aboutsummaryrefslogtreecommitdiff
path: root/app/dispatch/static/materialize/js/materialize.js
diff options
context:
space:
mode:
authorMitch Riedstra <Mitch@riedstra.us>2017-06-29 14:45:24 -0400
committerMitch Riedstra <Mitch@riedstra.us>2017-06-29 14:45:24 -0400
commit8bdfbc6ddc1080c3e0c279ad92c19e47b25fd3bd (patch)
treed1caa0c37370d283453d339d995e911e28856f19 /app/dispatch/static/materialize/js/materialize.js
parent8312e3b36a3bf2276e98b883bc1dbeb235ca9ffe (diff)
downloaddispatch-tracker-8bdfbc6ddc1080c3e0c279ad92c19e47b25fd3bd.tar.gz
dispatch-tracker-8bdfbc6ddc1080c3e0c279ad92c19e47b25fd3bd.tar.xz
Add templates and static assets for materialize
Diffstat (limited to 'app/dispatch/static/materialize/js/materialize.js')
-rw-r--r--app/dispatch/static/materialize/js/materialize.js9045
1 files changed, 9045 insertions, 0 deletions
diff --git a/app/dispatch/static/materialize/js/materialize.js b/app/dispatch/static/materialize/js/materialize.js
new file mode 100644
index 0000000..f8c3d68
--- /dev/null
+++ b/app/dispatch/static/materialize/js/materialize.js
@@ -0,0 +1,9045 @@
+/*!
+ * Materialize v0.99.0 (http://materializecss.com)
+ * Copyright 2014-2017 Materialize
+ * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
+ */
+// Check for jQuery.
+if (typeof(jQuery) === 'undefined') {
+ var jQuery;
+ // Check if require is a defined function.
+ if (typeof(require) === 'function') {
+ jQuery = $ = require('jquery');
+ // Else use the dollar sign alias.
+ } else {
+ jQuery = $;
+ }
+}
+;/*
+ * jQuery Easing v1.4.0 - http://gsgd.co.uk/sandbox/jquery/easing/
+ * Open source under the BSD License.
+ * Copyright © 2008 George McGinley Smith
+ * All rights reserved.
+ * https://raw.github.com/gdsmith/jquery-easing/master/LICENSE
+*/
+
+(function (factory) {
+ if (typeof define === "function" && define.amd) {
+ define(['jquery'], function ($) {
+ return factory($);
+ });
+ } else if (typeof module === "object" && typeof module.exports === "object") {
+ exports = factory(require('jquery'));
+ } else {
+ factory(jQuery);
+ }
+})(function($){
+
+// Preserve the original jQuery "swing" easing as "jswing"
+$.easing['jswing'] = $.easing['swing'];
+
+var pow = Math.pow,
+ sqrt = Math.sqrt,
+ sin = Math.sin,
+ cos = Math.cos,
+ PI = Math.PI,
+ c1 = 1.70158,
+ c2 = c1 * 1.525,
+ c3 = c1 + 1,
+ c4 = ( 2 * PI ) / 3,
+ c5 = ( 2 * PI ) / 4.5;
+
+// x is the fraction of animation progress, in the range 0..1
+function bounceOut(x) {
+ var n1 = 7.5625,
+ d1 = 2.75;
+ if ( x < 1/d1 ) {
+ return n1*x*x;
+ } else if ( x < 2/d1 ) {
+ return n1*(x-=(1.5/d1))*x + .75;
+ } else if ( x < 2.5/d1 ) {
+ return n1*(x-=(2.25/d1))*x + .9375;
+ } else {
+ return n1*(x-=(2.625/d1))*x + .984375;
+ }
+}
+
+$.extend( $.easing,
+{
+ def: 'easeOutQuad',
+ swing: function (x) {
+ return $.easing[$.easing.def](x);
+ },
+ easeInQuad: function (x) {
+ return x * x;
+ },
+ easeOutQuad: function (x) {
+ return 1 - ( 1 - x ) * ( 1 - x );
+ },
+ easeInOutQuad: function (x) {
+ return x < 0.5 ?
+ 2 * x * x :
+ 1 - pow( -2 * x + 2, 2 ) / 2;
+ },
+ easeInCubic: function (x) {
+ return x * x * x;
+ },
+ easeOutCubic: function (x) {
+ return 1 - pow( 1 - x, 3 );
+ },
+ easeInOutCubic: function (x) {
+ return x < 0.5 ?
+ 4 * x * x * x :
+ 1 - pow( -2 * x + 2, 3 ) / 2;
+ },
+ easeInQuart: function (x) {
+ return x * x * x * x;
+ },
+ easeOutQuart: function (x) {
+ return 1 - pow( 1 - x, 4 );
+ },
+ easeInOutQuart: function (x) {
+ return x < 0.5 ?
+ 8 * x * x * x * x :
+ 1 - pow( -2 * x + 2, 4 ) / 2;
+ },
+ easeInQuint: function (x) {
+ return x * x * x * x * x;
+ },
+ easeOutQuint: function (x) {
+ return 1 - pow( 1 - x, 5 );
+ },
+ easeInOutQuint: function (x) {
+ return x < 0.5 ?
+ 16 * x * x * x * x * x :
+ 1 - pow( -2 * x + 2, 5 ) / 2;
+ },
+ easeInSine: function (x) {
+ return 1 - cos( x * PI/2 );
+ },
+ easeOutSine: function (x) {
+ return sin( x * PI/2 );
+ },
+ easeInOutSine: function (x) {
+ return -( cos( PI * x ) - 1 ) / 2;
+ },
+ easeInExpo: function (x) {
+ return x === 0 ? 0 : pow( 2, 10 * x - 10 );
+ },
+ easeOutExpo: function (x) {
+ return x === 1 ? 1 : 1 - pow( 2, -10 * x );
+ },
+ easeInOutExpo: function (x) {
+ return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ?
+ pow( 2, 20 * x - 10 ) / 2 :
+ ( 2 - pow( 2, -20 * x + 10 ) ) / 2;
+ },
+ easeInCirc: function (x) {
+ return 1 - sqrt( 1 - pow( x, 2 ) );
+ },
+ easeOutCirc: function (x) {
+ return sqrt( 1 - pow( x - 1, 2 ) );
+ },
+ easeInOutCirc: function (x) {
+ return x < 0.5 ?
+ ( 1 - sqrt( 1 - pow( 2 * x, 2 ) ) ) / 2 :
+ ( sqrt( 1 - pow( -2 * x + 2, 2 ) ) + 1 ) / 2;
+ },
+ easeInElastic: function (x) {
+ return x === 0 ? 0 : x === 1 ? 1 :
+ -pow( 2, 10 * x - 10 ) * sin( ( x * 10 - 10.75 ) * c4 );
+ },
+ easeOutElastic: function (x) {
+ return x === 0 ? 0 : x === 1 ? 1 :
+ pow( 2, -10 * x ) * sin( ( x * 10 - 0.75 ) * c4 ) + 1;
+ },
+ easeInOutElastic: function (x) {
+ return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ?
+ -( pow( 2, 20 * x - 10 ) * sin( ( 20 * x - 11.125 ) * c5 )) / 2 :
+ pow( 2, -20 * x + 10 ) * sin( ( 20 * x - 11.125 ) * c5 ) / 2 + 1;
+ },
+ easeInBack: function (x) {
+ return c3 * x * x * x - c1 * x * x;
+ },
+ easeOutBack: function (x) {
+ return 1 + c3 * pow( x - 1, 3 ) + c1 * pow( x - 1, 2 );
+ },
+ easeInOutBack: function (x) {
+ return x < 0.5 ?
+ ( pow( 2 * x, 2 ) * ( ( c2 + 1 ) * 2 * x - c2 ) ) / 2 :
+ ( pow( 2 * x - 2, 2 ) *( ( c2 + 1 ) * ( x * 2 - 2 ) + c2 ) + 2 ) / 2;
+ },
+ easeInBounce: function (x) {
+ return 1 - bounceOut( 1 - x );
+ },
+ easeOutBounce: bounceOut,
+ easeInOutBounce: function (x) {
+ return x < 0.5 ?
+ ( 1 - bounceOut( 1 - 2 * x ) ) / 2 :
+ ( 1 + bounceOut( 2 * x - 1 ) ) / 2;
+ }
+});
+
+});;// Custom Easing
+jQuery.extend( jQuery.easing,
+{
+ easeInOutMaterial: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t + b;
+ return c/4*((t-=2)*t*t + 2) + b;
+ }
+});;/*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */
+/*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */
+/*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */
+jQuery.Velocity?console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity."):(!function(e){function t(e){var t=e.length,a=r.type(e);return"function"===a||r.isWindow(e)?!1:1===e.nodeType&&t?!0:"array"===a||0===t||"number"==typeof t&&t>0&&t-1 in e}if(!e.jQuery){var r=function(e,t){return new r.fn.init(e,t)};r.isWindow=function(e){return null!=e&&e==e.window},r.type=function(e){return null==e?e+"":"object"==typeof e||"function"==typeof e?n[i.call(e)]||"object":typeof e},r.isArray=Array.isArray||function(e){return"array"===r.type(e)},r.isPlainObject=function(e){var t;if(!e||"object"!==r.type(e)||e.nodeType||r.isWindow(e))return!1;try{if(e.constructor&&!o.call(e,"constructor")&&!o.call(e.constructor.prototype,"isPrototypeOf"))return!1}catch(a){return!1}for(t in e);return void 0===t||o.call(e,t)},r.each=function(e,r,a){var n,o=0,i=e.length,s=t(e);if(a){if(s)for(;i>o&&(n=r.apply(e[o],a),n!==!1);o++);else for(o in e)if(n=r.apply(e[o],a),n===!1)break}else if(s)for(;i>o&&(n=r.call(e[o],o,e[o]),n!==!1);o++);else for(o in e)if(n=r.call(e[o],o,e[o]),n===!1)break;return e},r.data=function(e,t,n){if(void 0===n){var o=e[r.expando],i=o&&a[o];if(void 0===t)return i;if(i&&t in i)return i[t]}else if(void 0!==t){var o=e[r.expando]||(e[r.expando]=++r.uuid);return a[o]=a[o]||{},a[o][t]=n,n}},r.removeData=function(e,t){var n=e[r.expando],o=n&&a[n];o&&r.each(t,function(e,t){delete o[t]})},r.extend=function(){var e,t,a,n,o,i,s=arguments[0]||{},l=1,u=arguments.length,c=!1;for("boolean"==typeof s&&(c=s,s=arguments[l]||{},l++),"object"!=typeof s&&"function"!==r.type(s)&&(s={}),l===u&&(s=this,l--);u>l;l++)if(null!=(o=arguments[l]))for(n in o)e=s[n],a=o[n],s!==a&&(c&&a&&(r.isPlainObject(a)||(t=r.isArray(a)))?(t?(t=!1,i=e&&r.isArray(e)?e:[]):i=e&&r.isPlainObject(e)?e:{},s[n]=r.extend(c,i,a)):void 0!==a&&(s[n]=a));return s},r.queue=function(e,a,n){function o(e,r){var a=r||[];return null!=e&&(t(Object(e))?!function(e,t){for(var r=+t.length,a=0,n=e.length;r>a;)e[n++]=t[a++];if(r!==r)for(;void 0!==t[a];)e[n++]=t[a++];return e.length=n,e}(a,"string"==typeof e?[e]:e):[].push.call(a,e)),a}if(e){a=(a||"fx")+"queue";var i=r.data(e,a);return n?(!i||r.isArray(n)?i=r.data(e,a,o(n)):i.push(n),i):i||[]}},r.dequeue=function(e,t){r.each(e.nodeType?[e]:e,function(e,a){t=t||"fx";var n=r.queue(a,t),o=n.shift();"inprogress"===o&&(o=n.shift()),o&&("fx"===t&&n.unshift("inprogress"),o.call(a,function(){r.dequeue(a,t)}))})},r.fn=r.prototype={init:function(e){if(e.nodeType)return this[0]=e,this;throw new Error("Not a DOM node.")},offset:function(){var t=this[0].getBoundingClientRect?this[0].getBoundingClientRect():{top:0,left:0};return{top:t.top+(e.pageYOffset||document.scrollTop||0)-(document.clientTop||0),left:t.left+(e.pageXOffset||document.scrollLeft||0)-(document.clientLeft||0)}},position:function(){function e(){for(var e=this.offsetParent||document;e&&"html"===!e.nodeType.toLowerCase&&"static"===e.style.position;)e=e.offsetParent;return e||document}var t=this[0],e=e.apply(t),a=this.offset(),n=/^(?:body|html)$/i.test(e.nodeName)?{top:0,left:0}:r(e).offset();return a.top-=parseFloat(t.style.marginTop)||0,a.left-=parseFloat(t.style.marginLeft)||0,e.style&&(n.top+=parseFloat(e.style.borderTopWidth)||0,n.left+=parseFloat(e.style.borderLeftWidth)||0),{top:a.top-n.top,left:a.left-n.left}}};var a={};r.expando="velocity"+(new Date).getTime(),r.uuid=0;for(var n={},o=n.hasOwnProperty,i=n.toString,s="Boolean Number String Function Array Date RegExp Object Error".split(" "),l=0;l<s.length;l++)n["[object "+s[l]+"]"]=s[l].toLowerCase();r.fn.init.prototype=r.fn,e.Velocity={Utilities:r}}}(window),function(e){"object"==typeof module&&"object"==typeof module.exports?module.exports=e():"function"==typeof define&&define.amd?define(e):e()}(function(){return function(e,t,r,a){function n(e){for(var t=-1,r=e?e.length:0,a=[];++t<r;){var n=e[t];n&&a.push(n)}return a}function o(e){return m.isWrapped(e)?e=[].slice.call(e):m.isNode(e)&&(e=[e]),e}function i(e){var t=f.data(e,"velocity");return null===t?a:t}function s(e){return function(t){return Math.round(t*e)*(1/e)}}function l(e,r,a,n){function o(e,t){return 1-3*t+3*e}function i(e,t){return 3*t-6*e}function s(e){return 3*e}function l(e,t,r){return((o(t,r)*e+i(t,r))*e+s(t))*e}function u(e,t,r){return 3*o(t,r)*e*e+2*i(t,r)*e+s(t)}function c(t,r){for(var n=0;m>n;++n){var o=u(r,e,a);if(0===o)return r;var i=l(r,e,a)-t;r-=i/o}return r}function p(){for(var t=0;b>t;++t)w[t]=l(t*x,e,a)}function f(t,r,n){var o,i,s=0;do i=r+(n-r)/2,o=l(i,e,a)-t,o>0?n=i:r=i;while(Math.abs(o)>h&&++s<v);return i}function d(t){for(var r=0,n=1,o=b-1;n!=o&&w[n]<=t;++n)r+=x;--n;var i=(t-w[n])/(w[n+1]-w[n]),s=r+i*x,l=u(s,e,a);return l>=y?c(t,s):0==l?s:f(t,r,r+x)}function g(){V=!0,(e!=r||a!=n)&&p()}var m=4,y=.001,h=1e-7,v=10,b=11,x=1/(b-1),S="Float32Array"in t;if(4!==arguments.length)return!1;for(var P=0;4>P;++P)if("number"!=typeof arguments[P]||isNaN(arguments[P])||!isFinite(arguments[P]))return!1;e=Math.min(e,1),a=Math.min(a,1),e=Math.max(e,0),a=Math.max(a,0);var w=S?new Float32Array(b):new Array(b),V=!1,C=function(t){return V||g(),e===r&&a===n?t:0===t?0:1===t?1:l(d(t),r,n)};C.getControlPoints=function(){return[{x:e,y:r},{x:a,y:n}]};var T="generateBezier("+[e,r,a,n]+")";return C.toString=function(){return T},C}function u(e,t){var r=e;return m.isString(e)?b.Easings[e]||(r=!1):r=m.isArray(e)&&1===e.length?s.apply(null,e):m.isArray(e)&&2===e.length?x.apply(null,e.concat([t])):m.isArray(e)&&4===e.length?l.apply(null,e):!1,r===!1&&(r=b.Easings[b.defaults.easing]?b.defaults.easing:v),r}function c(e){if(e){var t=(new Date).getTime(),r=b.State.calls.length;r>1e4&&(b.State.calls=n(b.State.calls));for(var o=0;r>o;o++)if(b.State.calls[o]){var s=b.State.calls[o],l=s[0],u=s[2],d=s[3],g=!!d,y=null;d||(d=b.State.calls[o][3]=t-16);for(var h=Math.min((t-d)/u.duration,1),v=0,x=l.length;x>v;v++){var P=l[v],V=P.element;if(i(V)){var C=!1;if(u.display!==a&&null!==u.display&&"none"!==u.display){if("flex"===u.display){var T=["-webkit-box","-moz-box","-ms-flexbox","-webkit-flex"];f.each(T,function(e,t){S.setPropertyValue(V,"display",t)})}S.setPropertyValue(V,"display",u.display)}u.visibility!==a&&"hidden"!==u.visibility&&S.setPropertyValue(V,"visibility",u.visibility);for(var k in P)if("element"!==k){var A,F=P[k],j=m.isString(F.easing)?b.Easings[F.easing]:F.easing;if(1===h)A=F.endValue;else{var E=F.endValue-F.startValue;if(A=F.startValue+E*j(h,u,E),!g&&A===F.currentValue)continue}if(F.currentValue=A,"tween"===k)y=A;else{if(S.Hooks.registered[k]){var H=S.Hooks.getRoot(k),N=i(V).rootPropertyValueCache[H];N&&(F.rootPropertyValue=N)}var L=S.setPropertyValue(V,k,F.currentValue+(0===parseFloat(A)?"":F.unitType),F.rootPropertyValue,F.scrollData);S.Hooks.registered[k]&&(i(V).rootPropertyValueCache[H]=S.Normalizations.registered[H]?S.Normalizations.registered[H]("extract",null,L[1]):L[1]),"transform"===L[0]&&(C=!0)}}u.mobileHA&&i(V).transformCache.translate3d===a&&(i(V).transformCache.translate3d="(0px, 0px, 0px)",C=!0),C&&S.flushTransformCache(V)}}u.display!