view.on('mousemove.carousel', drag); + view.on('mouseup.carousel', release); + view.on('mouseleave.carousel', release); + view.on('click.carousel', click); + } + + function xpos(e) { + // touch event + if (e.targetTouches && e.targetTouches.length >= 1) { + return e.targetTouches[0].clientX; + } + + // mouse event + return e.clientX; + } + + function ypos(e) { + // touch event + if (e.targetTouches && e.targetTouches.length >= 1) { + return e.targetTouches[0].clientY; + } + + // mouse event + return e.clientY; + } + + function wrap(x) { + return x >= count ? x % count : x < 0 ? wrap(count + x % count) : x; + } + + function scroll(x) { + // Track scrolling state + scrolling = true; + if (!view.hasClass('scrolling')) { + view.addClass('scrolling'); + } + if (scrollingTimeout != null) { + window.clearTimeout(scrollingTimeout); + } + scrollingTimeout = window.setTimeout(function () { + scrolling = false; + view.removeClass('scrolling'); + }, options.duration); + + // Start actual scroll + var i, half, delta, dir, tween, el, alignment, xTranslation; + var lastCenter = center; + + offset = typeof x === 'number' ? x : offset; + center = Math.floor((offset + dim / 2) / dim); + delta = offset - center * dim; + dir = delta < 0 ? 1 : -1; + tween = -dir * delta * 2 / dim; + half = count >> 1; + + if (!options.fullWidth) { + alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) '; + alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)'; + } else { + alignment = 'translateX(0)'; + } + + // Set indicator active + if (showIndicators) { + var diff = center % count; + var activeIndicator = $indicators.find('.indicator-item.active'); + if (activeIndicator.index() !== diff) { + activeIndicator.removeClass('active'); + $indicators.find('.indicator-item').eq(diff).addClass('active'); + } + } + + // center + // Don't show wrapped items. + if (!noWrap || center >= 0 && center < count) { + el = images[wrap(center)]; + + // Add active class to center item. + if (!$(el).hasClass('active')) { + view.find('.carousel-item').removeClass('active'); + $(el).addClass('active'); + } + el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween * i + 'px)' + ' translateZ(' + options.dist * tween + 'px)'; + el.style.zIndex = 0; + if (options.fullWidth) { + tweenedOpacity = 1; + } else { + tweenedOpacity = 1 - 0.2 * tween; + } + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + + for (i = 1; i <= half; ++i) { + // right side + if (options.fullWidth) { + zTranslation = options.dist; + tweenedOpacity = i === half && delta < 0 ? 1 - tween : 1; + } else { + zTranslation = options.dist * (i * 2 + tween * dir); + tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir); + } + // Don't show wrapped items. + if (!noWrap || center + i < count) { + el = images[wrap(center + i)]; + el.style[xform] = alignment + ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)'; + el.style.zIndex = -i; + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + + // left side + if (options.fullWidth) { + zTranslation = options.dist; + tweenedOpacity = i === half && delta > 0 ? 1 - tween : 1; + } else { + zTranslation = options.dist * (i * 2 - tween * dir); + tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir); + } + // Don't show wrapped items. + if (!noWrap || center - i >= 0) { + el = images[wrap(center - i)]; + el.style[xform] = alignment + ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)'; + el.style.zIndex = -i; + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + } + + // center + // Don't show wrapped items. + if (!noWrap || center >= 0 && center < count) { + el = images[wrap(center)]; + el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween + 'px)' + ' translateZ(' + options.dist * tween + 'px)'; + el.style.zIndex = 0; + if (options.fullWidth) { + tweenedOpacity = 1; + } else { + tweenedOpacity = 1 - 0.2 * tween; + } + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + + // onCycleTo callback + if (lastCenter !== center && typeof options.onCycleTo === "function") { + var $curr_item = view.find('.carousel-item').eq(wrap(center)); + options.onCycleTo.call(this, $curr_item, dragged); + } + + // One time callback + if (typeof oneTimeCallback === "function") { + oneTimeCallback.call(this, $curr_item, dragged); + oneTimeCallback = null; + } + } + + function track() { + var now, elapsed, delta, v; + + now = Date.now(); + elapsed = now - timestamp; + timestamp = now; + delta = offset - frame; + frame = offset; + + v = 1000 * delta / (1 + elapsed); + velocity = 0.8 * v + 0.2 * velocity; + } + + function autoScroll() { + var elapsed, delta; + + if (amplitude) { + elapsed = Date.now() - timestamp; + delta = amplitude * Math.exp(-elapsed / options.duration); + if (delta > 2 || delta < -2) { + scroll(target - delta); + requestAnimationFrame(autoScroll); + } else { + scroll(target); + } + } + } + + function click(e) { + // Disable clicks if carousel was dragged. + if (dragged) { + e.preventDefault(); + e.stopPropagation(); + return false; + } else if (!options.fullWidth) { + var clickedIndex = $(e.target).closest('.carousel-item').index(); + var diff = wrap(center) - clickedIndex; + + // Disable clicks if carousel was shifted by click + if (diff !== 0) { + e.preventDefault(); + e.stopPropagation(); + } + cycleTo(clickedIndex); + } + } + + function cycleTo(n) { + var diff = center % count - n; + + // Account for wraparound. + if (!noWrap) { + if (diff < 0) { + if (Math.abs(diff + count) < Math.abs(diff)) { + diff += count; + } + } else if (diff > 0) { + if (Math.abs(diff - count) < diff) { + diff -= count; + } + } + } + + // Call prev or next accordingly. + if (diff < 0) { + view.trigger('carouselNext', [Math.abs(diff)]); + } else if (diff > 0) { + view.trigger('carouselPrev', [diff]); + } + } + + function tap(e) { + // Fixes firefox draggable image bug + if (e.type === 'mousedown' && $(e.target).is('img')) { + e.preventDefault(); + } + pressed = true; + dragged = false; + vertical_dragged = false; + reference = xpos(e); + referenceY = ypos(e); + + velocity = amplitude = 0; + frame = offset; + timestamp = Date.now(); + clearInterval(ticker); + ticker = setInterval(track, 100); + } + + function drag(e) { + var x, delta, deltaY; + if (pressed) { + x = xpos(e); + y = ypos(e); + delta = reference - x; + deltaY = Math.abs(referenceY - y); + if (deltaY < 30 && !vertical_dragged) { + // If vertical scrolling don't allow dragging. + if (delta > 2 || delta < -2) { + dragged = true; + reference = x; + scroll(offset + delta); + } + } else if (dragged) { + // If dragging don't allow vertical scroll. + e.preventDefault(); + e.stopPropagation(); + return false; + } else { + // Vertical scrolling. + vertical_dragged = true; + } + } + + if (dragged) { + // If dragging don't allow vertical scroll. + e.preventDefault(); + e.stopPropagation(); + return false; + } + } + + function release(e) { + if (pressed) { + pressed = false; + } else { + return; + } + + clearInterval(ticker); + target = offset; + if (velocity > 10 || velocity < -10) { + amplitude = 0.9 * velocity; + target = offset + amplitude; + } + target = Math.round(target / dim) * dim; + + // No wrap of items. + if (noWrap) { + if (target >= dim * (count - 1)) { + target = dim * (count - 1); + } else if (target < 0) { + target = 0; + } + } + amplitude = target - offset; + timestamp = Date.now(); + requestAnimationFrame(autoScroll); + + if (dragged) { + e.preventDefault(); + e.stopPropagation(); + } + return false; + } + + xform = 'transform'; + ['webkit', 'Moz', 'O', 'ms'].every(function (prefix) { + var e = prefix + 'Transform'; + if (typeof document.body.style[e] !== 'undefined') { + xform = e; + return false; + } + return true; + }); + + var throttledResize = Materialize.throttle(function () { + if (options.fullWidth) { + item_width = view.find('.carousel-item').first().innerWidth(); + var imageHeight = view.find('.carousel-item.active').height(); + dim = item_width * 2 + options.padding; + offset = center * 2 * item_width; + target = offset; + setCarouselHeight(true); + } else { + scroll(); + } + }, 200); + $(window).off('resize.carousel-' + uniqueNamespace).on('resize.carousel-' + uniqueNamespace, throttledResize); + + setupEvents(); + scroll(offset); + + $(this).on('carouselNext', function (e, n, callback) { + if (n === undefined) { + n = 1; + } + if (typeof callback === "function") { + oneTimeCallback = callback; + } + + target = dim * Math.round(offset / dim) + dim * n; + if (offset !== target) { + amplitude = target - offset; + timestamp = Date.now(); + requestAnimationFrame(autoScroll); + } + }); + + $(this).on('carouselPrev', function (e, n, callback) { + if (n === undefined) { + n = 1; + } + if (typeof callback === "function") { + oneTimeCallback = callback; + } + + target = dim * Math.round(offset / dim) - dim * n; + if (offset !== target) { + amplitude = target - offset; + timestamp = Date.now(); + requestAnimationFrame(autoScroll); + } + }); + + $(this).on('carouselSet', function (e, n, callback) { + if (n === undefined) { + n = 0; + } + if (typeof callback === "function") { + oneTimeCallback = callback; + } + + cycleTo(n); + }); + }); + }, + next: function (n, callback) { + $(this).trigger('carouselNext', [n, callback]); + }, + prev: function (n, callback) { + $(this).trigger('carouselPrev', [n, callback]); + }, + set: function (n, callback) { + $(this).trigger('carouselSet', [n, callback]); + }, + destroy: function () { + var uniqueNamespace = $(this).attr('data-namespace'); + $(this).removeAttr('data-namespace'); + $(this).removeClass('initialized'); + $(this).find('.indicators').remove(); + + // Remove event handlers + $(this).off('carouselNext carouselPrev carouselSet'); + $(window).off('resize.carousel-' + uniqueNamespace); + if (typeof window.ontouchstart !== 'undefined') { + $(this).off('touchstart.carousel touchmove.carousel touchend.carousel'); + } + $(this).off('mousedown.carousel mousemove.carousel mouseup.carousel mouseleave.carousel click.carousel'); + } + }; + + $.fn.carousel = function (methodOrOptions) { + if (methods[methodOrOptions]) { + return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1)); + } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { + // Default to "init" + return methods.init.apply(this, arguments); + } else { + $.error('Method ' + methodOrOptions + ' does not exist on jQuery.carousel'); + } + }; // Plugin end +})(jQuery); +;(function ($) { + + var methods = { + init: function (options) { + return this.each(function () { + var origin = $('#' + $(this).attr('data-activates')); + var screen = $('body'); + + // Creating tap target + var tapTargetEl = $(this); + var tapTargetWrapper = tapTargetEl.parent('.tap-target-wrapper'); + var tapTargetWave = tapTargetWrapper.find('.tap-target-wave'); + var tapTargetOriginEl = tapTargetWrapper.find('.tap-target-origin'); + var tapTargetContentEl = tapTargetEl.find('.tap-target-content'); + + // Creating wrapper + if (!tapTargetWrapper.length) { + tapTargetWrapper = tapTargetEl.wrap($('
        ')).parent(); + } + + // Creating content + if (!tapTargetContentEl.length) { + tapTargetContentEl = $('
        '); + tapTargetEl.append(tapTargetContentEl); + } + + // Creating foreground wave + if (!tapTargetWave.length) { + tapTargetWave = $('
        '); + + // Creating origin + if (!tapTargetOriginEl.length) { + tapTargetOriginEl = origin.clone(true, true); + tapTargetOriginEl.addClass('tap-target-origin'); + tapTargetOriginEl.removeAttr('id'); + tapTargetOriginEl.removeAttr('style'); + tapTargetWave.append(tapTargetOriginEl); + } + + tapTargetWrapper.append(tapTargetWave); + } + + // Open + var openTapTarget = function () { + if (tapTargetWrapper.is('.open')) { + return; + } + + // Adding open class + tapTargetWrapper.addClass('open'); + + setTimeout(function () { + tapTargetOriginEl.off('click.tapTarget').on('click.tapTarget', function (e) { + closeTapTarget(); + tapTargetOriginEl.off('click.tapTarget'); + }); + + $(document).off('click.tapTarget').on('click.tapTarget', function (e) { + closeTapTarget(); + $(document).off('click.tapTarget'); + }); + + var throttledCalc = Materialize.throttle(function () { + calculateTapTarget(); + }, 200); + $(window).off('resize.tapTarget').on('resize.tapTarget', throttledCalc); + }, 0); + }; + + // Close + var closeTapTarget = function () { + if (!tapTargetWrapper.is('.open')) { + return; + } + + tapTargetWrapper.removeClass('open'); + tapTargetOriginEl.off('click.tapTarget'); + $(document).off('click.tapTarget'); + $(window).off('resize.tapTarget'); + }; + + // Pre calculate + var calculateTapTarget = function () { + // Element or parent is fixed position? + var isFixed = origin.css('position') === 'fixed'; + if (!isFixed) { + var parents = origin.parents(); + for (var i = 0; i < parents.length; i++) { + isFixed = $(parents[i]).css('position') == 'fixed'; + if (isFixed) { + break; + } + } + } + + // Calculating origin + var originWidth = origin.outerWidth(); + var originHeight = origin.outerHeight(); + var originTop = isFixed ? origin.offset().top - $(document).scrollTop() : origin.offset().top; + var originLeft = isFixed ? origin.offset().left - $(document).scrollLeft() : origin.offset().left; + + // Calculating screen + var windowWidth = $(window).width(); + var windowHeight = $(window).height(); + var centerX = windowWidth / 2; + var centerY = windowHeight / 2; + var isLeft = originLeft <= centerX; + var isRight = originLeft > centerX; + var isTop = originTop <= centerY; + var isBottom = originTop > centerY; + var isCenterX = originLeft >= windowWidth * 0.25 && originLeft <= windowWidth * 0.75; + var isCenterY = originTop >= windowHeight * 0.25 && originTop <= windowHeight * 0.75; + + // Calculating tap target + var tapTargetWidth = tapTargetEl.outerWidth(); + var tapTargetHeight = tapTargetEl.outerHeight(); + var tapTargetTop = originTop + originHeight / 2 - tapTargetHeight / 2; + var tapTargetLeft = originLeft + originWidth / 2 - tapTargetWidth / 2; + var tapTargetPosition = isFixed ? 'fixed' : 'absolute'; + + // Calculating content + var tapTargetTextWidth = isCenterX ? tapTargetWidth : tapTargetWidth / 2 + originWidth; + var tapTargetTextHeight = tapTargetHeight / 2; + var tapTargetTextTop = isTop ? tapTargetHeight / 2 : 0; + var tapTargetTextBottom = 0; + var tapTargetTextLeft = isLeft && !isCenterX ? tapTargetWidth / 2 - originWidth : 0; + var tapTargetTextRight = 0; + var tapTargetTextPadding = originWidth; + var tapTargetTextAlign = isBottom ? 'bottom' : 'top'; + + // Calculating wave + var tapTargetWaveWidth = originWidth > originHeight ? originWidth * 2 : originWidth * 2; + var tapTargetWaveHeight = tapTargetWaveWidth; + var tapTargetWaveTop = tapTargetHeight / 2 - tapTargetWaveHeight / 2; + var tapTargetWaveLeft = tapTargetWidth / 2 - tapTargetWaveWidth / 2; + + // Setting tap target + var tapTargetWrapperCssObj = {}; + tapTargetWrapperCssObj.top = isTop ? tapTargetTop : ''; + tapTargetWrapperCssObj.right = isRight ? windowWidth - tapTargetLeft - tapTargetWidth : ''; + tapTargetWrapperCssObj.bottom = isBottom ? windowHeight - tapTargetTop - tapTargetHeight : ''; + tapTargetWrapperCssObj.left = isLeft ? tapTargetLeft : ''; + tapTargetWrapperCssObj.position = tapTargetPosition; + tapTargetWrapper.css(tapTargetWrapperCssObj); + + // Setting content + tapTargetContentEl.css({ + width: tapTargetTextWidth, + height: tapTargetTextHeight, + top: tapTargetTextTop, + right: tapTargetTextRight, + bottom: tapTargetTextBottom, + left: tapTargetTextLeft, + padding: tapTargetTextPadding, + verticalAlign: tapTargetTextAlign + }); + + // Setting wave + tapTargetWave.css({ + top: tapTargetWaveTop, + left: tapTargetWaveLeft, + width: tapTargetWaveWidth, + height: tapTargetWaveHeight + }); + }; + + if (options == 'open') { + calculateTapTarget(); + openTapTarget(); + } + + if (options == 'close') closeTapTarget(); + }); + }, + open: function () {}, + close: function () {} + }; + + $.fn.tapTarget = function (methodOrOptions) { + if (methods[methodOrOptions] || typeof methodOrOptions === 'object') return methods.init.apply(this, arguments); + + $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tap-target'); + }; +})(jQuery); diff --git a/app/dispatch/static/materialize/js/bin/materialize.min.js b/app/dispatch/static/materialize/js/bin/materialize.min.js new file mode 100644 index 0000000..c1a6d7e --- /dev/null +++ b/app/dispatch/static/materialize/js/bin/materialize.min.js @@ -0,0 +1,6 @@ +/*! + * Materialize v0.100.2 (http://materializecss.com) + * Copyright 2014-2017 Materialize + * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE) + */ +function _classCallCheck(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")}var _createClass=function(){function t(t,e){for(var i=0;i0&&e-1 in t))}if(!t.jQuery){var i=function(t,e){return new i.fn.init(t,e)};i.isWindow=function(t){return null!=t&&t==t.window},i.type=function(t){return null==t?t+"":"object"==typeof t||"function"==typeof t?o[r.call(t)]||"object":typeof t},i.isArray=Array.isArray||function(t){return"array"===i.type(t)},i.isPlainObject=function(t){var e;if(!t||"object"!==i.type(t)||t.nodeType||i.isWindow(t))return!1;try{if(t.constructor&&!a.call(t,"constructor")&&!a.call(t.constructor.prototype,"isPrototypeOf"))return!1}catch(t){return!1}for(e in t);return void 0===e||a.call(t,e)},i.each=function(t,i,n){var o=0,a=t.length,r=e(t);if(n){if(r)for(;a>o&&!1!==i.apply(t[o],n);o++);else for(o in t)if(!1===i.apply(t[o],n))break}else if(r)for(;a>o&&!1!==i.call(t[o],o,t[o]);o++);else for(o in t)if(!1===i.call(t[o],o,t[o]))break;return t},i.data=function(t,e,o){if(void 0===o){var a=(r=t[i.expando])&&n[r];if(void 0===e)return a;if(a&&e in a)return a[e]}else if(void 0!==e){var r=t[i.expando]||(t[i.expando]=++i.uuid);return n[r]=n[r]||{},n[r][e]=o,o}},i.removeData=function(t,e){var o=t[i.expando],a=o&&n[o];a&&i.each(e,function(t,e){delete a[e]})},i.extend=function(){var t,e,n,o,a,r,s=arguments[0]||{},l=1,c=arguments.length,u=!1;for("boolean"==typeof s&&(u=s,s=arguments[l]||{},l++),"object"!=typeof s&&"function"!==i.type(s)&&(s={}),l===c&&(s=this,l--);c>l;l++)if(null!=(a=arguments[l]))for(o in a)t=s[o],s!==(n=a[o])&&(u&&n&&(i.isPlainObject(n)||(e=i.isArray(n)))?(e?(e=!1,r=t&&i.isArray(t)?t:[]):r=t&&i.isPlainObject(t)?t:{},s[o]=i.extend(u,r,n)):void 0!==n&&(s[o]=n));return s},i.queue=function(t,n,o){if(t){n=(n||"fx")+"queue";var a=i.data(t,n);return o?(!a||i.isArray(o)?a=i.data(t,n,function(t,i){var n=i||[];return null!=t&&(e(Object(t))?function(t,e){for(var i=+e.length,n=0,o=t.length;i>n;)t[o++]=e[n++];if(i!==i)for(;void 0!==e[n];)t[o++]=e[n++];t.length=o}(n,"string"==typeof t?[t]:t):[].push.call(n,t)),n}(o)):a.push(o),a):a||[]}},i.dequeue=function(t,e){i.each(t.nodeType?[t]:t,function(t,n){e=e||"fx";var o=i.queue(n,e),a=o.shift();"inprogress"===a&&(a=o.shift()),a&&("fx"===e&&o.unshift("inprogress"),a.call(n,function(){i.dequeue(n,e)}))})},i.fn=i.prototype={init:function(t){if(t.nodeType)return this[0]=t,this;throw new Error("Not a DOM node.")},offset:function(){var e=this[0].getBoundingClientRect?this[0].getBoundingClientRect():{top:0,left:0};return{top:e.top+(t.pageYOffset||document.scrollTop||0)-(document.clientTop||0),left:e.left+(t.pageXOffset||document.scrollLeft||0)-(document.clientLeft||0)}},position:function(){function t(){for(var t=this.offsetParent||document;t&&"html"===!t.nodeType.toLowerCase&&"static"===t.style.position;)t=t.offsetParent;return t||document}var e=this[0],t=t.apply(e),n=this.offset(),o=/^(?:body|html)$/i.test(t.nodeName)?{top:0,left:0}:i(t).offset();return n.top-=parseFloat(e.style.marginTop)||0,n.left-=parseFloat(e.style.marginLeft)||0,t.style&&(o.top+=parseFloat(t.style.borderTopWidth)||0,o.left+=parseFloat(t.style.borderLeftWidth)||0),{top:n.top-o.top,left:n.left-o.left}}};var n={};i.expando="velocity"+(new Date).getTime(),i.uuid=0;for(var o={},a=o.hasOwnProperty,r=o.toString,s="Boolean Number String Function Array Date RegExp Object Error".split(" "),l=0;lo;++o){var a=c(i,t,n);if(0===a)return i;i-=(l(i,t,n)-e)/a}return i}function d(){for(var e=0;b>e;++e)C[e]=l(e*w,t,n)}function p(e,i,o){var a,r,s=0;do{(a=l(r=i+(o-i)/2,t,n)-e)>0?o=r:i=r}while(Math.abs(a)>g&&++s=m?u(e,r):0==s?r:p(e,i,i+w)}function f(){T=!0,(t!=i||n!=o)&&d()}var v=4,m=.001,g=1e-7,y=10,b=11,w=1/(b-1),k="Float32Array"in e;if(4!==arguments.length)return!1;for(var x=0;4>x;++x)if("number"!=typeof arguments[x]||isNaN(arguments[x])||!isFinite(arguments[x]))return!1;t=Math.min(t,1),n=Math.min(n,1),t=Math.max(t,0),n=Math.max(n,0);var C=k?new Float32Array(b):new Array(b),T=!1,S=function(e){return T||f(),t===i&&n===o?e:0===e?0:1===e?1:l(h(e),i,o)};S.getControlPoints=function(){return[{x:t,y:i},{x:n,y:o}]};var P="generateBezier("+[t,i,n,o]+")";return S.toString=function(){return P},S}function c(t,e){var i=t;return v.isString(t)?b.Easings[t]||(i=!1):i=v.isArray(t)&&1===t.length?s.apply(null,t):v.isArray(t)&&2===t.length?w.apply(null,t.concat([e])):!(!v.isArray(t)||4!==t.length)&&l.apply(null,t),!1===i&&(i=b.Easings[b.defaults.easing]?b.defaults.easing:y),i}function u(t){if(t){var e=(new Date).getTime(),i=b.State.calls.length;i>1e4&&(b.State.calls=o(b.State.calls));for(var a=0;i>a;a++)if(b.State.calls[a]){var s=b.State.calls[a],l=s[0],c=s[2],h=s[3],f=!!h,m=null;h||(h=b.State.calls[a][3]=e-16);for(var g=Math.min((e-h)/c.duration,1),y=0,w=l.length;w>y;y++){var x=l[y],T=x.element;if(r(T)){var S=!1;if(c.display!==n&&null!==c.display&&"none"!==c.display){if("flex"===c.display){var P=["-webkit-box","-moz-box","-ms-flexbox","-webkit-flex"];p.each(P,function(t,e){k.setPropertyValue(T,"display",e)})}k.setPropertyValue(T,"display",c.display)}c.visibility!==n&&"hidden"!==c.visibility&&k.setPropertyValue(T,"visibility",c.visibility);for(var A in x)if("element"!==A){var O,E=x[A],_=v.isString(E.easing)?b.Easings[E.easing]:E.easing;if(1===g)O=E.endValue;else{var M=E.endValue-E.startValue;if(O=E.startValue+M*_(g,c,M),!f&&O===E.currentValue)continue}if(E.currentValue=O,"tween"===A)m=O;else{if(k.Hooks.registered[A]){var I=k.Hooks.getRoot(A),D=r(T).rootPropertyValueCache[I];D&&(E.rootPropertyValue=D)}var q=k.setPropertyValue(T,A,E.currentValue+(0===parseFloat(O)?"":E.unitType),E.rootPropertyValue,E.scrollData);k.Hooks.registered[A]&&(r(T).rootPropertyValueCache[I]=k.Normalizations.registered[I]?k.Normalizations.registered[I]("extract",null,q[1]):q[1]),"transform"===q[0]&&(S=!0)}}c.mobileHA&&r(T).transformCache.translate3d===n&&(r(T).transformCache.translate3d="(0px, 0px, 0px)",S=!0),S&&k.flushTransformCache(T)}}c.display!==n&&"none"!==c.display&&(b.State.calls[a][2].display=!1),c.visibility!==n&&"hidden"!==c.visibility&&(b.State.calls[a][2].visibility=!1),c.progress&&c.progress.call(s[1],s[1],g,Math.max(0,h+c.duration-e),h,m),1===g&&d(a)}}b.State.isTicking&&C(u)}function d(t,e){if(!b.State.calls[t])return!1;for(var i=b.State.calls[t][0],o=b.State.calls[t][1],a=b.State.calls[t][2],s=b.State.calls[t][4],l=!1,c=0,u=i.length;u>c;c++){var d=i[c].element;if(e||a.loop||("none"===a.display&&k.setPropertyValue(d,"display",a.display),"hidden"===a.visibility&&k.setPropertyValue(d,"visibility",a.visibility)),!0!==a.loop&&(p.queue(d)[1]===n||!/\.velocityQueueEntryFlag/i.test(p.queue(d)[1]))&&r(d)){r(d).isAnimating=!1,r(d).rootPropertyValueCache={};var h=!1;p.each(k.Lists.transforms3D,function(t,e){var i=/^scale/.test(e)?1:0,o=r(d).transformCache[e];r(d).transformCache[e]!==n&&new RegExp("^\\("+i+"[^.]").test(o)&&(h=!0,delete r(d).transformCache[e])}),a.mobileHA&&(h=!0,delete r(d).transformCache.translate3d),h&&k.flushTransformCache(d),k.Values.removeClass(d,"velocity-animating")}if(!e&&a.complete&&!a.loop&&c===u-1)try{a.complete.call(o,o)}catch(t){setTimeout(function(){throw t},1)}s&&!0!==a.loop&&s(o),r(d)&&!0===a.loop&&!e&&(p.each(r(d).tweensContainer,function(t,e){/^rotate/.test(t)&&360===parseFloat(e.endValue)&&(e.endValue=0,e.startValue=360),/^backgroundPosition/.test(t)&&100===parseFloat(e.endValue)&&"%"===e.unitType&&(e.endValue=0,e.startValue=100)}),b(d,"reverse",{loop:!0,delay:a.delay})),!1!==a.queue&&p.dequeue(d,a.queue)}b.State.calls[t]=!1;for(var f=0,v=b.State.calls.length;v>f;f++)if(!1!==b.State.calls[f]){l=!0;break}!1===l&&(b.State.isTicking=!1,delete b.State.calls,b.State.calls=[])}var p,h=function(){if(i.documentMode)return i.documentMode;for(var t=7;t>4;t--){var e=i.createElement("div");if(e.innerHTML="\x3c!--[if IE "+t+"]>0)},isWrapped:function(t){return t&&(t.jquery||e.Zepto&&e.Zepto.zepto.isZ(t))},isSVG:function(t){return e.SVGElement&&t instanceof e.SVGElement},isEmptyObject:function(t){for(var e in t)return!1;return!0}},m=!1;if(t.fn&&t.fn.jquery?(p=t,m=!0):p=e.Velocity.Utilities,8>=h&&!m)throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");{if(!(7>=h)){var g=400,y="swing",b={State:{isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),isAndroid:/Android/i.test(navigator.userAgent),isGingerbread:/Android 2\.3\.[3-7]/i.test(navigator.userAgent),isChrome:e.chrome,isFirefox:/Firefox/i.test(navigator.userAgent),prefixElement:i.createElement("div"),prefixMatches:{},scrollAnchor:null,scrollPropertyLeft:null,scrollPropertyTop:null,isTicking:!1,calls:[]},CSS:{},Utilities:p,Redirects:{},Easings:{},Promise:e.Promise,defaults:{queue:"",duration:g,easing:y,begin:n,complete:n,progress:n,display:n,visibility:n,loop:!1,delay:!1,mobileHA:!0,_cacheValues:!0},init:function(t){p.data(t,"velocity",{isSVG:v.isSVG(t),isAnimating:!1,computedStyle:null,tweensContainer:null,rootPropertyValueCache:{},transformCache:{}})},hook:null,mock:!1,version:{major:1,minor:2,patch:2},debug:!1};e.pageYOffset!==n?(b.State.scrollAnchor=e,b.State.scrollPropertyLeft="pageXOffset",b.State.scrollPropertyTop="pageYOffset"):(b.State.scrollAnchor=i.documentElement||i.body.parentNode||i.body,b.State.scrollPropertyLeft="scrollLeft",b.State.scrollPropertyTop="scrollTop");var w=function(){function t(t){return-t.tension*t.x-t.friction*t.v}function e(e,i,n){var o={x:e.x+n.dx*i,v:e.v+n.dv*i,tension:e.tension,friction:e.friction};return{dx:o.v,dv:t(o)}}function i(i,n){var o={dx:i.v,dv:t(i)},a=e(i,.5*n,o),r=e(i,.5*n,a),s=e(i,n,r),l=1/6*(o.dx+2*(a.dx+r.dx)+s.dx),c=1/6*(o.dv+2*(a.dv+r.dv)+s.dv);return i.x=i.x+l*n,i.v=i.v+c*n,i}return function t(e,n,o){var a,r,s,l={x:-1,v:0,tension:null,friction:null},c=[0],u=0;for(e=parseFloat(e)||500,n=parseFloat(n)||20,o=o||null,l.tension=e,l.friction=n,(a=null!==o)?(u=t(e,n),r=u/o*.016):r=.016;s=i(s||l,r),c.push(1+s.x),u+=16,Math.abs(s.x)>1e-4&&Math.abs(s.v)>1e-4;);return a?function(t){return c[t*(c.length-1)|0]}:u}}();b.Easings={linear:function(t){return t},swing:function(t){return.5-Math.cos(t*Math.PI)/2},spring:function(t){return 1-Math.cos(4.5*t*Math.PI)*Math.exp(6*-t)}},p.each([["ease",[.25,.1,.25,1]],["ease-in",[.42,0,1,1]],["ease-out",[0,0,.58,1]],["ease-in-out",[.42,0,.58,1]],["easeInSine",[.47,0,.745,.715]],["easeOutSine",[.39,.575,.565,1]],["easeInOutSine",[.445,.05,.55,.95]],["easeInQuad",[.55,.085,.68,.53]],["easeOutQuad",[.25,.46,.45,.94]],["easeInOutQuad",[.455,.03,.515,.955]],["easeInCubic",[.55,.055,.675,.19]],["easeOutCubic",[.215,.61,.355,1]],["easeInOutCubic",[.645,.045,.355,1]],["easeInQuart",[.895,.03,.685,.22]],["easeOutQuart",[.165,.84,.44,1]],["easeInOutQuart",[.77,0,.175,1]],["easeInQuint",[.755,.05,.855,.06]],["easeOutQuint",[.23,1,.32,1]],["easeInOutQuint",[.86,0,.07,1]],["easeInExpo",[.95,.05,.795,.035]],["easeOutExpo",[.19,1,.22,1]],["easeInOutExpo",[1,0,0,1]],["easeInCirc",[.6,.04,.98,.335]],["easeOutCirc",[.075,.82,.165,1]],["easeInOutCirc",[.785,.135,.15,.86]]],function(t,e){b.Easings[e[0]]=l.apply(null,e[1])});var k=b.CSS={RegEx:{isHex:/^#([A-f\d]{3}){1,2}$/i,valueUnwrap:/^[A-z]+\((.*)\)$/i,wrappedValueAlreadyExtracted:/[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/,valueSplit:/([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi},Lists:{colors:["fill","stroke","stopColor","color","backgroundColor","borderColor","borderTopColor","borderRightColor","borderBottomColor","borderLeftColor","outlineColor"],transformsBase:["translateX","translateY","scale","scaleX","scaleY","skewX","skewY","rotateZ"],transforms3D:["transformPerspective","translateZ","scaleZ","rotateX","rotateY"]},Hooks:{templates:{textShadow:["Color X Y Blur","black 0px 0px 0px"],boxShadow:["Color X Y Blur Spread","black 0px 0px 0px 0px"],clip:["Top Right Bottom Left","0px 0px 0px 0px"],backgroundPosition:["X Y","0% 0%"],transformOrigin:["X Y Z","50% 50% 0px"],perspectiveOrigin:["X Y","50% 50%"]},registered:{},register:function(){for(a=0;a=h)switch(t){case"name":return"filter";case"extract":var n=i.toString().match(/alpha\(opacity=(.*)\)/i);return i=n?n[1]/100:1;case"inject":return e.style.zoom=1,parseFloat(i)>=1?"":"alpha(opacity="+parseInt(100*parseFloat(i),10)+")"}else switch(t){case"name":return"opacity";case"extract":case"inject":return i}}},register:function(){9>=h||b.State.isGingerbread||(k.Lists.transformsBase=k.Lists.transformsBase.concat(k.Lists.transforms3D));for(t=0;to&&(o=1),a=!/(\d)$/i.test(o);break;case"skew":a=!/(deg|\d)$/i.test(o);break;case"rotate":a=!/(deg|\d)$/i.test(o)}return a||(r(i).transformCache[e]="("+o+")"),r(i).transformCache[e]}}}();for(var t=0;t=h||3!==a.split(" ").length||(a+=" 1"),a;case"inject":return 8>=h?4===o.split(" ").length&&(o=o.split(/\s+/).slice(0,3).join(" ")):3===o.split(" ").length&&(o+=" 1"),(8>=h?"rgb":"rgba")+"("+o.replace(/\s+/g,",").replace(/\.(\d)+(?=,)/g,"")+")"}}}()}},Names:{camelCase:function(t){return t.replace(/-(\w)/g,function(t,e){return e.toUpperCase()})},SVGAttribute:function(t){var e="width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return(h||b.State.isAndroid&&!b.State.isChrome)&&(e+="|transform"),new RegExp("^("+e+")$","i").test(t)},prefixCheck:function(t){if(b.State.prefixMatches[t])return[b.State.prefixMatches[t],!0];for(var e=["","Webkit","Moz","ms","O"],i=0,n=e.length;n>i;i++){var o;if(o=0===i?t:e[i]+t.replace(/^\w/,function(t){return t.toUpperCase()}),v.isString(b.State.prefixElement.style[o]))return b.State.prefixMatches[t]=o,[o,!0]}return[t,!1]}},Values:{hexToRgb:function(t){var e,i=/^#?([a-f\d])([a-f\d])([a-f\d])$/i,n=/^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return t=t.replace(i,function(t,e,i,n){return e+e+i+i+n+n}),e=n.exec(t),e?[parseInt(e[1],16),parseInt(e[2],16),parseInt(e[3],16)]:[0,0,0]},isCSSNullValue:function(t){return 0==t||/^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(t)},getUnitType:function(t){return/^(rotate|skew)/i.test(t)?"deg":/(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(t)?"":"px"},getDisplayType:function(t){var e=t&&t.tagName.toString().toLowerCase();return/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(e)?"inline":/^(li)$/i.test(e)?"list-item":/^(tr)$/i.test(e)?"table-row":/^(table)$/i.test(e)?"table":/^(tbody)$/i.test(e)?"table-row-group":"block"},addClass:function(t,e){t.classList?t.classList.add(e):t.className+=(t.className.length?" ":"")+e},removeClass:function(t,e){t.classList?t.classList.remove(e):t.className=t.className.toString().replace(new RegExp("(^|\\s)"+e.split(" ").join("|")+"(\\s|$)","gi")," ")}},getPropertyValue:function(t,i,o,a){function s(t,i){function o(){c&&k.setPropertyValue(t,"display","none")}var l=0;if(8>=h)l=p.css(t,i);else{var c=!1;if(/^(width|height)$/.test(i)&&0===k.getPropertyValue(t,"display")&&(c=!0,k.setPropertyValue(t,"display",k.Values.getDisplayType(t))),!a){if("height"===i&&"border-box"!==k.getPropertyValue(t,"boxSizing").toString().toLowerCase()){var u=t.offsetHeight-(parseFloat(k.getPropertyValue(t,"borderTopWidth"))||0)-(parseFloat(k.getPropertyValue(t,"borderBottomWidth"))||0)-(parseFloat(k.getPropertyValue(t,"paddingTop"))||0)-(parseFloat(k.getPropertyValue(t,"paddingBottom"))||0);return o(),u}if("width"===i&&"border-box"!==k.getPropertyValue(t,"boxSizing").toString().toLowerCase()){var d=t.offsetWidth-(parseFloat(k.getPropertyValue(t,"borderLeftWidth"))||0)-(parseFloat(k.getPropertyValue(t,"borderRightWidth"))||0)-(parseFloat(k.getPropertyValue(t,"paddingLeft"))||0)-(parseFloat(k.getPropertyValue(t,"paddingRight"))||0);return o(),d}}var f;f=r(t)===n?e.getComputedStyle(t,null):r(t).computedStyle?r(t).computedStyle:r(t).computedStyle=e.getComputedStyle(t,null),"borderColor"===i&&(i="borderTopColor"),(""===(l=9===h&&"filter"===i?f.getPropertyValue(i):f[i])||null===l)&&(l=t.style[i]),o()}if("auto"===l&&/^(top|right|bottom|left)$/i.test(i)){var v=s(t,"position");("fixed"===v||"absolute"===v&&/top|left/i.test(i))&&(l=p(t).position()[i]+"px")}return l}var l;if(k.Hooks.registered[i]){var c=i,u=k.Hooks.getRoot(c);o===n&&(o=k.getPropertyValue(t,k.Names.prefixCheck(u)[0])),k.Normalizations.registered[u]&&(o=k.Normalizations.registered[u]("extract",t,o)),l=k.Hooks.extractValue(c,o)}else if(k.Normalizations.registered[i]){var d,f;"transform"!==(d=k.Normalizations.registered[i]("name",t))&&(f=s(t,k.Names.prefixCheck(d)[0]),k.Values.isCSSNullValue(f)&&k.Hooks.templates[i]&&(f=k.Hooks.templates[i][1])),l=k.Normalizations.registered[i]("extract",t,f)}if(!/^[\d-]/.test(l))if(r(t)&&r(t).isSVG&&k.Names.SVGAttribute(i))if(/^(height|width)$/i.test(i))try{l=t.getBBox()[i]}catch(t){l=0}else l=t.getAttribute(i);else l=s(t,k.Names.prefixCheck(i)[0]);return k.Values.isCSSNullValue(l)&&(l=0),b.debug>=2&&console.log("Get "+i+": "+l),l},setPropertyValue:function(t,i,n,o,a){var s=i;if("scroll"===i)a.container?a.container["scroll"+a.direction]=n:"Left"===a.direction?e.scrollTo(n,a.alternateValue):e.scrollTo(a.alternateValue,n);else if(k.Normalizations.registered[i]&&"transform"===k.Normalizations.registered[i]("name",t))k.Normalizations.registered[i]("inject",t,n),s="transform",n=r(t).transformCache[i];else{if(k.Hooks.registered[i]){var l=i,c=k.Hooks.getRoot(i);o=o||k.getPropertyValue(t,c),n=k.Hooks.injectValue(l,n,o),i=c}if(k.Normalizations.registered[i]&&(n=k.Normalizations.registered[i]("inject",t,n),i=k.Normalizations.registered[i]("name",t)),s=k.Names.prefixCheck(i)[0],8>=h)try{t.style[s]=n}catch(t){b.debug&&console.log("Browser does not support ["+n+"] for ["+s+"]")}else r(t)&&r(t).isSVG&&k.Names.SVGAttribute(i)?t.setAttribute(i,n):t.style[s]=n;b.debug>=2&&console.log("Set "+i+" ("+s+"): "+n)}return[s,n]},flushTransformCache:function(t){function e(e){return parseFloat(k.getPropertyValue(t,e))}var i="";if((h||b.State.isAndroid&&!b.State.isChrome)&&r(t).isSVG){var n={translate:[e("translateX"),e("translateY")],skewX:[e("skewX")],skewY:[e("skewY")],scale:1!==e("scale")?[e("scale"),e("scale")]:[e("scaleX"),e("scaleY")],rotate:[e("rotateZ"),0,0]};p.each(r(t).transformCache,function(t){/^translate/i.test(t)?t="translate":/^scale/i.test(t)?t="scale":/^rotate/i.test(t)&&(t="rotate"),n[t]&&(i+=t+"("+n[t].join(" ")+") ",delete n[t])})}else{var o,a;p.each(r(t).transformCache,function(e){return o=r(t).transformCache[e],"transformPerspective"===e?(a=o,!0):(9===h&&"rotateZ"===e&&(e="rotate"),void(i+=e+o+" "))}),a&&(i="perspective"+a+" "+i)}k.setPropertyValue(t,"transform",i)}};k.Hooks.register(),k.Normalizations.register(),b.hook=function(t,e,i){var o=n;return t=a(t),p.each(t,function(t,a){if(r(a)===n&&b.init(a),i===n)o===n&&(o=b.CSS.getPropertyValue(a,e));else{var s=b.CSS.setPropertyValue(a,e,i);"transform"===s[0]&&b.CSS.flushTransformCache(a),o=s}}),o};var x=function(){function t(){return s?P.promise||null:l}function o(){function t(t){function d(t,e){var i=n,o=n,r=n;return v.isArray(t)?(i=t[0],!v.isArray(t[1])&&/^[\d-]/.test(t[1])||v.isFunction(t[1])||k.RegEx.isHex.test(t[1])?r=t[1]:(v.isString(t[1])&&!k.RegEx.isHex.test(t[1])||v.isArray(t[1]))&&(o=e?t[1]:c(t[1],s.duration),t[2]!==n&&(r=t[2]))):i=t,e||(o=o||s.easing),v.isFunction(i)&&(i=i.call(a,T,C)),v.isFunction(r)&&(r=r.call(a,T,C)),[i||0,o,r]}function h(t,e){var i,n;return n=(e||"0").toString().toLowerCase().replace(/[%A-z]+$/,function(t){return i=t,""}),i||(i=k.Values.getUnitType(t)),[n,i]}if(s.begin&&0===T)try{s.begin.call(f,f)}catch(t){setTimeout(function(){throw t},1)}if("scroll"===A){var g,w,x,S=/^x$/i.test(s.axis)?"Left":"Top",O=parseFloat(s.offset)||0;s.container?v.isWrapped(s.container)||v.isNode(s.container)?(s.container=s.container[0]||s.container,g=s.container["scroll"+S],x=g+p(a).position()[S.toLowerCase()]+O):s.container=null:(g=b.State.scrollAnchor[b.State["scrollProperty"+S]],w=b.State.scrollAnchor[b.State["scrollProperty"+("Left"===S?"Top":"Left")]],x=p(a).offset()[S.toLowerCase()]+O),l={scroll:{rootPropertyValue:!1,startValue:g,currentValue:g,endValue:x,unitType:"",easing:s.easing,scrollData:{container:s.container,direction:S,alternateValue:w}},element:a},b.debug&&console.log("tweensContainer (scroll): ",l.scroll,a)}else if("reverse"===A){if(!r(a).tweensContainer)return void p.dequeue(a,s.queue);"none"===r(a).opts.display&&(r(a).opts.display="auto"),"hidden"===r(a).opts.visibility&&(r(a).opts.visibility="visible"),r(a).opts.loop=!1,r(a).opts.begin=null,r(a).opts.complete=null,y.easing||delete s.easing,y.duration||delete s.duration,s=p.extend({},r(a).opts,s);M=p.extend(!0,{},r(a).tweensContainer);for(var E in M)if("element"!==E){var _=M[E].startValue;M[E].startValue=M[E].currentValue=M[E].endValue,M[E].endValue=_,v.isEmptyObject(y)||(M[E].easing=s.easing),b.debug&&console.log("reverse tweensContainer ("+E+"): "+JSON.stringify(M[E]),a)}l=M}else if("start"===A){var M;r(a).tweensContainer&&!0===r(a).isAnimating&&(M=r(a).tweensContainer),p.each(m,function(t,e){if(RegExp("^"+k.Lists.colors.join("$|^")+"$").test(t)){var i=d(e,!0),o=i[0],a=i[1],r=i[2];if(k.RegEx.isHex.test(o)){for(var s=["Red","Green","Blue"],l=k.Values.hexToRgb(o),c=r?k.Values.hexToRgb(r):n,u=0;u=1&&console.log("Unit ratios: "+JSON.stringify(l),a),l}();var X=/margin|padding|left|right|width|text|word|letter/i.test(q)||/X$/.test(q)||"x"===q?"x":"y";switch(F){case"%":L*="x"===X?o.percentToPxWidth:o.percentToPxHeight;break;case"px":break;default:L*=o[F+"ToPx"]}switch(W){case"%":L*=1/("x"===X?o.percentToPxWidth:o.percentToPxHeight);break;case"px":break;default:L*=1/o[W+"ToPx"]}}switch(Q){case"+":V=L+V;break;case"-":V=L-V;break;case"*":V*=L;break;case"/":V=L/V}l[q]={rootPropertyValue:$,startValue:L,currentValue:L,endValue:V,unitType:W,easing:H},b.debug&&console.log("tweensContainer ("+q+"): "+JSON.stringify(l[q]),a)}else b.debug&&console.log("Skipping ["+j+"] due to a lack of browser support.")}l.element=a}l.element&&(k.Values.addClass(a,"velocity-animating"),D.push(l),""===s.queue&&(r(a).tweensContainer=l,r(a).opts=s),r(a).isAnimating=!0,T===C-1?(b.State.calls.push([D,f,s,null,P.resolver]),!1===b.State.isTicking&&(b.State.isTicking=!0,u())):T++)}var o,a=this,s=p.extend({},b.defaults,y),l={};switch(r(a)===n&&b.init(a),parseFloat(s.delay)&&!1!==s.queue&&p.queue(a,s.queue,function(t){b.velocityQueueEntryFlag=!0,r(a).delayTimer={setTimeout:setTimeout(t,parseFloat(s.delay)),next:t}}),s.duration.toString().toLowerCase()){case"fast":s.duration=200;break;case"normal":s.duration=g;break;case"slow":s.duration=600;break;default:s.duration=parseFloat(s.duration)||1}!1!==b.mock&&(!0===b.mock?s.duration=s.delay=1:(s.duration*=parseFloat(b.mock)||1,s.delay*=parseFloat(b.mock)||1)),s.easing=c(s.easing,s.duration),s.begin&&!v.isFunction(s.begin)&&(s.begin=null),s.progress&&!v.isFunction(s.progress)&&(s.progress=null),s.complete&&!v.isFunction(s.complete)&&(s.complete=null),s.display!==n&&null!==s.display&&(s.display=s.display.toString().toLowerCase(),"auto"===s.display&&(s.display=b.CSS.Values.getDisplayType(a))),s.visibility!==n&&null!==s.visibility&&(s.visibility=s.visibility.toString().toLowerCase()),s.mobileHA=s.mobileHA&&b.State.isMobile&&!b.State.isGingerbread,!1===s.queue?s.delay?setTimeout(t,s.delay):t():p.queue(a,s.queue,function(e,i){return!0===i?(P.promise&&P.resolver(f),!0):(b.velocityQueueEntryFlag=!0,void t(e))}),""!==s.queue&&"fx"!==s.queue||"inprogress"===p.queue(a)[0]||p.dequeue(a)}var s,l,h,f,m,y,w=arguments[0]&&(arguments[0].p||p.isPlainObject(arguments[0].properties)&&!arguments[0].properties.names||v.isString(arguments[0].properties));if(v.isWrapped(this)?(s=!1,h=0,f=this,l=this):(s=!0,h=1,f=w?arguments[0].elements||arguments[0].e:arguments[0]),f=a(f)){w?(m=arguments[0].properties||arguments[0].p,y=arguments[0].options||arguments[0].o):(m=arguments[h],y=arguments[h+1]);var C=f.length,T=0;if(!/^(stop|finish)$/i.test(m)&&!p.isPlainObject(y)){y={};for(var S=h+1;SV;V++){var H={delay:z.delay,progress:z.progress};V===q-1&&(H.display=z.display,H.visibility=z.visibility,H.complete=z.complete),x(f,"reverse",H)}return t()}};(b=p.extend(x,b)).animate=x;var C=e.requestAnimationFrame||f;return b.State.isMobile||i.hidden===n||i.addEventListener("visibilitychange",function(){i.hidden?(C=function(t){return setTimeout(function(){t(!0)},16)},u()):C=e.requestAnimationFrame||f}),t.Velocity=b,t!==e&&(t.fn.velocity=x,t.fn.velocity.defaults=b.defaults),p.each(["Down","Up"],function(t,e){b.Redirects["slide"+e]=function(t,i,o,a,r,s){var l=p.extend({},i),c=l.begin,u=l.complete,d={height:"",marginTop:"",marginBottom:"",paddingTop:"",paddingBottom:""},h={};l.display===n&&(l.display="Down"===e?"inline"===b.CSS.Values.getDisplayType(t)?"inline-block":"block":"none"),l.begin=function(){c&&c.call(r,r);for(var i in d){h[i]=t.style[i];var n=b.CSS.getPropertyValue(t,i);d[i]="Down"===e?[n,0]:[0,n]}h.overflow=t.style.overflow,t.style.overflow="hidden"},l.complete=function(){for(var e in h)t.style[e]=h[e];u&&u.call(r,r),s&&s.resolver(r)},b(t,d,l)}}),p.each(["In","Out"],function(t,e){b.Redirects["fade"+e]=function(t,i,o,a,r,s){var l=p.extend({},i),c={opacity:"In"===e?1:0},u=l.complete;l.complete=o!==a-1?l.begin=null:function(){u&&u.call(r,r),s&&s.resolver(r)},l.display===n&&(l.display="In"===e?"auto":"none"),b(this,c,l)}}),b}jQuery.fn.velocity=jQuery.fn.animate}}(window.jQuery||window.Zepto||window,window,document)})),function(t,e,i,n){"use strict";function o(t,e,i){return setTimeout(u(t,i),e)}function a(t,e,i){return!!Array.isArray(t)&&(r(t,i[e],i),!0)}function r(t,e,i){var o;if(t)if(t.forEach)t.forEach(e,i);else if(t.length!==n)for(o=0;o-1}function g(t){return t.trim().split(/\s+/g)}function y(t,e,i){if(t.indexOf&&!i)return t.indexOf(e);for(var n=0;ni[e]}):n.sort()),n}function k(t,e){for(var i,o,a=e[0].toUpperCase()+e.slice(1),r=0;r1&&!i.firstMultiple?i.firstMultiple=_(e):1===o&&(i.firstMultiple=!1);var a=i.firstInput,r=i.firstMultiple,s=r?r.center:a.center,l=e.center=M(n);e.timeStamp=ht(),e.deltaTime=e.timeStamp-a.timeStamp,e.angle=z(s,l),e.distance=q(s,l),O(i,e),e.offsetDirection=D(e.deltaX,e.deltaY),e.scale=r?H(r.pointers,n):1,e.rotation=r?V(r.pointers,n):0,E(i,e);var c=t.element;v(e.srcEvent.target,c)&&(c=e.srcEvent.target),e.target=c}function O(t,e){var i=e.center,n=t.offsetDelta||{},o=t.prevDelta||{},a=t.prevInput||{};(e.eventType===xt||a.eventType===Tt)&&(o=t.prevDelta={x:a.deltaX||0,y:a.deltaY||0},n=t.offsetDelta={x:i.x,y:i.y}),e.deltaX=o.x+(i.x-n.x),e.deltaY=o.y+(i.y-n.y)}function E(t,e){var i,o,a,r,s=t.lastInterval||e,l=e.timeStamp-s.timeStamp;if(e.eventType!=St&&(l>kt||s.velocity===n)){var c=s.deltaX-e.deltaX,u=s.deltaY-e.deltaY,d=I(l,c,u);o=d.x,a=d.y,i=pt(d.x)>pt(d.y)?d.x:d.y,r=D(c,u),t.lastInterval=e}else i=s.velocity,o=s.velocityX,a=s.velocityY,r=s.direction;e.velocity=i,e.velocityX=o,e.velocityY=a,e.direction=r}function _(t){for(var e=[],i=0;io;)i+=t[o].clientX,n+=t[o].clientY,o++;return{x:dt(i/e),y:dt(n/e)}}function I(t,e,i){return{x:e/t||0,y:i/t||0}}function D(t,e){return t===e?Pt:pt(t)>=pt(e)?t>0?At:Ot:e>0?Et:_t}function q(t,e,i){i||(i=qt);var n=e[i[0]]-t[i[0]],o=e[i[1]]-t[i[1]];return Math.sqrt(n*n+o*o)}function z(t,e,i){i||(i=qt);var n=e[i[0]]-t[i[0]],o=e[i[1]]-t[i[1]];return 180*Math.atan2(o,n)/Math.PI}function V(t,e){return z(e[1],e[0],zt)-z(t[1],t[0],zt)}function H(t,e){return q(e[0],e[1],zt)/q(t[0],t[1],zt)}function L(){this.evEl=Ht,this.evWin=Lt,this.allow=!0,this.pressed=!1,T.apply(this,arguments)}function j(){this.evEl=Nt,this.evWin=Wt,T.apply(this,arguments),this.store=this.manager.session.pointerEvents=[]}function $(){this.evTarget=Qt,this.evWin=Xt,this.started=!1,T.apply(this,arguments)}function N(t,e){var i=b(t.touches),n=b(t.changedTouches);return e&(Tt|St)&&(i=w(i.concat(n),"identifier",!0)),[i,n]}function W(){this.evTarget=Yt,this.targetIds={},T.apply(this,arguments)}function F(t,e){var i=b(t.touches),n=this.targetIds;if(e&(xt|Ct)&&1===i.length)return n[i[0].identifier]=!0,[i,i];var o,a,r=b(t.changedTouches),s=[],l=this.target;if(a=i.filter(function(t){return v(t.target,l)}),e===xt)for(o=0;os&&(e.push(t),s=e.length-1):o&(Tt|St)&&(i=!0),0>s||(e[s]=t,this.callback(this.manager,o,{pointers:e,changedPointers:[t],pointerType:a,srcEvent:t}),i&&e.splice(s,1))}});var Ft={touchstart:xt,touchmove:Ct,touchend:Tt,touchcancel:St},Qt="touchstart",Xt="touchstart touchmove touchend touchcancel";c($,T,{handler:function(t){var e=Ft[t.type];if(e===xt&&(this.started=!0),this.started){var i=N.call(this,t,e);e&(Tt|St)&&0==i[0].length-i[1].length&&(this.started=!1),this.callback(this.manager,e,{pointers:i[0],changedPointers:i[1],pointerType:bt,srcEvent:t})}}});var Rt={touchstart:xt,touchmove:Ct,touchend:Tt,touchcancel:St},Yt="touchstart touchmove touchend touchcancel";c(W,T,{handler:function(t){var e=Rt[t.type],i=F.call(this,t,e);i&&this.callback(this.manager,e,{pointers:i[0],changedPointers:i[1],pointerType:bt,srcEvent:t})}}),c(Q,T,{handler:function(t,e,i){var n=i.pointerType==bt,o=i.pointerType==wt;if(n)this.mouse.allow=!1;else if(o&&!this.mouse.allow)return;e&(Tt|St)&&(this.mouse.allow=!0),this.callback(t,e,i)},destroy:function(){this.touch.destroy(),this.mouse.destroy()}});var Bt=k(ct.style,"touchAction"),Ut=Bt!==n,Gt="compute",Zt="auto",Jt="manipulation",Kt="none",te="pan-x",ee="pan-y";X.prototype={set:function(t){t==Gt&&(t=this.compute()),Ut&&(this.manager.element.style[Bt]=t),this.actions=t.toLowerCase().trim()},update:function(){this.set(this.manager.options.touchAction)},compute:function(){var t=[];return r(this.manager.recognizers,function(e){d(e.options.enable,[e])&&(t=t.concat(e.getTouchAction()))}),R(t.join(" "))},preventDefaults:function(t){if(!Ut){var e=t.srcEvent,i=t.offsetDirection;if(this.manager.session.prevented)return void e.preventDefault();var n=this.actions,o=m(n,Kt),a=m(n,ee),r=m(n,te);return o||a&&i&Mt||r&&i&It?this.preventSrc(e):void 0}},preventSrc:function(t){this.manager.session.prevented=!0,t.preventDefault()}};var ie=1,ne=2,oe=4,ae=8,re=ae,se=16;Y.prototype={defaults:{},set:function(t){return s(this.options,t),this.manager&&this.manager.touchAction.update(),this},recognizeWith:function(t){if(a(t,"recognizeWith",this))return this;var e=this.simultaneous;return t=G(t,this),e[t.id]||(e[t.id]=t,t.recognizeWith(this)),this},dropRecognizeWith:function(t){return a(t,"dropRecognizeWith",this)?this:(t=G(t,this),delete this.simultaneous[t.id],this)},requireFailure:function(t){if(a(t,"requireFailure",this))return this;var e=this.requireFail;return t=G(t,this),-1===y(e,t)&&(e.push(t),t.requireFailure(this)),this},dropRequireFailure:function(t){if(a(t,"dropRequireFailure",this))return this;t=G(t,this);var e=y(this.requireFail,t);return e>-1&&this.requireFail.splice(e,1),this},hasRequireFailures:function(){return this.requireFail.length>0},canRecognizeWith:function(t){return!!this.simultaneous[t.id]},emit:function(t){function e(e){i.manager.emit(i.options.event+(e?B(n):""),t)}var i=this,n=this.state;ae>n&&e(!0),e(),n>=ae&&e(!0)},tryEmit:function(t){return this.canEmit()?this.emit(t):void(this.state=32)},canEmit:function(){for(var t=0;ta?At:Ot,i=a!=this.pX,n=Math.abs(t.deltaX)):(o=0===r?Pt:0>r?Et:_t,i=r!=this.pY,n=Math.abs(t.deltaY))),t.direction=o,i&&n>e.threshold&&o&e.direction},attrTest:function(t){return Z.prototype.attrTest.call(this,t)&&(this.state&ne||!(this.state&ne)&&this.directionTest(t))},emit:function(t){this.pX=t.deltaX,this.pY=t.deltaY;var e=U(t.direction);e&&this.manager.emit(this.options.event+e,t),this._super.emit.call(this,t)}}),c(K,Z,{defaults:{event:"pinch",threshold:0,pointers:2},getTouchAction:function(){return[Kt]},attrTest:function(t){return this._super.attrTest.call(this,t)&&(Math.abs(t.scale-1)>this.options.threshold||this.state&ne)},emit:function(t){if(this._super.emit.call(this,t),1!==t.scale){var e=t.scale<1?"in":"out";this.manager.emit(this.options.event+e,t)}}}),c(tt,Y,{defaults:{event:"press",pointers:1,time:500,threshold:5},getTouchAction:function(){return[Zt]},process:function(t){var e=this.options,i=t.pointers.length===e.pointers,n=t.distancee.time;if(this._input=t,!n||!i||t.eventType&(Tt|St)&&!a)this.reset();else if(t.eventType&xt)this.reset(),this._timer=o(function(){this.state=re,this.tryEmit()},e.time,this);else if(t.eventType&Tt)return re;return 32},reset:function(){clearTimeout(this._timer)},emit:function(t){this.state===re&&(t&&t.eventType&Tt?this.manager.emit(this.options.event+"up",t):(this._input.timeStamp=ht(),this.manager.emit(this.options.event,this._input)))}}),c(et,Z,{defaults:{event:"rotate",threshold:0,pointers:2},getTouchAction:function(){return[Kt]},attrTest:function(t){return this._super.attrTest.call(this,t)&&(Math.abs(t.rotation)>this.options.threshold||this.state&ne)}}),c(it,Z,{defaults:{event:"swipe",threshold:10,velocity:.65,direction:Mt|It,pointers:1},getTouchAction:function(){return J.prototype.getTouchAction.call(this)},attrTest:function(t){var e,i=this.options.direction;return i&(Mt|It)?e=t.velocity:i&Mt?e=t.velocityX:i&It&&(e=t.velocityY),this._super.attrTest.call(this,t)&&i&t.direction&&t.distance>this.options.threshold&&pt(e)>this.options.velocity&&t.eventType&Tt},emit:function(t){var e=U(t.direction);e&&this.manager.emit(this.options.event+e,t),this.manager.emit(this.options.event,t)}}),c(nt,Y,{defaults:{event:"tap",pointers:1,taps:1,interval:300,time:250,threshold:2,posThreshold:10},getTouchAction:function(){return[Jt]},process:function(t){var e=this.options,i=t.pointers.length===e.pointers,n=t.distance=0&&!n;)n=t[i[a]+"RequestAnimationFrame"],o=t[i[a]+"CancelRequestAnimationFrame"];n&&o||(n=function(t){var i=+Date.now(),n=Math.max(e+16,i);return setTimeout(function(){t(e=n)},n-i)},o=clearTimeout),t.requestAnimationFrame=n,t.cancelAnimationFrame=o}(window),Materialize.objectSelectorString=function(t){return((t.prop("tagName")||"")+(t.attr("id")||"")+(t.attr("class")||"")).replace(/\s/g,"")},Materialize.guid=function(){function t(){return Math.floor(65536*(1+Math.random())).toString(16).substring(1)}return function(){return t()+t()+"-"+t()+"-"+t()+"-"+t()+"-"+t()+t()+t()}}(),Materialize.escapeHash=function(t){return t.replace(/(:|\.|\[|\]|,|=)/g,"\\$1")},Materialize.elementOrParentIsFixed=function(t){var e=$(t),i=!1;return e.add(e.parents()).each(function(){if("fixed"===$(this).css("position"))return i=!0,!1}),i};var getTime=Date.now||function(){return(new Date).getTime()};Materialize.throttle=function(t,e,i){var n,o,a,r=null,s=0;i||(i={});var l=function(){s=!1===i.leading?0:getTime(),r=null,a=t.apply(n,o),n=o=null};return function(){var c=getTime();s||!1!==i.leading||(s=c);var u=e-(c-s);return n=this,o=arguments,u<=0?(clearTimeout(r),r=null,s=c,a=t.apply(n,o),n=o=null):r||!1===i.trailing||(r=setTimeout(l,u)),a}};var Vel;Vel=jQuery?jQuery.Velocity:$?$.Velocity:Velocity,Materialize.Vel=Vel||Velocity,function(t){t.fn.collapsible=function(e,i){var n={accordion:void 0,onOpen:void 0,onClose:void 0},o=e;return e=t.extend(n,e),this.each(function(){function n(e){p=d.find("> li > .collapsible-header"),e.hasClass("active")?e.parent().addClass("active"):e.parent().removeClass("active"),e.parent().hasClass("active")?e.siblings(".collapsible-body").stop(!0,!1).slideDown({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height","")}}):e.siblings(".collapsible-body").stop(!0,!1).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height","")}}),p.not(e).removeClass("active").parent().removeClass("active"),p.not(e).parent().children(".collapsible-body").stop(!0,!1).each(function(){t(this).is(":visible")&&t(this).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height",""),s(t(this).siblings(".collapsible-header"))}})})}function a(e){e.hasClass("active")?e.parent().addClass("active"):e.parent().removeClass("active"),e.parent().hasClass("active")?e.siblings(".collapsible-body").stop(!0,!1).slideDown({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height","")}}):e.siblings(".collapsible-body").stop(!0,!1).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height","")}})}function r(t,i){i||t.toggleClass("active"),e.accordion||"accordion"===h||void 0===h?n(t):a(t),s(t)}function s(t){t.hasClass("active")?"function"==typeof e.onOpen&&e.onOpen.call(this,t.parent()):"function"==typeof e.onClose&&e.onClose.call(this,t.parent())}function l(t){return c(t).length>0}function c(t){return t.closest("li > .collapsible-header")}function u(){d.off("click.collapse","> li > .collapsible-header")}var d=t(this),p=t(this).find("> li > .collapsible-header"),h=d.data("collapsible");if("destroy"!==o)if(i>=0&&i li > .collapsible-header",function(e){var i=t(e.target);l(i)&&(i=c(i)),r(i)}),e.accordion||"accordion"===h||void 0===h?r(p.filter(".active").first(),!0):p.filter(".active").each(function(){r(t(this),!0)});else u()})},t(document).ready(function(){t(".collapsible").collapsible()})}(jQuery),function(t){t.fn.scrollTo=function(e){return t(this).scrollTop(t(this).scrollTop()-t(this).offset().top+t(e).offset().top),this},t.fn.dropdown=function(e){var i={inDuration:300,outDuration:225,constrainWidth:!0,hover:!1,gutter:0,belowOrigin:!1,alignment:"left",stopPropagation:!1};return"open"===e?(this.each(function(){t(this).trigger("open")}),!1):"close"===e?(this.each(function(){t(this).trigger("close")}),!1):void this.each(function(){function n(){void 0!==r.data("induration")&&(s.inDuration=r.data("induration")),void 0!==r.data("outduration")&&(s.outDuration=r.data("outduration")),void 0!==r.data("constrainwidth")&&(s.constrainWidth=r.data("constrainwidth")),void 0!==r.data("hover")&&(s.hover=r.data("hover")),void 0!==r.data("gutter")&&(s.gutter=r.data("gutter")),void 0!==r.data("beloworigin")&&(s.belowOrigin=r.data("beloworigin")),void 0!==r.data("alignment")&&(s.alignment=r.data("alignment")),void 0!==r.data("stoppropagation")&&(s.stopPropagation=r.data("stoppropagation"))}function o(e){"focus"===e&&(l=!0),n(),c.addClass("active"),r.addClass("active");var i=r[0].getBoundingClientRect().width;!0===s.constrainWidth?c.css("width",i):c.css("white-space","nowrap");var o=window.innerHeight,u=r.innerHeight(),d=r.offset().left,p=r.offset().top-t(window).scrollTop(),h=s.alignment,f=0,v=0,m=0;!0===s.belowOrigin&&(m=u);var g=0,y=0,b=r.parent();if(b.is("body")||(b[0].scrollHeight>b[0].clientHeight&&(g=b[0].scrollTop),b[0].scrollWidth>b[0].clientWidth&&(y=b[0].scrollLeft)),d+c.innerWidth()>t(window).width()?h="right":d-c.innerWidth()+r.innerWidth()<0&&(h="left"),p+c.innerHeight()>o)if(p+u-c.innerHeight()<0){var w=o-p-m;c.css("max-height",w)}else m||(m+=u),m-=c.innerHeight();"left"===h?(f=s.gutter,v=r.position().left+f):"right"===h&&(c.stop(!0,!0).css({opacity:0,left:0}),v=r.position().left+i-c.width()+(f=-s.gutter)),c.css({position:"absolute",top:r.position().top+m+g,left:v+y}),c.slideDown({queue:!1,duration:s.inDuration,easing:"easeOutCubic",complete:function(){t(this).css("height","")}}).animate({opacity:1},{queue:!1,duration:s.inDuration,easing:"easeOutSine"}),setTimeout(function(){t(document).on("click."+c.attr("id"),function(e){a(),t(document).off("click."+c.attr("id"))})},0)}function a(){l=!1,c.fadeOut(s.outDuration),c.removeClass("active"),r.removeClass("active"),t(document).off("click."+c.attr("id")),setTimeout(function(){c.css("max-height","")},s.outDuration)}var r=t(this),s=t.extend({},i,e),l=!1,c=t("#"+r.attr("data-activates"));if(n(),r.after(c),s.hover){var u=!1;r.off("click."+r.attr("id")),r.on("mouseenter",function(t){!1===u&&(o(),u=!0)}),r.on("mouseleave",function(e){var i=e.toElement||e.relatedTarget;t(i).closest(".dropdown-content").is(c)||(c.stop(!0,!0),a(),u=!1)}),c.on("mouseleave",function(e){var i=e.toElement||e.relatedTarget;t(i).closest(".dropdown-button").is(r)||(c.stop(!0,!0),a(),u=!1)})}else r.off("click."+r.attr("id")),r.on("click."+r.attr("id"),function(e){l||(r[0]!=e.currentTarget||r.hasClass("active")||0!==t(e.target).closest(".dropdown-content").length?r.hasClass("active")&&(a(),t(document).off("click."+c.attr("id"))):(e.preventDefault(),s.stopPropagation&&e.stopPropagation(),o("click")))});r.on("open",function(t,e){o(e)}),r.on("close",a)})},t(document).ready(function(){t(".dropdown-button").dropdown()})}(jQuery),function(t,e){"use strict";var i={opacity:.5,inDuration:250,outDuration:250,ready:void 0,complete:void 0,dismissible:!0,startingTop:"4%",endingTop:"10%"},n=function(){function n(e,i){_classCallCheck(this,n),e[0].M_Modal&&e[0].M_Modal.destroy(),this.$el=e,this.options=t.extend({},n.defaults,i),this.isOpen=!1,this.$el[0].M_Modal=this,this.id=e.attr("id"),this.openingTrigger=void 0,this.$overlay=t(''),n._increment++,n._count++,this.$overlay[0].style.zIndex=1e3+2*n._increment,this.$el[0].style.zIndex=1e3+2*n._increment+1,this.setupEventHandlers()}return _createClass(n,[{key:"getInstance",value:function(){return this}},{key:"destroy",value:function(){this.removeEventHandlers(),this.$el[0].removeAttribute("style"),this.$overlay[0].parentNode&&this.$overlay[0].parentNode.removeChild(this.$overlay[0]),this.$el[0].M_Modal=void 0,n._count--}},{key:"setupEventHandlers",value:function(){this.handleOverlayClickBound=this.handleOverlayClick.bind(this),this.handleModalCloseClickBound=this.handleModalCloseClick.bind(this),1===n._count&&document.body.addEventListener("click",this.handleTriggerClick),this.$overlay[0].addEventListener("click",this.handleOverlayClickBound),this.$el[0].addEventListener("click",this.handleModalCloseClickBound)}},{key:"removeEventHandlers",value:function(){0===n._count&&document.body.removeEventListener("click",this.handleTriggerClick),this.$overlay[0].removeEventListener("click",this.handleOverlayClickBound),this.$el[0].removeEventListener("click",this.handleModalCloseClickBound)}},{key:"handleTriggerClick",value:function(e){var i=t(e.target).closest(".modal-trigger");if(e.target&&i.length){var n=i[0].getAttribute("href");n=n?n.slice(1):i[0].getAttribute("data-target");var o=document.getElementById(n).M_Modal;o&&o.open(i),e.preventDefault()}}},{key:"handleOverlayClick",value:function(){this.options.dismissible&&this.close()}},{key:"handleModalCloseClick",value:function(e){var i=t(e.target).closest(".modal-close");e.target&&i.length&&this.close()}},{key:"handleKeydown",value:function(t){27===t.keyCode&&this.options.dismissible&&this.close()}},{key:"animateIn",value:function(){var i=this;t.extend(this.$el[0].style,{display:"block",opacity:0}),t.extend(this.$overlay[0].style,{display:"block",opacity:0}),e(this.$overlay[0],{opacity:this.options.opacity},{duration:this.options.inDuration,queue:!1,ease:"easeOutCubic"});var n={duration:this.options.inDuration,queue:!1,ease:"easeOutCubic",complete:function(){"function"==typeof i.options.ready&&i.options.ready.call(i,i.$el,i.openingTrigger)}};this.$el[0].classList.contains("bottom-sheet")?e(this.$el[0],{bottom:0,opacity:1},n):(e.hook(this.$el[0],"scaleX",.7),this.$el[0].style.top=this.options.startingTop,e(this.$el[0],{top:this.options.endingTop,opacity:1,scaleX:1},n))}},{key:"animateOut",value:function(){var t=this;e(this.$overlay[0],{opacity:0},{duration:this.options.outDuration,queue:!1,ease:"easeOutQuart"});var i={duration:this.options.outDuration,queue:!1,ease:"easeOutCubic",complete:function(){t.$el[0].style.display="none","function"==typeof t.options.complete&&t.options.complete.call(t,t.$el),t.$overlay[0].parentNode.removeChild(t.$overlay[0])}};this.$el[0].classList.contains("bottom-sheet")?e(this.$el[0],{bottom:"-100%",opacity:0},i):e(this.$el[0],{top:this.options.startingTop,opacity:0,scaleX:.7},i)}},{key:"open",value:function(t){if(!this.isOpen){this.isOpen=!0;var e=document.body;return e.style.overflow="hidden",this.$el[0].classList.add("open"),e.appendChild(this.$overlay[0]),this.openingTrigger=t||void 0,this.options.dismissible&&(this.handleKeydownBound=this.handleKeydown.bind(this),document.addEventListener("keydown",this.handleKeydownBound)),this.animateIn(),this}}},{key:"close",value:function(){if(this.isOpen)return this.isOpen=!1,this.$el[0].classList.remove("open"),document.body.style.overflow="",this.options.dismissible&&document.removeEventListener("keydown",this.handleKeydownBound),this.animateOut(),this}}],[{key:"init",value:function(e,i){var o=[];return e.each(function(){o.push(new n(t(this),i))}),o}},{key:"defaults",get:function(){return i}}]),n}();n._increment=0,n._count=0,Materialize.Modal=n,t.fn.modal=function(e){return n.prototype[e]?"get"===e.slice(0,3)?this.first()[0].M_Modal[e]():this.each(function(){this.M_Modal[e]()}):"object"!=typeof e&&e?void t.error("Method "+e+" does not exist on jQuery.modal"):(n.init(this,arguments[0]),this)}}(jQuery,Materialize.Vel),function(t){t.fn.materialbox=function(){return this.each(function(){function e(){a=!1;var e=s.parent(".material-placeholder"),n=(window.innerWidth,window.innerHeight,s.data("width")),l=s.data("height");s.velocity("stop",!0),t("#materialbox-overlay").velocity("stop",!0),t(".materialbox-caption").velocity("stop",!0),t(window).off("scroll.materialbox"),t(document).off("keyup.materialbox"),t(window).off("resize.materialbox"),t("#materialbox-overlay").velocity({opacity:0},{duration:r,queue:!1,easing:"easeOutQuad",complete:function(){o=!1,t(this).remove()}}),s.velocity({width:n,height:l,left:0,top:0},{duration:r,queue:!1,easing:"easeOutQuad",complete:function(){e.css({height:"",width:"",position:"",top:"",left:""}),s.removeAttr("style"),s.attr("style",c),s.removeClass("active"),a=!0,i&&i.css("overflow","")}}),t(".materialbox-caption").velocity({opacity:0},{duration:r,queue:!1,easing:"easeOutQuad",complete:function(){t(this).remove()}})}if(!t(this).hasClass("initialized")){t(this).addClass("initialized");var i,n,o=!1,a=!0,r=200,s=t(this),l=t("
        ").addClass("material-placeholder"),c=s.attr("style");s.wrap(l),s.on("click",function(){var r=s.parent(".material-placeholder"),l=window.innerWidth,c=window.innerHeight,u=s.width(),d=s.height();if(!1===a)return e(),!1;if(o&&!0===a)return e(),!1;a=!1,s.addClass("active"),o=!0,r.css({width:r[0].getBoundingClientRect().width,height:r[0].getBoundingClientRect().height,position:"relative",top:0,left:0}),i=void 0,n=r[0].parentNode;for(;null!==n&&!t(n).is(document);){var p=t(n);"visible"!==p.css("overflow")&&(p.css("overflow","visible"),i=void 0===i?p:i.add(p)),n=n.parentNode}s.css({position:"absolute","z-index":1e3,"will-change":"left, top, width, height"}).data("width",u).data("height",d);var h=t('
        ').css({opacity:0}).click(function(){!0===a&&e()});s.before(h);var f=h[0].getBoundingClientRect();if(h.css({width:l,height:c,left:-1*f.left,top:-1*f.top}),h.velocity({opacity:1},{duration:275,queue:!1,easing:"easeOutQuad"}),""!==s.data("caption")){var v=t('
        ');v.text(s.data("caption")),t("body").append(v),v.css({display:"inline"}),v.velocity({opacity:1},{duration:275,queue:!1,easing:"easeOutQuad"})}var m=0,g=0;u/l>d/c?(m=.9*l,g=.9*l*(d/u)):(m=.9*c*(u/d),g=.9*c),s.hasClass("responsive-img")?s.velocity({"max-width":m,width:u},{duration:0,queue:!1,complete:function(){s.css({left:0,top:0}).velocity({height:g,width:m,left:t(document).scrollLeft()+l/2-s.parent(".material-placeholder").offset().left-m/2,top:t(document).scrollTop()+c/2-s.parent(".material-placeholder").offset().top-g/2},{duration:275,queue:!1,easing:"easeOutQuad",complete:function(){a=!0}})}}):s.css("left",0).css("top",0).velocity({height:g,width:m,left:t(document).scrollLeft()+l/2-s.parent(".material-placeholder").offset().left-m/2,top:t(document).scrollTop()+c/2-s.parent(".material-placeholder").offset().top-g/2},{duration:275,queue:!1,easing:"easeOutQuad",complete:function(){a=!0}}),t(window).on("scroll.materialbox",function(){o&&e()}),t(window).on("resize.materialbox",function(){o&&e()}),t(document).on("keyup.materialbox",function(t){27===t.keyCode&&!0===a&&o&&e()})})}})},t(document).ready(function(){t(".materialboxed").materialbox()})}(jQuery),function(t){t.fn.parallax=function(){var e=t(window).width();return this.each(function(i){function n(i){var n;n=e<601?o.height()>0?o.height():o.children("img").height():o.height()>0?o.height():500;var a=o.children("img").first(),r=a.height()-n,s=o.offset().top+n,l=o.offset().top,c=t(window).scrollTop(),u=window.innerHeight,d=(c+u-l)/(n+u),p=Math.round(r*d);i&&a.css("display","block"),s>c&&l=0?(s.velocity({right:b(o)},{duration:300,queue:!1,easing:"easeOutQuad"}),s.velocity({left:w(o)},{duration:300,queue:!1,easing:"easeOutQuad",delay:90})):(s.velocity({left:w(o)},{duration:300,queue:!1,easing:"easeOutQuad"}),s.velocity({right:b(o)},{duration:300,queue:!1,easing:"easeOutQuad",delay:90}))};e.swipeable&&d>e.responsiveThreshold&&(e.swipeable=!1),0===(o=t(p.filter('[href="'+location.hash+'"]'))).length&&(o=t(this).find("li.tab a.active").first()),0===o.length&&(o=t(this).find("li.tab a").first()),o.addClass("active"),(m=p.index(o))<0&&(m=0),void 0!==o[0]&&(a=t(o[0].hash)).addClass("active"),u.find(".indicator").length||u.append('
      • '),s=u.find(".indicator"),u.append(s),u.is(":visible")&&setTimeout(function(){s.css({right:b(o)}),s.css({left:w(o)})},0),t(window).off("resize.tabs-"+c).on("resize.tabs-"+c,function(){h=u.width(),v=Math.max(h,u[0].scrollWidth)/p.length,m<0&&(m=0),0!==v&&0!==h&&(s.css({right:b(o)}),s.css({left:w(o)}))}),e.swipeable?(p.each(function(){var e=t(Materialize.escapeHash(this.hash));e.addClass("carousel-item"),f=f.add(e)}),r=f.wrapAll(''),f.css("display",""),t(".tabs-content.carousel").carousel({fullWidth:!0,noWrap:!0,onCycleTo:function(t){if(!y){var i=m;m=r.index(t),o.removeClass("active"),(o=p.eq(m)).addClass("active"),k(i),"function"==typeof e.onShow&&e.onShow.call(u[0],a)}}})):p.not(o).each(function(){t(Materialize.escapeHash(this.hash)).hide()}),u.off("click.tabs").on("click.tabs","a",function(i){if(t(this).parent().hasClass("disabled"))i.preventDefault();else if(!t(this).attr("target")){y=!0,h=u.width(),v=Math.max(h,u[0].scrollWidth)/p.length,o.removeClass("active");var n=a;o=t(this),a=t(Materialize.escapeHash(this.hash)),p=u.find("li.tab a");o.position();o.addClass("active"),g=m,(m=p.index(t(this)))<0&&(m=0),e.swipeable?f.length&&f.carousel("set",m,function(){"function"==typeof e.onShow&&e.onShow.call(u[0],a)}):(void 0!==a&&(a.show(),a.addClass("active"),"function"==typeof e.onShow&&e.onShow.call(this,a)),void 0===n||n.is(a)||(n.hide(),n.removeClass("active"))),l=setTimeout(function(){y=!1},300),k(g),i.preventDefault()}})})},select_tab:function(t){this.find('a[href="#'+t+'"]').trigger("click")}};t.fn.tabs=function(i){return e[i]?e[i].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof i&&i?void t.error("Method "+i+" does not exist on jQuery.tabs"):e.init.apply(this,arguments)},t(document).ready(function(){t("ul.tabs").tabs()})}(jQuery),function(t){t.fn.tooltip=function(i){var n={delay:350,tooltip:"",position:"bottom",html:!1};return"remove"===i?(this.each(function(){t("#"+t(this).attr("data-tooltip-id")).remove(),t(this).removeAttr("data-tooltip-id"),t(this).off("mouseenter.tooltip mouseleave.tooltip")}),!1):(i=t.extend(n,i),this.each(function(){var n=Materialize.guid(),o=t(this);o.attr("data-tooltip-id")&&t("#"+o.attr("data-tooltip-id")).remove(),o.attr("data-tooltip-id",n);var a,r,s,l,c,u,d=function(){a=o.attr("data-html")?"true"===o.attr("data-html"):i.html,r=o.attr("data-delay"),r=void 0===r||""===r?i.delay:r,s=o.attr("data-position"),s=void 0===s||""===s?i.position:s,l=o.attr("data-tooltip"),l=void 0===l||""===l?i.tooltip:l};d();c=function(){var e=t('
        ');return l=a?t("").html(l):t("").text(l),e.append(l).appendTo(t("body")).attr("id",n),(u=t('
        ')).appendTo(e),e}(),o.off("mouseenter.tooltip mouseleave.tooltip");var p,h=!1;o.on({"mouseenter.tooltip":function(t){p=setTimeout(function(){d(),h=!0,c.velocity("stop"),u.velocity("stop"),c.css({visibility:"visible",left:"0px",top:"0px"});var t,i,n,a=o.outerWidth(),r=o.outerHeight(),l=c.outerHeight(),p=c.outerWidth(),f="0px",v="0px",m=u[0].offsetWidth,g=u[0].offsetHeight,y=8,b=8,w=0;"top"===s?(t=o.offset().top-l-5,i=o.offset().left+a/2-p/2,n=e(i,t,p,l),f="-10px",u.css({bottom:0,left:0,borderRadius:"14px 14px 0 0",transformOrigin:"50% 100%",marginTop:l,marginLeft:p/2-m/2})):"left"===s?(t=o.offset().top+r/2-l/2,i=o.offset().left-p-5,n=e(i,t,p,l),v="-10px",u.css({top:"-7px",right:0,width:"14px",height:"14px",borderRadius:"14px 0 0 14px",transformOrigin:"95% 50%",marginTop:l/2,marginLeft:p})):"right"===s?(t=o.offset().top+r/2-l/2,i=o.offset().left+a+5,n=e(i,t,p,l),v="+10px",u.css({top:"-7px",left:0,width:"14px",height:"14px",borderRadius:"0 14px 14px 0",transformOrigin:"5% 50%",marginTop:l/2,marginLeft:"0px"})):(t=o.offset().top+o.outerHeight()+5,i=o.offset().left+a/2-p/2,n=e(i,t,p,l),f="+10px",u.css({top:0,left:0,marginLeft:p/2-m/2})),c.css({top:n.y,left:n.x}),y=Math.SQRT2*p/parseInt(m),b=Math.SQRT2*l/parseInt(g),w=Math.max(y,b),c.velocity({translateY:f,translateX:v},{duration:350,queue:!1}).velocity({opacity:1},{duration:300,delay:50,queue:!1}),u.css({visibility:"visible"}).velocity({opacity:1},{duration:55,delay:0,queue:!1}).velocity({scaleX:w,scaleY:w},{duration:300,delay:0,queue:!1,easing:"easeInOutQuad"})},r)},"mouseleave.tooltip":function(){h=!1,clearTimeout(p),setTimeout(function(){!0!==h&&(c.velocity({opacity:0,translateY:0,translateX:0},{duration:225,queue:!1}),u.velocity({opacity:0,scaleX:1,scaleY:1},{duration:225,queue:!1,complete:function(){u.css({visibility:"hidden"}),c.css({visibility:"hidden"}),h=!1}}))},225)}})}))};var e=function(e,i,n,o){var a=e,r=i;return a<0?a=4:a+n>window.innerWidth&&(a-=a+n-window.innerWidth),r<0?r=4:r+o>window.innerHeight+t(window).scrollTop&&(r-=r+o-window.innerHeight),{x:a,y:r}};t(document).ready(function(){t(".tooltipped").tooltip()})}(jQuery),function(t){"use strict";function e(t){return null!==t&&t===t.window}function i(t){return e(t)?t:9===t.nodeType&&t.defaultView}function n(t){var e,n,o={top:0,left:0},a=t&&t.ownerDocument;return e=a.documentElement,void 0!==t.getBoundingClientRect&&(o=t.getBoundingClientRect()),n=i(a),{top:o.top+n.pageYOffset-e.clientTop,left:o.left+n.pageXOffset-e.clientLeft}}function o(t){var e="";for(var i in t)t.hasOwnProperty(i)&&(e+=i+":"+t[i]+";");return e}function a(t){if(!1===u.allowEvent(t))return null;for(var e=null,i=t.target||t.srcElement;null!==i.parentNode;){if(!(i instanceof SVGElement)&&-1!==i.className.indexOf("waves-effect")){e=i;break}i=i.parentNode}return e}function r(e){var i=a(e);null!==i&&(c.show(e,i),"ontouchstart"in t&&(i.addEventListener("touchend",c.hide,!1),i.addEventListener("touchcancel",c.hide,!1)),i.addEventListener("mouseup",c.hide,!1),i.addEventListener("mouseleave",c.hide,!1),i.addEventListener("dragend",c.hide,!1))}var s=s||{},l=document.querySelectorAll.bind(document),c={duration:750,show:function(t,e){if(2===t.button)return!1;var i=e||this,a=document.createElement("div");a.className="waves-ripple",i.appendChild(a);var r=n(i),s=t.pageY-r.top,l=t.pageX-r.left,u="scale("+i.clientWidth/100*10+")";"touches"in t&&(s=t.touches[0].pageY-r.top,l=t.touches[0].pageX-r.left),a.setAttribute("data-hold",Date.now()),a.setAttribute("data-scale",u),a.setAttribute("data-x",l),a.setAttribute("data-y",s);var d={top:s+"px",left:l+"px"};a.className=a.className+" waves-notransition",a.setAttribute("style",o(d)),a.className=a.className.replace("waves-notransition",""),d["-webkit-transform"]=u,d["-moz-transform"]=u,d["-ms-transform"]=u,d["-o-transform"]=u,d.transform=u,d.opacity="1",d["-webkit-transition-duration"]=c.duration+"ms",d["-moz-transition-duration"]=c.duration+"ms",d["-o-transition-duration"]=c.duration+"ms",d["transition-duration"]=c.duration+"ms",d["-webkit-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",d["-moz-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",d["-o-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",d["transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",a.setAttribute("style",o(d))},hide:function(t){u.touchup(t);var e=this,i=(e.clientWidth,null),n=e.getElementsByClassName("waves-ripple");if(!(n.length>0))return!1;var a=(i=n[n.length-1]).getAttribute("data-x"),r=i.getAttribute("data-y"),s=i.getAttribute("data-scale"),l=350-(Date.now()-Number(i.getAttribute("data-hold")));l<0&&(l=0),setTimeout(function(){var t={top:r+"px",left:a+"px",opacity:"0","-webkit-transition-duration":c.duration+"ms","-moz-transition-duration":c.duration+"ms","-o-transition-duration":c.duration+"ms","transition-duration":c.duration+"ms","-webkit-transform":s,"-moz-transform":s,"-ms-transform":s,"-o-transform":s,transform:s};i.setAttribute("style",o(t)),setTimeout(function(){try{e.removeChild(i)}catch(t){return!1}},c.duration)},l)},wrapInput:function(t){for(var e=0;e0&&(u.touches-=1)},500):"mousedown"===t.type&&u.touches>0&&(e=!1),e},touchup:function(t){u.allowEvent(t)}};s.displayEffect=function(e){"duration"in(e=e||{})&&(c.duration=e.duration),c.wrapInput(l(".waves-effect")),"ontouchstart"in t&&document.body.addEventListener("touchstart",r,!1),document.body.addEventListener("mousedown",r,!1)},s.attach=function(e){"input"===e.tagName.toLowerCase()&&(c.wrapInput([e]),e=e.parentNode),"ontouchstart"in t&&e.addEventListener("touchstart",r,!1),e.addEventListener("mousedown",r,!1)},t.Waves=s,document.addEventListener("DOMContentLoaded",function(){s.displayEffect()},!1)}(window),function(t,e){"use strict";var i={displayLength:1/0,inDuration:300,outDuration:375,className:void 0,completeCallback:void 0,activationPercent:.8},n=function(){function n(e,i,o,a){if(_classCallCheck(this,n),e){this.options={displayLength:i,className:o,completeCallback:a},this.options=t.extend({},n.defaults,this.options),this.message=e,this.panning=!1,this.timeRemaining=this.options.displayLength,0===n._toasts.length&&n._createContainer(),n._toasts.push(this);var r=this.createToast();r.M_Toast=this,this.el=r,this._animateIn(),this.setTimer()}}return _createClass(n,[{key:"createToast",value:function(){var e=document.createElement("div");if(e.classList.add("toast"),this.options.className){var i=this.options.className.split(" "),o=void 0,a=void 0;for(o=0,a=i.length;oo||e.velocityX>1?(e.wasSwiped=!0,e.remove()):(e.el.style.transition="transform .2s, opacity .2s",e.el.style.transform="",e.el.style.opacity=""),n._draggedToast=null}}},{key:"_xPos",value:function(t){return t.targetTouches&&t.targetTouches.length>=1?t.targetTouches[0].clientX:t.clientX}},{key:"removeAll",value:function(){for(var t in n._toasts)n._toasts[t].remove()}},{key:"defaults",get:function(){return i}}]),n}();n._toasts=[],n._container=null,n._draggedToast=null,Materialize.Toast=n,Materialize.toast=function(t,e,i,o){return new n(t,e,i,o)}}(jQuery,Materialize.Vel),function(t){var e={init:function(e){var i={menuWidth:300,edge:"left",closeOnClick:!1,draggable:!0,onOpen:null,onClose:null};e=t.extend(i,e),t(this).each(function(){var i=t(this),n=i.attr("data-activates"),o=t("#"+n);300!=e.menuWidth&&o.css("width",e.menuWidth);var a=t('.drag-target[data-sidenav="'+n+'"]');e.draggable?(a.length&&a.remove(),a=t('