==a&&"none"!==u.display&&(b.State.calls[o][2].display=!1),u.visibility!==a&&"hidden"!==u.visibility&&(b.State.calls[o][2].visibility=!1),u.progress&&u.progress.call(s[1],s[1],h,Math.max(0,d+u.duration-t),d,y),1===h&&p(o)}}b.State.isTicking&&w(c)}function p(e,t){if(!b.State.calls[e])return!1;for(var r=b.State.calls[e][0],n=b.State.calls[e][1],o=b.State.calls[e][2],s=b.State.calls[e][4],l=!1,u=0,c=r.length;c>u;u++){var p=r[u].element;if(t||o.loop||("none"===o.display&&S.setPropertyValue(p,"display",o.display),"hidden"===o.visibility&&S.setPropertyValue(p,"visibility",o.visibility)),o.loop!==!0&&(f.queue(p)[1]===a||!/\.velocityQueueEntryFlag/i.test(f.queue(p)[1]))&&i(p)){i(p).isAnimating=!1,i(p).rootPropertyValueCache={};var d=!1;f.each(S.Lists.transforms3D,function(e,t){var r=/^scale/.test(t)?1:0,n=i(p).transformCache[t];i(p).transformCache[t]!==a&&new RegExp("^\\("+r+"[^.]").test(n)&&(d=!0,delete i(p).transformCache[t])}),o.mobileHA&&(d=!0,delete i(p).transformCache.translate3d),d&&S.flushTransformCache(p),S.Values.removeClass(p,"velocity-animating")}if(!t&&o.complete&&!o.loop&&u===c-1)try{o.complete.call(n,n)}catch(g){setTimeout(function(){throw g},1)}s&&o.loop!==!0&&s(n),i(p)&&o.loop===!0&&!t&&(f.each(i(p).tweensContainer,function(e,t){/^rotate/.test(e)&&360===parseFloat(t.endValue)&&(t.endValue=0,t.startValue=360),/^backgroundPosition/.test(e)&&100===parseFloat(t.endValue)&&"%"===t.unitType&&(t.endValue=0,t.startValue=100)}),b(p,"reverse",{loop:!0,delay:o.delay})),o.queue!==!1&&f.dequeue(p,o.queue)}b.State.calls[e]=!1;for(var m=0,y=b.State.calls.length;y>m;m++)if(b.State.calls[m]!==!1){l=!0;break}l===!1&&(b.State.isTicking=!1,delete b.State.calls,b.State.calls=[])}var f,d=function(){if(r.documentMode)return r.documentMode;for(var e=7;e>4;e--){var t=r.createElement("div");if(t.innerHTML="<!--[if IE "+e+"]><span></span><![endif]-->",t.getElementsByTagName("span").length)return t=null,e}return a}(),g=function(){var e=0;return t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||function(t){var r,a=(new Date).getTime();return r=Math.max(0,16-(a-e)),e=a+r,setTimeout(function(){t(a+r)},r)}}(),m={isString:function(e){return"string"==typeof e},isArray:Array.isArray||function(e){return"[object Array]"===Object.prototype.toString.call(e)},isFunction:function(e){return"[object Function]"===Object.prototype.toString.call(e)},isNode:function(e){return e&&e.nodeType},isNodeList:function(e){return"object"==typeof e&&/^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e))&&e.length!==a&&(0===e.length||"object"==typeof e[0]&&e[0].nodeType>0)},isWrapped:function(e){return e&&(e.jquery||t.Zepto&&t.Zepto.zepto.isZ(e))},isSVG:function(e){return t.SVGElement&&e instanceof t.SVGElement},isEmptyObject:function(e){for(var t in e)return!1;return!0}},y=!1;if(e.fn&&e.fn.jquery?(f=e,y=!0):f=t.Velocity.Utilities,8>=d&&!y)throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if(7>=d)return void(jQuery.fn.velocity=jQuery.fn.animate);var h=400,v="swing",b={State:{isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),isAndroid:/Android/i.test(navigator.userAgent),isGingerbread:/Android 2\.3\.[3-7]/i.test(navigator.userAgent),isChrome:t.chrome,isFirefox:/Firefox/i.test(navigator.userAgent),prefixElement:r.createElement("div"),prefixMatches:{},scrollAnchor:null,scrollPropertyLeft:null,scrollPropertyTop:null,isTicking:!1,calls:[]},CSS:{},Utilities:f,Redirects:{},Easings:{},Promise:t.Promise,defaults:{queue:"",duration:h,easing:v,begin:a,complete:a,progress:a,display:a,visibility:a,loop:!1,delay:!1,mobileHA:!0,_cacheValues:!0},init:function(e){f.data(e,"velocity",{isSVG:m.isSVG(e),isAnimating:!1,computedStyle:null,tweensContainer:null,rootPropertyValueCache:{},transformCache:{}})},hook:null,mock:!1,version:{major:1,minor:2,patch:2},debug:!1};t.pageYOffset!==a?(b.State.scrollAnchor=t,b.State.scrollPropertyLeft="pageXOffset",b.State.scrollPropertyTop="pageYOffset"):(b.State.scrollAnchor=r.documentElement||r.body.parentNode||r.body,b.State.scrollPropertyLeft="scrollLeft",b.State.scrollPropertyTop="scrollTop");var x=function(){function e(e){return-e.tension*e.x-e.friction*e.v}function t(t,r,a){var n={x:t.x+a.dx*r,v:t.v+a.dv*r,tension:t.tension,friction:t.friction};return{dx:n.v,dv:e(n)}}function r(r,a){var n={dx:r.v,dv:e(r)},o=t(r,.5*a,n),i=t(r,.5*a,o),s=t(r,a,i),l=1/6*(n.dx+2*(o.dx+i.dx)+s.dx),u=1/6*(n.dv+2*(o.dv+i.dv)+s.dv);return r.x=r.x+l*a,r.v=r.v+u*a,r}return function a(e,t,n){var o,i,s,l={x:-1,v:0,tension:null,friction:null},u=[0],c=0,p=1e-4,f=.016;for(e=parseFloat(e)||500,t=parseFloat(t)||20,n=n||null,l.tension=e,l.friction=t,o=null!==n,o?(c=a(e,t),i=c/n*f):i=f;s=r(s||l,i),u.push(1+s.x),c+=16,Math.abs(s.x)>p&&Math.abs(s.v)>p;);return o?function(e){return u[e*(u.length-1)|0]}:c}}();b.Easings={linear:function(e){return e},swing:function(e){return.5-Math.cos(e*Math.PI)/2},spring:function(e){return 1-Math.cos(4.5*e*Math.PI)*Math.exp(6*-e)}},f.each([["ease",[.25,.1,.25,1]],["ease-in",[.42,0,1,1]],["ease-out",[0,0,.58,1]],["ease-in-out",[.42,0,.58,1]],["easeInSine",[.47,0,.745,.715]],["easeOutSine",[.39,.575,.565,1]],["easeInOutSine",[.445,.05,.55,.95]],["easeInQuad",[.55,.085,.68,.53]],["easeOutQuad",[.25,.46,.45,.94]],["easeInOutQuad",[.455,.03,.515,.955]],["easeInCubic",[.55,.055,.675,.19]],["easeOutCubic",[.215,.61,.355,1]],["easeInOutCubic",[.645,.045,.355,1]],["easeInQuart",[.895,.03,.685,.22]],["easeOutQuart",[.165,.84,.44,1]],["easeInOutQuart",[.77,0,.175,1]],["easeInQuint",[.755,.05,.855,.06]],["easeOutQuint",[.23,1,.32,1]],["easeInOutQuint",[.86,0,.07,1]],["easeInExpo",[.95,.05,.795,.035]],["easeOutExpo",[.19,1,.22,1]],["easeInOutExpo",[1,0,0,1]],["easeInCirc",[.6,.04,.98,.335]],["easeOutCirc",[.075,.82,.165,1]],["easeInOutCirc",[.785,.135,.15,.86]]],function(e,t){b.Easings[t[0]]=l.apply(null,t[1])});var S=b.CSS={RegEx:{isHex:/^#([A-f\d]{3}){1,2}$/i,valueUnwrap:/^[A-z]+\((.*)\)$/i,wrappedValueAlreadyExtracted:/[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/,valueSplit:/([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi},Lists:{colors:["fill","stroke","stopColor","color","backgroundColor","borderColor","borderTopColor","borderRightColor","borderBottomColor","borderLeftColor","outlineColor"],transformsBase:["translateX","translateY","scale","scaleX","scaleY","skewX","skewY","rotateZ"],transforms3D:["transformPerspective","translateZ","scaleZ","rotateX","rotateY"]},Hooks:{templates:{textShadow:["Color X Y Blur","black 0px 0px 0px"],boxShadow:["Color X Y Blur Spread","black 0px 0px 0px 0px"],clip:["Top Right Bottom Left","0px 0px 0px 0px"],backgroundPosition:["X Y","0% 0%"],transformOrigin:["X Y Z","50% 50% 0px"],perspectiveOrigin:["X Y","50% 50%"]},registered:{},register:function(){for(var e=0;e<S.Lists.colors.length;e++){var t="color"===S.Lists.colors[e]?"0 0 0 1":"255 255 255 1";S.Hooks.templates[S.Lists.colors[e]]=["Red Green Blue Alpha",t]}var r,a,n;if(d)for(r in S.Hooks.templates){a=S.Hooks.templates[r],n=a[0].split(" ");var o=a[1].match(S.RegEx.valueSplit);"Color"===n[0]&&(n.push(n.shift()),o.push(o.shift()),S.Hooks.templates[r]=[n.join(" "),o.join(" ")])}for(r in S.Hooks.templates){a=S.Hooks.templates[r],n=a[0].split(" ");for(var e in n){var i=r+n[e],s=e;S.Hooks.registered[i]=[r,s]}}},getRoot:function(e){var t=S.Hooks.registered[e];return t?t[0]:e},cleanRootPropertyValue:function(e,t){return S.RegEx.valueUnwrap.test(t)&&(t=t.match(S.RegEx.valueUnwrap)[1]),S.Values.isCSSNullValue(t)&&(t=S.Hooks.templates[e][1]),t},extractValue:function(e,t){var r=S.Hooks.registered[e];if(r){var a=r[0],n=r[1];return t=S.Hooks.cleanRootPropertyValue(a,t),t.toString().match(S.RegEx.valueSplit)[n]}return t},injectValue:function(e,t,r){var a=S.Hooks.registered[e];if(a){var n,o,i=a[0],s=a[1];return r=S.Hooks.cleanRootPropertyValue(i,r),n=r.toString().match(S.RegEx.valueSplit),n[s]=t,o=n.join(" ")}return r}},Normalizations:{registered:{clip:function(e,t,r){switch(e){case"name":return"clip";case"extract":var a;return S.RegEx.wrappedValueAlreadyExtracted.test(r)?a=r:(a=r.toString().match(S.RegEx.valueUnwrap),a=a?a[1].replace(/,(\s+)?/g," "):r),a;case"inject":return"rect("+r+")"}},blur:function(e,t,r){switch(e){case"name":return b.State.isFirefox?"filter":"-webkit-filter";case"extract":var a=parseFloat(r);if(!a&&0!==a){var n=r.toString().match(/blur\(([0-9]+[A-z]+)\)/i);a=n?n[1]:0}return a;case"inject":return parseFloat(r)?"blur("+r+")":"none"}},opacity:function(e,t,r){if(8>=d)switch(e){case"name":return"filter";case"extract":var a=r.toString().match(/alpha\(opacity=(.*)\)/i);return r=a?a[1]/100:1;case"inject":return t.style.zoom=1,parseFloat(r)>=1?"":"alpha(opacity="+parseInt(100*parseFloat(r),10)+")"}else switch(e){case"name":return"opacity";case"extract":return r;case"inject":return r}}},register:function(){9>=d||b.State.isGingerbread||(S.Lists.transformsBase=S.Lists.transformsBase.concat(S.Lists.transforms3D));for(var e=0;e<S.Lists.transformsBase.length;e++)!function(){var t=S.Lists.transformsBase[e];S.Normalizations.registered[t]=function(e,r,n){switch(e){case"name":return"transform";case"extract":return i(r)===a||i(r).transformCache[t]===a?/^scale/i.test(t)?1:0:i(r).transformCache[t].replace(/[()]/g,"");case"inject":var o=!1;switch(t.substr(0,t.length-1)){case"translate":o=!/(%|px|em|rem|vw|vh|\d)$/i.test(n);break;case"scal":case"scale":b.State.isAndroid&&i(r).transformCache[t]===a&&1>n&&(n=1),o=!/(\d)$/i.test(n);break;case"skew":o=!/(deg|\d)$/i.test(n);break;case"rotate":o=!/(deg|\d)$/i.test(n)}return o||(i(r).transformCache[t]="("+n+")"),i(r).transformCache[t]}}}();for(var e=0;e<S.Lists.colors.length;e++)!function(){var t=S.Lists.colors[e];S.Normalizations.registered[t]=function(e,r,n){switch(e){case"name":return t;case"extract":var o;if(S.RegEx.wrappedValueAlreadyExtracted.test(n))o=n;else{var i,s={black:"rgb(0, 0, 0)",blue:"rgb(0, 0, 255)",gray:"rgb(128, 128, 128)",green:"rgb(0, 128, 0)",red:"rgb(255, 0, 0)",white:"rgb(255, 255, 255)"};/^[A-z]+$/i.test(n)?i=s[n]!==a?s[n]:s.black:S.RegEx.isHex.test(n)?i="rgb("+S.Values.hexToRgb(n).join(" ")+")":/^rgba?\(/i.test(n)||(i=s.black),o=(i||n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g," ")}return 8>=d||3!==o.split(" ").length||(o+=" 1"),o;case"inject":return 8>=d?4===n.split(" ").length&&(n=n.split(/\s+/).slice(0,3).join(" ")):3===n.split(" ").length&&(n+=" 1"),(8>=d?"rgb":"rgba")+"("+n.replace(/\s+/g,",").replace(/\.(\d)+(?=,)/g,"")+")"}}}()}},Names:{camelCase:function(e){return e.replace(/-(\w)/g,function(e,t){return t.toUpperCase()})},SVGAttribute:function(e){var t="width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return(d||b.State.isAndroid&&!b.State.isChrome)&&(t+="|transform"),new RegExp("^("+t+")$","i").test(e)},prefixCheck:function(e){if(b.State.prefixMatches[e])return[b.State.prefixMatches[e],!0];for(var t=["","Webkit","Moz","ms","O"],r=0,a=t.length;a>r;r++){var n;if(n=0===r?e:t[r]+e.replace(/^\w/,function(e){return e.toUpperCase()}),m.isString(b.State.prefixElement.style[n]))return b.State.prefixMatches[e]=n,[n,!0]}return[e,!1]}},Values:{hexToRgb:function(e){var t,r=/^#?([a-f\d])([a-f\d])([a-f\d])$/i,a=/^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return e=e.replace(r,function(e,t,r,a){return t+t+r+r+a+a}),t=a.exec(e),t?[parseInt(t[1],16),parseInt(t[2],16),parseInt(t[3],16)]:[0,0,0]},isCSSNullValue:function(e){return 0==e||/^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e)},getUnitType:function(e){return/^(rotate|skew)/i.test(e)?"deg":/(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e)?"":"px"},getDisplayType:function(e){var t=e&&e.tagName.toString().toLowerCase();return/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t)?"inline":/^(li)$/i.test(t)?"list-item":/^(tr)$/i.test(t)?"table-row":/^(table)$/i.test(t)?"table":/^(tbody)$/i.test(t)?"table-row-group":"block"},addClass:function(e,t){e.classList?e.classList.add(t):e.className+=(e.className.length?" ":"")+t},removeClass:function(e,t){e.classList?e.classList.remove(t):e.className=e.className.toString().replace(new RegExp("(^|\\s)"+t.split(" ").join("|")+"(\\s|$)","gi")," ")}},getPropertyValue:function(e,r,n,o){function s(e,r){function n(){u&&S.setPropertyValue(e,"display","none")}var l=0;if(8>=d)l=f.css(e,r);else{var u=!1;if(/^(width|height)$/.test(r)&&0===S.getPropertyValue(e,"display")&&(u=!0,S.setPropertyValue(e,"display",S.Values.getDisplayType(e))),!o){if("height"===r&&"border-box"!==S.getPropertyValue(e,"boxSizing").toString().toLowerCase()){var c=e.offsetHeight-(parseFloat(S.getPropertyValue(e,"borderTopWidth"))||0)-(parseFloat(S.getPropertyValue(e,"borderBottomWidth"))||0)-(parseFloat(S.getPropertyValue(e,"paddingTop"))||0)-(parseFloat(S.getPropertyValue(e,"paddingBottom"))||0);return n(),c}if("width"===r&&"border-box"!==S.getPropertyValue(e,"boxSizing").toString().toLowerCase()){var p=e.offsetWidth-(parseFloat(S.getPropertyValue(e,"borderLeftWidth"))||0)-(parseFloat(S.getPropertyValue(e,"borderRightWidth"))||0)-(parseFloat(S.getPropertyValue(e,"paddingLeft"))||0)-(parseFloat(S.getPropertyValue(e,"paddingRight"))||0);return n(),p}}var g;g=i(e)===a?t.getComputedStyle(e,null):i(e).computedStyle?i(e).computedStyle:i(e).computedStyle=t.getComputedStyle(e,null),"borderColor"===r&&(r="borderTopColor"),l=9===d&&"filter"===r?g.getPropertyValue(r):g[r],(""===l||null===l)&&(l=e.style[r]),n()}if("auto"===l&&/^(top|right|bottom|left)$/i.test(r)){var m=s(e,"position");("fixed"===m||"absolute"===m&&/top|left/i.test(r))&&(l=f(e).position()[r]+"px")}return l}var l;if(S.Hooks.registered[r]){var u=r,c=S.Hooks.getRoot(u);n===a&&(n=S.getPropertyValue(e,S.Names.prefixCheck(c)[0])),S.Normalizations.registered[c]&&(n=S.Normalizations.registered[c]("extract",e,n)),l=S.Hooks.extractValue(u,n)}else if(S.Normalizations.registered[r]){var p,g;p=S.Normalizations.registered[r]("name",e),"transform"!==p&&(g=s(e,S.Names.prefixCheck(p)[0]),S.Values.isCSSNullValue(g)&&S.Hooks.templates[r]&&(g=S.Hooks.templates[r][1])),l=S.Normalizations.registered[r]("extract",e,g)}if(!/^[\d-]/.test(l))if(i(e)&&i(e).isSVG&&S.Names.SVGAttribute(r))if(/^(height|width)$/i.test(r))try{l=e.getBBox()[r]}catch(m){l=0}else l=e.getAttribute(r);else l=s(e,S.Names.prefixCheck(r)[0]);return S.Values.isCSSNullValue(l)&&(l=0),b.debug>=2&&console.log("Get "+r+": "+l),l},setPropertyValue:function(e,r,a,n,o){var s=r;if("scroll"===r)o.container?o.container["scroll"+o.direction]=a:"Left"===o.direction?t.scrollTo(a,o.alternateValue):t.scrollTo(o.alternateValue,a);else if(S.Normalizations.registered[r]&&"transform"===S.Normalizations.registered[r]("name",e))S.Normalizations.registered[r]("inject",e,a),s="transform",a=i(e).transformCache[r];else{if(S.Hooks.registered[r]){var l=r,u=S.Hooks.getRoot(r);n=n||S.getPropertyValue(e,u),a=S.Hooks.injectValue(l,a,n),r=u}if(S.Normalizations.registered[r]&&(a=S.Normalizations.registered[r]("inject",e,a),r=S.Normalizations.registered[r]("name",e)),s=S.Names.prefixCheck(r)[0],8>=d)try{e.style[s]=a}catch(c){b.debug&&console.log("Browser does not support ["+a+"] for ["+s+"]")}else i(e)&&i(e).isSVG&&S.Names.SVGAttribute(r)?e.setAttribute(r,a):e.style[s]=a;b.debug>=2&&console.log("Set "+r+" ("+s+"): "+a)}return[s,a]},flushTransformCache:function(e){function t(t){return parseFloat(S.getPropertyValue(e,t))}var r="";if((d||b.State.isAndroid&&!b.State.isChrome)&&i(e).isSVG){var a={translate:[t("translateX"),t("translateY")],skewX:[t("skewX")],skewY:[t("skewY")],scale:1!==t("scale")?[t("scale"),t("scale")]:[t("scaleX"),t("scaleY")],rotate:[t("rotateZ"),0,0]};f.each(i(e).transformCache,function(e){/^translate/i.test(e)?e="translate":/^scale/i.test(e)?e="scale":/^rotate/i.test(e)&&(e="rotate"),a[e]&&(r+=e+"("+a[e].join(" ")+") ",delete a[e])})}else{var n,o;f.each(i(e).transformCache,function(t){return n=i(e).transformCache[t],"transformPerspective"===t?(o=n,!0):(9===d&&"rotateZ"===t&&(t="rotate"),void(r+=t+n+" "))}),o&&(r="perspective"+o+" "+r)}S.setPropertyValue(e,"transform",r)}};S.Hooks.register(),S.Normalizations.register(),b.hook=function(e,t,r){var n=a;return e=o(e),f.each(e,function(e,o){if(i(o)===a&&b.init(o),r===a)n===a&&(n=b.CSS.getPropertyValue(o,t));else{var s=b.CSS.setPropertyValue(o,t,r);"transform"===s[0]&&b.CSS.flushTransformCache(o),n=s}}),n};var P=function(){function e(){return s?k.promise||null:l}function n(){function e(e){function p(e,t){var r=a,n=a,i=a;return m.isArray(e)?(r=e[0],!m.isArray(e[1])&&/^[\d-]/.test(e[1])||m.isFunction(e[1])||S.RegEx.isHex.test(e[1])?i=e[1]:(m.isString(e[1])&&!S.RegEx.isHex.test(e[1])||m.isArray(e[1]))&&(n=t?e[1]:u(e[1],s.duration),e[2]!==a&&(i=e[2]))):r=e,t||(n=n||s.easing),m.isFunction(r)&&(r=r.call(o,V,w)),m.isFunction(i)&&(i=i.call(o,V,w)),[r||0,n,i]}function d(e,t){var r,a;return a=(t||"0").toString().toLowerCase().replace(/[%A-z]+$/,function(e){return r=e,""}),r||(r=S.Values.getUnitType(e)),[a,r]}function h(){var e={myParent:o.parentNode||r.body,position:S.getPropertyValue(o,"position"),fontSize:S.getPropertyValue(o,"fontSize")},a=e.position===L.lastPosition&&e.myParent===L.lastParent,n=e.fontSize===L.lastFontSize;L.lastParent=e.myParent,L.lastPosition=e.position,L.lastFontSize=e.fontSize;var s=100,l={};if(n&&a)l.emToPx=L.lastEmToPx,l.percentToPxWidth=L.lastPercentToPxWidth,l.percentToPxHeight=L.lastPercentToPxHeight;else{var u=i(o).isSVG?r.createElementNS("http://www.w3.org/2000/svg","rect"):r.createElement("div");b.init(u),e.myParent.appendChild(u),f.each(["overflow","overflowX","overflowY"],function(e,t){b.CSS.setPropertyValue(u,t,"hidden")}),b.CSS.setPropertyValue(u,"position",e.position),b.CSS.setPropertyValue(u,"fontSize",e.fontSize),b.CSS.setPropertyValue(u,"boxSizing","content-box"),f.each(["minWidth","maxWidth","width","minHeight","maxHeight","height"],function(e,t){b.CSS.setPropertyValue(u,t,s+"%")}),b.CSS.setPropertyValue(u,"paddingLeft",s+"em"),l.percentToPxWidth=L.lastPercentToPxWidth=(parseFloat(S.getPropertyValue(u,"width",null,!0))||1)/s,l.percentToPxHeight=L.lastPercentToPxHeight=(parseFloat(S.getPropertyValue(u,"height",null,!0))||1)/s,l.emToPx=L.lastEmToPx=(parseFloat(S.getPropertyValue(u,"paddingLeft"))||1)/s,e.myParent.removeChild(u)}return null===L.remToPx&&(L.remToPx=parseFloat(S.getPropertyValue(r.body,"fontSize"))||16),null===L.vwToPx&&(L.vwToPx=parseFloat(t.innerWidth)/100,L.vhToPx=parseFloat(t.innerHeight)/100),l.remToPx=L.remToPx,l.vwToPx=L.vwToPx,l.vhToPx=L.vhToPx,b.debug>=1&&console.log("Unit ratios: "+JSON.stringify(l),o),l}if(s.begin&&0===V)try{s.begin.call(g,g)}catch(x){setTimeout(function(){throw x},1)}if("scroll"===A){var P,C,T,F=/^x$/i.test(s.axis)?"Left":"Top",j=parseFloat(s.offset)||0;s.container?m.isWrapped(s.container)||m.isNode(s.container)?(s.container=s.container[0]||s.container,P=s.container["scroll"+F],T=P+f(o).position()[F.toLowerCase()]+j):s.container=null:(P=b.State.scrollAnchor[b.State["scrollProperty"+F]],C=b.State.scrollAnchor[b.State["scrollProperty"+("Left"===F?"Top":"Left")]],T=f(o).offset()[F.toLowerCase()]+j),l={scroll:{rootPropertyValue:!1,startValue:P,currentValue:P,endValue:T,unitType:"",easing:s.easing,scrollData:{container:s.container,direction:F,alternateValue:C}},element:o},b.debug&&console.log("tweensContainer (scroll): ",l.scroll,o)}else if("reverse"===A){if(!i(o).tweensContainer)return void f.dequeue(o,s.queue);"none"===i(o).opts.display&&(i(o).opts.display="auto"),"hidden"===i(o).opts.visibility&&(i(o).opts.visibility="visible"),i(o).opts.loop=!1,i(o).opts.begin=null,i(o).opts.complete=null,v.easing||delete s.easing,v.duration||delete s.duration,s=f.extend({},i(o).opts,s);var E=f.extend(!0,{},i(o).tweensContainer);for(var H in E)if("element"!==H){var N=E[H].startValue;E[H].startValue=E[H].currentValue=E[H].endValue,E[H].endValue=N,m.isEmptyObject(v)||(E[H].easing=s.easing),b.debug&&console.log("reverse tweensContainer ("+H+"): "+JSON.stringify(E[H]),o)}l=E}else if("start"===A){var E;i(o).tweensContainer&&i(o).isAnimating===!0&&(E=i(o).tweensContainer),f.each(y,function(e,t){if(RegExp("^"+S.Lists.colors.join("$|^")+"$").test(e)){var r=p(t,!0),n=r[0],o=r[1],i=r[2];if(S.RegEx.isHex.test(n)){for(var s=["Red","Green","Blue"],l=S.Values.hexToRgb(n),u=i?S.Values.hexToRgb(i):a,c=0;c<s.length;c++){var f=[l[c]];o&&f.push(o),u!==a&&f.push(u[c]),y[e+s[c]]=f}delete y[e]}}});for(var z in y){var O=p(y[z]),q=O[0],$=O[1],M=O[2];z=S.Names.camelCase(z);var I=S.Hooks.getRoot(z),B=!1;if(i(o).isSVG||"tween"===I||S.Names.prefixCheck(I)[1]!==!1||S.Normalizations.registered[I]!==a){(s.display!==a&&null!==s.display&&"none"!==s.display||s.visibility!==a&&"hidden"!==s.visibility)&&/opacity|filter/.test(z)&&!M&&0!==q&&(M=0),s._cacheValues&&E&&E[z]?(M===a&&(M=E[z].endValue+E[z].unitType),B=i(o).rootPropertyValueCache[I]):S.Hooks.registered[z]?M===a?(B=S.getPropertyValue(o,I),M=S.getPropertyValue(o,z,B)):B=S.Hooks.templates[I][1]:M===a&&(M=S.getPropertyValue(o,z));var W,G,Y,D=!1;if(W=d(z,M),M=W[0],Y=W[1],W=d(z,q),q=W[0].replace(/^([+-\/*])=/,function(e,t){return D=t,""}),G=W[1],M=parseFloat(M)||0,q=parseFloat(q)||0,"%"===G&&(/^(fontSize|lineHeight)$/.test(z)?(q/=100,G="em"):/^scale/.test(z)?(q/=100,G=""):/(Red|Green|Blue)$/i.test(z)&&(q=q/100*255,G="")),/[\/*]/.test(D))G=Y;else if(Y!==G&&0!==M)if(0===q)G=Y;else{n=n||h();var Q=/margin|padding|left|right|width|text|word|letter/i.test(z)||/X$/.test(z)||"x"===z?"x":"y";switch(Y){case"%":M*="x"===Q?n.percentToPxWidth:n.percentToPxHeight;break;case"px":break;default:M*=n[Y+"ToPx"]}switch(G){case"%":M*=1/("x"===Q?n.percentToPxWidth:n.percentToPxHeight);break;case"px":break;default:M*=1/n[G+"ToPx"]}}switch(D){case"+":q=M+q;break;case"-":q=M-q;break;case"*":q=M*q;break;case"/":q=M/q}l[z]={rootPropertyValue:B,startValue:M,currentValue:M,endValue:q,unitType:G,easing:$},b.debug&&console.log("tweensContainer ("+z+"): "+JSON.stringify(l[z]),o)}else b.debug&&console.log("Skipping ["+I+"] due to a lack of browser support.")}l.element=o}l.element&&(S.Values.addClass(o,"velocity-animating"),R.push(l),""===s.queue&&(i(o).tweensContainer=l,i(o).opts=s),i(o).isAnimating=!0,V===w-1?(b.State.calls.push([R,g,s,null,k.resolver]),b.State.isTicking===!1&&(b.State.isTicking=!0,c())):V++)}var n,o=this,s=f.extend({},b.defaults,v),l={};switch(i(o)===a&&b.init(o),parseFloat(s.delay)&&s.queue!==!1&&f.queue(o,s.queue,function(e){b.velocityQueueEntryFlag=!0,i(o).delayTimer={setTimeout:setTimeout(e,parseFloat(s.delay)),next:e}}),s.duration.toString().toLowerCase()){case"fast":s.duration=200;break;case"normal":s.duration=h;break;case"slow":s.duration=600;break;default:s.duration=parseFloat(s.duration)||1}b.mock!==!1&&(b.mock===!0?s.duration=s.delay=1:(s.duration*=parseFloat(b.mock)||1,s.delay*=parseFloat(b.mock)||1)),s.easing=u(s.easing,s.duration),s.begin&&!m.isFunction(s.begin)&&(s.begin=null),s.progress&&!m.isFunction(s.progress)&&(s.progress=null),s.complete&&!m.isFunction(s.complete)&&(s.complete=null),s.display!==a&&null!==s.display&&(s.display=s.display.toString().toLowerCase(),"auto"===s.display&&(s.display=b.CSS.Values.getDisplayType(o))),s.visibility!==a&&null!==s.visibility&&(s.visibility=s.visibility.toString().toLowerCase()),s.mobileHA=s.mobileHA&&b.State.isMobile&&!b.State.isGingerbread,s.queue===!1?s.delay?setTimeout(e,s.delay):e():f.queue(o,s.queue,function(t,r){return r===!0?(k.promise&&k.resolver(g),!0):(b.velocityQueueEntryFlag=!0,void e(t))}),""!==s.queue&&"fx"!==s.queue||"inprogress"===f.queue(o)[0]||f.dequeue(o)}var s,l,d,g,y,v,x=arguments[0]&&(arguments[0].p||f.isPlainObject(arguments[0].properties)&&!arguments[0].properties.names||m.isString(arguments[0].properties));if(m.isWrapped(this)?(s=!1,d=0,g=this,l=this):(s=!0,d=1,g=x?arguments[0].elements||arguments[0].e:arguments[0]),g=o(g)){x?(y=arguments[0].properties||arguments[0].p,v=arguments[0].options||arguments[0].o):(y=arguments[d],v=arguments[d+1]);var w=g.length,V=0;if(!/^(stop|finish)$/i.test(y)&&!f.isPlainObject(v)){var C=d+1;v={};for(var T=C;T<arguments.length;T++)m.isArray(arguments[T])||!/^(fast|normal|slow)$/i.test(arguments[T])&&!/^\d/.test(arguments[T])?m.isString(arguments[T])||m.isArray(arguments[T])?v.easing=arguments[T]:m.isFunction(arguments[T])&&(v.complete=arguments[T]):v.duration=arguments[T]}var k={promise:null,resolver:null,rejecter:null};s&&b.Promise&&(k.promise=new b.Promise(function(e,t){k.resolver=e,k.rejecter=t}));var A;switch(y){case"scroll":A="scroll";break;case"reverse":A="reverse";break;case"finish":case"stop":f.each(g,function(e,t){i(t)&&i(t).delayTimer&&(clearTimeout(i(t).delayTimer.setTimeout),i(t).delayTimer.next&&i(t).delayTimer.next(),delete i(t).delayTimer)});var F=[];return f.each(b.State.calls,function(e,t){t&&f.each(t[1],function(r,n){var o=v===a?"":v;return o===!0||t[2].queue===o||v===a&&t[2].queue===!1?void f.each(g,function(r,a){a===n&&((v===!0||m.isString(v))&&(f.each(f.queue(a,m.isString(v)?v:""),function(e,t){