        ').attr("data-sidenav",n),t("body").append(a)):a=t(),"left"==e.edge?(o.css("transform","translateX(-100%)"),a.css({left:0})):(o.addClass("right-aligned").css("transform","translateX(100%)"),a.css({right:0})),o.hasClass("fixed")&&window.innerWidth>992&&o.css("transform","translateX(0)"),o.hasClass("fixed")&&t(window).resize(function(){window.innerWidth>992?0!==t("#sidenav-overlay").length&&l?r(!0):o.css("transform","translateX(0%)"):!1===l&&("left"===e.edge?o.css("transform","translateX(-100%)"):o.css("transform","translateX(100%)"))}),!0===e.closeOnClick&&o.on("click.itemclick","a:not(.collapsible-header)",function(){window.innerWidth>992&&o.hasClass("fixed")||r()});var r=function(i){s=!1,l=!1,t("body").css({overflow:"",width:""}),t("#sidenav-overlay").velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){t(this).remove()}}),"left"===e.edge?(a.css({width:"",right:"",left:"0"}),o.velocity({translateX:"-100%"},{duration:200,queue:!1,easing:"easeOutCubic",complete:function(){!0===i&&(o.removeAttr("style"),o.css("width",e.menuWidth))}})):(a.css({width:"",right:"0",left:""}),o.velocity({translateX:"100%"},{duration:200,queue:!1,easing:"easeOutCubic",complete:function(){!0===i&&(o.removeAttr("style"),o.css("width",e.menuWidth))}})),"function"==typeof e.onClose&&e.onClose.call(this,o)},s=!1,l=!1;e.draggable&&(a.on("click",function(){l&&r()}),a.hammer({prevent_default:!1}).on("pan",function(i){if("touch"==i.gesture.pointerType){i.gesture.direction;var n=i.gesture.center.x,a=i.gesture.center.y;i.gesture.velocityX;if(0===n&&0===a)return;var s=t("body"),c=t("#sidenav-overlay"),u=s.innerWidth();if(s.css("overflow","hidden"),s.width(u),0===c.length&&((c=t('
        ')).css("opacity",0).click(function(){r()}),"function"==typeof e.onOpen&&e.onOpen.call(this,o),t("body").append(c)),"left"===e.edge&&(n>e.menuWidth?n=e.menuWidth:n<0&&(n=0)),"left"===e.edge)n=e.menuWidth/2&&(l=!0),o.css("transform","translateX("+(n-e.menuWidth)+"px)");else{n=window.innerWidth-e.menuWidth/2&&(l=!1);var d=n-e.menuWidth/2;d<0&&(d=0),o.css("transform","translateX("+d+"px)")}var p;"left"===e.edge?(p=n/e.menuWidth,c.velocity({opacity:p},{duration:10,queue:!1,easing:"easeOutQuad"})):(p=Math.abs((n-window.innerWidth)/e.menuWidth),c.velocity({opacity:p},{duration:10,queue:!1,easing:"easeOutQuad"}))}}).on("panend",function(i){if("touch"==i.gesture.pointerType){var n=t("#sidenav-overlay"),r=i.gesture.velocityX,c=i.gesture.center.x,u=c-e.menuWidth,d=c-e.menuWidth/2;u>0&&(u=0),d<0&&(d=0),s=!1,"left"===e.edge?l&&r<=.3||r<-.5?(0!==u&&o.velocity({translateX:[0,u]},{duration:300,queue:!1,easing:"easeOutQuad"}),n.velocity({opacity:1},{duration:50,queue:!1,easing:"easeOutQuad"}),a.css({width:"50%",right:0,left:""}),l=!0):(!l||r>.3)&&(t("body").css({overflow:"",width:""}),o.velocity({translateX:[-1*e.menuWidth-10,u]},{duration:200,queue:!1,easing:"easeOutQuad"}),n.velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){"function"==typeof e.onClose&&e.onClose.call(this,o),t(this).remove()}}),a.css({width:"10px",right:"",left:0})):l&&r>=-.3||r>.5?(0!==d&&o.velocity({translateX:[0,d]},{duration:300,queue:!1,easing:"easeOutQuad"}),n.velocity({opacity:1},{duration:50,queue:!1,easing:"easeOutQuad"}),a.css({width:"50%",right:"",left:0}),l=!0):(!l||r<-.3)&&(t("body").css({overflow:"",width:""}),o.velocity({translateX:[e.menuWidth+10,d]},{duration:200,queue:!1,easing:"easeOutQuad"}),n.velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){"function"==typeof e.onClose&&e.onClose.call(this,o),t(this).remove()}}),a.css({width:"10px",right:0,left:""}))}})),i.off("click.sidenav").on("click.sidenav",function(){if(!0===l)l=!1,s=!1,r();else{var i=t("body"),n=t('
        '),c=i.innerWidth();i.css("overflow","hidden"),i.width(c),t("body").append(a),"left"===e.edge?(a.css({width:"50%",right:0,left:""}),o.velocity({translateX:[0,-1*e.menuWidth]},{duration:300,queue:!1,easing:"easeOutQuad"})):(a.css({width:"50%",right:"",left:0}),o.velocity({translateX:[0,e.menuWidth]},{duration:300,queue:!1,easing:"easeOutQuad"})),n.css("opacity",0).click(function(){l=!1,s=!1,r(),n.velocity({opacity:0},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){t(this).remove()}})}),t("body").append(n),n.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){l=!0,s=!1}}),"function"==typeof e.onOpen&&e.onOpen.call(this,o)}return!1})})},destroy:function(){var e=t("#sidenav-overlay"),i=t('.drag-target[data-sidenav="'+t(this).attr("data-activates")+'"]');e.trigger("click"),i.remove(),t(this).off("click"),e.remove()},show:function(){this.trigger("click")},hide:function(){t("#sidenav-overlay").trigger("click")}};t.fn.sideNav=function(i){return e[i]?e[i].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof i&&i?void t.error("Method "+i+" does not exist on jQuery.sideNav"):e.init.apply(this,arguments)}}(jQuery),function(t){function e(e,i,n,o){var r=t();return t.each(a,function(t,a){if(a.height()>0){var s=a.offset().top,l=a.offset().left,c=l+a.width(),u=s+a.height();!(l>i||cn||u");n.html(s),e.is(":visible")?n.css("width",e.width()):n.css("width",t(window).width()/2),e.data("original-height")<=n.height()?e.css("height",n.height()):e.val().length0||t(i).is(":focus")||i.autofocus||void 0!==n.attr("placeholder")?n.siblings("label").addClass("active"):t(i)[0].validity?n.siblings("label").toggleClass("active",!0===t(i)[0].validity.badInput):n.siblings("label").removeClass("active")})};var i="input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea";t(document).on("change",i,function(){0===t(this).val().length&&void 0===t(this).attr("placeholder")||t(this).siblings("label").addClass("active"),validate_field(t(this))}),t(document).ready(function(){Materialize.updateTextFields()}),t(document).on("reset",function(e){var n=t(e.target);n.is("form")&&(n.find(i).removeClass("valid").removeClass("invalid"),n.find(i).each(function(){""===t(this).attr("value")&&t(this).siblings("label").removeClass("active")}),n.find("select.initialized").each(function(){var t=n.find("option[selected]").text();n.siblings("input.select-dropdown").val(t)}))}),t(document).on("focus",i,function(){t(this).siblings("label, .prefix").addClass("active")}),t(document).on("blur",i,function(){var e=t(this),i=".prefix";0===e.val().length&&!0!==e[0].validity.badInput&&void 0===e.attr("placeholder")&&(i+=", label"),e.siblings(i).removeClass("active"),validate_field(e)}),window.validate_field=function(t){var e=void 0!==t.attr("data-length"),i=parseInt(t.attr("data-length")),n=t.val().length;0!==t.val().length||!1!==t[0].validity.badInput||t.is(":required")?t.hasClass("validate")&&(t.is(":valid")&&e&&n<=i||t.is(":valid")&&!e?(t.removeClass("invalid"),t.addClass("valid")):(t.removeClass("valid"),t.addClass("invalid"))):t.hasClass("validate")&&(t.removeClass("valid"),t.removeClass("invalid"))};t(document).on("keyup.radio","input[type=radio], input[type=checkbox]",function(e){if(9===e.which)return t(this).addClass("tabbed"),void t(this).one("blur",function(e){t(this).removeClass("tabbed")})});var n=t(".hiddendiv").first();n.length||(n=t('
        '),t("body").append(n));t(".materialize-textarea").each(function(){var e=t(this);e.data("original-height",e.height()),e.data("previous-length",e.val().length)}),t("body").on("keyup keydown autoresize",".materialize-textarea",function(){e(t(this))}),t(document).on("change",'.file-field input[type="file"]',function(){for(var e=t(this).closest(".file-field").find("input.file-path"),i=t(this)[0].files,n=[],o=0;o
        ');t(this).after(e)});var r=function(t){var e=-7+parseInt(t.parent().css("padding-left"))+"px";t.velocity({height:"30px",width:"30px",top:"-30px",marginLeft:e},{duration:300,easing:"easeOutExpo"})},s=function(t){var e=t.width()-15,i=parseFloat(t.attr("max")),n=parseFloat(t.attr("min"));return(parseFloat(t.val())-n)/(i-n)*e};t(document).on("change",o,function(e){var i=t(this).siblings(".thumb");i.find(".value").html(t(this).val()),i.hasClass("active")||r(i);var n=s(t(this));i.addClass("active").css("left",n)}),t(document).on("mousedown touchstart",o,function(e){var i=t(this).siblings(".thumb");if(i.length<=0&&(i=t(''),t(this).after(i)),i.find(".value").html(t(this).val()),a=!0,t(this).addClass("active"),i.hasClass("active")||r(i),"input"!==e.type){var n=s(t(this));i.addClass("active").css("left",n)}}),t(document).on("mouseup touchend",".range-field",function(){a=!1,t(this).removeClass("active")}),t(document).on("input mousemove touchmove",".range-field",function(e){var i=t(this).children(".thumb"),n=t(this).find(o);if(a){i.hasClass("active")||r(i);var l=s(n);i.addClass("active").css("left",l),i.find(".value").html(i.siblings(o).val())}}),t(document).on("mouseout touchleave",".range-field",function(){if(!a){var e=t(this).children(".thumb"),i=7+parseInt(t(this).css("padding-left"))+"px";e.hasClass("active")&&e.velocity({height:"0",width:"0",top:"10px",marginLeft:i},{duration:100}),e.removeClass("active")}}),t.fn.autocomplete=function(e){var i={data:{},limit:1/0,onAutocomplete:null,minLength:1};return e=t.extend(i,e),this.each(function(){var i,n=t(this),o=e.data,a=0,r=-1,s=n.closest(".input-field");if(t.isEmptyObject(o))n.off("keyup.autocomplete focus.autocomplete");else{var l,c=t('');s.length?(l=s.children(".autocomplete-content.dropdown-content").first()).length||s.append(c):(l=n.next(".autocomplete-content.dropdown-content")).length||n.after(c),l.length&&(c=l);var u=function(t,e){var i=e.find("img"),n=e.text().toLowerCase().indexOf(""+t.toLowerCase()),o=n+t.length-1,a=e.text().slice(0,n),r=e.text().slice(n,o+1),s=e.text().slice(o+1);e.html(""+a+""+r+""+s+""),i.length&&e.prepend(i)},d=function(){r=-1,c.find(".active").removeClass("active")},p=function(){c.empty(),d(),i=void 0};n.off("blur.autocomplete").on("blur.autocomplete",function(){p()}),n.off("keyup.autocomplete focus.autocomplete").on("keyup.autocomplete focus.autocomplete",function(r){a=0;var s=n.val().toLowerCase();if(13!==r.which&&38!==r.which&&40!==r.which){if(i!==s&&(p(),s.length>=e.minLength))for(var l in o)if(o.hasOwnProperty(l)&&-1!==l.toLowerCase().indexOf(s)){if(a>=e.limit)break;var d=t("
      • ");o[l]?d.append(''+l+""):d.append(""+l+""),c.append(d),u(s,d),a++}i=s}}),n.off("keydown.autocomplete").on("keydown.autocomplete",function(t){var e,i=t.which,n=c.children("li").length,o=c.children(".active").first();13===i&&r>=0?(e=c.children("li").eq(r)).length&&(e.trigger("mousedown.autocomplete"),t.preventDefault()):38!==i&&40!==i||(t.preventDefault(),38===i&&r>0&&r--,40===i&&r=0&&c.children("li").eq(r).addClass("active"))}),c.off("mousedown.autocomplete touchstart.autocomplete").on("mousedown.autocomplete touchstart.autocomplete","li",function(){var i=t(this).text().trim();n.val(i),n.trigger("change"),p(),"function"==typeof e.onAutocomplete&&e.onAutocomplete.call(this,i)})}})}}),t.fn.material_select=function(e){function i(t,e,i){var o=t.indexOf(e),a=-1===o;return a?t.push(e):t.splice(o,1),i.siblings("ul.dropdown-content").find("li:not(.optgroup)").eq(e).toggleClass("active"),i.find("option").eq(e).prop("selected",a),n(t,i),a}function n(t,e){for(var i="",n=0,o=t.length;n
        ');s.addClass(n.attr("class")),n.is(":disabled")&&s.addClass("disabled");var l=t(''),c=n.children("option, optgroup"),u=[],d=!1,p=n.find("option:selected").html()||n.find("option:first").html()||"",h=function(e,i,n){var a=i.is(":disabled")?"disabled ":"",r="optgroup-option"===n?"optgroup-option ":"",s=o?'":"",c=i.data("icon"),u=i.attr("class");if(c){var d="";return u&&(d=' class="'+u+'"'),l.append(t('
      • "+s+i.html()+"
      • ")),!0}l.append(t('
      • '+s+i.html()+"
      • "))};c.length&&c.each(function(){if(t(this).is("option"))o?h(0,t(this),"multiple"):h(0,t(this));else if(t(this).is("optgroup")){var e=t(this).children("option");l.append(t('
      • '+t(this).attr("label")+"
      • ")),e.each(function(){h(0,t(this),"optgroup-option")})}}),l.find("li:not(.optgroup)").each(function(a){t(this).click(function(r){if(!t(this).hasClass("disabled")&&!t(this).hasClass("optgroup")){var s=!0;o?(t('input[type="checkbox"]',this).prop("checked",function(t,e){return!e}),s=i(u,a,n),m.trigger("focus")):(l.find("li").removeClass("active"),t(this).toggleClass("active"),m.val(t(this).text())),g(l,t(this)),n.find("option").eq(a).prop("selected",s),n.trigger("change"),void 0!==e&&e()}r.stopPropagation()})}),n.wrap(s);var f=t(''),v=p.replace(/"/g,"""),m=t('');n.before(m),m.before(f),m.after(l),n.is(":disabled")||m.dropdown({hover:!1}),n.attr("tabindex")&&t(m[0]).attr("tabindex",n.attr("tabindex")),n.addClass("initialized"),m.on({focus:function(){if(t("ul.select-dropdown").not(l[0]).is(":visible")&&(t("input.select-dropdown").trigger("close"),t(window).off("click.select")),!l.is(":visible")){t(this).trigger("open",["focus"]);var e=t(this).val();o&&e.indexOf(",")>=0&&(e=e.split(",")[0]);var i=l.find("li").filter(function(){return t(this).text().toLowerCase()===e.toLowerCase()})[0];g(l,i,!0),t(window).off("click.select").on("click.select",function(){o&&(d||m.trigger("close")),t(window).off("click.select")})}},click:function(t){t.stopPropagation()}}),m.on("blur",function(){o||(t(this).trigger("close"),t(window).off("click.select")),l.find("li.selected").removeClass("selected")}),l.hover(function(){d=!0},function(){d=!1}),o&&n.find("option:selected:not(:disabled)").each(function(){var t=this.index;i(u,t,n),l.find("li:not(.optgroup)").eq(t).find(":checkbox").prop("checked",!0)});var g=function(e,i,n){if(i){e.find("li.selected").removeClass("selected");var a=t(i);a.addClass("selected"),o&&!n||l.scrollTo(a)}},y=[];m.on("keydown",function(e){if(9!=e.which)if(40!=e.which||l.is(":visible")){if(13!=e.which||l.is(":visible")){e.preventDefault();var i=String.fromCharCode(e.which).toLowerCase(),n=[9,13,27,38,40];if(i&&-1===n.indexOf(e.which)){y.push(i);var a=y.join(""),r=l.find("li").filter(function(){return 0===t(this).text().toLowerCase().indexOf(a)})[0];r&&g(l,r)}if(13==e.which){var s=l.find("li.selected:not(.disabled)")[0];s&&(t(s).trigger("click"),o||m.trigger("close"))}40==e.which&&(r=l.find("li.selected").length?l.find("li.selected").next("li:not(.disabled)")[0]:l.find("li:not(.disabled)")[0],g(l,r)),27==e.which&&m.trigger("close"),38==e.which&&(r=l.find("li.selected").prev("li:not(.disabled)")[0])&&g(l,r),setTimeout(function(){y=[]},1e3)}}else m.trigger("open");else m.trigger("close")})}})}}(jQuery),function(t){var e={init:function(e){var i={indicators:!0,height:400,transition:500,interval:6e3};return e=t.extend(i,e),this.each(function(){function i(t,e){t.hasClass("center-align")?t.velocity({opacity:0,translateY:-100},{duration:e,queue:!1}):t.hasClass("right-align")?t.velocity({opacity:0,translateX:100},{duration:e,queue:!1}):t.hasClass("left-align")&&t.velocity({opacity:0,translateX:-100},{duration:e,queue:!1})}function n(t){t>=c.length?t=0:t<0&&(t=c.length-1),(u=l.find(".active").index())!=t&&(o=c.eq(u),$caption=o.find(".caption"),o.removeClass("active"),o.velocity({opacity:0},{duration:e.transition,queue:!1,easing:"easeOutQuad",complete:function(){c.not(".active").velocity({opacity:0,translateX:0,translateY:0},{duration:0,queue:!1})}}),i($caption,e.transition),e.indicators&&a.eq(u).removeClass("active"),c.eq(t).velocity({opacity:1},{duration:e.transition,queue:!1,easing:"easeOutQuad"}),c.eq(t).find(".caption").velocity({opacity:1,translateX:0,translateY:0},{duration:e.transition,delay:e.transition,queue:!1,easing:"easeOutQuad"}),c.eq(t).addClass("active"),e.indicators&&a.eq(t).addClass("active"))}var o,a,r,s=t(this),l=s.find("ul.slides").first(),c=l.find("> li"),u=l.find(".active").index();-1!=u&&(o=c.eq(u)),s.hasClass("fullscreen")||(e.indicators?s.height(e.height+40):s.height(e.height),l.height(e.height)),c.find(".caption").each(function(){i(t(this),0)}),c.find("img").each(function(){var e="data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==";t(this).attr("src")!==e&&(t(this).css("background-image",'url("'+t(this).attr("src")+'")'),t(this).attr("src",e))}),e.indicators&&(a=t('
          '),c.each(function(i){var o=t('
        • ');o.click(function(){n(l.parent().find(t(this)).index()),clearInterval(r),r=setInterval(function(){u=l.find(".active").index(),c.length==u+1?u=0:u+=1,n(u)},e.transition+e.interval)}),a.append(o)}),s.append(a),a=s.find("ul.indicators").find("li.indicator-item")),o?o.show():(c.first().addClass("active").velocity({opacity:1},{duration:e.transition,queue:!1,easing:"easeOutQuad"}),u=0,o=c.eq(u),e.indicators&&a.eq(u).addClass("active")),o.find("img").each(function(){o.find(".caption").velocity({opacity:1,translateX:0,translateY:0},{duration:e.transition,queue:!1,easing:"easeOutQuad"})}),r=setInterval(function(){n((u=l.find(".active").index())+1)},e.transition+e.interval);var d=!1,p=!1,h=!1;s.hammer({prevent_default:!1}).on("pan",function(t){if("touch"===t.gesture.pointerType){clearInterval(r);var e=t.gesture.direction,i=t.gesture.deltaX,n=t.gesture.velocityX,o=t.gesture.velocityY;$curr_slide=l.find(".active"),Math.abs(n)>Math.abs(o)&&$curr_slide.velocity({translateX:i},{duration:50,queue:!1,easing:"easeOutQuad"}),4===e&&(i>s.innerWidth()/2||n<-.65)?h=!0:2===e&&(i<-1*s.innerWidth()/2||n>.65)&&(p=!0);var a;p&&(0===(a=$curr_slide.next()).length&&(a=c.first()),a.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad"})),h&&(0===(a=$curr_slide.prev()).length&&(a=c.last()),a.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad"}))}}).on("panend",function(t){"touch"===t.gesture.pointerType&&($curr_slide=l.find(".active"),d=!1,curr_index=l.find(".active").index(),!h&&!p||c.length<=1?$curr_slide.velocity({translateX:0},{duration:300,queue:!1,easing:"easeOutQuad"}):p?(n(curr_index+1),$curr_slide.velocity({translateX:-1*s.innerWidth()},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){$curr_slide.velocity({opacity:0,translateX:0},{duration:0,queue:!1})}})):h&&(n(curr_index-1),$curr_slide.velocity({translateX:s.innerWidth()},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){$curr_slide.velocity({opacity:0,translateX:0},{duration:0,queue:!1})}})),p=!1,h=!1,clearInterval(r),r=setInterval(function(){u=l.find(".active").index(),c.length==u+1?u=0:u+=1,n(u)},e.transition+e.interval))}),s.on("sliderPause",function(){clearInterval(r)}),s.on("sliderStart",function(){clearInterval(r),r=setInterval(function(){u=l.find(".active").index(),c.length==u+1?u=0:u+=1,n(u)},e.transition+e.interval)}),s.on("sliderNext",function(){n((u=l.find(".active").index())+1)}),s.on("sliderPrev",function(){n((u=l.find(".active").index())-1)})})},pause:function(){t(this).trigger("sliderPause")},start:function(){t(this).trigger("sliderStart")},next:function(){t(this).trigger("sliderNext")},prev:function(){t(this).trigger("sliderPrev")}};t.fn.slider=function(i){return e[i]?e[i].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof i&&i?void t.error("Method "+i+" does not exist on jQuery.tooltip"):e.init.apply(this,arguments)}}(jQuery),function(t){t(document).ready(function(){t(document).on("click.card",".card",function(e){if(t(this).find("> .card-reveal").length){var i=t(e.target).closest(".card");void 0===i.data("initialOverflow")&&i.data("initialOverflow",void 0===i.css("overflow")?"":i.css("overflow")),t(e.target).is(t(".card-reveal .card-title"))||t(e.target).is(t(".card-reveal .card-title i"))?t(this).find(".card-reveal").velocity({translateY:0},{duration:225,queue:!1,easing:"easeInOutQuad",complete:function(){t(this).css({display:"none"}),i.css("overflow",i.data("initialOverflow"))}}):(t(e.target).is(t(".card .activator"))||t(e.target).is(t(".card .activator i")))&&(i.css("overflow","hidden"),t(this).find(".card-reveal").css({display:"block"}).velocity("stop",!1).velocity({translateY:"-100%"},{duration:300,queue:!1,easing:"easeInOutQuad"}))}})})}(jQuery),function(t){var e={data:[],placeholder:"",secondaryPlaceholder:"",autocompleteOptions:{}};t(document).ready(function(){t(document).on("click",".chip .close",function(e){t(this).closest(".chips").attr("data-initialized")||t(this).closest(".chip").remove()})}),t.fn.material_chip=function(i){var n=this;if(this.$el=t(this),this.$document=t(document),this.SELS={CHIPS:".chips",CHIP:".chip",INPUT:"input",DELETE:".material-icons",SELECTED_CHIP:".selected"},"data"===i)return this.$el.data("chips");var o=t.extend({},e,i);n.hasAutocomplete=!t.isEmptyObject(o.autocompleteOptions.data),this.init=function(){var e=0;n.$el.each(function(){var i=t(this),a=Materialize.guid();n.chipId=a,o.data&&o.data instanceof Array||(o.data=[]),i.data("chips",o.data),i.attr("data-index",e),i.attr("data-initialized",!0),i.hasClass(n.SELS.CHIPS)||i.addClass("chips"),n.chips(i,a),e++})},this.handleEvents=function(){var e=n.SELS;n.$document.off("click.chips-focus",e.CHIPS).on("click.chips-focus",e.CHIPS,function(i){t(i.target).find(e.INPUT).focus()}),n.$document.off("click.chips-select",e.CHIP).on("click.chips-select",e.CHIP,function(i){var o=t(i.target);if(o.length){var a=o.hasClass("selected"),r=o.closest(e.CHIPS);t(e.CHIP).removeClass("selected"),a||n.selectChip(o.index(),r)}}),n.$document.off("keydown.chips").on("keydown.chips",function(i){if(!t(i.target).is("input, textarea")){var o,a=n.$document.find(e.CHIP+e.SELECTED_CHIP),r=a.closest(e.CHIPS),s=a.siblings(e.CHIP).length;if(a.length)if(8===i.which||46===i.which){i.preventDefault(),o=a.index(),n.deleteChip(o,r);var l=null;o+1s)return void r.find("input").focus();n.selectChip(o,r)}}}),n.$document.off("focusin.chips",e.CHIPS+" "+e.INPUT).on("focusin.chips",e.CHIPS+" "+e.INPUT,function(i){var n=t(i.target).closest(e.CHIPS);n.addClass("focus"),n.siblings("label, .prefix").addClass("active"),t(e.CHIP).removeClass("selected")}),n.$document.off("focusout.chips",e.CHIPS+" "+e.INPUT).on("focusout.chips",e.CHIPS+" "+e.INPUT,function(i){var n=t(i.target).closest(e.CHIPS);n.removeClass("focus"),void 0!==n.data("chips")&&n.data("chips").length||n.siblings("label").removeClass("active"),n.siblings(".prefix").removeClass("active")}),n.$document.off("keydown.chips-add",e.CHIPS+" "+e.INPUT).on("keydown.chips-add",e.CHIPS+" "+e.INPUT,function(i){var o=t(i.target),a=o.closest(e.CHIPS),r=a.children(e.CHIP).length;if(13===i.which){if(n.hasAutocomplete&&a.find(".autocomplete-content.dropdown-content").length&&a.find(".autocomplete-content.dropdown-content").children().length)return;return i.preventDefault(),n.addChip({tag:o.val()},a),void o.val("")}if((8===i.keyCode||37===i.keyCode)&&""===o.val()&&r)return i.preventDefault(),n.selectChip(r-1,a),void o.blur()}),n.$document.off("click.chips-delete",e.CHIPS+" "+e.DELETE).on("click.chips-delete",e.CHIPS+" "+e.DELETE,function(i){var o=t(i.target),a=o.closest(e.CHIPS),r=o.closest(e.CHIP);i.stopPropagation(),n.deleteChip(r.index(),a),a.find("input").focus()})},this.chips=function(e,i){e.empty(),e.data("chips").forEach(function(t){e.append(n.renderChip(t))}),e.append(t('')),n.setPlaceholder(e);var a=e.next("label");a.length&&(a.attr("for",i),void 0!==e.data("chips")&&e.data("chips").length&&a.addClass("active"));var r=t("#"+i);n.hasAutocomplete&&(o.autocompleteOptions.onAutocomplete=function(t){n.addChip({tag:t},e),r.val(""),r.focus()},r.autocomplete(o.autocompleteOptions))},this.renderChip=function(e){if(e.tag){var i=t('
          ');return i.text(e.tag),e.image&&i.prepend(t("").attr("src",e.image)),i.append(t('close')),i}},this.setPlaceholder=function(t){void 0!==t.data("chips")&&!t.data("chips").length&&o.placeholder?t.find("input").prop("placeholder",o.placeholder):(void 0===t.data("chips")||t.data("chips").length)&&o.secondaryPlaceholder&&t.find("input").prop("placeholder",o.secondaryPlaceholder)},this.isValid=function(t,e){for(var i=t.data("chips"),n=!1,o=0;o=o&&!t(this).hasClass("pinned")&&(i(t(this)),t(this).css("top",e.offset),t(this).addClass("pinned")),oe.bottom&&!t(this).hasClass("pin-bottom")&&(i(t(this)),t(this).addClass("pin-bottom"),t(this).css("top",e.bottom-r))})}var o=Materialize.guid(),a=t(this),r=t(this).offset().top;t(this).data("pushpin-id",o),n(a,t(window).scrollTop()),t(window).on("scroll."+o,function(){var i=t(window).scrollTop()+e.offset;n(a,i)})}))}}(jQuery),function(t){t(document).ready(function(){t.fn.reverse=[].reverse,t(document).on("mouseenter.fixedActionBtn",".fixed-action-btn:not(.click-to-toggle):not(.toolbar)",function(i){var n=t(this);e(n)}),t(document).on("mouseleave.fixedActionBtn",".fixed-action-btn:not(.click-to-toggle):not(.toolbar)",function(e){var n=t(this);i(n)}),t(document).on("click.fabClickToggle",".fixed-action-btn.click-to-toggle > a",function(n){var o=t(this).parent();o.hasClass("active")?i(o):e(o)}),t(document).on("click.fabToolbar",".fixed-action-btn.toolbar > a",function(e){var i=t(this).parent();n(i)})}),t.fn.extend({openFAB:function(){e(t(this))},closeFAB:function(){i(t(this))},openToolbar:function(){n(t(this))},closeToolbar:function(){o(t(this))}});var e=function(e){var i=e;if(!1===i.hasClass("active")){var n,o;!0===i.hasClass("horizontal")?o=40:n=40,i.addClass("active"),i.find("ul .btn-floating").velocity({scaleY:".4",scaleX:".4",translateY:n+"px",translateX:o+"px"},{duration:0});var a=0;i.find("ul .btn-floating").reverse().each(function(){t(this).velocity({opacity:"1",scaleX:"1",scaleY:"1",translateY:"0",translateX:"0"},{duration:80,delay:a}),a+=40})}},i=function(t){var e,i,n=t;!0===n.hasClass("horizontal")?i=40:e=40,n.removeClass("active");n.find("ul .btn-floating").velocity("stop",!0),n.find("ul .btn-floating").velocity({opacity:"0",scaleX:".4",scaleY:".4",translateY:e+"px",translateX:i+"px"},{duration:80})},n=function(e){if("true"!==e.attr("data-open")){var i,n,a,r=window.innerWidth,s=window.innerHeight,l=e[0].getBoundingClientRect(),c=e.find("> a").first(),u=e.find("> ul").first(),d=t('
          '),p=c.css("background-color");c.append(d),i=l.left-r/2+l.width/2,n=s-l.bottom,a=r/d.width(),e.attr("data-origin-bottom",l.bottom),e.attr("data-origin-left",l.left),e.attr("data-origin-width",l.width),e.addClass("active"),e.attr("data-open",!0),e.css({"text-align":"center",width:"100%",bottom:0,left:0,transform:"translateX("+i+"px)",transition:"none"}),c.css({transform:"translateY("+-n+"px)",transition:"none"}),d.css({"background-color":p}),setTimeout(function(){e.css({transform:"",transition:"transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s"}),c.css({overflow:"visible",transform:"",transition:"transform .2s"}),setTimeout(function(){e.css({overflow:"hidden","background-color":p}),d.css({transform:"scale("+a+")",transition:"transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)"}),u.find("> li > a").css({opacity:1}),t(window).on("scroll.fabToolbarClose",function(){o(e),t(window).off("scroll.fabToolbarClose"),t(document).off("click.fabToolbarClose")}),t(document).on("click.fabToolbarClose",function(i){t(i.target).closest(u).length||(o(e),t(window).off("scroll.fabToolbarClose"),t(document).off("click.fabToolbarClose"))})},100)},0)}},o=function(t){if("true"===t.attr("data-open")){var e,i,n=window.innerWidth,o=window.innerHeight,a=t.attr("data-origin-width"),r=t.attr("data-origin-bottom"),s=t.attr("data-origin-left"),l=t.find("> .btn-floating").first(),c=t.find("> ul").first(),u=t.find(".fab-backdrop"),d=l.css("background-color");e=s-n/2+a/2,i=o-r,n/u.width(),t.removeClass("active"),t.attr("data-open",!1),t.css({"background-color":"transparent",transition:"none"}),l.css({transition:"none"}),u.css({transform:"scale(0)","background-color":d}),c.find("> li > a").css({opacity:""}),setTimeout(function(){u.remove(),t.css({"text-align":"",width:"",bottom:"",left:"",overflow:"","background-color":"",transform:"translate3d("+-e+"px,0,0)"}),l.css({overflow:"",transform:"translate3d(0,"+i+"px,0)"}),setTimeout(function(){t.css({transform:"translate3d(0,0,0)",transition:"transform .2s"}),l.css({transform:"translate3d(0,0,0)",transition:"transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)"})},20)},200)}}}(jQuery),function(t){Materialize.fadeInImage=function(e){var i;if("string"==typeof e)i=t(e);else{if("object"!=typeof e)return;i=e}i.css({opacity:0}),t(i).velocity({opacity:1},{duration:650,queue:!1,easing:"easeOutSine"}),t(i).velocity({opacity:1},{duration:1300,queue:!1,easing:"swing",step:function(e,i){i.start=100;var n=e/100,o=150-(100-e)/1.75;o<100&&(o=100),e>=0&&t(this).css({"-webkit-filter":"grayscale("+n+")brightness("+o+"%)",filter:"grayscale("+n+")brightness("+o+"%)"})}})},Materialize.showStaggeredList=function(e){var i;if("string"==typeof e)i=t(e);else{if("object"!=typeof e)return;i=e}var n=0;i.find("li").velocity({translateX:"-100px"},{duration:0}),i.find("li").each(function(){t(this).velocity({opacity:"1",translateX:"0"},{duration:800,delay:n,easing:[60,10]}),n+=120})},t(document).ready(function(){var e=!1,i=!1;t(".dismissable").each(function(){t(this).hammer({prevent_default:!1}).on("pan",function(n){if("touch"===n.gesture.pointerType){var o=t(this),a=n.gesture.direction,r=n.gesture.deltaX,s=n.gesture.velocityX;o.velocity({translateX:r},{duration:50,queue:!1,easing:"easeOutQuad"}),4===a&&(r>o.innerWidth()/2||s<-.75)&&(e=!0),2===a&&(r<-1*o.innerWidth()/2||s>.75)&&(i=!0)}}).on("panend",function(n){if(Math.abs(n.gesture.deltaX)s.getBoundingClientRect().top+window.pageYOffset+a&&!0!==n.done&&("function"==typeof r?r.call(this,s):"string"==typeof r&&new Function(r)(s),n.done=!0)}},n=Materialize.throttle(function(){i()},t.throttle||100);e||(window.addEventListener("scroll",n),window.addEventListener("resize",n),e=!0),setTimeout(n,0)}}(jQuery),function(t){Materialize.Picker=t(jQuery)}(function(t){function e(a,s,u,d){function p(){return e._.node("div",e._.node("div",e._.node("div",e._.node("div",T.component.nodes(b.open),k.box),k.wrap),k.frame),k.holder)}function h(){x.data(s,T).addClass(k.input).attr("tabindex",-1).val(x.data("value")?T.get("select",w.format):a.value),w.editable||x.on("focus."+b.id+" click."+b.id,function(t){t.preventDefault(),T.$root.eq(0).focus()}).on("keydown."+b.id,m),o(a,{haspopup:!0,expanded:!1,readonly:!1,owns:a.id+"_root"})}function f(){T.$root.on({keydown:m,focusin:function(t){T.$root.removeClass(k.focused),t.stopPropagation()},"mousedown click":function(e){var i=e.target;i!=T.$root.children()[0]&&(e.stopPropagation(),"mousedown"!=e.type||t(i).is("input, select, textarea, button, option")||(e.preventDefault(),T.$root.eq(0).focus()))}}).on({focus:function(){x.addClass(k.target)},blur:function(){x.removeClass(k.target)}}).on("focus.toOpen",g).on("click","[data-pick], [data-nav], [data-clear], [data-close]",function(){var e=t(this),i=e.data(),n=e.hasClass(k.navDisabled)||e.hasClass(k.disabled),o=r();o=o&&(o.type||o.href)&&o,(n||o&&!t.contains(T.$root[0],o))&&T.$root.eq(0).focus(),!n&&i.nav?T.set("highlight",T.component.item.highlight,{nav:i.nav}):!n&&"pick"in i?(T.set("select",i.pick),w.closeOnSelect&&T.close(!0)):i.clear?(T.clear(),w.closeOnSelect&&T.close(!0)):i.close&&T.close(!0)}),o(T.$root[0],"hidden",!0)}function v(){var e;!0===w.hiddenName?(e=a.name,a.name=""):e=(e=["string"==typeof w.hiddenPrefix?w.hiddenPrefix:"","string"==typeof w.hiddenSuffix?w.hiddenSuffix:"_submit"])[0]+a.name+e[1],T._hidden=t('")[0],x.on("change."+b.id,function(){T._hidden.value=a.value?T.get("select",w.formatSubmit):""}),w.container?t(w.container).append(T._hidden):x.before(T._hidden)}function m(t){var e=t.keyCode,i=/^(8|46)$/.test(e);if(27==e)return T.close(),!1;(32==e||i||!b.open&&T.component.key[e])&&(t.preventDefault(),t.stopPropagation(),i?T.clear().close():T.open())}function g(t){t.stopPropagation(),"focus"==t.type&&T.$root.addClass(k.focused),T.open()}if(!a)return e;var y=!1,b={id:a.id||"P"+Math.abs(~~(Math.random()*new Date))},w=u?t.extend(!0,{},u.defaults,d):d||{},k=t.extend({},e.klasses(),w.klass),x=t(a),C=function(){return this.start()},T=C.prototype={constructor:C,$node:x,start:function(){return b&&b.start?T:(b.methods={},b.start=!0,b.open=!1,b.type=a.type,a.autofocus=a==r(),a.readOnly=!w.editable,a.id=a.id||b.id,"text"!=a.type&&(a.type="text"),T.component=new u(T,w),T.$root=t(e._.node("div",p(),k.picker,'id="'+a.id+'_root" tabindex="0"')),f(),w.formatSubmit&&v(),h(),w.container?t(w.container).append(T.$root):x.before(T.$root),T.on({start:T.component.onStart,render:T.component.onRender,stop:T.component.onStop,open:T.component.onOpen,close:T.component.onClose,set:T.component.onSet}).on({start:w.onStart,render:w.onRender,stop:w.onStop,open:w.onOpen,close:w.onClose,set:w.onSet}),y=i(T.$root.children()[0]),a.autofocus&&T.open(),T.trigger("start").trigger("render"))},render:function(t){return t?T.$root.html(p()):T.$root.find("."+k.box).html(T.component.nodes(b.open)),T.trigger("render")},stop:function(){return b.start?(T.close(),T._hidden&&T._hidden.parentNode.removeChild(T._hidden),T.$root.remove(),x.removeClass(k.input).removeData(s),setTimeout(function(){x.off("."+b.id)},0),a.type=b.type,a.readOnly=!1,T.trigger("stop"),b.methods={},b.start=!1,T):T},open:function(i){return b.open?T:(x.addClass(k.active),o(a,"expanded",!0),setTimeout(function(){T.$root.addClass(k.opened),o(T.$root[0],"hidden",!1)},0),!1!==i&&(b.open=!0,y&&c.css("overflow","hidden").css("padding-right","+="+n()),T.$root.eq(0).focus(),l.on("click."+b.id+" focusin."+b.id,function(t){var e=t.target;e!=a&&e!=document&&3!=t.which&&T.close(e===T.$root.children()[0])}).on("keydown."+b.id,function(i){var n=i.keyCode,o=T.component.key[n],a=i.target;27==n?T.close(!0):a!=T.$root[0]||!o&&13!=n?t.contains(T.$root[0],a)&&13==n&&(i.preventDefault(),a.click()):(i.preventDefault(),o?e._.trigger(T.component.key.go,T,[e._.trigger(o)]):T.$root.find("."+k.highlighted).hasClass(k.disabled)||(T.set("select",T.component.item.highlight),w.closeOnSelect&&T.close(!0)))})),T.trigger("open"))},close:function(t){return t&&(T.$root.off("focus.toOpen").eq(0).focus(),setTimeout(function(){T.$root.on("focus.toOpen",g)},0)),x.removeClass(k.active),o(a,"expanded",!1),setTimeout(function(){T.$root.removeClass(k.opened+" "+k.focused),o(T.$root[0],"hidden",!0)},0),b.open?(b.open=!1,y&&c.css("overflow","").css("padding-right","-="+n()),l.off("."+b.id),T.trigger("close")):T},clear:function(t){return T.set("clear",null,t)},set:function(e,i,n){var o,a,r=t.isPlainObject(e),s=r?e:{};if(n=r&&t.isPlainObject(i)?i:n||{},e){r||(s[e]=i);for(o in s)a=s[o],o in T.component.item&&(void 0===a&&(a=null),T.component.set(o,a,n)),"select"!=o&&"clear"!=o||x.val("clear"==o?"":T.get(o,w.format)).trigger("change");T.render()}return n.muted?T:T.trigger("set",s)},get:function(t,i){if(t=t||"value",null!=b[t])return b[t];if("valueSubmit"==t){if(T._hidden)return T._hidden.value;t="value"}if("value"==t)return a.value;if(t in T.component.item){if("string"==typeof i){var n=T.component.get(t);return n?e._.trigger(T.component.formats.toString,T.component,[i,n]):""}return T.component.get(t)}},on:function(e,i,n){var o,a,r=t.isPlainObject(e),s=r?e:{};if(e){r||(s[e]=i);for(o in s)a=s[o],n&&(o="_"+o),b.methods[o]=b.methods[o]||[],b.methods[o].push(a)}return T},off:function(){var t,e,i=arguments;for(t=0,namesCount=i.length;t').appendTo("body"),i=e[0].offsetWidth;e.css("overflow","scroll");var n=t('
          ').appendTo(e)[0].offsetWidth;return e.remove(),i-n}function o(e,i,n){if(t.isPlainObject(i))for(var o in i)a(e,o,i[o]);else a(e,i,n)}function a(t,e,i){t.setAttribute(("role"==e?"":"aria-")+e,i)}function r(){try{return document.activeElement}catch(t){}}var s=t(window),l=t(document),c=t(document.documentElement);return e.klasses=function(t){return t=t||"picker",{picker:t,opened:t+"--opened",focused:t+"--focused",input:t+"__input",active:t+"__input--active",target:t+"__input--target",holder:t+"__holder",frame:t+"__frame",wrap:t+"__wrap",box:t+"__box"}},e._={group:function(t){for(var i,n="",o=e._.trigger(t.min,t);o<=e._.trigger(t.max,t,[o]);o+=t.i)i=e._.trigger(t.item,t,[o]),n+=e._.node(t.node,i[0],i[1],i[2]);return n},node:function(e,i,n,o){return i?(i=t.isArray(i)?i.join(""):i,n=n?' class="'+n+'"':"",o=o?" "+o:"","<"+e+n+o+">"+i+""):""},lead:function(t){return(t<10?"0":"")+t},trigger:function(t,e,i){return"function"==typeof t?t.apply(e,i||[]):t},digits:function(t){return/\d/.test(t[1])?2:1},isDate:function(t){return{}.toString.call(t).indexOf("Date")>-1&&this.isInteger(t.getDate())},isInteger:function(t){return{}.toString.call(t).indexOf("Number")>-1&&t%1==0},ariaAttr:function(e,i){t.isPlainObject(e)||(e={attribute:i}),i="";for(var n in e){var o=("role"==n?"":"aria-")+n;i+=null==e[n]?"":o+'="'+e[n]+'"'}return i}},e.extend=function(i,n){t.fn[i]=function(o,a){var r=this.data(i);return"picker"==o?r:r&&"string"==typeof o?e._.trigger(r[o],r,[a]):this.each(function(){t(this).data(i)||new e(this,i,n,o)})},t.fn[i].defaults=n.defaults},e}),function(t){t(Materialize.Picker,jQuery)}(function(t,e){function i(t,e){var i=this,n=t.$node[0],o=n.value,a=t.$node.data("value"),r=a||o,s=a?e.formatSubmit:e.format,l=function(){return n.currentStyle?"rtl"==n.currentStyle.direction:"rtl"==getComputedStyle(t.$root[0]).direction};i.settings=e,i.$node=t.$node,i.queue={min:"measure create",max:"measure create",now:"now create",select:"parse create validate",highlight:"parse navigate create validate",view:"parse create validate viewset",disable:"deactivate",enable:"activate"},i.item={},i.item.clear=null,i.item.disable=(e.disable||[]).slice(0),i.item.enable=-function(t){return!0===t[0]?t.shift():-1}(i.item.disable),i.set("min",e.min).set("max",e.max).set("now"),r?i.set("select",r,{format:s}):i.set("select",null).set("highlight",i.item.now),i.key={40:7,38:-7,39:function(){return l()?-1:1},37:function(){return l()?1:-1},go:function(t){var e=i.item.highlight,n=new Date(e.year,e.month,e.date+t);i.set("highlight",n,{interval:t}),this.render()}},t.on("render",function(){t.$root.find("."+e.klass.selectMonth).on("change",function(){var i=this.value;i&&(t.set("highlight",[t.get("view").year,i,t.get("highlight").date]),t.$root.find("."+e.klass.selectMonth).trigger("focus"))}),t.$root.find("."+e.klass.selectYear).on("change",function(){var i=this.value;i&&(t.set("highlight",[i,t.get("view").month,t.get("highlight").date]),t.$root.find("."+e.klass.selectYear).trigger("focus"))})},1).on("open",function(){var n="";i.disabled(i.get("now"))&&(n=":not(."+e.klass.buttonToday+")"),t.$root.find("button"+n+", select").attr("disabled",!1)},1).on("close",function(){t.$root.find("button, select").attr("disabled",!0)},1)}var n=t._;i.prototype.set=function(t,e,i){var n=this,o=n.item;return null===e?("clear"==t&&(t="select"),o[t]=e,n):(o["enable"==t?"disable":"flip"==t?"enable":t]=n.queue[t].split(" ").map(function(o){return e=n[o](t,e,i)}).pop(),"select"==t?n.set("highlight",o.select,i):"highlight"==t?n.set("view",o.highlight,i):t.match(/^(flip|min|max|disable|enable)$/)&&(o.select&&n.disabled(o.select)&&n.set("select",o.select,i),o.highlight&&n.disabled(o.highlight)&&n.set("highlight",o.highlight,i)),n)},i.prototype.get=function(t){return this.item[t]},i.prototype.create=function(t,i,o){var a,r=this;return i=void 0===i?t:i,i==-1/0||i==1/0?a=i:e.isPlainObject(i)&&n.isInteger(i.pick)?i=i.obj:e.isArray(i)?(i=new Date(i[0],i[1],i[2]),i=n.isDate(i)?i:r.create().obj):i=n.isInteger(i)||n.isDate(i)?r.normalize(new Date(i),o):r.now(t,i,o),{year:a||i.getFullYear(),month:a||i.getMonth(),date:a||i.getDate(),day:a||i.getDay(),obj:a||i,pick:a||i.getTime()}},i.prototype.createRange=function(t,i){var o=this,a=function(t){return!0===t||e.isArray(t)||n.isDate(t)?o.create(t):t};return n.isInteger(t)||(t=a(t)),n.isInteger(i)||(i=a(i)),n.isInteger(t)&&e.isPlainObject(i)?t=[i.year,i.month,i.date+t]:n.isInteger(i)&&e.isPlainObject(t)&&(i=[t.year,t.month,t.date+i]),{from:a(t),to:a(i)}},i.prototype.withinRange=function(t,e){return t=this.createRange(t.from,t.to),e.pick>=t.from.pick&&e.pick<=t.to.pick},i.prototype.overlapRanges=function(t,e){var i=this;return t=i.createRange(t.from,t.to),e=i.createRange(e.from,e.to),i.withinRange(t,e.from)||i.withinRange(t,e.to)||i.withinRange(e,t.from)||i.withinRange(e,t.to)},i.prototype.now=function(t,e,i){return e=new Date,i&&i.rel&&e.setDate(e.getDate()+i.rel),this.normalize(e,i)},i.prototype.navigate=function(t,i,n){var o,a,r,s,l=e.isArray(i),c=e.isPlainObject(i),u=this.item.view;if(l||c){for(c?(a=i.year,r=i.month,s=i.date):(a=+i[0],r=+i[1],s=+i[2]),n&&n.nav&&u&&u.month!==r&&(a=u.year,r=u.month),a=(o=new Date(a,r+(n&&n.nav?n.nav:0),1)).getFullYear(),r=o.getMonth();new Date(a,r,s).getMonth()!==r;)s-=1;i=[a,r,s]}return i},i.prototype.normalize=function(t){return t.setHours(0,0,0,0),t},i.prototype.measure=function(t,e){var i=this;return e?"string"==typeof e?e=i.parse(t,e):n.isInteger(e)&&(e=i.now(t,e,{rel:e})):e="min"==t?-1/0:1/0,e},i.prototype.viewset=function(t,e){return this.create([e.year,e.month,1])},i.prototype.validate=function(t,i,o){var a,r,s,l,c=this,u=i,d=o&&o.interval?o.interval:1,p=-1===c.item.enable,h=c.item.min,f=c.item.max,v=p&&c.item.disable.filter(function(t){if(e.isArray(t)){var o=c.create(t).pick;oi.pick&&(r=!0)}return n.isInteger(t)}).length;if((!o||!o.nav)&&(!p&&c.disabled(i)||p&&c.disabled(i)&&(v||a||r)||!p&&(i.pick<=h.pick||i.pick>=f.pick)))for(p&&!v&&(!r&&d>0||!a&&d<0)&&(d*=-1);c.disabled(i)&&(Math.abs(d)>1&&(i.monthu.month)&&(i=u,d=d>0?1:-1),i.pick<=h.pick?(s=!0,d=1,i=c.create([h.year,h.month,h.date+(i.pick===h.pick?0:-1)])):i.pick>=f.pick&&(l=!0,d=-1,i=c.create([f.year,f.month,f.date+(i.pick===f.pick?0:1)])),!s||!l);)i=c.create([i.year,i.month,i.date+d]);return i},i.prototype.disabled=function(t){var i=this,o=i.item.disable.filter(function(o){return n.isInteger(o)?t.day===(i.settings.firstDay?o:o-1)%7:e.isArray(o)||n.isDate(o)?t.pick===i.create(o).pick:e.isPlainObject(o)?i.withinRange(o,t):void 0});return o=o.length&&!o.filter(function(t){return e.isArray(t)&&"inverted"==t[3]||e.isPlainObject(t)&&t.inverted}).length,-1===i.item.enable?!o:o||t.picki.item.max.pick},i.prototype.parse=function(t,e,i){var o=this,a={};return e&&"string"==typeof e?(i&&i.format||((i=i||{}).format=o.settings.format),o.formats.toArray(i.format).map(function(t){var i=o.formats[t],r=i?n.trigger(i,o,[e,a]):t.replace(/^!/,"").length;i&&(a[t]=e.substr(0,r)),e=e.substr(r)}),[a.yyyy||a.yy,+(a.mm||a.m)-1,a.dd||a.d]):e},i.prototype.formats=function(){function t(t,e,i){var n=t.match(/\w+/)[0];return i.mm||i.m||(i.m=e.indexOf(n)+1),n.length}function e(t){return t.match(/\w+/)[0].length}return{d:function(t,e){return t?n.digits(t):e.date},dd:function(t,e){return t?2:n.lead(e.date)},ddd:function(t,i){return t?e(t):this.settings.weekdaysShort[i.day]},dddd:function(t,i){return t?e(t):this.settings.weekdaysFull[i.day]},m:function(t,e){return t?n.digits(t):e.month+1},mm:function(t,e){return t?2:n.lead(e.month+1)},mmm:function(e,i){var n=this.settings.monthsShort;return e?t(e,n,i):n[i.month]},mmmm:function(e,i){var n=this.settings.monthsFull;return e?t(e,n,i):n[i.month]},yy:function(t,e){return t?2:(""+e.year).slice(2)},yyyy:function(t,e){return t?4:e.year},toArray:function(t){return t.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g)},toString:function(t,e){var i=this;return i.formats.toArray(t).map(function(t){return n.trigger(i.formats[t],i,[0,e])||t.replace(/^!/,"")}).join("")}}}(),i.prototype.isDateExact=function(t,i){var o=this;return n.isInteger(t)&&n.isInteger(i)||"boolean"==typeof t&&"boolean"==typeof i?t===i:(n.isDate(t)||e.isArray(t))&&(n.isDate(i)||e.isArray(i))?o.create(t).pick===o.create(i).pick:!(!e.isPlainObject(t)||!e.isPlainObject(i))&&(o.isDateExact(t.from,i.from)&&o.isDateExact(t.to,i.to))},i.prototype.isDateOverlap=function(t,i){var o=this,a=o.settings.firstDay?1:0;return n.isInteger(t)&&(n.isDate(i)||e.isArray(i))?(t=t%7+a)===o.create(i).day+1:n.isInteger(i)&&(n.isDate(t)||e.isArray(t))?(i=i%7+a)===o.create(t).day+1:!(!e.isPlainObject(t)||!e.isPlainObject(i))&&o.overlapRanges(t,i)},i.prototype.flipEnable=function(t){var e=this.item;e.enable=t||(-1==e.enable?1:-1)},i.prototype.deactivate=function(t,i){var o=this,a=o.item.disable.slice(0);return"flip"==i?o.flipEnable():!1===i?(o.flipEnable(1),a=[]):!0===i?(o.flipEnable(-1),a=[]):i.map(function(t){for(var i,r=0;r=d.year&&l.month>=d.month||!t&&l.year<=u.year&&l.month<=u.month?" "+i.klass.navDisabled:""),"data-nav="+(t||-1)+" "+n.ariaAttr({role:"button",controls:e.$node[0].id+"_table"})+' title="'+(t?i.labelMonthNext:i.labelMonthPrev)+'"')},f=function(o){var a=i.showMonthsShort?i.monthsShort:i.monthsFull;return"short_months"==o&&(a=i.monthsShort),i.selectMonths&&void 0==o?n.node("select",n.group({min:0,max:11,i:1,node:"option",item:function(t){return[a[t],0,"value="+t+(l.month==t?" selected":"")+(l.year==u.year&&td.month?" disabled":"")]}}),i.klass.selectMonth+" browser-default",(t?"":"disabled")+" "+n.ariaAttr({controls:e.$node[0].id+"_table"})+' title="'+i.labelMonthSelect+'"'):"short_months"==o?null!=r?a[r.month]:a[l.month]:n.node("div",a[l.month],i.klass.month)},v=function(o){var a=l.year,s=!0===i.selectYears?5:~~(i.selectYears/2);if(s){var c=u.year,p=d.year,h=a-s,f=a+s;if(c>h&&(f+=c-h,h=c),pm?m:v,f=p}if(i.selectYears&&void 0==o)return n.node("select",n.group({min:h,max:f,i:1,node:"option",item:function(t){return[t,0,"value="+t+(a==t?" selected":"")]}}),i.klass.selectYear+" browser-default",(t?"":"disabled")+" "+n.ariaAttr({controls:e.$node[0].id+"_table"})+' title="'+i.labelYearSelect+'"')}return"raw"===o&&null!=r?n.node("div",r.year):n.node("div",a,i.klass.year)};return createDayLabel=function(){return null!=r?r.date:a.date},createWeekdayLabel=function(){var t;return t=null!=r?r.day:a.day,i.weekdaysShort[t]},n.node("div",n.node("div",v("raw"),i.klass.year_display)+n.node("span",createWeekdayLabel()+", ","picker__weekday-display")+n.node("span",f("short_months")+" ",i.klass.month_display)+n.node("span",createDayLabel(),i.klass.day_display),i.klass.date_display)+n.node("div",n.node("div",n.node("div",(i.selectYears,f()+v()+h()+h(1)),i.klass.header)+n.node("table",p+n.node("tbody",n.group({min:0,max:5,i:1,node:"tr",item:function(t){var o=i.firstDay&&0===e.create([l.year,l.month,1]).day?-7:0;return[n.group({min:7*t-l.day+o+1,max:function(){return this.min+7-1},i:1,node:"td",item:function(t){t=e.create([l.year,l.month,t+(i.firstDay?1:0)]);var o=r&&r.pick==t.pick,p=s&&s.pick==t.pick,h=c&&e.disabled(t)||t.pickd.pick,f=n.trigger(e.formats.toString,e,[i.format,t]);return[n.node("div",t.date,function(e){return e.push(l.month==t.month?i.klass.infocus:i.klass.outfocus),a.pick==t.pick&&e.push(i.klass.now),o&&e.push(i.klass.selected),p&&e.push(i.klass.highlighted),h&&e.push(i.klass.disabled),e.join(" ")}([i.klass.day]),"data-pick="+t.pick+" "+n.ariaAttr({role:"gridcell",label:f,selected:!(!o||e.$node.val()!==f)||null,activedescendant:!!p||null,disabled:!!h||null})+" "+(h?"":'tabindex="0"')),"",n.ariaAttr({role:"presentation"})]}})]}})),i.klass.table,'id="'+e.$node[0].id+'_table" '+n.ariaAttr({role:"grid",controls:e.$node[0].id,readonly:!0})),i.klass.calendar_container)+n.node("div",n.node("button",i.today,"btn-flat picker__today waves-effect","type=button data-pick="+a.pick+(t&&!e.disabled(a)?"":" disabled")+" "+n.ariaAttr({controls:e.$node[0].id}))+n.node("button",i.clear,"btn-flat picker__clear waves-effect","type=button data-clear=1"+(t?"":" disabled")+" "+n.ariaAttr({controls:e.$node[0].id}))+n.node("button",i.close,"btn-flat picker__close waves-effect","type=button data-close=true "+(t?"":" disabled")+" "+n.ariaAttr({controls:e.$node[0].id})),i.klass.footer),"picker__container__wrapper")},i.defaults=function(t){return{labelMonthNext:"Next month",labelMonthPrev:"Previous month",labelMonthSelect:"Select a month",labelYearSelect:"Select a year",monthsFull:["January","February","March","April","May","June","July","August","September","October","November","December"],monthsShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],weekdaysFull:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],weekdaysShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],weekdaysLetter:["S","M","T","W","T","F","S"],today:"Today",clear:"Clear",close:"Ok",closeOnSelect:!1,format:"d mmmm, yyyy",klass:{table:t+"table",header:t+"header",date_display:t+"date-display",day_display:t+"day-display",month_display:t+"month-display",year_display:t+"year-display",calendar_container:t+"calendar-container",navPrev:t+"nav--prev",navNext:t+"nav--next",navDisabled:t+"nav--disabled",month:t+"month",year:t+"year",selectMonth:t+"select--month",selectYear:t+"select--year",weekdays:t+"weekday",day:t+"day",disabled:t+"day--disabled",selected:t+"day--selected",highlighted:t+"day--highlighted",now:t+"day--today",infocus:t+"day--infocus",outfocus:t+"day--outfocus",footer:t+"footer",buttonClear:t+"button--clear",buttonToday:t+"button--today",buttonClose:t+"button--close"}}}(t.klasses().picker+"__"),t.extend("pickadate",i)}),function(t){function e(t){return document.createElementNS(l,t)}function i(t){return(t<10?"0":"")+t}function n(t){var e=++m+"";return t?t+e:e}function o(o,r){function l(t,e){var i=d.offset(),n=/^touch/.test(t.type),o=i.left+g,a=i.top+g,l=(n?t.originalEvent.touches[0]:t).pageX-o,c=(n?t.originalEvent.touches[0]:t).pageY-a,u=Math.sqrt(l*l+c*c),p=!1;if(!e||!(uy+w)){t.preventDefault();var v=setTimeout(function(){E.popover.addClass("clockpicker-moving")},200);E.setHand(l,c,!e,!0),s.off(h).on(h,function(t){t.preventDefault();var e=/^touch/.test(t.type),i=(e?t.originalEvent.touches[0]:t).pageX-o,n=(e?t.originalEvent.touches[0]:t).pageY-a;(p||i!==l||n!==c)&&(p=!0,E.setHand(i,n,!1,!0))}),s.off(f).on(f,function(t){s.off(f),t.preventDefault();var i=/^touch/.test(t.type),n=(i?t.originalEvent.changedTouches[0]:t).pageX-o,u=(i?t.originalEvent.changedTouches[0]:t).pageY-a;(e||p)&&n===l&&u===c&&E.setHand(n,u),"hours"===E.currentView?E.toggleView("minutes",x/2):r.autoclose&&(E.minutesView.addClass("clockpicker-dial-out"),setTimeout(function(){E.done()},x/2)),d.prepend(z),clearTimeout(v),E.popover.removeClass("clockpicker-moving"),s.off(h)})}}var u=t(C),d=u.find(".clockpicker-plate"),v=u.find(".picker__holder"),m=u.find(".clockpicker-hours"),T=u.find(".clockpicker-minutes"),S=u.find(".clockpicker-am-pm-block"),P="INPUT"===o.prop("tagName"),A=P?o:o.find("input"),O=t("label[for="+A.attr("id")+"]"),E=this;this.id=n("cp"),this.element=o,this.holder=v,this.options=r,this.isAppended=!1,this.isShown=!1,this.currentView="hours",this.isInput=P,this.input=A,this.label=O,this.popover=u,this.plate=d,this.hoursView=m,this.minutesView=T,this.amPmBlock=S,this.spanHours=u.find(".clockpicker-span-hours"),this.spanMinutes=u.find(".clockpicker-span-minutes"),this.spanAmPm=u.find(".clockpicker-span-am-pm"),this.footer=u.find(".picker__footer"),this.amOrPm="PM",r.twelvehour&&(r.ampmclickable?(this.spanAmPm.empty(),t('
          AM
          ').on("click",function(){E.spanAmPm.children("#click-am").addClass("text-primary"),E.spanAmPm.children("#click-pm").removeClass("text-primary"),E.amOrPm="AM"}).appendTo(this.spanAmPm),t('
          PM
          ').on("click",function(){E.spanAmPm.children("#click-pm").addClass("text-primary"),E.spanAmPm.children("#click-am").removeClass("text-primary"),E.amOrPm="PM"}).appendTo(this.spanAmPm)):(this.spanAmPm.empty(),t('
          AM
          ').appendTo(this.spanAmPm),t('
          PM
          ').appendTo(this.spanAmPm))),t('").click(t.proxy(this.clear,this)).appendTo(this.footer),t('").click(t.proxy(this.hide,this)).appendTo(this.footer),t('").click(t.proxy(this.done,this)).appendTo(this.footer),this.spanHours.click(t.proxy(this.toggleView,this,"hours")),this.spanMinutes.click(t.proxy(this.toggleView,this,"minutes")),A.on("focus.clockpicker click.clockpicker",t.proxy(this.show,this));var _,M,I,D,q=t('
          ');if(r.twelvehour)for(_=1;_<13;_+=1)M=q.clone(),I=_/6*Math.PI,D=y,M.css({left:g+Math.sin(I)*D-w,top:g-Math.cos(I)*D-w}),M.html(0===_?"00":_),m.append(M),M.on(p,l);else for(_=0;_<24;_+=1)M=q.clone(),I=_/6*Math.PI,D=_>0&&_<13?b:y,M.css({left:g+Math.sin(I)*D-w,top:g-Math.cos(I)*D-w}),M.html(0===_?"00":_),m.append(M),M.on(p,l);for(_=0;_<60;_+=5)M=q.clone(),I=_/30*Math.PI,M.css({left:g+Math.sin(I)*y-w,top:g-Math.cos(I)*y-w}),M.html(i(_)),T.append(M),M.on(p,l);if(d.on(p,function(e){0===t(e.target).closest(".clockpicker-tick").length&&l(e,!0)}),c){var z=u.find(".clockpicker-canvas"),V=e("svg");V.setAttribute("class","clockpicker-svg"),V.setAttribute("width",k),V.setAttribute("height",k);var H=e("g");H.setAttribute("transform","translate("+g+","+g+")");var L=e("circle");L.setAttribute("class","clockpicker-canvas-bearing"),L.setAttribute("cx",0),L.setAttribute("cy",0),L.setAttribute("r",4);var j=e("line");j.setAttribute("x1",0),j.setAttribute("y1",0);var $=e("circle");$.setAttribute("class","clockpicker-canvas-bg"),$.setAttribute("r",w),H.appendChild(j),H.appendChild($),H.appendChild(L),V.appendChild(H),z.append(V),this.hand=j,this.bg=$,this.bearing=L,this.g=H,this.canvas=z}a(this.options.init)}function a(t){t&&"function"==typeof t&&t()}var r=t(window),s=t(document),l="http://www.w3.org/2000/svg",c="SVGAngle"in window&&function(){var t,e=document.createElement("div");return e.innerHTML="",t=(e.firstChild&&e.firstChild.namespaceURI)==l,e.innerHTML="",t}(),u=function(){var t=document.createElement("div").style;return"transition"in t||"WebkitTransition"in t||"MozTransition"in t||"msTransition"in t||"OTransition"in t}(),d="ontouchstart"in window,p="mousedown"+(d?" touchstart":""),h="mousemove.clockpicker"+(d?" touchmove.clockpicker":""),f="mouseup.clockpicker"+(d?" touchend.clockpicker":""),v=navigator.vibrate?"vibrate":navigator.webkitVibrate?"webkitVibrate":null,m=0,g=135,y=105,b=70,w=20,k=2*g,x=u?350:1,C=['
          ','
          ','
          ','
          ','
          ','
          ','
          ','
          ','',":",'',"
          ",'
          ','
          ',"
          ","
          ","
          ",'
          ','
          ','
          ','
          ','
          ','
          ',"
          ",'
          ',"
          ","
          ",'","
          ","
          ","
          ","
          ","
          ","
          "].join("");o.DEFAULTS={default:"",fromnow:0,donetext:"Ok",cleartext:"Clear",canceltext:"Cancel",autoclose:!1,ampmclickable:!0,darktheme:!1,twelvehour:!0,vibrate:!0},o.prototype.toggle=function(){this[this.isShown?"hide":"show"]()},o.prototype.locate=function(){var t=this.element,e=this.popover;t.offset(),t.outerWidth(),t.outerHeight(),this.options.align;e.show()},o.prototype.show=function(e){if(!this.isShown){a(this.options.beforeShow),t(":input").each(function(){t(this).attr("tabindex",-1)});var n=this;this.input.blur(),this.popover.addClass("picker--opened"),this.input.addClass("picker__input picker__input--active"),t(document.body).css("overflow","hidden");var o=((this.input.prop("value")||this.options.default||"")+"").split(":");if(this.options.twelvehour&&void 0!==o[1]&&(o[1].indexOf("AM")>0?this.amOrPm="AM":this.amOrPm="PM",o[1]=o[1].replace("AM","").replace("PM","")),"now"===o[0]){var l=new Date(+new Date+this.options.fromnow);o=[l.getHours(),l.getMinutes()],this.options.twelvehour&&(this.amOrPm=o[0]>=12&&o[0]<24?"PM":"AM")}if(this.hours=+o[0]||0,this.minutes=+o[1]||0,this.spanHours.html(this.hours),this.spanMinutes.html(i(this.minutes)),!this.isAppended){var c=document.querySelector(this.options.container);this.options.container&&c?c.appendChild(this.popover[0]):this.popover.insertAfter(this.input),this.options.twelvehour&&("PM"===this.amOrPm?(this.spanAmPm.children("#click-pm").addClass("text-primary"),this.spanAmPm.children("#click-am").removeClass("text-primary")):(this.spanAmPm.children("#click-am").addClass("text-primary"),this.spanAmPm.children("#click-pm").removeClass("text-primary"))),r.on("resize.clockpicker"+this.id,function(){n.isShown&&n.locate()}),this.isAppended=!0}this.toggleView("hours"),this.locate(),this.isShown=!0,s.on("click.clockpicker."+this.id+" focusin.clockpicker."+this.id,function(e){var i=t(e.target);0===i.closest(n.popover.find(".picker__wrap")).length&&0===i.closest(n.input).length&&n.hide()}),s.on("keyup.clockpicker."+this.id,function(t){27===t.keyCode&&n.hide()}),a(this.options.afterShow)}},o.prototype.hide=function(){a(this.options.beforeHide),this.input.removeClass("picker__input picker__input--active"),this.popover.removeClass("picker--opened"),t(document.body).css("overflow","visible"),this.isShown=!1,t(":input").each(function(e){t(this).attr("tabindex",e+1)}),s.off("click.clockpicker."+this.id+" focusin.clockpicker."+this.id),s.off("keyup.clockpicker."+this.id),this.popover.hide(),a(this.options.afterHide)},o.prototype.toggleView=function(e,i){var n=!1;"minutes"===e&&"visible"===t(this.hoursView).css("visibility")&&(a(this.options.beforeHourSelect),n=!0);var o="hours"===e,r=o?this.hoursView:this.minutesView,s=o?this.minutesView:this.hoursView;this.currentView=e,this.spanHours.toggleClass("text-primary",o),this.spanMinutes.toggleClass("text-primary",!o),s.addClass("clockpicker-dial-out"),r.css("visibility","visible").removeClass("clockpicker-dial-out"),this.resetClock(i),clearTimeout(this.toggleViewTimer),this.toggleViewTimer=setTimeout(function(){s.css("visibility","hidden")},x),n&&a(this.options.afterHourSelect)},o.prototype.resetClock=function(t){var e=this.currentView,i=this[e],n="hours"===e,o=i*(Math.PI/(n?6:30)),a=n&&i>0&&i<13?b:y,r=Math.sin(o)*a,s=-Math.cos(o)*a,l=this;c&&t?(l.canvas.addClass("clockpicker-canvas-out"),setTimeout(function(){l.canvas.removeClass("clockpicker-canvas-out"),l.setHand(r,s)},t)):this.setHand(r,s)},o.prototype.setHand=function(e,n,o,a){var r,s=Math.atan2(e,-n),l="hours"===this.currentView,u=Math.PI/(l||o?6:30),d=Math.sqrt(e*e+n*n),p=this.options,h=l&&d<(y+b)/2,f=h?b:y;if(p.twelvehour&&(f=y),s<0&&(s=2*Math.PI+s),r=Math.round(s/u),s=r*u,p.twelvehour?l?0===r&&(r=12):(o&&(r*=5),60===r&&(r=0)):l?(12===r&&(r=0),r=h?0===r?12:r:0===r?0:r+12):(o&&(r*=5),60===r&&(r=0)),this[this.currentView]!==r&&v&&this.options.vibrate&&(this.vibrateTimer||(navigator[v](10),this.vibrateTimer=setTimeout(t.proxy(function(){this.vibrateTimer=null},this),100))),this[this.currentView]=r,l?this.spanHours.html(r):this.spanMinutes.html(i(r)),c){var m=Math.sin(s)*(f-w),g=-Math.cos(s)*(f-w),k=Math.sin(s)*f,x=-Math.cos(s)*f;this.hand.setAttribute("x2",m),this.hand.setAttribute("y2",g),this.bg.setAttribute("cx",k),this.bg.setAttribute("cy",x)}else this[l?"hoursView":"minutesView"].find(".clockpicker-tick").each(function(){var e=t(this);e.toggleClass("active",r===+e.html())})},o.prototype.done=function(){a(this.options.beforeDone),this.hide(),this.label.addClass("active");var t=this.input.prop("value"),e=i(this.hours)+":"+i(this.minutes);this.options.twelvehour&&(e+=this.amOrPm),this.input.prop("value",e),e!==t&&(this.input.triggerHandler("change"),this.isInput||this.element.trigger("change")),this.options.autoclose&&this.input.trigger("blur"),a(this.options.afterDone)},o.prototype.clear=function(){this.hide(),this.label.removeClass("active");var t=this.input.prop("value");this.input.prop("value",""),""!==t&&(this.input.triggerHandler("change"),this.isInput||this.element.trigger("change")),this.options.autoclose&&this.input.trigger("blur")},o.prototype.remove=function(){this.element.removeData("clockpicker"),this.input.off("focus.clockpicker click.clockpicker"),this.isShown&&this.hide(),this.isAppended&&(r.off("resize.clockpicker"+this.id),this.popover.remove())},t.fn.pickatime=function(e){var i=Array.prototype.slice.call(arguments,1);return this.each(function(){var n=t(this),a=n.data("clockpicker");if(a)"function"==typeof a[e]&&a[e].apply(a,i);else{var r=t.extend({},o.DEFAULTS,n.data(),"object"==typeof e&&e);n.data("clockpicker",new o(n,r))}})}}(jQuery),function(t){function e(){var e=+t(this).attr("data-length"),i=+t(this).val().length,n=i<=e;t(this).parent().find('span[class="character-counter"]').html(i+"/"+e),o(n,t(this))}function i(e){var i=e.parent().find('span[class="character-counter"]');i.length||(i=t("").addClass("character-counter").css("float","right").css("font-size","12px").css("height",1),e.parent().append(i))}function n(){t(this).parent().find('span[class="character-counter"]').html("")}function o(t,e){var i=e.hasClass("invalid");t&&i?e.removeClass("invalid"):t||i||(e.removeClass("valid"),e.addClass("invalid"))}t.fn.characterCounter=function(){return this.each(function(){var o=t(this);o.parent().find('span[class="character-counter"]').length||void 0!==o.attr("data-length")&&(o.on("input",e),o.on("focus",e),o.on("blur",n),i(o))})},t(document).ready(function(){t("input, textarea").characterCounter()})}(jQuery),function(t){var e={init:function(e){var i={duration:200,dist:-100,shift:0,padding:0,fullWidth:!1,indicators:!1,noWrap:!1,onCycleTo:null};e=t.extend(i,e);var n=Materialize.objectSelectorString(t(this));return this.each(function(i){function o(t){return t.targetTouches&&t.targetTouches.length>=1?t.targetTouches[0].clientX:t.clientX}function a(t){return t.targetTouches&&t.targetTouches.length>=1?t.targetTouches[0].clientY:t.clientY}function r(t){return t>=C?t%C:t<0?r(C+t%C):t}function s(i){E=!0,j.hasClass("scrolling")||j.addClass("scrolling"),null!=H&&window.clearTimeout(H),H=window.setTimeout(function(){E=!1,j.removeClass("scrolling")},e.duration);var n,o,a,s,l,c,u,d=w;if(b="number"==typeof i?i:b,w=Math.floor((b+x/2)/x),a=b-w*x,s=a<0?1:-1,l=-s*a*2/x,o=C>>1,e.fullWidth?u="translateX(0)":(u="translateX("+(j[0].clientWidth-m)/2+"px) ",u+="translateY("+(j[0].clientHeight-g)/2+"px)"),N){var p=w%C,h=V.find(".indicator-item.active");h.index()!==p&&(h.removeClass("active"),V.find(".indicator-item").eq(p).addClass("active"))}for((!W||w>=0&&w0?1-l:1):(zTranslation=e.dist*(2*n-l*s),tweenedOpacity=1-.2*(2*n-l*s)),(!W||w-n>=0)&&((c=v[r(w-n)]).style[_]=u+" translateX("+(-e.shift+(-x*n-a)/2)+"px) translateZ("+zTranslation+"px)",c.style.zIndex=-n,c.style.opacity=tweenedOpacity,c.style.display="block");if((!W||w>=0&&w2||i<-2?(s(A-i),requestAnimationFrame(c)):s(A))}function u(i){if(q)return i.preventDefault(),i.stopPropagation(),!1;if(!e.fullWidth){var n=t(i.target).closest(".carousel-item").index();0!==r(w)-n&&(i.preventDefault(),i.stopPropagation()),d(n)}}function d(t){var e=w%C-t;W||(e<0?Math.abs(e+C)0&&Math.abs(e-C)0&&j.trigger("carouselPrev",[e])}function p(e){"mousedown"===e.type&&t(e.target).is("img")&&e.preventDefault(),k=!0,q=!1,z=!1,T=o(e),S=a(e),O=P=0,M=b,I=Date.now(),clearInterval(D),D=setInterval(l,100)}function h(t){var e,i;if(k)if(e=o(t),y=a(t),i=T-e,Math.abs(S-y)<30&&!z)(i>2||i<-2)&&(q=!0,T=e,s(b+i));else{if(q)return t.preventDefault(),t.stopPropagation(),!1;z=!0}if(q)return t.preventDefault(),t.stopPropagation(),!1}function f(t){if(k)return k=!1,clearInterval(D),A=b,(O>10||O<-10)&&(A=b+(P=.9*O)),A=Math.round(A/x)*x,W&&(A>=x*(C-1)?A=x*(C-1):A<0&&(A=0)),P=A-b,I=Date.now(),requestAnimationFrame(c),q&&(t.preventDefault(),t.stopPropagation()),!1}var v,m,g,b,w,k,x,C,T,S,P,A,O,E,_,M,I,D,q,z,V=t('
            '),H=null,L=null,j=t(this),$=j.find(".carousel-item").length>1,N=(j.attr("data-indicators")||e.indicators)&&$,W=j.attr("data-no-wrap")||e.noWrap||!$,F=j.attr("data-namespace")||n+i;j.attr("data-namespace",F);var Q=function(e){var i=j.find(".carousel-item.active").length?j.find(".carousel-item.active").first():j.find(".carousel-item").first(),n=i.find("img").first();if(n.length)if(n[0].complete)if(n.height()>0)j.css("height",n.height());else{var o=n[0].naturalWidth,a=n[0].naturalHeight,r=j.width()/o*a;j.css("height",r)}else n.on("load",function(){j.css("height",t(this).height())});else if(!e){var s=i.height();j.css("height",s)}};if(e.fullWidth&&(e.dist=0,Q(),N&&j.find(".carousel-fixed-item").addClass("with-indicators")),j.hasClass("initialized"))return t(window).trigger("resize"),j.trigger("carouselNext",[1e-6]),!0;j.addClass("initialized"),k=!1,b=A=0,v=[],m=j.find(".carousel-item").first().innerWidth(),g=j.find(".carousel-item").first().innerHeight(),x=2*m+e.padding,j.find(".carousel-item").each(function(e){if(v.push(t(this)[0]),N){var i=t('
          • ');0===e&&i.addClass("active"),i.click(function(e){e.stopPropagation(),d(t(this).index())}),V.append(i)}}),N&&j.append(V),C=v.length,_="transform",["webkit","Moz","O","ms"].every(function(t){var e=t+"Transform";return void 0===document.body.style[e]||(_=e,!1)});var X=Materialize.throttle(function(){if(e.fullWidth){m=j.find(".carousel-item").first().innerWidth();j.find(".carousel-item.active").height();x=2*m+e.padding,A=b=2*w*m,Q(!0)}else s()},200);t(window).off("resize.carousel-"+F).on("resize.carousel-"+F,X),void 0!==window.ontouchstart&&(j.on("touchstart.carousel",p),j.on("touchmove.carousel",h),j.on("touchend.carousel",f)),j.on("mousedown.carousel",p),j.on("mousemove.carousel",h),j.on("mouseup.carousel",f),j.on("mouseleave.carousel",f),j.on("click.carousel",u),s(b),t(this).on("carouselNext",function(t,e,i){void 0===e&&(e=1),"function"==typeof i&&(L=i),A=x*Math.round(b/x)+x*e,b!==A&&(P=A-b,I=Date.now(),requestAnimationFrame(c))}),t(this).on("carouselPrev",function(t,e,i){void 0===e&&(e=1),"function"==typeof i&&(L=i),A=x*Math.round(b/x)-x*e,b!==A&&(P=A-b,I=Date.now(),requestAnimationFrame(c))}),t(this).on("carouselSet",function(t,e,i){void 0===e&&(e=0),"function"==typeof i&&(L=i),d(e)})})},next:function(e,i){t(this).trigger("carouselNext",[e,i])},prev:function(e,i){t(this).trigger("carouselPrev",[e,i])},set:function(e,i){t(this).trigger("carouselSet",[e,i])},destroy:function(){var e=t(this).attr("data-namespace");t(this).removeAttr("data-namespace"),t(this).removeClass("initialized"),t(this).find(".indicators").remove(),t(this).off("carouselNext carouselPrev carouselSet"),t(window).off("resize.carousel-"+e),void 0!==window.ontouchstart&&t(this).off("touchstart.carousel touchmove.carousel touchend.carousel"),t(this).off("mousedown.carousel mousemove.carousel mouseup.carousel mouseleave.carousel click.carousel")}};t.fn.carousel=function(i){return e[i]?e[i].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof i&&i?void t.error("Method "+i+" does not exist on jQuery.carousel"):e.init.apply(this,arguments)}}(jQuery),function(t){var e={init:function(e){return this.each(function(){var i=t("#"+t(this).attr("data-activates")),n=(t("body"),t(this)),o=n.parent(".tap-target-wrapper"),a=o.find(".tap-target-wave"),r=o.find(".tap-target-origin"),s=n.find(".tap-target-content");o.length||(o=n.wrap(t('
            ')).parent()),s.length||(s=t('
            '),n.append(s)),a.length||(a=t('
            '),r.length||((r=i.clone(!0,!0)).addClass("tap-target-origin"),r.removeAttr("id"),r.removeAttr("style"),a.append(r)),o.append(a));var l=function(){o.is(".open")&&(o.removeClass("open"),r.off("click.tapTarget"),t(document).off("click.tapTarget"),t(window).off("resize.tapTarget"))},c=function(){var e="fixed"===i.css("position");if(!e)for(var r=i.parents(),l=0;lv,b=d<=m,w=d>m,k=p>=.25*h&&p<=.75*h,x=n.outerWidth(),C=n.outerHeight(),T=d+u/2-C/2,S=p+c/2-x/2,P=e?"fixed":"absolute",A=k?x:x/2+c,O=C/2,E=b?C/2:0,_=g&&!k?x/2-c:0,M=c,I=w?"bottom":"top",D=2*c,q=D,z=C/2-q/2,V=x/2-D/2,H={};H.top=b?T:"",H.right=y?h-S-x:"",H.bottom=w?f-T-C:"",H.left=g?S:"",H.position=P,o.css(H),s.css({width:A,height:O,top:E,right:0,bottom:0,left:_,padding:M,verticalAlign:I}),a.css({top:z,left:V,width:D,height:q})};"open"==e&&(c(),o.is(".open")||(o.addClass("open"),setTimeout(function(){r.off("click.tapTarget").on("click.tapTarget",function(t){l(),r.off("click.tapTarget")}),t(document).off("click.tapTarget").on("click.tapTarget",function(e){l(),t(document).off("click.tapTarget")});var e=Materialize.throttle(function(){c()},200);t(window).off("resize.tapTarget").on("resize.tapTarget",e)},0))),"close"==e&&l()})},open:function(){},close:function(){}};t.fn.tapTarget=function(i){if(e[i]||"object"==typeof i)return e.init.apply(this,arguments);t.error("Method "+i+" does not exist on jQuery.tap-target")}}(jQuery); \ No newline at end of file diff --git a/app/dispatch/static/materialize/js/buttons.js b/app/dispatch/static/materialize/js/buttons.js new file mode 100644 index 0000000..ca923d2 --- /dev/null +++ b/app/dispatch/static/materialize/js/buttons.js @@ -0,0 +1,267 @@ +(function ($) { + $(document).ready(function() { + + // jQuery reverse + $.fn.reverse = [].reverse; + + // Hover behaviour: make sure this doesn't work on .click-to-toggle FABs! + $(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function(e) { + var $this = $(this); + openFABMenu($this); + }); + $(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function(e) { + var $this = $(this); + closeFABMenu($this); + }); + + // Toggle-on-click behaviour. + $(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function(e) { + var $this = $(this); + var $menu = $this.parent(); + if ($menu.hasClass('active')) { + closeFABMenu($menu); + } else { + openFABMenu($menu); + } + }); + + // Toolbar transition behaviour. + $(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function(e) { + var $this = $(this); + var $menu = $this.parent(); + FABtoToolbar($menu); + }); + + }); + + $.fn.extend({ + openFAB: function() { + openFABMenu($(this)); + }, + closeFAB: function() { + closeFABMenu($(this)); + }, + openToolbar: function() { + FABtoToolbar($(this)); + }, + closeToolbar: function() { + toolbarToFAB($(this)); + } + }); + + + var openFABMenu = function (btn) { + var $this = btn; + if ($this.hasClass('active') === false) { + + // Get direction option + var horizontal = $this.hasClass('horizontal'); + var offsetY, offsetX; + + if (horizontal === true) { + offsetX = 40; + } else { + offsetY = 40; + } + + $this.addClass('active'); + $this.find('ul .btn-floating').velocity( + { scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px'}, + { duration: 0 }); + + var time = 0; + $this.find('ul .btn-floating').reverse().each( function () { + $(this).velocity( + { opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0'}, + { duration: 80, delay: time }); + time += 40; + }); + } + }; + + var closeFABMenu = function (btn) { + var $this = btn; + // Get direction option + var horizontal = $this.hasClass('horizontal'); + var offsetY, offsetX; + + if (horizontal === true) { + offsetX = 40; + } else { + offsetY = 40; + } + + $this.removeClass('active'); + var time = 0; + $this.find('ul .btn-floating').velocity("stop", true); + $this.find('ul .btn-floating').velocity( + { opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px'}, + { duration: 80 } + ); + }; + + + /** + * Transform FAB into toolbar + * @param {Object} object jQuery object + */ + var FABtoToolbar = function(btn) { + if (btn.attr('data-open') === "true") { + return; + } + + var offsetX, offsetY, scaleFactor; + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var btnRect = btn[0].getBoundingClientRect(); + var anchor = btn.find('> a').first(); + var menu = btn.find('> ul').first(); + var backdrop = $('