+m.isFunction(t)&&t(null,!0)}),f.queue(a,m.isString(v)?v:"",[])),"stop"===y?(i(a)&&i(a).tweensContainer&&o!==!1&&f.each(i(a).tweensContainer,function(e,t){t.endValue=t.currentValue}),F.push(e)):"finish"===y&&(t[2].duration=1))}):!0})}),"stop"===y&&(f.each(F,function(e,t){p(t,!0)}),k.promise&&k.resolver(g)),e();default:if(!f.isPlainObject(y)||m.isEmptyObject(y)){if(m.isString(y)&&b.Redirects[y]){var j=f.extend({},v),E=j.duration,H=j.delay||0;return j.backwards===!0&&(g=f.extend(!0,[],g).reverse()),f.each(g,function(e,t){parseFloat(j.stagger)?j.delay=H+parseFloat(j.stagger)*e:m.isFunction(j.stagger)&&(j.delay=H+j.stagger.call(t,e,w)),j.drag&&(j.duration=parseFloat(E)||(/^(callout|transition)/.test(y)?1e3:h),j.duration=Math.max(j.duration*(j.backwards?1-e/w:(e+1)/w),.75*j.duration,200)),b.Redirects[y].call(t,t,j||{},e,w,g,k.promise?k:a)}),e()}var N="Velocity: First argument ("+y+") was not a property map, a known action, or a registered redirect. Aborting.";return k.promise?k.rejecter(new Error(N)):console.log(N),e()}A="start"}var L={lastParent:null,lastPosition:null,lastFontSize:null,lastPercentToPxWidth:null,lastPercentToPxHeight:null,lastEmToPx:null,remToPx:null,vwToPx:null,vhToPx:null},R=[];f.each(g,function(e,t){m.isNode(t)&&n.call(t)});var z,j=f.extend({},b.defaults,v);if(j.loop=parseInt(j.loop),z=2*j.loop-1,j.loop)for(var O=0;z>O;O++){var q={delay:j.delay,progress:j.progress};O===z-1&&(q.display=j.display,q.visibility=j.visibility,q.complete=j.complete),P(g,"reverse",q)}return e()}};b=f.extend(P,b),b.animate=P;var w=t.requestAnimationFrame||g;return b.State.isMobile||r.hidden===a||r.addEventListener("visibilitychange",function(){r.hidden?(w=function(e){return setTimeout(function(){e(!0)},16)},c()):w=t.requestAnimationFrame||g}),e.Velocity=b,e!==t&&(e.fn.velocity=P,e.fn.velocity.defaults=b.defaults),f.each(["Down","Up"],function(e,t){b.Redirects["slide"+t]=function(e,r,n,o,i,s){var l=f.extend({},r),u=l.begin,c=l.complete,p={height:"",marginTop:"",marginBottom:"",paddingTop:"",paddingBottom:""},d={};l.display===a&&(l.display="Down"===t?"inline"===b.CSS.Values.getDisplayType(e)?"inline-block":"block":"none"),l.begin=function(){u&&u.call(i,i);for(var r in p){d[r]=e.style[r];var a=b.CSS.getPropertyValue(e,r);p[r]="Down"===t?[a,0]:[0,a]}d.overflow=e.style.overflow,e.style.overflow="hidden"},l.complete=function(){for(var t in d)e.style[t]=d[t];c&&c.call(i,i),s&&s.resolver(i)},b(e,p,l)}}),f.each(["In","Out"],function(e,t){b.Redirects["fade"+t]=function(e,r,n,o,i,s){var l=f.extend({},r),u={opacity:"In"===t?1:0},c=l.complete;l.complete=n!==o-1?l.begin=null:function(){c&&c.call(i,i),s&&s.resolver(i)},l.display===a&&(l.display="In"===t?"auto":"none"),b(this,u,l)}}),b}(window.jQuery||window.Zepto||window,window,document)}));
+;!function(a,b,c,d){"use strict";function k(a,b,c){return setTimeout(q(a,c),b)}function l(a,b,c){return Array.isArray(a)?(m(a,c[b],c),!0):!1}function m(a,b,c){var e;if(a)if(a.forEach)a.forEach(b,c);else if(a.length!==d)for(e=0;e<a.length;)b.call(c,a[e],e,a),e++;else for(e in a)a.hasOwnProperty(e)&&b.call(c,a[e],e,a)}function n(a,b,c){for(var e=Object.keys(b),f=0;f<e.length;)(!c||c&&a[e[f]]===d)&&(a[e[f]]=b[e[f]]),f++;return a}function o(a,b){return n(a,b,!0)}function p(a,b,c){var e,d=b.prototype;e=a.prototype=Object.create(d),e.constructor=a,e._super=d,c&&n(e,c)}function q(a,b){return function(){return a.apply(b,arguments)}}function r(a,b){return typeof a==g?a.apply(b?b[0]||d:d,b):a}function s(a,b){return a===d?b:a}function t(a,b,c){m(x(b),function(b){a.addEventListener(b,c,!1)})}function u(a,b,c){m(x(b),function(b){a.removeEventListener(b,c,!1)})}function v(a,b){for(;a;){if(a==b)return!0;a=a.parentNode}return!1}function w(a,b){return a.indexOf(b)>-1}function x(a){return a.trim().split(/\s+/g)}function y(a,b,c){if(a.indexOf&&!c)return a.indexOf(b);for(var d=0;d<a.length;){if(c&&a[d][c]==b||!c&&a[d]===b)return d;d++}return-1}function z(a){return Array.prototype.slice.call(a,0)}function A(a,b,c){for(var d=[],e=[],f=0;f<a.length;){var g=b?a[f][b]:a[f];y(e,g)<0&&d.push(a[f]),e[f]=g,f++}return c&&(d=b?d.sort(function(a,c){return a[b]>c[b]}):d.sort()),d}function B(a,b){for(var c,f,g=b[0].toUpperCase()+b.slice(1),h=0;h<e.length;){if(c=e[h],f=c?c+g:b,f in a)return f;h++}return d}function D(){return C++}function E(a){var b=a.ownerDocument;return b.defaultView||b.parentWindow}function ab(a,b){var c=this;this.manager=a,this.callback=b,this.element=a.element,this.target=a.options.inputTarget,this.domHandler=function(b){r(a.options.enable,[a])&&c.handler(b)},this.init()}function bb(a){var b,c=a.options.inputClass;return b=c?c:H?wb:I?Eb:G?Gb:rb,new b(a,cb)}function cb(a,b,c){var d=c.pointers.length,e=c.changedPointers.length,f=b&O&&0===d-e,g=b&(Q|R)&&0===d-e;c.isFirst=!!f,c.isFinal=!!g,f&&(a.session={}),c.eventType=b,db(a,c),a.emit("hammer.input",c),a.recognize(c),a.session.prevInput=c}function db(a,b){var c=a.session,d=b.pointers,e=d.length;c.firstInput||(c.firstInput=gb(b)),e>1&&!c.firstMultiple?c.firstMultiple=gb(b):1===e&&(c.firstMultiple=!1);var f=c.firstInput,g=c.firstMultiple,h=g?g.center:f.center,i=b.center=hb(d);b.timeStamp=j(),b.deltaTime=b.timeStamp-f.timeStamp,b.angle=lb(h,i),b.distance=kb(h,i),eb(c,b),b.offsetDirection=jb(b.deltaX,b.deltaY),b.scale=g?nb(g.pointers,d):1,b.rotation=g?mb(g.pointers,d):0,fb(c,b);var k=a.element;v(b.srcEvent.target,k)&&(k=b.srcEvent.target),b.target=k}function eb(a,b){var c=b.center,d=a.offsetDelta||{},e=a.prevDelta||{},f=a.prevInput||{};(b.eventType===O||f.eventType===Q)&&(e=a.prevDelta={x:f.deltaX||0,y:f.deltaY||0},d=a.offsetDelta={x:c.x,y:c.y}),b.deltaX=e.x+(c.x-d.x),b.deltaY=e.y+(c.y-d.y)}function fb(a,b){var f,g,h,j,c=a.lastInterval||b,e=b.timeStamp-c.timeStamp;if(b.eventType!=R&&(e>N||c.velocity===d)){var k=c.deltaX-b.deltaX,l=c.deltaY-b.deltaY,m=ib(e,k,l);g=m.x,h=m.y,f=i(m.x)>i(m.y)?m.x:m.y,j=jb(k,l),a.lastInterval=b}else f=c.velocity,g=c.velocityX,h=c.velocityY,j=c.direction;b.velocity=f,b.velocityX=g,b.velocityY=h,b.direction=j}function gb(a){for(var b=[],c=0;c<a.pointers.length;)b[c]={clientX:h(a.pointers[c].clientX),clientY:h(a.pointers[c].clientY)},c++;return{timeStamp:j(),pointers:b,center:hb(b),deltaX:a.deltaX,deltaY:a.deltaY}}function hb(a){var b=a.length;if(1===b)return{x:h(a[0].clientX),y:h(a[0].clientY)};for(var c=0,d=0,e=0;b>e;)c+=a[e].clientX,d+=a[e].clientY,e++;return{x:h(c/b),y:h(d/b)}}function ib(a,b,c){return{x:b/a||0,y:c/a||0}}function jb(a,b){return a===b?S:i(a)>=i(b)?a>0?T:U:b>0?V:W}function kb(a,b,c){c||(c=$);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return Math.sqrt(d*d+e*e)}function lb(a,b,c){c||(c=$);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return 180*Math.atan2(e,d)/Math.PI}function mb(a,b){return lb(b[1],b[0],_)-lb(a[1],a[0],_)}function nb(a,b){return kb(b[0],b[1],_)/kb(a[0],a[1],_)}function rb(){this.evEl=pb,this.evWin=qb,this.allow=!0,this.pressed=!1,ab.apply(this,arguments)}function wb(){this.evEl=ub,this.evWin=vb,ab.apply(this,arguments),this.store=this.manager.session.pointerEvents=[]}function Ab(){this.evTarget=yb,this.evWin=zb,this.started=!1,ab.apply(this,arguments)}function Bb(a,b){var c=z(a.touches),d=z(a.changedTouches);return b&(Q|R)&&(c=A(c.concat(d),"identifier",!0)),[c,d]}function Eb(){this.evTarget=Db,this.targetIds={},ab.apply(this,arguments)}function Fb(a,b){var c=z(a.touches),d=this.targetIds;if(b&(O|P)&&1===c.length)return d[c[0].identifier]=!0,[c,c];var e,f,g=z(a.changedTouches),h=[],i=this.target;if(f=c.filter(function(a){return v(a.target,i)}),b===O)for(e=0;e<f.length;)d[f[e].identifier]=!0,e++;for(e=0;e<g.length;)d[g[e].identifier]&&h.push(g[e]),b&(Q|R)&&delete d[g[e].identifier],e++;return h.length?[A(f.concat(h),"identifier",!0),h]:void 0}function Gb(){ab.apply(this,arguments);var a=q(this.handler,this);this.touch=new Eb(this.manager,a),this.mouse=new rb(this.manager,a)}function Pb(a,b){this.manager=a,this.set(b)}function Qb(a){if(w(a,Mb))return Mb;var b=w(a,Nb),c=w(a,Ob);return b&&c?Nb+" "+Ob:b||c?b?Nb:Ob:w(a,Lb)?Lb:Kb}function Yb(a){this.id=D(),this.manager=null,this.options=o(a||{},this.defaults),this.options.enable=s(this.options.enable,!0),this.state=Rb,this.simultaneous={},this.requireFail=[]}function Zb(a){return a&Wb?"cancel":a&Ub?"end":a&Tb?"move":a&Sb?"start":""}function $b(a){return a==W?"down":a==V?"up":a==T?"left":a==U?"right":""}function _b(a,b){var c=b.manager;return c?c.get(a):a}function ac(){Yb.apply(this,arguments)}function bc(){ac.apply(this,arguments),this.pX=null,this.pY=null}function cc(){ac.apply(this,arguments)}function dc(){Yb.apply(this,arguments),this._timer=null,this._input=null}function ec(){ac.apply(this,arguments)}function fc(){ac.apply(this,arguments)}function gc(){Yb.apply(this,arguments),this.pTime=!1,this.pCenter=!1,this._timer=null,this._input=null,this.count=0}function hc(a,b){return b=b||{},b.recognizers=s(b.recognizers,hc.defaults.preset),new kc(a,b)}function kc(a,b){b=b||{},this.options=o(b,hc.defaults),this.options.inputTarget=this.options.inputTarget||a,this.handlers={},this.session={},this.recognizers=[],this.element=a,this.input=bb(this),this.touchAction=new Pb(this,this.options.touchAction),lc(this,!0),m(b.recognizers,function(a){var b=this.add(new a[0](a[1]));a[2]&&b.recognizeWith(a[2]),a[3]&&b.requireFailure(a[3])},this)}function lc(a,b){var c=a.element;m(a.options.cssProps,function(a,d){c.style[B(c.style,d)]=b?a:""})}function mc(a,c){var d=b.createEvent("Event");d.initEvent(a,!0,!0),d.gesture=c,c.target.dispatchEvent(d)}var e=["","webkit","moz","MS","ms","o"],f=b.createElement("div"),g="function",h=Math.round,i=Math.abs,j=Date.now,C=1,F=/mobile|tablet|ip(ad|hone|od)|android/i,G="ontouchstart"in a,H=B(a,"PointerEvent")!==d,I=G&&F.test(navigator.userAgent),J="touch",K="pen",L="mouse",M="kinect",N=25,O=1,P=2,Q=4,R=8,S=1,T=2,U=4,V=8,W=16,X=T|U,Y=V|W,Z=X|Y,$=["x","y"],_=["clientX","clientY"];ab.prototype={handler:function(){},init:function(){this.evEl&&t(this.element,this.evEl,this.domHandler),this.evTarget&&t(this.target,this.evTarget,this.domHandler),this.evWin&&t(E(this.element),this.evWin,this.domHandler)},destroy:function(){this.evEl&&u(this.element,this.evEl,this.domHandler),this.evTarget&&u(this.target,this.evTarget,this.domHandler),this.evWin&&u(E(this.element),this.evWin,this.domHandler)}};var ob={mousedown:O,mousemove:P,mouseup:Q},pb="mousedown",qb="mousemove mouseup";p(rb,ab,{handler:function(a){var b=ob[a.type];b&O&&0===a.button&&(this.pressed=!0),b&P&&1!==a.which&&(b=Q),this.pressed&&this.allow&&(b&Q&&(this.pressed=!1),this.callback(this.manager,b,{pointers:[a],changedPointers:[a],pointerType:L,srcEvent:a}))}});var sb={pointerdown:O,pointermove:P,pointerup:Q,pointercancel:R,pointerout:R},tb={2:J,3:K,4:L,5:M},ub="pointerdown",vb="pointermove pointerup pointercancel";a.MSPointerEvent&&(ub="MSPointerDown",vb="MSPointerMove MSPointerUp MSPointerCancel"),p(wb,ab,{handler:function(a){var b=this.store,c=!1,d=a.type.toLowerCase().replace("ms",""),e=sb[d],f=tb[a.pointerType]||a.pointerType,g=f==J,h=y(b,a.pointerId,"pointerId");e&O&&(0===a.button||g)?0>h&&(b.push(a),h=b.length-1):e&(Q|R)&&(c=!0),0>h||(b[h]=a,this.callback(this.manager,e,{pointers:b,changedPointers:[a],pointerType:f,srcEvent:a}),c&&b.splice(h,1))}});var xb={touchstart:O,touchmove:P,touchend:Q,touchcancel:R},yb="touchstart",zb="touchstart touchmove touchend touchcancel";p(Ab,ab,{handler:function(a){var b=xb[a.type];if(b===O&&(this.started=!0),this.started){var c=Bb.call(this,a,b);b&(Q|R)&&0===c[0].length-c[1].length&&(this.started=!1),this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:J,srcEvent:a})}}});var Cb={touchstart:O,touchmove:P,touchend:Q,touchcancel:R},Db="touchstart touchmove touchend touchcancel";p(Eb,ab,{handler:function(a){var b=Cb[a.type],c=Fb.call(this,a,b);c&&this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:J,srcEvent:a})}}),p(Gb,ab,{handler:function(a,b,c){var d=c.pointerType==J,e=c.pointerType==L;if(d)this.mouse.allow=!1;else if(e&&!this.mouse.allow)return;b&(Q|R)&&(this.mouse.allow=!0),this.callback(a,b,c)},destroy:function(){this.touch.destroy(),this.mouse.destroy()}});var Hb=B(f.style,"touchAction"),Ib=Hb!==d,Jb="compute",Kb="auto",Lb="manipulation",Mb="none",Nb="pan-x",Ob="pan-y";Pb.prototype={set:function(a){a==Jb&&(a=this.compute()),Ib&&(this.manager.element.style[Hb]=a),this.actions=a.toLowerCase().trim()},update:function(){this.set(this.manager.options.touchAction)},compute:function(){var a=[];return m(this.manager.recognizers,function(b){r(b.options.enable,[b])&&(a=a.concat(b.getTouchAction()))}),Qb(a.join(" "))},preventDefaults:function(a){if(!Ib){var b=a.srcEvent,c=a.offsetDirection;if(this.manager.session.prevented)return b.preventDefault(),void 0;var d=this.actions,e=w(d,Mb),f=w(d,Ob),g=w(d,Nb);return e||f&&c&X||g&&c&Y?this.preventSrc(b):void 0}},preventSrc:function(a){this.manager.session.prevented=!0,a.preventDefault()}};var Rb=1,Sb=2,Tb=4,Ub=8,Vb=Ub,Wb=16,Xb=32;Yb.prototype={defaults:{},set:function(a){return n(this.options,a),this.manager&&this.manager.touchAction.update(),this},recognizeWith:function(a){if(l(a,"recognizeWith",this))return this;var b=this.simultaneous;return a=_b(a,this),b[a.id]||(b[a.id]=a,a.recognizeWith(this)),this},dropRecognizeWith:function(a){return l(a,"dropRecognizeWith",this)?this:(a=_b(a,this),delete this.simultaneous[a.id],this)},requireFailure:function(a){if(l(a,"requireFailure",this))return this;var b=this.requireFail;return a=_b(a,this),-1===y(b,a)&&(b.push(a),a.requireFailure(this)),this},dropRequireFailure:function(a){if(l(a,"dropRequireFailure",this))return this;a=_b(a,this);var b=y(this.requireFail,a);return b>-1&&this.requireFail.splice(b,1),this},hasRequireFailures:function(){return this.requireFail.length>0},canRecognizeWith:function(a){return!!this.simultaneous[a.id]},emit:function(a){function d(d){b.manager.emit(b.options.event+(d?Zb(c):""),a)}var b=this,c=this.state;Ub>c&&d(!0),d(),c>=Ub&&d(!0)},tryEmit:function(a){return this.canEmit()?this.emit(a):(this.state=Xb,void 0)},canEmit:function(){for(var a=0;a<this.requireFail.length;){if(!(this.requireFail[a].state&(Xb|Rb)))return!1;a++}return!0},recognize:function(a){var b=n({},a);return r(this.options.enable,[this,b])?