            '); + var fabColor = anchor.css('background-color'); + anchor.append(backdrop); + + offsetX = btnRect.left - (windowWidth / 2) + (btnRect.width / 2); + offsetY = windowHeight - btnRect.bottom; + scaleFactor = windowWidth / backdrop.width(); + btn.attr('data-origin-bottom', btnRect.bottom); + btn.attr('data-origin-left', btnRect.left); + btn.attr('data-origin-width', btnRect.width); + + // Set initial state + btn.addClass('active'); + btn.attr('data-open', true); + btn.css({ + 'text-align': 'center', + width: '100%', + bottom: 0, + left: 0, + transform: 'translateX(' + offsetX + 'px)', + transition: 'none' + }); + anchor.css({ + transform: 'translateY(' + -offsetY + 'px)', + transition: 'none' + }); + backdrop.css({ + 'background-color': fabColor + }); + + + setTimeout(function() { + btn.css({ + transform: '', + transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s' + }); + anchor.css({ + overflow: 'visible', + transform: '', + transition: 'transform .2s' + }); + + setTimeout(function() { + btn.css({ + overflow: 'hidden', + 'background-color': fabColor + }); + backdrop.css({ + transform: 'scale(' + scaleFactor + ')', + transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)' + }); + menu.find('> li > a').css({ + opacity: 1 + }); + + // Scroll to close. + $(window).on('scroll.fabToolbarClose', function() { + toolbarToFAB(btn); + $(window).off('scroll.fabToolbarClose'); + $(document).off('click.fabToolbarClose'); + }); + + $(document).on('click.fabToolbarClose', function(e) { + if (!$(e.target).closest(menu).length) { + toolbarToFAB(btn); + $(window).off('scroll.fabToolbarClose'); + $(document).off('click.fabToolbarClose'); + } + }); + }, 100); + }, 0); + }; + + /** + * Transform toolbar back into FAB + * @param {Object} object jQuery object + */ + var toolbarToFAB = function(btn) { + if (btn.attr('data-open') !== "true") { + return; + } + + var offsetX, offsetY, scaleFactor; + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var btnWidth = btn.attr('data-origin-width'); + var btnBottom = btn.attr('data-origin-bottom'); + var btnLeft = btn.attr('data-origin-left'); + var anchor = btn.find('> .btn-floating').first(); + var menu = btn.find('> ul').first(); + var backdrop = btn.find('.fab-backdrop'); + var fabColor = anchor.css('background-color'); + + offsetX = btnLeft - (windowWidth / 2) + (btnWidth / 2); + offsetY = windowHeight - btnBottom; + scaleFactor = windowWidth / backdrop.width(); + + + // Hide backdrop + btn.removeClass('active'); + btn.attr('data-open', false); + btn.css({ + 'background-color': 'transparent', + transition: 'none' + }); + anchor.css({ + transition: 'none' + }); + backdrop.css({ + transform: 'scale(0)', + 'background-color': fabColor + }); + menu.find('> li > a').css({ + opacity: '' + }); + + setTimeout(function() { + backdrop.remove(); + + // Set initial state. + btn.css({ + 'text-align': '', + width: '', + bottom: '', + left: '', + overflow: '', + 'background-color': '', + transform: 'translate3d(' + -offsetX + 'px,0,0)' + }); + anchor.css({ + overflow: '', + transform: 'translate3d(0,' + offsetY + 'px,0)' + }); + + setTimeout(function() { + btn.css({ + transform: 'translate3d(0,0,0)', + transition: 'transform .2s' + }); + anchor.css({ + transform: 'translate3d(0,0,0)', + transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)' + }); + }, 20); + }, 200); + }; + + +}( jQuery )); diff --git a/app/dispatch/static/materialize/js/cards.js b/app/dispatch/static/materialize/js/cards.js new file mode 100644 index 0000000..7e06f94 --- /dev/null +++ b/app/dispatch/static/materialize/js/cards.js @@ -0,0 +1,36 @@ +(function ($) { + $(document).ready(function() { + + $(document).on('click.card', '.card', function (e) { + if ($(this).find('> .card-reveal').length) { + var $card = $(e.target).closest('.card'); + if ($card.data('initialOverflow') === undefined) { + $card.data( + 'initialOverflow', + $card.css('overflow') === undefined ? '' : $card.css('overflow') + ); + } + if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) { + // Make Reveal animate down and display none + $(this).find('.card-reveal').velocity( + {translateY: 0}, { + duration: 225, + queue: false, + easing: 'easeInOutQuad', + complete: function() { + $(this).css({ display: 'none'}); + $card.css('overflow', $card.data('initialOverflow')); + } + } + ); + } + else if ($(e.target).is($('.card .activator')) || + $(e.target).is($('.card .activator i')) ) { + $card.css('overflow', 'hidden'); + $(this).find('.card-reveal').css({ display: 'block'}).velocity("stop", false).velocity({translateY: '-100%'}, {duration: 300, queue: false, easing: 'easeInOutQuad'}); + } + } + }); + + }); +}( jQuery )); diff --git a/app/dispatch/static/materialize/js/carousel.js b/app/dispatch/static/materialize/js/carousel.js new file mode 100644 index 0000000..44bb118 --- /dev/null +++ b/app/dispatch/static/materialize/js/carousel.js @@ -0,0 +1,565 @@ +(function ($) { + + var methods = { + + init : function(options) { + var defaults = { + duration: 200, // ms + dist: -100, // zoom scale TODO: make this more intuitive as an option + shift: 0, // spacing for center image + padding: 0, // Padding between non center items + fullWidth: false, // Change to full width styles + indicators: false, // Toggle indicators + noWrap: false, // Don't wrap around and cycle through items. + onCycleTo: null // Callback for when a new slide is cycled to. + }; + options = $.extend(defaults, options); + var namespace = Materialize.objectSelectorString($(this)); + + return this.each(function(i) { + + var images, item_width, item_height, offset, center, pressed, dim, count, + reference, referenceY, amplitude, target, velocity, scrolling, + xform, frame, timestamp, ticker, dragged, vertical_dragged; + var $indicators = $('
              '); + var scrollingTimeout = null; + var oneTimeCallback = null; + + + // Initialize + var view = $(this); + var hasMultipleSlides = view.find('.carousel-item').length > 1; + var showIndicators = (view.attr('data-indicators') || options.indicators) && hasMultipleSlides; + var noWrap = (view.attr('data-no-wrap') || options.noWrap) || !hasMultipleSlides; + var uniqueNamespace = view.attr('data-namespace') || namespace+i; + view.attr('data-namespace', uniqueNamespace); + + + // Options + var setCarouselHeight = function(imageOnly) { + var firstSlide = view.find('.carousel-item.active').length ? view.find('.carousel-item.active').first() : view.find('.carousel-item').first(); + var firstImage = firstSlide.find('img').first(); + if (firstImage.length) { + if (firstImage[0].complete) { + // If image won't trigger the load event + var imageHeight = firstImage.height(); + if (imageHeight > 0) { + view.css('height', firstImage.height()); + } else { + // If image still has no height, use the natural dimensions to calculate + var naturalWidth = firstImage[0].naturalWidth; + var naturalHeight = firstImage[0].naturalHeight; + var adjustedHeight = (view.width() / naturalWidth) * naturalHeight; + view.css('height', adjustedHeight); + } + } else { + // Get height when image is loaded normally + firstImage.on('load', function(){ + view.css('height', $(this).height()); + }); + } + } else if (!imageOnly) { + var slideHeight = firstSlide.height(); + view.css('height', slideHeight); + } + }; + + if (options.fullWidth) { + options.dist = 0; + setCarouselHeight(); + + // Offset fixed items when indicators. + if (showIndicators) { + view.find('.carousel-fixed-item').addClass('with-indicators'); + } + } + + + // Don't double initialize. + if (view.hasClass('initialized')) { + // Recalculate variables + $(window).trigger('resize'); + + // Redraw carousel. + view.trigger('carouselNext', [0.000001]); + return true; + } + + + view.addClass('initialized'); + pressed = false; + offset = target = 0; + images = []; + item_width = view.find('.carousel-item').first().innerWidth(); + item_height = view.find('.carousel-item').first().innerHeight(); + dim = item_width * 2 + options.padding; + + view.find('.carousel-item').each(function (i) { + images.push($(this)[0]); + if (showIndicators) { + var $indicator = $('
            • '); + + // Add active to first by default. + if (i === 0) { + $indicator.addClass('active'); + } + + // Handle clicks on indicators. + $indicator.click(function (e) { + e.stopPropagation(); + + var index = $(this).index(); + cycleTo(index); + }); + $indicators.append($indicator); + } + }); + + if (showIndicators) { + view.append($indicators); + } + count = images.length; + + + function setupEvents() { + if (typeof window.ontouchstart !== 'undefined') { + view.on('touchstart.carousel', tap); + view.on('touchmove.carousel', drag); + view.on('touchend.carousel', release); + } + view.on('mousedown.carousel', tap); + view.on('mousemove.carousel', drag); + view.on('mouseup.carousel', release); + view.on('mouseleave.carousel', release); + view.on('click.carousel', click); + } + + function xpos(e) { + // touch event + if (e.targetTouches && (e.targetTouches.length >= 1)) { + return e.targetTouches[0].clientX; + } + + // mouse event + return e.clientX; + } + + function ypos(e) { + // touch event + if (e.targetTouches && (e.targetTouches.length >= 1)) { + return e.targetTouches[0].clientY; + } + + // mouse event + return e.clientY; + } + + function wrap(x) { + return (x >= count) ? (x % count) : (x < 0) ? wrap(count + (x % count)) : x; + } + + function scroll(x) { + // Track scrolling state + scrolling = true; + if (!view.hasClass('scrolling')) { + view.addClass('scrolling'); + } + if (scrollingTimeout != null) { + window.clearTimeout(scrollingTimeout); + } + scrollingTimeout = window.setTimeout(function() { + scrolling = false; + view.removeClass('scrolling'); + }, options.duration); + + // Start actual scroll + var i, half, delta, dir, tween, el, alignment, xTranslation; + var lastCenter = center; + + offset = (typeof x === 'number') ? x : offset; + center = Math.floor((offset + dim / 2) / dim); + delta = offset - center * dim; + dir = (delta < 0) ? 1 : -1; + tween = -dir * delta * 2 / dim; + half = count >> 1; + + if (!options.fullWidth) { + alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) '; + alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)'; + } else { + alignment = 'translateX(0)'; + } + + // Set indicator active + if (showIndicators) { + var diff = (center % count); + var activeIndicator = $indicators.find('.indicator-item.active'); + if (activeIndicator.index() !== diff) { + activeIndicator.removeClass('active'); + $indicators.find('.indicator-item').eq(diff).addClass('active'); + } + } + + // center + // Don't show wrapped items. + if (!noWrap || (center >= 0 && center < count)) { + el = images[wrap(center)]; + + // Add active class to center item. + if (!$(el).hasClass('active')) { + view.find('.carousel-item').removeClass('active'); + $(el).addClass('active'); + } + el.style[xform] = alignment + + ' translateX(' + (-delta / 2) + 'px)' + + ' translateX(' + (dir * options.shift * tween * i) + 'px)' + + ' translateZ(' + (options.dist * tween) + 'px)'; + el.style.zIndex = 0; + if (options.fullWidth) { tweenedOpacity = 1; } + else { tweenedOpacity = 1 - 0.2 * tween; } + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + + for (i = 1; i <= half; ++i) { + // right side + if (options.fullWidth) { + zTranslation = options.dist; + tweenedOpacity = (i === half && delta < 0) ? 1 - tween : 1; + } else { + zTranslation = options.dist * (i * 2 + tween * dir); + tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir); + } + // Don't show wrapped items. + if (!noWrap || center + i < count) { + el = images[wrap(center + i)]; + el.style[xform] = alignment + + ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' + + ' translateZ(' + zTranslation + 'px)'; + el.style.zIndex = -i; + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + + + // left side + if (options.fullWidth) { + zTranslation = options.dist; + tweenedOpacity = (i === half && delta > 0) ? 1 - tween : 1; + } else { + zTranslation = options.dist * (i * 2 - tween * dir); + tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir); + } + // Don't show wrapped items. + if (!noWrap || center - i >= 0) { + el = images[wrap(center - i)]; + el.style[xform] = alignment + + ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' + + ' translateZ(' + zTranslation + 'px)'; + el.style.zIndex = -i; + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + } + + // center + // Don't show wrapped items. + if (!noWrap || (center >= 0 && center < count)) { + el = images[wrap(center)]; + el.style[xform] = alignment + + ' translateX(' + (-delta / 2) + 'px)' + + ' translateX(' + (dir * options.shift * tween) + 'px)' + + ' translateZ(' + (options.dist * tween) + 'px)'; + el.style.zIndex = 0; + if (options.fullWidth) { tweenedOpacity = 1; } + else { tweenedOpacity = 1 - 0.2 * tween; } + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + + // onCycleTo callback + if (lastCenter !== center && + typeof(options.onCycleTo) === "function") { + var $curr_item = view.find('.carousel-item').eq(wrap(center)); + options.onCycleTo.call(this, $curr_item, dragged); + } + + // One time callback + if (typeof(oneTimeCallback) === "function") { + oneTimeCallback.call(this, $curr_item, dragged); + oneTimeCallback = null; + } + } + + function track() { + var now, elapsed, delta, v; + + now = Date.now(); + elapsed = now - timestamp; + timestamp = now; + delta = offset - frame; + frame = offset; + + v = 1000 * delta / (1 + elapsed); + velocity = 0.8 * v + 0.2 * velocity; + } + + function autoScroll() { + var elapsed, delta; + + if (amplitude) { + elapsed = Date.now() - timestamp; + delta = amplitude * Math.exp(-elapsed / options.duration); + if (delta > 2 || delta < -2) { + scroll(target - delta); + requestAnimationFrame(autoScroll); + } else { + scroll(target); + } + } + } + + function click(e) { + // Disable clicks if carousel was dragged. + if (dragged) { + e.preventDefault(); + e.stopPropagation(); + return false; + + } else if (!options.fullWidth) { + var clickedIndex = $(e.target).closest('.carousel-item').index(); + var diff = wrap(center) - clickedIndex; + + // Disable clicks if carousel was shifted by click + if (diff !== 0) { + e.preventDefault(); + e.stopPropagation(); + } + cycleTo(clickedIndex); + } + } + + function cycleTo(n) { + var diff = (center % count) - n; + + // Account for wraparound. + if (!noWrap) { + if (diff < 0) { + if (Math.abs(diff + count) < Math.abs(diff)) { diff += count; } + + } else if (diff > 0) { + if (Math.abs(diff - count) < diff) { diff -= count; } + } + } + + // Call prev or next accordingly. + if (diff < 0) { + view.trigger('carouselNext', [Math.abs(diff)]); + + } else if (diff > 0) { + view.trigger('carouselPrev', [diff]); + } + } + + function tap(e) { + // Fixes firefox draggable image bug + if (e.type === 'mousedown' && $(e.target).is('img')) { + e.preventDefault(); + } + pressed = true; + dragged = false; + vertical_dragged = false; + reference = xpos(e); + referenceY = ypos(e); + + velocity = amplitude = 0; + frame = offset; + timestamp = Date.now(); + clearInterval(ticker); + ticker = setInterval(track, 100); + } + + function drag(e) { + var x, delta, deltaY; + if (pressed) { + x = xpos(e); + y = ypos(e); + delta = reference - x; + deltaY = Math.abs(referenceY - y); + if (deltaY < 30 && !vertical_dragged) { + // If vertical scrolling don't allow dragging. + if (delta > 2 || delta < -2) { + dragged = true; + reference = x; + scroll(offset + delta); + } + + } else if (dragged) { + // If dragging don't allow vertical scroll. + e.preventDefault(); + e.stopPropagation(); + return false; + + } else { + // Vertical scrolling. + vertical_dragged = true; + } + } + + if (dragged) { + // If dragging don't allow vertical scroll. + e.preventDefault(); + e.stopPropagation(); + return false; + } + } + + function release(e) { + if (pressed) { + pressed = false; + } else { + return; + } + + clearInterval(ticker); + target = offset; + if (velocity > 10 || velocity < -10) { + amplitude = 0.9 * velocity; + target = offset + amplitude; + } + target = Math.round(target / dim) * dim; + + // No wrap of items. + if (noWrap) { + if (target >= dim * (count - 1)) { + target = dim * (count - 1); + } else if (target < 0) { + target = 0; + } + } + amplitude = target - offset; + timestamp = Date.now(); + requestAnimationFrame(autoScroll); + + if (dragged) { + e.preventDefault(); + e.stopPropagation(); + } + return false; + } + + xform = 'transform'; + ['webkit', 'Moz', 'O', 'ms'].every(function (prefix) { + var e = prefix + 'Transform'; + if (typeof document.body.style[e] !== 'undefined') { + xform = e; + return false; + } + return true; + }); + + + var throttledResize = Materialize.throttle(function() { + if (options.fullWidth) { + item_width = view.find('.carousel-item').first().innerWidth(); + var imageHeight = view.find('.carousel-item.active').height(); + dim = item_width * 2 + options.padding; + offset = center * 2 * item_width; + target = offset; + setCarouselHeight(true); + } else { + scroll(); + } + }, 200); + $(window) + .off('resize.carousel-'+uniqueNamespace) + .on('resize.carousel-'+uniqueNamespace, throttledResize); + + setupEvents(); + scroll(offset); + + $(this).on('carouselNext', function(e, n, callback) { + if (n === undefined) { + n = 1; + } + if (typeof(callback) === "function") { + oneTimeCallback = callback; + } + + target = (dim * Math.round(offset / dim)) + (dim * n); + if (offset !== target) { + amplitude = target - offset; + timestamp = Date.now(); + requestAnimationFrame(autoScroll); + } + }); + + $(this).on('carouselPrev', function(e, n, callback) { + if (n === undefined) { + n = 1; + } + if (typeof(callback) === "function") { + oneTimeCallback = callback; + } + + target = (dim * Math.round(offset / dim)) - (dim * n); + if (offset !== target) { + amplitude = target - offset; + timestamp = Date.now(); + requestAnimationFrame(autoScroll); + } + }); + + $(this).on('carouselSet', function(e, n, callback) { + if (n === undefined) { + n = 0; + } + if (typeof(callback) === "function") { + oneTimeCallback = callback; + } + + cycleTo(n); + }); + + }); + + + + }, + next : function(n, callback) { + $(this).trigger('carouselNext', [n, callback]); + }, + prev : function(n, callback) { + $(this).trigger('carouselPrev', [n, callback]); + }, + set : function(n, callback) { + $(this).trigger('carouselSet', [n, callback]); + }, + destroy : function() { + var uniqueNamespace = $(this).attr('data-namespace'); + $(this).removeAttr('data-namespace'); + $(this).removeClass('initialized'); + $(this).find('.indicators').remove(); + + // Remove event handlers + $(this).off('carouselNext carouselPrev carouselSet'); + $(window).off('resize.carousel-'+uniqueNamespace); + if (typeof window.ontouchstart !== 'undefined') { + $(this).off('touchstart.carousel touchmove.carousel touchend.carousel'); + } + $(this).off('mousedown.carousel mousemove.carousel mouseup.carousel mouseleave.carousel click.carousel'); + } + }; + + + $.fn.carousel = function(methodOrOptions) { + if ( methods[methodOrOptions] ) { + return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 )); + } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) { + // Default to "init" + return methods.init.apply( this, arguments ); + } else { + $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.carousel' ); + } + }; // Plugin end +}( jQuery )); diff --git a/app/dispatch/static/materialize/js/character_counter.js b/app/dispatch/static/materialize/js/character_counter.js new file mode 100644 index 0000000..5a36cdf --- /dev/null +++ b/app/dispatch/static/materialize/js/character_counter.js @@ -0,0 +1,72 @@ +(function ($) { + + $.fn.characterCounter = function(){ + return this.each(function(){ + var $input = $(this); + var $counterElement = $input.parent().find('span[class="character-counter"]'); + + // character counter has already been added appended to the parent container + if ($counterElement.length) { + return; + } + + var itHasLengthAttribute = $input.attr('data-length') !== undefined; + + if(itHasLengthAttribute){ + $input.on('input', updateCounter); + $input.on('focus', updateCounter); + $input.on('blur', removeCounterElement); + + addCounterElement($input); + } + + }); + }; + + function updateCounter(){ + var maxLength = +$(this).attr('data-length'), + actualLength = +$(this).val().length, + isValidLength = actualLength <= maxLength; + + $(this).parent().find('span[class="character-counter"]') + .html( actualLength + '/' + maxLength); + + addInputStyle(isValidLength, $(this)); + } + + function addCounterElement($input) { + var $counterElement = $input.parent().find('span[class="character-counter"]'); + + if ($counterElement.length) { + return; + } + + $counterElement = $('') + .addClass('character-counter') + .css('float','right') + .css('font-size','12px') + .css('height', 1); + + $input.parent().append($counterElement); + } + + function removeCounterElement(){ + $(this).parent().find('span[class="character-counter"]').html(''); + } + + function addInputStyle(isValidLength, $input){ + var inputHasInvalidClass = $input.hasClass('invalid'); + if (isValidLength && inputHasInvalidClass) { + $input.removeClass('invalid'); + } + else if(!isValidLength && !inputHasInvalidClass){ + $input.removeClass('valid'); + $input.addClass('invalid'); + } + } + + $(document).ready(function(){ + $('input, textarea').characterCounter(); + }); + +}( jQuery )); diff --git a/app/dispatch/static/materialize/js/chips.js b/app/dispatch/static/materialize/js/chips.js new file mode 100644 index 0000000..59c7d94 --- /dev/null +++ b/app/dispatch/static/materialize/js/chips.js @@ -0,0 +1,318 @@ +(function ($) { + var materialChipsDefaults = { + data: [], + placeholder: '', + secondaryPlaceholder: '', + autocompleteOptions: {}, + }; + + $(document).ready(function() { + // Handle removal of static chips. + $(document).on('click', '.chip .close', function(e){ + var $chips = $(this).closest('.chips'); + if ($chips.attr('data-initialized')) { + return; + } + $(this).closest('.chip').remove(); + }); + }); + + $.fn.material_chip = function (options) { + var self = this; + this.$el = $(this); + this.$document = $(document); + this.SELS = { + CHIPS: '.chips', + CHIP: '.chip', + INPUT: 'input', + DELETE: '.material-icons', + SELECTED_CHIP: '.selected', + }; + + if ('data' === options) { + return this.$el.data('chips'); + } + + var curr_options = $.extend({}, materialChipsDefaults, options); + self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteOptions.data); + + // Initialize + this.init = function() { + var i = 0; + var chips; + self.$el.each(function(){ + var $chips = $(this); + var chipId = Materialize.guid(); + self.chipId = chipId; + + if (!curr_options.data || !(curr_options.data instanceof Array)) { + curr_options.data = []; + } + $chips.data('chips', curr_options.data); + $chips.attr('data-index', i); + $chips.attr('data-initialized', true); + + if (!$chips.hasClass(self.SELS.CHIPS)) { + $chips.addClass('chips'); + } + + self.chips($chips, chipId); + i++; + }); + }; + + this.handleEvents = function() { + var SELS = self.SELS; + + self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function(e){ + $(e.target).find(SELS.INPUT).focus(); + }); + + self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function(e){ + var $chip = $(e.target); + if ($chip.length) { + var wasSelected = $chip.hasClass('selected'); + var $chips = $chip.closest(SELS.CHIPS); + $(SELS.CHIP).removeClass('selected'); + + if (!wasSelected) { + self.selectChip($chip.index(), $chips); + } + } + }); + + self.$document.off('keydown.chips').on('keydown.chips', function(e){ + if ($(e.target).is('input, textarea')) { + return; + } + + // delete + var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP); + var $chips = $chip.closest(SELS.CHIPS); + var length = $chip.siblings(SELS.CHIP).length; + var index; + + if (!$chip.length) { + return; + } + + if (e.which === 8 || e.which === 46) { + e.preventDefault(); + + index = $chip.index(); + self.deleteChip(index, $chips); + + var selectIndex = null; + if ((index + 1) < length) { + selectIndex = index; + } else if (index === length || (index + 1) === length) { + selectIndex = length - 1; + } + + if (selectIndex < 0) selectIndex = null; + + if (null !== selectIndex) { + self.selectChip(selectIndex, $chips); + } + if (!length) $chips.find('input').focus(); + + // left + } else if (e.which === 37) { + index = $chip.index() - 1; + if (index < 0) { + return; + } + $(SELS.CHIP).removeClass('selected'); + self.selectChip(index, $chips); + + // right + } else if (e.which === 39) { + index = $chip.index() + 1; + $(SELS.CHIP).removeClass('selected'); + if (index > length) { + $chips.find('input').focus(); + return; + } + self.selectChip(index, $chips); + } + }); + + self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function(e){ + var $currChips = $(e.target).closest(SELS.CHIPS); + $currChips.addClass('focus'); + $currChips.siblings('label, .prefix').addClass('active'); + $(SELS.CHIP).removeClass('selected'); + }); + + self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function(e){ + var $currChips = $(e.target).closest(SELS.CHIPS); + $currChips.removeClass('focus'); + + // Remove active if empty + if ($currChips.data('chips') === undefined || !$currChips.data('chips').length) { + $currChips.siblings('label').removeClass('active'); + } + $currChips.siblings('.prefix').removeClass('active'); + }); + + self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function(e){ + var $target = $(e.target); + var $chips = $target.closest(SELS.CHIPS); + var chipsLength = $chips.children(SELS.CHIP).length; + + // enter + if (13 === e.which) { + // Override enter if autocompleting. + if (self.hasAutocomplete && + $chips.find('.autocomplete-content.dropdown-content').length && + $chips.find('.autocomplete-content.dropdown-content').children().length) { + return; + } + + e.preventDefault(); + self.addChip({tag: $target.val()}, $chips); + $target.val(''); + return; + } + + // delete or left + if ((8 === e.keyCode || 37 === e.keyCode) && '' === $target.val() && chipsLength) { + e.preventDefault(); + self.selectChip(chipsLength - 1, $chips); + $target.blur(); + return; + } + }); + + // Click on delete icon in chip. + self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function(e) { + var $target = $(e.target); + var $chips = $target.closest(SELS.CHIPS); + var $chip = $target.closest(SELS.CHIP); + e.stopPropagation(); + self.deleteChip($chip.index(), $chips); + $chips.find('input').focus(); + }); + }; + + this.chips = function($chips, chipId) { + $chips.empty(); + $chips.data('chips').forEach(function(elem){ + $chips.append(self.renderChip(elem)); + }); + $chips.append($('')); + self.setPlaceholder($chips); + + // Set for attribute for label + var label = $chips.next('label'); + if (label.length) { + label.attr('for', chipId); + + if ($chips.data('chips')!== undefined && $chips.data('chips').length) { + label.addClass('active'); + } + } + + // Setup autocomplete if needed. + var input = $('#' + chipId); + if (self.hasAutocomplete) { + curr_options.autocompleteOptions.onAutocomplete = function(val) { + self.addChip({tag: val}, $chips); + input.val(''); + input.focus(); + } + input.autocomplete(curr_options.autocompleteOptions); + } + }; + + /** + * Render chip jQuery element. + * @param {Object} elem + * @return {jQuery} + */ + this.renderChip = function(elem) { + if (!elem.tag) return; + + var $renderedChip = $('
              '); + $renderedChip.text(elem.tag); + if (elem.image) { + $renderedChip.prepend($('').attr('src', elem.image)) + } + $renderedChip.append($('close')); + return $renderedChip; + }; + + this.setPlaceholder = function($chips) { + if (($chips.data('chips') !== undefined && !$chips.data('chips').length) && curr_options.placeholder) { + $chips.find('input').prop('placeholder', curr_options.placeholder); + + } else if (($chips.data('chips') === undefined || !!$chips.data('chips').length) && curr_options.secondaryPlaceholder) { + $chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder); + } + }; + + this.isValid = function($chips, elem) { + var chips = $chips.data('chips'); + var exists = false; + for (var i=0; i < chips.length; i++) { + if (chips[i].tag === elem.tag) { + exists = true; + return; + } + } + return '' !== elem.tag && !exists; + }; + + this.addChip = function(elem, $chips) { + if (!self.isValid($chips, elem)) { + return; + } + var $renderedChip = self.renderChip(elem); + var newData = []; + var oldData = $chips.data('chips'); + for (var i = 0; i < oldData.length; i++) { + newData.push(oldData[i]); + } + newData.push(elem); + + $chips.data('chips', newData); + $renderedChip.insertBefore($chips.find('input')); + $chips.trigger('chip.add', elem); + self.setPlaceholder($chips); + }; + + this.deleteChip = function(chipIndex, $chips) { + var chip = $chips.data('chips')[chipIndex]; + $chips.find('.chip').eq(chipIndex).remove(); + + var newData = []; + var oldData = $chips.data('chips'); + for (var i = 0; i < oldData.length; i++) { + if (i !== chipIndex) { + newData.push(oldData[i]); + } + } + + $chips.data('chips', newData); + $chips.trigger('chip.delete', chip); + self.setPlaceholder($chips); + }; + + this.selectChip = function(chipIndex, $chips) { + var $chip = $chips.find('.chip').eq(chipIndex); + if ($chip && false === $chip.hasClass('selected')) { + $chip.addClass('selected'); + $chips.trigger('chip.select', $chips.data('chips')[chipIndex]); + } + }; + + this.getChipsElement = function(index, $chips) { + return $chips.eq(index); + }; + + // init + this.init(); + + this.handleEvents(); + }; +}( jQuery )); diff --git a/app/dispatch/static/materialize/js/collapsible.js b/app/dispatch/static/materialize/js/collapsible.js new file mode 100644 index 0000000..8782ea2 --- /dev/null +++ b/app/dispatch/static/materialize/js/collapsible.js @@ -0,0 +1,183 @@ +(function ($) { + $.fn.collapsible = function(options, methodParam) { + var defaults = { + accordion: undefined, + onOpen: undefined, + onClose: undefined + }; + + var methodName = options; + options = $.extend(defaults, options); + + + return this.each(function() { + + var $this = $(this); + + var $panel_headers = $(this).find('> li > .collapsible-header'); + + var collapsible_type = $this.data("collapsible"); + + /**************** + Helper Functions + ****************/ + + // Accordion Open + function accordionOpen(object) { + $panel_headers = $this.find('> li > .collapsible-header'); + if (object.hasClass('active')) { + object.parent().addClass('active'); + } + else { + object.parent().removeClass('active'); + } + if (object.parent().hasClass('active')){ + object.siblings('.collapsible-body').stop(true,false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}}); + } + else{ + object.siblings('.collapsible-body').stop(true,false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}}); + } + + $panel_headers.not(object).removeClass('active').parent().removeClass('active'); + + // Close previously open accordion elements. + $panel_headers.not(object).parent().children('.collapsible-body').stop(true,false).each(function() { + if ($(this).is(':visible')) { + $(this).slideUp({ + duration: 350, + easing: "easeOutQuart", + queue: false, + complete: + function() { + $(this).css('height', ''); + execCallbacks($(this).siblings('.collapsible-header')); + } + }); + } + }); + } + + // Expandable Open + function expandableOpen(object) { + if (object.hasClass('active')) { + object.parent().addClass('active'); + } + else { + object.parent().removeClass('active'); + } + if (object.parent().hasClass('active')){ + object.siblings('.collapsible-body').stop(true,false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}}); + } + else { + object.siblings('.collapsible-body').stop(true,false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}}); + } + } + + // Open collapsible. object: .collapsible-header + function collapsibleOpen(object, noToggle) { + if (!noToggle) { + object.toggleClass('active'); + } + + if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion + accordionOpen(object); + } else { // Handle Expandables + expandableOpen(object); + } + + execCallbacks(object); + } + + // Handle callbacks + function execCallbacks(object) { + if (object.hasClass('active')) { + if (typeof(options.onOpen) === "function") { + options.onOpen.call(this, object.parent()); + } + } else { + if (typeof(options.onClose) === "function") { + options.onClose.call(this, object.parent()); + } + } + } + + /** + * Check if object is children of panel header + * @param {Object} object Jquery object + * @return {Boolean} true if it is children + */ + function isChildrenOfPanelHeader(object) { + + var panelHeader = getPanelHeader(object); + + return panelHeader.length > 0; + } + + /** + * Get panel header from a children element + * @param {Object} object Jquery object + * @return {Object} panel header object + */ + function getPanelHeader(object) { + + return object.closest('li > .collapsible-header'); + } + + + // Turn off any existing event handlers + function removeEventHandlers() { + $this.off('click.collapse', '> li > .collapsible-header'); + } + + /***** End Helper Functions *****/ + + + // Methods + if (methodName === 'destroy') { + removeEventHandlers(); + return; + } else if (methodParam >= 0 && + methodParam < $panel_headers.length) { + var $curr_header = $panel_headers.eq(methodParam); + if ($curr_header.length && + (methodName === 'open' || + (methodName === 'close' && + $curr_header.hasClass('active')))) { + collapsibleOpen($curr_header); + } + return; + } + + + removeEventHandlers(); + + + // Add click handler to only direct collapsible header children + $this.on('click.collapse', '> li > .collapsible-header', function(e) { + var element = $(e.target); + + if (isChildrenOfPanelHeader(element)) { + element = getPanelHeader(element); + } + + collapsibleOpen(element); + }); + + + // Open first active + if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion + collapsibleOpen($panel_headers.filter('.active').first(), true); + + } else { // Handle Expandables + $panel_headers.filter('.active').each(function() { + collapsibleOpen($(this), true); + }); + } + + }); + }; + + $(document).ready(function(){ + $('.collapsible').collapsible(); + }); +}( jQuery )); \ No newline at end of file diff --git a/app/dispatch/static/materialize/js/date_picker/picker.date.js b/app/dispatch/static/materialize/js/date_picker/picker.date.js new file mode 100644 index 0000000..1a7fbe9 --- /dev/null +++ b/app/dispatch/static/materialize/js/date_picker/picker.date.js @@ -0,0 +1,1429 @@ +/*! + * Date picker for pickadate.js v3.5.0 + * http://amsul.github.io/pickadate.js/date.htm + */ + +(function ( factory ) { + factory( Materialize.Picker, jQuery ) + +}(function( Picker, $ ) { + + +/** + * Globals and constants + */ +var DAYS_IN_WEEK = 7, + WEEKS_IN_CALENDAR = 6, + _ = Picker._; + + + +/** + * The date picker constructor + */ +function DatePicker( picker, settings ) { + + var calendar = this, + element = picker.$node[ 0 ], + elementValue = element.value, + elementDataValue = picker.$node.data( 'value' ), + valueString = elementDataValue || elementValue, + formatString = elementDataValue ? settings.formatSubmit : settings.format, + isRTL = function() { + + return element.currentStyle ? + + // For IE. + element.currentStyle.direction == 'rtl' : + + // For normal browsers. + getComputedStyle( picker.$root[0] ).direction == 'rtl' + } + + calendar.settings = settings + calendar.$node = picker.$node + + // The queue of methods that will be used to build item objects. + calendar.queue = { + min: 'measure create', + max: 'measure create', + now: 'now create', + select: 'parse create validate', + highlight: 'parse navigate create validate', + view: 'parse create validate viewset', + disable: 'deactivate', + enable: 'activate' + } + + // The component's item object. + calendar.item = {} + + calendar.item.clear = null + calendar.item.disable = ( settings.disable || [] ).slice( 0 ) + calendar.item.enable = -(function( collectionDisabled ) { + return collectionDisabled[ 0 ] === true ? collectionDisabled.shift() : -1 + })( calendar.item.disable ) + + calendar. + set( 'min', settings.min ). + set( 'max', settings.max ). + set( 'now' ) + + // When there’s a value, set the `select`, which in turn + // also sets the `highlight` and `view`. + if ( valueString ) { + calendar.set( 'select', valueString, { format: formatString }) + } + + // If there’s no value, default to highlighting “today”. + else { + calendar. + set( 'select', null ). + set( 'highlight', calendar.item.now ) + } + + + // The keycode to movement mapping. + calendar.key = { + 40: 7, // Down + 38: -7, // Up + 39: function() { return isRTL() ? -1 : 1 }, // Right + 37: function() { return isRTL() ? 1 : -1 }, // Left + go: function( timeChange ) { + var highlightedObject = calendar.item.highlight, + targetDate = new Date( highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange ) + calendar.set( + 'highlight', + targetDate, + { interval: timeChange } + ) + this.render() + } + } + + + // Bind some picker events. + picker. + on( 'render', function() { + picker.$root.find( '.' + settings.klass.selectMonth ).on( 'change', function() { + var value = this.value + if ( value ) { + picker.set( 'highlight', [ picker.get( 'view' ).year, value, picker.get( 'highlight' ).date ] ) + picker.$root.find( '.' + settings.klass.selectMonth ).trigger( 'focus' ) + } + }) + picker.$root.find( '.' + settings.klass.selectYear ).on( 'change', function() { + var value = this.value + if ( value ) { + picker.set( 'highlight', [ value, picker.get( 'view' ).month, picker.get( 'highlight' ).date ] ) + picker.$root.find( '.' + settings.klass.selectYear ).trigger( 'focus' ) + } + }) + }, 1 ). + on( 'open', function() { + var includeToday = '' + if ( calendar.disabled( calendar.get('now') ) ) { + includeToday = ':not(.' + settings.klass.buttonToday + ')' + } + picker.$root.find( 'button' + includeToday + ', select' ).attr( 'disabled', false ) + }, 1 ). + on( 'close', function() { + picker.$root.find( 'button, select' ).attr( 'disabled', true ) + }, 1 ) + +} //DatePicker + + +/** + * Set a datepicker item object. + */ +DatePicker.prototype.set = function( type, value, options ) { + + var calendar = this, + calendarItem = calendar.item + + // If the value is `null` just set it immediately. + if ( value === null ) { + if ( type == 'clear' ) type = 'select' + calendarItem[ type ] = value + return calendar + } + + // Otherwise go through the queue of methods, and invoke the functions. + // Update this as the time unit, and set the final value as this item. + // * In the case of `enable`, keep the queue but set `disable` instead. + // And in the case of `flip`, keep the queue but set `enable` instead. + calendarItem[ ( type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type ) ] = calendar.queue[ type ].split( ' ' ).map( function( method ) { + value = calendar[ method ]( type, value, options ) + return value + }).pop() + + // Check if we need to cascade through more updates. + if ( type == 'select' ) { + calendar.set( 'highlight', calendarItem.select, options ) + } + else if ( type == 'highlight' ) { + calendar.set( 'view', calendarItem.highlight, options ) + } + else if ( type.match( /^(flip|min|max|disable|enable)$/ ) ) { + if ( calendarItem.select && calendar.disabled( calendarItem.select ) ) { + calendar.set( 'select', calendarItem.select, options ) + } + if ( calendarItem.highlight && calendar.disabled( calendarItem.highlight ) ) { + calendar.set( 'highlight', calendarItem.highlight, options ) + } + } + + return calendar +} //DatePicker.prototype.set + + +/** + * Get a datepicker item object. + */ +DatePicker.prototype.get = function( type ) { + return this.item[ type ] +} //DatePicker.prototype.get + + +/** + * Create a picker date object. + */ +DatePicker.prototype.create = function( type, value, options ) { + + var isInfiniteValue, + calendar = this + + // If there’s no value, use the type as the value. + value = value === undefined ? type : value + + + // If it’s infinity, update the value. + if ( value == -Infinity || value == Infinity ) { + isInfiniteValue = value + } + + // If it’s an object, use the native date object. + else if ( $.isPlainObject( value ) && _.isInteger( value.pick ) ) { + value = value.obj + } + + // If it’s an array, convert it into a date and make sure + // that it’s a valid date – otherwise default to today. + else if ( $.isArray( value ) ) { + value = new Date( value[ 0 ], value[ 1 ], value[ 2 ] ) + value = _.isDate( value ) ? value : calendar.create().obj + } + + // If it’s a number or date object, make a normalized date. + else if ( _.isInteger( value ) || _.isDate( value ) ) { + value = calendar.normalize( new Date( value ), options ) + } + + // If it’s a literal true or any other case, set it to now. + else /*if ( value === true )*/ { + value = calendar.now( type, value, options ) + } + + // Return the compiled object. + return { + year: isInfiniteValue || value.getFullYear(), + month: isInfiniteValue || value.getMonth(), + date: isInfiniteValue || value.getDate(), + day: isInfiniteValue || value.getDay(), + obj: isInfiniteValue || value, + pick: isInfiniteValue || value.getTime() + } +} //DatePicker.prototype.create + + +/** + * Create a range limit object using an array, date object, + * literal “true”, or integer relative to another time. + */ +DatePicker.prototype.createRange = function( from, to ) { + + var calendar = this, + createDate = function( date ) { + if ( date === true || $.isArray( date ) || _.isDate( date ) ) { + return calendar.create( date ) + } + return date + } + + // Create objects if possible. + if ( !_.isInteger( from ) ) { + from = createDate( from ) + } + if ( !_.isInteger( to ) ) { + to = createDate( to ) + } + + // Create relative dates. + if ( _.isInteger( from ) && $.isPlainObject( to ) ) { + from = [ to.year, to.month, to.date + from ]; + } + else if ( _.isInteger( to ) && $.isPlainObject( from ) ) { + to = [ from.year, from.month, from.date + to ]; + } + + return { + from: createDate( from ), + to: createDate( to ) + } +} //DatePicker.prototype.createRange + + +/** + * Check if a date unit falls within a date range object. + */ +DatePicker.prototype.withinRange = function( range, dateUnit ) { + range = this.createRange(range.from, range.to) + return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick +} + + +/** + * Check if two date range objects overlap. + */ +DatePicker.prototype.overlapRanges = function( one, two ) { + + var calendar = this + + // Convert the ranges into comparable dates. + one = calendar.createRange( one.from, one.to ) + two = calendar.createRange( two.from, two.to ) + + return calendar.withinRange( one, two.from ) || calendar.withinRange( one, two.to ) || + calendar.withinRange( two, one.from ) || calendar.withinRange( two, one.to ) +} + + +/** + * Get the date today. + */ +DatePicker.prototype.now = function( type, value, options ) { + value = new Date() + if ( options && options.rel ) { + value.setDate( value.getDate() + options.rel ) + } + return this.normalize( value, options ) +} + + +/** + * Navigate to next/prev month. + */ +DatePicker.prototype.navigate = function( type, value, options ) { + + var targetDateObject, + targetYear, + targetMonth, + targetDate, + isTargetArray = $.isArray( value ), + isTargetObject = $.isPlainObject( value ), + viewsetObject = this.item.view/*, + safety = 100*/ + + + if ( isTargetArray || isTargetObject ) { + + if ( isTargetObject ) { + targetYear = value.year + targetMonth = value.month + targetDate = value.date + } + else { + targetYear = +value[0] + targetMonth = +value[1] + targetDate = +value[2] + } + + // If we’re navigating months but the view is in a different + // month, navigate to the view’s year and month. + if ( options && options.nav && viewsetObject && viewsetObject.month !== targetMonth ) { + targetYear = viewsetObject.year + targetMonth = viewsetObject.month + } + + // Figure out the expected target year and month. + targetDateObject = new Date( targetYear, targetMonth + ( options && options.nav ? options.nav : 0 ), 1 ) + targetYear = targetDateObject.getFullYear() + targetMonth = targetDateObject.getMonth() + + // If the month we’re going to doesn’t have enough days, + // keep decreasing the date until we reach the month’s last date. + while ( /*safety &&*/ new Date( targetYear, targetMonth, targetDate ).getMonth() !== targetMonth ) { + targetDate -= 1 + /*safety -= 1 + if ( !safety ) { + throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.' + }*/ + } + + value = [ targetYear, targetMonth, targetDate ] + } + + return value +} //DatePicker.prototype.navigate + + +/** + * Normalize a date by setting the hours to midnight. + */ +DatePicker.prototype.normalize = function( value/*, options*/ ) { + value.setHours( 0, 0, 0, 0 ) + return value +} + + +/** + * Measure the range of dates. + */ +DatePicker.prototype.measure = function( type, value/*, options*/ ) { + + var calendar = this + + // If it’s anything false-y, remove the limits. + if ( !value ) { + value = type == 'min' ? -Infinity : Infinity + } + + // If it’s a string, parse it. + else if ( typeof value == 'string' ) { + value = calendar.parse( type, value ) + } + + // If it's an integer, get a date relative to today. + else if ( _.isInteger( value ) ) { + value = calendar.now( type, value, { rel: value } ) + } + + return value +} ///DatePicker.prototype.measure + + +/** + * Create a viewset object based on navigation. + */ +DatePicker.prototype.viewset = function( type, dateObject/*, options*/ ) { + return this.create([ dateObject.year, dateObject.month, 1 ]) +} + + +/** + * Validate a date as enabled and shift if needed. + */ +DatePicker.prototype.validate = function( type, dateObject, options ) { + + var calendar = this, + + // Keep a reference to the original date. + originalDateObject = dateObject, + + // Make sure we have an interval. + interval = options && options.interval ? options.interval : 1, + + // Check if the calendar enabled dates are inverted. + isFlippedBase = calendar.item.enable === -1, + + // Check if we have any enabled dates after/before now. + hasEnabledBeforeTarget, hasEnabledAfterTarget, + + // The min & max limits. + minLimitObject = calendar.item.min, + maxLimitObject = calendar.item.max, + + // Check if we’ve reached the limit during shifting. + reachedMin, reachedMax, + + // Check if the calendar is inverted and at least one weekday is enabled. + hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter( function( value ) { + + // If there’s a date, check where it is relative to the target. + if ( $.isArray( value ) ) { + var dateTime = calendar.create( value ).pick + if ( dateTime < dateObject.pick ) hasEnabledBeforeTarget = true + else if ( dateTime > dateObject.pick ) hasEnabledAfterTarget = true + } + + // Return only integers for enabled weekdays. + return _.isInteger( value ) + }).length/*, + + safety = 100*/ + + + + // Cases to validate for: + // [1] Not inverted and date disabled. + // [2] Inverted and some dates enabled. + // [3] Not inverted and out of range. + // + // Cases to **not** validate for: + // • Navigating months. + // • Not inverted and date enabled. + // • Inverted and all dates disabled. + // • ..and anything else. + if ( !options || !options.nav ) if ( + /* 1 */ ( !isFlippedBase && calendar.disabled( dateObject ) ) || + /* 2 */ ( isFlippedBase && calendar.disabled( dateObject ) && ( hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget ) ) || + /* 3 */ ( !isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick) ) + ) { + + + // When inverted, flip the direction if there aren’t any enabled weekdays + // and there are no enabled dates in the direction of the interval. + if ( isFlippedBase && !hasEnabledWeekdays && ( ( !hasEnabledAfterTarget && interval > 0 ) || ( !hasEnabledBeforeTarget && interval < 0 ) ) ) { + interval *= -1 + } + + + // Keep looping until we reach an enabled date. + while ( /*safety &&*/ calendar.disabled( dateObject ) ) { + + /*safety -= 1 + if ( !safety ) { + throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.' + }*/ + + + // If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval. + if ( Math.abs( interval ) > 1 && ( dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month ) ) { + dateObject = originalDateObject + interval = interval > 0 ? 1 : -1 + } + + + // If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit. + if ( dateObject.pick <= minLimitObject.pick ) { + reachedMin = true + interval = 1 + dateObject = calendar.create([ + minLimitObject.year, + minLimitObject.month, + minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1) + ]) + } + else if ( dateObject.pick >= maxLimitObject.pick ) { + reachedMax = true + interval = -1 + dateObject = calendar.create([ + maxLimitObject.year, + maxLimitObject.month, + maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1) + ]) + } + + + // If we’ve reached both limits, just break out of the loop. + if ( reachedMin && reachedMax ) { + break + } + + + // Finally, create the shifted date using the interval and keep looping. + dateObject = calendar.create([ dateObject.year, dateObject.month, dateObject.date + interval ]) + } + + } //endif + + + // Return the date object settled on. + return dateObject +} //DatePicker.prototype.validate + + +/** + * Check if a date is disabled. + */ +DatePicker.prototype.disabled = function( dateToVerify ) { + + var + calendar = this, + + // Filter through the disabled dates to check if this is one. + isDisabledMatch = calendar.item.disable.filter( function( dateToDisable ) { + + // If the date is a number, match the weekday with 0index and `firstDay` check. + if ( _.isInteger( dateToDisable ) ) { + return dateToVerify.day === ( calendar.settings.firstDay ? dateToDisable : dateToDisable - 1 ) % 7 + } + + // If it’s an array or a native JS date, create and match the exact date. + if ( $.isArray( dateToDisable ) || _.isDate( dateToDisable ) ) { + return dateToVerify.pick === calendar.create( dateToDisable ).pick + } + + // If it’s an object, match a date within the “from” and “to” range. + if ( $.isPlainObject( dateToDisable ) ) { + return calendar.withinRange( dateToDisable, dateToVerify ) + } + }) + + // If this date matches a disabled date, confirm it’s not inverted. + isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function( dateToDisable ) { + return $.isArray( dateToDisable ) && dateToDisable[3] == 'inverted' || + $.isPlainObject( dateToDisable ) && dateToDisable.inverted + }).length + + // Check the calendar “enabled” flag and respectively flip the + // disabled state. Then also check if it’s beyond the min/max limits. + return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch || + dateToVerify.pick < calendar.item.min.pick || + dateToVerify.pick > calendar.item.max.pick + +} //DatePicker.prototype.disabled + + +/** + * Parse a string into a usable type. + */ +DatePicker.prototype.parse = function( type, value, options ) { + + var calendar = this, + parsingObject = {} + + // If it’s already parsed, we’re good. + if ( !value || typeof value != 'string' ) { + return value + } + + // We need a `.format` to parse the value with. + if ( !( options && options.format ) ) { + options = options || {} + options.format = calendar.settings.format + } + + // Convert the format into an array and then map through it. + calendar.formats.toArray( options.format ).map( function( label ) { + + var + // Grab the formatting label. + formattingLabel = calendar.formats[ label ], + + // The format length is from the formatting label function or the + // label length without the escaping exclamation (!) mark. + formatLength = formattingLabel ? _.trigger( formattingLabel, calendar, [ value, parsingObject ] ) : label.replace( /^!/, '' ).length + + // If there's a format label, split the value up to the format length. + // Then add it to the parsing object with appropriate label. + if ( formattingLabel ) { + parsingObject[ label ] = value.substr( 0, formatLength ) + } + + // Update the value as the substring from format length to end. + value = value.substr( formatLength ) + }) + + // Compensate for month 0index. + return [ + parsingObject.yyyy || parsingObject.yy, + +( parsingObject.mm || parsingObject.m ) - 1, + parsingObject.dd || parsingObject.d + ] +} //DatePicker.prototype.parse + + +/** + * Various formats to display the object in. + */ +DatePicker.prototype.formats = (function() { + + // Return the length of the first word in a collection. + function getWordLengthFromCollection( string, collection, dateObject ) { + + // Grab the first word from the string. + var word = string.match( /\w+/ )[ 0 ] + + // If there's no month index, add it to the date object + if ( !dateObject.mm && !dateObject.m ) { + dateObject.m = collection.indexOf( word ) + 1 + } + + // Return the length of the word. + return word.length + } + + // Get the length of the first word in a string. + function getFirstWordLength( string ) { + return string.match( /\w+/ )[ 0 ].length + } + + return { + + d: function( string, dateObject ) { + + // If there's string, then get the digits length. + // Otherwise return the selected date. + return string ? _.digits( string ) : dateObject.date + }, + dd: function( string, dateObject ) { + + // If there's a string, then the length is always 2. + // Otherwise return the selected date with a leading zero. + return string ? 2 : _.lead( dateObject.date ) + }, + ddd: function( string, dateObject ) { + + // If there's a string, then get the length of the first word. + // Otherwise return the short selected weekday. + return string ? getFirstWordLength( string ) : this.settings.weekdaysShort[ dateObject.day ] + }, + dddd: function( string, dateObject ) { + + // If there's a string, then get the length of the first word. + // Otherwise return the full selected weekday. + return string ? getFirstWordLength( string ) : this.settings.weekdaysFull[ dateObject.day ] + }, + m: function( string, dateObject ) { + + // If there's a string, then get the length of the digits + // Otherwise return the selected month with 0index compensation. + return string ? _.digits( string ) : dateObject.month + 1 + }, + mm: function( string, dateObject ) { + + // If there's a string, then the length is always 2. + // Otherwise return the selected month with 0index and leading zero. + return string ? 2 : _.lead( dateObject.month + 1 ) + }, + mmm: function( string, dateObject ) { + + var collection = this.settings.monthsShort + + // If there's a string, get length of the relevant month from the short + // months collection. Otherwise return the selected month from that collection. + return string ? getWordLengthFromCollection( string, collection, dateObject ) : collection[ dateObject.month ] + }, + mmmm: function( string, dateObject ) { + + var collection = this.settings.monthsFull + + // If there's a string, get length of the relevant month from the full + // months collection. Otherwise return the selected month from that collection. + return string ? getWordLengthFromCollection( string, collection, dateObject ) : collection[ dateObject.month ] + }, + yy: function( string, dateObject ) { + + // If there's a string, then the length is always 2. + // Otherwise return the selected year by slicing out the first 2 digits. + return string ? 2 : ( '' + dateObject.year ).slice( 2 ) + }, + yyyy: function( string, dateObject ) { + + // If there's a string, then the length is always 4. + // Otherwise return the selected year. + return string ? 4 : dateObject.year + }, + + // Create an array by splitting the formatting string passed. + toArray: function( formatString ) { return formatString.split( /(d{1,4}|m{1,4}|y{4}|yy|!.)/g ) }, + + // Format an object into a string using the formatting options. + toString: function ( formatString, itemObject ) { + var calendar = this + return calendar.formats.toArray( formatString ).map( function( label ) { + return _.trigger( calendar.formats[ label ], calendar, [ 0, itemObject ] ) || label.replace( /^!/, '' ) + }).join( '' ) + } + } +})() //DatePicker.prototype.formats + + + + +/** + * Check if two date units are the exact. + */ +DatePicker.prototype.isDateExact = function( one, two ) { + + var calendar = this + + // When we’re working with weekdays, do a direct comparison. + if ( + ( _.isInteger( one ) && _.isInteger( two ) ) || + ( typeof one == 'boolean' && typeof two == 'boolean' ) + ) { + return one === two + } + + // When we’re working with date representations, compare the “pick” value. + if ( + ( _.isDate( one ) || $.isArray( one ) ) && + ( _.isDate( two ) || $.isArray( two ) ) + ) { + return calendar.create( one ).pick === calendar.create( two ).pick + } + + // When we’re working with range objects, compare the “from” and “to”. + if ( $.isPlainObject( one ) && $.isPlainObject( two ) ) { + return calendar.isDateExact( one.from, two.from ) && calendar.isDateExact( one.to, two.to ) + } + + return false +} + + +/** + * Check if two date units overlap. + */ +DatePicker.prototype.isDateOverlap = function( one, two ) { + + var calendar = this, + firstDay = calendar.settings.firstDay ? 1 : 0 + + // When we’re working with a weekday index, compare the days. + if ( _.isInteger( one ) && ( _.isDate( two ) || $.isArray( two ) ) ) { + one = one % 7 + firstDay + return one === calendar.create( two ).day + 1 + } + if ( _.isInteger( two ) && ( _.isDate( one ) || $.isArray( one ) ) ) { + two = two % 7 + firstDay + return two === calendar.create( one ).day + 1 + } + + // When we’re working with range objects, check if the ranges overlap. + if ( $.isPlainObject( one ) && $.isPlainObject( two ) ) { + return calendar.overlapRanges( one, two ) + } + + return false +} + + +/** + * Flip the “enabled” state. + */ +DatePicker.prototype.flipEnable = function(val) { + var itemObject = this.item + itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1) +} + + +/** + * Mark a collection of dates as “disabled”. + */ +DatePicker.prototype.deactivate = function( type, datesToDisable ) { + + var calendar = this, + disabledItems = calendar.item.disable.slice(0) + + + // If we’re flipping, that’s all we need to do. + if ( datesToDisable == 'flip' ) { + calendar.flipEnable() + } + + else if ( datesToDisable === false ) { + calendar.flipEnable(1) + disabledItems = [] + } + + else if ( datesToDisable === true ) { + calendar.flipEnable(-1) + disabledItems = [] + } + + // Otherwise go through the dates to disable. + else { + + datesToDisable.map(function( unitToDisable ) { + + var matchFound + + // When we have disabled items, check for matches. + // If something is matched, immediately break out. + for ( var index = 0; index < disabledItems.length; index += 1 ) { + if ( calendar.isDateExact( unitToDisable, disabledItems[index] ) ) { + matchFound = true + break + } + } + + // If nothing was found, add the validated unit to the collection. + if ( !matchFound ) { + if ( + _.isInteger( unitToDisable ) || + _.isDate( unitToDisable ) || + $.isArray( unitToDisable ) || + ( $.isPlainObject( unitToDisable ) && unitToDisable.from && unitToDisable.to ) + ) { + disabledItems.push( unitToDisable ) + } + } + }) + } + + // Return the updated collection. + return disabledItems +} //DatePicker.prototype.deactivate + + +/** + * Mark a collection of dates as “enabled”. + */ +DatePicker.prototype.activate = function( type, datesToEnable ) { + + var calendar = this, + disabledItems = calendar.item.disable, + disabledItemsCount = disabledItems.length + + // If we’re flipping, that’s all we need to do. + if ( datesToEnable == 'flip' ) { + calendar.flipEnable() + } + + else if ( datesToEnable === true ) { + calendar.flipEnable(1) + disabledItems = [] + } + + else if ( datesToEnable === false ) { + calendar.flipEnable(-1) + disabledItems = [] + } + + // Otherwise go through the disabled dates. + else { + + datesToEnable.map(function( unitToEnable ) { + + var matchFound, + disabledUnit, + index, + isExactRange + + // Go through the disabled items and try to find a match. + for ( index = 0; index < disabledItemsCount; index += 1 ) { + + disabledUnit = disabledItems[index] + + // When an exact match is found, remove it from the collection. + if ( calendar.isDateExact( disabledUnit, unitToEnable ) ) { + matchFound = disabledItems[index] = null + isExactRange = true + break + } + + // When an overlapped match is found, add the “inverted” state to it. + else if ( calendar.isDateOverlap( disabledUnit, unitToEnable ) ) { + if ( $.isPlainObject( unitToEnable ) ) { + unitToEnable.inverted = true + matchFound = unitToEnable + } + else if ( $.isArray( unitToEnable ) ) { + matchFound = unitToEnable + if ( !matchFound[3] ) matchFound.push( 'inverted' ) + } + else if ( _.isDate( unitToEnable ) ) { + matchFound = [ unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted' ] + } + break + } + } + + // If a match was found, remove a previous duplicate entry. + if ( matchFound ) for ( index = 0; index < disabledItemsCount; index += 1 ) { + if ( calendar.isDateExact( disabledItems[index], unitToEnable ) ) { + disabledItems[index] = null + break + } + } + + // In the event that we’re dealing with an exact range of dates, + // make sure there are no “inverted” dates because of it. + if ( isExactRange ) for ( index = 0; index < disabledItemsCount; index += 1 ) { + if ( calendar.isDateOverlap( disabledItems[index], unitToEnable ) ) { + disabledItems[index] = null + break + } + } + + // If something is still matched, add it into the collection. + if ( matchFound ) { + disabledItems.push( matchFound ) + } + }) + } + + // Return the updated collection. + return disabledItems.filter(function( val ) { return val != null }) +} //DatePicker.prototype.activate + + +/** + * Create a string for the nodes in the picker. + */ +DatePicker.prototype.nodes = function( isOpen ) { + + var + calendar = this, + settings = calendar.settings, + calendarItem = calendar.item, + nowObject = calendarItem.now, + selectedObject = calendarItem.select, + highlightedObject = calendarItem.highlight, + viewsetObject = calendarItem.view, + disabledCollection = calendarItem.disable, + minLimitObject = calendarItem.min, + maxLimitObject = calendarItem.max, + + + // Create the calendar table head using a copy of weekday labels collection. + // * We do a copy so we don't mutate the original array. + tableHead = (function( collection, fullCollection ) { + + // If the first day should be Monday, move Sunday to the end. + if ( settings.firstDay ) { + collection.push( collection.shift() ) + fullCollection.push( fullCollection.shift() ) + } + + // Create and return the table head group. + return _.node( + 'thead', + _.node( + 'tr', + _.group({ + min: 0, + max: DAYS_IN_WEEK - 1, + i: 1, + node: 'th', + item: function( counter ) { + return [ + collection[ counter ], + settings.klass.weekdays, + 'scope=col title="' + fullCollection[ counter ] + '"' + ] + } + }) + ) + ) //endreturn + + // Materialize modified + })( ( settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter ).slice( 0 ), settings.weekdaysFull.slice( 0 ) ), //tableHead + + + // Create the nav for next/prev month. + createMonthNav = function( next ) { + + // Otherwise, return the created month tag. + return _.node( + 'div', + ' ', + settings.klass[ 'nav' + ( next ? 'Next' : 'Prev' ) ] + ( + + // If the focused month is outside the range, disabled the button. + ( next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month ) || + ( !next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month ) ? + ' ' + settings.klass.navDisabled : '' + ), + 'data-nav=' + ( next || -1 ) + ' ' + + _.ariaAttr({ + role: 'button', + controls: calendar.$node[0].id + '_table' + }) + ' ' + + 'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev ) + '"' + ) //endreturn + }, //createMonthNav + + + // Create the month label. + //Materialize modified + createMonthLabel = function(override) { + + var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull + + // Materialize modified + if (override == "short_months") { + monthsCollection = settings.monthsShort; + } + + // If there are months to select, add a dropdown menu. + if ( settings.selectMonths && override == undefined) { + + return _.node( 'select', + _.group({ + min: 0, + max: 11, + i: 1, + node: 'option', + item: function( loopedMonth ) { + + return [ + + // The looped month and no classes. + monthsCollection[ loopedMonth ], 0, + + // Set the value and selected index. + 'value=' + loopedMonth + + ( viewsetObject.month == loopedMonth ? ' selected' : '' ) + + ( + ( + ( viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month ) || + ( viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month ) + ) ? + ' disabled' : '' + ) + ] + } + }), + settings.klass.selectMonth + ' browser-default', + ( isOpen ? '' : 'disabled' ) + ' ' + + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + + 'title="' + settings.labelMonthSelect + '"' + ) + } + + // Materialize modified + if (override == "short_months") + if (selectedObject != null) + return monthsCollection[ selectedObject.month ]; + else return monthsCollection[ viewsetObject.month ]; + + // If there's a need for a month selector + return _.node( 'div', monthsCollection[ viewsetObject.month ], settings.klass.month ) + }, //createMonthLabel + + + // Create the year label. + // Materialize modified + createYearLabel = function(override) { + + var focusedYear = viewsetObject.year, + + // If years selector is set to a literal "true", set it to 5. Otherwise + // divide in half to get half before and half after focused year. + numberYears = settings.selectYears === true ? 5 : ~~( settings.selectYears / 2 ) + + + // If there are years to select, add a dropdown menu. + if ( numberYears ) { + + var + minYear = minLimitObject.year, + maxYear = maxLimitObject.year, + lowestYear = focusedYear - numberYears, + highestYear = focusedYear + numberYears + + // If the min year is greater than the lowest year, increase the highest year + // by the difference and set the lowest year to the min year. + if ( minYear > lowestYear ) { + highestYear += minYear - lowestYear + lowestYear = minYear + } + + // If the max year is less than the highest year, decrease the lowest year + // by the lower of the two: available and needed years. Then set the + // highest year to the max year. + if ( maxYear < highestYear ) { + + var availableYears = lowestYear - minYear, + neededYears = highestYear - maxYear + + lowestYear -= availableYears > neededYears ? neededYears : availableYears + highestYear = maxYear + } + + if ( settings.selectYears && override == undefined ) { + return _.node( 'select', + _.group({ + min: lowestYear, + max: highestYear, + i: 1, + node: 'option', + item: function( loopedYear ) { + return [ + + // The looped year and no classes. + loopedYear, 0, + + // Set the value and selected index. + 'value=' + loopedYear + ( focusedYear == loopedYear ? ' selected' : '' ) + ] + } + }), + settings.klass.selectYear + ' browser-default', + ( isOpen ? '' : 'disabled' ) + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + + 'title="' + settings.labelYearSelect + '"' + ) + } + } + + + // Materialize modified + if (override === 'raw' && selectedObject != null) { + return _.node( 'div', selectedObject.year ) + } + + + + // Otherwise just return the year focused + return _.node( 'div', focusedYear, settings.klass.year ) + } //createYearLabel + + + // Materialize modified + createDayLabel = function() { + if (selectedObject != null) + return selectedObject.date + else return nowObject.date + } + createWeekdayLabel = function() { + var display_day; + + if (selectedObject != null) + display_day = selectedObject.day; + else + display_day = nowObject.day; + var weekday = settings.weekdaysShort[ display_day ]; + return weekday + } + + + // Create and return the entire calendar. + +return _.node( + // Date presentation View + 'div', + _.node( + // Div for Year + 'div', + createYearLabel("raw") , + settings.klass.year_display + )+ + _.node( + 'span', + createWeekdayLabel() + ', ', + "picker__weekday-display" + )+ + _.node( + // Div for short Month + 'span', + createMonthLabel("short_months") + ' ', + settings.klass.month_display + )+ + _.node( + // Div for Day + 'span', + createDayLabel() , + settings.klass.day_display + ), + settings.klass.date_display + )+ + // Calendar container + _.node('div', + _.node('div', + _.node('div', + ( settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel() ) + + createMonthNav() + createMonthNav( 1 ), + settings.klass.header + ) + _.node( + 'table', + tableHead + + _.node( + 'tbody', + _.group({ + min: 0, + max: WEEKS_IN_CALENDAR - 1, + i: 1, + node: 'tr', + item: function( rowCounter ) { + + // If Monday is the first day and the month starts on Sunday, shift the date back a week. + var shiftDateBy = settings.firstDay && calendar.create([ viewsetObject.year, viewsetObject.month, 1 ]).day === 0 ? -7 : 0 + + return [ + _.group({ + min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index + max: function() { + return this.min + DAYS_IN_WEEK - 1 + }, + i: 1, + node: 'td', + item: function( targetDate ) { + + // Convert the time date from a relative date to a target date. + targetDate = calendar.create([ viewsetObject.year, viewsetObject.month, targetDate + ( settings.firstDay ? 1 : 0 ) ]) + + var isSelected = selectedObject && selectedObject.pick == targetDate.pick, + isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick, + isDisabled = disabledCollection && calendar.disabled( targetDate ) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick, + formattedDate = _.trigger( calendar.formats.toString, calendar, [ settings.format, targetDate ] ) + + return [ + _.node( + 'div', + targetDate.date, + (function( klasses ) { + + // Add the `infocus` or `outfocus` classes based on month in view. + klasses.push( viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus ) + + // Add the `today` class if needed. + if ( nowObject.pick == targetDate.pick ) { + klasses.push( settings.klass.now ) + } + + // Add the `selected` class if something's selected and the time matches. + if ( isSelected ) { + klasses.push( settings.klass.selected ) + } + + // Add the `highlighted` class if something's highlighted and the time matches. + if ( isHighlighted ) { + klasses.push( settings.klass.highlighted ) + } + + // Add the `disabled` class if something's disabled and the object matches. + if ( isDisabled ) { + klasses.push( settings.klass.disabled ) + } + + return klasses.join( ' ' ) + })([ settings.klass.day ]), + 'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({ + role: 'gridcell', + label: formattedDate, + selected: isSelected && calendar.$node.val() === formattedDate ? true : null, + activedescendant: isHighlighted ? true : null, + disabled: isDisabled ? true : null + }) + ' ' + (isDisabled ? '' : 'tabindex="0"') + ), + '', + _.ariaAttr({ role: 'presentation' }) + ] //endreturn + } + }) + ] //endreturn + } + }) + ), + settings.klass.table, + 'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({ + role: 'grid', + controls: calendar.$node[0].id, + readonly: true + }) + ) + , settings.klass.calendar_container) // end calendar + + + + + // * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”. + _.node( + 'div', + _.node( 'button', settings.today, "btn-flat picker__today waves-effect", + 'type=button data-pick=' + nowObject.pick + + ( isOpen && !calendar.disabled(nowObject) ? '' : ' disabled' ) + ' ' + + _.ariaAttr({ controls: calendar.$node[0].id }) ) + + _.node( 'button', settings.clear, "btn-flat picker__clear waves-effect", + 'type=button data-clear=1' + + ( isOpen ? '' : ' disabled' ) + ' ' + + _.ariaAttr({ controls: calendar.$node[0].id }) ) + + _.node('button', settings.close, "btn-flat picker__close waves-effect", + 'type=button data-close=true ' + + ( isOpen ? '' : ' disabled' ) + ' ' + + _.ariaAttr({ controls: calendar.$node[0].id }) ), + settings.klass.footer + ), 'picker__container__wrapper' + ) //endreturn +} //DatePicker.prototype.nodes + + + + +/** + * The date picker defaults. + */ +DatePicker.defaults = (function( prefix ) { + + return { + + // The title label to use for the month nav buttons + labelMonthNext: 'Next month', + labelMonthPrev: 'Previous month', + + // The title label to use for the dropdown selectors + labelMonthSelect: 'Select a month', + labelYearSelect: 'Select a year', + + // Months and weekdays + monthsFull: [ 'January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December' ], + monthsShort: [ 'Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec' ], + weekdaysFull: [ 'Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday' ], + weekdaysShort: [ 'Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat' ], + + // Materialize modified + weekdaysLetter: [ 'S', 'M', 'T', 'W', 'T', 'F', 'S' ], + + // Today and clear + today: 'Today', + clear: 'Clear', + close: 'Ok', + + // Picker close behavior (Prevent a change in behaviour for backwards compatibility) + closeOnSelect: false, + + // The format to show on the `input` element + format: 'd mmmm, yyyy', + + // Classes + klass: { + + table: prefix + 'table', + + header: prefix + 'header', + + + // Materialize Added klasses + date_display: prefix + 'date-display', + day_display: prefix + 'day-display', + month_display: prefix + 'month-display', + year_display: prefix + 'year-display', + calendar_container: prefix + 'calendar-container', + // end + + + + navPrev: prefix + 'nav--prev', + navNext: prefix + 'nav--next', + navDisabled: prefix + 'nav--disabled', + + month: prefix + 'month', + year: prefix + 'year', + + selectMonth: prefix + 'select--month', + selectYear: prefix + 'select--year', + + weekdays: prefix + 'weekday', + + day: prefix + 'day', + disabled: prefix + 'day--disabled', + selected: prefix + 'day--selected', + highlighted: prefix + 'day--highlighted', + now: prefix + 'day--today', + infocus: prefix + 'day--infocus', + outfocus: prefix + 'day--outfocus', + + footer: prefix + 'footer', + + buttonClear: prefix + 'button--clear', + buttonToday: prefix + 'button--today', + buttonClose: prefix + 'button--close' + } + } +})( Picker.klasses().picker + '__' ) + + + + + +/** + * Extend the picker to add the date picker. + */ +Picker.extend( 'pickadate', DatePicker ) + + +})); diff --git a/app/dispatch/static/materialize/js/date_picker/picker.js b/app/dispatch/static/materialize/js/date_picker/picker.js new file mode 100644 index 0000000..b2baf00 --- /dev/null +++ b/app/dispatch/static/materialize/js/date_picker/picker.js @@ -0,0 +1,1121 @@ +/*! + * pickadate.js v3.5.0, 2014/04/13 + * By Amsul, http://amsul.ca + * Hosted on http://amsul.github.io/pickadate.js + * Licensed under MIT + */ + +(function ( factory ) { + + Materialize.Picker = factory( jQuery ) + +}(function( $ ) { + +var $window = $( window ) +var $document = $( document ) +var $html = $( document.documentElement ) + + +/** + * The picker constructor that creates a blank picker. + */ +function PickerConstructor( ELEMENT, NAME, COMPONENT, OPTIONS ) { + + // If there’s no element, return the picker constructor. + if ( !ELEMENT ) return PickerConstructor + + + var + IS_DEFAULT_THEME = false, + + + // The state of the picker. + STATE = { + id: ELEMENT.id || 'P' + Math.abs( ~~(Math.random() * new Date()) ) + }, + + + // Merge the defaults and options passed. + SETTINGS = COMPONENT ? $.extend( true, {}, COMPONENT.defaults, OPTIONS ) : OPTIONS || {}, + + + // Merge the default classes with the settings classes. + CLASSES = $.extend( {}, PickerConstructor.klasses(), SETTINGS.klass ), + + + // The element node wrapper into a jQuery object. + $ELEMENT = $( ELEMENT ), + + + // Pseudo picker constructor. + PickerInstance = function() { + return this.start() + }, + + + // The picker prototype. + P = PickerInstance.prototype = { + + constructor: PickerInstance, + + $node: $ELEMENT, + + + /** + * Initialize everything + */ + start: function() { + + // If it’s already started, do nothing. + if ( STATE && STATE.start ) return P + + + // Update the picker states. + STATE.methods = {} + STATE.start = true + STATE.open = false + STATE.type = ELEMENT.type + + + // Confirm focus state, convert into text input to remove UA stylings, + // and set as readonly to prevent keyboard popup. + ELEMENT.autofocus = ELEMENT == getActiveElement() + ELEMENT.readOnly = !SETTINGS.editable + ELEMENT.id = ELEMENT.id || STATE.id + if ( ELEMENT.type != 'text' ) { + ELEMENT.type = 'text' + } + + + // Create a new picker component with the settings. + P.component = new COMPONENT(P, SETTINGS) + + + // Create the picker root with a holder and then prepare it. + P.$root = $( PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"') ) + prepareElementRoot() + + + // If there’s a format for the hidden input element, create the element. + if ( SETTINGS.formatSubmit ) { + prepareElementHidden() + } + + + // Prepare the input element. + prepareElement() + + + // Insert the root as specified in the settings. + if ( SETTINGS.container ) $( SETTINGS.container ).append( P.$root ) + else $ELEMENT.before( P.$root ) + + + // Bind the default component and settings events. + P.on({ + start: P.component.onStart, + render: P.component.onRender, + stop: P.component.onStop, + open: P.component.onOpen, + close: P.component.onClose, + set: P.component.onSet + }).on({ + start: SETTINGS.onStart, + render: SETTINGS.onRender, + stop: SETTINGS.onStop, + open: SETTINGS.onOpen, + close: SETTINGS.onClose, + set: SETTINGS.onSet + }) + + + // Once we’re all set, check the theme in use. + IS_DEFAULT_THEME = isUsingDefaultTheme( P.$root.children()[ 0 ] ) + + + // If the element has autofocus, open the picker. + if ( ELEMENT.autofocus ) { + P.open() + } + + + // Trigger queued the “start” and “render” events. + return P.trigger( 'start' ).trigger( 'render' ) + }, //start + + + /** + * Render a new picker + */ + render: function( entireComponent ) { + + // Insert a new component holder in the root or box. + if ( entireComponent ) P.$root.html( createWrappedComponent() ) + else P.$root.find( '.' + CLASSES.box ).html( P.component.nodes( STATE.open ) ) + + // Trigger the queued “render” events. + return P.trigger( 'render' ) + }, //render + + + /** + * Destroy everything + */ + stop: function() { + + // If it’s already stopped, do nothing. + if ( !STATE.start ) return P + + // Then close the picker. + P.close() + + // Remove the hidden field. + if ( P._hidden ) { + P._hidden.parentNode.removeChild( P._hidden ) + } + + // Remove the root. + P.$root.remove() + + // Remove the input class, remove the stored data, and unbind + // the events (after a tick for IE - see `P.close`). + $ELEMENT.removeClass( CLASSES.input ).removeData( NAME ) + setTimeout( function() { + $ELEMENT.off( '.' + STATE.id ) + }, 0) + + // Restore the element state + ELEMENT.type = STATE.type + ELEMENT.readOnly = false + + // Trigger the queued “stop” events. + P.trigger( 'stop' ) + + // Reset the picker states. + STATE.methods = {} + STATE.start = false + + return P + }, //stop + + + /** + * Open up the picker + */ + open: function( dontGiveFocus ) { + + // If it’s already open, do nothing. + if ( STATE.open ) return P + + // Add the “active” class. + $ELEMENT.addClass( CLASSES.active ) + aria( ELEMENT, 'expanded', true ) + + // * A Firefox bug, when `html` has `overflow:hidden`, results in + // killing transitions :(. So add the “opened” state on the next tick. + // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289 + setTimeout( function() { + + // Add the “opened” class to the picker root. + P.$root.addClass( CLASSES.opened ) + aria( P.$root[0], 'hidden', false ) + + }, 0 ) + + // If we have to give focus, bind the element and doc events. + if ( dontGiveFocus !== false ) { + + // Set it as open. + STATE.open = true + + // Prevent the page from scrolling. + if ( IS_DEFAULT_THEME ) { + $html. + css( 'overflow', 'hidden' ). + css( 'padding-right', '+=' + getScrollbarWidth() ) + } + + // Pass focus to the root element’s jQuery object. + // * Workaround for iOS8 to bring the picker’s root into view. + P.$root.eq(0).focus() + + // Bind the document events. + $document.on( 'click.' + STATE.id + ' focusin.' + STATE.id, function( event ) { + + var target = event.target + + // If the target of the event is not the element, close the picker picker. + // * Don’t worry about clicks or focusins on the root because those don’t bubble up. + // Also, for Firefox, a click on an `option` element bubbles up directly + // to the doc. So make sure the target wasn't the doc. + // * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling, + // which causes the picker to unexpectedly close when right-clicking it. So make + // sure the event wasn’t a right-click. + if ( target != ELEMENT && target != document && event.which != 3 ) { + + // If the target was the holder that covers the screen, + // keep the element focused to maintain tabindex. + P.close( target === P.$root.children()[0] ) + } + + }).on( 'keydown.' + STATE.id, function( event ) { + + var + // Get the keycode. + keycode = event.keyCode, + + // Translate that to a selection change. + keycodeToMove = P.component.key[ keycode ], + + // Grab the target. + target = event.target + + + // On escape, close the picker and give focus. + if ( keycode == 27 ) { + P.close( true ) + } + + + // Check if there is a key movement or “enter” keypress on the element. + else if ( target == P.$root[0] && ( keycodeToMove || keycode == 13 ) ) { + + // Prevent the default action to stop page movement. + event.preventDefault() + + // Trigger the key movement action. + if ( keycodeToMove ) { + PickerConstructor._.trigger( P.component.key.go, P, [ PickerConstructor._.trigger( keycodeToMove ) ] ) + } + + // On “enter”, if the highlighted item isn’t disabled, set the value and close. + else if ( !P.$root.find( '.' + CLASSES.highlighted ).hasClass( CLASSES.disabled ) ) { + P.set( 'select', P.component.item.highlight ) + if ( SETTINGS.closeOnSelect ) { + P.close( true ) + } + } + } + + + // If the target is within the root and “enter” is pressed, + // prevent the default action and trigger a click on the target instead. + else if ( $.contains( P.$root[0], target ) && keycode == 13 ) { + event.preventDefault() + target.click() + } + }) + } + + // Trigger the queued “open” events. + return P.trigger( 'open' ) + }, //open + + + /** + * Close the picker + */ + close: function( giveFocus ) { + + // If we need to give focus, do it before changing states. + if ( giveFocus ) { + // ....ah yes! It would’ve been incomplete without a crazy workaround for IE :| + // The focus is triggered *after* the close has completed - causing it + // to open again. So unbind and rebind the event at the next tick. + P.$root.off( 'focus.toOpen' ).eq(0).focus() + setTimeout( function() { + P.$root.on( 'focus.toOpen', handleFocusToOpenEvent ) + }, 0 ) + } + + // Remove the “active” class. + $ELEMENT.removeClass( CLASSES.active ) + aria( ELEMENT, 'expanded', false ) + + // * A Firefox bug, when `html` has `overflow:hidden`, results in + // killing transitions :(. So remove the “opened” state on the next tick. + // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289 + setTimeout( function() { + + // Remove the “opened” and “focused” class from the picker root. + P.$root.removeClass( CLASSES.opened + ' ' + CLASSES.focused ) + aria( P.$root[0], 'hidden', true ) + + }, 0 ) + + // If it’s already closed, do nothing more. + if ( !STATE.open ) return P + + // Set it as closed. + STATE.open = false + + // Allow the page to scroll. + if ( IS_DEFAULT_THEME ) { + $html. + css( 'overflow', '' ). + css( 'padding-right', '-=' + getScrollbarWidth() ) + } + + // Unbind the document events. + $document.off( '.' + STATE.id ) + + // Trigger the queued “close” events. + return P.trigger( 'close' ) + }, //close + + + /** + * Clear the values + */ + clear: function( options ) { + return P.set( 'clear', null, options ) + }, //clear + + + /** + * Set something + */ + set: function( thing, value, options ) { + + var thingItem, thingValue, + thingIsObject = $.isPlainObject( thing ), + thingObject = thingIsObject ? thing : {} + + // Make sure we have usable options. + options = thingIsObject && $.isPlainObject( value ) ? value : options || {} + + if ( thing ) { + + // If the thing isn’t an object, make it one. + if ( !thingIsObject ) { + thingObject[ thing ] = value + } + + // Go through the things of items to set. + for ( thingItem in thingObject ) { + + // Grab the value of the thing. + thingValue = thingObject[ thingItem ] + + // First, if the item exists and there’s a value, set it. + if ( thingItem in P.component.item ) { + if ( thingValue === undefined ) thingValue = null + P.component.set( thingItem, thingValue, options ) + } + + // Then, check to update the element value and broadcast a change. + if ( thingItem == 'select' || thingItem == 'clear' ) { + $ELEMENT. + val( thingItem == 'clear' ? '' : P.get( thingItem, SETTINGS.format ) ). + trigger( 'change' ) + } + } + + // Render a new picker. + P.render() + } + + // When the method isn’t muted, trigger queued “set” events and pass the `thingObject`. + return options.muted ? P : P.trigger( 'set', thingObject ) + }, //set + + + /** + * Get something + */ + get: function( thing, format ) { + + // Make sure there’s something to get. + thing = thing || 'value' + + // If a picker state exists, return that. + if ( STATE[ thing ] != null ) { + return STATE[ thing ] + } + + // Return the submission value, if that. + if ( thing == 'valueSubmit' ) { + if ( P._hidden ) { + return P._hidden.value + } + thing = 'value' + } + + // Return the value, if that. + if ( thing == 'value' ) { + return ELEMENT.value + } + + // Check if a component item exists, return that. + if ( thing in P.component.item ) { + if ( typeof format == 'string' ) { + var thingValue = P.component.get( thing ) + return thingValue ? + PickerConstructor._.trigger( + P.component.formats.toString, + P.component, + [ format, thingValue ] + ) : '' + } + return P.component.get( thing ) + } + }, //get + + + + /** + * Bind events on the things. + */ + on: function( thing, method, internal ) { + + var thingName, thingMethod, + thingIsObject = $.isPlainObject( thing ), + thingObject = thingIsObject ? thing : {} + + if ( thing ) { + + // If the thing isn’t an object, make it one. + if ( !thingIsObject ) { + thingObject[ thing ] = method + } + + // Go through the things to bind to. + for ( thingName in thingObject ) { + + // Grab the method of the thing. + thingMethod = thingObject[ thingName ] + + // If it was an internal binding, prefix it. + if ( internal ) { + thingName = '_' + thingName + } + + // Make sure the thing methods collection exists. + STATE.methods[ thingName ] = STATE.methods[ thingName ] || [] + + // Add the method to the relative method collection. + STATE.methods[ thingName ].push( thingMethod ) + } + } + + return P + }, //on + + + + /** + * Unbind events on the things. + */ + off: function() { + var i, thingName, + names = arguments; + for ( i = 0, namesCount = names.length; i < namesCount; i += 1 ) { + thingName = names[i] + if ( thingName in STATE.methods ) { + delete STATE.methods[thingName] + } + } + return P + }, + + + /** + * Fire off method events. + */ + trigger: function( name, data ) { + var _trigger = function( name ) { + var methodList = STATE.methods[ name ] + if ( methodList ) { + methodList.map( function( method ) { + PickerConstructor._.trigger( method, P, [ data ] ) + }) + } + } + _trigger( '_' + name ) + _trigger( name ) + return P + } //trigger + } //PickerInstance.prototype + + + /** + * Wrap the picker holder components together. + */ + function createWrappedComponent() { + + // Create a picker wrapper holder + return PickerConstructor._.node( 'div', + + // Create a picker wrapper node + PickerConstructor._.node( 'div', + + // Create a picker frame + PickerConstructor._.node( 'div', + + // Create a picker box node + PickerConstructor._.node( 'div', + + // Create the components nodes. + P.component.nodes( STATE.open ), + + // The picker box class + CLASSES.box + ), + + // Picker wrap class + CLASSES.wrap + ), + + // Picker frame class + CLASSES.frame + ), + + // Picker holder class + CLASSES.holder + ) //endreturn + } //createWrappedComponent + + + + /** + * Prepare the input element with all bindings. + */ + function prepareElement() { + + $ELEMENT. + + // Store the picker data by component name. + data(NAME, P). + + // Add the “input” class name. + addClass(CLASSES.input). + + // Remove the tabindex. + attr('tabindex', -1). + + // If there’s a `data-value`, update the value of the element. + val( $ELEMENT.data('value') ? + P.get('select', SETTINGS.format) : + ELEMENT.value + ) + + + // Only bind keydown events if the element isn’t editable. + if ( !SETTINGS.editable ) { + + $ELEMENT. + + // On focus/click, focus onto the root to open it up. + on( 'focus.' + STATE.id + ' click.' + STATE.id, function( event ) { + event.preventDefault() + P.$root.eq(0).focus() + }). + + // Handle keyboard event based on the picker being opened or not. + on( 'keydown.' + STATE.id, handleKeydownEvent ) + } + + + // Update the aria attributes. + aria(ELEMENT, { + haspopup: true, + expanded: false, + readonly: false, + owns: ELEMENT.id + '_root' + }) + } + + + /** + * Prepare the root picker element with all bindings. + */ + function prepareElementRoot() { + + P.$root. + + on({ + + // For iOS8. + keydown: handleKeydownEvent, + + // When something within the root is focused, stop from bubbling + // to the doc and remove the “focused” state from the root. + focusin: function( event ) { + P.$root.removeClass( CLASSES.focused ) + event.stopPropagation() + }, + + // When something within the root holder is clicked, stop it + // from bubbling to the doc. + 'mousedown click': function( event ) { + + var target = event.target + + // Make sure the target isn’t the root holder so it can bubble up. + if ( target != P.$root.children()[ 0 ] ) { + + event.stopPropagation() + + // * For mousedown events, cancel the default action in order to + // prevent cases where focus is shifted onto external elements + // when using things like jQuery mobile or MagnificPopup (ref: #249 & #120). + // Also, for Firefox, don’t prevent action on the `option` element. + if ( event.type == 'mousedown' && !$( target ).is( 'input, select, textarea, button, option' )) { + + event.preventDefault() + + // Re-focus onto the root so that users can click away + // from elements focused within the picker. + P.$root.eq(0).focus() + } + } + } + }). + + // Add/remove the “target” class on focus and blur. + on({ + focus: function() { + $ELEMENT.addClass( CLASSES.target ) + }, + blur: function() { + $ELEMENT.removeClass( CLASSES.target ) + } + }). + + // Open the picker and adjust the root “focused” state + on( 'focus.toOpen', handleFocusToOpenEvent ). + + // If there’s a click on an actionable element, carry out the actions. + on( 'click', '[data-pick], [data-nav], [data-clear], [data-close]', function() { + + var $target = $( this ), + targetData = $target.data(), + targetDisabled = $target.hasClass( CLASSES.navDisabled ) || $target.hasClass( CLASSES.disabled ), + + // * For IE, non-focusable elements can be active elements as well + // (http://stackoverflow.com/a/2684561). + activeElement = getActiveElement(); + activeElement = activeElement && ( activeElement.type || activeElement.href ) && activeElement; + + // If it’s disabled or nothing inside is actively focused, re-focus the element. + if ( targetDisabled || activeElement && !$.contains( P.$root[0], activeElement ) ) { + P.$root.eq(0).focus() + } + + // If something is superficially changed, update the `highlight` based on the `nav`. + if ( !targetDisabled && targetData.nav ) { + P.set( 'highlight', P.component.item.highlight, { nav: targetData.nav } ) + } + + // If something is picked, set `select` then close with focus. + else if ( !targetDisabled && 'pick' in targetData ) { + P.set( 'select', targetData.pick ) + if ( SETTINGS.closeOnSelect ) { + P.close( true ) + } + } + + // If a “clear” button is pressed, empty the values and close with focus. + else if ( targetData.clear ) { + P.clear() + if ( SETTINGS.closeOnSelect ) { + P.close( true ) + } + } + + else if ( targetData.close ) { + P.close( true ) + } + + }) //P.$root + + aria( P.$root[0], 'hidden', true ) + } + + + /** + * Prepare the hidden input element along with all bindings. + */ + function prepareElementHidden() { + + var name + + if ( SETTINGS.hiddenName === true ) { + name = ELEMENT.name + ELEMENT.name = '' + } + else { + name = [ + typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : '', + typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit' + ] + name = name[0] + ELEMENT.name + name[1] + } + + P._hidden = $( + '' + )[0] + + $ELEMENT. + + // If the value changes, update the hidden input with the correct format. + on('change.' + STATE.id, function() { + P._hidden.value = ELEMENT.value ? + P.get('select', SETTINGS.formatSubmit) : + '' + }) + + + // Insert the hidden input as specified in the settings. + if ( SETTINGS.container ) $( SETTINGS.container ).append( P._hidden ) + else $ELEMENT.before( P._hidden ) + } + + + // For iOS8. + function handleKeydownEvent( event ) { + + var keycode = event.keyCode, + + // Check if one of the delete keys was pressed. + isKeycodeDelete = /^(8|46)$/.test(keycode) + + // For some reason IE clears the input value on “escape”. + if ( keycode == 27 ) { + P.close() + return false + } + + // Check if `space` or `delete` was pressed or the picker is closed with a key movement. + if ( keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode] ) { + + // Prevent it from moving the page and bubbling to doc. + event.preventDefault() + event.stopPropagation() + + // If `delete` was pressed, clear the values and close the picker. + // Otherwise open the picker. + if ( isKeycodeDelete ) { P.clear().close() } + else { P.open() } + } + } + + + // Separated for IE + function handleFocusToOpenEvent( event ) { + + // Stop the event from propagating to the doc. + event.stopPropagation() + + // If it’s a focus event, add the “focused” class to the root. + if ( event.type == 'focus' ) { + P.$root.addClass( CLASSES.focused ) + } + + // And then finally open the picker. + P.open() + } + + + // Return a new picker instance. + return new PickerInstance() +} //PickerConstructor + + + +/** + * The default classes and prefix to use for the HTML classes. + */ +PickerConstructor.klasses = function( prefix ) { + prefix = prefix || 'picker' + return { + + picker: prefix, + opened: prefix + '--opened', + focused: prefix + '--focused', + + input: prefix + '__input', + active: prefix + '__input--active', + target: prefix + '__input--target', + + holder: prefix + '__holder', + + frame: prefix + '__frame', + wrap: prefix + '__wrap', + + box: prefix + '__box' + } +} //PickerConstructor.klasses + + + +/** + * Check if the default theme is being used. + */ +function isUsingDefaultTheme( element ) { + + var theme, + prop = 'position' + + // For IE. + if ( element.currentStyle ) { + theme = element.currentStyle[prop] + } + + // For normal browsers. + else if ( window.getComputedStyle ) { + theme = getComputedStyle( element )[prop] + } + + return theme == 'fixed' +} + + + +/** + * Get the width of the browser’s scrollbar. + * Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js + */ +function getScrollbarWidth() { + + if ( $html.height() <= $window.height() ) { + return 0 + } + + var $outer = $( '
              ' ). + appendTo( 'body' ) + + // Get the width without scrollbars. + var widthWithoutScroll = $outer[0].offsetWidth + + // Force adding scrollbars. + $outer.css( 'overflow', 'scroll' ) + + // Add the inner div. + var $inner = $( '
              ' ).appendTo( $outer ) + + // Get the width with scrollbars. + var widthWithScroll = $inner[0].offsetWidth + + // Remove the divs. + $outer.remove() + + // Return the difference between the widths. + return widthWithoutScroll - widthWithScroll +} + + + +/** + * PickerConstructor helper methods. + */ +PickerConstructor._ = { + + /** + * Create a group of nodes. Expects: + * ` + { + min: {Integer}, + max: {Integer}, + i: {Integer}, + node: {String}, + item: {Function} + } + * ` + */ + group: function( groupObject ) { + + var + // Scope for the looped object + loopObjectScope, + + // Create the nodes list + nodesList = '', + + // The counter starts from the `min` + counter = PickerConstructor._.trigger( groupObject.min, groupObject ) + + + // Loop from the `min` to `max`, incrementing by `i` + for ( ; counter <= PickerConstructor._.trigger( groupObject.max, groupObject, [ counter ] ); counter += groupObject.i ) { + + // Trigger the `item` function within scope of the object + loopObjectScope = PickerConstructor._.trigger( groupObject.item, groupObject, [ counter ] ) + + // Splice the subgroup and create nodes out of the sub nodes + nodesList += PickerConstructor._.node( + groupObject.node, + loopObjectScope[ 0 ], // the node + loopObjectScope[ 1 ], // the classes + loopObjectScope[ 2 ] // the attributes + ) + } + + // Return the list of nodes + return nodesList + }, //group + + + /** + * Create a dom node string + */ + node: function( wrapper, item, klass, attribute ) { + + // If the item is false-y, just return an empty string + if ( !item ) return '' + + // If the item is an array, do a join + item = $.isArray( item ) ? item.join( '' ) : item + + // Check for the class + klass = klass ? ' class="' + klass + '"' : '' + + // Check for any attributes + attribute = attribute ? ' ' + attribute : '' + + // Return the wrapped item + return '<' + wrapper + klass + attribute + '>' + item + '' + }, //node + + + /** + * Lead numbers below 10 with a zero. + */ + lead: function( number ) { + return ( number < 10 ? '0': '' ) + number + }, + + + /** + * Trigger a function otherwise return the value. + */ + trigger: function( callback, scope, args ) { + return typeof callback == 'function' ? callback.apply( scope, args || [] ) : callback + }, + + + /** + * If the second character is a digit, length is 2 otherwise 1. + */ + digits: function( string ) { + return ( /\d/ ).test( string[ 1 ] ) ? 2 : 1 + }, + + + /** + * Tell if something is a date object. + */ + isDate: function( value ) { + return {}.toString.call( value ).indexOf( 'Date' ) > -1 && this.isInteger( value.getDate() ) + }, + + + /** + * Tell if something is an integer. + */ + isInteger: function( value ) { + return {}.toString.call( value ).indexOf( 'Number' ) > -1 && value % 1 === 0 + }, + + + /** + * Create ARIA attribute strings. + */ + ariaAttr: ariaAttr +} //PickerConstructor._ + + + +/** + * Extend the picker with a component and defaults. + */ +PickerConstructor.extend = function( name, Component ) { + + // Extend jQuery. + $.fn[ name ] = function( options, action ) { + + // Grab the component data. + var componentData = this.data( name ) + + // If the picker is requested, return the data object. + if ( options == 'picker' ) { + return componentData + } + + // If the component data exists and `options` is a string, carry out the action. + if ( componentData && typeof options == 'string' ) { + return PickerConstructor._.trigger( componentData[ options ], componentData, [ action ] ) + } + + // Otherwise go through each matched element and if the component + // doesn’t exist, create a new picker using `this` element + // and merging the defaults and options with a deep copy. + return this.each( function() { + var $this = $( this ) + if ( !$this.data( name ) ) { + new PickerConstructor( this, name, Component, options ) + } + }) + } + + // Set the defaults. + $.fn[ name ].defaults = Component.defaults +} //PickerConstructor.extend + + + +function aria(element, attribute, value) { + if ( $.isPlainObject(attribute) ) { + for ( var key in attribute ) { + ariaSet(element, key, attribute[key]) + } + } + else { + ariaSet(element, attribute, value) + } +} +function ariaSet(element, attribute, value) { + element.setAttribute( + (attribute == 'role' ? '' : 'aria-') + attribute, + value + ) +} +function ariaAttr(attribute, data) { + if ( !$.isPlainObject(attribute) ) { + attribute = { attribute: data } + } + data = '' + for ( var key in attribute ) { + var attr = (key == 'role' ? '' : 'aria-') + key, + attrVal = attribute[key] + data += attrVal == null ? '' : attr + '="' + attribute[key] + '"' + } + return data +} + +// IE8 bug throws an error for activeElements within iframes. +function getActiveElement() { + try { + return document.activeElement + } catch ( err ) { } +} + + + +// Expose the picker constructor. +return PickerConstructor + + +})); diff --git a/app/dispatch/static/materialize/js/date_picker/picker.time.js b/app/dispatch/static/materialize/js/date_picker/picker.time.js new file mode 100644 index 0000000..7379529 --- /dev/null +++ b/app/dispatch/static/materialize/js/date_picker/picker.time.js @@ -0,0 +1,695 @@ +/*! + * ClockPicker v0.0.7 (http://weareoutman.github.io/clockpicker/) + * Copyright 2014 Wang Shenwei. + * Licensed under MIT (https://github.com/weareoutman/clockpicker/blob/gh-pages/LICENSE) + * + * Further modified + * Copyright 2015 Ching Yaw Hao. + */ + +(function($){ + var $win = $(window), + $doc = $(document); + + // Can I use inline svg ? + var svgNS = 'http://www.w3.org/2000/svg', + svgSupported = 'SVGAngle' in window && (function() { + var supported, + el = document.createElement('div'); + el.innerHTML = ''; + supported = (el.firstChild && el.firstChild.namespaceURI) == svgNS; + el.innerHTML = ''; + return supported; + })(); + + // Can I use transition ? + var transitionSupported = (function() { + var style = document.createElement('div').style; + return 'transition' in style || + 'WebkitTransition' in style || + 'MozTransition' in style || + 'msTransition' in style || + 'OTransition' in style; + })(); + + // Listen touch events in touch screen device, instead of mouse events in desktop. + var touchSupported = 'ontouchstart' in window, + mousedownEvent = 'mousedown' + ( touchSupported ? ' touchstart' : ''), + mousemoveEvent = 'mousemove.clockpicker' + ( touchSupported ? ' touchmove.clockpicker' : ''), + mouseupEvent = 'mouseup.clockpicker' + ( touchSupported ? ' touchend.clockpicker' : ''); + + // Vibrate the device if supported + var vibrate = navigator.vibrate ? 'vibrate' : navigator.webkitVibrate ? 'webkitVibrate' : null; + + function createSvgElement(name) { + return document.createElementNS(svgNS, name); + } + + function leadingZero(num) { + return (num < 10 ? '0' : '') + num; + } + + // Get a unique id + var idCounter = 0; + function uniqueId(prefix) { + var id = ++idCounter + ''; + return prefix ? prefix + id : id; + } + + // Clock size + var dialRadius = 135, + outerRadius = 105, + // innerRadius = 80 on 12 hour clock + innerRadius = 70, + tickRadius = 20, + diameter = dialRadius * 2, + duration = transitionSupported ? 350 : 1; + + // Popover template + var tpl = [ + '
              ', + '
              ', + '
              ', + '
              ', + '
              ', + '
              ', + '
              ', + '
              ', + '', + ':', + '', + '
              ', + '
              ', + '
              ', + '
              ', + '
              ', + '
              ', + '
              ', + '
              ', + '
              ', + '
              ', + '
              ', + '
              ', + '
              ', + '
              ', + '
              ', + '
              ', + '', + '
              ', + '
              ', + '
              ', + '
              ', + '
              ', + '
              ' + ].join(''); + + // ClockPicker + function ClockPicker(element, options) { + var popover = $(tpl), + plate = popover.find('.clockpicker-plate'), + holder = popover.find('.picker__holder'), + hoursView = popover.find('.clockpicker-hours'), + minutesView = popover.find('.clockpicker-minutes'), + amPmBlock = popover.find('.clockpicker-am-pm-block'), + isInput = element.prop('tagName') === 'INPUT', + input = isInput ? element : element.find('input'), + label = $("label[for=" + input.attr("id") + "]"), + self = this; + + this.id = uniqueId('cp'); + this.element = element; + this.holder = holder; + this.options = options; + this.isAppended = false; + this.isShown = false; + this.currentView = 'hours'; + this.isInput = isInput; + this.input = input; + this.label = label; + this.popover = popover; + this.plate = plate; + this.hoursView = hoursView; + this.minutesView = minutesView; + this.amPmBlock = amPmBlock; + this.spanHours = popover.find('.clockpicker-span-hours'); + this.spanMinutes = popover.find('.clockpicker-span-minutes'); + this.spanAmPm = popover.find('.clockpicker-span-am-pm'); + this.footer = popover.find('.picker__footer'); + this.amOrPm = "PM"; + + // Setup for for 12 hour clock if option is selected + if (options.twelvehour) { + if (!options.ampmclickable) { + this.spanAmPm.empty(); + $('
              AM
              ').appendTo(this.spanAmPm); + $('
              PM
              ').appendTo(this.spanAmPm); + } + else { + this.spanAmPm.empty(); + $('
              AM
              ').on("click", function() { + self.spanAmPm.children('#click-am').addClass("text-primary"); + self.spanAmPm.children('#click-pm').removeClass("text-primary"); + self.amOrPm = "AM"; + }).appendTo(this.spanAmPm); + $('
              PM
              ').on("click", function() { + self.spanAmPm.children('#click-pm').addClass("text-primary"); + self.spanAmPm.children('#click-am').removeClass("text-primary"); + self.amOrPm = 'PM'; + }).appendTo(this.spanAmPm); + } + } + + // Add buttons to footer + $('').click($.proxy(this.clear, this)).appendTo(this.footer); + $('').click($.proxy(this.hide, this)).appendTo(this.footer); + $('').click($.proxy(this.done, this)).appendTo(this.footer); + + this.spanHours.click($.proxy(this.toggleView, this, 'hours')); + this.spanMinutes.click($.proxy(this.toggleView, this, 'minutes')); + + // Show or toggle + input.on('focus.clockpicker click.clockpicker', $.proxy(this.show, this)); + + // Build ticks + var tickTpl = $('
              '), + i, tick, radian, radius; + + // Hours view + if (options.twelvehour) { + for (i = 1; i < 13; i += 1) { + tick = tickTpl.clone(); + radian = i / 6 * Math.PI; + radius = outerRadius; + tick.css({ + left: dialRadius + Math.sin(radian) * radius - tickRadius, + top: dialRadius - Math.cos(radian) * radius - tickRadius + }); + tick.html(i === 0 ? '00' : i); + hoursView.append(tick); + tick.on(mousedownEvent, mousedown); + } + } else { + for (i = 0; i < 24; i += 1) { + tick = tickTpl.clone(); + radian = i / 6 * Math.PI; + var inner = i > 0 && i < 13; + radius = inner ? innerRadius : outerRadius; + tick.css({ + left: dialRadius + Math.sin(radian) * radius - tickRadius, + top: dialRadius - Math.cos(radian) * radius - tickRadius + }); + tick.html(i === 0 ? '00' : i); + hoursView.append(tick); + tick.on(mousedownEvent, mousedown); + } + } + + // Minutes view + for (i = 0; i < 60; i += 5) { + tick = tickTpl.clone(); + radian = i / 30 * Math.PI; + tick.css({ + left: dialRadius + Math.sin(radian) * outerRadius - tickRadius, + top: dialRadius - Math.cos(radian) * outerRadius - tickRadius + }); + tick.html(leadingZero(i)); + minutesView.append(tick); + tick.on(mousedownEvent, mousedown); + } + + // Clicking on minutes view space + plate.on(mousedownEvent, function(e) { + if ($(e.target).closest('.clockpicker-tick').length === 0) { + mousedown(e, true); + } + }); + + // Mousedown or touchstart + function mousedown(e, space) { + var offset = plate.offset(), + isTouch = /^touch/.test(e.type), + x0 = offset.left + dialRadius, + y0 = offset.top + dialRadius, + dx = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0, + dy = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0, + z = Math.sqrt(dx * dx + dy * dy), + moved = false; + + // When clicking on minutes view space, check the mouse position + if (space && (z < outerRadius - tickRadius || z > outerRadius + tickRadius)) { + return; + } + e.preventDefault(); + + // Set cursor style of body after 200ms + var movingTimer = setTimeout(function(){ + self.popover.addClass('clockpicker-moving'); + }, 200); + + // Clock + self.setHand(dx, dy, !space, true); + + // Mousemove on document + $doc.off(mousemoveEvent).on(mousemoveEvent, function(e){ + e.preventDefault(); + var isTouch = /^touch/.test(e.type), + x = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0, + y = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0; + if (! moved && x === dx && y === dy) { + // Clicking in chrome on windows will trigger a mousemove event + return; + } + moved = true; + self.setHand(x, y, false, true); + }); + + // Mouseup on document + $doc.off(mouseupEvent).on(mouseupEvent, function(e) { + $doc.off(mouseupEvent); + e.preventDefault(); + var isTouch = /^touch/.test(e.type), + x = (isTouch ? e.originalEvent.changedTouches[0] : e).pageX - x0, + y = (isTouch ? e.originalEvent.changedTouches[0] : e).pageY - y0; + if ((space || moved) && x === dx && y === dy) { + self.setHand(x, y); + } + + if (self.currentView === 'hours') { + self.toggleView('minutes', duration / 2); + } else if (options.autoclose) { + self.minutesView.addClass('clockpicker-dial-out'); + setTimeout(function(){ + self.done(); + }, duration / 2); + } + plate.prepend(canvas); + + // Reset cursor style of body + clearTimeout(movingTimer); + self.popover.removeClass('clockpicker-moving'); + + // Unbind mousemove event + $doc.off(mousemoveEvent); + }); + } + + if (svgSupported) { + // Draw clock hands and others + var canvas = popover.find('.clockpicker-canvas'), + svg = createSvgElement('svg'); + svg.setAttribute('class', 'clockpicker-svg'); + svg.setAttribute('width', diameter); + svg.setAttribute('height', diameter); + var g = createSvgElement('g'); + g.setAttribute('transform', 'translate(' + dialRadius + ',' + dialRadius + ')'); + var bearing = createSvgElement('circle'); + bearing.setAttribute('class', 'clockpicker-canvas-bearing'); + bearing.setAttribute('cx', 0); + bearing.setAttribute('cy', 0); + bearing.setAttribute('r', 4); + var hand = createSvgElement('line'); + hand.setAttribute('x1', 0); + hand.setAttribute('y1', 0); + var bg = createSvgElement('circle'); + bg.setAttribute('class', 'clockpicker-canvas-bg'); + bg.setAttribute('r', tickRadius); + g.appendChild(hand); + g.appendChild(bg); + g.appendChild(bearing); + svg.appendChild(g); + canvas.append(svg); + + this.hand = hand; + this.bg = bg; + this.bearing = bearing; + this.g = g; + this.canvas = canvas; + } + + raiseCallback(this.options.init); + } + + function raiseCallback(callbackFunction) { + if (callbackFunction && typeof callbackFunction === "function") + callbackFunction(); + } + + // Default options + ClockPicker.DEFAULTS = { + 'default': '', // default time, 'now' or '13:14' e.g. + fromnow: 0, // set default time to * milliseconds from now (using with default = 'now') + donetext: 'Ok', // done button text + cleartext: 'Clear', + canceltext: 'Cancel', + autoclose: false, // auto close when minute is selected + ampmclickable: true, // set am/pm button on itself + darktheme: false, // set to dark theme + twelvehour: true, // change to 12 hour AM/PM clock from 24 hour + vibrate: true // vibrate the device when dragging clock hand + }; + + // Show or hide popover + ClockPicker.prototype.toggle = function() { + this[this.isShown ? 'hide' : 'show'](); + }; + + // Set popover position + ClockPicker.prototype.locate = function() { + var element = this.element, + popover = this.popover, + offset = element.offset(), + width = element.outerWidth(), + height = element.outerHeight(), + align = this.options.align, + self = this; + + popover.show(); + }; + + // Show popover + ClockPicker.prototype.show = function(e){ + // Not show again + if (this.isShown) { + return; + } + raiseCallback(this.options.beforeShow); + $(':input').each(function() { + $(this).attr('tabindex', -1); + }) + var self = this; + // Initialize + this.input.blur(); + this.popover.addClass('picker--opened'); + this.input.addClass('picker__input picker__input--active'); + $(document.body).css('overflow', 'hidden'); + // Get the time + var value = ((this.input.prop('value') || this.options['default'] || '') + '').split(':'); + if (this.options.twelvehour && !(typeof value[1] === 'undefined')) { + if (value[1].indexOf("AM") > 0){ + this.amOrPm = 'AM'; + } else { + this.amOrPm = 'PM'; + } + value[1] = value[1].replace("AM", "").replace("PM", ""); + } + if (value[0] === 'now') { + var now = new Date(+ new Date() + this.options.fromnow); + value = [ + now.getHours(), + now.getMinutes() + ]; + if (this.options.twelvehour) { + this.amOrPm = value[0] >= 12 && value[0] < 24 ? 'PM' : 'AM'; + } + } + this.hours = + value[0] || 0; + this.minutes = + value[1] || 0; + this.spanHours.html(this.hours); + this.spanMinutes.html(leadingZero(this.minutes)); + if (!this.isAppended) { + + // Append popover to input by default + var containerEl = document.querySelector(this.options.container); + if (this.options.container && containerEl) { + containerEl.appendChild(this.popover[0]); + } else { + this.popover.insertAfter(this.input); + } + + if (this.options.twelvehour) { + if (this.amOrPm === 'PM'){ + this.spanAmPm.children('#click-pm').addClass("text-primary"); + this.spanAmPm.children('#click-am').removeClass("text-primary"); + } else { + this.spanAmPm.children('#click-am').addClass("text-primary"); + this.spanAmPm.children('#click-pm').removeClass("text-primary"); + } + } + // Reset position when resize + $win.on('resize.clockpicker' + this.id, function() { + if (self.isShown) { + self.locate(); + } + }); + this.isAppended = true; + } + // Toggle to hours view + this.toggleView('hours'); + // Set position + this.locate(); + this.isShown = true; + // Hide when clicking or tabbing on any element except the clock and input + $doc.on('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id, function(e) { + var target = $(e.target); + if (target.closest(self.popover.find('.picker__wrap')).length === 0 && target.closest(self.input).length === 0) { + self.hide(); + } + }); + // Hide when ESC is pressed + $doc.on('keyup.clockpicker.' + this.id, function(e){ + if (e.keyCode === 27) { + self.hide(); + } + }); + raiseCallback(this.options.afterShow); + }; + // Hide popover + ClockPicker.prototype.hide = function() { + raiseCallback(this.options.beforeHide); + this.input.removeClass('picker__input picker__input--active'); + this.popover.removeClass('picker--opened'); + $(document.body).css('overflow', 'visible'); + this.isShown = false; + $(':input').each(function(index) { + $(this).attr('tabindex', index + 1); + }); + // Unbinding events on document + $doc.off('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id); + $doc.off('keyup.clockpicker.' + this.id); + this.popover.hide(); + raiseCallback(this.options.afterHide); + }; + // Toggle to hours or minutes view + ClockPicker.prototype.toggleView = function(view, delay) { + var raiseAfterHourSelect = false; + if (view === 'minutes' && $(this.hoursView).css("visibility") === "visible") { + raiseCallback(this.options.beforeHourSelect); + raiseAfterHourSelect = true; + } + var isHours = view === 'hours', + nextView = isHours ? this.hoursView : this.minutesView, + hideView = isHours ? this.minutesView : this.hoursView; + this.currentView = view; + + this.spanHours.toggleClass('text-primary', isHours); + this.spanMinutes.toggleClass('text-primary', ! isHours); + + // Let's make transitions + hideView.addClass('clockpicker-dial-out'); + nextView.css('visibility', 'visible').removeClass('clockpicker-dial-out'); + + // Reset clock hand + this.resetClock(delay); + + // After transitions ended + clearTimeout(this.toggleViewTimer); + this.toggleViewTimer = setTimeout(function() { + hideView.css('visibility', 'hidden'); + }, duration); + + if (raiseAfterHourSelect) { + raiseCallback(this.options.afterHourSelect); + } + }; + + // Reset clock hand + ClockPicker.prototype.resetClock = function(delay) { + var view = this.currentView, + value = this[view], + isHours = view === 'hours', + unit = Math.PI / (isHours ? 6 : 30), + radian = value * unit, + radius = isHours && value > 0 && value < 13 ? innerRadius : outerRadius, + x = Math.sin(radian) * radius, + y = - Math.cos(radian) * radius, + self = this; + + if (svgSupported && delay) { + self.canvas.addClass('clockpicker-canvas-out'); + setTimeout(function(){ + self.canvas.removeClass('clockpicker-canvas-out'); + self.setHand(x, y); + }, delay); + } else + this.setHand(x, y); + }; + + // Set clock hand to (x, y) + ClockPicker.prototype.setHand = function(x, y, roundBy5, dragging) { + var radian = Math.atan2(x, - y), + isHours = this.currentView === 'hours', + unit = Math.PI / (isHours || roundBy5? 6 : 30), + z = Math.sqrt(x * x + y * y), + options = this.options, + inner = isHours && z < (outerRadius + innerRadius) / 2, + radius = inner ? innerRadius : outerRadius, + value; + + if (options.twelvehour) { + radius = outerRadius; + } + + // Radian should in range [0, 2PI] + if (radian < 0) { + radian = Math.PI * 2 + radian; + } + + // Get the round value + value = Math.round(radian / unit); + + // Get the round radian + radian = value * unit; + + // Correct the hours or minutes + if (options.twelvehour) { + if (isHours) { + if (value === 0) + value = 12; + } else { + if (roundBy5) + value *= 5; + if (value === 60) + value = 0; + } + } else { + if (isHours) { + if (value === 12) + value = 0; + value = inner ? (value === 0 ? 12 : value) : value === 0 ? 0 : value + 12; + } else { + if (roundBy5) + value *= 5; + if (value === 60) + value = 0; + } + } + + // Once hours or minutes changed, vibrate the device + if (this[this.currentView] !== value) { + if (vibrate && this.options.vibrate) { + // Do not vibrate too frequently + if (!this.vibrateTimer) { + navigator[vibrate](10); + this.vibrateTimer = setTimeout($.proxy(function(){ + this.vibrateTimer = null; + }, this), 100); + } + } + } + + this[this.currentView] = value; + if (isHours) { + this['spanHours'].html(value); + } else { + this['spanMinutes'].html(leadingZero(value)); + } + + // If svg is not supported, just add an active class to the tick + if (!svgSupported) { + this[isHours ? 'hoursView' : 'minutesView'].find('.clockpicker-tick').each(function(){ + var tick = $(this); + tick.toggleClass('active', value === + tick.html()); + }); + return; + } + + // Set clock hand and others' position + var cx1 = Math.sin(radian) * (radius - tickRadius), + cy1 = - Math.cos(radian) * (radius - tickRadius), + cx2 = Math.sin(radian) * radius, + cy2 = - Math.cos(radian) * radius; + this.hand.setAttribute('x2', cx1); + this.hand.setAttribute('y2', cy1); + this.bg.setAttribute('cx', cx2); + this.bg.setAttribute('cy', cy2); + }; + + // Hours and minutes are selected + ClockPicker.prototype.done = function() { + raiseCallback(this.options.beforeDone); + this.hide(); + this.label.addClass('active'); + + var last = this.input.prop('value'), + value = leadingZero(this.hours) + ':' + leadingZero(this.minutes); + if (this.options.twelvehour) { + value = value + this.amOrPm; + } + + this.input.prop('value', value); + if (value !== last) { + this.input.triggerHandler('change'); + if (!this.isInput) { + this.element.trigger('change'); + } + } + + if (this.options.autoclose) + this.input.trigger('blur'); + + raiseCallback(this.options.afterDone); + }; + + // Clear input field + ClockPicker.prototype.clear = function() { + this.hide(); + this.label.removeClass('active'); + + var last = this.input.prop('value'), + value = ''; + + this.input.prop('value', value); + if (value !== last) { + this.input.triggerHandler('change'); + if (! this.isInput) { + this.element.trigger('change'); + } + } + + if (this.options.autoclose) { + this.input.trigger('blur'); + } + }; + + // Remove clockpicker from input + ClockPicker.prototype.remove = function() { + this.element.removeData('clockpicker'); + this.input.off('focus.clockpicker click.clockpicker'); + if (this.isShown) { + this.hide(); + } + if (this.isAppended) { + $win.off('resize.clockpicker' + this.id); + this.popover.remove(); + } + }; + + // Extends $.fn.clockpicker + $.fn.pickatime = function(option){ + var args = Array.prototype.slice.call(arguments, 1); + return this.each(function(){ + var $this = $(this), + data = $this.data('clockpicker'); + if (!data) { + var options = $.extend({}, ClockPicker.DEFAULTS, $this.data(), typeof option == 'object' && option); + $this.data('clockpicker', new ClockPicker($this, options)); + } else { + // Manual operatsions. show, hide, remove, e.g. + if (typeof data[option] === 'function') { + data[option].apply(data, args); + } + } + }); + }; +})(jQuery); diff --git a/app/dispatch/static/materialize/js/dropdown.js b/app/dispatch/static/materialize/js/dropdown.js new file mode 100644 index 0000000..6627e45 --- /dev/null +++ b/app/dispatch/static/materialize/js/dropdown.js @@ -0,0 +1,274 @@ +(function ($) { + + // Add posibility to scroll to selected option + // usefull for select for example + $.fn.scrollTo = function(elem) { + $(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top); + return this; + }; + + $.fn.dropdown = function (options) { + var defaults = { + inDuration: 300, + outDuration: 225, + constrainWidth: true, // Constrains width of dropdown to the activator + hover: false, + gutter: 0, // Spacing from edge + belowOrigin: false, + alignment: 'left', + stopPropagation: false + }; + + // Open dropdown. + if (options === "open") { + this.each(function() { + $(this).trigger('open'); + }); + return false; + } + + // Close dropdown. + if (options === "close") { + this.each(function() { + $(this).trigger('close'); + }); + return false; + } + + this.each(function(){ + var origin = $(this); + var curr_options = $.extend({}, defaults, options); + var isFocused = false; + + // Dropdown menu + var activates = $("#"+ origin.attr('data-activates')); + + function updateOptions() { + if (origin.data('induration') !== undefined) + curr_options.inDuration = origin.data('induration'); + if (origin.data('outduration') !== undefined) + curr_options.outDuration = origin.data('outduration'); + if (origin.data('constrainwidth') !== undefined) + curr_options.constrainWidth = origin.data('constrainwidth'); + if (origin.data('hover') !== undefined) + curr_options.hover = origin.data('hover'); + if (origin.data('gutter') !== undefined) + curr_options.gutter = origin.data('gutter'); + if (origin.data('beloworigin') !== undefined) + curr_options.belowOrigin = origin.data('beloworigin'); + if (origin.data('alignment') !== undefined) + curr_options.alignment = origin.data('alignment'); + if (origin.data('stoppropagation') !== undefined) + curr_options.stopPropagation = origin.data('stoppropagation'); + } + + updateOptions(); + + // Attach dropdown to its activator + origin.after(activates); + + /* + Helper function to position and resize dropdown. + Used in hover and click handler. + */ + function placeDropdown(eventType) { + // Check for simultaneous focus and click events. + if (eventType === 'focus') { + isFocused = true; + } + + // Check html data attributes + updateOptions(); + + // Set Dropdown state + activates.addClass('active'); + origin.addClass('active'); + + var originWidth = origin[0].getBoundingClientRect().width; + + // Constrain width + if (curr_options.constrainWidth === true) { + activates.css('width', originWidth); + + } else { + activates.css('white-space', 'nowrap'); + } + + // Offscreen detection + var windowHeight = window.innerHeight; + var originHeight = origin.innerHeight(); + var offsetLeft = origin.offset().left; + var offsetTop = origin.offset().top - $(window).scrollTop(); + var currAlignment = curr_options.alignment; + var gutterSpacing = 0; + var leftPosition = 0; + + // Below Origin + var verticalOffset = 0; + if (curr_options.belowOrigin === true) { + verticalOffset = originHeight; + } + + // Check for scrolling positioned container. + var scrollYOffset = 0; + var scrollXOffset = 0; + var wrapper = origin.parent(); + if (!wrapper.is('body')) { + if (wrapper[0].scrollHeight > wrapper[0].clientHeight) { + scrollYOffset = wrapper[0].scrollTop; + } + if (wrapper[0].scrollWidth > wrapper[0].clientWidth) { + scrollXOffset = wrapper[0].scrollLeft; + } + } + + + if (offsetLeft + activates.innerWidth() > $(window).width()) { + // Dropdown goes past screen on right, force right alignment + currAlignment = 'right'; + + } else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) { + // Dropdown goes past screen on left, force left alignment + currAlignment = 'left'; + } + // Vertical bottom offscreen detection + if (offsetTop + activates.innerHeight() > windowHeight) { + // If going upwards still goes offscreen, just crop height of dropdown. + if (offsetTop + originHeight - activates.innerHeight() < 0) { + var adjustedHeight = windowHeight - offsetTop - verticalOffset; + activates.css('max-height', adjustedHeight); + } else { + // Flow upwards. + if (!verticalOffset) { + verticalOffset += originHeight; + } + verticalOffset -= activates.innerHeight(); + } + } + + // Handle edge alignment + if (currAlignment === 'left') { + gutterSpacing = curr_options.gutter; + leftPosition = origin.position().left + gutterSpacing; + } + else if (currAlignment === 'right') { + // Material icons fix + activates + .stop(true, true) + .css({ + opacity: 0, + left: 0 + }) + + var offsetRight = origin.position().left + originWidth - activates.width(); + gutterSpacing = -curr_options.gutter; + leftPosition = offsetRight + gutterSpacing; + } + + // Position dropdown + activates.css({ + position: 'absolute', + top: origin.position().top + verticalOffset + scrollYOffset, + left: leftPosition + scrollXOffset + }); + + // Show dropdown + activates + .slideDown({ + queue: false, + duration: curr_options.inDuration, + easing: 'easeOutCubic', + complete: function() { + $(this).css('height', ''); + } + }) + .animate( {opacity: 1}, {queue: false, duration: curr_options.inDuration, easing: 'easeOutSine'}); + + // Add click close handler to document + setTimeout(function() { + $(document).on('click.'+ activates.attr('id'), function (e) { + hideDropdown(); + $(document).off('click.'+ activates.attr('id')); + }); + }, 0); + } + + function hideDropdown() { + // Check for simultaneous focus and click events. + isFocused = false; + activates.fadeOut(curr_options.outDuration); + activates.removeClass('active'); + origin.removeClass('active'); + $(document).off('click.'+ activates.attr('id')); + setTimeout(function() { activates.css('max-height', ''); }, curr_options.outDuration); + } + + // Hover + if (curr_options.hover) { + var open = false; + origin.off('click.' + origin.attr('id')); + // Hover handler to show dropdown + origin.on('mouseenter', function(e){ // Mouse over + if (open === false) { + placeDropdown(); + open = true; + } + }); + origin.on('mouseleave', function(e){ + // If hover on origin then to something other than dropdown content, then close + var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element + if(!$(toEl).closest('.dropdown-content').is(activates)) { + activates.stop(true, true); + hideDropdown(); + open = false; + } + }); + + activates.on('mouseleave', function(e){ // Mouse out + var toEl = e.toElement || e.relatedTarget; + if(!$(toEl).closest('.dropdown-button').is(origin)) { + activates.stop(true, true); + hideDropdown(); + open = false; + } + }); + + // Click + } else { + // Click handler to show dropdown + origin.off('click.' + origin.attr('id')); + origin.on('click.'+origin.attr('id'), function(e){ + if (!isFocused) { + if ( origin[0] == e.currentTarget && + !origin.hasClass('active') && + ($(e.target).closest('.dropdown-content').length === 0)) { + e.preventDefault(); // Prevents button click from moving window + if (curr_options.stopPropagation) { + e.stopPropagation(); + } + placeDropdown('click'); + } + // If origin is clicked and menu is open, close menu + else if (origin.hasClass('active')) { + hideDropdown(); + $(document).off('click.'+ activates.attr('id')); + } + } + }); + + } // End else + + // Listen to open and close event - useful for select component + origin.on('open', function(e, eventType) { + placeDropdown(eventType); + }); + origin.on('close', hideDropdown); + + + }); + }; // End dropdown plugin + + $(document).ready(function(){ + $('.dropdown-button').dropdown(); + }); +}( jQuery )); diff --git a/app/dispatch/static/materialize/js/forms.js b/app/dispatch/static/materialize/js/forms.js new file mode 100644 index 0000000..cda137e --- /dev/null +++ b/app/dispatch/static/materialize/js/forms.js @@ -0,0 +1,811 @@ +(function ($) { + $(document).ready(function() { + + // Function to update labels of text fields + Materialize.updateTextFields = function() { + var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea'; + $(input_selector).each(function(index, element) { + var $this = $(this); + if ($(element).val().length > 0 || $(element).is(':focus') || element.autofocus || $this.attr('placeholder') !== undefined) { + $this.siblings('label').addClass('active'); + } else if ($(element)[0].validity) { + $this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true); + } else { + $this.siblings('label').removeClass('active'); + } + }); + }; + + // Text based inputs + var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea'; + + // Add active if form auto complete + $(document).on('change', input_selector, function () { + if($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) { + $(this).siblings('label').addClass('active'); + } + validate_field($(this)); + }); + + // Add active if input element has been pre-populated on document ready + $(document).ready(function() { + Materialize.updateTextFields(); + }); + + // HTML DOM FORM RESET handling + $(document).on('reset', function(e) { + var formReset = $(e.target); + if (formReset.is('form')) { + formReset.find(input_selector).removeClass('valid').removeClass('invalid'); + formReset.find(input_selector).each(function () { + if ($(this).attr('value') === '') { + $(this).siblings('label').removeClass('active'); + } + }); + + // Reset select + formReset.find('select.initialized').each(function () { + var reset_text = formReset.find('option[selected]').text(); + formReset.siblings('input.select-dropdown').val(reset_text); + }); + } + }); + + // Add active when element has focus + $(document).on('focus', input_selector, function () { + $(this).siblings('label, .prefix').addClass('active'); + }); + + $(document).on('blur', input_selector, function () { + var $inputElement = $(this); + var selector = ".prefix"; + + if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) { + selector += ", label"; + } + + $inputElement.siblings(selector).removeClass('active'); + + validate_field($inputElement); + }); + + window.validate_field = function(object) { + var hasLength = object.attr('data-length') !== undefined; + var lenAttr = parseInt(object.attr('data-length')); + var len = object.val().length; + + if (object.val().length === 0 && object[0].validity.badInput === false && !object.is(':required')) { + if (object.hasClass('validate')) { + object.removeClass('valid'); + object.removeClass('invalid'); + } + } + else { + if (object.hasClass('validate')) { + // Check for character counter attributes + if ((object.is(':valid') && hasLength && (len <= lenAttr)) || (object.is(':valid') && !hasLength)) { + object.removeClass('invalid'); + object.addClass('valid'); + } + else { + object.removeClass('valid'); + object.addClass('invalid'); + } + } + } + }; + + // Radio and Checkbox focus class + var radio_checkbox = 'input[type=radio], input[type=checkbox]'; + $(document).on('keyup.radio', radio_checkbox, function(e) { + // TAB, check if tabbing to radio or checkbox. + if (e.which === 9) { + $(this).addClass('tabbed'); + var $this = $(this); + $this.one('blur', function(e) { + + $(this).removeClass('tabbed'); + }); + return; + } + }); + + // Textarea Auto Resize + var hiddenDiv = $('.hiddendiv').first(); + if (!hiddenDiv.length) { + hiddenDiv = $('
              '); + $('body').append(hiddenDiv); + } + var text_area_selector = '.materialize-textarea'; + + function textareaAutoResize($textarea) { + // Set font properties of hiddenDiv + + var fontFamily = $textarea.css('font-family'); + var fontSize = $textarea.css('font-size'); + var lineHeight = $textarea.css('line-height'); + var padding = $textarea.css('padding'); + + if (fontSize) { hiddenDiv.css('font-size', fontSize); } + if (fontFamily) { hiddenDiv.css('font-family', fontFamily); } + if (lineHeight) { hiddenDiv.css('line-height', lineHeight); } + if (padding) { hiddenDiv.css('padding', padding); } + + // Set original-height, if none + if (!$textarea.data('original-height')) { + $textarea.data('original-height', $textarea.height()); + } + + if ($textarea.attr('wrap') === 'off') { + hiddenDiv.css('overflow-wrap', 'normal') + .css('white-space', 'pre'); + } + + hiddenDiv.text($textarea.val() + '\n'); + var content = hiddenDiv.html().replace(/\n/g, '
              '); + hiddenDiv.html(content); + + + // When textarea is hidden, width goes crazy. + // Approximate with half of window size + + if ($textarea.is(':visible')) { + hiddenDiv.css('width', $textarea.width()); + } + else { + hiddenDiv.css('width', $(window).width()/2); + } + + + /** + * Resize if the new height is greater than the + * original height of the textarea + */ + if ($textarea.data('original-height') <= hiddenDiv.height()) { + $textarea.css('height', hiddenDiv.height()); + } else if ($textarea.val().length < $textarea.data('previous-length')) { + /** + * In case the new height is less than original height, it + * means the textarea has less text than before + * So we set the height to the original one + */ + $textarea.css('height', $textarea.data('original-height')); + } + $textarea.data('previous-length', $textarea.val().length); + } + + $(text_area_selector).each(function () { + var $textarea = $(this); + /** + * Instead of resizing textarea on document load, + * store the original height and the original length + */ + $textarea.data('original-height', $textarea.height()); + $textarea.data('previous-length', $textarea.val().length); + }); + + $('body').on('keyup keydown autoresize', text_area_selector, function () { + textareaAutoResize($(this)); + }); + + // File Input Path + $(document).on('change', '.file-field input[type="file"]', function () { + var file_field = $(this).closest('.file-field'); + var path_input = file_field.find('input.file-path'); + var files = $(this)[0].files; + var file_names = []; + for (var i = 0; i < files.length; i++) { + file_names.push(files[i].name); + } + path_input.val(file_names.join(", ")); + path_input.trigger('change'); + }); + + /**************** + * Range Input * + ****************/ + + var range_type = 'input[type=range]'; + var range_mousedown = false; + var left; + + $(range_type).each(function () { + var thumb = $(''); + $(this).after(thumb); + }); + + var showRangeBubble = function(thumb) { + var paddingLeft = parseInt(thumb.parent().css('padding-left')); + var marginLeft = (-7 + paddingLeft) + 'px'; + thumb.velocity({ height: "30px", width: "30px", top: "-30px", marginLeft: marginLeft}, { duration: 300, easing: 'easeOutExpo' }); + }; + + var calcRangeOffset = function(range) { + var width = range.width() - 15; + var max = parseFloat(range.attr('max')); + var min = parseFloat(range.attr('min')); + var percent = (parseFloat(range.val()) - min) / (max - min); + return percent * width; + } + + var range_wrapper = '.range-field'; + $(document).on('change', range_type, function(e) { + var thumb = $(this).siblings('.thumb'); + thumb.find('.value').html($(this).val()); + + if (!thumb.hasClass('active')) { + showRangeBubble(thumb); + } + + var offsetLeft = calcRangeOffset($(this)); + thumb.addClass('active').css('left', offsetLeft); + }); + + $(document).on('mousedown touchstart', range_type, function(e) { + var thumb = $(this).siblings('.thumb'); + + // If thumb indicator does not exist yet, create it + if (thumb.length <= 0) { + thumb = $(''); + $(this).after(thumb); + } + + // Set indicator value + thumb.find('.value').html($(this).val()); + + range_mousedown = true; + $(this).addClass('active'); + + if (!thumb.hasClass('active')) { + showRangeBubble(thumb); + } + + if (e.type !== 'input') { + var offsetLeft = calcRangeOffset($(this)); + thumb.addClass('active').css('left', offsetLeft); + } + }); + + $(document).on('mouseup touchend', range_wrapper, function() { + range_mousedown = false; + $(this).removeClass('active'); + }); + + $(document).on('input mousemove touchmove', range_wrapper, function(e) { + var thumb = $(this).children('.thumb'); + var left; + var input = $(this).find(range_type); + + if (range_mousedown) { + if (!thumb.hasClass('active')) { + showRangeBubble(thumb); + } + + var offsetLeft = calcRangeOffset(input); + thumb.addClass('active').css('left', offsetLeft); + thumb.find('.value').html(thumb.siblings(range_type).val()); + } + }); + + $(document).on('mouseout touchleave', range_wrapper, function() { + if (!range_mousedown) { + + var thumb = $(this).children('.thumb'); + var paddingLeft = parseInt($(this).css('padding-left')); + var marginLeft = (7 + paddingLeft) + 'px'; + + if (thumb.hasClass('active')) { + thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: marginLeft}, { duration: 100 }); + } + thumb.removeClass('active'); + } + }); + + /************************** + * Auto complete plugin * + *************************/ + $.fn.autocomplete = function (options) { + // Defaults + var defaults = { + data: {}, + limit: Infinity, + onAutocomplete: null, + minLength: 1 + }; + + options = $.extend(defaults, options); + + return this.each(function() { + var $input = $(this); + var data = options.data, + count = 0, + activeIndex = -1, + oldVal, + $inputDiv = $input.closest('.input-field'); // Div to append on + + // Check if data isn't empty + if (!$.isEmptyObject(data)) { + var $autocomplete = $(''); + var $oldAutocomplete; + + // Append autocomplete element. + // Prevent double structure init. + if ($inputDiv.length) { + $oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first(); + if (!$oldAutocomplete.length) { + $inputDiv.append($autocomplete); // Set ul in body + } + } else { + $oldAutocomplete = $input.next('.autocomplete-content.dropdown-content'); + if (!$oldAutocomplete.length) { + $input.after($autocomplete); + } + } + if ($oldAutocomplete.length) { + $autocomplete = $oldAutocomplete; + } + + // Highlight partial match. + var highlight = function(string, $el) { + var img = $el.find('img'); + var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""), + matchEnd = matchStart + string.length - 1, + beforeMatch = $el.text().slice(0, matchStart), + matchText = $el.text().slice(matchStart, matchEnd + 1), + afterMatch = $el.text().slice(matchEnd + 1); + $el.html("" + beforeMatch + "" + matchText + "" + afterMatch + ""); + if (img.length) { + $el.prepend(img); + } + }; + + // Reset current element position + var resetCurrentElement = function() { + activeIndex = -1; + $autocomplete.find('.active').removeClass('active'); + } + + // Remove autocomplete elements + var removeAutocomplete = function() { + $autocomplete.empty(); + resetCurrentElement(); + oldVal = undefined; + }; + + $input.off('blur.autocomplete').on('blur.autocomplete', function() { + removeAutocomplete(); + }); + + // Perform search + $input.off('keyup.autocomplete focus.autocomplete').on('keyup.autocomplete focus.autocomplete', function (e) { + // Reset count. + count = 0; + var val = $input.val().toLowerCase(); + + // Don't capture enter or arrow key usage. + if (e.which === 13 || + e.which === 38 || + e.which === 40) { + return; + } + + + // Check if the input isn't empty + if (oldVal !== val) { + removeAutocomplete(); + + if (val.length >= options.minLength) { + for(var key in data) { + if (data.hasOwnProperty(key) && + key.toLowerCase().indexOf(val) !== -1) { + // Break if past limit + if (count >= options.limit) { + break; + } + + var autocompleteOption = $('
            • '); + if (!!data[key]) { + autocompleteOption.append(''+ key +''); + } else { + autocompleteOption.append(''+ key +''); + } + + $autocomplete.append(autocompleteOption); + highlight(val, autocompleteOption); + count++; + } + } + } + } + + // Update oldVal + oldVal = val; + }); + + $input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) { + // Arrow keys and enter key usage + var keyCode = e.which, + liElement, + numItems = $autocomplete.children('li').length, + $active = $autocomplete.children('.active').first(); + + // select element on Enter + if (keyCode === 13 && activeIndex >= 0) { + liElement = $autocomplete.children('li').eq(activeIndex); + if (liElement.length) { + liElement.trigger('mousedown.autocomplete'); + e.preventDefault(); + } + return; + } + + // Capture up and down key + if ( keyCode === 38 || keyCode === 40 ) { + e.preventDefault(); + + if (keyCode === 38 && + activeIndex > 0) { + activeIndex--; + } + + if (keyCode === 40 && + activeIndex < (numItems - 1)) { + activeIndex++; + } + + $active.removeClass('active'); + if (activeIndex >= 0) { + $autocomplete.children('li').eq(activeIndex).addClass('active'); + } + } + }); + + // Set input value + $autocomplete.off('mousedown.autocomplete touchstart.autocomplete').on('mousedown.autocomplete touchstart.autocomplete', 'li', function () { + var text = $(this).text().trim(); + $input.val(text); + $input.trigger('change'); + removeAutocomplete(); + + // Handle onAutocomplete callback. + if (typeof(options.onAutocomplete) === "function") { + options.onAutocomplete.call(this, text); + } + }); + + // Empty data + } else { + $input.off('keyup.autocomplete focus.autocomplete'); + } + }); + }; + + }); // End of $(document).ready + + /******************* + * Select Plugin * + ******************/ + $.fn.material_select = function (callback) { + $(this).each(function(){ + var $select = $(this); + + if ($select.hasClass('browser-default')) { + return; // Continue to next (return false breaks out of entire loop) + } + + var multiple = $select.attr('multiple') ? true : false, + lastID = $select.attr('data-select-id'); // Tear down structure if Select needs to be rebuilt + + if (lastID) { + $select.parent().find('span.caret').remove(); + $select.parent().find('input').remove(); + + $select.unwrap(); + $('ul#select-options-'+lastID).remove(); + } + + // If destroying the select, remove the selelct-id and reset it to it's uninitialized state. + if(callback === 'destroy') { + $select.removeAttr('data-select-id').removeClass('initialized'); + $(window).off('click.select'); + return; + } + + var uniqueID = Materialize.guid(); + $select.attr('data-select-id', uniqueID); + var wrapper = $('
              '); + wrapper.addClass($select.attr('class')); + if ($select.is(':disabled')) + wrapper.addClass('disabled'); + var options = $(''), + selectChildren = $select.children('option, optgroup'), + valuesSelected = [], + optionsHover = false; + + var label = $select.find('option:selected').html() || $select.find('option:first').html() || ""; + + // Function that renders and appends the option taking into + // account type and possible image icon. + var appendOptionWithIcon = function(select, option, type) { + // Add disabled attr if disabled + var disabledClass = (option.is(':disabled')) ? 'disabled ' : ''; + var optgroupClass = (type === 'optgroup-option') ? 'optgroup-option ' : ''; + var multipleCheckbox = multiple ? '' : ''; + + // add icons + var icon_url = option.data('icon'); + var classes = option.attr('class'); + if (!!icon_url) { + var classString = ''; + if (!!classes) classString = ' class="' + classes + '"'; + + // Check for multiple type. + options.append($('