(this.state&(Vb|Wb|Xb)&&(this.state=Rb),this.state=this.process(b),this.state&(Sb|Tb|Ub|Wb)&&this.tryEmit(b),void 0):(this.reset(),this.state=Xb,void 0)},process:function(){},getTouchAction:function(){},reset:function(){}},p(ac,Yb,{defaults:{pointers:1},attrTest:function(a){var b=this.options.pointers;return 0===b||a.pointers.length===b},process:function(a){var b=this.state,c=a.eventType,d=b&(Sb|Tb),e=this.attrTest(a);return d&&(c&R||!e)?b|Wb:d||e?c&Q?b|Ub:b&Sb?b|Tb:Sb:Xb}}),p(bc,ac,{defaults:{event:"pan",threshold:10,pointers:1,direction:Z},getTouchAction:function(){var a=this.options.direction,b=[];return a&X&&b.push(Ob),a&Y&&b.push(Nb),b},directionTest:function(a){var b=this.options,c=!0,d=a.distance,e=a.direction,f=a.deltaX,g=a.deltaY;return e&b.direction||(b.direction&X?(e=0===f?S:0>f?T:U,c=f!=this.pX,d=Math.abs(a.deltaX)):(e=0===g?S:0>g?V:W,c=g!=this.pY,d=Math.abs(a.deltaY))),a.direction=e,c&&d>b.threshold&&e&b.direction},attrTest:function(a){return ac.prototype.attrTest.call(this,a)&&(this.state&Sb||!(this.state&Sb)&&this.directionTest(a))},emit:function(a){this.pX=a.deltaX,this.pY=a.deltaY;var b=$b(a.direction);b&&this.manager.emit(this.options.event+b,a),this._super.emit.call(this,a)}}),p(cc,ac,{defaults:{event:"pinch",threshold:0,pointers:2},getTouchAction:function(){return[Mb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.scale-1)>this.options.threshold||this.state&Sb)},emit:function(a){if(this._super.emit.call(this,a),1!==a.scale){var b=a.scale<1?"in":"out";this.manager.emit(this.options.event+b,a)}}}),p(dc,Yb,{defaults:{event:"press",pointers:1,time:500,threshold:5},getTouchAction:function(){return[Kb]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance<b.threshold,e=a.deltaTime>b.time;if(this._input=a,!d||!c||a.eventType&(Q|R)&&!e)this.reset();else if(a.eventType&O)this.reset(),this._timer=k(function(){this.state=Vb,this.tryEmit()},b.time,this);else if(a.eventType&Q)return Vb;return Xb},reset:function(){clearTimeout(this._timer)},emit:function(a){this.state===Vb&&(a&&a.eventType&Q?this.manager.emit(this.options.event+"up",a):(this._input.timeStamp=j(),this.manager.emit(this.options.event,this._input)))}}),p(ec,ac,{defaults:{event:"rotate",threshold:0,pointers:2},getTouchAction:function(){return[Mb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.rotation)>this.options.threshold||this.state&Sb)}}),p(fc,ac,{defaults:{event:"swipe",threshold:10,velocity:.65,direction:X|Y,pointers:1},getTouchAction:function(){return bc.prototype.getTouchAction.call(this)},attrTest:function(a){var c,b=this.options.direction;return b&(X|Y)?c=a.velocity:b&X?c=a.velocityX:b&Y&&(c=a.velocityY),this._super.attrTest.call(this,a)&&b&a.direction&&a.distance>this.options.threshold&&i(c)>this.options.velocity&&a.eventType&Q},emit:function(a){var b=$b(a.direction);b&&this.manager.emit(this.options.event+b,a),this.manager.emit(this.options.event,a)}}),p(gc,Yb,{defaults:{event:"tap",pointers:1,taps:1,interval:300,time:250,threshold:2,posThreshold:10},getTouchAction:function(){return[Lb]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance<b.threshold,e=a.deltaTime<b.time;if(this.reset(),a.eventType&O&&0===this.count)return this.failTimeout();if(d&&e&&c){if(a.eventType!=Q)return this.failTimeout();var f=this.pTime?a.timeStamp-this.pTime<b.interval:!0,g=!this.pCenter||kb(this.pCenter,a.center)<b.posThreshold;this.pTime=a.timeStamp,this.pCenter=a.center,g&&f?this.count+=1:this.count=1,this._input=a;var h=this.count%b.taps;if(0===h)return this.hasRequireFailures()?(this._timer=k(function(){this.state=Vb,this.tryEmit()},b.interval,this),Sb):Vb}return Xb},failTimeout:function(){return this._timer=k(function(){this.state=Xb},this.options.interval,this),Xb},reset:function(){clearTimeout(this._timer)},emit:function(){this.state==Vb&&(this._input.tapCount=this.count,this.manager.emit(this.options.event,this._input))}}),hc.VERSION="2.0.4",hc.defaults={domEvents:!1,touchAction:Jb,enable:!0,inputTarget:null,inputClass:null,preset:[[ec,{enable:!1}],[cc,{enable:!1},["rotate"]],[fc,{direction:X}],[bc,{direction:X},["swipe"]],[gc],[gc,{event:"doubletap",taps:2},["tap"]],[dc]],cssProps:{userSelect:"default",touchSelect:"none",touchCallout:"none",contentZooming:"none",userDrag:"none",tapHighlightColor:"rgba(0,0,0,0)"}};var ic=1,jc=2;kc.prototype={set:function(a){return n(this.options,a),a.touchAction&&this.touchAction.update(),a.inputTarget&&(this.input.destroy(),this.input.target=a.inputTarget,this.input.init()),this},stop:function(a){this.session.stopped=a?jc:ic},recognize:function(a){var b=this.session;if(!b.stopped){this.touchAction.preventDefaults(a);var c,d=this.recognizers,e=b.curRecognizer;(!e||e&&e.state&Vb)&&(e=b.curRecognizer=null);for(var f=0;f<d.length;)c=d[f],b.stopped===jc||e&&c!=e&&!c.canRecognizeWith(e)?c.reset():c.recognize(a),!e&&c.state&(Sb|Tb|Ub)&&(e=b.curRecognizer=c),f++}},get:function(a){if(a instanceof Yb)return a;for(var b=this.recognizers,c=0;c<b.length;c++)if(b[c].options.event==a)return b[c];return null},add:function(a){if(l(a,"add",this))return this;var b=this.get(a.options.event);return b&&this.remove(b),this.recognizers.push(a),a.manager=this,this.touchAction.update(),a},remove:function(a){if(l(a,"remove",this))return this;var b=this.recognizers;return a=this.get(a),b.splice(y(b,a),1),this.touchAction.update(),this},on:function(a,b){var c=this.handlers;return m(x(a),function(a){c[a]=c[a]||[],c[a].push(b)}),this},off:function(a,b){var c=this.handlers;return m(x(a),function(a){b?c[a].splice(y(c[a],b),1):delete c[a]}),this},emit:function(a,b){this.options.domEvents&&mc(a,b);var c=this.handlers[a]&&this.handlers[a].slice();if(c&&c.length){b.type=a,b.preventDefault=function(){b.srcEvent.preventDefault()};for(var d=0;d<c.length;)c[d](b),d++}},destroy:function(){this.element&&lc(this,!1),this.handlers={},this.session={},this.input.destroy(),this.element=null}},n(hc,{INPUT_START:O,INPUT_MOVE:P,INPUT_END:Q,INPUT_CANCEL:R,STATE_POSSIBLE:Rb,STATE_BEGAN:Sb,STATE_CHANGED:Tb,STATE_ENDED:Ub,STATE_RECOGNIZED:Vb,STATE_CANCELLED:Wb,STATE_FAILED:Xb,DIRECTION_NONE:S,DIRECTION_LEFT:T,DIRECTION_RIGHT:U,DIRECTION_UP:V,DIRECTION_DOWN:W,DIRECTION_HORIZONTAL:X,DIRECTION_VERTICAL:Y,DIRECTION_ALL:Z,Manager:kc,Input:ab,TouchAction:Pb,TouchInput:Eb,MouseInput:rb,PointerEventInput:wb,TouchMouseInput:Gb,SingleTouchInput:Ab,Recognizer:Yb,AttrRecognizer:ac,Tap:gc,Pan:bc,Swipe:fc,Pinch:cc,Rotate:ec,Press:dc,on:t,off:u,each:m,merge:o,extend:n,inherit:p,bindFn:q,prefixed:B}),typeof define==g&&define.amd?define(function(){return hc}):"undefined"!=typeof module&&module.exports?module.exports=hc:a[c]=hc}(window,document,"Hammer");;(function(factory) {
+ if (typeof define === 'function' && define.amd) {
+ define(['jquery', 'hammerjs'], factory);
+ } else if (typeof exports === 'object') {
+ factory(require('jquery'), require('hammerjs'));
+ } else {
+ factory(jQuery, Hammer);
+ }
+}(function($, Hammer) {
+ function hammerify(el, options) {
+ var $el = $(el);
+ if(!$el.data("hammer")) {
+ $el.data("hammer", new Hammer($el[0], options));
+ }
+ }
+
+ $.fn.hammer = function(options) {
+ return this.each(function() {
+ hammerify(this, options);
+ });
+ };
+
+ // extend the emit method to also trigger jQuery events
+ Hammer.Manager.prototype.emit = (function(originalEmit) {
+ return function(type, data) {
+ originalEmit.call(this, type, data);
+ $(this.element).trigger({
+ type: type,
+ gesture: data
+ });
+ };
+ })(Hammer.Manager.prototype.emit);
+}));
+;// Required for Meteor package, the use of window prevents export by Meteor
+(function(window){
+ if(window.Package){
+ Materialize = {};
+ } else {
+ window.Materialize = {};
+ }
+})(window);
+
+
+/*
+ * raf.js
+ * https://github.com/ngryman/raf.js
+ *
+ * original requestAnimationFrame polyfill by Erik Möller
+ * inspired from paul_irish gist and post
+ *
+ * Copyright (c) 2013 ngryman
+ * Licensed under the MIT license.
+ */
+(function(window) {
+ var lastTime = 0,
+ vendors = ['webkit', 'moz'],
+ requestAnimationFrame = window.requestAnimationFrame,
+ cancelAnimationFrame = window.cancelAnimationFrame,
+ i = vendors.length;
+
+ // try to un-prefix existing raf
+ while (--i >= 0 && !requestAnimationFrame) {
+ requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame'];
+ cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame'];
+ }
+
+ // polyfill with setTimeout fallback
+ // heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945
+ if (!requestAnimationFrame || !cancelAnimationFrame) {
+ requestAnimationFrame = function(callback) {
+ var now = +Date.now(),
+ nextTime = Math.max(lastTime + 16, now);
+ return setTimeout(function() {
+ callback(lastTime = nextTime);
+ }, nextTime - now);
+ };
+
+ cancelAnimationFrame = clearTimeout;
+ }
+
+ // export to window
+ window.requestAnimationFrame = requestAnimationFrame;
+ window.cancelAnimationFrame = cancelAnimationFrame;
+}(window));
+
+
+/**
+ * Generate approximated selector string for a jQuery object
+ * @param {jQuery} obj jQuery object to be parsed
+ * @returns {string}
+ */
+Materialize.objectSelectorString = function(obj) {
+ var tagStr = obj.prop('tagName') || '';
+ var idStr = obj.attr('id') || '';
+ var classStr = obj.attr('class') || '';
+ return (tagStr + idStr + classStr).replace(/\s/g,'');
+};
+
+
+// Unique Random ID
+Materialize.guid = (function() {
+ function s4() {
+ return Math.floor((1 + Math.random()) * 0x10000)
+ .toString(16)
+ .substring(1);
+ }
+ return function() {
+ return s4() + s4() + '-' + s4() + '-' + s4() + '-' +
+ s4() + '-' + s4() + s4() + s4();
+ };
+})();
+
+/**
+ * Escapes hash from special characters
+ * @param {string} hash String returned from this.hash
+ * @returns {string}
+ */
+Materialize.escapeHash = function(hash) {
+ return hash.replace( /(:|\.|\[|\]|,|=)/g, "\\$1" );
+};
+
+Materialize.elementOrParentIsFixed = function(element) {
+ var $element = $(element);
+ var $checkElements = $element.add($element.parents());
+ var isFixed = false;
+ $checkElements.each(function(){
+ if ($(this).css("position") === "fixed") {
+ isFixed = true;
+ return false;
+ }
+ });
+ return isFixed;
+};
+
+
+/**
+ * Get time in ms
+ * @license https://raw.github.com/jashkenas/underscore/master/LICENSE
+ * @type {function}
+ * @return {number}
+ */
+var getTime = (Date.now || function () {
+ return new Date().getTime();
+});
+
+
+/**
+ * Returns a function, that, when invoked, will only be triggered at most once
+ * during a given window of time. Normally, the throttled function will run
+ * as much as it can, without ever going more than once per `wait` duration;
+ * but if you'd like to disable the execution on the leading edge, pass
+ * `{leading: false}`. To disable execution on the trailing edge, ditto.
+ * @license https://raw.github.com/jashkenas/underscore/master/LICENSE
+ * @param {function} func
+ * @param {number} wait
+ * @param {Object=} options
+ * @returns {Function}
+ */
+Materialize.throttle = function(func, wait, options) {
+ var context, args, result;
+ var timeout = null;
+ var previous = 0;
+ options || (options = {});
+ var later = function () {
+ previous = options.leading === false ? 0 : getTime();
+ timeout = null;
+ result = func.apply(context, args);
+ context = args = null;
+ };
+ return function () {
+ var now = getTime();
+ if (!previous && options.leading === false) previous = now;
+ var remaining = wait - (now - previous);
+ context = this;
+ args = arguments;
+ if (remaining <= 0) {
+ clearTimeout(timeout);
+ timeout = null;
+ previous = now;
+ result = func.apply(context, args);
+ context = args = null;
+ } else if (!timeout && options.trailing !== false) {
+ timeout = setTimeout(later, remaining);
+ }
+ return result;
+ };
+};
+
+
+// Velocity has conflicts when loaded with jQuery, this will check for it
+// First, check if in noConflict mode
+var Vel;
+if (jQuery) {
+ Vel = jQuery.Velocity;
+} else if ($) {
+ Vel = $.Velocity;
+} else {
+ Vel = Velocity;
+}
+;(function ($) {
+ $.fn.collapsible = function(options, methodParam) {
+ var defaults = {
+ accordion: undefined,
+ onOpen: undefined,
+ onClose: undefined
+ };
+
+ var methodName = options;
+ options = $.extend(defaults, options);
+
+
+ return this.each(function() {
+
+ var $this = $(this);
+
+ var $panel_headers = $(this).find('> li > .collapsible-header');
+
+ var collapsible_type = $this.data("collapsible");
+
+ /****************
+ Helper Functions
+ ****************/
+
+ // Accordion Open
+ function accordionOpen(object) {
+ $panel_headers = $this.find('> li > .collapsible-header');
+ if (object.hasClass('active')) {
+ object.parent().addClass('active');
+ }
+ else {
+ object.parent().removeClass('active');
+ }
+ if (object.parent().hasClass('active')){
+ object.siblings('.collapsible-body').stop(true,false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}});
+ }
+ else{
+ object.siblings('.collapsible-body').stop(true,false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}});
+ }
+
+ $panel_headers.not(object).removeClass('active').parent().removeClass('active');
+
+ // Close previously open accordion elements.