            • ' + multipleCheckbox + option.html() + '
            • ')); + return true; + } + + // Check for multiple type. + options.append($('
            • ' + multipleCheckbox + option.html() + '
            • ')); + }; + + /* Create dropdown structure. */ + if (selectChildren.length) { + selectChildren.each(function() { + if ($(this).is('option')) { + // Direct descendant option. + if (multiple) { + appendOptionWithIcon($select, $(this), 'multiple'); + + } else { + appendOptionWithIcon($select, $(this)); + } + } else if ($(this).is('optgroup')) { + // Optgroup. + var selectOptions = $(this).children('option'); + options.append($('
            • ' + $(this).attr('label') + '
            • ')); + + selectOptions.each(function() { + appendOptionWithIcon($select, $(this), 'optgroup-option'); + }); + } + }); + } + + options.find('li:not(.optgroup)').each(function (i) { + $(this).click(function (e) { + // Check if option element is disabled + if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) { + var selected = true; + + if (multiple) { + $('input[type="checkbox"]', this).prop('checked', function(i, v) { return !v; }); + selected = toggleEntryFromArray(valuesSelected, i, $select); + $newSelect.trigger('focus'); + } else { + options.find('li').removeClass('active'); + $(this).toggleClass('active'); + $newSelect.val($(this).text()); + } + + activateOption(options, $(this)); + $select.find('option').eq(i).prop('selected', selected); + // Trigger onchange() event + $select.trigger('change'); + if (typeof callback !== 'undefined') callback(); + } + + e.stopPropagation(); + }); + }); + + // Wrap Elements + $select.wrap(wrapper); + // Add Select Display Element + var dropdownIcon = $(''); + + // escape double quotes + var sanitizedLabelHtml = label.replace(/"/g, '"'); + + var $newSelect = $(''); + $select.before($newSelect); + $newSelect.before(dropdownIcon); + + $newSelect.after(options); + // Check if section element is disabled + if (!$select.is(':disabled')) { + $newSelect.dropdown({'hover': false}); + } + + // Copy tabindex + if ($select.attr('tabindex')) { + $($newSelect[0]).attr('tabindex', $select.attr('tabindex')); + } + + $select.addClass('initialized'); + + $newSelect.on({ + 'focus': function (){ + if ($('ul.select-dropdown').not(options[0]).is(':visible')) { + $('input.select-dropdown').trigger('close'); + $(window).off('click.select'); + } + if (!options.is(':visible')) { + $(this).trigger('open', ['focus']); + var label = $(this).val(); + if (multiple && label.indexOf(',') >= 0) { + label = label.split(',')[0]; + } + + var selectedOption = options.find('li').filter(function() { + return $(this).text().toLowerCase() === label.toLowerCase(); + })[0]; + activateOption(options, selectedOption, true); + + $(window).off('click.select').on('click.select', function () { + multiple && (optionsHover || $newSelect.trigger('close')); + $(window).off('click.select'); + }); + } + }, + 'click': function (e){ + e.stopPropagation(); + } + }); + + $newSelect.on('blur', function() { + if (!multiple) { + $(this).trigger('close'); + $(window).off('click.select'); + } + options.find('li.selected').removeClass('selected'); + }); + + options.hover(function() { + optionsHover = true; + }, function () { + optionsHover = false; + }); + + // Add initial multiple selections. + if (multiple) { + $select.find("option:selected:not(:disabled)").each(function () { + var index = this.index; + + toggleEntryFromArray(valuesSelected, index, $select); + options.find("li:not(.optgroup)").eq(index).find(":checkbox").prop("checked", true); + }); + } + + /** + * Make option as selected and scroll to selected position + * @param {jQuery} collection Select options jQuery element + * @param {Element} newOption element of the new option + * @param {Boolean} firstActivation If on first activation of select + */ + var activateOption = function(collection, newOption, firstActivation) { + if (newOption) { + collection.find('li.selected').removeClass('selected'); + var option = $(newOption); + option.addClass('selected'); + if (!multiple || !!firstActivation) { + options.scrollTo(option); + } + } + }; + + // Allow user to search by typing + // this array is cleared after 1 second + var filterQuery = [], + onKeyDown = function(e){ + // TAB - switch to another input + if(e.which == 9){ + $newSelect.trigger('close'); + return; + } + + // ARROW DOWN WHEN SELECT IS CLOSED - open select options + if(e.which == 40 && !options.is(':visible')){ + $newSelect.trigger('open'); + return; + } + + // ENTER WHEN SELECT IS CLOSED - submit form + if(e.which == 13 && !options.is(':visible')){ + return; + } + + e.preventDefault(); + + // CASE WHEN USER TYPE LETTERS + var letter = String.fromCharCode(e.which).toLowerCase(), + nonLetters = [9,13,27,38,40]; + if (letter && (nonLetters.indexOf(e.which) === -1)) { + filterQuery.push(letter); + + var string = filterQuery.join(''), + newOption = options.find('li').filter(function() { + return $(this).text().toLowerCase().indexOf(string) === 0; + })[0]; + + if (newOption) { + activateOption(options, newOption); + } + } + + // ENTER - select option and close when select options are opened + if (e.which == 13) { + var activeOption = options.find('li.selected:not(.disabled)')[0]; + if(activeOption){ + $(activeOption).trigger('click'); + if (!multiple) { + $newSelect.trigger('close'); + } + } + } + + // ARROW DOWN - move to next not disabled option + if (e.which == 40) { + if (options.find('li.selected').length) { + newOption = options.find('li.selected').next('li:not(.disabled)')[0]; + } else { + newOption = options.find('li:not(.disabled)')[0]; + } + activateOption(options, newOption); + } + + // ESC - close options + if (e.which == 27) { + $newSelect.trigger('close'); + } + + // ARROW UP - move to previous not disabled option + if (e.which == 38) { + newOption = options.find('li.selected').prev('li:not(.disabled)')[0]; + if(newOption) + activateOption(options, newOption); + } + + // Automaticaly clean filter query so user can search again by starting letters + setTimeout(function(){ filterQuery = []; }, 1000); + }; + + $newSelect.on('keydown', onKeyDown); + }); + + function toggleEntryFromArray(entriesArray, entryIndex, select) { + var index = entriesArray.indexOf(entryIndex), + notAdded = index === -1; + + if (notAdded) { + entriesArray.push(entryIndex); + } else { + entriesArray.splice(index, 1); + } + + select.siblings('ul.dropdown-content').find('li:not(.optgroup)').eq(entryIndex).toggleClass('active'); + + // use notAdded instead of true (to detect if the option is selected or not) + select.find('option').eq(entryIndex).prop('selected', notAdded); + setValueToInput(entriesArray, select); + + return notAdded; + } + + function setValueToInput(entriesArray, select) { + var value = ''; + + for (var i = 0, count = entriesArray.length; i < count; i++) { + var text = select.find('option').eq(entriesArray[i]).text(); + + i === 0 ? value += text : value += ', ' + text; + } + + if (value === '') { + value = select.find('option:disabled').eq(0).text(); + } + + select.siblings('input.select-dropdown').val(value); + } + }; + +}( jQuery )); diff --git a/app/dispatch/static/materialize/js/global.js b/app/dispatch/static/materialize/js/global.js new file mode 100644 index 0000000..db5437b --- /dev/null +++ b/app/dispatch/static/materialize/js/global.js @@ -0,0 +1,177 @@ +// Required for Meteor package, the use of window prevents export by Meteor +(function(window){ + if(window.Package){ + Materialize = {}; + } else { + window.Materialize = {}; + } +})(window); + +if (typeof exports !== 'undefined' && !exports.nodeType) { + if (typeof module !== 'undefined' && !module.nodeType && module.exports) { + exports = module.exports = Materialize; + } + exports.default = Materialize; +} + +/* + * raf.js + * https://github.com/ngryman/raf.js + * + * original requestAnimationFrame polyfill by Erik Möller + * inspired from paul_irish gist and post + * + * Copyright (c) 2013 ngryman + * Licensed under the MIT license. + */ +(function(window) { + var lastTime = 0, + vendors = ['webkit', 'moz'], + requestAnimationFrame = window.requestAnimationFrame, + cancelAnimationFrame = window.cancelAnimationFrame, + i = vendors.length; + + // try to un-prefix existing raf + while (--i >= 0 && !requestAnimationFrame) { + requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame']; + cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame']; + } + + // polyfill with setTimeout fallback + // heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945 + if (!requestAnimationFrame || !cancelAnimationFrame) { + requestAnimationFrame = function(callback) { + var now = +Date.now(), + nextTime = Math.max(lastTime + 16, now); + return setTimeout(function() { + callback(lastTime = nextTime); + }, nextTime - now); + }; + + cancelAnimationFrame = clearTimeout; + } + + // export to window + window.requestAnimationFrame = requestAnimationFrame; + window.cancelAnimationFrame = cancelAnimationFrame; +}(window)); + +/** + * Generate approximated selector string for a jQuery object + * @param {jQuery} obj jQuery object to be parsed + * @returns {string} + */ +Materialize.objectSelectorString = function(obj) { + var tagStr = obj.prop('tagName') || ''; + var idStr = obj.attr('id') || ''; + var classStr = obj.attr('class') || ''; + return (tagStr + idStr + classStr).replace(/\s/g,''); +}; + + +// Unique Random ID +Materialize.guid = (function() { + function s4() { + return Math.floor((1 + Math.random()) * 0x10000) + .toString(16) + .substring(1); + } + return function() { + return s4() + s4() + '-' + s4() + '-' + s4() + '-' + + s4() + '-' + s4() + s4() + s4(); + }; +})(); + +/** + * Escapes hash from special characters + * @param {string} hash String returned from this.hash + * @returns {string} + */ +Materialize.escapeHash = function(hash) { + return hash.replace( /(:|\.|\[|\]|,|=)/g, "\\$1" ); +}; + +Materialize.elementOrParentIsFixed = function(element) { + var $element = $(element); + var $checkElements = $element.add($element.parents()); + var isFixed = false; + $checkElements.each(function(){ + if ($(this).css("position") === "fixed") { + isFixed = true; + return false; + } + }); + return isFixed; +}; + + +/** + * Get time in ms + * @license https://raw.github.com/jashkenas/underscore/master/LICENSE + * @type {function} + * @return {number} + */ +var getTime = (Date.now || function () { + return new Date().getTime(); +}); + + +/** + * Returns a function, that, when invoked, will only be triggered at most once + * during a given window of time. Normally, the throttled function will run + * as much as it can, without ever going more than once per `wait` duration; + * but if you'd like to disable the execution on the leading edge, pass + * `{leading: false}`. To disable execution on the trailing edge, ditto. + * @license https://raw.github.com/jashkenas/underscore/master/LICENSE + * @param {function} func + * @param {number} wait + * @param {Object=} options + * @returns {Function} + */ +Materialize.throttle = function(func, wait, options) { + var context, args, result; + var timeout = null; + var previous = 0; + options || (options = {}); + var later = function () { + previous = options.leading === false ? 0 : getTime(); + timeout = null; + result = func.apply(context, args); + context = args = null; + }; + return function () { + var now = getTime(); + if (!previous && options.leading === false) previous = now; + var remaining = wait - (now - previous); + context = this; + args = arguments; + if (remaining <= 0) { + clearTimeout(timeout); + timeout = null; + previous = now; + result = func.apply(context, args); + context = args = null; + } else if (!timeout && options.trailing !== false) { + timeout = setTimeout(later, remaining); + } + return result; + }; +}; + + +// Velocity has conflicts when loaded with jQuery, this will check for it +// First, check if in noConflict mode +var Vel; +if (jQuery) { + Vel = jQuery.Velocity; +} else if ($) { + Vel = $.Velocity; +} else { + Vel = Velocity; +} + +if (Vel) { + Materialize.Vel = Vel; +} else { + Materialize.Vel = Velocity; +} diff --git a/app/dispatch/static/materialize/js/hammer.min.js b/app/dispatch/static/materialize/js/hammer.min.js new file mode 100644 index 0000000..6c232c8 --- /dev/null +++ b/app/dispatch/static/materialize/js/hammer.min.js @@ -0,0 +1 @@ +!function(a,b,c,d){"use strict";function k(a,b,c){return setTimeout(q(a,c),b)}function l(a,b,c){return Array.isArray(a)?(m(a,c[b],c),!0):!1}function m(a,b,c){var e;if(a)if(a.forEach)a.forEach(b,c);else if(a.length!==d)for(e=0;e-1}function x(a){return a.trim().split(/\s+/g)}function y(a,b,c){if(a.indexOf&&!c)return a.indexOf(b);for(var d=0;dc[b]}):d.sort()),d}function B(a,b){for(var c,f,g=b[0].toUpperCase()+b.slice(1),h=0;h1&&!c.firstMultiple?c.firstMultiple=gb(b):1===e&&(c.firstMultiple=!1);var f=c.firstInput,g=c.firstMultiple,h=g?g.center:f.center,i=b.center=hb(d);b.timeStamp=j(),b.deltaTime=b.timeStamp-f.timeStamp,b.angle=lb(h,i),b.distance=kb(h,i),eb(c,b),b.offsetDirection=jb(b.deltaX,b.deltaY),b.scale=g?nb(g.pointers,d):1,b.rotation=g?mb(g.pointers,d):0,fb(c,b);var k=a.element;v(b.srcEvent.target,k)&&(k=b.srcEvent.target),b.target=k}function eb(a,b){var c=b.center,d=a.offsetDelta||{},e=a.prevDelta||{},f=a.prevInput||{};(b.eventType===O||f.eventType===Q)&&(e=a.prevDelta={x:f.deltaX||0,y:f.deltaY||0},d=a.offsetDelta={x:c.x,y:c.y}),b.deltaX=e.x+(c.x-d.x),b.deltaY=e.y+(c.y-d.y)}function fb(a,b){var f,g,h,j,c=a.lastInterval||b,e=b.timeStamp-c.timeStamp;if(b.eventType!=R&&(e>N||c.velocity===d)){var k=c.deltaX-b.deltaX,l=c.deltaY-b.deltaY,m=ib(e,k,l);g=m.x,h=m.y,f=i(m.x)>i(m.y)?m.x:m.y,j=jb(k,l),a.lastInterval=b}else f=c.velocity,g=c.velocityX,h=c.velocityY,j=c.direction;b.velocity=f,b.velocityX=g,b.velocityY=h,b.direction=j}function gb(a){for(var b=[],c=0;ce;)c+=a[e].clientX,d+=a[e].clientY,e++;return{x:h(c/b),y:h(d/b)}}function ib(a,b,c){return{x:b/a||0,y:c/a||0}}function jb(a,b){return a===b?S:i(a)>=i(b)?a>0?T:U:b>0?V:W}function kb(a,b,c){c||(c=$);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return Math.sqrt(d*d+e*e)}function lb(a,b,c){c||(c=$);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return 180*Math.atan2(e,d)/Math.PI}function mb(a,b){return lb(b[1],b[0],_)-lb(a[1],a[0],_)}function nb(a,b){return kb(b[0],b[1],_)/kb(a[0],a[1],_)}function rb(){this.evEl=pb,this.evWin=qb,this.allow=!0,this.pressed=!1,ab.apply(this,arguments)}function wb(){this.evEl=ub,this.evWin=vb,ab.apply(this,arguments),this.store=this.manager.session.pointerEvents=[]}function Ab(){this.evTarget=yb,this.evWin=zb,this.started=!1,ab.apply(this,arguments)}function Bb(a,b){var c=z(a.touches),d=z(a.changedTouches);return b&(Q|R)&&(c=A(c.concat(d),"identifier",!0)),[c,d]}function Eb(){this.evTarget=Db,this.targetIds={},ab.apply(this,arguments)}function Fb(a,b){var c=z(a.touches),d=this.targetIds;if(b&(O|P)&&1===c.length)return d[c[0].identifier]=!0,[c,c];var e,f,g=z(a.changedTouches),h=[],i=this.target;if(f=c.filter(function(a){return v(a.target,i)}),b===O)for(e=0;eh&&(b.push(a),h=b.length-1):e&(Q|R)&&(c=!0),0>h||(b[h]=a,this.callback(this.manager,e,{pointers:b,changedPointers:[a],pointerType:f,srcEvent:a}),c&&b.splice(h,1))}});var xb={touchstart:O,touchmove:P,touchend:Q,touchcancel:R},yb="touchstart",zb="touchstart touchmove touchend touchcancel";p(Ab,ab,{handler:function(a){var b=xb[a.type];if(b===O&&(this.started=!0),this.started){var c=Bb.call(this,a,b);b&(Q|R)&&0===c[0].length-c[1].length&&(this.started=!1),this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:J,srcEvent:a})}}});var Cb={touchstart:O,touchmove:P,touchend:Q,touchcancel:R},Db="touchstart touchmove touchend touchcancel";p(Eb,ab,{handler:function(a){var b=Cb[a.type],c=Fb.call(this,a,b);c&&this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:J,srcEvent:a})}}),p(Gb,ab,{handler:function(a,b,c){var d=c.pointerType==J,e=c.pointerType==L;if(d)this.mouse.allow=!1;else if(e&&!this.mouse.allow)return;b&(Q|R)&&(this.mouse.allow=!0),this.callback(a,b,c)},destroy:function(){this.touch.destroy(),this.mouse.destroy()}});var Hb=B(f.style,"touchAction"),Ib=Hb!==d,Jb="compute",Kb="auto",Lb="manipulation",Mb="none",Nb="pan-x",Ob="pan-y";Pb.prototype={set:function(a){a==Jb&&(a=this.compute()),Ib&&(this.manager.element.style[Hb]=a),this.actions=a.toLowerCase().trim()},update:function(){this.set(this.manager.options.touchAction)},compute:function(){var a=[];return m(this.manager.recognizers,function(b){r(b.options.enable,[b])&&(a=a.concat(b.getTouchAction()))}),Qb(a.join(" "))},preventDefaults:function(a){if(!Ib){var b=a.srcEvent,c=a.offsetDirection;if(this.manager.session.prevented)return b.preventDefault(),void 0;var d=this.actions,e=w(d,Mb),f=w(d,Ob),g=w(d,Nb);return e||f&&c&X||g&&c&Y?this.preventSrc(b):void 0}},preventSrc:function(a){this.manager.session.prevented=!0,a.preventDefault()}};var Rb=1,Sb=2,Tb=4,Ub=8,Vb=Ub,Wb=16,Xb=32;Yb.prototype={defaults:{},set:function(a){return n(this.options,a),this.manager&&this.manager.touchAction.update(),this},recognizeWith:function(a){if(l(a,"recognizeWith",this))return this;var b=this.simultaneous;return a=_b(a,this),b[a.id]||(b[a.id]=a,a.recognizeWith(this)),this},dropRecognizeWith:function(a){return l(a,"dropRecognizeWith",this)?this:(a=_b(a,this),delete this.simultaneous[a.id],this)},requireFailure:function(a){if(l(a,"requireFailure",this))return this;var b=this.requireFail;return a=_b(a,this),-1===y(b,a)&&(b.push(a),a.requireFailure(this)),this},dropRequireFailure:function(a){if(l(a,"dropRequireFailure",this))return this;a=_b(a,this);var b=y(this.requireFail,a);return b>-1&&this.requireFail.splice(b,1),this},hasRequireFailures:function(){return this.requireFail.length>0},canRecognizeWith:function(a){return!!this.simultaneous[a.id]},emit:function(a){function d(d){b.manager.emit(b.options.event+(d?Zb(c):""),a)}var b=this,c=this.state;Ub>c&&d(!0),d(),c>=Ub&&d(!0)},tryEmit:function(a){return this.canEmit()?this.emit(a):(this.state=Xb,void 0)},canEmit:function(){for(var a=0;af?T:U,c=f!=this.pX,d=Math.abs(a.deltaX)):(e=0===g?S:0>g?V:W,c=g!=this.pY,d=Math.abs(a.deltaY))),a.direction=e,c&&d>b.threshold&&e&b.direction},attrTest:function(a){return ac.prototype.attrTest.call(this,a)&&(this.state&Sb||!(this.state&Sb)&&this.directionTest(a))},emit:function(a){this.pX=a.deltaX,this.pY=a.deltaY;var b=$b(a.direction);b&&this.manager.emit(this.options.event+b,a),this._super.emit.call(this,a)}}),p(cc,ac,{defaults:{event:"pinch",threshold:0,pointers:2},getTouchAction:function(){return[Mb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.scale-1)>this.options.threshold||this.state&Sb)},emit:function(a){if(this._super.emit.call(this,a),1!==a.scale){var b=a.scale<1?"in":"out";this.manager.emit(this.options.event+b,a)}}}),p(dc,Yb,{defaults:{event:"press",pointers:1,time:500,threshold:5},getTouchAction:function(){return[Kb]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distanceb.time;if(this._input=a,!d||!c||a.eventType&(Q|R)&&!e)this.reset();else if(a.eventType&O)this.reset(),this._timer=k(function(){this.state=Vb,this.tryEmit()},b.time,this);else if(a.eventType&Q)return Vb;return Xb},reset:function(){clearTimeout(this._timer)},emit:function(a){this.state===Vb&&(a&&a.eventType&Q?this.manager.emit(this.options.event+"up",a):(this._input.timeStamp=j(),this.manager.emit(this.options.event,this._input)))}}),p(ec,ac,{defaults:{event:"rotate",threshold:0,pointers:2},getTouchAction:function(){return[Mb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.rotation)>this.options.threshold||this.state&Sb)}}),p(fc,ac,{defaults:{event:"swipe",threshold:10,velocity:.65,direction:X|Y,pointers:1},getTouchAction:function(){return bc.prototype.getTouchAction.call(this)},attrTest:function(a){var c,b=this.options.direction;return b&(X|Y)?c=a.velocity:b&X?c=a.velocityX:b&Y&&(c=a.velocityY),this._super.attrTest.call(this,a)&&b&a.direction&&a.distance>this.options.threshold&&i(c)>this.options.velocity&&a.eventType&Q},emit:function(a){var b=$b(a.direction);b&&this.manager.emit(this.options.event+b,a),this.manager.emit(this.options.event,a)}}),p(gc,Yb,{defaults:{event:"tap",pointers:1,taps:1,interval:300,time:250,threshold:2,posThreshold:10},getTouchAction:function(){return[Lb]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance
              ').addClass('material-placeholder'); + var originalWidth = 0; + var originalHeight = 0; + var ancestorsChanged; + var ancestor; + var originInlineStyles = origin.attr('style'); + origin.wrap(placeholder); + + + // Start click handler + origin.on('click', function() { + var placeholder = origin.parent('.material-placeholder'); + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var originalWidth = origin.width(); + var originalHeight = origin.height(); + + + // If already modal, return to original + if (doneAnimating === false) { + returnToOriginal(); + return false; + } + else if (overlayActive && doneAnimating===true) { + returnToOriginal(); + return false; + } + + + // Set states + doneAnimating = false; + origin.addClass('active'); + overlayActive = true; + + // Set positioning for placeholder + placeholder.css({ + width: placeholder[0].getBoundingClientRect().width, + height: placeholder[0].getBoundingClientRect().height, + position: 'relative', + top: 0, + left: 0 + }); + + // Find ancestor with overflow: hidden; and remove it + ancestorsChanged = undefined; + ancestor = placeholder[0].parentNode; + var count = 0; + while (ancestor !== null && !$(ancestor).is(document)) { + var curr = $(ancestor); + if (curr.css('overflow') !== 'visible') { + curr.css('overflow', 'visible'); + if (ancestorsChanged === undefined) { + ancestorsChanged = curr; + } + else { + ancestorsChanged = ancestorsChanged.add(curr); + } + } + ancestor = ancestor.parentNode; + } + + // Set css on origin + origin.css({ + position: 'absolute', + 'z-index': 1000, + 'will-change': 'left, top, width, height' + }) + .data('width', originalWidth) + .data('height', originalHeight); + + // Add overlay + var overlay = $('
              ') + .css({ + opacity: 0 + }) + .click(function(){ + if (doneAnimating === true) + returnToOriginal(); + }); + + // Put before in origin image to preserve z-index layering. + origin.before(overlay); + + // Set dimensions if needed + var overlayOffset = overlay[0].getBoundingClientRect(); + overlay.css({ + width: windowWidth, + height: windowHeight, + left: -1 * overlayOffset.left, + top: -1 * overlayOffset.top + }) + + // Animate Overlay + overlay.velocity({opacity: 1}, + {duration: inDuration, queue: false, easing: 'easeOutQuad'} ); + + // Add and animate caption if it exists + if (origin.data('caption') !== "") { + var $photo_caption = $('
              '); + $photo_caption.text(origin.data('caption')); + $('body').append($photo_caption); + $photo_caption.css({ "display": "inline" }); + $photo_caption.velocity({opacity: 1}, {duration: inDuration, queue: false, easing: 'easeOutQuad'}); + } + + // Resize Image + var ratio = 0; + var widthPercent = originalWidth / windowWidth; + var heightPercent = originalHeight / windowHeight; + var newWidth = 0; + var newHeight = 0; + + if (widthPercent > heightPercent) { + ratio = originalHeight / originalWidth; + newWidth = windowWidth * 0.9; + newHeight = windowWidth * 0.9 * ratio; + } + else { + ratio = originalWidth / originalHeight; + newWidth = (windowHeight * 0.9) * ratio; + newHeight = windowHeight * 0.9; + } + + // Animate image + set z-index + if(origin.hasClass('responsive-img')) { + origin.velocity({'max-width': newWidth, 'width': originalWidth}, {duration: 0, queue: false, + complete: function(){ + origin.css({left: 0, top: 0}) + .velocity( + { + height: newHeight, + width: newWidth, + left: $(document).scrollLeft() + windowWidth/2 - origin.parent('.material-placeholder').offset().left - newWidth/2, + top: $(document).scrollTop() + windowHeight/2 - origin.parent('.material-placeholder').offset().top - newHeight/ 2 + }, + { + duration: inDuration, + queue: false, + easing: 'easeOutQuad', + complete: function(){doneAnimating = true;} + } + ); + } // End Complete + }); // End Velocity + } + else { + origin.css('left', 0) + .css('top', 0) + .velocity( + { + height: newHeight, + width: newWidth, + left: $(document).scrollLeft() + windowWidth/2 - origin.parent('.material-placeholder').offset().left - newWidth/2, + top: $(document).scrollTop() + windowHeight/2 - origin.parent('.material-placeholder').offset().top - newHeight/ 2 + }, + { + duration: inDuration, + queue: false, + easing: 'easeOutQuad', + complete: function(){doneAnimating = true;} + } + ); // End Velocity + } + + // Handle Exit triggers + $(window).on('scroll.materialbox', function() { + if (overlayActive) { + returnToOriginal(); + } + }); + + $(window).on('resize.materialbox', function() { + if (overlayActive) { + returnToOriginal(); + } + }); + + $(document).on('keyup.materialbox', function(e) { + // ESC key + if (e.keyCode === 27 && + doneAnimating === true && + overlayActive) { + returnToOriginal(); + } + }); + + }); // End click handler + + + // This function returns the modaled image to the original spot + function returnToOriginal() { + + doneAnimating = false; + + var placeholder = origin.parent('.material-placeholder'); + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var originalWidth = origin.data('width'); + var originalHeight = origin.data('height'); + + origin.velocity("stop", true); + $('#materialbox-overlay').velocity("stop", true); + $('.materialbox-caption').velocity("stop", true); + + // disable exit handlers + $(window).off('scroll.materialbox'); + $(document).off('keyup.materialbox'); + $(window).off('resize.materialbox'); + + $('#materialbox-overlay').velocity({opacity: 0}, { + duration: outDuration, // Delay prevents animation overlapping + queue: false, easing: 'easeOutQuad', + complete: function(){ + // Remove Overlay + overlayActive = false; + $(this).remove(); + } + }); + + // Resize Image + origin.velocity( + { + width: originalWidth, + height: originalHeight, + left: 0, + top: 0 + }, + { + duration: outDuration, + queue: false, easing: 'easeOutQuad', + complete: function() { + placeholder.css({ + height: '', + width: '', + position: '', + top: '', + left: '' + }); + + origin.removeAttr('style'); + origin.attr('style', originInlineStyles); + + // Remove class + origin.removeClass('active'); + doneAnimating = true; + + // Remove overflow overrides on ancestors + if (ancestorsChanged) { + ancestorsChanged.css('overflow', ''); + } + } + } + ); + + // Remove Caption + reset css settings on image + $('.materialbox-caption').velocity({opacity: 0}, { + duration: outDuration, // Delay prevents animation overlapping + queue: false, easing: 'easeOutQuad', + complete: function(){ + $(this).remove(); + } + }); + + } + }); + }; + + $(document).ready(function(){ + $('.materialboxed').materialbox(); + }); + +}( jQuery )); diff --git a/app/dispatch/static/materialize/js/modal.js b/app/dispatch/static/materialize/js/modal.js new file mode 100644 index 0000000..fb182d7 --- /dev/null +++ b/app/dispatch/static/materialize/js/modal.js @@ -0,0 +1,371 @@ +(function($, Vel) { + 'use strict'; + + let _defaults = { + opacity: 0.5, + inDuration: 250, + outDuration: 250, + ready: undefined, + complete: undefined, + dismissible: true, + startingTop: '4%', + endingTop: '10%' + }; + + + /** + * @class + * + */ + class Modal { + /** + * Construct Modal instance and set up overlay + * @constructor + * @param {jQuery} $el + * @param {Object} options + */ + constructor($el, options) { + + // If exists, destroy and reinitialize + if (!!$el[0].M_Modal) { + $el[0].M_Modal.destroy(); + } + + /** + * The jQuery element + * @type {jQuery} + */ + this.$el = $el; + + /** + * Options for the modal + * @member Modal#options + * @prop {Number} [opacity=0.5] - Opacity of the modal overlay + * @prop {Number} [inDuration=250] - Length in ms of enter transition + * @prop {Number} [outDuration=250] - Length in ms of exit transition + * @prop {Function} ready - Callback function called when modal is finished entering + * @prop {Function} complete - Callback function called when modal is finished exiting + * @prop {Boolean} [dismissible=true] - Allow modal to be dismissed by keyboard or overlay click + * @prop {String} [startingTop='4%'] - startingTop + * @prop {String} [endingTop='10%'] - endingTop + */ + this.options = $.extend({}, Modal.defaults, options); + + /** + * Describes open/close state of modal + * @type {Boolean} + */ + this.isOpen = false; + + this.$el[0].M_Modal = this; + this.id = $el.attr('id'); + this.openingTrigger = undefined; + this.$overlay = $(''); + + Modal._increment++; + Modal._count++; + this.$overlay[0].style.zIndex = 1000 + Modal._increment * 2; + this.$el[0].style.zIndex = 1000 + Modal._increment * 2 + 1; + this.setupEventHandlers(); + } + + static get defaults() { + return _defaults; + } + + static init($els, options) { + let arr = []; + $els.each(function() { + arr.push(new Modal($(this), options)); + }); + return arr; + } + + /** + * Get Instance + */ + getInstance() { + return this; + } + + /** + * Teardown component + */ + destroy() { + this.removeEventHandlers(); + this.$el[0].removeAttribute('style') + if (!!this.$overlay[0].parentNode) { + this.$overlay[0].parentNode.removeChild(this.$overlay[0]); + } + this.$el[0].M_Modal = undefined; + Modal._count--; + } + + /** + * Setup Event Handlers + */ + setupEventHandlers() { + this.handleOverlayClickBound = this.handleOverlayClick.bind(this); + this.handleModalCloseClickBound = this.handleModalCloseClick.bind(this); + + if (Modal._count === 1) { + document.body.addEventListener('click', this.handleTriggerClick); + } + this.$overlay[0].addEventListener('click', this.handleOverlayClickBound); + this.$el[0].addEventListener('click', this.handleModalCloseClickBound); + } + + /** + * Remove Event Handlers + */ + removeEventHandlers() { + if (Modal._count === 0) { + document.body.removeEventListener('click', this.handleTriggerClick); + } + this.$overlay[0].removeEventListener('click', this.handleOverlayClickBound); + this.$el[0].removeEventListener('click', this.handleModalCloseClickBound); + } + + /** + * Handle Trigger Click + * @param {Event} e + */ + handleTriggerClick(e) { + let $trigger = $(e.target).closest('.modal-trigger'); + if (e.target && $trigger.length) { + let modalId = $trigger[0].getAttribute('href'); + if (modalId) { + modalId = modalId.slice(1); + } else { + modalId = $trigger[0].getAttribute('data-target'); + } + let modalInstance = document.getElementById(modalId).M_Modal; + if (modalInstance) { + modalInstance.open($trigger); + } + e.preventDefault(); + } + } + + /** + * Handle Overlay Click + */ + handleOverlayClick() { + if (this.options.dismissible) { + this.close(); + } + } + + /** + * Handle Modal Close Click + * @param {Event} e + */ + handleModalCloseClick(e) { + let $closeTrigger = $(e.target).closest('.modal-close'); + if (e.target && $closeTrigger.length) { + this.close(); + } + } + + /** + * Handle Keydown + * @param {Event} e + */ + handleKeydown(e) { + // ESC key + if (e.keyCode === 27 && this.options.dismissible) { + this.close(); + } + } + + /** + * Animate in modal + */ + animateIn() { + // Set initial styles + $.extend(this.$el[0].style, { + display: 'block', + opacity: 0 + }); + $.extend(this.$overlay[0].style, { + display: 'block', + opacity: 0 + }); + + // Animate overlay + Vel( + this.$overlay[0], + {opacity: this.options.opacity}, + {duration: this.options.inDuration, queue: false, ease: 'easeOutCubic'} + ); + + + // Define modal animation options + let enterVelocityOptions = { + duration: this.options.inDuration, + queue: false, + ease: 'easeOutCubic', + // Handle modal ready callback + complete: () => { + if (typeof(this.options.ready) === 'function') { + this.options.ready.call(this, this.$el, this.openingTrigger); + } + } + }; + + // Bottom sheet animation + if (this.$el[0].classList.contains('bottom-sheet')) { + Vel( + this.$el[0], + {bottom: 0, opacity: 1}, + enterVelocityOptions); + + // Normal modal animation + } else { + Vel.hook(this.$el[0], 'scaleX', 0.7); + this.$el[0].style.top = this.options.startingTop; + Vel( + this.$el[0], + {top: this.options.endingTop, opacity: 1, scaleX: 1}, + enterVelocityOptions + ); + } + } + + /** + * Animate out modal + */ + animateOut() { + // Animate overlay + Vel( + this.$overlay[0], + { opacity: 0}, + {duration: this.options.outDuration, queue: false, ease: 'easeOutQuart'} + ); + + // Define modal animation options + var exitVelocityOptions = { + duration: this.options.outDuration, + queue: false, + ease: 'easeOutCubic', + // Handle modal ready callback + complete: () => { + this.$el[0].style.display = 'none'; + // Call complete callback + if (typeof(this.options.complete) === 'function') { + this.options.complete.call(this, this.$el); + } + this.$overlay[0].parentNode.removeChild(this.$overlay[0]); + } + }; + + // Bottom sheet animation + if (this.$el[0].classList.contains('bottom-sheet')) { + Vel( + this.$el[0], + {bottom: '-100%', opacity: 0}, + exitVelocityOptions + ); + + // Normal modal animation + } else { + Vel( + this.$el[0], + {top: this.options.startingTop, opacity: 0, scaleX: 0.7}, + exitVelocityOptions + ); + } + } + + + /** + * Open Modal + * @param {jQuery} [$trigger] + */ + open($trigger) { + if (this.isOpen) { + return; + } + + this.isOpen = true; + let body = document.body; + body.style.overflow = 'hidden'; + this.$el[0].classList.add('open'); + body.appendChild(this.$overlay[0]); + + // Set opening trigger, undefined indicates modal was opened by javascript + this.openingTrigger = !!$trigger ? $trigger : undefined; + + + if (this.options.dismissible) { + this.handleKeydownBound = this.handleKeydown.bind(this); + document.addEventListener('keydown', this.handleKeydownBound); + } + + this.animateIn(); + + return this; + } + + /** + * Close Modal + */ + close() { + if (!this.isOpen) { + return; + } + + this.isOpen = false; + this.$el[0].classList.remove('open'); + document.body.style.overflow = ''; + + if (this.options.dismissible) { + document.removeEventListener('keydown', this.handleKeydownBound); + } + + this.animateOut(); + + return this; + } + } + + /** + * @static + * @memberof Modal + */ + Modal._increment = 0; + + /** + * @static + * @memberof Modal + */ + Modal._count = 0; + + Materialize.Modal = Modal; + + $.fn.modal = function(methodOrOptions) { + // Call plugin method if valid method name is passed in + if (Modal.prototype[methodOrOptions]) { + // Getter methods + if (methodOrOptions.slice(0,3) === 'get') { + return this.first()[0].M_Modal[methodOrOptions](); + + // Void methods + } else { + return this.each(function() { + this.M_Modal[methodOrOptions](); + }); + } + + // Initialize plugin if options or no argument is passed in + } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) { + Modal.init(this, arguments[0]); + return this; + + // Return error if an unrecognized method name is passed in + } else { + $.error(`Method ${methodOrOptions} does not exist on jQuery.modal`); + } + }; + +})(jQuery, Materialize.Vel); diff --git a/app/dispatch/static/materialize/js/parallax.js b/app/dispatch/static/materialize/js/parallax.js new file mode 100644 index 0000000..529210d --- /dev/null +++ b/app/dispatch/static/materialize/js/parallax.js @@ -0,0 +1,58 @@ +(function ($) { + + $.fn.parallax = function () { + var window_width = $(window).width(); + // Parallax Scripts + return this.each(function(i) { + var $this = $(this); + $this.addClass('parallax'); + + function updateParallax(initial) { + var container_height; + if (window_width < 601) { + container_height = ($this.height() > 0) ? $this.height() : $this.children("img").height(); + } + else { + container_height = ($this.height() > 0) ? $this.height() : 500; + } + var $img = $this.children("img").first(); + var img_height = $img.height(); + var parallax_dist = img_height - container_height; + var bottom = $this.offset().top + container_height; + var top = $this.offset().top; + var scrollTop = $(window).scrollTop(); + var windowHeight = window.innerHeight; + var windowBottom = scrollTop + windowHeight; + var percentScrolled = (windowBottom - top) / (container_height + windowHeight); + var parallax = Math.round((parallax_dist * percentScrolled)); + + if (initial) { + $img.css('display', 'block'); + } + if ((bottom > scrollTop) && (top < (scrollTop + windowHeight))) { + $img.css('transform', "translate3D(-50%," + parallax + "px, 0)"); + } + + } + + // Wait for image load + $this.children("img").one("load", function() { + updateParallax(true); + }).each(function() { + if (this.complete) $(this).trigger("load"); + }); + + $(window).scroll(function() { + window_width = $(window).width(); + updateParallax(false); + }); + + $(window).resize(function() { + window_width = $(window).width(); + updateParallax(false); + }); + + }); + + }; +}( jQuery )); diff --git a/app/dispatch/static/materialize/js/pushpin.js b/app/dispatch/static/materialize/js/pushpin.js new file mode 100644 index 0000000..4fef6c3 --- /dev/null +++ b/app/dispatch/static/materialize/js/pushpin.js @@ -0,0 +1,71 @@ +(function ($) { + $.fn.pushpin = function (options) { + // Defaults + var defaults = { + top: 0, + bottom: Infinity, + offset: 0 + }; + + // Remove pushpin event and classes + if (options === "remove") { + this.each(function () { + if (id = $(this).data('pushpin-id')) { + $(window).off('scroll.' + id); + $(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style'); + } + }); + return false; + } + + options = $.extend(defaults, options); + + + $index = 0; + return this.each(function() { + var $uniqueId = Materialize.guid(), + $this = $(this), + $original_offset = $(this).offset().top; + + function removePinClasses(object) { + object.removeClass('pin-top'); + object.removeClass('pinned'); + object.removeClass('pin-bottom'); + } + + function updateElements(objects, scrolled) { + objects.each(function () { + // Add position fixed (because its between top and bottom) + if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) { + removePinClasses($(this)); + $(this).css('top', options.offset); + $(this).addClass('pinned'); + } + + // Add pin-top (when scrolled position is above top) + if (scrolled < options.top && !$(this).hasClass('pin-top')) { + removePinClasses($(this)); + $(this).css('top', 0); + $(this).addClass('pin-top'); + } + + // Add pin-bottom (when scrolled position is below bottom) + if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) { + removePinClasses($(this)); + $(this).addClass('pin-bottom'); + $(this).css('top', options.bottom - $original_offset); + } + }); + } + + $(this).data('pushpin-id', $uniqueId); + updateElements($this, $(window).scrollTop()); + $(window).on('scroll.' + $uniqueId, function () { + var $scrolled = $(window).scrollTop() + options.offset; + updateElements($this, $scrolled); + }); + + }); + + }; +}( jQuery )); \ No newline at end of file diff --git a/app/dispatch/static/materialize/js/scrollFire.js b/app/dispatch/static/materialize/js/scrollFire.js new file mode 100644 index 0000000..37750cb --- /dev/null +++ b/app/dispatch/static/materialize/js/scrollFire.js @@ -0,0 +1,51 @@ +(function($) { + + var scrollFireEventsHandled = false; + + // Input: Array of JSON objects {selector, offset, callback} + Materialize.scrollFire = function(options) { + var onScroll = function() { + var windowScroll = window.pageYOffset + window.innerHeight; + + for (var i = 0 ; i < options.length; i++) { + // Get options from each line + var value = options[i]; + var selector = value.selector, + offset = value.offset, + callback = value.callback; + + var currentElement = document.querySelector(selector); + if ( currentElement !== null) { + var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset; + + if (windowScroll > (elementOffset + offset)) { + if (value.done !== true) { + if (typeof(callback) === 'function') { + callback.call(this, currentElement); + } else if (typeof(callback) === 'string') { + var callbackFunc = new Function(callback); + callbackFunc(currentElement); + } + value.done = true; + } + } + } + } + }; + + + var throttledScroll = Materialize.throttle(function() { + onScroll(); + }, options.throttle || 100); + + if (!scrollFireEventsHandled) { + window.addEventListener("scroll", throttledScroll); + window.addEventListener("resize", throttledScroll); + scrollFireEventsHandled = true; + } + + // perform a scan once, after current execution context, and after dom is ready + setTimeout(throttledScroll, 0); + }; + +})(jQuery); diff --git a/app/dispatch/static/materialize/js/scrollspy.js b/app/dispatch/static/materialize/js/scrollspy.js new file mode 100644 index 0000000..52cc875 --- /dev/null +++ b/app/dispatch/static/materialize/js/scrollspy.js @@ -0,0 +1,238 @@ +/** + * Extend jquery with a scrollspy plugin. + * This watches the window scroll and fires events when elements are scrolled into viewport. + * + * throttle() and getTime() taken from Underscore.js + * https://github.com/jashkenas/underscore + * + * @author Copyright 2013 John Smart + * @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE + * @see https://github.com/thesmart + * @version 0.1.2 + */ +(function($) { + + var jWindow = $(window); + var elements = []; + var elementsInView = []; + var isSpying = false; + var ticks = 0; + var unique_id = 1; + var offset = { + top : 0, + right : 0, + bottom : 0, + left : 0, + } + + /** + * Find elements that are within the boundary + * @param {number} top + * @param {number} right + * @param {number} bottom + * @param {number} left + * @return {jQuery} A collection of elements + */ + function findElements(top, right, bottom, left) { + var hits = $(); + $.each(elements, function(i, element) { + if (element.height() > 0) { + var elTop = element.offset().top, + elLeft = element.offset().left, + elRight = elLeft + element.width(), + elBottom = elTop + element.height(); + + var isIntersect = !(elLeft > right || + elRight < left || + elTop > bottom || + elBottom < top); + + if (isIntersect) { + hits.push(element); + } + } + }); + + return hits; + } + + + /** + * Called when the user scrolls the window + */ + function onScroll(scrollOffset) { + // unique tick id + ++ticks; + + // viewport rectangle + var top = jWindow.scrollTop(), + left = jWindow.scrollLeft(), + right = left + jWindow.width(), + bottom = top + jWindow.height(); + + // determine which elements are in view + var intersections = findElements(top+offset.top + scrollOffset || 200, right+offset.right, bottom+offset.bottom, left+offset.left); + $.each(intersections, function(i, element) { + + var lastTick = element.data('scrollSpy:ticks'); + if (typeof lastTick != 'number') { + // entered into view + element.triggerHandler('scrollSpy:enter'); + } + + // update tick id + element.data('scrollSpy:ticks', ticks); + }); + + // determine which elements are no longer in view + $.each(elementsInView, function(i, element) { + var lastTick = element.data('scrollSpy:ticks'); + if (typeof lastTick == 'number' && lastTick !== ticks) { + // exited from view + element.triggerHandler('scrollSpy:exit'); + element.data('scrollSpy:ticks', null); + } + }); + + // remember elements in view for next tick + elementsInView = intersections; + } + + /** + * Called when window is resized + */ + function onWinSize() { + jWindow.trigger('scrollSpy:winSize'); + } + + + /** + * Enables ScrollSpy using a selector + * @param {jQuery|string} selector The elements collection, or a selector + * @param {Object=} options Optional. + throttle : number -> scrollspy throttling. Default: 100 ms + offsetTop : number -> offset from top. Default: 0 + offsetRight : number -> offset from right. Default: 0 + offsetBottom : number -> offset from bottom. Default: 0 + offsetLeft : number -> offset from left. Default: 0 + activeClass : string -> Class name to be added to the active link. Default: active + * @returns {jQuery} + */ + $.scrollSpy = function(selector, options) { + var defaults = { + throttle: 100, + scrollOffset: 200, // offset - 200 allows elements near bottom of page to scroll + activeClass: 'active', + getActiveElement: function(id) { + return 'a[href="#' + id + '"]'; + } + }; + options = $.extend(defaults, options); + + var visible = []; + selector = $(selector); + selector.each(function(i, element) { + elements.push($(element)); + $(element).data("scrollSpy:id", i); + // Smooth scroll to section + $('a[href="#' + $(element).attr('id') + '"]').click(function(e) { + e.preventDefault(); + var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1; + $('html, body').animate({ scrollTop: offset - options.scrollOffset }, {duration: 400, queue: false, easing: 'easeOutCubic'}); + }); + }); + + offset.top = options.offsetTop || 0; + offset.right = options.offsetRight || 0; + offset.bottom = options.offsetBottom || 0; + offset.left = options.offsetLeft || 0; + + var throttledScroll = Materialize.throttle(function() { + onScroll(options.scrollOffset); + }, options.throttle || 100); + var readyScroll = function(){ + $(document).ready(throttledScroll); + }; + + if (!isSpying) { + jWindow.on('scroll', readyScroll); + jWindow.on('resize', readyScroll); + isSpying = true; + } + + // perform a scan once, after current execution context, and after dom is ready + setTimeout(readyScroll, 0); + + + selector.on('scrollSpy:enter', function() { + visible = $.grep(visible, function(value) { + return value.height() != 0; + }); + + var $this = $(this); + + if (visible[0]) { + $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass); + if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) { + visible.unshift($(this)); + } + else { + visible.push($(this)); + } + } + else { + visible.push($(this)); + } + + + $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass); + }); + selector.on('scrollSpy:exit', function() { + visible = $.grep(visible, function(value) { + return value.height() != 0; + }); + + if (visible[0]) { + $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass); + var $this = $(this); + visible = $.grep(visible, function(value) { + return value.attr('id') != $this.attr('id'); + }); + if (visible[0]) { // Check if empty + $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass); + } + } + }); + + return selector; + }; + + /** + * Listen for window resize events + * @param {Object=} options Optional. Set { throttle: number } to change throttling. Default: 100 ms + * @returns {jQuery} $(window) + */ + $.winSizeSpy = function(options) { + $.winSizeSpy = function() { return jWindow; }; // lock from multiple calls + options = options || { + throttle: 100 + }; + return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100)); + }; + + /** + * Enables ScrollSpy on a collection of elements + * e.g. $('.scrollSpy').scrollSpy() + * @param {Object=} options Optional. + throttle : number -> scrollspy throttling. Default: 100 ms + offsetTop : number -> offset from top. Default: 0 + offsetRight : number -> offset from right. Default: 0 + offsetBottom : number -> offset from bottom. Default: 0 + offsetLeft : number -> offset from left. Default: 0 + * @returns {jQuery} + */ + $.fn.scrollSpy = function(options) { + return $.scrollSpy($(this), options); + }; + +})(jQuery); diff --git a/app/dispatch/static/materialize/js/sideNav.js b/app/dispatch/static/materialize/js/sideNav.js new file mode 100644 index 0000000..bfda17a --- /dev/null +++ b/app/dispatch/static/materialize/js/sideNav.js @@ -0,0 +1,414 @@ +(function ($) { + + var methods = { + init : function(options) { + var defaults = { + menuWidth: 300, + edge: 'left', + closeOnClick: false, + draggable: true, + onOpen: null, + onClose: null + }; + options = $.extend(defaults, options); + + $(this).each(function(){ + var $this = $(this); + var menuId = $this.attr('data-activates'); + var menu = $("#"+ menuId); + + // Set to width + if (options.menuWidth != 300) { + menu.css('width', options.menuWidth); + } + + // Add Touch Area + var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]'); + if (options.draggable) { + // Regenerate dragTarget + if ($dragTarget.length) { + $dragTarget.remove(); + } + + $dragTarget = $('
              ').attr('data-sidenav', menuId); + $('body').append($dragTarget); + } else { + $dragTarget = $(); + } + + if (options.edge == 'left') { + menu.css('transform', 'translateX(-100%)'); + $dragTarget.css({'left': 0}); // Add Touch Area + } + else { + menu.addClass('right-aligned') // Change text-alignment to right + .css('transform', 'translateX(100%)'); + $dragTarget.css({'right': 0}); // Add Touch Area + } + + // If fixed sidenav, bring menu out + if (menu.hasClass('fixed')) { + if (window.innerWidth > 992) { + menu.css('transform', 'translateX(0)'); + } + } + + // Window resize to reset on large screens fixed + if (menu.hasClass('fixed')) { + $(window).resize( function() { + if (window.innerWidth > 992) { + // Close menu if window is resized bigger than 992 and user has fixed sidenav + if ($('#sidenav-overlay').length !== 0 && menuOut) { + removeMenu(true); + } + else { + // menu.removeAttr('style'); + menu.css('transform', 'translateX(0%)'); + // menu.css('width', options.menuWidth); + } + } + else if (menuOut === false){ + if (options.edge === 'left') { + menu.css('transform', 'translateX(-100%)'); + } else { + menu.css('transform', 'translateX(100%)'); + } + + } + + }); + } + + // if closeOnClick, then add close event for all a tags in side sideNav + if (options.closeOnClick === true) { + menu.on("click.itemclick", "a:not(.collapsible-header)", function(){ + if (!(window.innerWidth > 992 && menu.hasClass('fixed'))){ + removeMenu(); + } + }); + } + + var removeMenu = function(restoreNav) { + panning = false; + menuOut = false; + // Reenable scrolling + $('body').css({ + overflow: '', + width: '' + }); + + $('#sidenav-overlay').velocity({opacity: 0}, {duration: 200, + queue: false, easing: 'easeOutQuad', + complete: function() { + $(this).remove(); + } }); + if (options.edge === 'left') { + // Reset phantom div + $dragTarget.css({width: '', right: '', left: '0'}); + menu.velocity( + {'translateX': '-100%'}, + { duration: 200, + queue: false, + easing: 'easeOutCubic', + complete: function() { + if (restoreNav === true) { + // Restore Fixed sidenav + menu.removeAttr('style'); + menu.css('width', options.menuWidth); + } + } + + }); + } + else { + // Reset phantom div + $dragTarget.css({width: '', right: '0', left: ''}); + menu.velocity( + {'translateX': '100%'}, + { duration: 200, + queue: false, + easing: 'easeOutCubic', + complete: function() { + if (restoreNav === true) { + // Restore Fixed sidenav + menu.removeAttr('style'); + menu.css('width', options.menuWidth); + } + } + }); + } + + // Callback + if (typeof(options.onClose) === 'function') { + options.onClose.call(this, menu); + } + } + + + + // Touch Event + var panning = false; + var menuOut = false; + + if (options.draggable) { + $dragTarget.on('click', function(){ + if (menuOut) { + removeMenu(); + } + }); + + $dragTarget.hammer({ + prevent_default: false + }).on('pan', function(e) { + + if (e.gesture.pointerType == "touch") { + + var direction = e.gesture.direction; + var x = e.gesture.center.x; + var y = e.gesture.center.y; + var velocityX = e.gesture.velocityX; + + // Vertical scroll bugfix + if (x === 0 && y === 0) { + return; + } + + // Disable Scrolling + var $body = $('body'); + var $overlay = $('#sidenav-overlay'); + var oldWidth = $body.innerWidth(); + $body.css('overflow', 'hidden'); + $body.width(oldWidth); + + // If overlay does not exist, create one and if it is clicked, close menu + if ($overlay.length === 0) { + $overlay = $('
              '); + $overlay.css('opacity', 0).click( function(){ + removeMenu(); + }); + + // Run 'onOpen' when sidenav is opened via touch/swipe if applicable + if (typeof(options.onOpen) === 'function') { + options.onOpen.call(this, menu); + } + + $('body').append($overlay); + } + + // Keep within boundaries + if (options.edge === 'left') { + if (x > options.menuWidth) { x = options.menuWidth; } + else if (x < 0) { x = 0; } + } + + if (options.edge === 'left') { + // Left Direction + if (x < (options.menuWidth / 2)) { menuOut = false; } + // Right Direction + else if (x >= (options.menuWidth / 2)) { menuOut = true; } + menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)'); + } + else { + // Left Direction + if (x < (window.innerWidth - options.menuWidth / 2)) { + menuOut = true; + } + // Right Direction + else if (x >= (window.innerWidth - options.menuWidth / 2)) { + menuOut = false; + } + var rightPos = (x - options.menuWidth / 2); + if (rightPos < 0) { + rightPos = 0; + } + + menu.css('transform', 'translateX(' + rightPos + 'px)'); + } + + + // Percentage overlay + var overlayPerc; + if (options.edge === 'left') { + overlayPerc = x / options.menuWidth; + $overlay.velocity({opacity: overlayPerc }, {duration: 10, queue: false, easing: 'easeOutQuad'}); + } + else { + overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth); + $overlay.velocity({opacity: overlayPerc }, {duration: 10, queue: false, easing: 'easeOutQuad'}); + } + } + + }).on('panend', function(e) { + + if (e.gesture.pointerType == "touch") { + var $overlay = $('#sidenav-overlay'); + var velocityX = e.gesture.velocityX; + var x = e.gesture.center.x; + var leftPos = x - options.menuWidth; + var rightPos = x - options.menuWidth / 2; + if (leftPos > 0 ) { + leftPos = 0; + } + if (rightPos < 0) { + rightPos = 0; + } + panning = false; + + if (options.edge === 'left') { + // If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut + if ((menuOut && velocityX <= 0.3) || velocityX < -0.5) { + // Return menu to open + if (leftPos !== 0) { + menu.velocity({'translateX': [0, leftPos]}, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + + $overlay.velocity({opacity: 1 }, {duration: 50, queue: false, easing: 'easeOutQuad'}); + $dragTarget.css({width: '50%', right: 0, left: ''}); + menuOut = true; + } + else if (!menuOut || velocityX > 0.3) { + // Enable Scrolling + $('body').css({ + overflow: '', + width: '' + }); + // Slide menu closed + menu.velocity({'translateX': [-1 * options.menuWidth - 10, leftPos]}, {duration: 200, queue: false, easing: 'easeOutQuad'}); + $overlay.velocity({opacity: 0 }, {duration: 200, queue: false, easing: 'easeOutQuad', + complete: function () { + // Run 'onClose' when sidenav is closed via touch/swipe if applicable + if (typeof(options.onClose) === 'function') { + options.onClose.call(this, menu); + } + + $(this).remove(); + }}); + $dragTarget.css({width: '10px', right: '', left: 0}); + } + } + else { + if ((menuOut && velocityX >= -0.3) || velocityX > 0.5) { + // Return menu to open + if (rightPos !== 0) { + menu.velocity({'translateX': [0, rightPos]}, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + + $overlay.velocity({opacity: 1 }, {duration: 50, queue: false, easing: 'easeOutQuad'}); + $dragTarget.css({width: '50%', right: '', left: 0}); + menuOut = true; + } + else if (!menuOut || velocityX < -0.3) { + // Enable Scrolling + $('body').css({ + overflow: '', + width: '' + }); + + // Slide menu closed + menu.velocity({'translateX': [options.menuWidth + 10, rightPos]}, {duration: 200, queue: false, easing: 'easeOutQuad'}); + $overlay.velocity({opacity: 0 }, {duration: 200, queue: false, easing: 'easeOutQuad', + complete: function () { + // Run 'onClose' when sidenav is closed via touch/swipe if applicable + if (typeof(options.onClose) === 'function') { + options.onClose.call(this, menu); + } + + $(this).remove(); + }}); + $dragTarget.css({width: '10px', right: 0, left: ''}); + } + } + + } + }); + } + + $this.off('click.sidenav').on('click.sidenav', function() { + if (menuOut === true) { + menuOut = false; + panning = false; + removeMenu(); + } + else { + + // Disable Scrolling + var $body = $('body'); + var $overlay = $('
              '); + var oldWidth = $body.innerWidth(); + $body.css('overflow', 'hidden'); + $body.width(oldWidth); + + // Push current drag target on top of DOM tree + $('body').append($dragTarget); + + if (options.edge === 'left') { + $dragTarget.css({width: '50%', right: 0, left: ''}); + menu.velocity({'translateX': [0, -1 * options.menuWidth]}, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + else { + $dragTarget.css({width: '50%', right: '', left: 0}); + menu.velocity({'translateX': [0, options.menuWidth]}, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + + // Overlay close on click + $overlay.css('opacity', 0) + .click(function() { + menuOut = false; + panning = false; + removeMenu(); + $overlay.velocity({opacity: 0}, {duration: 300, queue: false, easing: 'easeOutQuad', + complete: function() { + $(this).remove(); + } + }); + }); + + // Append body + $('body').append($overlay); + $overlay.velocity({opacity: 1}, {duration: 300, queue: false, easing: 'easeOutQuad', + complete: function () { + menuOut = true; + panning = false; + } + }); + + // Callback + if (typeof(options.onOpen) === 'function') { + options.onOpen.call(this, menu); + } + } + + return false; + }); + }); + + + }, + destroy: function () { + var $overlay = $('#sidenav-overlay'); + var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]'); + $overlay.trigger('click'); + $dragTarget.remove(); + $(this).off('click'); + $overlay.remove(); + }, + show : function() { + this.trigger('click'); + }, + hide : function() { + $('#sidenav-overlay').trigger('click'); + } + }; + + + $.fn.sideNav = function(methodOrOptions) { + if ( methods[methodOrOptions] ) { + return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 )); + } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) { + // Default to "init" + return methods.init.apply( this, arguments ); + } else { + $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.sideNav' ); + } + }; // Plugin end +}( jQuery )); diff --git a/app/dispatch/static/materialize/js/slider.js b/app/dispatch/static/materialize/js/slider.js new file mode 100644 index 0000000..37ba6e6 --- /dev/null +++ b/app/dispatch/static/materialize/js/slider.js @@ -0,0 +1,324 @@ +(function ($) { + + var methods = { + + init : function(options) { + var defaults = { + indicators: true, + height: 400, + transition: 500, + interval: 6000 + }; + options = $.extend(defaults, options); + + return this.each(function() { + + // For each slider, we want to keep track of + // which slide is active and its associated content + var $this = $(this); + var $slider = $this.find('ul.slides').first(); + var $slides = $slider.find('> li'); + var $active_index = $slider.find('.active').index(); + var $active, $indicators, $interval; + if ($active_index != -1) { $active = $slides.eq($active_index); } + + // Transitions the caption depending on alignment + function captionTransition(caption, duration) { + if (caption.hasClass("center-align")) { + caption.velocity({opacity: 0, translateY: -100}, {duration: duration, queue: false}); + } + else if (caption.hasClass("right-align")) { + caption.velocity({opacity: 0, translateX: 100}, {duration: duration, queue: false}); + } + else if (caption.hasClass("left-align")) { + caption.velocity({opacity: 0, translateX: -100}, {duration: duration, queue: false}); + } + } + + // This function will transition the slide to any index of the next slide + function moveToSlide(index) { + // Wrap around indices. + if (index >= $slides.length) index = 0; + else if (index < 0) index = $slides.length -1; + + $active_index = $slider.find('.active').index(); + + // Only do if index changes + if ($active_index != index) { + $active = $slides.eq($active_index); + $caption = $active.find('.caption'); + + $active.removeClass('active'); + $active.velocity({opacity: 0}, {duration: options.transition, queue: false, easing: 'easeOutQuad', + complete: function() { + $slides.not('.active').velocity({opacity: 0, translateX: 0, translateY: 0}, {duration: 0, queue: false}); + } }); + captionTransition($caption, options.transition); + + + // Update indicators + if (options.indicators) { + $indicators.eq($active_index).removeClass('active'); + } + + $slides.eq(index).velocity({opacity: 1}, {duration: options.transition, queue: false, easing: 'easeOutQuad'}); + $slides.eq(index).find('.caption').velocity({opacity: 1, translateX: 0, translateY: 0}, {duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad'}); + $slides.eq(index).addClass('active'); + + + // Update indicators + if (options.indicators) { + $indicators.eq(index).addClass('active'); + } + } + } + + // Set height of slider + // If fullscreen, do nothing + if (!$this.hasClass('fullscreen')) { + if (options.indicators) { + // Add height if indicators are present + $this.height(options.height + 40); + } + else { + $this.height(options.height); + } + $slider.height(options.height); + } + + + // Set initial positions of captions + $slides.find('.caption').each(function () { + captionTransition($(this), 0); + }); + + // Move img src into background-image + $slides.find('img').each(function () { + var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw=='; + if ($(this).attr('src') !== placeholderBase64) { + $(this).css('background-image', 'url("' + $(this).attr('src') + '")' ); + $(this).attr('src', placeholderBase64); + } + }); + + // dynamically add indicators + if (options.indicators) { + $indicators = $('
                '); + $slides.each(function( index ) { + var $indicator = $('
              • '); + + // Handle clicks on indicators + $indicator.click(function () { + var $parent = $slider.parent(); + var curr_index = $parent.find($(this)).index(); + moveToSlide(curr_index); + + // reset interval + clearInterval($interval); + $interval = setInterval( + function(){ + $active_index = $slider.find('.active').index(); + if ($slides.length == $active_index + 1) $active_index = 0; // loop to start + else $active_index += 1; + + moveToSlide($active_index); + + }, options.transition + options.interval + ); + }); + $indicators.append($indicator); + }); + $this.append($indicators); + $indicators = $this.find('ul.indicators').find('li.indicator-item'); + } + + if ($active) { + $active.show(); + } + else { + $slides.first().addClass('active').velocity({opacity: 1}, {duration: options.transition, queue: false, easing: 'easeOutQuad'}); + + $active_index = 0; + $active = $slides.eq($active_index); + + // Update indicators + if (options.indicators) { + $indicators.eq($active_index).addClass('active'); + } + } + + // Adjust height to current slide + $active.find('img').each(function() { + $active.find('.caption').velocity({opacity: 1, translateX: 0, translateY: 0}, {duration: options.transition, queue: false, easing: 'easeOutQuad'}); + }); + + // auto scroll + $interval = setInterval( + function(){ + $active_index = $slider.find('.active').index(); + moveToSlide($active_index + 1); + + }, options.transition + options.interval + ); + + + // HammerJS, Swipe navigation + + // Touch Event + var panning = false; + var swipeLeft = false; + var swipeRight = false; + + $this.hammer({ + prevent_default: false + }).on('pan', function(e) { + if (e.gesture.pointerType === "touch") { + + // reset interval + clearInterval($interval); + + var direction = e.gesture.direction; + var x = e.gesture.deltaX; + var velocityX = e.gesture.velocityX; + var velocityY = e.gesture.velocityY; + + $curr_slide = $slider.find('.active'); + if (Math.abs(velocityX) > Math.abs(velocityY)) { + $curr_slide.velocity({ translateX: x + }, {duration: 50, queue: false, easing: 'easeOutQuad'}); + } + + // Swipe Left + if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.65)) { + swipeRight = true; + } + // Swipe Right + else if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.65)) { + swipeLeft = true; + } + + // Make Slide Behind active slide visible + var next_slide; + if (swipeLeft) { + next_slide = $curr_slide.next(); + if (next_slide.length === 0) { + next_slide = $slides.first(); + } + next_slide.velocity({ opacity: 1 + }, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + if (swipeRight) { + next_slide = $curr_slide.prev(); + if (next_slide.length === 0) { + next_slide = $slides.last(); + } + next_slide.velocity({ opacity: 1 + }, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + + + } + + }).on('panend', function(e) { + if (e.gesture.pointerType === "touch") { + + $curr_slide = $slider.find('.active'); + panning = false; + curr_index = $slider.find('.active').index(); + + if (!swipeRight && !swipeLeft || $slides.length <=1) { + // Return to original spot + $curr_slide.velocity({ translateX: 0 + }, {duration: 300, queue: false, easing: 'easeOutQuad'}); + } + else if (swipeLeft) { + moveToSlide(curr_index + 1); + $curr_slide.velocity({translateX: -1 * $this.innerWidth() }, {duration: 300, queue: false, easing: 'easeOutQuad', + complete: function() { + $curr_slide.velocity({opacity: 0, translateX: 0}, {duration: 0, queue: false}); + } }); + } + else if (swipeRight) { + moveToSlide(curr_index - 1); + $curr_slide.velocity({translateX: $this.innerWidth() }, {duration: 300, queue: false, easing: 'easeOutQuad', + complete: function() { + $curr_slide.velocity({opacity: 0, translateX: 0}, {duration: 0, queue: false}); + } }); + } + swipeLeft = false; + swipeRight = false; + + // Restart interval + clearInterval($interval); + $interval = setInterval( + function(){ + $active_index = $slider.find('.active').index(); + if ($slides.length == $active_index + 1) $active_index = 0; // loop to start + else $active_index += 1; + + moveToSlide($active_index); + + }, options.transition + options.interval + ); + } + }); + + $this.on('sliderPause', function() { + clearInterval($interval); + }); + + $this.on('sliderStart', function() { + clearInterval($interval); + $interval = setInterval( + function(){ + $active_index = $slider.find('.active').index(); + if ($slides.length == $active_index + 1) $active_index = 0; // loop to start + else $active_index += 1; + + moveToSlide($active_index); + + }, options.transition + options.interval + ); + }); + + $this.on('sliderNext', function() { + $active_index = $slider.find('.active').index(); + moveToSlide($active_index + 1); + }); + + $this.on('sliderPrev', function() { + $active_index = $slider.find('.active').index(); + moveToSlide($active_index - 1); + }); + + }); + + + + }, + pause : function() { + $(this).trigger('sliderPause'); + }, + start : function() { + $(this).trigger('sliderStart'); + }, + next : function() { + $(this).trigger('sliderNext'); + }, + prev : function() { + $(this).trigger('sliderPrev'); + } + }; + + + $.fn.slider = function(methodOrOptions) { + if ( methods[methodOrOptions] ) { + return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 )); + } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) { + // Default to "init" + return methods.init.apply( this, arguments ); + } else { + $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.tooltip' ); + } + }; // Plugin end +}( jQuery )); diff --git a/app/dispatch/static/materialize/js/tabs.js b/app/dispatch/static/materialize/js/tabs.js new file mode 100644 index 0000000..2631134 --- /dev/null +++ b/app/dispatch/static/materialize/js/tabs.js @@ -0,0 +1,246 @@ +(function ($) { + + var methods = { + init : function(options) { + var defaults = { + onShow: null, + swipeable: false, + responsiveThreshold: Infinity, // breakpoint for swipeable + }; + options = $.extend(defaults, options); + var namespace = Materialize.objectSelectorString($(this)); + + return this.each(function(i) { + + var uniqueNamespace = namespace+i; + + // For each set of tabs, we want to keep track of + // which tab is active and its associated content + var $this = $(this), + window_width = $(window).width(); + + var $active, $content, $links = $this.find('li.tab a'), + $tabs_width = $this.width(), + $tabs_content = $(), + $tabs_wrapper, + $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length, + $indicator, + index = 0, + prev_index = 0, + clicked = false, + clickedTimeout, + transition = 300; + + + // Finds right attribute for indicator based on active tab. + // el: jQuery Object + var calcRightPos = function(el) { + return Math.ceil($tabs_width - el.position().left - el[0].getBoundingClientRect().width - $this.scrollLeft()); + }; + + // Finds left attribute for indicator based on active tab. + // el: jQuery Object + var calcLeftPos = function(el) { + return Math.floor(el.position().left + $this.scrollLeft()); + }; + + // Animates Indicator to active tab. + // prev_index: Number + var animateIndicator = function(prev_index) { + if ((index - prev_index) >= 0) { + $indicator.velocity({"right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad'}); + $indicator.velocity({"left": calcLeftPos($active) }, {duration: transition, queue: false, easing: 'easeOutQuad', delay: 90}); + + } else { + $indicator.velocity({"left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad'}); + $indicator.velocity({"right": calcRightPos($active) }, {duration: transition, queue: false, easing: 'easeOutQuad', delay: 90}); + } + }; + + // Change swipeable according to responsive threshold + if (options.swipeable) { + if (window_width > options.responsiveThreshold) { + options.swipeable = false; + } + } + + + // If the location.hash matches one of the links, use that as the active tab. + $active = $($links.filter('[href="'+location.hash+'"]')); + + // If no match is found, use the first link or any with class 'active' as the initial active tab. + if ($active.length === 0) { + $active = $(this).find('li.tab a.active').first(); + } + if ($active.length === 0) { + $active = $(this).find('li.tab a').first(); + } + + $active.addClass('active'); + index = $links.index($active); + if (index < 0) { + index = 0; + } + + if ($active[0] !== undefined) { + $content = $($active[0].hash); + $content.addClass('active'); + } + + // append indicator then set indicator width to tab width + if (!$this.find('.indicator').length) { + $this.append('
              • '); + } + $indicator = $this.find('.indicator'); + + // we make sure that the indicator is at the end of the tabs + $this.append($indicator); + + if ($this.is(":visible")) { + // $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)}); + // $indicator.css({"left": index * $tab_width}); + setTimeout(function() { + $indicator.css({"right": calcRightPos($active) }); + $indicator.css({"left": calcLeftPos($active) }); + }, 0); + } + $(window).off('resize.tabs-'+uniqueNamespace).on('resize.tabs-'+uniqueNamespace, function () { + $tabs_width = $this.width(); + $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length; + if (index < 0) { + index = 0; + } + if ($tab_width !== 0 && $tabs_width !== 0) { + $indicator.css({"right": calcRightPos($active) }); + $indicator.css({"left": calcLeftPos($active) }); + } + }); + + // Initialize Tabs Content. + if (options.swipeable) { + // TODO: Duplicate calls with swipeable? handle multiple div wrapping. + $links.each(function () { + var $curr_content = $(Materialize.escapeHash(this.hash)); + $curr_content.addClass('carousel-item'); + $tabs_content = $tabs_content.add($curr_content); + }); + $tabs_wrapper = $tabs_content.wrapAll(''); + $tabs_content.css('display', ''); + $('.tabs-content.carousel').carousel({ + fullWidth: true, + noWrap: true, + onCycleTo: function(item) { + if (!clicked) { + var prev_index = index; + index = $tabs_wrapper.index(item); + $active.removeClass('active'); + $active = $links.eq(index); + $active.addClass('active'); + animateIndicator(prev_index); + if (typeof(options.onShow) === "function") { + options.onShow.call($this[0], $content); + } + } + }, + }); + } else { + // Hide the remaining content + $links.not($active).each(function () { + $(Materialize.escapeHash(this.hash)).hide(); + }); + } + + + // Bind the click event handler + $this.off('click.tabs').on('click.tabs', 'a', function(e) { + if ($(this).parent().hasClass('disabled')) { + e.preventDefault(); + return; + } + + // Act as regular link if target attribute is specified. + if (!!$(this).attr("target")) { + return; + } + + clicked = true; + $tabs_width = $this.width(); + $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length; + + // Make the old tab inactive. + $active.removeClass('active'); + var $oldContent = $content + + // Update the variables with the new link and content + $active = $(this); + $content = $(Materialize.escapeHash(this.hash)); + $links = $this.find('li.tab a'); + var activeRect = $active.position(); + + // Make the tab active. + $active.addClass('active'); + prev_index = index; + index = $links.index($(this)); + if (index < 0) { + index = 0; + } + // Change url to current tab + // window.location.hash = $active.attr('href'); + + // Swap content + if (options.swipeable) { + if ($tabs_content.length) { + $tabs_content.carousel('set', index, function() { + if (typeof(options.onShow) === "function") { + options.onShow.call($this[0], $content); + } + }); + } + } else { + if ($content !== undefined) { + $content.show(); + $content.addClass('active'); + if (typeof(options.onShow) === "function") { + options.onShow.call(this, $content); + } + } + + if ($oldContent !== undefined && + !$oldContent.is($content)) { + $oldContent.hide(); + $oldContent.removeClass('active'); + } + } + + // Reset clicked state + clickedTimeout = setTimeout(function(){ clicked = false; }, transition); + + // Update indicator + animateIndicator(prev_index); + + // Prevent the anchor's default click action + e.preventDefault(); + }); + }); + + }, + select_tab : function( id ) { + this.find('a[href="#' + id + '"]').trigger('click'); + } + }; + + $.fn.tabs = function(methodOrOptions) { + if ( methods[methodOrOptions] ) { + return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 )); + } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) { + // Default to "init" + return methods.init.apply( this, arguments ); + } else { + $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.tabs' ); + } + }; + + $(document).ready(function(){ + $('ul.tabs').tabs(); + }); +}( jQuery )); diff --git a/app/dispatch/static/materialize/js/tapTarget.js b/app/dispatch/static/materialize/js/tapTarget.js new file mode 100644 index 0000000..33ed757 --- /dev/null +++ b/app/dispatch/static/materialize/js/tapTarget.js @@ -0,0 +1,187 @@ +(function ($) { + + var methods = { + init: function (options) { + return this.each(function() { + var origin = $('#'+$(this).attr('data-activates')); + var screen = $('body'); + + // Creating tap target + var tapTargetEl = $(this); + var tapTargetWrapper = tapTargetEl.parent('.tap-target-wrapper'); + var tapTargetWave = tapTargetWrapper.find('.tap-target-wave'); + var tapTargetOriginEl = tapTargetWrapper.find('.tap-target-origin'); + var tapTargetContentEl = tapTargetEl.find('.tap-target-content'); + + // Creating wrapper + if (!tapTargetWrapper.length) { + tapTargetWrapper = tapTargetEl.wrap($('
                ')).parent(); + } + + // Creating content + if (!tapTargetContentEl.length) { + tapTargetContentEl = $('
                '); + tapTargetEl.append(tapTargetContentEl); + } + + // Creating foreground wave + if (!tapTargetWave.length) { + tapTargetWave = $('
                '); + + // Creating origin + if (!tapTargetOriginEl.length) { + tapTargetOriginEl = origin.clone(true, true); + tapTargetOriginEl.addClass('tap-target-origin'); + tapTargetOriginEl.removeAttr('id'); + tapTargetOriginEl.removeAttr('style'); + tapTargetWave.append(tapTargetOriginEl); + } + + tapTargetWrapper.append(tapTargetWave); + } + + // Open + var openTapTarget = function() { + if (tapTargetWrapper.is('.open')) { + return; + } + + // Adding open class + tapTargetWrapper.addClass('open'); + + setTimeout(function() { + tapTargetOriginEl.off('click.tapTarget').on('click.tapTarget', function(e) { + closeTapTarget(); + tapTargetOriginEl.off('click.tapTarget'); + }); + + $(document).off('click.tapTarget').on('click.tapTarget', function(e) { + closeTapTarget(); + $(document).off('click.tapTarget'); + }); + + var throttledCalc = Materialize.throttle(function() { + calculateTapTarget(); + }, 200); + $(window).off('resize.tapTarget').on('resize.tapTarget', throttledCalc); + }, 0); + }; + + // Close + var closeTapTarget = function(){ + if (!tapTargetWrapper.is('.open')) { + return; + } + + tapTargetWrapper.removeClass('open'); + tapTargetOriginEl.off('click.tapTarget') + $(document).off('click.tapTarget'); + $(window).off('resize.tapTarget'); + }; + + // Pre calculate + var calculateTapTarget = function() { + // Element or parent is fixed position? + var isFixed = origin.css('position') === 'fixed'; + if (!isFixed) { + var parents = origin.parents(); + for(var i = 0; i < parents.length; i++) { + isFixed = $(parents[i]).css('position') == 'fixed'; + if (isFixed) { + break; + } + } + } + + // Calculating origin + var originWidth = origin.outerWidth(); + var originHeight = origin.outerHeight(); + var originTop = isFixed ? origin.offset().top - $(document).scrollTop() : origin.offset().top; + var originLeft = isFixed ? origin.offset().left - $(document).scrollLeft() : origin.offset().left; + + // Calculating screen + var windowWidth = $(window).width(); + var windowHeight = $(window).height(); + var centerX = windowWidth / 2; + var centerY = windowHeight / 2; + var isLeft = originLeft <= centerX; + var isRight = originLeft > centerX; + var isTop = originTop <= centerY; + var isBottom = originTop > centerY; + var isCenterX = originLeft >= windowWidth*0.25 && originLeft <= windowWidth*0.75; + var isCenterY = originTop >= windowHeight*0.25 && originTop <= windowHeight*0.75; + + // Calculating tap target + var tapTargetWidth = tapTargetEl.outerWidth(); + var tapTargetHeight = tapTargetEl.outerHeight(); + var tapTargetTop = originTop + originHeight/2 - tapTargetHeight/2; + var tapTargetLeft = originLeft + originWidth/2 - tapTargetWidth/2; + var tapTargetPosition = isFixed ? 'fixed' : 'absolute'; + + // Calculating content + var tapTargetTextWidth = isCenterX ? tapTargetWidth : tapTargetWidth/2 + originWidth; + var tapTargetTextHeight = tapTargetHeight/2; + var tapTargetTextTop = isTop ? tapTargetHeight/2 : 0; + var tapTargetTextBottom = 0; + var tapTargetTextLeft = isLeft && !isCenterX ? tapTargetWidth/2 - originWidth : 0; + var tapTargetTextRight = 0; + var tapTargetTextPadding = originWidth; + var tapTargetTextAlign = isBottom ? 'bottom' : 'top'; + + // Calculating wave + var tapTargetWaveWidth = originWidth > originHeight ? originWidth*2 : originWidth*2; + var tapTargetWaveHeight = tapTargetWaveWidth; + var tapTargetWaveTop = tapTargetHeight/2 - tapTargetWaveHeight/2; + var tapTargetWaveLeft = tapTargetWidth/2 - tapTargetWaveWidth/2; + + // Setting tap target + var tapTargetWrapperCssObj = {}; + tapTargetWrapperCssObj.top = isTop ? tapTargetTop : ''; + tapTargetWrapperCssObj.right = isRight ? windowWidth - tapTargetLeft - tapTargetWidth : ''; + tapTargetWrapperCssObj.bottom = isBottom ? windowHeight - tapTargetTop - tapTargetHeight : ''; + tapTargetWrapperCssObj.left = isLeft ? tapTargetLeft : ''; + tapTargetWrapperCssObj.position = tapTargetPosition; + tapTargetWrapper.css(tapTargetWrapperCssObj); + + // Setting content + tapTargetContentEl.css({ + width: tapTargetTextWidth, + height: tapTargetTextHeight, + top: tapTargetTextTop, + right: tapTargetTextRight, + bottom: tapTargetTextBottom, + left: tapTargetTextLeft, + padding: tapTargetTextPadding, + verticalAlign: tapTargetTextAlign + }); + + // Setting wave + tapTargetWave.css({ + top: tapTargetWaveTop, + left: tapTargetWaveLeft, + width: tapTargetWaveWidth, + height: tapTargetWaveHeight + }); + } + + if (options == 'open') { + calculateTapTarget(); + openTapTarget(); + } + + if (options == 'close') + closeTapTarget(); + }); + }, + open: function() {}, + close: function() {} + }; + + $.fn.tapTarget = function(methodOrOptions) { + if (methods[methodOrOptions] || typeof methodOrOptions === 'object') + return methods.init.apply( this, arguments ); + + $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.tap-target' ); + }; + +}( jQuery )); diff --git a/app/dispatch/static/materialize/js/toasts.js b/app/dispatch/static/materialize/js/toasts.js new file mode 100644 index 0000000..70abed8 --- /dev/null +++ b/app/dispatch/static/materialize/js/toasts.js @@ -0,0 +1,320 @@ +(function($, Vel) { + 'use strict'; + + let _defaults = { + displayLength: Infinity, + inDuration: 300, + outDuration: 375, + className: undefined, + completeCallback: undefined, + activationPercent: 0.8 + }; + + class Toast { + constructor(message, displayLength, className, completeCallback) { + if (!message) { + return; + } + + + /** + * Options for the toast + * @member Toast#options + */ + this.options = { + displayLength: displayLength, + className: className, + completeCallback: completeCallback + }; + + this.options = $.extend({}, Toast.defaults, this.options); + this.message = message; + + /** + * Describes current pan state toast + * @type {Boolean} + */ + this.panning = false; + + /** + * Time remaining until toast is removed + */ + this.timeRemaining = this.options.displayLength; + + if (Toast._toasts.length === 0) { + Toast._createContainer(); + } + + // Create new toast + Toast._toasts.push(this); + let toastElement = this.createToast(); + toastElement.M_Toast = this; + this.el = toastElement; + this._animateIn(); + this.setTimer(); + } + + static get defaults() { + return _defaults; + } + + /** + * Append toast container and add event handlers + */ + static _createContainer() { + let container = document.createElement('div'); + container.setAttribute('id', 'toast-container'); + + // Add event handler + container.addEventListener('touchstart', Toast._onDragStart); + container.addEventListener('touchmove', Toast._onDragMove); + container.addEventListener('touchend', Toast._onDragEnd); + + container.addEventListener('mousedown', Toast._onDragStart); + document.addEventListener('mousemove', Toast._onDragMove); + document.addEventListener('mouseup', Toast._onDragEnd); + + document.body.appendChild(container); + Toast._container = container; + } + + /** + * Remove toast container and event handlers + */ + static _removeContainer() { + // Add event handler + document.removeEventListener('mousemove', Toast._onDragMove); + document.removeEventListener('mouseup', Toast._onDragEnd); + + Toast._container.parentNode.removeChild(Toast._container); + Toast._container = null; + } + + /** + * Begin drag handler + * @param {Event} e + */ + static _onDragStart(e) { + if (e.target && $(e.target).closest('.toast').length) { + let $toast = $(e.target).closest('.toast'); + let toast = $toast[0].M_Toast; + toast.panning = true; + Toast._draggedToast = toast; + toast.el.classList.add('panning'); + toast.el.style.transition = ''; + toast.startingXPos = Toast._xPos(e); + toast.time = Date.now(); + toast.xPos = Toast._xPos(e); + } + } + + /** + * Drag move handler + * @param {Event} e + */ + static _onDragMove(e) { + if (!!Toast._draggedToast) { + e.preventDefault(); + let toast = Toast._draggedToast; + toast.deltaX = Math.abs(toast.xPos - Toast._xPos(e)); + toast.xPos = Toast._xPos(e); + toast.velocityX = toast.deltaX / (Date.now() - toast.time); + toast.time = Date.now(); + + let totalDeltaX = toast.xPos - toast.startingXPos; + let activationDistance = + toast.el.offsetWidth * toast.options.activationPercent; + toast.el.style.transform = `translateX(${totalDeltaX}px)`; + toast.el.style.opacity = 1-Math.abs(totalDeltaX / activationDistance); + } + } + + /** + * End drag handler + * @param {Event} e + */ + static _onDragEnd(e) { + if (!!Toast._draggedToast) { + let toast = Toast._draggedToast; + toast.panning = false; + toast.el.classList.remove('panning'); + + let totalDeltaX = toast.xPos - toast.startingXPos; + let activationDistance = + toast.el.offsetWidth * toast.options.activationPercent; + let shouldBeDismissed = Math.abs(totalDeltaX) > activationDistance || + toast.velocityX > 1; + + // Remove toast + if (shouldBeDismissed) { + toast.wasSwiped = true; + toast.remove(); + + // Animate toast back to original position + } else { + toast.el.style.transition = 'transform .2s, opacity .2s'; + toast.el.style.transform = ''; + toast.el.style.opacity = ''; + } + Toast._draggedToast = null; + } + } + + /** + * Get x position of mouse or touch event + * @param {Event} e + */ + static _xPos(e) { + if (e.targetTouches && (e.targetTouches.length >= 1)) { + return e.targetTouches[0].clientX; + } + // mouse event + return e.clientX; + } + + /** + * Remove all toasts + */ + static removeAll() { + for(let toastIndex in Toast._toasts) { + Toast._toasts[toastIndex].remove(); + } + } + + + /** + * Create toast and append it to toast container + */ + createToast() { + let toast = document.createElement('div'); + toast.classList.add('toast'); + + // Add custom classes onto toast + if (this.options.className) { + let classes = this.options.className.split(' '); + let i, count; + for (i = 0, count = classes.length; i < count; i++) { + toast.classList.add(classes[i]); + } + } + + // Set content + if ( typeof HTMLElement === 'object' ? + this.message instanceof HTMLElement : + this.message && typeof this.message === 'object' && + this.message !== null && this.message.nodeType === 1 && + typeof this.message.nodeName==='string' + ) { + toast.appendChild(this.message); + + // Check if it is jQuery object + } else if (this.message instanceof jQuery) { + $(toast).append(this.message); + + // Insert as text; + } else { + toast.innerHTML = this.message; + } + + // Append toasft + Toast._container.appendChild(toast); + return toast; + } + + /** + * Animate in toast + */ + _animateIn() { + // Animate toast in + Vel(this.el, {top: 0, opacity: 1 }, { + duration: 300, + easing: 'easeOutCubic', + queue: false + }); + } + + + /** + * Create setInterval which automatically removes toast when timeRemaining >= 0 + * has been reached + */ + setTimer() { + if (this.timeRemaining !== Infinity) { + this.counterInterval = setInterval(() => { + // If toast is not being dragged, decrease its time remaining + if (!this.panning) { + this.timeRemaining -= 20; + } + + // Animate toast out + if (this.timeRemaining <= 0) { + this.remove(); + } + }, 20); + } + } + + + /** + * Dismiss toast with animation + */ + remove() { + window.clearInterval(this.counterInterval); + let activationDistance = + this.el.offsetWidth * this.options.activationPercent; + + if(this.wasSwiped) { + this.el.style.transition = 'transform .05s, opacity .05s'; + this.el.style.transform = `translateX(${activationDistance}px)`; + this.el.style.opacity = 0; + } + + Vel( + this.el, + {opacity: 0, marginTop: '-40px'}, + { + duration: this.options.outDuration, + easing: 'easeOutExpo', + queue: false, + complete: () => { + // Call the optional callback + if(typeof(this.options.completeCallback) === 'function') { + this.options.completeCallback(); + } + // Remove toast from DOM + this.el.parentNode.removeChild(this.el); + Toast._toasts.splice(Toast._toasts.indexOf(this), 1); + if (Toast._toasts.length === 0) { + Toast._removeContainer(); + } + } + } + ); + } + } + + /** + * @static + * @memberof Toast + * @type {Array.} + */ + Toast._toasts = []; + + /** + * @static + * @memberof Toast + */ + Toast._container = null; + + /** + * @static + * @memberof Toast + * @type {Toast} + */ + Toast._draggedToast = null; + + Materialize.Toast = Toast; + Materialize.toast = function(message, displayLength, className, completeCallback) { + return new Toast(message, displayLength, className, completeCallback); + }; +})(jQuery, Materialize.Vel); diff --git a/app/dispatch/static/materialize/js/tooltip.js b/app/dispatch/static/materialize/js/tooltip.js new file mode 100644 index 0000000..c75ddd0 --- /dev/null +++ b/app/dispatch/static/materialize/js/tooltip.js @@ -0,0 +1,239 @@ +(function ($) { + $.fn.tooltip = function (options) { + var timeout = null, + margin = 5; + + // Defaults + var defaults = { + delay: 350, + tooltip: '', + position: 'bottom', + html: false + }; + + // Remove tooltip from the activator + if (options === "remove") { + this.each(function() { + $('#' + $(this).attr('data-tooltip-id')).remove(); + $(this).removeAttr('data-tooltip-id'); + $(this).off('mouseenter.tooltip mouseleave.tooltip'); + }); + return false; + } + + options = $.extend(defaults, options); + + return this.each(function() { + var tooltipId = Materialize.guid(); + var origin = $(this); + + // Destroy old tooltip + if (origin.attr('data-tooltip-id')) { + $('#' + origin.attr('data-tooltip-id')).remove(); + } + + origin.attr('data-tooltip-id', tooltipId); + + // Get attributes. + var allowHtml, + tooltipDelay, + tooltipPosition, + tooltipText, + tooltipEl, + backdrop; + var setAttributes = function() { + allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html; + tooltipDelay = origin.attr('data-delay'); + tooltipDelay = (tooltipDelay === undefined || tooltipDelay === '') ? + options.delay : tooltipDelay; + tooltipPosition = origin.attr('data-position'); + tooltipPosition = (tooltipPosition === undefined || tooltipPosition === '') ? + options.position : tooltipPosition; + tooltipText = origin.attr('data-tooltip'); + tooltipText = (tooltipText === undefined || tooltipText === '') ? + options.tooltip : tooltipText; + }; + setAttributes(); + + var renderTooltipEl = function() { + var tooltip = $('
                '); + + // Create Text span + if (allowHtml) { + tooltipText = $('').html(tooltipText); + } else{ + tooltipText = $('').text(tooltipText); + } + + // Create tooltip + tooltip.append(tooltipText) + .appendTo($('body')) + .attr('id', tooltipId); + + // Create backdrop + backdrop = $('
                '); + backdrop.appendTo(tooltip); + return tooltip; + }; + tooltipEl = renderTooltipEl(); + + // Destroy previously binded events + origin.off('mouseenter.tooltip mouseleave.tooltip'); + // Mouse In + var started = false, timeoutRef; + origin.on({'mouseenter.tooltip': function(e) { + var showTooltip = function() { + setAttributes(); + started = true; + tooltipEl.velocity('stop'); + backdrop.velocity('stop'); + tooltipEl.css({ visibility: 'visible', left: '0px', top: '0px' }); + + // Tooltip positioning + var originWidth = origin.outerWidth(); + var originHeight = origin.outerHeight(); + var tooltipHeight = tooltipEl.outerHeight(); + var tooltipWidth = tooltipEl.outerWidth(); + var tooltipVerticalMovement = '0px'; + var tooltipHorizontalMovement = '0px'; + var backdropOffsetWidth = backdrop[0].offsetWidth; + var backdropOffsetHeight = backdrop[0].offsetHeight; + var scaleXFactor = 8; + var scaleYFactor = 8; + var scaleFactor = 0; + var targetTop, targetLeft, newCoordinates; + + if (tooltipPosition === "top") { + // Top Position + targetTop = origin.offset().top - tooltipHeight - margin; + targetLeft = origin.offset().left + originWidth/2 - tooltipWidth/2; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + tooltipVerticalMovement = '-10px'; + backdrop.css({ + bottom: 0, + left: 0, + borderRadius: '14px 14px 0 0', + transformOrigin: '50% 100%', + marginTop: tooltipHeight, + marginLeft: (tooltipWidth/2) - (backdropOffsetWidth/2) + }); + } + // Left Position + else if (tooltipPosition === "left") { + targetTop = origin.offset().top + originHeight/2 - tooltipHeight/2; + targetLeft = origin.offset().left - tooltipWidth - margin; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + + tooltipHorizontalMovement = '-10px'; + backdrop.css({ + top: '-7px', + right: 0, + width: '14px', + height: '14px', + borderRadius: '14px 0 0 14px', + transformOrigin: '95% 50%', + marginTop: tooltipHeight/2, + marginLeft: tooltipWidth + }); + } + // Right Position + else if (tooltipPosition === "right") { + targetTop = origin.offset().top + originHeight/2 - tooltipHeight/2; + targetLeft = origin.offset().left + originWidth + margin; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + + tooltipHorizontalMovement = '+10px'; + backdrop.css({ + top: '-7px', + left: 0, + width: '14px', + height: '14px', + borderRadius: '0 14px 14px 0', + transformOrigin: '5% 50%', + marginTop: tooltipHeight/2, + marginLeft: '0px' + }); + } + else { + // Bottom Position + targetTop = origin.offset().top + origin.outerHeight() + margin; + targetLeft = origin.offset().left + originWidth/2 - tooltipWidth/2; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + tooltipVerticalMovement = '+10px'; + backdrop.css({ + top: 0, + left: 0, + marginLeft: (tooltipWidth/2) - (backdropOffsetWidth/2) + }); + } + + // Set tooptip css placement + tooltipEl.css({ + top: newCoordinates.y, + left: newCoordinates.x + }); + + // Calculate Scale to fill + scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth); + scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight); + scaleFactor = Math.max(scaleXFactor, scaleYFactor); + + tooltipEl.velocity({ translateY: tooltipVerticalMovement, translateX: tooltipHorizontalMovement}, { duration: 350, queue: false }) + .velocity({opacity: 1}, {duration: 300, delay: 50, queue: false}); + backdrop.css({ visibility: 'visible' }) + .velocity({opacity:1},{duration: 55, delay: 0, queue: false}) + .velocity({scaleX: scaleFactor, scaleY: scaleFactor}, {duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad'}); + }; + + timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval + + // Mouse Out + }, + 'mouseleave.tooltip': function(){ + // Reset State + started = false; + clearTimeout(timeoutRef); + + // Animate back + setTimeout(function() { + if (started !== true) { + tooltipEl.velocity({ + opacity: 0, translateY: 0, translateX: 0}, { duration: 225, queue: false}); + backdrop.velocity({opacity: 0, scaleX: 1, scaleY: 1}, { + duration:225, + queue: false, + complete: function(){ + backdrop.css({ visibility: 'hidden' }); + tooltipEl.css({ visibility: 'hidden' }); + started = false;} + }); + } + },225); + } + }); + }); + }; + + var repositionWithinScreen = function(x, y, width, height) { + var newX = x; + var newY = y; + + if (newX < 0) { + newX = 4; + } else if (newX + width > window.innerWidth) { + newX -= newX + width - window.innerWidth; + } + + if (newY < 0) { + newY = 4; + } else if (newY + height > window.innerHeight + $(window).scrollTop) { + newY -= newY + height - window.innerHeight; + } + + return {x: newX, y: newY}; + }; + + $(document).ready(function(){ + $('.tooltipped').tooltip(); + }); +}( jQuery )); diff --git a/app/dispatch/static/materialize/js/transitions.js b/app/dispatch/static/materialize/js/transitions.js new file mode 100644 index 0000000..5460279 --- /dev/null +++ b/app/dispatch/static/materialize/js/transitions.js @@ -0,0 +1,169 @@ +(function ($) { + // Image transition function + Materialize.fadeInImage = function(selectorOrEl) { + var element; + if (typeof(selectorOrEl) === 'string') { + element = $(selectorOrEl); + } else if (typeof(selectorOrEl) === 'object') { + element = selectorOrEl; + } else { + return; + } + element.css({opacity: 0}); + $(element).velocity({opacity: 1}, { + duration: 650, + queue: false, + easing: 'easeOutSine' + }); + $(element).velocity({opacity: 1}, { + duration: 1300, + queue: false, + easing: 'swing', + step: function(now, fx) { + fx.start = 100; + var grayscale_setting = now/100; + var brightness_setting = 150 - (100 - now)/1.75; + + if (brightness_setting < 100) { + brightness_setting = 100; + } + if (now >= 0) { + $(this).css({ + "-webkit-filter": "grayscale("+grayscale_setting+")" + "brightness("+brightness_setting+"%)", + "filter": "grayscale("+grayscale_setting+")" + "brightness("+brightness_setting+"%)" + }); + } + } + }); + }; + + // Horizontal staggered list + Materialize.showStaggeredList = function(selectorOrEl) { + var element; + if (typeof(selectorOrEl) === 'string') { + element = $(selectorOrEl); + } else if (typeof(selectorOrEl) === 'object') { + element = selectorOrEl; + } else { + return; + } + var time = 0; + element.find('li').velocity( + { translateX: "-100px"}, + { duration: 0 }); + + element.find('li').each(function() { + $(this).velocity( + { opacity: "1", translateX: "0"}, + { duration: 800, delay: time, easing: [60, 10] }); + time += 120; + }); + }; + + + $(document).ready(function() { + // Hardcoded .staggered-list scrollFire + // var staggeredListOptions = []; + // $('ul.staggered-list').each(function (i) { + + // var label = 'scrollFire-' + i; + // $(this).addClass(label); + // staggeredListOptions.push( + // {selector: 'ul.staggered-list.' + label, + // offset: 200, + // callback: 'showStaggeredList("ul.staggered-list.' + label + '")'}); + // }); + // scrollFire(staggeredListOptions); + + // HammerJS, Swipe navigation + + // Touch Event + var swipeLeft = false; + var swipeRight = false; + + + // Dismissible Collections + $('.dismissable').each(function() { + $(this).hammer({ + prevent_default: false + }).on('pan', function(e) { + if (e.gesture.pointerType === "touch") { + var $this = $(this); + var direction = e.gesture.direction; + var x = e.gesture.deltaX; + var velocityX = e.gesture.velocityX; + + $this.velocity({ translateX: x + }, {duration: 50, queue: false, easing: 'easeOutQuad'}); + + // Swipe Left + if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.75)) { + swipeLeft = true; + } + + // Swipe Right + if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.75)) { + swipeRight = true; + } + } + }).on('panend', function(e) { + // Reset if collection is moved back into original position + if (Math.abs(e.gesture.deltaX) < ($(this).innerWidth() / 2)) { + swipeRight = false; + swipeLeft = false; + } + + if (e.gesture.pointerType === "touch") { + var $this = $(this); + if (swipeLeft || swipeRight) { + var fullWidth; + if (swipeLeft) { fullWidth = $this.innerWidth(); } + else { fullWidth = -1 * $this.innerWidth(); } + + $this.velocity({ translateX: fullWidth, + }, {duration: 100, queue: false, easing: 'easeOutQuad', complete: + function() { + $this.css('border', 'none'); + $this.velocity({ height: 0, padding: 0, + }, {duration: 200, queue: false, easing: 'easeOutQuad', complete: + function() { $this.remove(); } + }); + } + }); + } + else { + $this.velocity({ translateX: 0, + }, {duration: 100, queue: false, easing: 'easeOutQuad'}); + } + swipeLeft = false; + swipeRight = false; + } + }); + + }); + + + // time = 0 + // // Vertical Staggered list + // $('ul.staggered-list.vertical li').velocity( + // { translateY: "100px"}, + // { duration: 0 }); + + // $('ul.staggered-list.vertical li').each(function() { + // $(this).velocity( + // { opacity: "1", translateY: "0"}, + // { duration: 800, delay: time, easing: [60, 25] }); + // time += 120; + // }); + + // // Fade in and Scale + // $('.fade-in.scale').velocity( + // { scaleX: .4, scaleY: .4, translateX: -600}, + // { duration: 0}); + // $('.fade-in').each(function() { + // $(this).velocity( + // { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0}, + // { duration: 800, easing: [60, 10] }); + // }); + }); +}( jQuery )); diff --git a/app/dispatch/static/materialize/js/velocity.min.js b/app/dispatch/static/materialize/js/velocity.min.js new file mode 100644 index 0000000..b4a3de4 --- /dev/null +++ b/app/dispatch/static/materialize/js/velocity.min.js @@ -0,0 +1,5 @@ +/*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */ +/*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */ +/*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */ +jQuery.Velocity?console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity."):(!function(e){function t(e){var t=e.length,a=r.type(e);return"function"===a||r.isWindow(e)?!1:1===e.nodeType&&t?!0:"array"===a||0===t||"number"==typeof t&&t>0&&t-1 in e}if(!e.jQuery){var r=function(e,t){return new r.fn.init(e,t)};r.isWindow=function(e){return null!=e&&e==e.window},r.type=function(e){return null==e?e+"":"object"==typeof e||"function"==typeof e?n[i.call(e)]||"object":typeof e},r.isArray=Array.isArray||function(e){return"array"===r.type(e)},r.isPlainObject=function(e){var t;if(!e||"object"!==r.type(e)||e.nodeType||r.isWindow(e))return!1;try{if(e.constructor&&!o.call(e,"constructor")&&!o.call(e.constructor.prototype,"isPrototypeOf"))return!1}catch(a){return!1}for(t in e);return void 0===t||o.call(e,t)},r.each=function(e,r,a){var n,o=0,i=e.length,s=t(e);if(a){if(s)for(;i>o&&(n=r.apply(e[o],a),n!==!1);o++);else for(o in e)if(n=r.apply(e[o],a),n===!1)break}else if(s)for(;i>o&&(n=r.call(e[o],o,e[o]),n!==!1);o++);else for(o in e)if(n=r.call(e[o],o,e[o]),n===!1)break;return e},r.data=function(e,t,n){if(void 0===n){var o=e[r.expando],i=o&&a[o];if(void 0===t)return i;if(i&&t in i)return i[t]}else if(void 0!==t){var o=e[r.expando]||(e[r.expando]=++r.uuid);return a[o]=a[o]||{},a[o][t]=n,n}},r.removeData=function(e,t){var n=e[r.expando],o=n&&a[n];o&&r.each(t,function(e,t){delete o[t]})},r.extend=function(){var e,t,a,n,o,i,s=arguments[0]||{},l=1,u=arguments.length,c=!1;for("boolean"==typeof s&&(c=s,s=arguments[l]||{},l++),"object"!=typeof s&&"function"!==r.type(s)&&(s={}),l===u&&(s=this,l--);u>l;l++)if(null!=(o=arguments[l]))for(n in o)e=s[n],a=o[n],s!==a&&(c&&a&&(r.isPlainObject(a)||(t=r.isArray(a)))?(t?(t=!1,i=e&&r.isArray(e)?e:[]):i=e&&r.isPlainObject(e)?e:{},s[n]=r.extend(c,i,a)):void 0!==a&&(s[n]=a));return s},r.queue=function(e,a,n){function o(e,r){var a=r||[];return null!=e&&(t(Object(e))?!function(e,t){for(var r=+t.length,a=0,n=e.length;r>a;)e[n++]=t[a++];if(r!==r)for(;void 0!==t[a];)e[n++]=t[a++];return e.length=n,e}(a,"string"==typeof e?[e]:e):[].push.call(a,e)),a}if(e){a=(a||"fx")+"queue";var i=r.data(e,a);return n?(!i||r.isArray(n)?i=r.data(e,a,o(n)):i.push(n),i):i||[]}},r.dequeue=function(e,t){r.each(e.nodeType?[e]:e,function(e,a){t=t||"fx";var n=r.queue(a,t),o=n.shift();"inprogress"===o&&(o=n.shift()),o&&("fx"===t&&n.unshift("inprogress"),o.call(a,function(){r.dequeue(a,t)}))})},r.fn=r.prototype={init:function(e){if(e.nodeType)return this[0]=e,this;throw new Error("Not a DOM node.")},offset:function(){var t=this[0].getBoundingClientRect?this[0].getBoundingClientRect():{top:0,left:0};return{top:t.top+(e.pageYOffset||document.scrollTop||0)-(document.clientTop||0),left:t.left+(e.pageXOffset||document.scrollLeft||0)-(document.clientLeft||0)}},position:function(){function e(){for(var e=this.offsetParent||document;e&&"html"===!e.nodeType.toLowerCase&&"static"===e.style.position;)e=e.offsetParent;return e||document}var t=this[0],e=e.apply(t),a=this.offset(),n=/^(?:body|html)$/i.test(e.nodeName)?{top:0,left:0}:r(e).offset();return a.top-=parseFloat(t.style.marginTop)||0,a.left-=parseFloat(t.style.marginLeft)||0,e.style&&(n.top+=parseFloat(e.style.borderTopWidth)||0,n.left+=parseFloat(e.style.borderLeftWidth)||0),{top:a.top-n.top,left:a.left-n.left}}};var a={};r.expando="velocity"+(new Date).getTime(),r.uuid=0;for(var n={},o=n.hasOwnProperty,i=n.toString,s="Boolean Number String Function Array Date RegExp Object Error".split(" "),l=0;ln;++n){var o=u(r,e,a);if(0===o)return r;var i=l(r,e,a)-t;r-=i/o}return r}function p(){for(var t=0;b>t;++t)w[t]=l(t*x,e,a)}function f(t,r,n){var o,i,s=0;do i=r+(n-r)/2,o=l(i,e,a)-t,o>0?n=i:r=i;while(Math.abs(o)>h&&++s=y?c(t,s):0==l?s:f(t,r,r+x)}function g(){V=!0,(e!=r||a!=n)&&p()}var m=4,y=.001,h=1e-7,v=10,b=11,x=1/(b-1),S="Float32Array"in t;if(4!==arguments.length)return!1;for(var P=0;4>P;++P)if("number"!=typeof arguments[P]||isNaN(arguments[P])||!isFinite(arguments[P]))return!1;e=Math.min(e,1),a=Math.min(a,1),e=Math.max(e,0),a=Math.max(a,0);var w=S?new Float32Array(b):new Array(b),V=!1,C=function(t){return V||g(),e===r&&a===n?t:0===t?0:1===t?1:l(d(t),r,n)};C.getControlPoints=function(){return[{x:e,y:r},{x:a,y:n}]};var T="generateBezier("+[e,r,a,n]+")";return C.toString=function(){return T},C}function u(e,t){var r=e;return m.isString(e)?b.Easings[e]||(r=!1):r=m.isArray(e)&&1===e.length?s.apply(null,e):m.isArray(e)&&2===e.length?x.apply(null,e.concat([t])):m.isArray(e)&&4===e.length?l.apply(null,e):!1,r===!1&&(r=b.Easings[b.defaults.easing]?b.defaults.easing:v),r}function c(e){if(e){var t=(new Date).getTime(),r=b.State.calls.length;r>1e4&&(b.State.calls=n(b.State.calls));for(var o=0;r>o;o++)if(b.State.calls[o]){var s=b.State.calls[o],l=s[0],u=s[2],d=s[3],g=!!d,y=null;d||(d=b.State.calls[o][3]=t-16);for(var h=Math.min((t-d)/u.duration,1),v=0,x=l.length;x>v;v++){var P=l[v],V=P.element;if(i(V)){var C=!1;if(u.display!==a&&null!==u.display&&"none"!==u.display){if("flex"===u.display){var T=["-webkit-box","-moz-box","-ms-flexbox","-webkit-flex"];f.each(T,function(e,t){S.setPropertyValue(V,"display",t)})}S.setPropertyValue(V,"display",u.display)}u.visibility!==a&&"hidden"!==u.visibility&&S.setPropertyValue(V,"visibility",u.visibility);for(var k in P)if("element"!==k){var A,F=P[k],j=m.isString(F.easing)?b.Easings[F.easing]:F.easing;if(1===h)A=F.endValue;else{var E=F.endValue-F.startValue;if(A=F.startValue+E*j(h,u,E),!g&&A===F.currentValue)continue}if(F.currentValue=A,"tween"===k)y=A;else{if(S.Hooks.registered[k]){var H=S.Hooks.getRoot(k),N=i(V).rootPropertyValueCache[H];N&&(F.rootPropertyValue=N)}var L=S.setPropertyValue(V,k,F.currentValue+(0===parseFloat(A)?"":F.unitType),F.rootPropertyValue,F.scrollData);S.Hooks.registered[k]&&(i(V).rootPropertyValueCache[H]=S.Normalizations.registered[H]?S.Normalizations.registered[H]("extract",null,L[1]):L[1]),"transform"===L[0]&&(C=!0)}}u.mobileHA&&i(V).transformCache.translate3d===a&&(i(V).transformCache.translate3d="(0px, 0px, 0px)",C=!0),C&&S.flushTransformCache(V)}}u.display!==a&&"none"!==u.display&&(b.State.calls[o][2].display=!1),u.visibility!==a&&"hidden"!==u.visibility&&(b.State.calls[o][2].visibility=!1),u.progress&&u.progress.call(s[1],s[1],h,Math.max(0,d+u.duration-t),d,y),1===h&&p(o)}}b.State.isTicking&&w(c)}function p(e,t){if(!b.State.calls[e])return!1;for(var r=b.State.calls[e][0],n=b.State.calls[e][1],o=b.State.calls[e][2],s=b.State.calls[e][4],l=!1,u=0,c=r.length;c>u;u++){var p=r[u].element;if(t||o.loop||("none"===o.display&&S.setPropertyValue(p,"display",o.display),"hidden"===o.visibility&&S.setPropertyValue(p,"visibility",o.visibility)),o.loop!==!0&&(f.queue(p)[1]===a||!/\.velocityQueueEntryFlag/i.test(f.queue(p)[1]))&&i(p)){i(p).isAnimating=!1,i(p).rootPropertyValueCache={};var d=!1;f.each(S.Lists.transforms3D,function(e,t){var r=/^scale/.test(t)?1:0,n=i(p).transformCache[t];i(p).transformCache[t]!==a&&new RegExp("^\\("+r+"[^.]").test(n)&&(d=!0,delete i(p).transformCache[t])}),o.mobileHA&&(d=!0,delete i(p).transformCache.translate3d),d&&S.flushTransformCache(p),S.Values.removeClass(p,"velocity-animating")}if(!t&&o.complete&&!o.loop&&u===c-1)try{o.complete.call(n,n)}catch(g){setTimeout(function(){throw g},1)}s&&o.loop!==!0&&s(n),i(p)&&o.loop===!0&&!t&&(f.each(i(p).tweensContainer,function(e,t){/^rotate/.test(e)&&360===parseFloat(t.endValue)&&(t.endValue=0,t.startValue=360),/^backgroundPosition/.test(e)&&100===parseFloat(t.endValue)&&"%"===t.unitType&&(t.endValue=0,t.startValue=100)}),b(p,"reverse",{loop:!0,delay:o.delay})),o.queue!==!1&&f.dequeue(p,o.queue)}b.State.calls[e]=!1;for(var m=0,y=b.State.calls.length;y>m;m++)if(b.State.calls[m]!==!1){l=!0;break}l===!1&&(b.State.isTicking=!1,delete b.State.calls,b.State.calls=[])}var f,d=function(){if(r.documentMode)return r.documentMode;for(var e=7;e>4;e--){var t=r.createElement("div");if(t.innerHTML="",t.getElementsByTagName("span").length)return t=null,e}return a}(),g=function(){var e=0;return t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||function(t){var r,a=(new Date).getTime();return r=Math.max(0,16-(a-e)),e=a+r,setTimeout(function(){t(a+r)},r)}}(),m={isString:function(e){return"string"==typeof e},isArray:Array.isArray||function(e){return"[object Array]"===Object.prototype.toString.call(e)},isFunction:function(e){return"[object Function]"===Object.prototype.toString.call(e)},isNode:function(e){return e&&e.nodeType},isNodeList:function(e){return"object"==typeof e&&/^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e))&&e.length!==a&&(0===e.length||"object"==typeof e[0]&&e[0].nodeType>0)},isWrapped:function(e){return e&&(e.jquery||t.Zepto&&t.Zepto.zepto.isZ(e))},isSVG:function(e){return t.SVGElement&&e instanceof t.SVGElement},isEmptyObject:function(e){for(var t in e)return!1;return!0}},y=!1;if(e.fn&&e.fn.jquery?(f=e,y=!0):f=t.Velocity.Utilities,8>=d&&!y)throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if(7>=d)return void(jQuery.fn.velocity=jQuery.fn.animate);var h=400,v="swing",b={State:{isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),isAndroid:/Android/i.test(navigator.userAgent),isGingerbread:/Android 2\.3\.[3-7]/i.test(navigator.userAgent),isChrome:t.chrome,isFirefox:/Firefox/i.test(navigator.userAgent),prefixElement:r.createElement("div"),prefixMatches:{},scrollAnchor:null,scrollPropertyLeft:null,scrollPropertyTop:null,isTicking:!1,calls:[]},CSS:{},Utilities:f,Redirects:{},Easings:{},Promise:t.Promise,defaults:{queue:"",duration:h,easing:v,begin:a,complete:a,progress:a,display:a,visibility:a,loop:!1,delay:!1,mobileHA:!0,_cacheValues:!0},init:function(e){f.data(e,"velocity",{isSVG:m.isSVG(e),isAnimating:!1,computedStyle:null,tweensContainer:null,rootPropertyValueCache:{},transformCache:{}})},hook:null,mock:!1,version:{major:1,minor:2,patch:2},debug:!1};t.pageYOffset!==a?(b.State.scrollAnchor=t,b.State.scrollPropertyLeft="pageXOffset",b.State.scrollPropertyTop="pageYOffset"):(b.State.scrollAnchor=r.documentElement||r.body.parentNode||r.body,b.State.scrollPropertyLeft="scrollLeft",b.State.scrollPropertyTop="scrollTop");var x=function(){function e(e){return-e.tension*e.x-e.friction*e.v}function t(t,r,a){var n={x:t.x+a.dx*r,v:t.v+a.dv*r,tension:t.tension,friction:t.friction};return{dx:n.v,dv:e(n)}}function r(r,a){var n={dx:r.v,dv:e(r)},o=t(r,.5*a,n),i=t(r,.5*a,o),s=t(r,a,i),l=1/6*(n.dx+2*(o.dx+i.dx)+s.dx),u=1/6*(n.dv+2*(o.dv+i.dv)+s.dv);return r.x=r.x+l*a,r.v=r.v+u*a,r}return function a(e,t,n){var o,i,s,l={x:-1,v:0,tension:null,friction:null},u=[0],c=0,p=1e-4,f=.016;for(e=parseFloat(e)||500,t=parseFloat(t)||20,n=n||null,l.tension=e,l.friction=t,o=null!==n,o?(c=a(e,t),i=c/n*f):i=f;s=r(s||l,i),u.push(1+s.x),c+=16,Math.abs(s.x)>p&&Math.abs(s.v)>p;);return o?function(e){return u[e*(u.length-1)|0]}:c}}();b.Easings={linear:function(e){return e},swing:function(e){return.5-Math.cos(e*Math.PI)/2},spring:function(e){return 1-Math.cos(4.5*e*Math.PI)*Math.exp(6*-e)}},f.each([["ease",[.25,.1,.25,1]],["ease-in",[.42,0,1,1]],["ease-out",[0,0,.58,1]],["ease-in-out",[.42,0,.58,1]],["easeInSine",[.47,0,.745,.715]],["easeOutSine",[.39,.575,.565,1]],["easeInOutSine",[.445,.05,.55,.95]],["easeInQuad",[.55,.085,.68,.53]],["easeOutQuad",[.25,.46,.45,.94]],["easeInOutQuad",[.455,.03,.515,.955]],["easeInCubic",[.55,.055,.675,.19]],["easeOutCubic",[.215,.61,.355,1]],["easeInOutCubic",[.645,.045,.355,1]],["easeInQuart",[.895,.03,.685,.22]],["easeOutQuart",[.165,.84,.44,1]],["easeInOutQuart",[.77,0,.175,1]],["easeInQuint",[.755,.05,.855,.06]],["easeOutQuint",[.23,1,.32,1]],["easeInOutQuint",[.86,0,.07,1]],["easeInExpo",[.95,.05,.795,.035]],["easeOutExpo",[.19,1,.22,1]],["easeInOutExpo",[1,0,0,1]],["easeInCirc",[.6,.04,.98,.335]],["easeOutCirc",[.075,.82,.165,1]],["easeInOutCirc",[.785,.135,.15,.86]]],function(e,t){b.Easings[t[0]]=l.apply(null,t[1])});var S=b.CSS={RegEx:{isHex:/^#([A-f\d]{3}){1,2}$/i,valueUnwrap:/^[A-z]+\((.*)\)$/i,wrappedValueAlreadyExtracted:/[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/,valueSplit:/([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi},Lists:{colors:["fill","stroke","stopColor","color","backgroundColor","borderColor","borderTopColor","borderRightColor","borderBottomColor","borderLeftColor","outlineColor"],transformsBase:["translateX","translateY","scale","scaleX","scaleY","skewX","skewY","rotateZ"],transforms3D:["transformPerspective","translateZ","scaleZ","rotateX","rotateY"]},Hooks:{templates:{textShadow:["Color X Y Blur","black 0px 0px 0px"],boxShadow:["Color X Y Blur Spread","black 0px 0px 0px 0px"],clip:["Top Right Bottom Left","0px 0px 0px 0px"],backgroundPosition:["X Y","0% 0%"],transformOrigin:["X Y Z","50% 50% 0px"],perspectiveOrigin:["X Y","50% 50%"]},registered:{},register:function(){for(var e=0;e=d)switch(e){case"name":return"filter";case"extract":var a=r.toString().match(/alpha\(opacity=(.*)\)/i);return r=a?a[1]/100:1;case"inject":return t.style.zoom=1,parseFloat(r)>=1?"":"alpha(opacity="+parseInt(100*parseFloat(r),10)+")"}else switch(e){case"name":return"opacity";case"extract":return r;case"inject":return r}}},register:function(){9>=d||b.State.isGingerbread||(S.Lists.transformsBase=S.Lists.transformsBase.concat(S.Lists.transforms3D));for(var e=0;en&&(n=1),o=!/(\d)$/i.test(n);break;case"skew":o=!/(deg|\d)$/i.test(n);break;case"rotate":o=!/(deg|\d)$/i.test(n)}return o||(i(r).transformCache[t]="("+n+")"),i(r).transformCache[t]}}}();for(var e=0;e=d||3!==o.split(" ").length||(o+=" 1"),o;case"inject":return 8>=d?4===n.split(" ").length&&(n=n.split(/\s+/).slice(0,3).join(" ")):3===n.split(" ").length&&(n+=" 1"),(8>=d?"rgb":"rgba")+"("+n.replace(/\s+/g,",").replace(/\.(\d)+(?=,)/g,"")+")"}}}()}},Names:{camelCase:function(e){return e.replace(/-(\w)/g,function(e,t){return t.toUpperCase()})},SVGAttribute:function(e){var t="width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return(d||b.State.isAndroid&&!b.State.isChrome)&&(t+="|transform"),new RegExp("^("+t+")$","i").test(e)},prefixCheck:function(e){if(b.State.prefixMatches[e])return[b.State.prefixMatches[e],!0];for(var t=["","Webkit","Moz","ms","O"],r=0,a=t.length;a>r;r++){var n;if(n=0===r?e:t[r]+e.replace(/^\w/,function(e){return e.toUpperCase()}),m.isString(b.State.prefixElement.style[n]))return b.State.prefixMatches[e]=n,[n,!0]}return[e,!1]}},Values:{hexToRgb:function(e){var t,r=/^#?([a-f\d])([a-f\d])([a-f\d])$/i,a=/^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return e=e.replace(r,function(e,t,r,a){return t+t+r+r+a+a}),t=a.exec(e),t?[parseInt(t[1],16),parseInt(t[2],16),parseInt(t[3],16)]:[0,0,0]},isCSSNullValue:function(e){return 0==e||/^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e)},getUnitType:function(e){return/^(rotate|skew)/i.test(e)?"deg":/(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e)?"":"px"},getDisplayType:function(e){var t=e&&e.tagName.toString().toLowerCase();return/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t)?"inline":/^(li)$/i.test(t)?"list-item":/^(tr)$/i.test(t)?"table-row":/^(table)$/i.test(t)?"table":/^(tbody)$/i.test(t)?"table-row-group":"block"},addClass:function(e,t){e.classList?e.classList.add(t):e.className+=(e.className.length?" ":"")+t},removeClass:function(e,t){e.classList?e.classList.remove(t):e.className=e.className.toString().replace(new RegExp("(^|\\s)"+t.split(" ").join("|")+"(\\s|$)","gi")," ")}},getPropertyValue:function(e,r,n,o){function s(e,r){function n(){u&&S.setPropertyValue(e,"display","none")}var l=0;if(8>=d)l=f.css(e,r);else{var u=!1;if(/^(width|height)$/.test(r)&&0===S.getPropertyValue(e,"display")&&(u=!0,S.setPropertyValue(e,"display",S.Values.getDisplayType(e))),!o){if("height"===r&&"border-box"!==S.getPropertyValue(e,"boxSizing").toString().toLowerCase()){var c=e.offsetHeight-(parseFloat(S.getPropertyValue(e,"borderTopWidth"))||0)-(parseFloat(S.getPropertyValue(e,"borderBottomWidth"))||0)-(parseFloat(S.getPropertyValue(e,"paddingTop"))||0)-(parseFloat(S.getPropertyValue(e,"paddingBottom"))||0);return n(),c}if("width"===r&&"border-box"!==S.getPropertyValue(e,"boxSizing").toString().toLowerCase()){var p=e.offsetWidth-(parseFloat(S.getPropertyValue(e,"borderLeftWidth"))||0)-(parseFloat(S.getPropertyValue(e,"borderRightWidth"))||0)-(parseFloat(S.getPropertyValue(e,"paddingLeft"))||0)-(parseFloat(S.getPropertyValue(e,"paddingRight"))||0);return n(),p}}var g;g=i(e)===a?t.getComputedStyle(e,null):i(e).computedStyle?i(e).computedStyle:i(e).computedStyle=t.getComputedStyle(e,null),"borderColor"===r&&(r="borderTopColor"),l=9===d&&"filter"===r?g.getPropertyValue(r):g[r],(""===l||null===l)&&(l=e.style[r]),n()}if("auto"===l&&/^(top|right|bottom|left)$/i.test(r)){var m=s(e,"position");("fixed"===m||"absolute"===m&&/top|left/i.test(r))&&(l=f(e).position()[r]+"px")}return l}var l;if(S.Hooks.registered[r]){var u=r,c=S.Hooks.getRoot(u);n===a&&(n=S.getPropertyValue(e,S.Names.prefixCheck(c)[0])),S.Normalizations.registered[c]&&(n=S.Normalizations.registered[c]("extract",e,n)),l=S.Hooks.extractValue(u,n)}else if(S.Normalizations.registered[r]){var p,g;p=S.Normalizations.registered[r]("name",e),"transform"!==p&&(g=s(e,S.Names.prefixCheck(p)[0]),S.Values.isCSSNullValue(g)&&S.Hooks.templates[r]&&(g=S.Hooks.templates[r][1])),l=S.Normalizations.registered[r]("extract",e,g)}if(!/^[\d-]/.test(l))if(i(e)&&i(e).isSVG&&S.Names.SVGAttribute(r))if(/^(height|width)$/i.test(r))try{l=e.getBBox()[r]}catch(m){l=0}else l=e.getAttribute(r);else l=s(e,S.Names.prefixCheck(r)[0]);return S.Values.isCSSNullValue(l)&&(l=0),b.debug>=2&&console.log("Get "+r+": "+l),l},setPropertyValue:function(e,r,a,n,o){var s=r;if("scroll"===r)o.container?o.container["scroll"+o.direction]=a:"Left"===o.direction?t.scrollTo(a,o.alternateValue):t.scrollTo(o.alternateValue,a);else if(S.Normalizations.registered[r]&&"transform"===S.Normalizations.registered[r]("name",e))S.Normalizations.registered[r]("inject",e,a),s="transform",a=i(e).transformCache[r];else{if(S.Hooks.registered[r]){var l=r,u=S.Hooks.getRoot(r);n=n||S.getPropertyValue(e,u),a=S.Hooks.injectValue(l,a,n),r=u}if(S.Normalizations.registered[r]&&(a=S.Normalizations.registered[r]("inject",e,a),r=S.Normalizations.registered[r]("name",e)),s=S.Names.prefixCheck(r)[0],8>=d)try{e.style[s]=a}catch(c){b.debug&&console.log("Browser does not support ["+a+"] for ["+s+"]")}else i(e)&&i(e).isSVG&&S.Names.SVGAttribute(r)?e.setAttribute(r,a):e.style[s]=a;b.debug>=2&&console.log("Set "+r+" ("+s+"): "+a)}return[s,a]},flushTransformCache:function(e){function t(t){return parseFloat(S.getPropertyValue(e,t))}var r="";if((d||b.State.isAndroid&&!b.State.isChrome)&&i(e).isSVG){var a={translate:[t("translateX"),t("translateY")],skewX:[t("skewX")],skewY:[t("skewY")],scale:1!==t("scale")?[t("scale"),t("scale")]:[t("scaleX"),t("scaleY")],rotate:[t("rotateZ"),0,0]};f.each(i(e).transformCache,function(e){/^translate/i.test(e)?e="translate":/^scale/i.test(e)?e="scale":/^rotate/i.test(e)&&(e="rotate"),a[e]&&(r+=e+"("+a[e].join(" ")+") ",delete a[e])})}else{var n,o;f.each(i(e).transformCache,function(t){return n=i(e).transformCache[t],"transformPerspective"===t?(o=n,!0):(9===d&&"rotateZ"===t&&(t="rotate"),void(r+=t+n+" "))}),o&&(r="perspective"+o+" "+r)}S.setPropertyValue(e,"transform",r)}};S.Hooks.register(),S.Normalizations.register(),b.hook=function(e,t,r){var n=a;return e=o(e),f.each(e,function(e,o){if(i(o)===a&&b.init(o),r===a)n===a&&(n=b.CSS.getPropertyValue(o,t));else{var s=b.CSS.setPropertyValue(o,t,r);"transform"===s[0]&&b.CSS.flushTransformCache(o),n=s}}),n};var P=function(){function e(){return s?k.promise||null:l}function n(){function e(e){function p(e,t){var r=a,n=a,i=a;return m.isArray(e)?(r=e[0],!m.isArray(e[1])&&/^[\d-]/.test(e[1])||m.isFunction(e[1])||S.RegEx.isHex.test(e[1])?i=e[1]:(m.isString(e[1])&&!S.RegEx.isHex.test(e[1])||m.isArray(e[1]))&&(n=t?e[1]:u(e[1],s.duration),e[2]!==a&&(i=e[2]))):r=e,t||(n=n||s.easing),m.isFunction(r)&&(r=r.call(o,V,w)),m.isFunction(i)&&(i=i.call(o,V,w)),[r||0,n,i]}function d(e,t){var r,a;return a=(t||"0").toString().toLowerCase().replace(/[%A-z]+$/,function(e){return r=e,""}),r||(r=S.Values.getUnitType(e)),[a,r]}function h(){var e={myParent:o.parentNode||r.body,position:S.getPropertyValue(o,"position"),fontSize:S.getPropertyValue(o,"fontSize")},a=e.position===L.lastPosition&&e.myParent===L.lastParent,n=e.fontSize===L.lastFontSize;L.lastParent=e.myParent,L.lastPosition=e.position,L.lastFontSize=e.fontSize;var s=100,l={};if(n&&a)l.emToPx=L.lastEmToPx,l.percentToPxWidth=L.lastPercentToPxWidth,l.percentToPxHeight=L.lastPercentToPxHeight;else{var u=i(o).isSVG?r.createElementNS("http://www.w3.org/2000/svg","rect"):r.createElement("div");b.init(u),e.myParent.appendChild(u),f.each(["overflow","overflowX","overflowY"],function(e,t){b.CSS.setPropertyValue(u,t,"hidden")}),b.CSS.setPropertyValue(u,"position",e.position),b.CSS.setPropertyValue(u,"fontSize",e.fontSize),b.CSS.setPropertyValue(u,"boxSizing","content-box"),f.each(["minWidth","maxWidth","width","minHeight","maxHeight","height"],function(e,t){b.CSS.setPropertyValue(u,t,s+"%")}),b.CSS.setPropertyValue(u,"paddingLeft",s+"em"),l.percentToPxWidth=L.lastPercentToPxWidth=(parseFloat(S.getPropertyValue(u,"width",null,!0))||1)/s,l.percentToPxHeight=L.lastPercentToPxHeight=(parseFloat(S.getPropertyValue(u,"height",null,!0))||1)/s,l.emToPx=L.lastEmToPx=(parseFloat(S.getPropertyValue(u,"paddingLeft"))||1)/s,e.myParent.removeChild(u)}return null===L.remToPx&&(L.remToPx=parseFloat(S.getPropertyValue(r.body,"fontSize"))||16),null===L.vwToPx&&(L.vwToPx=parseFloat(t.innerWidth)/100,L.vhToPx=parseFloat(t.innerHeight)/100),l.remToPx=L.remToPx,l.vwToPx=L.vwToPx,l.vhToPx=L.vhToPx,b.debug>=1&&console.log("Unit ratios: "+JSON.stringify(l),o),l}if(s.begin&&0===V)try{s.begin.call(g,g)}catch(x){setTimeout(function(){throw x},1)}if("scroll"===A){var P,C,T,F=/^x$/i.test(s.axis)?"Left":"Top",j=parseFloat(s.offset)||0;s.container?m.isWrapped(s.container)||m.isNode(s.container)?(s.container=s.container[0]||s.container,P=s.container["scroll"+F],T=P+f(o).position()[F.toLowerCase()]+j):s.container=null:(P=b.State.scrollAnchor[b.State["scrollProperty"+F]],C=b.State.scrollAnchor[b.State["scrollProperty"+("Left"===F?"Top":"Left")]],T=f(o).offset()[F.toLowerCase()]+j),l={scroll:{rootPropertyValue:!1,startValue:P,currentValue:P,endValue:T,unitType:"",easing:s.easing,scrollData:{container:s.container,direction:F,alternateValue:C}},element:o},b.debug&&console.log("tweensContainer (scroll): ",l.scroll,o)}else if("reverse"===A){if(!i(o).tweensContainer)return void f.dequeue(o,s.queue);"none"===i(o).opts.display&&(i(o).opts.display="auto"),"hidden"===i(o).opts.visibility&&(i(o).opts.visibility="visible"),i(o).opts.loop=!1,i(o).opts.begin=null,i(o).opts.complete=null,v.easing||delete s.easing,v.duration||delete s.duration,s=f.extend({},i(o).opts,s);var E=f.extend(!0,{},i(o).tweensContainer);for(var H in E)if("element"!==H){var N=E[H].startValue;E[H].startValue=E[H].currentValue=E[H].endValue,E[H].endValue=N,m.isEmptyObject(v)||(E[H].easing=s.easing),b.debug&&console.log("reverse tweensContainer ("+H+"): "+JSON.stringify(E[H]),o)}l=E}else if("start"===A){var E;i(o).tweensContainer&&i(o).isAnimating===!0&&(E=i(o).tweensContainer),f.each(y,function(e,t){if(RegExp("^"+S.Lists.colors.join("$|^")+"$").test(e)){var r=p(t,!0),n=r[0],o=r[1],i=r[2];if(S.RegEx.isHex.test(n)){for(var s=["Red","Green","Blue"],l=S.Values.hexToRgb(n),u=i?S.Values.hexToRgb(i):a,c=0;cO;O++){var q={delay:j.delay,progress:j.progress};O===z-1&&(q.display=j.display,q.visibility=j.visibility,q.complete=j.complete),P(g,"reverse",q)}return e()}};b=f.extend(P,b),b.animate=P;var w=t.requestAnimationFrame||g;return b.State.isMobile||r.hidden===a||r.addEventListener("visibilitychange",function(){r.hidden?(w=function(e){return setTimeout(function(){e(!0)},16)},c()):w=t.requestAnimationFrame||g}),e.Velocity=b,e!==t&&(e.fn.velocity=P,e.fn.velocity.defaults=b.defaults),f.each(["Down","Up"],function(e,t){b.Redirects["slide"+t]=function(e,r,n,o,i,s){var l=f.extend({},r),u=l.begin,c=l.complete,p={height:"",marginTop:"",marginBottom:"",paddingTop:"",paddingBottom:""},d={};l.display===a&&(l.display="Down"===t?"inline"===b.CSS.Values.getDisplayType(e)?"inline-block":"block":"none"),l.begin=function(){u&&u.call(i,i);for(var r in p){d[r]=e.style[r];var a=b.CSS.getPropertyValue(e,r);p[r]="Down"===t?[a,0]:[0,a]}d.overflow=e.style.overflow,e.style.overflow="hidden"},l.complete=function(){for(var t in d)e.style[t]=d[t];c&&c.call(i,i),s&&s.resolver(i)},b(e,p,l)}}),f.each(["In","Out"],function(e,t){b.Redirects["fade"+t]=function(e,r,n,o,i,s){var l=f.extend({},r),u={opacity:"In"===t?1:0},c=l.complete;l.complete=n!==o-1?l.begin=null:function(){c&&c.call(i,i),s&&s.resolver(i)},l.display===a&&(l.display="In"===t?"auto":"none"),b(this,u,l)}}),b}(window.jQuery||window.Zepto||window,window,document)})); diff --git a/app/dispatch/static/materialize/js/waves.js b/app/dispatch/static/materialize/js/waves.js new file mode 100644 index 0000000..b56cc2c --- /dev/null +++ b/app/dispatch/static/materialize/js/waves.js @@ -0,0 +1,335 @@ +/*! + * Waves v0.6.4 + * http://fian.my.id/Waves + * + * Copyright 2014 Alfiana E. Sibuea and other contributors + * Released under the MIT license + * https://github.com/fians/Waves/blob/master/LICENSE + */ + +;(function(window) { + 'use strict'; + + var Waves = Waves || {}; + var $$ = document.querySelectorAll.bind(document); + + // Find exact position of element + function isWindow(obj) { + return obj !== null && obj === obj.window; + } + + function getWindow(elem) { + return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView; + } + + function offset(elem) { + var docElem, win, + box = {top: 0, left: 0}, + doc = elem && elem.ownerDocument; + + docElem = doc.documentElement; + + if (typeof elem.getBoundingClientRect !== typeof undefined) { + box = elem.getBoundingClientRect(); + } + win = getWindow(doc); + return { + top: box.top + win.pageYOffset - docElem.clientTop, + left: box.left + win.pageXOffset - docElem.clientLeft + }; + } + + function convertStyle(obj) { + var style = ''; + + for (var a in obj) { + if (obj.hasOwnProperty(a)) { + style += (a + ':' + obj[a] + ';'); + } + } + + return style; + } + + var Effect = { + + // Effect delay + duration: 750, + + show: function(e, element) { + + // Disable right click + if (e.button === 2) { + return false; + } + + var el = element || this; + + // Create ripple + var ripple = document.createElement('div'); + ripple.className = 'waves-ripple'; + el.appendChild(ripple); + + // Get click coordinate and element witdh + var pos = offset(el); + var relativeY = (e.pageY - pos.top); + var relativeX = (e.pageX - pos.left); + var scale = 'scale('+((el.clientWidth / 100) * 10)+')'; + + // Support for touch devices + if ('touches' in e) { + relativeY = (e.touches[0].pageY - pos.top); + relativeX = (e.touches[0].pageX - pos.left); + } + + // Attach data to element + ripple.setAttribute('data-hold', Date.now()); + ripple.setAttribute('data-scale', scale); + ripple.setAttribute('data-x', relativeX); + ripple.setAttribute('data-y', relativeY); + + // Set ripple position + var rippleStyle = { + 'top': relativeY+'px', + 'left': relativeX+'px' + }; + + ripple.className = ripple.className + ' waves-notransition'; + ripple.setAttribute('style', convertStyle(rippleStyle)); + ripple.className = ripple.className.replace('waves-notransition', ''); + + // Scale the ripple + rippleStyle['-webkit-transform'] = scale; + rippleStyle['-moz-transform'] = scale; + rippleStyle['-ms-transform'] = scale; + rippleStyle['-o-transform'] = scale; + rippleStyle.transform = scale; + rippleStyle.opacity = '1'; + + rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms'; + rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms'; + rippleStyle['-o-transition-duration'] = Effect.duration + 'ms'; + rippleStyle['transition-duration'] = Effect.duration + 'ms'; + + rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + + ripple.setAttribute('style', convertStyle(rippleStyle)); + }, + + hide: function(e) { + TouchHandler.touchup(e); + + var el = this; + var width = el.clientWidth * 1.4; + + // Get first ripple + var ripple = null; + var ripples = el.getElementsByClassName('waves-ripple'); + if (ripples.length > 0) { + ripple = ripples[ripples.length - 1]; + } else { + return false; + } + + var relativeX = ripple.getAttribute('data-x'); + var relativeY = ripple.getAttribute('data-y'); + var scale = ripple.getAttribute('data-scale'); + + // Get delay beetween mousedown and mouse leave + var diff = Date.now() - Number(ripple.getAttribute('data-hold')); + var delay = 350 - diff; + + if (delay < 0) { + delay = 0; + } + + // Fade out ripple after delay + setTimeout(function() { + var style = { + 'top': relativeY+'px', + 'left': relativeX+'px', + 'opacity': '0', + + // Duration + '-webkit-transition-duration': Effect.duration + 'ms', + '-moz-transition-duration': Effect.duration + 'ms', + '-o-transition-duration': Effect.duration + 'ms', + 'transition-duration': Effect.duration + 'ms', + '-webkit-transform': scale, + '-moz-transform': scale, + '-ms-transform': scale, + '-o-transform': scale, + 'transform': scale, + }; + + ripple.setAttribute('style', convertStyle(style)); + + setTimeout(function() { + try { + el.removeChild(ripple); + } catch(e) { + return false; + } + }, Effect.duration); + }, delay); + }, + + // Little hack to make can perform waves effect + wrapInput: function(elements) { + for (var a = 0; a < elements.length; a++) { + var el = elements[a]; + + if (el.tagName.toLowerCase() === 'input') { + var parent = el.parentNode; + + // If input already have parent just pass through + if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) { + continue; + } + + // Put element class and style to the specified parent + var wrapper = document.createElement('i'); + wrapper.className = el.className + ' waves-input-wrapper'; + + var elementStyle = el.getAttribute('style'); + + if (!elementStyle) { + elementStyle = ''; + } + + wrapper.setAttribute('style', elementStyle); + + el.className = 'waves-button-input'; + el.removeAttribute('style'); + + // Put element as child + parent.replaceChild(wrapper, el); + wrapper.appendChild(el); + } + } + } + }; + + + /** + * Disable mousedown event for 500ms during and after touch + */ + var TouchHandler = { + /* uses an integer rather than bool so there's no issues with + * needing to clear timeouts if another touch event occurred + * within the 500ms. Cannot mouseup between touchstart and + * touchend, nor in the 500ms after touchend. */ + touches: 0, + allowEvent: function(e) { + var allow = true; + + if (e.type === 'touchstart') { + TouchHandler.touches += 1; //push + } else if (e.type === 'touchend' || e.type === 'touchcancel') { + setTimeout(function() { + if (TouchHandler.touches > 0) { + TouchHandler.touches -= 1; //pop after 500ms + } + }, 500); + } else if (e.type === 'mousedown' && TouchHandler.touches > 0) { + allow = false; + } + + return allow; + }, + touchup: function(e) { + TouchHandler.allowEvent(e); + } + }; + + + /** + * Delegated click handler for .waves-effect element. + * returns null when .waves-effect element not in "click tree" + */ + function getWavesEffectElement(e) { + if (TouchHandler.allowEvent(e) === false) { + return null; + } + + var element = null; + var target = e.target || e.srcElement; + + while (target.parentNode !== null) { + if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) { + element = target; + break; + } + target = target.parentNode; + } + return element; + } + + /** + * Bubble the click and show effect if .waves-effect elem was found + */ + function showEffect(e) { + var element = getWavesEffectElement(e); + + if (element !== null) { + Effect.show(e, element); + + if ('ontouchstart' in window) { + element.addEventListener('touchend', Effect.hide, false); + element.addEventListener('touchcancel', Effect.hide, false); + } + + element.addEventListener('mouseup', Effect.hide, false); + element.addEventListener('mouseleave', Effect.hide, false); + element.addEventListener('dragend', Effect.hide, false); + } + } + + Waves.displayEffect = function(options) { + options = options || {}; + + if ('duration' in options) { + Effect.duration = options.duration; + } + + //Wrap input inside tag + Effect.wrapInput($$('.waves-effect')); + + if ('ontouchstart' in window) { + document.body.addEventListener('touchstart', showEffect, false); + } + + document.body.addEventListener('mousedown', showEffect, false); + }; + + /** + * Attach Waves to an input element (or any element which doesn't + * bubble mouseup/mousedown events). + * Intended to be used with dynamically loaded forms/inputs, or + * where the user doesn't want a delegated click handler. + */ + Waves.attach = function(element) { + //FUTURE: automatically add waves classes and allow users + // to specify them with an options param? Eg. light/classic/button + if (element.tagName.toLowerCase() === 'input') { + Effect.wrapInput([element]); + element = element.parentNode; + } + + if ('ontouchstart' in window) { + element.addEventListener('touchstart', showEffect, false); + } + + element.addEventListener('mousedown', showEffect, false); + }; + + window.Waves = Waves; + + document.addEventListener('DOMContentLoaded', function() { + Waves.displayEffect(); + }, false); + +})(window); diff --git a/app/dispatch/static/materialize/sass/.sass-cache/219915314f96ba592393ee0f91ebc5ca040988d6/materialize.scssc b/app/dispatch/static/materialize/sass/.sass-cache/219915314f96ba592393ee0f91ebc5ca040988d6/materialize.scssc new file mode 100644 index 0000000..e6019a1 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/219915314f96ba592393ee0f91ebc5ca040988d6/materialize.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_badges.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_badges.scssc new file mode 100644 index 0000000..52d5398 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_badges.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_buttons.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_buttons.scssc new file mode 100644 index 0000000..973967a Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_buttons.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_cards.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_cards.scssc new file mode 100644 index 0000000..41f89d0 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_cards.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_carousel.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_carousel.scssc new file mode 100644 index 0000000..a1b1b0e Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_carousel.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_chips.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_chips.scssc new file mode 100644 index 0000000..4a6b423 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_chips.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_collapsible.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_collapsible.scssc new file mode 100644 index 0000000..2be8526 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_collapsible.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_color.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_color.scssc new file mode 100644 index 0000000..a23f441 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_color.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_dropdown.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_dropdown.scssc new file mode 100644 index 0000000..1801314 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_dropdown.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_global.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_global.scssc new file mode 100644 index 0000000..746886f Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_global.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_grid.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_grid.scssc new file mode 100644 index 0000000..aacd3dc Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_grid.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_icons-material-design.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_icons-material-design.scssc new file mode 100644 index 0000000..72cbc7a Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_icons-material-design.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_materialbox.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_materialbox.scssc new file mode 100644 index 0000000..0fdedbc Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_materialbox.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_modal.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_modal.scssc new file mode 100644 index 0000000..ac1a7a7 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_modal.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_navbar.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_navbar.scssc new file mode 100644 index 0000000..3d2fc63 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_navbar.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_normalize.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_normalize.scssc new file mode 100644 index 0000000..785d767 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_normalize.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_preloader.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_preloader.scssc new file mode 100644 index 0000000..7b0cc05 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_preloader.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_pulse.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_pulse.scssc new file mode 100644 index 0000000..2e1c01d Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_pulse.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_roboto.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_roboto.scssc new file mode 100644 index 0000000..1a21d7e Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_roboto.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_sideNav.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_sideNav.scssc new file mode 100644 index 0000000..0acb5af Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_sideNav.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_slider.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_slider.scssc new file mode 100644 index 0000000..67982c4 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_slider.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_table_of_contents.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_table_of_contents.scssc new file mode 100644 index 0000000..aa18a43 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_table_of_contents.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tabs.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tabs.scssc new file mode 100644 index 0000000..e626372 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tabs.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tapTarget.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tapTarget.scssc new file mode 100644 index 0000000..751bfa7 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tapTarget.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_toast.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_toast.scssc new file mode 100644 index 0000000..b1b9ff8 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_toast.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tooltip.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tooltip.scssc new file mode 100644 index 0000000..e613511 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tooltip.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_transitions.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_transitions.scssc new file mode 100644 index 0000000..7e789b8 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_transitions.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_typography.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_typography.scssc new file mode 100644 index 0000000..f59df2c Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_typography.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_variables.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_variables.scssc new file mode 100644 index 0000000..9cd75cd Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_variables.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_waves.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_waves.scssc new file mode 100644 index 0000000..802d462 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_waves.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_checkboxes.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_checkboxes.scssc new file mode 100644 index 0000000..ec1450f Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_checkboxes.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_file-input.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_file-input.scssc new file mode 100644 index 0000000..f1ced8f Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_file-input.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_forms.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_forms.scssc new file mode 100644 index 0000000..5972264 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_forms.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_input-fields.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_input-fields.scssc new file mode 100644 index 0000000..c8a71bd Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_input-fields.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_radio-buttons.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_radio-buttons.scssc new file mode 100644 index 0000000..9914aa5 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_radio-buttons.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_range.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_range.scssc new file mode 100644 index 0000000..bbe3f8b Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_range.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_select.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_select.scssc new file mode 100644 index 0000000..134a162 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_select.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_switches.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_switches.scssc new file mode 100644 index 0000000..22f59dc Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_switches.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.date.scssc b/app/dispatch/static/materialize/sass/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.date.scssc new file mode 100644 index 0000000..70279c6 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.date.