+ $panel_headers.not(object).parent().children('.collapsible-body').stop(true,false).each(function() {
+ if ($(this).is(':visible')) {
+ $(this).slideUp({
+ duration: 350,
+ easing: "easeOutQuart",
+ queue: false,
+ complete:
+ function() {
+ $(this).css('height', '');
+ execCallbacks($(this).siblings('.collapsible-header'));
+ }
+ });
+ }
+ });
+ }
+
+ // Expandable Open
+ function expandableOpen(object) {
+ if (object.hasClass('active')) {
+ object.parent().addClass('active');
+ }
+ else {
+ object.parent().removeClass('active');
+ }
+ if (object.parent().hasClass('active')){
+ object.siblings('.collapsible-body').stop(true,false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}});
+ }
+ else {
+ object.siblings('.collapsible-body').stop(true,false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}});
+ }
+ }
+
+ // Open collapsible. object: .collapsible-header
+ function collapsibleOpen(object, noToggle) {
+ if (!noToggle) {
+ object.toggleClass('active');
+ }
+
+ if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion
+ accordionOpen(object);
+ } else { // Handle Expandables
+ expandableOpen(object);
+ }
+
+ execCallbacks(object);
+ }
+
+ // Handle callbacks
+ function execCallbacks(object) {
+ if (object.hasClass('active')) {
+ if (typeof(options.onOpen) === "function") {
+ options.onOpen.call(this, object.parent());
+ }
+ } else {
+ if (typeof(options.onClose) === "function") {
+ options.onClose.call(this, object.parent());
+ }
+ }
+ }
+
+ /**
+ * Check if object is children of panel header
+ * @param {Object} object Jquery object
+ * @return {Boolean} true if it is children
+ */
+ function isChildrenOfPanelHeader(object) {
+
+ var panelHeader = getPanelHeader(object);
+
+ return panelHeader.length > 0;
+ }
+
+ /**
+ * Get panel header from a children element
+ * @param {Object} object Jquery object
+ * @return {Object} panel header object
+ */
+ function getPanelHeader(object) {
+
+ return object.closest('li > .collapsible-header');
+ }
+
+
+ // Turn off any existing event handlers
+ function removeEventHandlers() {
+ $this.off('click.collapse', '> li > .collapsible-header');
+ }
+
+ /***** End Helper Functions *****/
+
+
+ // Methods
+ if (methodName === 'destroy') {
+ removeEventHandlers();
+ return;
+ } else if (methodParam >= 0 &&
+ methodParam < $panel_headers.length) {
+ var $curr_header = $panel_headers.eq(methodParam);
+ if ($curr_header.length &&
+ (methodName === 'open' ||
+ (methodName === 'close' &&
+ $curr_header.hasClass('active')))) {
+ collapsibleOpen($curr_header);
+ }
+ return;
+ }
+
+
+ removeEventHandlers();
+
+
+ // Add click handler to only direct collapsible header children
+ $this.on('click.collapse', '> li > .collapsible-header', function(e) {
+ var element = $(e.target);
+
+ if (isChildrenOfPanelHeader(element)) {
+ element = getPanelHeader(element);
+ }
+
+ collapsibleOpen(element);
+ });
+
+
+ // Open first active
+ if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion
+ collapsibleOpen($panel_headers.filter('.active').first(), true);
+
+ } else { // Handle Expandables
+ $panel_headers.filter('.active').each(function() {
+ collapsibleOpen($(this), true);
+ });
+ }
+
+ });
+ };
+
+ $(document).ready(function(){
+ $('.collapsible').collapsible();
+ });
+}( jQuery ));;(function ($) {
+
+ // Add posibility to scroll to selected option
+ // usefull for select for example
+ $.fn.scrollTo = function(elem) {
+ $(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top);
+ return this;
+ };
+
+ $.fn.dropdown = function (options) {
+ var defaults = {
+ inDuration: 300,
+ outDuration: 225,
+ constrainWidth: true, // Constrains width of dropdown to the activator
+ hover: false,
+ gutter: 0, // Spacing from edge
+ belowOrigin: false,
+ alignment: 'left',
+ stopPropagation: false
+ };
+
+ // Open dropdown.
+ if (options === "open") {
+ this.each(function() {
+ $(this).trigger('open');
+ });
+ return false;
+ }
+
+ // Close dropdown.
+ if (options === "close") {
+ this.each(function() {
+ $(this).trigger('close');
+ });
+ return false;
+ }
+
+ this.each(function(){
+ var origin = $(this);
+ var curr_options = $.extend({}, defaults, options);
+ var isFocused = false;
+
+ // Dropdown menu
+ var activates = $("#"+ origin.attr('data-activates'));
+
+ function updateOptions() {
+ if (origin.data('induration') !== undefined)
+ curr_options.inDuration = origin.data('induration');
+ if (origin.data('outduration') !== undefined)
+ curr_options.outDuration = origin.data('outduration');
+ if (origin.data('constrainwidth') !== undefined)
+ curr_options.constrainWidth = origin.data('constrainwidth');
+ if (origin.data('hover') !== undefined)
+ curr_options.hover = origin.data('hover');
+ if (origin.data('gutter') !== undefined)
+ curr_options.gutter = origin.data('gutter');
+ if (origin.data('beloworigin') !== undefined)
+ curr_options.belowOrigin = origin.data('beloworigin');
+ if (origin.data('alignment') !== undefined)
+ curr_options.alignment = origin.data('alignment');
+ if (origin.data('stoppropagation') !== undefined)
+ curr_options.stopPropagation = origin.data('stoppropagation');
+ }
+
+ updateOptions();
+
+ // Attach dropdown to its activator
+ origin.after(activates);
+
+ /*
+ Helper function to position and resize dropdown.
+ Used in hover and click handler.
+ */
+ function placeDropdown(eventType) {
+ // Check for simultaneous focus and click events.
+ if (eventType === 'focus') {
+ isFocused = true;
+ }
+
+ // Check html data attributes
+ updateOptions();
+
+ // Set Dropdown state
+ activates.addClass('active');
+ origin.addClass('active');
+
+ // Constrain width
+ if (curr_options.constrainWidth === true) {
+ activates.css('width', origin.outerWidth());
+
+ } else {
+ activates.css('white-space', 'nowrap');
+ }
+
+ // Offscreen detection
+ var windowHeight = window.innerHeight;
+ var originHeight = origin.innerHeight();
+ var offsetLeft = origin.offset().left;
+ var offsetTop = origin.offset().top - $(window).scrollTop();
+ var currAlignment = curr_options.alignment;
+ var gutterSpacing = 0;
+ var leftPosition = 0;
+
+ // Below Origin
+ var verticalOffset = 0;
+ if (curr_options.belowOrigin === true) {
+ verticalOffset = originHeight;
+ }
+
+ // Check for scrolling positioned container.
+ var scrollYOffset = 0;
+ var scrollXOffset = 0;
+ var wrapper = origin.parent();
+ if (!wrapper.is('body')) {
+ if (wrapper[0].scrollHeight > wrapper[0].clientHeight) {
+ scrollYOffset = wrapper[0].scrollTop;
+ }
+ if (wrapper[0].scrollWidth > wrapper[0].clientWidth) {
+ scrollXOffset = wrapper[0].scrollLeft;
+ }
+ }
+
+
+ if (offsetLeft + activates.innerWidth() > $(window).width()) {
+ // Dropdown goes past screen on right, force right alignment
+ currAlignment = 'right';
+
+ } else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) {
+ // Dropdown goes past screen on left, force left alignment
+ currAlignment = 'left';
+ }
+ // Vertical bottom offscreen detection
+ if (offsetTop + activates.innerHeight() > windowHeight) {
+ // If going upwards still goes offscreen, just crop height of dropdown.
+ if (offsetTop + originHeight - activates.innerHeight() < 0) {
+ var adjustedHeight = windowHeight - offsetTop - verticalOffset;
+ activates.css('max-height', adjustedHeight);
+ } else {
+ // Flow upwards.
+ if (!verticalOffset) {
+ verticalOffset += originHeight;
+ }
+ verticalOffset -= activates.innerHeight();
+ }
+ }
+
+ // Handle edge alignment
+ if (currAlignment === 'left') {
+ gutterSpacing = curr_options.gutter;
+ leftPosition = origin.position().left + gutterSpacing;
+ }
+ else if (currAlignment === 'right') {
+ // Material icons fix
+ activates
+ .stop(true, true)
+ .css({
+ opacity: 0,
+ left: 0
+ })
+
+ var offsetRight = origin.position().left + origin.outerWidth() - activates.outerWidth();
+ gutterSpacing = -curr_options.gutter;
+ leftPosition = offsetRight + gutterSpacing;
+ }
+
+ // Position dropdown
+ activates.css({
+ position: 'absolute',
+ top: origin.position().top + verticalOffset + scrollYOffset,
+ left: leftPosition + scrollXOffset
+ });
+
+ // Show dropdown
+ activates
+ .slideDown({
+ queue: false,
+ duration: curr_options.inDuration,
+ easing: 'easeOutCubic',
+ complete: function() {
+ $(this).css('height', '');
+ }
+ })
+ .animate( {opacity: 1}, {queue: false, duration: curr_options.inDuration, easing: 'easeOutSine'});
+
+ // Add click close handler to document
+ setTimeout(function() {
+ $(document).on('click.'+ activates.attr('id'), function (e) {
+ hideDropdown();
+ $(document).off('click.'+ activates.attr('id'));
+ });
+ }, 0);
+ }
+
+ function hideDropdown() {
+ // Check for simultaneous focus and click events.
+ isFocused = false;
+ activates.fadeOut(curr_options.outDuration);
+ activates.removeClass('active');
+ origin.removeClass('active');
+ $(document).off('click.'+ activates.attr('id'));
+ setTimeout(function() { activates.css('max-height', ''); }, curr_options.outDuration);
+ }
+
+ // Hover
+ if (curr_options.hover) {
+ var open = false;
+ origin.off('click.' + origin.attr('id'));
+ // Hover handler to show dropdown
+ origin.on('mouseenter', function(e){ // Mouse over
+ if (open === false) {
+ placeDropdown();
+ open = true;
+ }
+ });
+ origin.on('mouseleave', function(e){
+ // If hover on origin then to something other than dropdown content, then close
+ var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element
+ if(!$(toEl).closest('.dropdown-content').is(activates)) {
+ activates.stop(true, true);
+ hideDropdown();
+ open = false;
+ }
+ });
+
+ activates.on('mouseleave', function(e){ // Mouse out
+ var toEl = e.toElement || e.relatedTarget;
+ if(!$(toEl).closest('.dropdown-button').is(origin)) {
+ activates.stop(true, true);
+ hideDropdown();
+ open = false;
+ }
+ });
+
+ // Click
+ } else {
+ // Click handler to show dropdown
+ origin.off('click.' + origin.attr('id'));
+ origin.on('click.'+origin.attr('id'), function(e){
+ if (!isFocused) {
+ if ( origin[0] == e.currentTarget &&
+ !origin.hasClass('active') &&
+ ($(e.target).closest('.dropdown-content').length === 0)) {
+ e.preventDefault(); // Prevents button click from moving window
+ if (curr_options.stopPropagation) {
+ e.stopPropagation();
+ }
+ placeDropdown('click');
+ }
+ // If origin is clicked and menu is open, close menu
+ else if (origin.hasClass('active')) {
+ hideDropdown();
+ $(document).off('click.'+ activates.attr('id'));
+ }
+ }
+ });
+
+ } // End else
+
+ // Listen to open and close event - useful for select component
+ origin.on('open', function(e, eventType) {
+ placeDropdown(eventType);
+ });
+ origin.on('close', hideDropdown);
+
+
+ });
+ }; // End dropdown plugin
+
+ $(document).ready(function(){
+ $('.dropdown-button').dropdown();
+ });
+}( jQuery ));
+;(function($) {
+ var _stack = 0,
+ _lastID = 0,
+ _generateID = function() {
+ _lastID++;
+ return 'materialize-modal-overlay-' + _lastID;
+ };
+
+ var methods = {
+ init : function(options) {
+ var defaults = {
+ opacity: 0.5,
+ inDuration: 350,
+ outDuration: 250,
+ ready: undefined,
+ complete: undefined,
+ dismissible: true,
+ startingTop: '4%',
+ endingTop: '10%'
+ };
+
+ // Override defaults
+ options = $.extend(defaults, options);
+
+ return this.each(function() {
+ var $modal = $(this);
+ var modal_id = $(this).attr("id") || '#' + $(this).data('target');
+
+ var closeModal = function() {
+ var overlayID = $modal.data('overlay-id');
+ var $overlay = $('#' + overlayID);
+ $modal.removeClass('open');
+
+ // Enable scrolling
+ $('body').css({
+ overflow: '',
+ width: ''
+ });
+
+ $modal.find('.modal-close').off('click.close');
+ $(document).off('keyup.modal' + overlayID);
+
+ $overlay.velocity( { opacity: 0}, {duration: options.outDuration, queue: false, ease: "easeOutQuart"});
+
+
+ // Define Bottom Sheet animation
+ var exitVelocityOptions = {
+ duration: options.outDuration,
+ queue: false,
+ ease: "easeOutCubic",
+ // Handle modal ready callback
+ complete: function() {
+ $(this).css({display:"none"});
+
+ // Call complete callback
+ if (typeof(options.complete) === "function") {
+ options.complete.call(this, $modal);
+ }
+ $overlay.remove();
+ _stack--;
+ }
+ };
+ if ($modal.hasClass('bottom-sheet')) {
+ $modal.velocity({bottom: "-100%", opacity: 0}, exitVelocityOptions);
+ }
+ else {
+ $modal.velocity(
+ { top: options.startingTop, opacity: 0, scaleX: 0.7},
+ exitVelocityOptions
+ );
+ }
+ };
+
+ var openModal = function($trigger) {
+ var $body = $('body');
+ var oldWidth = $body.innerWidth();
+ $body.css('overflow', 'hidden');
+ $body.width(oldWidth);
+
+ if ($modal.hasClass('open')) {
+ return;
+ }
+
+ var overlayID = _generateID();
+ var $overlay = $('<div class="modal-overlay"></div>');
+ var lStack = (++_stack);
+
+ // Store a reference of the overlay
+ $overlay.attr('id', overlayID).css('z-index', 1000 + lStack * 2);
+ $modal.data('overlay-id', overlayID).css('z-index', 1000 + lStack * 2 + 1);
+ $modal.addClass('open');
+
+ $("body").append($overlay);
+
+ if (options.dismissible) {
+ $overlay.click(function() {
+ closeModal();
+ });
+ // Return on ESC
+ $(document).on('keyup.modal' + overlayID, function(e) {
+ if (e.keyCode === 27) { // ESC key
+ closeModal();
+ }
+ });
+ }
+
+ $modal.find(".modal-close").on('click.close', function(e) {
+ closeModal();
+ });
+
+ $overlay.css({ display : "block", opacity : 0 });
+
+ $modal.css({
+ display : "block",
+ opacity: 0
+ });
+
+ $overlay.velocity({opacity: options.opacity}, {duration: options.inDuration, queue: false, ease: "easeOutCubic"});
+ $modal.data('associated-overlay', $overlay[0]);
+
+ // Define Bottom Sheet animation
+ var enterVelocityOptions = {
+ duration: options.inDuration,
+ queue: false,
+ ease: "easeOutCubic",
+ // Handle modal ready callback
+ complete: function() {
+ if (typeof(options.ready) === "function") {
+ options.ready.call(this, $modal, $trigger);
+ }
+ }
+ };
+ if ($modal.hasClass('bottom-sheet')) {
+ $modal.velocity({bottom: "0", opacity: 1}, enterVelocityOptions);
+ }
+ else {
+ $.Velocity.hook($modal, "scaleX", 0.7);
+ $modal.css({ top: options.startingTop });
+ $modal.velocity({top: options.endingTop, opacity: 1, scaleX: '1'}, enterVelocityOptions);
+ }
+
+ };
+
+ // Reset handlers
+ $(document).off('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]');
+ $(this).off('openModal');
+ $(this).off('closeModal');
+
+ // Close Handlers
+ $(document).on('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]', function(e) {
+ options.startingTop = ($(this).offset().top - $(window).scrollTop()) /1.15;
+ openModal($(this));
+ e.preventDefault();
+ }); // done set on click
+
+ $(this).on('openModal', function() {
+ var modal_id = $(this).attr("href") || '#' + $(this).data('target');
+ openModal();
+ });
+
+ $(this).on('closeModal', function() {
+ closeModal();
+ });
+ }); // done return
+ },
+ open : function() {
+ methods.init.apply( this, arguments );
+ $(this).trigger('openModal');
+ },
+ close : function() {
+ $(this).trigger('closeModal');
+ }
+ };
+
+ $.fn.modal = function(methodOrOptions) {
+ if ( methods[methodOrOptions] ) {
+ return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
+ } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
+ // Default to "init"
+ return methods.init.apply( this, arguments );
+ } else {
+ $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.modal' );
+ }
+ };
+})(jQuery);
+;(function ($) {
+
+ $.fn.materialbox = function () {
+
+ return this.each(function() {
+
+ if ($(this).hasClass('initialized')) {
+ return;
+ }
+
+ $(this).addClass('initialized');
+
+ var overlayActive = false;
+ var doneAnimating = true;
+ var inDuration = 275;
+ var outDuration = 200;
+ var origin = $(this);
+ var placeholder = $('<div></div>').addClass('material-placeholder');
+ var originalWidth = 0;
+ var originalHeight = 0;
+ var ancestorsChanged;
+ var ancestor;
+ var originInlineStyles = origin.attr('style');
+ origin.wrap(placeholder);
+
+
+ // Start click handler
+ origin.on('click', function() {
+ var placeholder = origin.parent('.material-placeholder');
+ var windowWidth = window.innerWidth;
+ var windowHeight = window.innerHeight;
+ var originalWidth = origin.width();
+ var originalHeight = origin.height();
+
+
+ // If already modal, return to original
+ if (doneAnimating === false) {
+ returnToOriginal();
+ return false;
+ }
+ else if (overlayActive && doneAnimating===true) {
+ returnToOriginal();
+ return false;
+ }
+
+
+ // Set states
+ doneAnimating = false;
+ origin.addClass('active');
+ overlayActive = true;
+
+ // Set positioning for placeholder
+ placeholder.css({
+ width: placeholder[0].getBoundingClientRect().width,
+ height: placeholder[0].getBoundingClientRect().height,
+ position: 'relative',
+ top: 0,
+ left: 0
+ });
+
+ // Find ancestor with overflow: hidden; and remove it
+ ancestorsChanged = undefined;
+ ancestor = placeholder[0].parentNode;
+ var count = 0;
+ while (ancestor !== null && !$(ancestor).is(document)) {
+ var curr = $(ancestor);
+ if (curr.css('overflow') !== 'visible') {
+ curr.css('overflow', 'visible');
+ if (ancestorsChanged === undefined) {
+ ancestorsChanged = curr;
+ }
+ else {
+ ancestorsChanged = ancestorsChanged.add(curr);
+ }
+ }
+ ancestor = ancestor.parentNode;
+ }
+
+ // Set css on origin
+ origin.css({
+ position: 'absolute',
+ 'z-index': 1000,
+ 'will-change': 'left, top, width, height'
+ })
+ .data('width', originalWidth)
+ .data('height', originalHeight);
+
+ // Add overlay
+ var overlay = $('<div id="materialbox-overlay"></div>')
+ .css({
+ opacity: 0
+ })
+ .click(function(){
+ if (doneAnimating === true)
+ returnToOriginal();
+ });
+
+ // Put before in origin image to preserve z-index layering.