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.scssc b/app/dispatch/static/materialize/sass/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.scssc new file mode 100644 index 0000000..1d1ce58 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.scssc differ diff --git a/app/dispatch/static/materialize/sass/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.time.scssc b/app/dispatch/static/materialize/sass/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.time.scssc new file mode 100644 index 0000000..bdbaf39 Binary files /dev/null and b/app/dispatch/static/materialize/sass/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.time.scssc differ diff --git a/app/dispatch/static/materialize/sass/components/_badges.scss b/app/dispatch/static/materialize/sass/components/_badges.scss new file mode 100644 index 0000000..ed8f185 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_badges.scss @@ -0,0 +1,47 @@ +// Badges +span.badge { + min-width: 3rem; + padding: 0 6px; + margin-left: 14px; + text-align: center; + font-size: 1rem; + line-height: $badge-height; + height: $badge-height; + color: color('grey', 'darken-1'); + float: right; + box-sizing: border-box; + + &.new { + font-weight: 300; + font-size: 0.8rem; + color: #fff; + background-color: $badge-bg-color; + border-radius: 2px; + } + &.new:after { + content: " new"; + } + + &[data-badge-caption]::after { + content: " " attr(data-badge-caption); + } +} +nav ul a span.badge { + display: inline-block; + float: none; + margin-left: 4px; + line-height: $badge-height; + height: $badge-height; + -webkit-font-smoothing: auto; +} + +// Line height centering +.collection-item span.badge { + margin-top: calc(#{$collection-line-height / 2} - #{$badge-height / 2}); +} +.collapsible span.badge { + margin-left: auto; +} +.side-nav span.badge { + margin-top: calc(#{$sidenav-line-height / 2} - #{$badge-height / 2}); +} diff --git a/app/dispatch/static/materialize/sass/components/_buttons.scss b/app/dispatch/static/materialize/sass/components/_buttons.scss new file mode 100644 index 0000000..42730dd --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_buttons.scss @@ -0,0 +1,291 @@ +// shared styles +.btn, +.btn-flat { + border: $button-border; + border-radius: $button-radius; + display: inline-block; + height: $button-height; + line-height: $button-height; + padding: $button-padding; + text-transform: uppercase; + vertical-align: middle; + // Gets rid of tap active state + -webkit-tap-highlight-color: transparent; +} + +// Disabled shared style +.btn.disabled, +.btn-floating.disabled, +.btn-large.disabled, +.btn-flat.disabled, +.btn:disabled, +.btn-floating:disabled, +.btn-large:disabled, +.btn-flat:disabled, +.btn[disabled], +.btn-floating[disabled], +.btn-large[disabled], +.btn-flat[disabled] { + pointer-events: none; + background-color: $button-disabled-background !important; + box-shadow: none; + color: $button-disabled-color !important; + cursor: default; + + &:hover { + background-color: $button-disabled-background !important; + color: $button-disabled-color !important; + } +} + +// Shared icon styles +.btn, +.btn-floating, +.btn-large, +.btn-flat { + font-size: $button-font-size; + outline: 0; + + i { + font-size: $button-icon-font-size; + line-height: inherit; + } +} + +// Shared focus button style +.btn, +.btn-floating { + &:focus { + background-color: darken($button-raised-background, 10%); + } +} + +// Raised Button +.btn { + text-decoration: none; + color: $button-raised-color; + background-color: $button-raised-background; + text-align: center; + letter-spacing: .5px; + @extend .z-depth-1; + transition: .2s ease-out; + cursor: pointer; + + &:hover { + background-color: $button-raised-background-hover; + @extend .z-depth-1-half; + } +} + +// Floating button +.btn-floating { + &:hover { + background-color: $button-floating-background-hover; + @extend .z-depth-1-half; + } + + &:before { + border-radius: 0; + } + + &.btn-large { + &.halfway-fab { + bottom: -$button-floating-large-size / 2; + } + + width: $button-floating-large-size; + height: $button-floating-large-size; + i { + line-height: $button-floating-large-size; + } + } + + &.halfway-fab { + &.left { + right: auto; + left: 24px; + } + + position: absolute; + right: 24px; + bottom: -$button-floating-size / 2; + } + + display: inline-block; + color: $button-floating-color; + position: relative; + overflow: hidden; + z-index: 1; + width: $button-floating-size; + height: $button-floating-size; + line-height: $button-floating-size; + padding: 0; + background-color: $button-floating-background; + border-radius: $button-floating-radius; + @extend .z-depth-1; + transition: .3s; + cursor: pointer; + vertical-align: middle; + + i { + width: inherit; + display: inline-block; + text-align: center; + color: $button-floating-color; + font-size: $button-large-icon-font-size; + line-height: $button-floating-size; + } +} + +// button fix +button.btn-floating { + border: $button-border; +} + +// Fixed Action Button +.fixed-action-btn { + &.active { + ul { + visibility: visible; + } + } + + &.horizontal { + padding: 0 0 0 15px; + + ul { + text-align: right; + right: 64px; + top: 50%; + transform: translateY(-50%); + height: 100%; + left: auto; + width: 500px; /*width 100% only goes to width of button container */ + + li { + display: inline-block; + margin: 15px 15px 0 0; + } + } + } + + &.toolbar { + &.active { + & > a i { + opacity: 0; + } + } + + padding: 0; + height: $button-floating-large-size; + + ul { + display: flex; + top: 0; + bottom: 0; + z-index: 1; + + li { + flex: 1; + display: inline-block; + margin: 0; + height: 100%; + transition: none; + + a { + display: block; + overflow: hidden; + position: relative; + width: 100%; + height: 100%; + background-color: transparent; + box-shadow: none; + color: #fff; + line-height: $button-floating-large-size; + z-index: 1; + + i { + line-height: inherit; + } + } + } + } + } + + position: fixed; + right: 23px; + bottom: 23px; + padding-top: 15px; + margin-bottom: 0; + z-index: 997; + + ul { + left: 0; + right: 0; + text-align: center; + position: absolute; + bottom: 64px; + margin: 0; + visibility: hidden; + + li { + margin-bottom: 15px; + } + + a.btn-floating { + opacity: 0; + } + } + + .fab-backdrop { + position: absolute; + top: 0; + left: 0; + z-index: -1; + width: $button-floating-size; + height: $button-floating-size; + background-color: $button-floating-background; + border-radius: $button-floating-radius; + transform: scale(0); + } +} + +// Flat button +.btn-flat { + box-shadow: none; + background-color: transparent; + color: $button-flat-color; + cursor: pointer; + transition: background-color .2s; + + &:focus, + &:hover { + box-shadow: none; + } + + &:focus { + background-color: rgba(0,0,0,.1); + } + + &.disabled { + background-color: transparent !important; + color: $button-flat-disabled-color !important; + cursor: default; + } +} + +// Large button +.btn-large { + @extend .btn; + height: $button-large-height; + line-height: $button-large-height; + + i { + font-size: $button-large-icon-font-size; + } +} + +// Block button +.btn-block { + display: block; +} diff --git a/app/dispatch/static/materialize/sass/components/_cards.scss b/app/dispatch/static/materialize/sass/components/_cards.scss new file mode 100644 index 0000000..c9b0216 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_cards.scss @@ -0,0 +1,196 @@ + + +.card-panel { + transition: box-shadow .25s; + padding: $card-padding; + margin: $element-top-margin 0 $element-bottom-margin 0; + border-radius: 2px; + @extend .z-depth-1; + background-color: $card-bg-color; +} + +.card { + position: relative; + margin: $element-top-margin 0 $element-bottom-margin 0; + background-color: $card-bg-color; + transition: box-shadow .25s; + border-radius: 2px; + @extend .z-depth-1; + + + .card-title { + font-size: 24px; + font-weight: 300; + &.activator { + cursor: pointer; + } + } + + // Card Sizes + &.small, &.medium, &.large { + position: relative; + + .card-image { + max-height: 60%; + overflow: hidden; + } + .card-image + .card-content { + max-height: 40%; + } + .card-content { + max-height: 100%; + overflow: hidden; + } + .card-action { + position: absolute; + bottom: 0; + left: 0; + right: 0; + } + } + + &.small { + height: 300px; + } + + &.medium { + height: 400px; + } + + &.large { + height: 500px; + } + + // Horizontal Cards + &.horizontal { + &.small, &.medium, &.large { + .card-image { + height: 100%; + max-height: none; + overflow: visible; + + img { + height: 100%; + } + } + } + + display: flex; + + .card-image { + max-width: 50%; + img { + border-radius: 2px 0 0 2px; + max-width: 100%; + width: auto; + } + } + + .card-stacked { + display: flex; + flex-direction: column; + flex: 1; + position: relative; + + .card-content { + flex-grow: 1; + } + } + } + + // Sticky Action Section + &.sticky-action { + .card-action { + z-index: 2; + } + + .card-reveal { + z-index: 1; + padding-bottom: 64px; + } + } + + + + + .card-image { + position: relative; + + // Image background for content + img { + display: block; + border-radius: 2px 2px 0 0; + position: relative; + left: 0; + right: 0; + top: 0; + bottom: 0; + width: 100%; + } + + .card-title { + color: $card-bg-color; + position: absolute; + bottom: 0; + left: 0; + max-width: 100%; + padding: $card-padding; + } + } + + .card-content { + padding: $card-padding; + border-radius: 0 0 2px 2px; + + p { + margin: 0; + color: inherit; + } + .card-title { + display: block; + line-height: 32px; + margin-bottom: 8px; + + i { + line-height: 32px; + } + } + } + + .card-action { + &:last-child { + border-radius: 0 0 2px 2px; + } + position: relative; + background-color: inherit; + border-top: 1px solid rgba(160,160,160,.2); + padding: 16px $card-padding; + + a:not(.btn):not(.btn-large):not(.btn-floating) { + color: $card-link-color; + margin-right: $card-padding; + transition: color .3s ease; + text-transform: uppercase; + + &:hover { color: $card-link-color-light; } + } + } + + .card-reveal { + padding: $card-padding; + position: absolute; + background-color: $card-bg-color; + width: 100%; + overflow-y: auto; + left: 0; + top: 100%; + height: 100%; + z-index: 3; + display: none; + + .card-title { + cursor: pointer; + display: block; + } + } +} diff --git a/app/dispatch/static/materialize/sass/components/_carousel.scss b/app/dispatch/static/materialize/sass/components/_carousel.scss new file mode 100644 index 0000000..fccdc82 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_carousel.scss @@ -0,0 +1,90 @@ +.carousel { + &.carousel-slider { + top: 0; + left: 0; + + .carousel-fixed-item { + &.with-indicators { + bottom: 68px; + } + + position: absolute; + left: 0; + right: 0; + bottom: 20px; + z-index: 1; + } + + .carousel-item { + width: 100%; + height: 100%; + min-height: $carousel-height; + position: absolute; + top: 0; + left: 0; + + h2 { + font-size: 24px; + font-weight: 500; + line-height: 32px; + } + + p { + font-size: 15px; + } + } + } + + overflow: hidden; + position: relative; + width: 100%; + height: $carousel-height; + perspective: 500px; + transform-style: preserve-3d; + transform-origin: 0% 50%; + + .carousel-item { + display: none; + width: $carousel-item-width; + height: $carousel-item-height; + position: absolute; + top: 0; + left: 0; + + & > img { + width: 100%; + } + } + + .indicators { + position: absolute; + text-align: center; + left: 0; + right: 0; + bottom: 0; + margin: 0; + + .indicator-item { + &.active { + background-color: #fff; + } + + display: inline-block; + position: relative; + cursor: pointer; + height: 8px; + width: 8px; + margin: 24px 4px; + background-color: rgba(255,255,255,.5); + + transition: background-color .3s; + border-radius: 50%; + } + } + + // Materialbox compatibility + &.scrolling .carousel-item .materialboxed, + .carousel-item:not(.active) .materialboxed { + pointer-events: none; + } +} diff --git a/app/dispatch/static/materialize/sass/components/_chips.scss b/app/dispatch/static/materialize/sass/components/_chips.scss new file mode 100644 index 0000000..c291578 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_chips.scss @@ -0,0 +1,89 @@ +.chip { + display: inline-block; + height: 32px; + font-size: 13px; + font-weight: 500; + color: rgba(0,0,0,.6); + line-height: 32px; + padding: 0 12px; + border-radius: 16px; + background-color: $chip-bg-color; + margin-bottom: $chip-margin; + margin-right: $chip-margin; + + > img { + float: left; + margin: 0 8px 0 -12px; + height: 32px; + width: 32px; + border-radius: 50%; + } + + .close { + cursor: pointer; + float: right; + font-size: 16px; + line-height: 32px; + padding-left: 8px; + } +} + +.chips { + border: none; + border-bottom: 1px solid $chip-border-color; + box-shadow: none; + margin: $input-margin; + min-height: 45px; + outline: none; + transition: all .3s; + + &.focus { + border-bottom: 1px solid $chip-selected-color; + box-shadow: 0 1px 0 0 $chip-selected-color; + } + + &:hover { + cursor: text; + } + + .chip.selected { + background-color: $chip-selected-color; + color: #fff; + } + + .input { + background: none; + border: 0; + color: rgba(0,0,0,.6); + display: inline-block; + font-size: $input-font-size; + height: $input-height; + line-height: 32px; + outline: 0; + margin: 0; + padding: 0 !important; + width: 120px !important; + } + + .input:focus { + border: 0 !important; + box-shadow: none !important; + } + + // Autocomplete + .autocomplete-content { + margin-top: 0; + margin-bottom: 0; + } +} + +// Form prefix +.prefix ~ .chips { + margin-left: 3rem; + width: 92%; + width: calc(100% - 3rem); +} +.chips:empty ~ label { + font-size: 0.8rem; + transform: translateY(-140%); +} diff --git a/app/dispatch/static/materialize/sass/components/_collapsible.scss b/app/dispatch/static/materialize/sass/components/_collapsible.scss new file mode 100644 index 0000000..ef59d96 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_collapsible.scss @@ -0,0 +1,84 @@ +.collapsible { + border-top: 1px solid $collapsible-border-color; + border-right: 1px solid $collapsible-border-color; + border-left: 1px solid $collapsible-border-color; + margin: $element-top-margin 0 $element-bottom-margin 0; + @extend .z-depth-1; +} + +.collapsible-header { + display: flex; + cursor: pointer; + -webkit-tap-highlight-color: transparent; + line-height: 1.5; + padding: 1rem; + background-color: $collapsible-header-color; + border-bottom: 1px solid $collapsible-border-color; + + i { + width: 2rem; + font-size: 1.6rem; + display: inline-block; + text-align: center; + margin-right: 1rem; + } +} + +.collapsible-body { + display: none; + border-bottom: 1px solid $collapsible-border-color; + box-sizing: border-box; + padding: 2rem; +} + +// sideNav collapsible styling +.side-nav, +.side-nav.fixed { + + .collapsible { + border: none; + box-shadow: none; + + li { padding: 0; } + } + + .collapsible-header { + background-color: transparent; + border: none; + line-height: inherit; + height: inherit; + padding: 0 $sidenav-padding; + + &:hover { background-color: rgba(0,0,0,.05); } + i { line-height: inherit; } + } + + .collapsible-body { + border: 0; + background-color: $collapsible-header-color; + + li a { + padding: 0 (7.5px + $sidenav-padding) + 0 (15px + $sidenav-padding); + } + } + +} + +// Popout Collapsible + +.collapsible.popout { + border: none; + box-shadow: none; + > li { + box-shadow: 0 2px 5px 0 rgba(0, 0, 0, 0.16), 0 2px 10px 0 rgba(0, 0, 0, 0.12); + // transform: scaleX(.92); + margin: 0 24px; + transition: margin .35s cubic-bezier(0.250, 0.460, 0.450, 0.940); + } + > li.active { + box-shadow: 0 5px 11px 0 rgba(0, 0, 0, 0.18), 0 4px 15px 0 rgba(0, 0, 0, 0.15); + margin: 16px 0; + // transform: scaleX(1); + } +} diff --git a/app/dispatch/static/materialize/sass/components/_color.scss b/app/dispatch/static/materialize/sass/components/_color.scss new file mode 100644 index 0000000..bf4b123 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_color.scss @@ -0,0 +1,412 @@ +// Utility Color Classes + +//.success { +// +//} + +// Google Color Palette defined: http://www.google.com/design/spec/style/color.html + + +$materialize-red: ( + "base": #e51c23, + "lighten-5": #fdeaeb, + "lighten-4": #f8c1c3, + "lighten-3": #f3989b, + "lighten-2": #ee6e73, + "lighten-1": #ea454b, + "darken-1": #d0181e, + "darken-2": #b9151b, + "darken-3": #a21318, + "darken-4": #8b1014, +); + +$red: ( + "base": #F44336, + "lighten-5": #FFEBEE, + "lighten-4": #FFCDD2, + "lighten-3": #EF9A9A, + "lighten-2": #E57373, + "lighten-1": #EF5350, + "darken-1": #E53935, + "darken-2": #D32F2F, + "darken-3": #C62828, + "darken-4": #B71C1C, + "accent-1": #FF8A80, + "accent-2": #FF5252, + "accent-3": #FF1744, + "accent-4": #D50000 +); + +$pink: ( + "base": #e91e63, + "lighten-5": #fce4ec, + "lighten-4": #f8bbd0, + "lighten-3": #f48fb1, + "lighten-2": #f06292, + "lighten-1": #ec407a, + "darken-1": #d81b60, + "darken-2": #c2185b, + "darken-3": #ad1457, + "darken-4": #880e4f, + "accent-1": #ff80ab, + "accent-2": #ff4081, + "accent-3": #f50057, + "accent-4": #c51162 +); + +$purple: ( + "base": #9c27b0, + "lighten-5": #f3e5f5, + "lighten-4": #e1bee7, + "lighten-3": #ce93d8, + "lighten-2": #ba68c8, + "lighten-1": #ab47bc, + "darken-1": #8e24aa, + "darken-2": #7b1fa2, + "darken-3": #6a1b9a, + "darken-4": #4a148c, + "accent-1": #ea80fc, + "accent-2": #e040fb, + "accent-3": #d500f9, + "accent-4": #aa00ff +); + +$deep-purple: ( + "base": #673ab7, + "lighten-5": #ede7f6, + "lighten-4": #d1c4e9, + "lighten-3": #b39ddb, + "lighten-2": #9575cd, + "lighten-1": #7e57c2, + "darken-1": #5e35b1, + "darken-2": #512da8, + "darken-3": #4527a0, + "darken-4": #311b92, + "accent-1": #b388ff, + "accent-2": #7c4dff, + "accent-3": #651fff, + "accent-4": #6200ea +); + +$indigo: ( + "base": #3f51b5, + "lighten-5": #e8eaf6, + "lighten-4": #c5cae9, + "lighten-3": #9fa8da, + "lighten-2": #7986cb, + "lighten-1": #5c6bc0, + "darken-1": #3949ab, + "darken-2": #303f9f, + "darken-3": #283593, + "darken-4": #1a237e, + "accent-1": #8c9eff, + "accent-2": #536dfe, + "accent-3": #3d5afe, + "accent-4": #304ffe +); + +$blue: ( + "base": #2196F3, + "lighten-5": #E3F2FD, + "lighten-4": #BBDEFB, + "lighten-3": #90CAF9, + "lighten-2": #64B5F6, + "lighten-1": #42A5F5, + "darken-1": #1E88E5, + "darken-2": #1976D2, + "darken-3": #1565C0, + "darken-4": #0D47A1, + "accent-1": #82B1FF, + "accent-2": #448AFF, + "accent-3": #2979FF, + "accent-4": #2962FF +); + +$light-blue: ( + "base": #03a9f4, + "lighten-5": #e1f5fe, + "lighten-4": #b3e5fc, + "lighten-3": #81d4fa, + "lighten-2": #4fc3f7, + "lighten-1": #29b6f6, + "darken-1": #039be5, + "darken-2": #0288d1, + "darken-3": #0277bd, + "darken-4": #01579b, + "accent-1": #80d8ff, + "accent-2": #40c4ff, + "accent-3": #00b0ff, + "accent-4": #0091ea +); + +$cyan: ( + "base": #00bcd4, + "lighten-5": #e0f7fa, + "lighten-4": #b2ebf2, + "lighten-3": #80deea, + "lighten-2": #4dd0e1, + "lighten-1": #26c6da, + "darken-1": #00acc1, + "darken-2": #0097a7, + "darken-3": #00838f, + "darken-4": #006064, + "accent-1": #84ffff, + "accent-2": #18ffff, + "accent-3": #00e5ff, + "accent-4": #00b8d4 +); + +$teal: ( + "base": #009688, + "lighten-5": #e0f2f1, + "lighten-4": #b2dfdb, + "lighten-3": #80cbc4, + "lighten-2": #4db6ac, + "lighten-1": #26a69a, + "darken-1": #00897b, + "darken-2": #00796b, + "darken-3": #00695c, + "darken-4": #004d40, + "accent-1": #a7ffeb, + "accent-2": #64ffda, + "accent-3": #1de9b6, + "accent-4": #00bfa5 +); + +$green: ( + "base": #4CAF50, + "lighten-5": #E8F5E9, + "lighten-4": #C8E6C9, + "lighten-3": #A5D6A7, + "lighten-2": #81C784, + "lighten-1": #66BB6A, + "darken-1": #43A047, + "darken-2": #388E3C, + "darken-3": #2E7D32, + "darken-4": #1B5E20, + "accent-1": #B9F6CA, + "accent-2": #69F0AE, + "accent-3": #00E676, + "accent-4": #00C853 +); + +$light-green: ( + "base": #8bc34a, + "lighten-5": #f1f8e9, + "lighten-4": #dcedc8, + "lighten-3": #c5e1a5, + "lighten-2": #aed581, + "lighten-1": #9ccc65, + "darken-1": #7cb342, + "darken-2": #689f38, + "darken-3": #558b2f, + "darken-4": #33691e, + "accent-1": #ccff90, + "accent-2": #b2ff59, + "accent-3": #76ff03, + "accent-4": #64dd17 +); + +$lime: ( + "base": #cddc39, + "lighten-5": #f9fbe7, + "lighten-4": #f0f4c3, + "lighten-3": #e6ee9c, + "lighten-2": #dce775, + "lighten-1": #d4e157, + "darken-1": #c0ca33, + "darken-2": #afb42b, + "darken-3": #9e9d24, + "darken-4": #827717, + "accent-1": #f4ff81, + "accent-2": #eeff41, + "accent-3": #c6ff00, + "accent-4": #aeea00 +); + +$yellow: ( + "base": #ffeb3b, + "lighten-5": #fffde7, + "lighten-4": #fff9c4, + "lighten-3": #fff59d, + "lighten-2": #fff176, + "lighten-1": #ffee58, + "darken-1": #fdd835, + "darken-2": #fbc02d, + "darken-3": #f9a825, + "darken-4": #f57f17, + "accent-1": #ffff8d, + "accent-2": #ffff00, + "accent-3": #ffea00, + "accent-4": #ffd600 +); + +$amber: ( + "base": #ffc107, + "lighten-5": #fff8e1, + "lighten-4": #ffecb3, + "lighten-3": #ffe082, + "lighten-2": #ffd54f, + "lighten-1": #ffca28, + "darken-1": #ffb300, + "darken-2": #ffa000, + "darken-3": #ff8f00, + "darken-4": #ff6f00, + "accent-1": #ffe57f, + "accent-2": #ffd740, + "accent-3": #ffc400, + "accent-4": #ffab00 +); + +$orange: ( + "base": #ff9800, + "lighten-5": #fff3e0, + "lighten-4": #ffe0b2, + "lighten-3": #ffcc80, + "lighten-2": #ffb74d, + "lighten-1": #ffa726, + "darken-1": #fb8c00, + "darken-2": #f57c00, + "darken-3": #ef6c00, + "darken-4": #e65100, + "accent-1": #ffd180, + "accent-2": #ffab40, + "accent-3": #ff9100, + "accent-4": #ff6d00 +); + +$deep-orange: ( + "base": #ff5722, + "lighten-5": #fbe9e7, + "lighten-4": #ffccbc, + "lighten-3": #ffab91, + "lighten-2": #ff8a65, + "lighten-1": #ff7043, + "darken-1": #f4511e, + "darken-2": #e64a19, + "darken-3": #d84315, + "darken-4": #bf360c, + "accent-1": #ff9e80, + "accent-2": #ff6e40, + "accent-3": #ff3d00, + "accent-4": #dd2c00 +); + +$brown: ( + "base": #795548, + "lighten-5": #efebe9, + "lighten-4": #d7ccc8, + "lighten-3": #bcaaa4, + "lighten-2": #a1887f, + "lighten-1": #8d6e63, + "darken-1": #6d4c41, + "darken-2": #5d4037, + "darken-3": #4e342e, + "darken-4": #3e2723 +); + +$blue-grey: ( + "base": #607d8b, + "lighten-5": #eceff1, + "lighten-4": #cfd8dc, + "lighten-3": #b0bec5, + "lighten-2": #90a4ae, + "lighten-1": #78909c, + "darken-1": #546e7a, + "darken-2": #455a64, + "darken-3": #37474f, + "darken-4": #263238 +); + +$grey: ( + "base": #9e9e9e, + "lighten-5": #fafafa, + "lighten-4": #f5f5f5, + "lighten-3": #eeeeee, + "lighten-2": #e0e0e0, + "lighten-1": #bdbdbd, + "darken-1": #757575, + "darken-2": #616161, + "darken-3": #424242, + "darken-4": #212121 +); + +$shades: ( + "black": #000000, + "white": #FFFFFF, + "transparent": transparent +); + +$colors: ( + "materialize-red": $materialize-red, + "red": $red, + "pink": $pink, + "purple": $purple, + "deep-purple": $deep-purple, + "indigo": $indigo, + "blue": $blue, + "light-blue": $light-blue, + "cyan": $cyan, + "teal": $teal, + "green": $green, + "light-green": $light-green, + "lime": $lime, + "yellow": $yellow, + "amber": $amber, + "orange": $orange, + "deep-orange": $deep-orange, + "brown": $brown, + "blue-grey": $blue-grey, + "grey": $grey, + "shades": $shades +) !default; + + +// Color Classes + +@each $color_name, $color in $colors { + @each $color_type, $color_value in $color { + @if $color_type == "base" { + .#{$color_name} { + background-color: $color_value !important; + } + .#{$color_name}-text { + color: $color_value !important; + } + } + @else if $color_name != "shades" { + .#{$color_name}.#{$color_type} { + background-color: $color_value !important; + } + .#{$color_name}-text.text-#{$color_type} { + color: $color_value !important; + } + } + } +} + +// Shade classes +@each $color, $color_value in $shades { + .#{$color} { + background-color: $color_value !important; + } + .#{$color}-text { + color: $color_value !important; + } +} + + +// usage: color("name_of_color", "type_of_color") +// to avoid to repeating map-get($colors, ...) + +@function color($color, $type) { + @if map-has-key($colors, $color) { + $curr_color: map-get($colors, $color); + @if map-has-key($curr_color, $type) { + @return map-get($curr_color, $type); + } + } + @warn "Unknown `#{$color}` - `#{$type}` in $colors."; + @return null; +} + diff --git a/app/dispatch/static/materialize/sass/components/_dropdown.scss b/app/dispatch/static/materialize/sass/components/_dropdown.scss new file mode 100644 index 0000000..27131b5 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_dropdown.scss @@ -0,0 +1,68 @@ +.dropdown-content { + @extend .z-depth-1; + background-color: $dropdown-bg-color; + margin: 0; + display: none; + min-width: 100px; + max-height: 650px; + overflow-y: auto; + opacity: 0; + position: absolute; + z-index: 999; + will-change: width, height; + + li { + clear: both; + color: $off-black; + cursor: pointer; + min-height: $dropdown-item-height; + line-height: 1.5rem; + width: 100%; + text-align: left; + text-transform: none; + + &:hover, &.active, &.selected { + background-color: $dropdown-hover-bg-color; + } + + &.active.selected { + background-color: darken($dropdown-hover-bg-color, 5%); + } + + &.divider { + min-height: 0; + height: 1px; + } + + & > a, & > span { + font-size: 16px; + color: $dropdown-color; + display: block; + line-height: 22px; + padding: (($dropdown-item-height - 22) / 2) 16px; + } + + & > span > label { + top: 1px; + left: 0; + height: 18px; + } + + // Icon alignment override + & > a > i { + height: inherit; + line-height: inherit; + float: left; + margin: 0 24px 0 0; + width: 24px; + } + } +} + +// Input field specificity bugfix +.input-field.col .dropdown-content [type="checkbox"] + label { + top: 1px; + left: 0; + height: 18px; +} + diff --git a/app/dispatch/static/materialize/sass/components/_global.scss b/app/dispatch/static/materialize/sass/components/_global.scss new file mode 100644 index 0000000..5a7709f --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_global.scss @@ -0,0 +1,734 @@ +//Default styles + +html { + box-sizing: border-box; +} +*, *:before, *:after { + box-sizing: inherit; +} + +body { + // display: flex; + // min-height: 100vh; + // flex-direction: column; +} + +main { + // flex: 1 0 auto; +} + +ul { + &:not(.browser-default) { + padding-left: 0; + list-style-type: none; + + & > li { + list-style-type: none; + } + } +} + +a { + color: $link-color; + text-decoration: none; + + // Gets rid of tap active state + -webkit-tap-highlight-color: transparent; +} + + +// Positioning +.valign-wrapper { + display: flex; + align-items: center; +} + + +// classic clearfix +.clearfix { + clear: both; +} + + +// Z-levels +.z-depth-0 { + box-shadow: none !important; +} +.z-depth-1 { + box-shadow: 0 2px 2px 0 rgba(0, 0, 0, 0.14), 0 1px 5px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -2px rgba(0, 0, 0, 0.2); +} +.z-depth-1-half { + box-shadow: 0 3px 3px 0 rgba(0, 0, 0, 0.14), 0 1px 7px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -1px rgba(0, 0, 0, 0.2); +} +.z-depth-2 { + box-shadow: 0 4px 5px 0 rgba(0, 0, 0, 0.14), 0 1px 10px 0 rgba(0, 0, 0, 0.12), 0 2px 4px -1px rgba(0, 0, 0, 0.3); +} +.z-depth-3 { + box-shadow: 0 6px 10px 0 rgba(0, 0, 0, 0.14), 0 1px 18px 0 rgba(0, 0, 0, 0.12), 0 3px 5px -1px rgba(0, 0, 0, 0.3); +} +.z-depth-4 { + box-shadow: 0 8px 10px 1px rgba(0, 0, 0, 0.14), 0 3px 14px 2px rgba(0, 0, 0, 0.12), 0 5px 5px -3px rgba(0, 0, 0, 0.3); +} +.z-depth-5 { + box-shadow: 0 16px 24px 2px rgba(0, 0, 0, 0.14), 0 6px 30px 5px rgba(0, 0, 0, 0.12), 0 8px 10px -5px rgba(0, 0, 0, 0.3); +} + +.hoverable { + transition: box-shadow .25s; + + &:hover { + box-shadow: 0 8px 17px 0 rgba(0, 0, 0, 0.2), 0 6px 20px 0 rgba(0, 0, 0, 0.19); + } +} + +// Dividers + +.divider { + height: 1px; + overflow: hidden; + background-color: color("grey", "lighten-2"); +} + + +// Blockquote + +blockquote { + margin: 20px 0; + padding-left: 1.5rem; + border-left: 5px solid $primary-color; +} + +// Icon Styles + +i { + line-height: inherit; + + &.left { + float: left; + margin-right: 15px; + } + &.right { + float: right; + margin-left: 15px; + } + &.tiny { + font-size: 1rem; + } + &.small { + font-size: 2rem; + } + &.medium { + font-size: 4rem; + } + &.large { + font-size: 6rem; + } +} + +// Images +img.responsive-img, +video.responsive-video { + max-width: 100%; + height: auto; +} + + +// Pagination + +.pagination { + + li { + display: inline-block; + border-radius: 2px; + text-align: center; + vertical-align: top; + height: 30px; + + a { + color: #444; + display: inline-block; + font-size: 1.2rem; + padding: 0 10px; + line-height: 30px; + } + + &.active a { color: #fff; } + + &.active { background-color: $primary-color; } + + &.disabled a { + cursor: default; + color: #999; + } + + i { + font-size: 2rem; + } + } + + + li.pages ul li { + display: inline-block; + float: none; + } +} +@media #{$medium-and-down} { + .pagination { + width: 100%; + + li.prev, + li.next { + width: 10%; + } + + li.pages { + width: 80%; + overflow: hidden; + white-space: nowrap; + } + } +} + +// Breadcrumbs +.breadcrumb { + font-size: 18px; + color: rgba(255,255,255, .7); + + i, + [class^="mdi-"], [class*="mdi-"], + i.material-icons { + display: inline-block; + float: left; + font-size: 24px; + } + + &:before { + content: '\E5CC'; + color: rgba(255,255,255, .7); + vertical-align: top; + display: inline-block; + font-family: 'Material Icons'; + font-weight: normal; + font-style: normal; + font-size: 25px; + margin: 0 10px 0 8px; + -webkit-font-smoothing: antialiased; + } + + &:first-child:before { + display: none; + } + + &:last-child { + color: #fff; + } +} + +// Parallax +.parallax-container { + position: relative; + overflow: hidden; + height: 500px; + + .parallax { + position: absolute; + top: 0; + left: 0; + right: 0; + bottom: 0; + z-index: -1; + + img { + display: none; + position: absolute; + left: 50%; + bottom: 0; + min-width: 100%; + min-height: 100%; + transform: translate3d(0,0,0); + transform: translateX(-50%); + } + } +} + +// Pushpin +.pin-top, .pin-bottom { + position: relative; +} +.pinned { + position: fixed !important; +} + +/********************* + Transition Classes +**********************/ + +ul.staggered-list li { + opacity: 0; +} + +.fade-in { + opacity: 0; + transform-origin: 0 50%; +} + + +/********************* + Media Query Classes +**********************/ +.hide-on-small-only, .hide-on-small-and-down { + @media #{$small-and-down} { + display: none !important; + } +} +.hide-on-med-and-down { + @media #{$medium-and-down} { + display: none !important; + } +} +.hide-on-med-and-up { + @media #{$medium-and-up} { + display: none !important; + } +} +.hide-on-med-only { + @media only screen and (min-width: $small-screen) and (max-width: $medium-screen) { + display: none !important; + } +} +.hide-on-large-only { + @media #{$large-and-up} { + display: none !important; + } +} +.show-on-large { + @media #{$large-and-up} { + display: block !important; + } +} +.show-on-medium { + @media only screen and (min-width: $small-screen) and (max-width: $medium-screen) { + display: block !important; + } +} +.show-on-small { + @media #{$small-and-down} { + display: block !important; + } +} +.show-on-medium-and-up { + @media #{$medium-and-up} { + display: block !important; + } +} +.show-on-medium-and-down { + @media #{$medium-and-down} { + display: block !important; + } +} + + +// Center text on mobile +.center-on-small-only { + @media #{$small-and-down} { + text-align: center; + } +} + +// Footer +.page-footer { + padding-top: 20px; + color: $footer-font-color; + background-color: $footer-bg-color; + + .footer-copyright { + overflow: hidden; + min-height: 50px; + display: flex; + align-items: center; + padding: 10px 0px; + color: $footer-copyright-font-color; + background-color: $footer-copyright-bg-color; + @extend .light; + } +} + +// Tables +table, th, td { + border: none; +} + +table { + width:100%; + display: table; + + &.bordered > thead > tr, + &.bordered > tbody > tr { + border-bottom: 1px solid $table-border-color; + } + + &.striped > tbody { + > tr:nth-child(odd) { + background-color: $table-striped-color; + } + + > tr > td { + border-radius: 0; + } + } + + &.highlight > tbody > tr { + transition: background-color .25s ease; + &:hover { + background-color: $table-striped-color; + } + } + + &.centered { + thead tr th, tbody tr td { + text-align: center; + } + } + +} + +thead { + border-bottom: 1px solid $table-border-color; +} + +td, th{ + padding: 15px 5px; + display: table-cell; + text-align: left; + vertical-align: middle; + border-radius: 2px; +} + +// Responsive Table +@media #{$medium-and-down} { + + table.responsive-table { + width: 100%; + border-collapse: collapse; + border-spacing: 0; + display: block; + position: relative; + + td:empty:before { + content: '\00a0'; + } + + th, + td { + margin: 0; + vertical-align: top; + } + + th { text-align: left; } + thead { + display: block; + float: left; + + tr { + display: block; + padding: 0 10px 0 0; + + th::before { + content: "\00a0"; + } + } + } + tbody { + display: block; + width: auto; + position: relative; + overflow-x: auto; + white-space: nowrap; + + tr { + display: inline-block; + vertical-align: top; + } + } + th { + display: block; + text-align: right; + } + td { + display: block; + min-height: 1.25em; + text-align: left; + } + tr { padding: 0 10px; } + + /* sort out borders */ + thead { + border: 0; + border-right: 1px solid $table-border-color; + } + + &.bordered { + th { border-bottom: 0; border-left: 0; } + td { border-left: 0; border-right: 0; border-bottom: 0; } + tr { border: 0; } + tbody tr { border-right: 1px solid $table-border-color; } + } + + } + +} + + +// Collections +.collection { + margin: $element-top-margin 0 $element-bottom-margin 0; + border: 1px solid $collection-border-color; + border-radius: 2px; + overflow: hidden; + position: relative; + + .collection-item { + background-color: $collection-bg-color; + line-height: $collection-line-height; + padding: 10px 20px; + margin: 0; + border-bottom: 1px solid $collection-border-color; + + // Avatar Collection + &.avatar { + min-height: 84px; + padding-left: 72px; + position: relative; + + // Don't style circles inside preloader classes. + &:not(.circle-clipper) > .circle, + :not(.circle-clipper) > .circle { + position: absolute; + width: 42px; + height: 42px; + overflow: hidden; + left: 15px; + display: inline-block; + vertical-align: middle; + } + i.circle { + font-size: 18px; + line-height: 42px; + color: #fff; + background-color: #999; + text-align: center; + } + + + .title { + font-size: 16px; + } + + p { + margin: 0; + } + + .secondary-content { + position: absolute; + top: 16px; + right: 16px; + } + + } + + + &:last-child { + border-bottom: none; + } + + &.active { + background-color: $collection-active-bg-color; + color: $collection-active-color; + + .secondary-content { + color: #fff; + } + } + } + a.collection-item{ + display: block; + transition: .25s; + color: $collection-link-color; + &:not(.active) { + &:hover { + background-color: $collection-hover-bg-color; + } + } + } + + &.with-header { + .collection-header { + background-color: $collection-bg-color; + border-bottom: 1px solid $collection-border-color; + padding: 10px 20px; + } + .collection-item { + padding-left: 30px; + } + .collection-item.avatar { + padding-left: 72px; + } + } + +} +// Made less specific to allow easier overriding +.secondary-content { + float: right; + color: $secondary-color; +} +.collapsible .collection { + margin: 0; + border: none; +} + + + +// Responsive Videos +.video-container { + position: relative; + padding-bottom: 56.25%; + height: 0; + overflow: hidden; + + iframe, object, embed { + position: absolute; + top: 0; + left: 0; + width: 100%; + height: 100%; + } +} + +// Progress Bar +.progress { + position: relative; + height: 4px; + display: block; + width: 100%; + background-color: lighten($progress-bar-color, 40%); + border-radius: 2px; + margin: $element-top-margin 0 $element-bottom-margin 0; + overflow: hidden; + .determinate { + position: absolute; + top: 0; + left: 0; + bottom: 0; + background-color: $progress-bar-color; + transition: width .3s linear; + } + .indeterminate { + background-color: $progress-bar-color; + &:before { + content: ''; + position: absolute; + background-color: inherit; + top: 0; + left:0; + bottom: 0; + will-change: left, right; + // Custom bezier + animation: indeterminate 2.1s cubic-bezier(0.650, 0.815, 0.735, 0.395) infinite; + + } + &:after { + content: ''; + position: absolute; + background-color: inherit; + top: 0; + left:0; + bottom: 0; + will-change: left, right; + // Custom bezier + animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.840, 0.440, 1.000) infinite; + animation-delay: 1.15s; + } + } +} +@keyframes indeterminate { + 0% { + left: -35%; + right:100%; + } + 60% { + left: 100%; + right: -90%; + } + 100% { + left: 100%; + right: -90%; + } +} + +@keyframes indeterminate-short { + 0% { + left: -200%; + right: 100%; + } + 60% { + left: 107%; + right: -8%; + } + 100% { + left: 107%; + right: -8%; + } +} + + +/******************* + Utility Classes +*******************/ + +.hide { + display: none !important; +} + +// Text Align +.left-align { + text-align: left; +} +.right-align { + text-align: right +} +.center, .center-align { + text-align: center; +} + +.left { + float: left !important; +} +.right { + float: right !important; +} + +// No Text Select +.no-select { + user-select: none; +} + +.circle { + border-radius: 50%; +} + +.center-block { + display: block; + margin-left: auto; + margin-right: auto; +} + +.truncate { + display: block; + white-space: nowrap; + overflow: hidden; + text-overflow: ellipsis; +} + +.no-padding { + padding: 0 !important; +} diff --git a/app/dispatch/static/materialize/sass/components/_grid.scss b/app/dispatch/static/materialize/sass/components/_grid.scss new file mode 100644 index 0000000..7aa9e8f --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_grid.scss @@ -0,0 +1,156 @@ +.container { + margin: 0 auto; + max-width: 1280px; + width: 90%; +} +@media #{$medium-and-up} { + .container { + width: 85%; + } +} +@media #{$large-and-up} { + .container { + width: 70%; + } +} +.container .row { + margin-left: (-1 * $gutter-width / 2); + margin-right: (-1 * $gutter-width / 2); +} + +.section { + padding-top: 1rem; + padding-bottom: 1rem; + + &.no-pad { + padding: 0; + } + &.no-pad-bot { + padding-bottom: 0; + } + &.no-pad-top { + padding-top: 0; + } +} + + +// Mixins to eliminate code repitition +@mixin reset-offset { + margin-left: auto; + left: auto; + right: auto; +} +@mixin grid-classes($size, $i, $perc) { + &.offset-#{$size}#{$i} { + margin-left: $perc; + } + &.pull-#{$size}#{$i} { + right: $perc; + } + &.push-#{$size}#{$i} { + left: $perc; + } +} + + +.row { + margin-left: auto; + margin-right: auto; + margin-bottom: 20px; + + // Clear floating children + &:after { + content: ""; + display: table; + clear: both; + } + + .col { + float: left; + box-sizing: border-box; + padding: 0 $gutter-width / 2; + min-height: 1px; + + &[class*="push-"], + &[class*="pull-"] { + position: relative; + } + + $i: 1; + @while $i <= $num-cols { + $perc: unquote((100 / ($num-cols / $i)) + "%"); + &.s#{$i} { + width: $perc; + @include reset-offset; + } + $i: $i + 1; + } + + $i: 1; + @while $i <= $num-cols { + $perc: unquote((100 / ($num-cols / $i)) + "%"); + @include grid-classes("s", $i, $perc); + $i: $i + 1; + } + + @media #{$medium-and-up} { + + $i: 1; + @while $i <= $num-cols { + $perc: unquote((100 / ($num-cols / $i)) + "%"); + &.m#{$i} { + width: $perc; + @include reset-offset; + } + $i: $i + 1 + } + + $i: 1; + @while $i <= $num-cols { + $perc: unquote((100 / ($num-cols / $i)) + "%"); + @include grid-classes("m", $i, $perc); + $i: $i + 1; + } + } + + @media #{$large-and-up} { + + $i: 1; + @while $i <= $num-cols { + $perc: unquote((100 / ($num-cols / $i)) + "%"); + &.l#{$i} { + width: $perc; + @include reset-offset; + } + $i: $i + 1; + } + + $i: 1; + @while $i <= $num-cols { + $perc: unquote((100 / ($num-cols / $i)) + "%"); + @include grid-classes("l", $i, $perc); + $i: $i + 1; + } + } + + @media #{$extra-large-and-up} { + + $i: 1; + @while $i <= $num-cols { + $perc: unquote((100 / ($num-cols / $i)) + "%"); + &.xl#{$i} { + width: $perc; + @include reset-offset; + } + $i: $i + 1; + } + + $i: 1; + @while $i <= $num-cols { + $perc: unquote((100 / ($num-cols / $i)) + "%"); + @include grid-classes("xl", $i, $perc); + $i: $i + 1; + } + } + } +} diff --git a/app/dispatch/static/materialize/sass/components/_icons-material-design.scss b/app/dispatch/static/materialize/sass/components/_icons-material-design.scss new file mode 100644 index 0000000..2aa6a4a --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_icons-material-design.scss @@ -0,0 +1,5 @@ +/* This is needed for some mobile phones to display the Google Icon font properly */ +.material-icons { + text-rendering: optimizeLegibility; + font-feature-settings: 'liga'; +} diff --git a/app/dispatch/static/materialize/sass/components/_materialbox.scss b/app/dispatch/static/materialize/sass/components/_materialbox.scss new file mode 100644 index 0000000..3027667 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_materialbox.scss @@ -0,0 +1,43 @@ +.materialboxed { + &:hover { + &:not(.active) { + opacity: .8; + } + } + + display: block; + cursor: zoom-in; + position: relative; + transition: opacity .4s; + -webkit-backface-visibility: hidden; + + &.active { + cursor: zoom-out; + } +} + +#materialbox-overlay { + position:fixed; + top: 0; + right: 0; + bottom: 0; + left: 0; + background-color: #292929; + z-index: 1000; + will-change: opacity; +} + +.materialbox-caption { + position: fixed; + display: none; + color: #fff; + line-height: 50px; + bottom: 0; + left: 0; + width: 100%; + text-align: center; + padding: 0% 15%; + height: 50px; + z-index: 1000; + -webkit-font-smoothing: antialiased; +} \ No newline at end of file diff --git a/app/dispatch/static/materialize/sass/components/_modal.scss b/app/dispatch/static/materialize/sass/components/_modal.scss new file mode 100644 index 0000000..82445b4 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_modal.scss @@ -0,0 +1,90 @@ +.modal { + @extend .z-depth-4; + + display: none; + position: fixed; + left: 0; + right: 0; + background-color: #fafafa; + padding: 0; + max-height: 70%; + width: 55%; + margin: auto; + overflow-y: auto; + + border-radius: 2px; + will-change: top, opacity; + + @media #{$medium-and-down} { + width: 80%; + } + + h1,h2,h3,h4 { + margin-top: 0; + } + + .modal-content { + padding: 24px; + } + .modal-close { + cursor: pointer; + } + + .modal-footer { + border-radius: 0 0 2px 2px; + background-color: #fafafa; + padding: 4px 6px; + height: 56px; + width: 100%; + text-align: right; + + .btn, .btn-flat { + margin: 6px 0; + } + } +} +.modal-overlay { + position: fixed; + z-index: 999; + top: -25%; + left: 0; + bottom: 0; + right: 0; + height: 125%; + width: 100%; + background: #000; + display: none; + + will-change: opacity; +} + +// Modal with fixed action footer +.modal.modal-fixed-footer { + padding: 0; + height: 70%; + + .modal-content { + position: absolute; + height: calc(100% - 56px); + max-height: 100%; + width: 100%; + overflow-y: auto; + } + + .modal-footer { + border-top: 1px solid rgba(0,0,0,.1); + position: absolute; + bottom: 0; + } +} + +// Modal Bottom Sheet Style +.modal.bottom-sheet { + top: auto; + bottom: -100%; + margin: 0; + width: 100%; + max-height: 45%; + border-radius: 0; + will-change: bottom, opacity; +} diff --git a/app/dispatch/static/materialize/sass/components/_navbar.scss b/app/dispatch/static/materialize/sass/components/_navbar.scss new file mode 100644 index 0000000..d6fb2f1 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_navbar.scss @@ -0,0 +1,208 @@ +nav { + &.nav-extended { + height: auto; + + .nav-wrapper { + min-height: $navbar-height-mobile; + height: auto; + } + + .nav-content { + position: relative; + line-height: normal; + } + } + + color: $navbar-font-color; + @extend .z-depth-1; + background-color: $primary-color; + width: 100%; + height: $navbar-height-mobile; + line-height: $navbar-line-height-mobile; + + a { color: $navbar-font-color; } + + i, + [class^="mdi-"], [class*="mdi-"], + i.material-icons { + display: block; + font-size: 24px; + height: $navbar-height-mobile; + line-height: $navbar-line-height-mobile; + } + + .nav-wrapper { + position: relative; + height: 100%; + } + + @media #{$large-and-up} { + a.button-collapse { display: none; } + } + + + // Collapse button + .button-collapse { + float: left; + position: relative; + z-index: 1; + height: $navbar-height-mobile; + margin: 0 18px; + + i { + height: $navbar-height-mobile; + line-height: $navbar-line-height-mobile; + } + } + + + // Logo + .brand-logo { + position: absolute; + color: $navbar-font-color; + display: inline-block; + font-size: $navbar-brand-font-size; + padding: 0; + + &.center { + left: 50%; + transform: translateX(-50%); + } + + @media #{$medium-and-down} { + left: 50%; + transform: translateX(-50%); + + &.left, &.right { + padding: 0; + transform: none; + } + + &.left { left: 0.5rem; } + &.right { + right: 0.5rem; + left: auto; + } + } + + &.right { + right: 0.5rem; + padding: 0; + } + + i, + [class^="mdi-"], [class*="mdi-"], + i.material-icons { + float: left; + margin-right: 15px; + } + } + + + // Title + .nav-title { + display: inline-block; + font-size: 32px; + padding: 28px 0; + } + + + // Navbar Links + ul { + margin: 0; + + li { + transition: background-color .3s; + float: left; + padding: 0; + + &.active { + background-color: rgba(0,0,0,.1); + } + } + a { + transition: background-color .3s; + font-size: $navbar-font-size; + color: $navbar-font-color; + display: block; + padding: 0 15px; + cursor: pointer; + + &.btn, &.btn-large, &.btn-flat, &.btn-floating { + margin-top: -2px; + margin-left: 15px; + margin-right: 15px; + + & > .material-icons { + height: inherit; + line-height: inherit; + } + } + + &:hover { + background-color: rgba(0,0,0,.1); + } + } + + &.left { + float: left; + } + } + + // Navbar Search Form + form { + height: 100%; + } + + .input-field { + margin: 0; + height: 100%; + + input { + height: 100%; + font-size: 1.2rem; + border: none; + padding-left: 2rem; + + &:focus, &[type=text]:valid, &[type=password]:valid, + &[type=email]:valid, &[type=url]:valid, &[type=date]:valid { + border: none; + box-shadow: none; + } + } + + label { + top: 0; + left: 0; + + i { + color: rgba(255,255,255,.7); + transition: color .3s; + } + &.active i { color: $navbar-font-color; } + } + } +} + +// Fixed Navbar +.navbar-fixed { + position: relative; + height: $navbar-height-mobile; + z-index: 997; + + nav { + position: fixed; + } +} +@media #{$medium-and-up} { + nav.nav-extended .nav-wrapper { + min-height: $navbar-height; + } + nav, nav .nav-wrapper i, nav a.button-collapse, nav a.button-collapse i { + height: $navbar-height; + line-height: $navbar-line-height; + } + .navbar-fixed { + height: $navbar-height; + } +} diff --git a/app/dispatch/static/materialize/sass/components/_normalize.scss b/app/dispatch/static/materialize/sass/components/_normalize.scss new file mode 100644 index 0000000..d6d3c19 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_normalize.scss @@ -0,0 +1,424 @@ +/*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */ + +/** + * 1. Set default font family to sans-serif. + * 2. Prevent iOS and IE text size adjust after device orientation change, + * without disabling user zoom. + */ + +html { + font-family: sans-serif; /* 1 */ + -ms-text-size-adjust: 100%; /* 2 */ + -webkit-text-size-adjust: 100%; /* 2 */ +} + +/** + * Remove default margin. + */ + +body { + margin: 0; +} + +/* HTML5 display definitions + ========================================================================== */ + +/** + * Correct `block` display not defined for any HTML5 element in IE 8/9. + * Correct `block` display not defined for `details` or `summary` in IE 10/11 + * and Firefox. + * Correct `block` display not defined for `main` in IE 11. + */ + +article, +aside, +details, +figcaption, +figure, +footer, +header, +hgroup, +main, +menu, +nav, +section, +summary { + display: block; +} + +/** + * 1. Correct `inline-block` display not defined in IE 8/9. + * 2. Normalize vertical alignment of `progress` in Chrome, Firefox, and Opera. + */ + +audio, +canvas, +progress, +video { + display: inline-block; /* 1 */ + vertical-align: baseline; /* 2 */ +} + +/** + * Prevent modern browsers from displaying `audio` without controls. + * Remove excess height in iOS 5 devices. + */ + +audio:not([controls]) { + display: none; + height: 0; +} + +/** + * Address `[hidden]` styling not present in IE 8/9/10. + * Hide the `template` element in IE 8/9/10/11, Safari, and Firefox < 22. + */ + +[hidden], +template { + display: none; +} + +/* Links + ========================================================================== */ + +/** + * Remove the gray background color from active links in IE 10. + */ + +a { + background-color: transparent; +} + +/** + * Improve readability of focused elements when they are also in an + * active/hover state. + */ + +a:active, +a:hover { + outline: 0; +} + +/* Text-level semantics + ========================================================================== */ + +/** + * Address styling not present in IE 8/9/10/11, Safari, and Chrome. + */ + +abbr[title] { + border-bottom: 1px dotted; +} + +/** + * Address style set to `bolder` in Firefox 4+, Safari, and Chrome. + */ + +b, +strong { + font-weight: bold; +} + +/** + * Address styling not present in Safari and Chrome. + */ + +dfn { + font-style: italic; +} + +/** + * Address variable `h1` font-size and margin within `section` and `article` + * contexts in Firefox 4+, Safari, and Chrome. + */ + +h1 { + font-size: 2em; + margin: 0.67em 0; +} + +/** + * Address styling not present in IE 8/9. + */ + +mark { + background: #ff0; + color: #000; +} + +/** + * Address inconsistent and variable font size in all browsers. + */ + +small { + font-size: 80%; +} + +/** + * Prevent `sub` and `sup` affecting `line-height` in all browsers. + */ + +sub, +sup { + font-size: 75%; + line-height: 0; + position: relative; + vertical-align: baseline; +} + +sup { + top: -0.5em; +} + +sub { + bottom: -0.25em; +} + +/* Embedded content + ========================================================================== */ + +/** + * Remove border when inside `a` element in IE 8/9/10. + */ + +img { + border: 0; +} + +/** + * Correct overflow not hidden in IE 9/10/11. + */ + +svg:not(:root) { + overflow: hidden; +} + +/* Grouping content + ========================================================================== */ + +/** + * Address margin not present in IE 8/9 and Safari. + */ + +figure { + margin: 1em 40px; +} + +/** + * Address differences between Firefox and other browsers. + */ + +hr { + box-sizing: content-box; + height: 0; +} + +/** + * Contain overflow in all browsers. + */ + +pre { + overflow: auto; +} + +/** + * Address odd `em`-unit font size rendering in all browsers. + */ + +code, +kbd, +pre, +samp { + font-family: monospace, monospace; + font-size: 1em; +} + +/* Forms + ========================================================================== */ + +/** + * Known limitation: by default, Chrome and Safari on OS X allow very limited + * styling of `select`, unless a `border` property is set. + */ + +/** + * 1. Correct color not being inherited. + * Known issue: affects color of disabled elements. + * 2. Correct font properties not being inherited. + * 3. Address margins set differently in Firefox 4+, Safari, and Chrome. + */ + +button, +input, +optgroup, +select, +textarea { + color: inherit; /* 1 */ + font: inherit; /* 2 */ + margin: 0; /* 3 */ +} + +/** + * Address `overflow` set to `hidden` in IE 8/9/10/11. + */ + +button { + overflow: visible; +} + +/** + * Address inconsistent `text-transform` inheritance for `button` and `select`. + * All other form control elements do not inherit `text-transform` values. + * Correct `button` style inheritance in Firefox, IE 8/9/10/11, and Opera. + * Correct `select` style inheritance in Firefox. + */ + +button, +select { + text-transform: none; +} + +/** + * 1. Avoid the WebKit bug in Android 4.0.* where (2) destroys native `audio` + * and `video` controls. + * 2. Correct inability to style clickable `input` types in iOS. + * 3. Improve usability and consistency of cursor style between image-type + * `input` and others. + */ + +button, +html input[type="button"], /* 1 */ +input[type="reset"], +input[type="submit"] { + -webkit-appearance: button; /* 2 */ + cursor: pointer; /* 3 */ +} + +/** + * Re-set default cursor for disabled elements. + */ + +button[disabled], +html input[disabled] { + cursor: default; +} + +/** + * Remove inner padding and border in Firefox 4+. + */ + +button::-moz-focus-inner, +input::-moz-focus-inner { + border: 0; + padding: 0; +} + +/** + * Address Firefox 4+ setting `line-height` on `input` using `!important` in + * the UA stylesheet. + */ + +input { + line-height: normal; +} + +/** + * It's recommended that you don't attempt to style these elements. + * Firefox's implementation doesn't respect box-sizing, padding, or width. + * + * 1. Address box sizing set to `content-box` in IE 8/9/10. + * 2. Remove excess padding in IE 8/9/10. + */ + +input[type="checkbox"], +input[type="radio"] { + box-sizing: border-box; /* 1 */ + padding: 0; /* 2 */ +} + +/** + * Fix the cursor style for Chrome's increment/decrement buttons. For certain + * `font-size` values of the `input`, it causes the cursor style of the + * decrement button to change from `default` to `text`. + */ + +input[type="number"]::-webkit-inner-spin-button, +input[type="number"]::-webkit-outer-spin-button { + height: auto; +} + +/** + * 1. Address `appearance` set to `searchfield` in Safari and Chrome. + * 2. Address `box-sizing` set to `border-box` in Safari and Chrome. + */ + +input[type="search"] { + -webkit-appearance: textfield; /* 1 */ + box-sizing: content-box; /* 2 */ +} + +/** + * Remove inner padding and search cancel button in Safari and Chrome on OS X. + * Safari (but not Chrome) clips the cancel button when the search input has + * padding (and `textfield` appearance). + */ + +input[type="search"]::-webkit-search-cancel-button, +input[type="search"]::-webkit-search-decoration { + -webkit-appearance: none; +} + +/** + * Define consistent border, margin, and padding. + */ + +fieldset { + border: 1px solid #c0c0c0; + margin: 0 2px; + padding: 0.35em 0.625em 0.75em; +} + +/** + * 1. Correct `color` not being inherited in IE 8/9/10/11. + * 2. Remove padding so people aren't caught out if they zero out fieldsets. + */ + +legend { + border: 0; /* 1 */ + padding: 0; /* 2 */ +} + +/** + * Remove default vertical scrollbar in IE 8/9/10/11. + */ + +textarea { + overflow: auto; +} + +/** + * Don't inherit the `font-weight` (applied by a rule above). + * NOTE: the default cannot safely be changed in Chrome and Safari on OS X. + */ + +optgroup { + font-weight: bold; +} + +/* Tables + ========================================================================== */ + +/** + * Remove most spacing between table cells. + */ + +table { + border-collapse: collapse; + border-spacing: 0; +} + +td, +th { + padding: 0; +} diff --git a/app/dispatch/static/materialize/sass/components/_preloader.scss b/app/dispatch/static/materialize/sass/components/_preloader.scss new file mode 100644 index 0000000..cfe2993 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_preloader.scss @@ -0,0 +1,334 @@ +/* + @license + Copyright (c) 2014 The Polymer Project Authors. All rights reserved. + This code may only be used under the BSD style license found at http://polymer.github.io/LICENSE.txt + The complete set of authors may be found at http://polymer.github.io/AUTHORS.txt + The complete set of contributors may be found at http://polymer.github.io/CONTRIBUTORS.txt + Code distributed by Google as part of the polymer project is also + subject to an additional IP rights grant found at http://polymer.github.io/PATENTS.txt + */ + +/**************************/ +/* STYLES FOR THE SPINNER */ +/**************************/ + +/* + * Constants: + * STROKEWIDTH = 3px + * ARCSIZE = 270 degrees (amount of circle the arc takes up) + * ARCTIME = 1333ms (time it takes to expand and contract arc) + * ARCSTARTROT = 216 degrees (how much the start location of the arc + * should rotate each time, 216 gives us a + * 5 pointed star shape (it's 360/5 * 3). + * For a 7 pointed star, we might do + * 360/7 * 3 = 154.286) + * CONTAINERWIDTH = 28px + * SHRINK_TIME = 400ms + */ + + +.preloader-wrapper { + display: inline-block; + position: relative; + width: 50px; + height: 50px; + + &.small { + width: 36px; + height: 36px; + } + + &.big { + width: 64px; + height: 64px; + } + + &.active { + /* duration: 360 * ARCTIME / (ARCSTARTROT + (360-ARCSIZE)) */ + -webkit-animation: container-rotate 1568ms linear infinite; + animation: container-rotate 1568ms linear infinite; + } +} + +@-webkit-keyframes container-rotate { + to { -webkit-transform: rotate(360deg) } +} + +@keyframes container-rotate { + to { transform: rotate(360deg) } +} + +.spinner-layer { + position: absolute; + width: 100%; + height: 100%; + opacity: 0; + border-color: $spinner-default-color; +} + +.spinner-blue, +.spinner-blue-only { + border-color: #4285f4; +} + +.spinner-red, +.spinner-red-only { + border-color: #db4437; +} + +.spinner-yellow, +.spinner-yellow-only { + border-color: #f4b400; +} + +.spinner-green, +.spinner-green-only { + border-color: #0f9d58; +} + +/** + * IMPORTANT NOTE ABOUT CSS ANIMATION PROPERTIES (keanulee): + * + * iOS Safari (tested on iOS 8.1) does not handle animation-delay very well - it doesn't + * guarantee that the animation will start _exactly_ after that value. So we avoid using + * animation-delay and instead set custom keyframes for each color (as redundant as it + * seems). + * + * We write out each animation in full (instead of separating animation-name, + * animation-duration, etc.) because under the polyfill, Safari does not recognize those + * specific properties properly, treats them as -webkit-animation, and overrides the + * other animation rules. See https://github.com/Polymer/platform/issues/53. + */ +.active .spinner-layer.spinner-blue { + /* durations: 4 * ARCTIME */ + -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both, blue-fade-in-out 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both; + animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both, blue-fade-in-out 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both; +} + +.active .spinner-layer.spinner-red { + /* durations: 4 * ARCTIME */ + -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both, red-fade-in-out 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both; + animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both, red-fade-in-out 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both; +} + +.active .spinner-layer.spinner-yellow { + /* durations: 4 * ARCTIME */ + -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both, yellow-fade-in-out 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both; + animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both, yellow-fade-in-out 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both; +} + +.active .spinner-layer.spinner-green { + /* durations: 4 * ARCTIME */ + -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both, green-fade-in-out 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both; + animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both, green-fade-in-out 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both; +} + +.active .spinner-layer, +.active .spinner-layer.spinner-blue-only, +.active .spinner-layer.spinner-red-only, +.active .spinner-layer.spinner-yellow-only, +.active .spinner-layer.spinner-green-only { + /* durations: 4 * ARCTIME */ + opacity: 1; + -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both; + animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both; +} + +@-webkit-keyframes fill-unfill-rotate { + 12.5% { -webkit-transform: rotate(135deg); } /* 0.5 * ARCSIZE */ + 25% { -webkit-transform: rotate(270deg); } /* 1 * ARCSIZE */ + 37.5% { -webkit-transform: rotate(405deg); } /* 1.5 * ARCSIZE */ + 50% { -webkit-transform: rotate(540deg); } /* 2 * ARCSIZE */ + 62.5% { -webkit-transform: rotate(675deg); } /* 2.5 * ARCSIZE */ + 75% { -webkit-transform: rotate(810deg); } /* 3 * ARCSIZE */ + 87.5% { -webkit-transform: rotate(945deg); } /* 3.5 * ARCSIZE */ + to { -webkit-transform: rotate(1080deg); } /* 4 * ARCSIZE */ +} + +@keyframes fill-unfill-rotate { + 12.5% { transform: rotate(135deg); } /* 0.5 * ARCSIZE */ + 25% { transform: rotate(270deg); } /* 1 * ARCSIZE */ + 37.5% { transform: rotate(405deg); } /* 1.5 * ARCSIZE */ + 50% { transform: rotate(540deg); } /* 2 * ARCSIZE */ + 62.5% { transform: rotate(675deg); } /* 2.5 * ARCSIZE */ + 75% { transform: rotate(810deg); } /* 3 * ARCSIZE */ + 87.5% { transform: rotate(945deg); } /* 3.5 * ARCSIZE */ + to { transform: rotate(1080deg); } /* 4 * ARCSIZE */ +} + +@-webkit-keyframes blue-fade-in-out { + from { opacity: 1; } + 25% { opacity: 1; } + 26% { opacity: 0; } + 89% { opacity: 0; } + 90% { opacity: 1; } + 100% { opacity: 1; } +} + +@keyframes blue-fade-in-out { + from { opacity: 1; } + 25% { opacity: 1; } + 26% { opacity: 0; } + 89% { opacity: 0; } + 90% { opacity: 1; } + 100% { opacity: 1; } +} + +@-webkit-keyframes red-fade-in-out { + from { opacity: 0; } + 15% { opacity: 0; } + 25% { opacity: 1; } + 50% { opacity: 1; } + 51% { opacity: 0; } +} + +@keyframes red-fade-in-out { + from { opacity: 0; } + 15% { opacity: 0; } + 25% { opacity: 1; } + 50% { opacity: 1; } + 51% { opacity: 0; } +} + +@-webkit-keyframes yellow-fade-in-out { + from { opacity: 0; } + 40% { opacity: 0; } + 50% { opacity: 1; } + 75% { opacity: 1; } + 76% { opacity: 0; } +} + +@keyframes yellow-fade-in-out { + from { opacity: 0; } + 40% { opacity: 0; } + 50% { opacity: 1; } + 75% { opacity: 1; } + 76% { opacity: 0; } +} + +@-webkit-keyframes green-fade-in-out { + from { opacity: 0; } + 65% { opacity: 0; } + 75% { opacity: 1; } + 90% { opacity: 1; } + 100% { opacity: 0; } +} + +@keyframes green-fade-in-out { + from { opacity: 0; } + 65% { opacity: 0; } + 75% { opacity: 1; } + 90% { opacity: 1; } + 100% { opacity: 0; } +} + +/** + * Patch the gap that appear between the two adjacent div.circle-clipper while the + * spinner is rotating (appears on Chrome 38, Safari 7.1, and IE 11). + */ +.gap-patch { + position: absolute; + top: 0; + left: 45%; + width: 10%; + height: 100%; + overflow: hidden; + border-color: inherit; +} + +.gap-patch .circle { + width: 1000%; + left: -450%; +} + +.circle-clipper { + display: inline-block; + position: relative; + width: 50%; + height: 100%; + overflow: hidden; + border-color: inherit; + + .circle { + width: 200%; + height: 100%; + border-width: 3px; /* STROKEWIDTH */ + border-style: solid; + border-color: inherit; + border-bottom-color: transparent !important; + border-radius: 50%; + -webkit-animation: none; + animation: none; + position: absolute; + top: 0; + right: 0; + bottom: 0; + } + + &.left .circle { + left: 0; + border-right-color: transparent !important; + -webkit-transform: rotate(129deg); + transform: rotate(129deg); + } + &.right .circle { + left: -100%; + border-left-color: transparent !important; + -webkit-transform: rotate(-129deg); + transform: rotate(-129deg); + } +} + + + +.active .circle-clipper.left .circle { + /* duration: ARCTIME */ + -webkit-animation: left-spin 1333ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both; + animation: left-spin 1333ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both; +} + +.active .circle-clipper.right .circle { + /* duration: ARCTIME */ + -webkit-animation: right-spin 1333ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both; + animation: right-spin 1333ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both; +} + +@-webkit-keyframes left-spin { + from { -webkit-transform: rotate(130deg); } + 50% { -webkit-transform: rotate(-5deg); } + to { -webkit-transform: rotate(130deg); } +} + +@keyframes left-spin { + from { transform: rotate(130deg); } + 50% { transform: rotate(-5deg); } + to { transform: rotate(130deg); } +} + +@-webkit-keyframes right-spin { + from { -webkit-transform: rotate(-130deg); } + 50% { -webkit-transform: rotate(5deg); } + to { -webkit-transform: rotate(-130deg); } +} + +@keyframes right-spin { + from { transform: rotate(-130deg); } + 50% { transform: rotate(5deg); } + to { transform: rotate(-130deg); } +} + +#spinnerContainer.cooldown { + /* duration: SHRINK_TIME */ + -webkit-animation: container-rotate 1568ms linear infinite, fade-out 400ms cubic-bezier(0.4, 0.0, 0.2, 1); + animation: container-rotate 1568ms linear infinite, fade-out 400ms cubic-bezier(0.4, 0.0, 0.2, 1); +} + +@-webkit-keyframes fade-out { + from { opacity: 1; } + to { opacity: 0; } +} + +@keyframes fade-out { + from { opacity: 1; } + to { opacity: 0; } +} diff --git a/app/dispatch/static/materialize/sass/components/_pulse.scss b/app/dispatch/static/materialize/sass/components/_pulse.scss new file mode 100644 index 0000000..a3b7d9f --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_pulse.scss @@ -0,0 +1,34 @@ +.pulse { + &::before { + content: ''; + display: block; + position: absolute; + width: 100%; + height: 100%; + top: 0; + left: 0; + background-color: inherit; + border-radius: inherit; + transition: opacity .3s, transform .3s; + animation: pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite; + z-index: -1; + } + + overflow: initial; + position: relative; +} + +@keyframes pulse-animation { + 0% { + opacity: 1; + transform: scale(1); + } + 50% { + opacity: 0; + transform: scale(1.5); + } + 100% { + opacity: 0; + transform: scale(1.5); + } +} diff --git a/app/dispatch/static/materialize/sass/components/_roboto.scss b/app/dispatch/static/materialize/sass/components/_roboto.scss new file mode 100644 index 0000000..a4ec3cb --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_roboto.scss @@ -0,0 +1,39 @@ +@font-face { + font-family: "Roboto"; + src: local(Roboto Thin), + url("#{$roboto-font-path}Roboto-Thin.woff2") format("woff2"), + url("#{$roboto-font-path}Roboto-Thin.woff") format("woff"); + + font-weight: 100; +} +@font-face { + font-family: "Roboto"; + src: local(Roboto Light), + url("#{$roboto-font-path}Roboto-Light.woff2") format("woff2"), + url("#{$roboto-font-path}Roboto-Light.woff") format("woff"); + font-weight: 300; +} + +@font-face { + font-family: "Roboto"; + src: local(Roboto Regular), + url("#{$roboto-font-path}Roboto-Regular.woff2") format("woff2"), + url("#{$roboto-font-path}Roboto-Regular.woff") format("woff"); + font-weight: 400; +} + +@font-face { + font-family: "Roboto"; + src: local(Roboto Medium), + url("#{$roboto-font-path}Roboto-Medium.woff2") format("woff2"), + url("#{$roboto-font-path}Roboto-Medium.woff") format("woff"); + font-weight: 500; +} + +@font-face { + font-family: "Roboto"; + src: local(Roboto Bold), + url("#{$roboto-font-path}Roboto-Bold.woff2") format("woff2"), + url("#{$roboto-font-path}Roboto-Bold.woff") format("woff"); + font-weight: 700; +} diff --git a/app/dispatch/static/materialize/sass/components/_sideNav.scss b/app/dispatch/static/materialize/sass/components/_sideNav.scss new file mode 100644 index 0000000..051e1f3 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_sideNav.scss @@ -0,0 +1,214 @@ +.side-nav { + position: fixed; + width: 300px; + left: 0; + top: 0; + margin: 0; + transform: translateX(-100%); + height: 100%; + height: calc(100% + 60px); + height: -moz-calc(100%); //Temporary Firefox Fix + padding-bottom: 60px; + background-color: $sidenav-bg-color; + z-index: 999; + overflow-y: auto; + will-change: transform; + backface-visibility: hidden; + transform: translateX(-105%); + + @extend .z-depth-1; + + // Right Align + &.right-aligned { + right: 0; + transform: translateX(105%); + left: auto; + transform: translateX(100%); + } + + .collapsible { + margin: 0; + } + + + li { + float: none; + line-height: $sidenav-line-height; + + &.active { background-color: rgba(0,0,0,.05); } + } + + li > a { + color: $sidenav-font-color; + display: block; + font-size: $sidenav-font-size; + font-weight: 500; + height: $sidenav-item-height; + line-height: $sidenav-line-height; + padding: 0 ($sidenav-padding * 2); + + &:hover { background-color: rgba(0,0,0,.05);} + + &.btn, &.btn-large, &.btn-flat, &.btn-floating { + margin: 10px 15px; + } + + &.btn, + &.btn-large, + &.btn-floating { color: $button-raised-color; } + &.btn-flat { color: $button-flat-color; } + + &.btn:hover, + &.btn-large:hover { background-color: lighten($button-raised-background, 5%); } + &.btn-floating:hover { background-color: $button-raised-background; } + + & > i, + & > [class^="mdi-"], li > a > [class*="mdi-"], + & > i.material-icons { + float: left; + height: $sidenav-item-height; + line-height: $sidenav-line-height; + margin: 0 ($sidenav-padding * 2) 0 0; + width: $sidenav-item-height / 2; + color: rgba(0,0,0,.54); + } + } + + + .divider { + margin: ($sidenav-padding / 2) 0 0 0; + } + + .subheader { + &:hover { + background-color: transparent; + } + + cursor: initial; + pointer-events: none; + color: rgba(0,0,0,.54); + font-size: $sidenav-font-size; + font-weight: 500; + line-height: $sidenav-line-height; + } + + .user-view, + .userView { + position: relative; + padding: ($sidenav-padding * 2) ($sidenav-padding * 2) 0; + margin-bottom: $sidenav-padding / 2; + + & > a { + &:hover { background-color: transparent; } + height: auto; + padding: 0; + } + + .background { + overflow: hidden; + position: absolute; + top: 0; + right: 0; + bottom: 0; + left: 0; + z-index: -1; + } + + .circle, .name, .email { + display: block; + } + + .circle { + height: 64px; + width: 64px; + } + + .name, + .email { + font-size: $sidenav-font-size; + line-height: $sidenav-line-height / 2; + } + + .name { + margin-top: 16px; + font-weight: 500; + } + + .email { + padding-bottom: 16px; + font-weight: 400; + } + } +} + + +// Touch interaction +.drag-target { + height: 100%; + width: 10px; + position: fixed; + top: 0; + z-index: 998; +} + + +// Fixed side-nav shown +.side-nav.fixed { + left: 0; + transform: translateX(0); + position: fixed; + + // Right Align + &.right-aligned { + right: 0; + left: auto; + } +} + +// Fixed sideNav hide on smaller +@media #{$medium-and-down} { + .side-nav { + &.fixed { + transform: translateX(-105%); + + &.right-aligned { + transform: translateX(105%); + } + } + + a { + padding: 0 $sidenav-padding; + } + + .user-view, + .userView { + padding: $sidenav-padding $sidenav-padding 0; + } + } +} + + +.side-nav .collapsible-body > ul:not(.collapsible) > li.active, +.side-nav.fixed .collapsible-body > ul:not(.collapsible) > li.active { + background-color: $primary-color; + a { + color: $sidenav-bg-color; + } +} +.side-nav .collapsible-body { + padding: 0; +} + + +#sidenav-overlay { + position: fixed; + top: 0; + left: 0; + right: 0; + + height: 120vh; + background-color: rgba(0,0,0,.5); + z-index: 997; + + will-change: opacity; +} diff --git a/app/dispatch/static/materialize/sass/components/_slider.scss b/app/dispatch/static/materialize/sass/components/_slider.scss new file mode 100644 index 0000000..5d7c27e --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_slider.scss @@ -0,0 +1,92 @@ +.slider { + position: relative; + height: 400px; + width: 100%; + + // Fullscreen slider + &.fullscreen { + height: 100%; + width: 100%; + position: absolute; + top: 0; + left: 0; + right: 0; + bottom: 0; + + ul.slides { + height: 100%; + } + + ul.indicators { + z-index: 2; + bottom: 30px; + } + } + + .slides { + background-color: $slider-bg-color; + margin: 0; + height: 400px; + + li { + opacity: 0; + position: absolute; + top: 0; + left: 0; + z-index: 1; + width: 100%; + height: inherit; + overflow: hidden; + + img { + height: 100%; + width: 100%; + background-size: cover; + background-position: center; + } + + .caption { + color: #fff; + position: absolute; + top: 15%; + left: 15%; + width: 70%; + opacity: 0; + + p { color: $slider-bg-color-light; } + } + + &.active { + z-index: 2; + } + } + } + + + .indicators { + position: absolute; + text-align: center; + left: 0; + right: 0; + bottom: 0; + margin: 0; + + .indicator-item { + display: inline-block; + position: relative; + cursor: pointer; + height: 16px; + width: 16px; + margin: 0 12px; + background-color: $slider-bg-color-light; + + transition: background-color .3s; + border-radius: 50%; + + &.active { + background-color: $slider-indicator-color; + } + } + } + +} \ No newline at end of file diff --git a/app/dispatch/static/materialize/sass/components/_table_of_contents.scss b/app/dispatch/static/materialize/sass/components/_table_of_contents.scss new file mode 100644 index 0000000..dde6090 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_table_of_contents.scss @@ -0,0 +1,33 @@ +/*************** + Nav List +***************/ +.table-of-contents { + &.fixed { + position: fixed; + } + + li { + padding: 2px 0; + } + a { + display: inline-block; + font-weight: 300; + color: #757575; + padding-left: 20px; + height: 1.5rem; + line-height: 1.5rem; + letter-spacing: .4; + display: inline-block; + + &:hover { + color: lighten(#757575, 20%); + padding-left: 19px; + border-left: 1px solid $primary-color; + } + &.active { + font-weight: 500; + padding-left: 18px; + border-left: 2px solid $primary-color; + } + } +} diff --git a/app/dispatch/static/materialize/sass/components/_tabs.scss b/app/dispatch/static/materialize/sass/components/_tabs.scss new file mode 100644 index 0000000..5a1a459 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_tabs.scss @@ -0,0 +1,93 @@ +.tabs { + &.tabs-transparent { + background-color: transparent; + + .tab a, + .tab.disabled a, + .tab.disabled a:hover { + color: rgba(255,255,255,0.7); + } + + .tab a:hover, + .tab a.active { + color: #fff; + } + + .indicator { + background-color: #fff; + } + } + + &.tabs-fixed-width { + display: flex; + + .tab { + flex-grow: 1; + } + } + + position: relative; + overflow-x: auto; + overflow-y: hidden; + height: 48px; + width: 100%; + background-color: $tabs-bg-color; + margin: 0 auto; + white-space: nowrap; + + .tab { + display: inline-block; + text-align: center; + line-height: 48px; + height: 48px; + padding: 0; + margin: 0; + text-transform: uppercase; + + a { + &:hover, + &.active { + background-color: transparent; + color: $tabs-text-color; + } + + color: rgba($tabs-text-color, .7); + display: block; + width: 100%; + height: 100%; + padding: 0 24px; + font-size: 14px; + text-overflow: ellipsis; + overflow: hidden; + transition: color .28s ease; + } + + &.disabled a, + &.disabled a:hover { + color: rgba($tabs-text-color, .7); + cursor: default; + } + } + .indicator { + position: absolute; + bottom: 0; + height: 2px; + background-color: $tabs-underline-color; + will-change: left, right; + } +} + +// Fixed sideNav hide on smaller +@media #{$medium-and-down} { + .tabs { + display: flex; + + .tab { + flex-grow: 1; + + a { + padding: 0 12px; + } + } + } +} diff --git a/app/dispatch/static/materialize/sass/components/_tapTarget.scss b/app/dispatch/static/materialize/sass/components/_tapTarget.scss new file mode 100644 index 0000000..49aecd5 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_tapTarget.scss @@ -0,0 +1,103 @@ +.tap-target-wrapper { + width: 800px; + height: 800px; + position: fixed; + z-index: 1000; + visibility: hidden; + transition: visibility 0s .3s; +} + +.tap-target-wrapper.open { + visibility: visible; + transition: visibility 0s; + + .tap-target { + transform: scale(1); + opacity: .95; + transition: + transform .3s cubic-bezier(.42,0,.58,1), + opacity .3s cubic-bezier(.42,0,.58,1); + } + + .tap-target-wave::before { + transform: scale(1); + } + .tap-target-wave::after { + visibility: visible; + animation: pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite; + transition: + opacity .3s, + transform .3s, + visibility 0s 1s; + } +} + +.tap-target { + position: absolute; + font-size: 1rem; + border-radius: 50%; + background-color: $primary-color; + box-shadow: 0 20px 20px 0 rgba(0,0,0,0.14), 0 10px 50px 0 rgba(0,0,0,0.12), 0 30px 10px -20px rgba(0,0,0,0.2); + width: 100%; + height: 100%; + opacity: 0; + transform: scale(0); + transition: + transform .3s cubic-bezier(.42,0,.58,1), + opacity .3s cubic-bezier(.42,0,.58,1); +} + +.tap-target-content { + position: relative; + display: table-cell; +} + +.tap-target-wave { + &::before, + &::after { + content: ''; + display: block; + position: absolute; + width: 100%; + height: 100%; + border-radius: 50%; + background-color: #ffffff; + } + &::before { + transform: scale(0); + transition: transform .3s; + } + &::after { + visibility: hidden; + transition: + opacity .3s, + transform .3s, + visibility 0s; + z-index: -1; + } + + position: absolute; + border-radius: 50%; + z-index: 10001; +} + +.tap-target-origin { + &:not(.btn), + &:not(.btn):hover { + background: none; + } + + top: 50%; + left: 50%; + transform: translate(-50%,-50%); + + z-index: 10002; + position: absolute !important; +} + +@media only screen and (max-width: 600px) { + .tap-target, .tap-target-wrapper { + width: 600px; + height: 600px; + } +} diff --git a/app/dispatch/static/materialize/sass/components/_toast.scss b/app/dispatch/static/materialize/sass/components/_toast.scss new file mode 100644 index 0000000..3772d44 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_toast.scss @@ -0,0 +1,59 @@ +#toast-container { + display:block; + position: fixed; + z-index: 10000; + + @media #{$small-and-down} { + min-width: 100%; + bottom: 0%; + } + @media #{$medium-only} { + left: 5%; + bottom: 7%; + max-width: 90%; + } + @media #{$large-and-up} { + top: 10%; + right: 7%; + max-width: 86%; + } +} + +.toast { + @extend .z-depth-1; + border-radius: 2px; + top: 35px; + width: auto; + margin-top: 10px; + position: relative; + max-width:100%; + height: auto; + min-height: $toast-height; + line-height: 1.5em; + word-break: break-all; + background-color: $toast-color; + padding: 10px 25px; + font-size: 1.1rem; + font-weight: 300; + color: $toast-text-color; + display: flex; + align-items: center; + justify-content: space-between; + cursor: default; + + .toast-action { + color: $toast-action-color; + font-weight: 500; + margin-right: -25px; + margin-left: 3rem; + } + + &.rounded{ + border-radius: 24px; + } + + @media #{$small-and-down} { + width: 100%; + border-radius: 0; + } +} diff --git a/app/dispatch/static/materialize/sass/components/_tooltip.scss b/app/dispatch/static/materialize/sass/components/_tooltip.scss new file mode 100644 index 0000000..21ea6a7 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_tooltip.scss @@ -0,0 +1,31 @@ +.material-tooltip { + padding: 10px 8px; + font-size: 1rem; + z-index: 2000; + background-color: transparent; + border-radius: 2px; + color: #fff; + min-height: 36px; + line-height: 120%; + opacity: 0; + position: absolute; + text-align: center; + max-width: calc(100% - 4px); + overflow: hidden; + left: 0; + top: 0; + pointer-events: none; + visibility: hidden; +} + +.backdrop { + position: absolute; + opacity: 0; + height: 7px; + width: 14px; + border-radius: 0 0 50% 50%; + background-color: #323232; + z-index: -1; + transform-origin: 50% 0%; + visibility: hidden; +} diff --git a/app/dispatch/static/materialize/sass/components/_transitions.scss b/app/dispatch/static/materialize/sass/components/_transitions.scss new file mode 100644 index 0000000..cb9f60d --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_transitions.scss @@ -0,0 +1,13 @@ +// Scale transition +.scale-transition { + &.scale-out { + transform: scale(0); + transition: transform .2s !important; + } + + &.scale-in { + transform: scale(1); + } + + transition: transform .3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important; +} \ No newline at end of file diff --git a/app/dispatch/static/materialize/sass/components/_typography.scss b/app/dispatch/static/materialize/sass/components/_typography.scss new file mode 100644 index 0000000..a773afd --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_typography.scss @@ -0,0 +1,61 @@ + +a { + text-decoration: none; +} + +html{ + line-height: 1.5; + + @media only screen and (min-width: 0) { + font-size: 14px; + } + + @media only screen and (min-width: $medium-screen) { + font-size: 14.5px; + } + + @media only screen and (min-width: $large-screen) { + font-size: 15px; + } + + font-family: "Roboto", sans-serif; + font-weight: normal; + color: $off-black; +} +h1, h2, h3, h4, h5, h6 { + font-weight: 400; + line-height: 1.1; +} + +// Header Styles +h1 a, h2 a, h3 a, h4 a, h5 a, h6 a { font-weight: inherit; } +h1 { font-size: $h1-fontsize; line-height: 110%; margin: ($h1-fontsize / 2) 0 ($h1-fontsize / 2.5) 0;} +h2 { font-size: $h2-fontsize; line-height: 110%; margin: ($h2-fontsize / 2) 0 ($h2-fontsize / 2.5) 0;} +h3 { font-size: $h3-fontsize; line-height: 110%; margin: ($h3-fontsize / 2) 0 ($h3-fontsize / 2.5) 0;} +h4 { font-size: $h4-fontsize; line-height: 110%; margin: ($h4-fontsize / 2) 0 ($h4-fontsize / 2.5) 0;} +h5 { font-size: $h5-fontsize; line-height: 110%; margin: ($h5-fontsize / 2) 0 ($h5-fontsize / 2.5) 0;} +h6 { font-size: $h6-fontsize; line-height: 110%; margin: ($h6-fontsize / 2) 0 ($h6-fontsize / 2.5) 0;} + +// Text Styles +em { font-style: italic; } +strong { font-weight: 500; } +small { font-size: 75%; } +.light { font-weight: 300; } +.thin { font-weight: 200; } + + +.flow-text{ + font-weight: 300; + $i: 0; + @while $i <= $intervals { + @media only screen and (min-width : 360 + ($i * $interval-size)) { + font-size: 1.2rem * (1 + (.02 * $i)); + } + $i: $i + 1; + } + + // Handle below 360px screen + @media only screen and (max-width: 360px) { + font-size: 1.2rem; + } +} \ No newline at end of file diff --git a/app/dispatch/static/materialize/sass/components/_variables.scss b/app/dispatch/static/materialize/sass/components/_variables.scss new file mode 100644 index 0000000..297191a --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_variables.scss @@ -0,0 +1,353 @@ +// ========================================================================== +// Materialize variables +// ========================================================================== +// +// Table of Contents: +// +// 1. Colors +// 2. Badges +// 3. Buttons +// 4. Cards +// 5. Carousel +// 6. Collapsible +// 7. Chips +// 8. Date + Time Picker +// 9. Dropdown +// 10. Fonts +// 11. Forms +// 12. Global +// 13. Grid +// 14. Navigation Bar +// 15. Side Navigation +// 16. Photo Slider +// 17. Spinners | Loaders +// 18. Tabs +// 19. Tables +// 20. Toasts +// 21. Typography +// 22. Footer +// 23. Flow Text +// 24. Collections +// 25. Progress Bar + + + +// 1. Colors +// ========================================================================== + +$primary-color: color("materialize-red", "lighten-2") !default; +$primary-color-light: lighten($primary-color, 15%) !default; +$primary-color-dark: darken($primary-color, 15%) !default; + +$secondary-color: color("teal", "lighten-1") !default; +$success-color: color("green", "base") !default; +$error-color: color("red", "base") !default; +$link-color: color("light-blue", "darken-1") !default; + + +// 2. Badges +// ========================================================================== + +$badge-bg-color: $secondary-color !default; +$badge-height: 22px !default; + + +// 3. Buttons +// ========================================================================== + +// Shared styles +$button-border: none !default; +$button-background-focus: lighten($secondary-color, 4%) !default; +$button-font-size: 1rem !default; +$button-icon-font-size: 1.3rem !default; +$button-height: 36px !default; +$button-padding: 0 2rem !default; +$button-radius: 2px !default; + +// Disabled styles +$button-disabled-background: #DFDFDF !default; +$button-disabled-color: #9F9F9F !default; + +// Raised buttons +$button-raised-background: $secondary-color !default; +$button-raised-background-hover: lighten($button-raised-background, 5%) !default; +$button-raised-color: #fff !default; + +// Large buttons +$button-large-icon-font-size: 1.6rem !default; +$button-large-height: $button-height * 1.5 !default; + +// Flat buttons +$button-flat-color: #343434 !default; +$button-flat-disabled-color: lighten(#999, 10%) !default; + +// Floating buttons +$button-floating-background: $secondary-color !default; +$button-floating-background-hover: $button-floating-background !default; +$button-floating-color: #fff !default; +$button-floating-size: 40px !default; +$button-floating-large-size: 56px !default; +$button-floating-radius: 50% !default; + + +// 4. Cards +// ========================================================================== + +$card-padding: 24px !default; +$card-bg-color: #fff !default; +$card-link-color: color("orange", "accent-2") !default; +$card-link-color-light: lighten($card-link-color, 20%) !default; + + +// 5. Carousel +// ========================================================================== + +$carousel-height: 400px !default; +$carousel-item-height: $carousel-height / 2 !default; +$carousel-item-width: $carousel-item-height !default; + + +// 6. Collapsible +// ========================================================================== + +$collapsible-height: 3rem !default; +$collapsible-line-height: $collapsible-height !default; +$collapsible-header-color: #fff !default; +$collapsible-border-color: #ddd !default; + + +// 7. Chips +// ========================================================================== + +$chip-bg-color: #e4e4e4 !default; +$chip-border-color: #9e9e9e !default; +$chip-selected-color: #26a69a !default; +$chip-margin: 5px !default; + + +// 8. Date + Time Picker +// ========================================================================== + +$datepicker-display-font-size: 2.8rem; +$datepicker-weekday-color: rgba(0, 0, 0, .87) !default; +$datepicker-weekday-bg: darken($secondary-color, 7%) !default; +$datepicker-date-bg: $secondary-color !default; +$datepicker-year: rgba(255, 255, 255, .7) !default; +$datepicker-focus: rgba(0,0,0, .05) !default; +$datepicker-selected: $secondary-color !default; +$datepicker-selected-outfocus: desaturate(lighten($secondary-color, 35%), 15%) !default; + +$timepicker-clock-color: rgba(0, 0, 0, .87) !default; +$timepicker-clock-plate-bg: #eee; + + +// 9. Dropdown +// ========================================================================== + +$dropdown-bg-color: #fff !default; +$dropdown-hover-bg-color: #eee !default; +$dropdown-color: $secondary-color !default; +$dropdown-item-height: 50px !default; + + +// 10. Fonts +// ========================================================================== + +$roboto-font-path: "../fonts/roboto/" !default; + + +// 11. Forms +// ========================================================================== + +// Text Inputs + Textarea +$input-height: 3rem !default; +$input-border-color: color("grey", "base") !default; +$input-border: 1px solid $input-border-color !default; +$input-background: #fff !default; +$input-error-color: $error-color !default; +$input-success-color: $success-color !default; +$input-focus-color: $secondary-color !default; +$input-font-size: 1rem !default; +$input-margin-bottom: 20px; +$input-margin: 0 0 $input-margin-bottom 0 !default; +$input-padding: 0 !default; +$input-transition: all .3s !default; +$label-font-size: .8rem !default; +$input-disabled-color: rgba(0,0,0, .42) !default; +$input-disabled-solid-color: #949494 !default; +$input-disabled-border: 1px dotted $input-disabled-color !default; +$input-invalid-border: 1px solid $input-error-color !default; +$placeholder-text-color: lighten($input-border-color, 20%) !default; + +// Radio Buttons +$radio-fill-color: $secondary-color !default; +$radio-empty-color: #5a5a5a !default; +$radio-border: 2px solid $radio-fill-color !default; + +// Range +$range-height: 14px !default; +$range-width: 14px !default; +$track-height: 3px !default; + +// Select +$select-border: 1px solid #f2f2f2 !default; +$select-background: rgba(255, 255, 255, 0.90) !default; +$select-focus: 1px solid lighten($secondary-color, 47%) !default; +$select-option-hover: rgba(0,0,0,.06) !default; +$select-option-focus: rgba(0,0,0,.03) !default; +$select-padding: 5px !default; +$select-radius: 2px !default; +$select-disabled-color: rgba(0,0,0,.3) !default; + +// Switches +$switch-bg-color: $secondary-color !default; +$switch-checked-lever-bg: desaturate(lighten($switch-bg-color, 25%), 25%) !default; +$switch-unchecked-bg: #F1F1F1 !default; +$switch-unchecked-lever-bg: rgba(0,0,0,.38) !default; +$switch-radius: 15px !default; + + +// 12. Global +// ========================================================================== + +// Media Query Ranges +$small-screen-up: 601px !default; +$medium-screen-up: 993px !default; +$large-screen-up: 1201px !default; +$small-screen: 600px !default; +$medium-screen: 992px !default; +$large-screen: 1200px !default; + +/* +$medium-and-up: "only screen and (min-width : #{$small-screen-up})" !default; +$large-and-up: "only screen and (min-width : #{$medium-screen-up})" !default; +$extra-large-and-up: "only screen and (min-width : #{$large-screen-up})" !default; +$small-and-down: "only screen and (max-width : #{$small-screen})" !default; +$medium-and-down: "only screen and (max-width : #{$medium-screen})" !default; +$medium-only: "only screen and (min-width : #{$small-screen-up}) and (max-width : #{$medium-screen})" !default; +*/ + +$medium-and-up: "(min-width : #{$small-screen-up})" !default; +$large-and-up: "(min-width : #{$medium-screen-up})" !default; +$extra-large-and-up: "(min-width : #{$large-screen-up})" !default; +$small-and-down: "(max-width : #{$small-screen})" !default; +$medium-and-down: "(max-width : #{$medium-screen})" !default; +$medium-only: "(min-width : #{$small-screen-up}) and (max-width : #{$medium-screen})" !default; + + + +// 13. Grid +// ========================================================================== + +$num-cols: 12 !default; +$gutter-width: 1.5rem !default; +$element-top-margin: $gutter-width/3 !default; +$element-bottom-margin: ($gutter-width*2)/3 !default; + + +// 14. Navigation Bar +// ========================================================================== + +$navbar-height: 64px !default; +$navbar-line-height: $navbar-height !default; +$navbar-height-mobile: 56px !default; +$navbar-line-height-mobile: $navbar-height-mobile !default; +$navbar-font-size: 1rem !default; +$navbar-font-color: #fff !default; +$navbar-brand-font-size: 2.1rem !default; + +// 15. Side Navigation +// ========================================================================== + +$sidenav-font-size: 14px !default; +$sidenav-font-color: rgba(0,0,0,.87) !default; +$sidenav-bg-color: #fff !default; +$sidenav-padding: 16px !default; +$sidenav-item-height: 48px !default; +$sidenav-line-height: $sidenav-item-height !default; + + +// 16. Photo Slider +// ========================================================================== + +$slider-bg-color: color('grey', 'base') !default; +$slider-bg-color-light: color('grey', 'lighten-2') !default; +$slider-indicator-color: color('green', 'base') !default; + + +// 17. Spinners | Loaders +// ========================================================================== + +$spinner-default-color: $secondary-color !default; + + +// 18. Tabs +// ========================================================================== + +$tabs-underline-color: $primary-color-light !default; +$tabs-text-color: $primary-color !default; +$tabs-bg-color: #fff !default; + + +// 19. Tables +// ========================================================================== + +$table-border-color: #d0d0d0 !default; +$table-striped-color: #f2f2f2 !default; + + +// 20. Toasts +// ========================================================================== + +$toast-height: 48px !default; +$toast-color: #323232 !default; +$toast-text-color: #fff !default; +$toast-action-color: #eeff41; + + +// 21. Typography +// ========================================================================== + +$off-black: rgba(0, 0, 0, 0.87) !default; +// Header Styles +$h1-fontsize: 4.2rem !default; +$h2-fontsize: 3.56rem !default; +$h3-fontsize: 2.92rem !default; +$h4-fontsize: 2.28rem !default; +$h5-fontsize: 1.64rem !default; +$h6-fontsize: 1rem !default; + + +// 22. Footer +// ========================================================================== + +$footer-font-color: #fff !default; +$footer-bg-color: $primary-color !default; +$footer-copyright-font-color: rgba(255,255,255,.8) !default; +$footer-copyright-bg-color: rgba(51,51,51,.08) !default; + + +// 23. Flow Text +// ========================================================================== + +$range : $large-screen - $small-screen !default; +$intervals: 20 !default; +$interval-size: $range / $intervals !default; + + +// 24. Collections +// ========================================================================== + +$collection-border-color: #e0e0e0 !default; +$collection-bg-color: #fff !default; +$collection-active-bg-color: $secondary-color !default; +$collection-active-color: lighten($secondary-color, 55%) !default; +$collection-hover-bg-color: #ddd !default; +$collection-link-color: $secondary-color !default; +$collection-line-height: 1.5rem !default; + + +// 25. Progress Bar +// ========================================================================== + +$progress-bar-color: $secondary-color !default; diff --git a/app/dispatch/static/materialize/sass/components/_waves.scss b/app/dispatch/static/materialize/sass/components/_waves.scss new file mode 100644 index 0000000..b36c718 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_waves.scss @@ -0,0 +1,114 @@ + +/*! + * Waves v0.6.0 + * http://fian.my.id/Waves + * + * Copyright 2014 Alfiana E. Sibuea and other contributors + * Released under the MIT license + * https://github.com/fians/Waves/blob/master/LICENSE + */ + + +.waves-effect { + position: relative; + cursor: pointer; + display: inline-block; + overflow: hidden; + user-select: none; + -webkit-tap-highlight-color: transparent; + vertical-align: middle; + z-index: 1; + transition: .3s ease-out; + + .waves-ripple { + position: absolute; + border-radius: 50%; + width: 20px; + height: 20px; + margin-top:-10px; + margin-left:-10px; + opacity: 0; + + background: rgba(0,0,0,0.2); + transition: all 0.7s ease-out; + transition-property: transform, opacity; + transform: scale(0); + pointer-events: none; + } + + // Waves Colors + &.waves-light .waves-ripple { + background-color: rgba(255, 255, 255, 0.45); + } + &.waves-red .waves-ripple { + background-color: rgba(244, 67, 54, .70); + } + &.waves-yellow .waves-ripple { + background-color: rgba(255, 235, 59, .70); + } + &.waves-orange .waves-ripple { + background-color: rgba(255, 152, 0, .70); + } + &.waves-purple .waves-ripple { + background-color: rgba(156, 39, 176, 0.70); + } + &.waves-green .waves-ripple { + background-color: rgba(76, 175, 80, 0.70); + } + &.waves-teal .waves-ripple { + background-color: rgba(0, 150, 136, 0.70); + } + + // Style input button bug. + input[type="button"], input[type="reset"], input[type="submit"] { + border: 0; + font-style: normal; + font-size: inherit; + text-transform: inherit; + background: none; + } + + img { + position: relative; + z-index: -1; + } +} + +.waves-notransition { + transition: none #{"!important"}; +} + +.waves-circle { + transform: translateZ(0); + -webkit-mask-image: -webkit-radial-gradient(circle, white 100%, black 100%); +} + +.waves-input-wrapper { + border-radius: 0.2em; + vertical-align: bottom; + + .waves-button-input { + position: relative; + top: 0; + left: 0; + z-index: 1; + } +} + +.waves-circle { + text-align: center; + width: 2.5em; + height: 2.5em; + line-height: 2.5em; + border-radius: 50%; + -webkit-mask-image: none; +} + +.waves-block { + display: block; +} + +/* Firefox Bug: link not triggered */ +.waves-effect .waves-ripple { + z-index: -1; +} \ No newline at end of file diff --git a/app/dispatch/static/materialize/sass/components/date_picker/_default.date.scss b/app/dispatch/static/materialize/sass/components/date_picker/_default.date.scss new file mode 100644 index 0000000..39ca1f2 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/date_picker/_default.date.scss @@ -0,0 +1,456 @@ +/* ========================================================================== + $BASE-DATE-PICKER + ========================================================================== */ +/** + * The picker box. + */ +.picker__box { + padding: 0; + border-radius: 2px; + overflow: hidden; +} +/** + * The header containing the month and year stuff. + */ +.picker__header { + text-align: center; + position: relative; + margin-top: .75em; +} +/** + * The month and year labels. + */ +.picker__month, +.picker__year { +// font-weight: 500; + display: inline-block; + margin-left: .25em; + margin-right: .25em; +} +/** + * The month and year selectors. + */ +.picker__select--month, +.picker__select--year { + + height: 2em; + padding: 0; + margin-left: .25em; + margin-right: .25em; +} + +// Modified +.picker__select--month.browser-default { + display: inline; + background-color: #FFFFFF; + width: 40%; +} +.picker__select--year.browser-default { + display: inline; + background-color: #FFFFFF; + width: 26%; +} +.picker__select--month:focus, +.picker__select--year:focus { + border-color: $datepicker-focus; +} +/** + * The month navigation buttons. + */ +.picker__nav--prev, +.picker__nav--next { + position: absolute; + padding: .5em 1.25em; + width: 1em; + height: 1em; + box-sizing: content-box; + top: -0.25em; +} +//@media (min-width: 24.5em) { +// .picker__nav--prev, +// .picker__nav--next { +// top: -0.33em; +// } +//} +.picker__nav--prev { + left: -1em; + padding-right: 1.25em; +} +//@media (min-width: 24.5em) { +// .picker__nav--prev { +// padding-right: 1.5em; +// } +//} +.picker__nav--next { + right: -1em; + padding-left: 1.25em; +} +//@media (min-width: 24.5em) { +// .picker__nav--next { +// padding-left: 1.5em; +// } +//} + +.picker__nav--disabled, +.picker__nav--disabled:hover, +.picker__nav--disabled:before, +.picker__nav--disabled:before:hover { + cursor: default; + background: none; + border-right-color: #f5f5f5; + border-left-color: #f5f5f5; +} +/** + * The calendar table of dates + */ +.picker__table { + text-align: center; + border-collapse: collapse; + border-spacing: 0; + table-layout: fixed; + font-size: 1rem; + width: 100%; + margin-top: .75em; + margin-bottom: .5em; +} + + + +.picker__table th, .picker__table td { + text-align: center; +} + + + + + + +.picker__table td { + margin: 0; + padding: 0; +} +/** + * The weekday labels + */ +.picker__weekday { + width: 14.285714286%; + font-size: .75em; + padding-bottom: .25em; + color: #999999; + font-weight: 500; + /* Increase the spacing a tad */ +} +@media (min-height: 33.875em) { + .picker__weekday { + padding-bottom: .5em; + } +} +/** + * The days on the calendar + */ + +.picker__day--today { + position: relative; + color: #595959; + letter-spacing: -.3; + padding: .75rem 0; + font-weight: 400; + border: 1px solid transparent; + +} + +//.picker__day--today:before { +// content: " "; +// position: absolute; +// top: 2px; +// right: 2px; +// width: 0; +// height: 0; +// border-top: 0.5em solid #0059bc; +// border-left: .5em solid transparent; +//} +.picker__day--disabled:before { + border-top-color: #aaaaaa; +} + + +.picker__day--infocus:hover{ + cursor: pointer; + color: #000; + font-weight: 500; +} + +.picker__day--outfocus { + display: none; + padding: .75rem 0; + color: #fff; + +} +.picker__day--outfocus:hover { + cursor: pointer; + color: #dddddd; +// background: #b1dcfb; + font-weight: 500; +} + + +.picker__day--highlighted { +// border-color: #0089ec; +} +.picker__day--highlighted:hover, +.picker--focused .picker__day--highlighted { + cursor: pointer; +// color: #000000; +// background: #b1dcfb; +// font-weight: 500; +} +.picker__day--selected, +.picker__day--selected:hover, +.picker--focused .picker__day--selected { + + +// Circle background + border-radius: 50%; + transform: scale(.75); + background: #0089ec; + color: #ffffff; +} +.picker__day--disabled, +.picker__day--disabled:hover, +.picker--focused .picker__day--disabled { + background: #f5f5f5; + border-color: #f5f5f5; + color: #dddddd; + cursor: default; +} +.picker__day--highlighted.picker__day--disabled, +.picker__day--highlighted.picker__day--disabled:hover { + background: #bbbbbb; +} +/** + * The footer containing the "today", "clear", and "close" buttons. + */ +.picker__footer { + text-align: right; +} +.picker__button--today, +.picker__button--clear, +.picker__button--close { + border: 1px solid #ffffff; + background: #ffffff; + font-size: .8em; + padding: .66em 0; + font-weight: bold; + width: 33%; + display: inline-block; + vertical-align: bottom; +} +.picker__button--today:hover, +.picker__button--clear:hover, +.picker__button--close:hover { + cursor: pointer; + color: #000000; + background: #b1dcfb; + border-bottom-color: #b1dcfb; +} +.picker__button--today:focus, +.picker__button--clear:focus, +.picker__button--close:focus { + background: #b1dcfb; + border-color: $datepicker-focus; + outline: none; +} +.picker__button--today:before, +.picker__button--clear:before, +.picker__button--close:before { + position: relative; + display: inline-block; + height: 0; +} +.picker__button--today:before, +.picker__button--clear:before { + content: " "; + margin-right: .45em; +} +.picker__button--today:before { + top: -0.05em; + width: 0; + border-top: 0.66em solid #0059bc; + border-left: .66em solid transparent; +} +.picker__button--clear:before { + top: -0.25em; + width: .66em; + border-top: 3px solid #ee2200; +} +.picker__button--close:before { + content: "\D7"; + top: -0.1em; + vertical-align: top; + font-size: 1.1em; + margin-right: .35em; + color: #777777; +} +.picker__button--today[disabled], +.picker__button--today[disabled]:hover { + background: #f5f5f5; + border-color: #f5f5f5; + color: #dddddd; + cursor: default; +} +.picker__button--today[disabled]:before { + border-top-color: #aaaaaa; +} + +/* ========================================================================== + CUSTOM MATERIALIZE STYLES + ========================================================================== */ +/*.picker__box { + border-radius: 2px; + overflow: hidden; +}*/ + +.picker__date-display { + text-align: left; + background-color: $datepicker-date-bg; + color: #fff; + padding: 18px; + font-weight: 300; +} + +@media only screen and (min-width: 601px) { + .picker__date-display { + flex:1; + } + .picker__weekday-display { + display:block; + } + .picker__container__wrapper { + flex:2 + } +} + +.picker__nav--prev:hover, +.picker__nav--next:hover { + cursor: pointer; + color: #000000; + background: $datepicker-selected-outfocus; +} + +.picker__weekday-display { + font-weight: 500; + font-size: $datepicker-display-font-size; + margin-right: 5px; + margin-top: 4px; +} + +.picker__month-display { + //text-transform: uppercase; + font-size: $datepicker-display-font-size; + font-weight: 500; +} +.picker__day-display { + font-size: $datepicker-display-font-size; + font-weight: 500; + margin-right: 5px; +} +.picker__year-display { + font-size: 1.5rem; + font-weight: 500; + color: $datepicker-year; +} + +/*.picker__box { + padding: 0; +}*/ +.picker__calendar-container { + padding: 0 1rem; + + thead { + border: none; + } +} + +// Calendar +.picker__table { + margin-top: 0; + margin-bottom: .5em; +} + +.picker__day--infocus { + color: $datepicker-weekday-color; + letter-spacing: -.3px; + padding: 0.75rem 0; + font-weight: 400; + border: 1px solid transparent; +} +@media only screen and (min-width: 601px) { + .picker__day--infocus { + padding: 1.1rem 0; + } +} + + +//Today style +.picker__day.picker__day--today { + color: $datepicker-selected; +} + +.picker__day.picker__day--today.picker__day--selected { + color: #fff; +} + +// Table Header +.picker__weekday { + font-size: .9rem; +} + + +.picker__day--selected, +.picker__day--selected:hover, +.picker--focused .picker__day--selected { + // Circle background + border-radius: 50%; + transform: scale(.9); + background-color: $datepicker-selected; + &.picker__day--outfocus { + background-color: $datepicker-selected-outfocus; + } + color: #ffffff; +} + +.picker__footer { + text-align: right; + padding: 5px 10px; +} + +// Materialize modified +.picker__close, .picker__today, .picker__clear { + font-size: 1.1rem; + padding: 0 1rem; + color: $datepicker-selected; +} +.picker__clear { + color:#f44336; + float:left; +} + +//month nav buttons +.picker__nav--prev:before, +.picker__nav--next:before { + content: " "; + border-top: .5em solid transparent; + border-bottom: .5em solid transparent; + border-right: 0.75em solid #676767; + width: 0; + height: 0; + display: block; + margin: 0 auto; +} +.picker__nav--next:before { + border-right: 0; + border-left: 0.75em solid #676767; +} +button.picker__today:focus, button.picker__clear:focus, button.picker__close:focus { + background-color: $datepicker-selected-outfocus; +} diff --git a/app/dispatch/static/materialize/sass/components/date_picker/_default.scss b/app/dispatch/static/materialize/sass/components/date_picker/_default.scss new file mode 100644 index 0000000..b091e55 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/date_picker/_default.scss @@ -0,0 +1,212 @@ +/* ========================================================================== + $BASE-PICKER + ========================================================================== */ +/** + * Note: the root picker element should *NOT* be styled more than what's here. + */ +.picker { + font-size: 16px; + text-align: left; + line-height: 1.2; + color: #000000; + position: absolute; + z-index: 10000; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + outline: none; +} +/** + * The picker input element. + */ +.picker__input { + cursor: default; +} +/** + * When the picker is opened, the input element is "activated". + */ +.picker__input.picker__input--active { + border-color: #0089ec; +} +/** + * The holder is the only "scrollable" top-level container element. + */ +.picker__holder { + width: 100%; + overflow-y: auto; + -webkit-overflow-scrolling: touch; +} + +/*! + * Default mobile-first, responsive styling for pickadate.js + * Demo: http://amsul.github.io/pickadate.js + */ +/** + * Note: the root picker element should *NOT* be styled more than what's here. + */ +/** + * Make the holder and frame fullscreen. + */ +.picker__holder, +.picker__frame { + bottom: 0; + left: 0; + right: 0; + top: 100%; +} +/** + * The holder should overlay the entire screen. + */ +.picker__holder { + position: fixed; + -webkit-transition: background 0.15s ease-out, top 0s 0.15s; + -moz-transition: background 0.15s ease-out, top 0s 0.15s; + transition: background 0.15s ease-out, top 0s 0.15s; + -webkit-backface-visibility: hidden; +} +/** + * The frame that bounds the box contents of the picker. + */ +.picker__frame { + position: absolute; + margin: 0 auto; + min-width: 256px; + +// picker width + width: 300px; + max-height: 350px; + + -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; + filter: alpha(opacity=0); + -moz-opacity: 0; + opacity: 0; + -webkit-transition: all 0.15s ease-out; + -moz-transition: all 0.15s ease-out; + transition: all 0.15s ease-out; +} +@media (min-height: 28.875em) { + .picker__frame { + overflow: visible; + top: auto; + bottom: -100%; + max-height: 80%; + } +} +@media (min-height: 40.125em) { + .picker__frame { + margin-bottom: 7.5%; + } +} +/** + * The wrapper sets the stage to vertically align the box contents. + */ +.picker__wrap { + display: table; + width: 100%; + height: 100%; +} +@media (min-height: 28.875em) { + .picker__wrap { + display: block; + } +} +/** + * The box contains all the picker contents. + */ +.picker__box { + background: #ffffff; + display: table-cell; + vertical-align: middle; +} +//@media (min-height: 26.5em) { +// .picker__box { +//// font-size: 1.25em; +// } +//} +@media (min-height: 28.875em) { + .picker__box { + display: block; + +// picker header font-size +// font-size: 1rem; + + border: 1px solid #777777; + border-top-color: #898989; + border-bottom-width: 0; + -webkit-border-radius: 5px 5px 0 0; + -moz-border-radius: 5px 5px 0 0; + border-radius: 5px 5px 0 0; + -webkit-box-shadow: 0 12px 36px 16px rgba(0, 0, 0, 0.24); + -moz-box-shadow: 0 12px 36px 16px rgba(0, 0, 0, 0.24); + box-shadow: 0 12px 36px 16px rgba(0, 0, 0, 0.24); + } +} +//@media (min-height: 40.125em) { +// .picker__box { +// font-size: 1.1rem; +// border-bottom-width: 1px; +// -webkit-border-radius: 5px; +// -moz-border-radius: 5px; +// border-radius: 5px; +// } +//} +/** + * When the picker opens... + */ +.picker--opened .picker__holder { + top: 0; + background: transparent; + -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorstr=#1E000000,endColorstr=#1E000000)"; + zoom: 1; + background: rgba(0, 0, 0, 0.32); + -webkit-transition: background 0.15s ease-out; + -moz-transition: background 0.15s ease-out; + transition: background 0.15s ease-out; +} +.picker--opened .picker__frame { + top: 0; + -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=100)"; + filter: alpha(opacity=100); + -moz-opacity: 1; + opacity: 1; +} +@media (min-height: 35.875em) { + .picker--opened .picker__frame { + top: 10%; + bottom: auto; + } +} +/** + * For `large` screens, transform into an inline picker. + */ + +/* ========================================================================== + CUSTOM MATERIALIZE STYLES + ========================================================================== */ + +.picker__input.picker__input--active { + border-color: color("blue", "lighten-5"); +} + +.picker__frame { + margin: 0 auto; + max-width: 325px; +} + +@media (min-height: 38.875em) { + .picker--opened .picker__frame { + top: 10%; + bottom: auto; + } +} + +@media only screen and (min-width: 601px) { + .picker__box { + display:flex; + } + .picker__frame { + width: 80%; + max-width:600px; + } +} diff --git a/app/dispatch/static/materialize/sass/components/date_picker/_default.time.scss b/app/dispatch/static/materialize/sass/components/date_picker/_default.time.scss new file mode 100644 index 0000000..ae0b778 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/date_picker/_default.time.scss @@ -0,0 +1,267 @@ +/* ========================================================================== + $BASE-TIME-PICKER + ========================================================================== */ +/** + * The list of times. + */ +.picker__list { + list-style: none; + padding: 0.75em 0 4.2em; + margin: 0; +} +/** + * The times on the clock. + */ +.picker__list-item { + border-bottom: 1px solid #ddd; + border-top: 1px solid #ddd; + margin-bottom: -1px; + position: relative; + background: #fff; + padding: .75em 1.25em; +} +@media (min-height: 46.75em) { + .picker__list-item { + padding: .5em 1em; + } +} +/* Hovered time */ +.picker__list-item:hover { + cursor: pointer; + color: #000; + background: #b1dcfb; + border-color: #0089ec; + z-index: 10; +} +/* Highlighted and hovered/focused time */ +.picker__list-item--highlighted { + border-color: #0089ec; + z-index: 10; +} +.picker__list-item--highlighted:hover, +.picker--focused .picker__list-item--highlighted { + cursor: pointer; + color: #000; + background: #b1dcfb; +} +/* Selected and hovered/focused time */ +.picker__list-item--selected, +.picker__list-item--selected:hover, +.picker--focused .picker__list-item--selected { + background: #0089ec; + color: #fff; + z-index: 10; +} +/* Disabled time */ +.picker__list-item--disabled, +.picker__list-item--disabled:hover, +.picker--focused .picker__list-item--disabled { + background: #f5f5f5; + border-color: #f5f5f5; + color: #ddd; + cursor: default; + border-color: #ddd; + z-index: auto; +} +/** + * The clear button + */ +.picker--time .picker__button--clear { + display: block; + width: 80%; + margin: 1em auto 0; + padding: 1em 1.25em; + background: none; + border: 0; + font-weight: 500; + font-size: .67em; + text-align: center; + text-transform: uppercase; + color: $timepicker-clock-color; +} +.picker--time .picker__button--clear:hover, +.picker--time .picker__button--clear:focus { + color: #000; + background: #b1dcfb; + background: #ee2200; + border-color: #ee2200; + cursor: pointer; + color: #fff; + outline: none; +} +.picker--time .picker__button--clear:before { + top: -0.25em; + color: $timepicker-clock-color; + font-size: 1.25em; + font-weight: bold; +} +.picker--time .picker__button--clear:hover:before, +.picker--time .picker__button--clear:focus:before { + color: #fff; +} + +/* ========================================================================== + $DEFAULT-TIME-PICKER + ========================================================================== */ +/** + * The frame the bounds the time picker. + */ +.picker--time .picker__frame { + min-width: 256px; + max-width: 320px; +} +/** + * The picker box. + */ +.picker--time .picker__box { + font-size: 1em; + background: #f2f2f2; + padding: 0; +} +@media (min-height: 40.125em) { + .picker--time .picker__box { + margin-bottom: 5em; + } +} + +/* ========================================================================== + $DEFAULT-TIME-PICKER + ========================================================================== */ +.clockpicker-display { + font-size: 4rem; + font-weight: bold; + text-align: center; + color: rgba(255, 255, 255, 0.6); + font-weight: 400; + clear: both; + position: relative; +} + +.clockpicker-span-am-pm { + font-size: 1.3rem; + position: absolute; + right: 1rem; + bottom: 0.3rem; + line-height: 2rem; + font-weight: 500; +} +@media only screen and (min-width: 601px) { + .clockpicker-display { + top: 32%; + } + .clockpicker-span-am-pm { + position: relative; + right: auto; + bottom: auto; + text-align: center; + margin-top: 1.2rem; + } +} + + +.text-primary{ + color: rgba(255, 255, 255, 1) +} +.clockpicker-span-hours { + margin-right: 3px; +} +.clockpicker-span-minutes { + margin-left: 3px; +} + +.clockpicker-span-hours, +.clockpicker-span-minutes, +.clockpicker-span-am-pm div { + cursor: pointer; +} +.clockpicker-moving { + cursor: move; +} +.clockpicker-plate { + background-color: $timepicker-clock-plate-bg; + border-radius: 50%; + width: 270px; + height: 270px; + overflow: visible; + position: relative; + margin: auto; + margin-top: 25px; + margin-bottom: 5px; + user-select: none; +} +.clockpicker-canvas, +.clockpicker-dial { + width: 270px; + height: 270px; + position: absolute; + left: -1px; + top: -1px; +} +.clockpicker-minutes { + visibility: hidden; +} +.clockpicker-tick { + border-radius: 50%; + color: $timepicker-clock-color; + line-height: 40px; + text-align: center; + width: 40px; + height: 40px; + position: absolute; + cursor: pointer; +} +.clockpicker-tick.active, +.clockpicker-tick:hover { + background-color: transparentize($secondary-color, .75); +} +.clockpicker-dial { + -webkit-transition: -webkit-transform 350ms, opacity 350ms; + -moz-transition: -moz-transform 350ms, opacity 350ms; + -ms-transition: -ms-transform 350ms, opacity 350ms; + -o-transition: -o-transform 350ms, opacity 350ms; + transition: transform 350ms, opacity 350ms; +} +.clockpicker-dial-out { + opacity: 0; +} +.clockpicker-hours.clockpicker-dial-out { + -webkit-transform: scale(1.2, 1.2); + -moz-transform: scale(1.2, 1.2); + -ms-transform: scale(1.2, 1.2); + -o-transform: scale(1.2, 1.2); + transform: scale(1.2, 1.2); +} +.clockpicker-minutes.clockpicker-dial-out { + -webkit-transform: scale(.8, .8); + -moz-transform: scale(.8, .8); + -ms-transform: scale(.8, .8); + -o-transform: scale(.8, .8); + transform: scale(.8, .8); +} +.clockpicker-canvas { + -webkit-transition: opacity 175ms; + -moz-transition: opacity 175ms; + -ms-transition: opacity 175ms; + -o-transition: opacity 175ms; + transition: opacity 175ms; +} +.clockpicker-canvas-out { + opacity: 0.25; +} +.clockpicker-canvas-bearing { + stroke: none; + fill: $secondary-color; +} +.clockpicker-canvas-bg { + stroke: none; + fill: $secondary-color; +} +.clockpicker-canvas-bg-trans { + fill: $secondary-color; +} +.clockpicker-canvas line { + stroke: $secondary-color; + stroke-width: 4; + stroke-linecap: round; + /*shape-rendering: crispEdges;*/ +} diff --git a/app/dispatch/static/materialize/sass/components/forms/_checkboxes.scss b/app/dispatch/static/materialize/sass/components/forms/_checkboxes.scss new file mode 100644 index 0000000..60334b2 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/forms/_checkboxes.scss @@ -0,0 +1,210 @@ +/* Checkboxes + ========================================================================== */ + +/* CUSTOM CSS CHECKBOXES */ +form p { + margin-bottom: 10px; + text-align: left; +} + +form p:last-child { + margin-bottom: 0; +} + +/* Remove default checkbox */ +[type="checkbox"]:not(:checked), +[type="checkbox"]:checked { + position: absolute; + opacity: 0; + pointer-events: none; +} + +// Checkbox Styles +[type="checkbox"] { + // Text Label Style + + label { + position: relative; + padding-left: 35px; + cursor: pointer; + display: inline-block; + height: 25px; + line-height: 25px; + font-size: 1rem; + user-select: none; + } + + /* checkbox aspect */ + + label:before, + &:not(.filled-in) + label:after { + content: ''; + position: absolute; + top: 0; + left: 0; + width: 18px; + height: 18px; + z-index: 0; + border: 2px solid $radio-empty-color; + border-radius: 1px; + margin-top: 2px; + transition: .2s; + } + + &:not(.filled-in) + label:after { + border: 0; + transform: scale(0); + } + + &:not(:checked):disabled + label:before { + border: none; + background-color: $input-disabled-color; + } + + // Focused styles + &.tabbed:focus + label:after { + transform: scale(1); + border: 0; + border-radius: 50%; + box-shadow: 0 0 0 10px rgba(0,0,0,.1); + background-color: rgba(0,0,0,.1); + } +} + +[type="checkbox"]:checked { + + label:before { + top: -4px; + left: -5px; + width: 12px; + height: 22px; + border-top: 2px solid transparent; + border-left: 2px solid transparent; + border-right: $radio-border; + border-bottom: $radio-border; + transform: rotate(40deg); + backface-visibility: hidden; + transform-origin: 100% 100%; + } + + &:disabled + label:before { + border-right: 2px solid $input-disabled-color; + border-bottom: 2px solid $input-disabled-color; + } +} + +/* Indeterminate checkbox */ +[type="checkbox"]:indeterminate { + +label:before { + top: -11px; + left: -12px; + width: 10px; + height: 22px; + border-top: none; + border-left: none; + border-right: $radio-border; + border-bottom: none; + transform: rotate(90deg); + backface-visibility: hidden; + transform-origin: 100% 100%; + } + + // Disabled indeterminate + &:disabled + label:before { + border-right: 2px solid $input-disabled-color; + background-color: transparent; + } +} + +// Filled in Style +[type="checkbox"].filled-in { + // General + + label:after { + border-radius: 2px; + } + + + label:before, + + label:after { + content: ''; + left: 0; + position: absolute; + /* .1s delay is for check animation */ + transition: border .25s, background-color .25s, width .20s .1s, height .20s .1s, top .20s .1s, left .20s .1s; + z-index: 1; + } + + // Unchecked style + &:not(:checked) + label:before { + width: 0; + height: 0; + border: 3px solid transparent; + left: 6px; + top: 10px; + transform: rotateZ(37deg); + transform-origin: 100% 100%; + } + + &:not(:checked) + label:after { + height: 20px; + width: 20px; + background-color: transparent; + border: 2px solid $radio-empty-color; + top: 0px; + z-index: 0; + } + + // Checked style + &:checked { + + label:before { + top: 0; + left: 1px; + width: 8px; + height: 13px; + border-top: 2px solid transparent; + border-left: 2px solid transparent; + border-right: 2px solid $input-background; + border-bottom: 2px solid $input-background; + transform: rotateZ(37deg); + transform-origin: 100% 100%; + } + + + label:after { + top: 0; + width: 20px; + height: 20px; + border: 2px solid $secondary-color; + background-color: $secondary-color; + z-index: 0; + } + } + + // Focused styles + &.tabbed:focus + label:after { + border-radius: 2px; + border-color: $radio-empty-color; + background-color: rgba(0,0,0,.1); + } + + &.tabbed:checked:focus + label:after { + border-radius: 2px; + background-color: $secondary-color; + border-color: $secondary-color; + } + + // Disabled style + &:disabled:not(:checked) + label:before { + background-color: transparent; + border: 2px solid transparent; + } + + &:disabled:not(:checked) + label:after { + border-color: transparent; + background-color: $input-disabled-solid-color; + } + + &:disabled:checked + label:before { + background-color: transparent; + } + + &:disabled:checked + label:after { + background-color: $input-disabled-solid-color; + border-color: $input-disabled-solid-color; + } +} diff --git a/app/dispatch/static/materialize/sass/components/forms/_file-input.scss b/app/dispatch/static/materialize/sass/components/forms/_file-input.scss new file mode 100644 index 0000000..e0f7ef7 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/forms/_file-input.scss @@ -0,0 +1,44 @@ +/* File Input + ========================================================================== */ + +.file-field { + position: relative; + + .file-path-wrapper { + overflow: hidden; + padding-left: 10px; + } + + input.file-path { width: 100%; } + + .btn { + float: left; + height: $input-height; + line-height: $input-height; + } + + span { + cursor: pointer; + } + + input[type=file] { + + // Needed to override webkit button + &::-webkit-file-upload-button { + display: none; + } + + position: absolute; + top: 0; + right: 0; + left: 0; + bottom: 0; + width: 100%; + margin: 0; + padding: 0; + font-size: 20px; + cursor: pointer; + opacity: 0; + filter: alpha(opacity=0); + } +} diff --git a/app/dispatch/static/materialize/sass/components/forms/_forms.scss b/app/dispatch/static/materialize/sass/components/forms/_forms.scss new file mode 100644 index 0000000..4c19f4c --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/forms/_forms.scss @@ -0,0 +1,22 @@ +// Remove Focus Boxes +select:focus { + outline: $select-focus; +} + +button:focus { + outline: none; + background-color: $button-background-focus; +} + +label { + font-size: $label-font-size; + color: $input-border-color; +} + +@import 'input-fields'; +@import 'radio-buttons'; +@import 'checkboxes'; +@import 'switches'; +@import 'select'; +@import 'file-input'; +@import 'range'; diff --git a/app/dispatch/static/materialize/sass/components/forms/_input-fields.scss b/app/dispatch/static/materialize/sass/components/forms/_input-fields.scss new file mode 100644 index 0000000..ffdf522 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/forms/_input-fields.scss @@ -0,0 +1,333 @@ +/* Text Inputs + Textarea + ========================================================================== */ + +/* Style Placeholders */ + +::placeholder { + color: $placeholder-text-color; +} + +/* Text inputs */ + +input:not([type]), +input[type=text]:not(.browser-default), +input[type=password]:not(.browser-default), +input[type=email]:not(.browser-default), +input[type=url]:not(.browser-default), +input[type=time]:not(.browser-default), +input[type=date]:not(.browser-default), +input[type=datetime]:not(.browser-default), +input[type=datetime-local]:not(.browser-default), +input[type=tel]:not(.browser-default), +input[type=number]:not(.browser-default), +input[type=search]:not(.browser-default), +textarea.materialize-textarea { + + // General Styles + background-color: transparent; + border: none; + border-bottom: $input-border; + border-radius: 0; + outline: none; + height: $input-height; + width: 100%; + font-size: $input-font-size; + margin: $input-margin; + padding: $input-padding; + box-shadow: none; + box-sizing: content-box; + transition: $input-transition; + + // Disabled input style + &:disabled, + &[readonly="readonly"] { + color: $input-disabled-color; + border-bottom: $input-disabled-border; + } + + // Disabled label style + &:disabled+label, + &[readonly="readonly"]+label { + color: $input-disabled-color; + } + + // Focused input style + &:focus:not([readonly]) { + border-bottom: 1px solid $input-focus-color; + box-shadow: 0 1px 0 0 $input-focus-color; + } + + // Focused label style + &:focus:not([readonly])+label { + color: $input-focus-color; + } + + // Valid Input Style + &.valid, + &:focus.valid { + @extend %valid-input-style; + } + + // Custom Success Message + &.valid + label:after, + &:focus.valid + label:after { + @extend %custom-success-message; + } + + // Invalid Input Style + &.invalid, + &:focus.invalid { + @extend %invalid-input-style; + } + + // Custom Error message + &.invalid + label:after, + &:focus.invalid + label:after { + @extend %custom-error-message; + } + + // Full width label when using validate for error messages + &.validate + label { + width: 100%; + } + + // Form Message Shared Styles + & + label:after { + @extend %input-after-style; + } + + // TODO: Remove once input fields are reworked to support validation messages better + &.invalid + label:after, + &.valid + label:after{ + display: none; + } + + &.invalid + label.active:after, + &.valid + label.active:after{ + display: block; + } +} + + +/* Validation Sass Placeholders */ +%valid-input-style { + border-bottom: 1px solid $input-success-color; + box-shadow: 0 1px 0 0 $input-success-color; +} +%invalid-input-style { + border-bottom: $input-invalid-border; + box-shadow: 0 1px 0 0 $input-error-color; +} +%custom-success-message { + content: attr(data-success); + color: $input-success-color; + opacity: 1; + transform: translateY(9px); +} +%custom-error-message { + content: attr(data-error); + color: $input-error-color; + opacity: 1; + transform: translateY(9px); +} +%input-after-style { + display: block; + content: ""; + position: absolute; + top: 100%; + left: 0; + opacity: 0; + transition: .2s opacity ease-out, .2s color ease-out; +} + + +// Styling for input field wrapper +.input-field { + // Inline styles + &.inline { + display: inline-block; + vertical-align: middle; + margin-left: 5px; + + input, + .select-dropdown { + margin-bottom: 1rem; + } + } + + // Gutter spacing + &.col { + label { + left: $gutter-width / 2; + } + + .prefix ~ label, + .prefix ~ .validate ~ label { + width: calc(100% - 3rem - #{$gutter-width}); + } + } + + position: relative; + margin-top: 1rem; + + label { + color: $input-border-color; + position: absolute; + top: 0; + left: 0; + height: 100%; + font-size: 1rem; + cursor: text; + transition: transform .2s ease-out; + transform-origin: 0% 100%; + text-align: initial; + transform: translateY(12px); + pointer-events: none; + + &:not(.label-icon).active { + transform: translateY(-14px) scale(.8); + transform-origin: 0 0; + } + } + + // Prefix Icons + .prefix { + position: absolute; + width: $input-height; + font-size: 2rem; + transition: color .2s; + + &.active { color: $input-focus-color; } + } + + .prefix ~ input, + .prefix ~ textarea, + .prefix ~ label, + .prefix ~ .validate ~ label, + .prefix ~ .autocomplete-content { + margin-left: 3rem; + width: 92%; + width: calc(100% - 3rem); + } + + .prefix ~ label { margin-left: 3rem; } + + @media #{$medium-and-down} { + .prefix ~ input { + width: 86%; + width: calc(100% - 3rem); + } + } + + @media #{$small-and-down} { + .prefix ~ input { + width: 80%; + width: calc(100% - 3rem); + } + } +} + + +/* Search Field */ + +.input-field input[type=search] { + display: block; + line-height: inherit; + + .nav-wrapper & { + height: inherit; + padding-left: 4rem; + width: calc(100% - 4rem); + border: 0; + box-shadow: none; + } + + &:focus { + background-color: $input-background; + border: 0; + box-shadow: none; + color: #444; + + & + label i, + & ~ .mdi-navigation-close, + & ~ .material-icons { + color: #444; + } + } + + & + label { + left: 1rem; + } + + & ~ .mdi-navigation-close, + & ~ .material-icons { + position: absolute; + top: 0; + right: 1rem; + color: transparent; + cursor: pointer; + font-size: 2rem; + transition: .3s color; + } +} + + +/* Textarea */ + +// Default textarea +textarea { + width: 100%; + height: $input-height; + background-color: transparent; + + &.materialize-textarea { + // Fixes validation messages for dynamic textareas + &.validate + label { + &::after { + top: calc(100% - 12px); + } + &:not(.label-icon).active { + transform: translateY(-25px); + } + height: 100%; + } + + overflow-y: hidden; /* prevents scroll bar flash */ + padding: .8rem 0 1.6rem 0; /* prevents text jump on Enter keypress */ + resize: none; + min-height: $input-height; + } +} + +// For textarea autoresize +.hiddendiv { + display: none; + white-space: pre-wrap; + word-wrap: break-word; + overflow-wrap: break-word; /* future version of deprecated 'word-wrap' */ + padding-top: 1.2rem; /* prevents text jump on Enter keypress */ + + // Reduces repaints + position: absolute; + top: 0; +} + + +/* Autocomplete */ +.autocomplete-content { + margin-top: -1 * $input-margin-bottom; + margin-bottom: $input-margin-bottom; + display: block; + opacity: 1; + position: static; + + li { + .highlight { color: #444; } + + img { + height: $dropdown-item-height - 10; + width: $dropdown-item-height - 10; + margin: 5px 15px; + } + } +} diff --git a/app/dispatch/static/materialize/sass/components/forms/_radio-buttons.scss b/app/dispatch/static/materialize/sass/components/forms/_radio-buttons.scss new file mode 100644 index 0000000..ca82a96 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/forms/_radio-buttons.scss @@ -0,0 +1,115 @@ +/* Radio Buttons + ========================================================================== */ + +// Remove default Radio Buttons +[type="radio"]:not(:checked), +[type="radio"]:checked { + position: absolute; + opacity: 0; + pointer-events: none; +} + +[type="radio"]:not(:checked) + label, +[type="radio"]:checked + label { + position: relative; + padding-left: 35px; + cursor: pointer; + display: inline-block; + height: 25px; + line-height: 25px; + font-size: 1rem; + transition: .28s ease; + user-select: none; +} + +[type="radio"] + label:before, +[type="radio"] + label:after { + content: ''; + position: absolute; + left: 0; + top: 0; + margin: 4px; + width: 16px; + height: 16px; + z-index: 0; + transition: .28s ease; +} + +/* Unchecked styles */ +[type="radio"]:not(:checked) + label:before, +[type="radio"]:not(:checked) + label:after, +[type="radio"]:checked + label:before, +[type="radio"]:checked + label:after, +[type="radio"].with-gap:checked + label:before, +[type="radio"].with-gap:checked + label:after { + border-radius: 50%; +} + +[type="radio"]:not(:checked) + label:before, +[type="radio"]:not(:checked) + label:after { + border: 2px solid $radio-empty-color; +} + +[type="radio"]:not(:checked) + label:after { + transform: scale(0); +} + +/* Checked styles */ +[type="radio"]:checked + label:before { + border: 2px solid transparent; +} + +[type="radio"]:checked + label:after, +[type="radio"].with-gap:checked + label:before, +[type="radio"].with-gap:checked + label:after { + border: $radio-border; +} + +[type="radio"]:checked + label:after, +[type="radio"].with-gap:checked + label:after { + background-color: $radio-fill-color; +} + +[type="radio"]:checked + label:after { + transform: scale(1.02); +} + +/* Radio With gap */ +[type="radio"].with-gap:checked + label:after { + transform: scale(.5); +} + +/* Focused styles */ +[type="radio"].tabbed:focus + label:before { + box-shadow: 0 0 0 10px rgba(0,0,0,.1); +} + +/* Disabled Radio With gap */ +[type="radio"].with-gap:disabled:checked + label:before { + border: 2px solid $input-disabled-color; +} + +[type="radio"].with-gap:disabled:checked + label:after { + border: none; + background-color: $input-disabled-color; +} + +/* Disabled style */ +[type="radio"]:disabled:not(:checked) + label:before, +[type="radio"]:disabled:checked + label:before { + background-color: transparent; + border-color: $input-disabled-color; +} + +[type="radio"]:disabled + label { + color: $input-disabled-color; +} + +[type="radio"]:disabled:not(:checked) + label:before { + border-color: $input-disabled-color; +} + +[type="radio"]:disabled:checked + label:after { + background-color: $input-disabled-color; + border-color: $input-disabled-solid-color; +} diff --git a/app/dispatch/static/materialize/sass/components/forms/_range.scss b/app/dispatch/static/materialize/sass/components/forms/_range.scss new file mode 100644 index 0000000..d37ff7e --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/forms/_range.scss @@ -0,0 +1,160 @@ +/* Range + ========================================================================== */ + +.range-field { + position: relative; +} + +input[type=range], +input[type=range] + .thumb { + @extend .no-select; + cursor: pointer; +} + +input[type=range] { + position: relative; + background-color: transparent; + border: none; + outline: none; + width: 100%; + margin: 15px 0; + padding: 0; + + &:focus { + outline: none; + } +} + +input[type=range] + .thumb { + position: absolute; + top: 10px; + left: 0; + border: none; + height: 0; + width: 0; + border-radius: 50%; + background-color: $radio-fill-color; + margin-left: 7px; + + transform-origin: 50% 50%; + transform: rotate(-45deg); + + .value { + display: block; + width: 30px; + text-align: center; + color: $radio-fill-color; + font-size: 0; + transform: rotate(45deg); + } + + &.active { + border-radius: 50% 50% 50% 0; + + .value { + color: $input-background; + margin-left: -1px; + margin-top: 8px; + font-size: 10px; + } + } +} + +// WebKit +input[type=range] { + -webkit-appearance: none; +} + +input[type=range]::-webkit-slider-runnable-track { + height: $track-height; + background: #c2c0c2; + border: none; +} + +input[type=range]::-webkit-slider-thumb { + -webkit-appearance: none; + border: none; + height: $range-height; + width: $range-width; + border-radius: 50%; + background-color: $radio-fill-color; + transform-origin: 50% 50%; + margin: -5px 0 0 0; + transition: .3s; +} + +input[type=range]:focus::-webkit-slider-runnable-track { + background: #ccc; +} + +// FireFox +input[type=range] { + /* fix for FF unable to apply focus style bug */ + border: 1px solid white; + + /*required for proper track sizing in FF*/ +} + +input[type=range]::-moz-range-track { + height: $track-height; + background: #ddd; + border: none; +} + +input[type=range]::-moz-range-thumb { + border: none; + height: $range-height; + width: $range-width; + border-radius: 50%; + background: $radio-fill-color; + margin-top: -5px; +} + +// hide the outline behind the border +input[type=range]:-moz-focusring { + outline: 1px solid #fff; + outline-offset: -1px; +} + +input[type=range]:focus::-moz-range-track { + background: #ccc; +} + +// IE 10+ +input[type=range]::-ms-track { + height: $track-height; + + // remove bg colour from the track, we'll use ms-fill-lower and ms-fill-upper instead + background: transparent; + + // leave room for the larger thumb to overflow with a transparent border */ + border-color: transparent; + border-width: 6px 0; + + /*remove default tick marks*/ + color: transparent; +} + +input[type=range]::-ms-fill-lower { + background: #777; +} + +input[type=range]::-ms-fill-upper { + background: #ddd; +} + +input[type=range]::-ms-thumb { + border: none; + height: $range-height; + width: $range-width; + border-radius: 50%; + background: $radio-fill-color; +} + +input[type=range]:focus::-ms-fill-lower { + background: #888; +} + +input[type=range]:focus::-ms-fill-upper { + background: #ccc; +} diff --git a/app/dispatch/static/materialize/sass/components/forms/_select.scss b/app/dispatch/static/materialize/sass/components/forms/_select.scss new file mode 100644 index 0000000..bc7208e --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/forms/_select.scss @@ -0,0 +1,182 @@ +/* Select Field + ========================================================================== */ + +select { display: none; } +select.browser-default { display: block; } + +select { + background-color: $select-background; + width: 100%; + padding: $select-padding; + border: $select-border; + border-radius: $select-radius; + height: $input-height; +} + + +.input-field { + & > select { + display: block; + position: absolute; + width: 0; + pointer-events: none; + height: 0; + top: 0; + left: 0; + opacity: 0; + } +} + +.select-label { + position: absolute; +} + +.select-wrapper { + &.valid { + & > input.select-dropdown { + @extend %valid-input-style; + } + + & + label:after { + @extend %custom-success-message; + } + } + + &.invalid { + & > input.select-dropdown { + @extend %invalid-input-style; + } + + & + label:after { + @extend %custom-error-message; + } + } + + &.valid + label, + &.invalid + label { + width: 100%; + pointer-events: none; + } + + & + label:after { + @extend %input-after-style; + } + + position: relative; + + input.select-dropdown { + position: relative; + cursor: pointer; + background-color: transparent; + border: none; + border-bottom: $input-border; + outline: none; + height: $input-height; + line-height: $input-height; + width: 100%; + font-size: $input-font-size; + margin: $input-margin; + padding: 0; + display: block; + user-select:none; + } + + span.caret { + color: initial; + position: absolute; + right: 0; + top: 0; + bottom: 0; + height: 10px; + margin: auto 0; + font-size: 10px; + line-height: 10px; + } + + & + label { + position: absolute; + top: -26px; + font-size: $label-font-size; + } +} + +// Disabled styles +select:disabled { + color: $input-disabled-color; +} + +.select-wrapper.disabled { + span.caret, + & + label { + color: $input-disabled-color; + } +} + +.select-wrapper input.select-dropdown:disabled { + color: $input-disabled-color; + cursor: default; + user-select: none; +} + +.select-wrapper i { + color: $select-disabled-color; +} + +.select-dropdown li.disabled, +.select-dropdown li.disabled > span, +.select-dropdown li.optgroup { + color: $select-disabled-color; + background-color: transparent; +} + +.select-dropdown.dropdown-content { + li { + &.active { + background-color: transparent; + } + + &:hover { + background-color: $select-option-hover; + } + + &.selected { + background-color: $select-option-focus; + } + } +} + +// Prefix Icons +.prefix ~ .select-wrapper { + margin-left: 3rem; + width: 92%; + width: calc(100% - 3rem); +} + +.prefix ~ label { margin-left: 3rem; } + +// Icons +.select-dropdown li { + img { + height: $dropdown-item-height - 10; + width: $dropdown-item-height - 10; + margin: 5px 15px; + float: right; + } +} + +// Optgroup styles +.select-dropdown li.optgroup { + border-top: 1px solid $dropdown-hover-bg-color; + + &.selected > span { + color: rgba(0, 0, 0, .7); + } + + & > span { + color: rgba(0, 0, 0, .4); + } + + & ~ li.optgroup-option { + padding-left: 1rem; + } +} diff --git a/app/dispatch/static/materialize/sass/components/forms/_switches.scss b/app/dispatch/static/materialize/sass/components/forms/_switches.scss new file mode 100644 index 0000000..3296b12 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/forms/_switches.scss @@ -0,0 +1,89 @@ +/* Switch + ========================================================================== */ + +.switch, +.switch * { + -webkit-tap-highlight-color: transparent; + user-select: none; +} + +.switch label { + cursor: pointer; +} + +.switch label input[type=checkbox] { + opacity: 0; + width: 0; + height: 0; + + &:checked + .lever { + background-color: $switch-checked-lever-bg; + + &:before, &:after { + left: 18px; + } + + &:after { + background-color: $switch-bg-color; + } + } +} + +.switch label .lever { + content: ""; + display: inline-block; + position: relative; + width: 36px; + height: 14px; + background-color: $switch-unchecked-lever-bg; + border-radius: $switch-radius; + margin-right: 10px; + transition: background 0.3s ease; + vertical-align: middle; + margin: 0 16px; + + &:before, &:after { + content: ""; + position: absolute; + display: inline-block; + width: 20px; + height: 20px; + border-radius: 50%; + left: 0; + top: -3px; + transition: left 0.3s ease, background .3s ease, box-shadow 0.1s ease, transform .1s ease; + } + + &:before { + background-color: transparentize($switch-bg-color, .85); + } + + &:after { + background-color: $switch-unchecked-bg; + box-shadow: 0px 3px 1px -2px rgba(0, 0, 0, 0.2), 0px 2px 2px 0px rgba(0, 0, 0, 0.14), 0px 1px 5px 0px rgba(0, 0, 0, 0.12); + } +} + +// Switch active style +input[type=checkbox]:checked:not(:disabled) ~ .lever:active::before, +input[type=checkbox]:checked:not(:disabled).tabbed:focus ~ .lever::before { + transform: scale(2.4); + background-color: transparentize($switch-bg-color, .85); +} + +input[type=checkbox]:not(:disabled) ~ .lever:active:before, +input[type=checkbox]:not(:disabled).tabbed:focus ~ .lever::before { + transform: scale(2.4); + background-color: rgba(0,0,0,.08); +} + +// Disabled Styles +.switch input[type=checkbox][disabled] + .lever { + cursor: default; + background-color: rgba(0,0,0,.12); +} + +.switch label input[type=checkbox][disabled] + .lever:after, +.switch label input[type=checkbox][disabled]:checked + .lever:after { + background-color: $input-disabled-solid-color; +} diff --git a/app/dispatch/static/materialize/sass/materialize.scss b/app/dispatch/static/materialize/sass/materialize.scss new file mode 100644 index 0000000..8eafa35 --- /dev/null +++ b/app/dispatch/static/materialize/sass/materialize.scss @@ -0,0 +1,42 @@ +@charset "UTF-8"; + +// Colors +@import "components/color"; + +// Variables; +@import "components/variables"; + +// Reset +@import "components/normalize"; + +// components +@import "components/global"; +@import "components/badges"; +@import "components/icons-material-design"; +@import "components/grid"; +@import "components/navbar"; +@import "components/roboto"; +@import "components/typography"; +@import "components/transitions"; +@import "components/cards"; +@import "components/toast"; +@import "components/tabs"; +@import "components/tooltip"; +@import "components/buttons"; +@import "components/dropdown"; +@import "components/waves"; +@import "components/modal"; +@import "components/collapsible"; +@import "components/chips"; +@import "components/materialbox"; +@import "components/forms/forms"; +@import "components/table_of_contents"; +@import "components/sideNav"; +@import "components/preloader"; +@import "components/slider"; +@import "components/carousel"; +@import "components/tapTarget"; +@import "components/pulse"; +@import "components/date_picker/default"; +@import "components/date_picker/default.date"; +@import "components/date_picker/default.time"; diff --git a/app/dispatch/static/print.css b/app/dispatch/static/print.css new file mode 100644 index 0000000..6fc7ed3 --- /dev/null +++ b/app/dispatch/static/print.css @@ -0,0 +1,18 @@ +footer, nav, .hide-print { display: none !important; } + +.padding-30 { + padding: none !important; +} + +.z-depth-3 { + box-shadow: none !important; +} + + + +@page { + /*size: 29.7cm 42cm; -> that would be a regular A4 page */ + /* size: 35cm 49.5cm; */ + /* size: 8.5in 11in; */ +} + diff --git a/app/dispatch/templates/dispatch/invoice/detail-table.html b/app/dispatch/templates/dispatch/invoice/detail-table.html new file mode 100644 index 0000000..acb6e01 --- /dev/null +++ b/app/dispatch/templates/dispatch/invoice/detail-table.html @@ -0,0 +1,89 @@ +
                +
                +

                + Invoice #{{object.invoice_id}} +

                +
                +
                +
                +
                + + + + + +
                + Invoice Date: +
                + Due Date: +
                + {{object.invoice_date}} +
                + {{object.due_date}} +
                +
                +
                + {{object.owner.name}} +
                + {{object.owner.address}} +
                + {{object.owner.city}}, {{object.owner.state}} {{object.owner.zip_code}} +
                +
                +
                +
                + {{object.bill_to.name}} +
                + {{object.bill_to.address}} +
                + {{object.bill_to.city}}, {{object.bill_to.state}} {{object.bill_to.zip_code}} +
                +
                + +
                +
                + + + + + + + + {% for item in object.items %} + + + + + + {% endfor %} + + + + + + + + + + + + + + + + +
                DateDescriptionTotal
                {{item.date|date:"m/d/Y"}}{{item.description}}{{item.total}}
                Total Price:{{object.total}}
                Amount Due:{{object.total}}
                +
                +
                + + diff --git a/app/dispatch/templates/dispatch/invoice/detail.html b/app/dispatch/templates/dispatch/invoice/detail.html new file mode 100644 index 0000000..d7b30f6 --- /dev/null +++ b/app/dispatch/templates/dispatch/invoice/detail.html @@ -0,0 +1,38 @@ +{% extends 'dispatch/base.html' %} + +{% block title %}Invoice for {{object.invoice_date}} by {{object.owner}}{% endblock %} + +{% block content %} +
                +
                +

                Invoice for {{object.invoice_date}} by {{object.owner}}

                +
                +
                + +
                + +
                +{% include "dispatch/invoice/detail-table.html" %} +
                + +
                + +
                +
                + Delete + Print +
                +
                + +
                + + + + + + +{%endblock%} diff --git a/app/dispatch/templates/dispatch/invoice/list.html b/app/dispatch/templates/dispatch/invoice/list.html new file mode 100644 index 0000000..292edd7 --- /dev/null +++ b/app/dispatch/templates/dispatch/invoice/list.html @@ -0,0 +1,41 @@ +{% extends 'dispatch/base.html' %} + +{% block title %}Invoices{% endblock %} + +{% block content %} +
                +
                +

                Invoices

                +
                +
                + + + + + + + + + + + + + + + {{object_list}} + {% for invoice in object_list %} + + + + + + + + + + + {% endfor %} + + +
                UserOwnerBill ToInvoice IDInvoice DateDue DateAmount
                {{invoice.user}}{{invoice.owner}}{{invoice.bill_to}}{{invoice.invoice_id}}{{invoice.invoice_date}}{{invoice.due_date}}{{invoice.total}}View
                +{% endblock %} diff --git a/app/dispatch/templates/dispatch/printable.html b/app/dispatch/templates/dispatch/printable.html new file mode 100644 index 0000000..9f9a181 --- /dev/null +++ b/app/dispatch/templates/dispatch/printable.html @@ -0,0 +1,112 @@ +{% load static %} +{% load custom_tags %} + + + + + {% block title %}{% endblock %} + + + + + + + + + + + +
                +
                + {% block content %} + {% endblock %} +
                +
                + + + + + + + + + + + -- cgit v1.2.3