+ origin.before(overlay);
+
+ // Set dimensions if needed
+ var overlayOffset = overlay[0].getBoundingClientRect();
+ overlay.css({
+ width: windowWidth,
+ height: windowHeight,
+ left: -1 * overlayOffset.left,
+ top: -1 * overlayOffset.top
+ })
+
+ // Animate Overlay
+ overlay.velocity({opacity: 1},
+ {duration: inDuration, queue: false, easing: 'easeOutQuad'} );
+
+ // Add and animate caption if it exists
+ if (origin.data('caption') !== "") {
+ var $photo_caption = $('<div class="materialbox-caption"></div>');
+ $photo_caption.text(origin.data('caption'));
+ $('body').append($photo_caption);
+ $photo_caption.css({ "display": "inline" });
+ $photo_caption.velocity({opacity: 1}, {duration: inDuration, queue: false, easing: 'easeOutQuad'});
+ }
+
+ // Resize Image
+ var ratio = 0;
+ var widthPercent = originalWidth / windowWidth;
+ var heightPercent = originalHeight / windowHeight;
+ var newWidth = 0;
+ var newHeight = 0;
+
+ if (widthPercent > heightPercent) {
+ ratio = originalHeight / originalWidth;
+ newWidth = windowWidth * 0.9;
+ newHeight = windowWidth * 0.9 * ratio;
+ }
+ else {
+ ratio = originalWidth / originalHeight;
+ newWidth = (windowHeight * 0.9) * ratio;
+ newHeight = windowHeight * 0.9;
+ }
+
+ // Animate image + set z-index
+ if(origin.hasClass('responsive-img')) {
+ origin.velocity({'max-width': newWidth, 'width': originalWidth}, {duration: 0, queue: false,
+ complete: function(){
+ origin.css({left: 0, top: 0})
+ .velocity(
+ {
+ height: newHeight,
+ width: newWidth,
+ left: $(document).scrollLeft() + windowWidth/2 - origin.parent('.material-placeholder').offset().left - newWidth/2,
+ top: $(document).scrollTop() + windowHeight/2 - origin.parent('.material-placeholder').offset().top - newHeight/ 2
+ },
+ {
+ duration: inDuration,
+ queue: false,
+ easing: 'easeOutQuad',
+ complete: function(){doneAnimating = true;}
+ }
+ );
+ } // End Complete
+ }); // End Velocity
+ }
+ else {
+ origin.css('left', 0)
+ .css('top', 0)
+ .velocity(
+ {
+ height: newHeight,
+ width: newWidth,
+ left: $(document).scrollLeft() + windowWidth/2 - origin.parent('.material-placeholder').offset().left - newWidth/2,
+ top: $(document).scrollTop() + windowHeight/2 - origin.parent('.material-placeholder').offset().top - newHeight/ 2
+ },
+ {
+ duration: inDuration,
+ queue: false,
+ easing: 'easeOutQuad',
+ complete: function(){doneAnimating = true;}
+ }
+ ); // End Velocity
+ }
+
+ // Handle Exit triggers
+ $(window).on('scroll.materialbox', function() {
+ if (overlayActive) {
+ returnToOriginal();
+ }
+ });
+
+ $(window).on('resize.materialbox', function() {
+ if (overlayActive) {
+ returnToOriginal();
+ }
+ });
+
+ $(document).on('keyup.materialbox', function(e) {
+ // ESC key
+ if (e.keyCode === 27 &&
+ doneAnimating === true &&
+ overlayActive) {
+ returnToOriginal();
+ }
+ });
+
+ }); // End click handler
+
+
+ // This function returns the modaled image to the original spot
+ function returnToOriginal() {
+
+ doneAnimating = false;
+
+ var placeholder = origin.parent('.material-placeholder');
+ var windowWidth = window.innerWidth;
+ var windowHeight = window.innerHeight;
+ var originalWidth = origin.data('width');
+ var originalHeight = origin.data('height');
+
+ origin.velocity("stop", true);
+ $('#materialbox-overlay').velocity("stop", true);
+ $('.materialbox-caption').velocity("stop", true);
+
+ // disable exit handlers
+ $(window).off('scroll.materialbox');
+ $(document).off('keyup.materialbox');
+ $(window).off('resize.materialbox');
+
+ $('#materialbox-overlay').velocity({opacity: 0}, {
+ duration: outDuration, // Delay prevents animation overlapping
+ queue: false, easing: 'easeOutQuad',
+ complete: function(){
+ // Remove Overlay
+ overlayActive = false;
+ $(this).remove();
+ }
+ });
+
+ // Resize Image
+ origin.velocity(
+ {
+ width: originalWidth,
+ height: originalHeight,
+ left: 0,
+ top: 0
+ },
+ {
+ duration: outDuration,
+ queue: false, easing: 'easeOutQuad',
+ complete: function() {
+ placeholder.css({
+ height: '',
+ width: '',
+ position: '',
+ top: '',
+ left: ''
+ });
+
+ origin.removeAttr('style');
+ origin.attr('style', originInlineStyles);
+
+ // Remove class
+ origin.removeClass('active');
+ doneAnimating = true;
+
+ // Remove overflow overrides on ancestors
+ if (ancestorsChanged) {
+ ancestorsChanged.css('overflow', '');
+ }
+ }
+ }
+ );
+
+ // Remove Caption + reset css settings on image
+ $('.materialbox-caption').velocity({opacity: 0}, {
+ duration: outDuration, // Delay prevents animation overlapping
+ queue: false, easing: 'easeOutQuad',
+ complete: function(){
+ $(this).remove();
+ }
+ });
+
+ }
+ });
+ };
+
+ $(document).ready(function(){
+ $('.materialboxed').materialbox();
+ });
+
+}( jQuery ));
+;(function ($) {
+
+ $.fn.parallax = function () {
+ var window_width = $(window).width();
+ // Parallax Scripts
+ return this.each(function(i) {
+ var $this = $(this);
+ $this.addClass('parallax');
+
+ function updateParallax(initial) {
+ var container_height;
+ if (window_width < 601) {
+ container_height = ($this.height() > 0) ? $this.height() : $this.children("img").height();
+ }
+ else {
+ container_height = ($this.height() > 0) ? $this.height() : 500;
+ }
+ var $img = $this.children("img").first();
+ var img_height = $img.height();
+ var parallax_dist = img_height - container_height;
+ var bottom = $this.offset().top + container_height;
+ var top = $this.offset().top;
+ var scrollTop = $(window).scrollTop();
+ var windowHeight = window.innerHeight;
+ var windowBottom = scrollTop + windowHeight;
+ var percentScrolled = (windowBottom - top) / (container_height + windowHeight);
+ var parallax = Math.round((parallax_dist * percentScrolled));
+
+ if (initial) {
+ $img.css('display', 'block');
+ }
+ if ((bottom > scrollTop) && (top < (scrollTop + windowHeight))) {
+ $img.css('transform', "translate3D(-50%," + parallax + "px, 0)");
+ }
+
+ }
+
+ // Wait for image load
+ $this.children("img").one("load", function() {
+ updateParallax(true);
+ }).each(function() {
+ if (this.complete) $(this).trigger("load");
+ });
+
+ $(window).scroll(function() {
+ window_width = $(window).width();
+ updateParallax(false);
+ });
+
+ $(window).resize(function() {
+ window_width = $(window).width();
+ updateParallax(false);
+ });
+
+ });
+
+ };
+}( jQuery ));
+;(function ($) {
+
+ var methods = {
+ init : function(options) {
+ var defaults = {
+ onShow: null,
+ swipeable: false,
+ responsiveThreshold: Infinity, // breakpoint for swipeable
+ };
+ options = $.extend(defaults, options);
+ var namespace = Materialize.objectSelectorString($(this));
+
+ return this.each(function(i) {
+
+ var uniqueNamespace = namespace+i;
+
+ // For each set of tabs, we want to keep track of
+ // which tab is active and its associated content
+ var $this = $(this),
+ window_width = $(window).width();
+
+ var $active, $content, $links = $this.find('li.tab a'),
+ $tabs_width = $this.width(),
+ $tabs_content = $(),
+ $tabs_wrapper,
+ $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length,
+ $indicator,
+ index = prev_index = 0,
+ clicked = false,
+ clickedTimeout,
+ transition = 300;
+
+
+ // Finds right attribute for indicator based on active tab.
+ // el: jQuery Object
+ var calcRightPos = function(el) {
+ return Math.ceil($tabs_width - el.position().left - el.outerWidth() - $this.scrollLeft());
+ };
+
+ // Finds left attribute for indicator based on active tab.
+ // el: jQuery Object
+ var calcLeftPos = function(el) {
+ return Math.floor(el.position().left + $this.scrollLeft());
+ };
+
+ // Animates Indicator to active tab.
+ // prev_index: Number
+ var animateIndicator = function(prev_index) {
+ if ((index - prev_index) >= 0) {
+ $indicator.velocity({"right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad'});
+ $indicator.velocity({"left": calcLeftPos($active) }, {duration: transition, queue: false, easing: 'easeOutQuad', delay: 90});
+
+ } else {
+ $indicator.velocity({"left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad'});
+ $indicator.velocity({"right": calcRightPos($active) }, {duration: transition, queue: false, easing: 'easeOutQuad', delay: 90});
+ }
+ };
+
+ // Change swipeable according to responsive threshold
+ if (options.swipeable) {
+ if (window_width > options.responsiveThreshold) {
+ options.swipeable = false;
+ }
+ }
+
+
+ // If the location.hash matches one of the links, use that as the active tab.
+ $active = $($links.filter('[href="'+location.hash+'"]'));
+
+ // If no match is found, use the first link or any with class 'active' as the initial active tab.
+ if ($active.length === 0) {
+ $active = $(this).find('li.tab a.active').first();
+ }
+ if ($active.length === 0) {
+ $active = $(this).find('li.tab a').first();
+ }
+
+ $active.addClass('active');
+ index = $links.index($active);
+ if (index < 0) {
+ index = 0;
+ }
+
+ if ($active[0] !== undefined) {
+ $content = $($active[0].hash);
+ $content.addClass('active');
+ }
+
+ // append indicator then set indicator width to tab width
+ if (!$this.find('.indicator').length) {
+ $this.append('<li class="indicator"></li>');
+ }
+ $indicator = $this.find('.indicator');
+
+ // we make sure that the indicator is at the end of the tabs
+ $this.append($indicator);
+
+ if ($this.is(":visible")) {
+ // $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)});
+ // $indicator.css({"left": index * $tab_width});
+ setTimeout(function() {
+ $indicator.css({"right": calcRightPos($active) });
+ $indicator.css({"left": calcLeftPos($active) });
+ }, 0);
+ }
+ $(window).off('resize.tabs-'+uniqueNamespace).on('resize.tabs-'+uniqueNamespace, function () {
+ $tabs_width = $this.width();
+ $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
+ if (index < 0) {
+ index = 0;
+ }
+ if ($tab_width !== 0 && $tabs_width !== 0) {
+ $indicator.css({"right": calcRightPos($active) });
+ $indicator.css({"left": calcLeftPos($active) });
+ }
+ });
+
+ // Initialize Tabs Content.
+ if (options.swipeable) {
+ // TODO: Duplicate calls with swipeable? handle multiple div wrapping.
+ $links.each(function () {
+ var $curr_content = $(Materialize.escapeHash(this.hash));
+ $curr_content.addClass('carousel-item');
+ $tabs_content = $tabs_content.add($curr_content);
+ });
+ $tabs_wrapper = $tabs_content.wrapAll('<div class="tabs-content carousel"></div>');
+ $tabs_content.css('display', '');
+ $('.tabs-content.carousel').carousel({
+ fullWidth: true,
+ noWrap: true,
+ onCycleTo: function(item) {
+ if (!clicked) {
+ var prev_index = index;
+ index = $tabs_wrapper.index(item);
+ $active = $links.eq(index);
+ animateIndicator(prev_index);
+ if (typeof(options.onShow) === "function") {
+ options.onShow.call($this[0], $content);
+ }
+ }
+ },
+ });
+ } else {
+ // Hide the remaining content
+ $links.not($active).each(function () {
+ $(Materialize.escapeHash(this.hash)).hide();
+ });
+ }
+
+
+ // Bind the click event handler
+ $this.off('click.tabs').on('click.tabs', 'a', function(e) {
+ if ($(this).parent().hasClass('disabled')) {
+ e.preventDefault();
+ return;
+ }
+
+ // Act as regular link if target attribute is specified.
+ if (!!$(this).attr("target")) {
+ return;
+ }
+
+ clicked = true;
+ $tabs_width = $this.width();
+ $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
+
+ // Make the old tab inactive.
+ $active.removeClass('active');
+ var $oldContent = $content
+
+ // Update the variables with the new link and content
+ $active = $(this);
+ $content = $(Materialize.escapeHash(this.hash));
+ $links = $this.find('li.tab a');
+ var activeRect = $active.position();
+
+ // Make the tab active.
+ $active.addClass('active');
+ prev_index = index;
+ index = $links.index($(this));
+ if (index < 0) {
+ index = 0;
+ }
+ // Change url to current tab
+ // window.location.hash = $active.attr('href');
+
+ // Swap content
+ if (options.swipeable) {
+ if ($tabs_content.length) {
+ $tabs_content.carousel('set', index, function() {
+ if (typeof(options.onShow) === "function") {
+ options.onShow.call($this[0], $content);
+ }
+ });
+ }
+ } else {
+ if ($content !== undefined) {
+ $content.show();
+ $content.addClass('active');
+ if (typeof(options.onShow) === "function") {
+ options.onShow.call(this, $content);
+ }
+ }
+
+ if ($oldContent !== undefined &&
+ !$oldContent.is($content)) {
+ $oldContent.hide();
+ $oldContent.removeClass('active');
+ }
+ }
+
+ // Reset clicked state
+ clickedTimeout = setTimeout(function(){ clicked = false; }, transition);
+
+ // Update indicator
+ animateIndicator(prev_index);
+
+ // Prevent the anchor's default click action
+ e.preventDefault();
+ });
+ });
+
+ },
+ select_tab : function( id ) {
+ this.find('a[href="#' + id + '"]').trigger('click');
+ }
+ };
+
+ $.fn.tabs = function(methodOrOptions) {
+ if ( methods[methodOrOptions] ) {
+ return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
+ } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
+ // Default to "init"
+ return methods.init.apply( this, arguments );
+ } else {
+ $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.tabs' );
+ }
+ };
+
+ $(document).ready(function(){
+ $('ul.tabs').tabs();
+ });
+}( jQuery ));
+;(function ($) {
+ $.fn.tooltip = function (options) {
+ var timeout = null,
+ margin = 5;
+
+ // Defaults
+ var defaults = {
+ delay: 350,
+ tooltip: '',
+ position: 'bottom',
+ html: false
+ };
+
+ // Remove tooltip from the activator
+ if (options === "remove") {
+ this.each(function() {
+ $('#' + $(this).attr('data-tooltip-id')).remove();
+ $(this).off('mouseenter.tooltip mouseleave.tooltip');
+ });
+ return false;
+ }
+
+ options = $.extend(defaults, options);
+
+ return this.each(function() {
+ var tooltipId = Materialize.guid();
+ var origin = $(this);
+
+ // Destroy old tooltip
+ if (origin.attr('data-tooltip-id')) {
+ $('#' + origin.attr('data-tooltip-id')).remove();
+ }
+
+ origin.attr('data-tooltip-id', tooltipId);
+
+ // Get attributes.
+ var allowHtml,
+ tooltipDelay,
+ tooltipPosition,
+ tooltipText,
+ tooltipEl,
+ backdrop;
+ var setAttributes = function() {
+ allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html;
+ tooltipDelay = origin.attr('data-delay');
+ tooltipDelay = (tooltipDelay === undefined || tooltipDelay === '') ?
+ options.delay : tooltipDelay;
+ tooltipPosition = origin.attr('data-position');
+ tooltipPosition = (tooltipPosition === undefined || tooltipPosition === '') ?
+ options.position : tooltipPosition;
+ tooltipText = origin.attr('data-tooltip');
+ tooltipText = (tooltipText === undefined || tooltipText === '') ?
+ options.tooltip : tooltipText;
+ };
+ setAttributes();
+
+ var renderTooltipEl = function() {
+ var tooltip = $('<div class="material-tooltip"></div>');
+
+ // Create Text span
+ if (allowHtml) {
+ tooltipText = $('<span></span>').html(tooltipText);
+ } else{
+ tooltipText = $('<span></span>').text(tooltipText);
+ }
+
+ // Create tooltip
+ tooltip.append(tooltipText)
+ .appendTo($('body'))
+ .attr('id', tooltipId);
+
+ // Create backdrop
+ backdrop = $('<div class="backdrop"></div>');
+ backdrop.appendTo(tooltip);
+ return tooltip;
+ };
+ tooltipEl = renderTooltipEl();
+
+ // Destroy previously binded events
+ origin.off('mouseenter.tooltip mouseleave.tooltip');
+ // Mouse In
+ var started = false, timeoutRef;
+ origin.on({'mouseenter.tooltip': function(e) {
+ var showTooltip = function() {
+ setAttributes();
+ started = true;
+ tooltipEl.velocity('stop');
+ backdrop.velocity('stop');
+ tooltipEl.css({ visibility: 'visible', left: '0px', top: '0px' });
+
+ // Tooltip positioning
+ var originWidth = origin.outerWidth();
+ var originHeight = origin.outerHeight();
+ var tooltipHeight = tooltipEl.outerHeight();
+ var tooltipWidth = tooltipEl.outerWidth();
+ var tooltipVerticalMovement = '0px';
+ var tooltipHorizontalMovement = '0px';
+ var backdropOffsetWidth = backdrop[0].offsetWidth;
+ var backdropOffsetHeight = backdrop[0].offsetHeight;
+ var scaleXFactor = 8;
+ var scaleYFactor = 8;
+ var scaleFactor = 0;
+ var targetTop, targetLeft, newCoordinates;
+
+ if (tooltipPosition === "top") {
+ // Top Position
+ targetTop = origin.offset().top - tooltipHeight - margin;
+ targetLeft = origin.offset().left + originWidth/2 - tooltipWidth/2;
+ newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+ tooltipVerticalMovement = '-10px';
+ backdrop.css({
+ bottom: 0,
+ left: 0,
+ borderRadius: '14px 14px 0 0',
+ transformOrigin: '50% 100%',
+ marginTop: tooltipHeight,
+ marginLeft: (tooltipWidth/2) - (backdropOffsetWidth/2)
+ });
+ }
+ // Left Position
+ else if (tooltipPosition === "left") {
+ targetTop = origin.offset().top + originHeight/2 - tooltipHeight/2;
+ targetLeft = origin.offset().left - tooltipWidth - margin;
+ newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+
+ tooltipHorizontalMovement = '-10px';
+ backdrop.css({
+ top: '-7px',
+ right: 0,
+ width: '14px',
+ height: '14px',
+ borderRadius: '14px 0 0 14px',
+ transformOrigin: '95% 50%',
+ marginTop: tooltipHeight/2,
+ marginLeft: tooltipWidth
+ });
+ }
+ // Right Position
+ else if (tooltipPosition === "right") {
+ targetTop = origin.offset().top + originHeight/2 - tooltipHeight/2;
+ targetLeft = origin.offset().left + originWidth + margin;
+ newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+
+ tooltipHorizontalMovement = '+10px';
+ backdrop.css({
+ top: '-7px',
+ left: 0,
+ width: '14px',
+ height: '14px',
+ borderRadius: '0 14px 14px 0',
+ transformOrigin: '5% 50%',
+ marginTop: tooltipHeight/2,
+ marginLeft: '0px'
+ });
+ }
+ else {
+ // Bottom Position
+ targetTop = origin.offset().top + origin.outerHeight() + margin;
+ targetLeft = origin.offset().left + originWidth/2 - tooltipWidth/2;
+ newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+ tooltipVerticalMovement = '+10px';
+ backdrop.css({
+ top: 0,
+ left: 0,
+ marginLeft: (tooltipWidth/2) - (backdropOffsetWidth/2)
+ });
+ }
+
+ // Set tooptip css placement
+ tooltipEl.css({
+ top: newCoordinates.y,
+ left: newCoordinates.x
+ });
+
+ // Calculate Scale to fill
+ scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth);
+ scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight);
+ scaleFactor = Math.max(scaleXFactor, scaleYFactor);
+
+ tooltipEl.velocity({ translateY: tooltipVerticalMovement, translateX: tooltipHorizontalMovement}, { duration: 350, queue: false })
+ .velocity({opacity: 1}, {duration: 300, delay: 50, queue: false});
+ backdrop.css({ visibility: 'visible' })
+ .velocity({opacity:1},{duration: 55, delay: 0, queue: false})
+ .velocity({scaleX: scaleFactor, scaleY: scaleFactor}, {duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad'});
+ };
+
+ timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval
+
+ // Mouse Out
+ },
+ 'mouseleave.tooltip': function(){
+ // Reset State
+ started = false;
+ clearTimeout(timeoutRef);
+
+ // Animate back
+ setTimeout(function() {
+ if (started !== true) {
+ tooltipEl.velocity({
+ opacity: 0, translateY: 0, translateX: 0}, { duration: 225, queue: false});
+ backdrop.velocity({opacity: 0, scaleX: 1, scaleY: 1}, {
+ duration:225,
+ queue: false,
+ complete: function(){
+ backdrop.css({ visibility: 'hidden' });
+ tooltipEl.css({ visibility: 'hidden' });
+ started = false;}
+ });
+ }
+ },225);
+ }
+ });
+ });
+ };
+
+ var repositionWithinScreen = function(x, y, width, height) {
+ var newX = x;
+ var newY = y;
+
+ if (newX < 0) {
+ newX = 4;
+ } else if (newX + width > window.innerWidth) {
+ newX -= newX + width - window.innerWidth;
+ }
+
+ if (newY < 0) {
+ newY = 4;
+ } else if (newY + height > window.innerHeight + $(window).scrollTop) {
+ newY -= newY + height - window.innerHeight;
+ }
+
+ return {x: newX, y: newY};
+ };
+
+ $(document).ready(function(){
+ $('.tooltipped').tooltip();
+ });
+}( jQuery ));
+;/*!
+ * Waves v0.6.4
+ * http://fian.my.id/Waves
+ *
+ * Copyright 2014 Alfiana E. Sibuea and other contributors
+ * Released under the MIT license
+ * https://github.com/fians/Waves/blob/master/LICENSE
+ */
+
+;(function(window) {
+ 'use strict';
+
+ var Waves = Waves || {};
+ var $$ = document.querySelectorAll.bind(document);
+
+ // Find exact position of element
+ function isWindow(obj) {
+ return obj !== null && obj === obj.window;
+ }
+
+ function getWindow(elem) {
+ return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView;
+ }
+
+ function offset(elem) {
+ var docElem, win,
+ box = {top: 0, left: 0},
+ doc = elem && elem.ownerDocument;
+
+ docElem = doc.documentElement;
+
+ if (typeof elem.getBoundingClientRect !== typeof undefined) {
+ box = elem.getBoundingClientRect();
+ }
+ win = getWindow(doc);
+ return {
+ top: box.top + win.pageYOffset - docElem.clientTop,
+ left: box.left + win.pageXOffset - docElem.clientLeft
+ };
+ }
+
+ function convertStyle(obj) {
+ var style = '';
+
+ for (var a in obj) {
+ if (obj.hasOwnProperty(a)) {
+ style += (a + ':' + obj[a] + ';');
+ }
+ }
+
+ return style;
+ }
+
+ var Effect = {
+
+ // Effect delay
+ duration: 750,
+
+ show: function(e, element) {
+
+ // Disable right click
+ if (e.button === 2) {
+ return false;
+ }
+
+ var el = element || this;
+
+ // Create ripple
+ var ripple = document.createElement('div');
+ ripple.className = 'waves-ripple';
+ el.appendChild(ripple);
+
+ // Get click coordinate and element witdh
+ var pos = offset(el);
+ var relativeY = (e.pageY - pos.top);
+ var relativeX = (e.pageX - pos.left);
+ var scale = 'scale('+((el.clientWidth / 100) * 10)+')';
+
+ // Support for touch devices
+ if ('touches' in e) {
+ relativeY = (e.touches[0].pageY - pos.top);
+ relativeX = (e.touches[0].pageX - pos.left);
+ }
+
+ // Attach data to element
+ ripple.setAttribute('data-hold', Date.now());
+ ripple.setAttribute('data-scale', scale);
+ ripple.setAttribute('data-x', relativeX);
+ ripple.setAttribute('data-y', relativeY);
+
+ // Set ripple position
+ var rippleStyle = {
+ 'top': relativeY+'px',
+ 'left': relativeX+'px'
+ };
+
+ ripple.className = ripple.className + ' waves-notransition';
+ ripple.setAttribute('style', convertStyle(rippleStyle));
+ ripple.className = ripple.className.replace('waves-notransition', '');
+
+ // Scale the ripple
+ rippleStyle['-webkit-transform'] = scale;
+ rippleStyle['-moz-transform'] = scale;
+ rippleStyle['-ms-transform'] = scale;
+ rippleStyle['-o-transform'] = scale;
+ rippleStyle.transform = scale;
+ rippleStyle.opacity = '1';
+
+ rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms';
+ rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms';
+ rippleStyle['-o-transition-duration'] = Effect.duration + 'ms';
+ rippleStyle['transition-duration'] = Effect.duration + 'ms';
+
+ rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+ rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+ rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+ rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+
+ ripple.setAttribute('style', convertStyle(rippleStyle));
+ },
+
+ hide: function(e) {
+ TouchHandler.touchup(e);
+
+ var el = this;
+ var width = el.clientWidth * 1.4;
+
+ // Get first ripple
+ var ripple = null;
+ var ripples = el.getElementsByClassName('waves-ripple');
+ if (ripples.length > 0) {
+ ripple = ripples[ripples.length - 1];
+ } else {
+ return false;
+ }
+
+ var relativeX = ripple.getAttribute('data-x');
+ var relativeY = ripple.getAttribute('data-y');
+ var scale = ripple.getAttribute('data-scale');
+
+ // Get delay beetween mousedown and mouse leave
+ var diff = Date.now() - Number(ripple.getAttribute('data-hold'));
+ var delay = 350 - diff;
+
+ if (delay < 0) {
+ delay = 0;
+ }
+
+ // Fade out ripple after delay
+ setTimeout(function() {
+ var style = {
+ 'top': relativeY+'px',
+ 'left': relativeX+'px',
+ 'opacity': '0',
+
+ // Duration
+ '-webkit-transition-duration': Effect.duration + 'ms',
+ '-moz-transition-duration': Effect.duration + 'ms',
+ '-o-transition-duration': Effect.duration + 'ms',
+ 'transition-duration': Effect.duration + 'ms',
+ '-webkit-transform': scale,
+ '-moz-transform': scale,
+ '-ms-transform': scale,
+ '-o-transform': scale,
+ 'transform': scale,
+ };
+
+ ripple.setAttribute('style', convertStyle(style));
+
+ setTimeout(function() {
+ try {
+ el.removeChild(ripple);
+ } catch(e) {
+ return false;
+ }
+ }, Effect.duration);
+ }, delay);
+ },
+
+ // Little hack to make <input> can perform waves effect
+ wrapInput: function(elements) {
+ for (var a = 0; a < elements.length; a++) {
+ var el = elements[a];
+
+ if (el.tagName.toLowerCase() === 'input') {
+ var parent = el.parentNode;
+
+ // If input already have parent just pass through
+ if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) {
+ continue;
+ }
+
+ // Put element class and style to the specified parent
+ var wrapper = document.createElement('i');
+ wrapper.className = el.className + ' waves-input-wrapper';
+
+ var elementStyle = el.getAttribute('style');
+
+ if (!elementStyle) {
+ elementStyle = '';
+ }
+
+ wrapper.setAttribute('style', elementStyle);
+
+ el.className = 'waves-button-input';
+ el.removeAttribute('style');
+
+ // Put element as child
+ parent.replaceChild(wrapper, el);
+ wrapper.appendChild(el);
+ }
+ }
+ }
+ };
+
+
+ /**
+ * Disable mousedown event for 500ms during and after touch
+ */
+ var TouchHandler = {
+ /* uses an integer rather than bool so there's no issues with
+ * needing to clear timeouts if another touch event occurred
+ * within the 500ms. Cannot mouseup between touchstart and
+ * touchend, nor in the 500ms after touchend. */
+ touches: 0,
+ allowEvent: function(e) {
+ var allow = true;
+
+ if (e.type === 'touchstart') {
+ TouchHandler.touches += 1; //push
+ } else if (e.type === 'touchend' || e.type === 'touchcancel') {
+ setTimeout(function() {
+ if (TouchHandler.touches > 0) {
+ TouchHandler.touches -= 1; //pop after 500ms
+ }
+ }, 500);
+ } else if (e.type === 'mousedown' && TouchHandler.touches > 0) {
+ allow = false;
+ }
+
+ return allow;
+ },
+ touchup: function(e) {
+ TouchHandler.allowEvent(e);
+ }
+ };
+
+
+ /**
+ * Delegated click handler for .waves-effect element.
+ * returns null when .waves-effect element not in "click tree"
+ */
+ function getWavesEffectElement(e) {
+ if (TouchHandler.allowEvent(e) === false) {
+ return null;
+ }
+
+ var element = null;
+ var target = e.target || e.srcElement;
+
+ while (target.parentElement !== null) {
+ if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) {
+ element = target;
+ break;
+ } else if (target.className.indexOf('waves-effect') !== -1) {
+ element = target;
+ break;
+ }
+ target = target.parentElement;
+ }
+
+ return element;
+ }
+
+ /**
+ * Bubble the click and show effect if .waves-effect elem was found
+ */
+ function showEffect(e) {
+ var element = getWavesEffectElement(e);
+
+ if (element !== null) {
+ Effect.show(e, element);
+
+ if ('ontouchstart' in window) {
+ element.addEventListener('touchend', Effect.hide, false);
+ element.addEventListener('touchcancel', Effect.hide, false);
+ }
+
+ element.addEventListener('mouseup', Effect.hide, false);
+ element.addEventListener('mouseleave', Effect.hide, false);
+ }
+ }
+
+ Waves.displayEffect = function(options) {
+ options = options || {};
+
+ if ('duration' in options) {
+ Effect.duration = options.duration;
+ }
+
+ //Wrap input inside <i> tag
+ Effect.wrapInput($$('.waves-effect'));
+
+ if ('ontouchstart' in window) {
+ document.body.addEventListener('touchstart', showEffect, false);
+ }
+
+ document.body.addEventListener('mousedown', showEffect, false);
+ };
+
+ /**
+ * Attach Waves to an input element (or any element which doesn't
+ * bubble mouseup/mousedown events).
+ * Intended to be used with dynamically loaded forms/inputs, or
+ * where the user doesn't want a delegated click handler.
+ */
+ Waves.attach = function(element) {
+ //FUTURE: automatically add waves classes and allow users
+ // to specify them with an options param? Eg. light/classic/button
+ if (element.tagName.toLowerCase() === 'input') {
+ Effect.wrapInput([element]);
+ element = element.parentElement;
+ }
+
+ if ('ontouchstart' in window) {
+ element.addEventListener('touchstart', showEffect, false);
+ }
+
+ element.addEventListener('mousedown', showEffect, false);
+ };
+
+ window.Waves = Waves;
+
+ document.addEventListener('DOMContentLoaded', function() {
+ Waves.displayEffect();
+ }, false);
+
+})(window);
+;Materialize.toast = function (message, displayLength, className, completeCallback) {
+ className = className || "";
+
+ var container = document.getElementById('toast-container');
+
+ // Create toast container if it does not exist
+ if (container === null) {
+ // create notification container
+ container = document.createElement('div');
+ container.id = 'toast-container';
+ document.body.appendChild(container);
+ }
+
+ // Select and append toast
+ var newToast = createToast(message);
+
+ // only append toast if message is not undefined
+ if(message){
+ container.appendChild(newToast);
+ }
+
+ newToast.style.opacity = 0;
+
+ // Animate toast in
+ Vel(newToast, {translateY: '-35px', opacity: 1 }, {duration: 300,
+ easing: 'easeOutCubic',
+ queue: false});
+
+ // Allows timer to be pause while being panned
+ var timeLeft = displayLength;
+ var counterInterval;
+ if (timeLeft != null) {
+ counterInterval = setInterval (function(){
+ if (newToast.parentNode === null)
+ window.clearInterval(counterInterval);
+
+ // If toast is not being dragged, decrease its time remaining
+ if (!newToast.classList.contains('panning')) {
+ timeLeft -= 20;
+ }
+
+ if (timeLeft <= 0) {
+ // Animate toast out
+ Vel(newToast, {"opacity": 0, marginTop: '-40px'}, { duration: 375,
+ easing: 'easeOutExpo',
+ queue: false,
+ complete: function(){
+ // Call the optional callback
+ if(typeof(completeCallback) === "function")
+ completeCallback();
+ // Remove toast after it times out
+ this[0].parentNode.removeChild(this[0]);
+ }
+ });
+ window.clearInterval(counterInterval);
+ }
+ }, 20);
+ }
+
+
+
+ function createToast(html) {
+
+ // Create toast
+ var toast = document.createElement('div');
+ toast.classList.add('toast');
+ if (className) {
+ var classes = className.split(' ');
+
+ for (var i = 0, count = classes.length; i < count; i++) {
+ toast.classList.add(classes[i]);
+ }
+ }
+ // If type of parameter is HTML Element
+ if ( typeof HTMLElement === "object" ? html instanceof HTMLElement : html && typeof html === "object" && html !== null && html.nodeType === 1 && typeof html.nodeName==="string"
+) {
+ toast.appendChild(html);
+ }
+ else if (html instanceof jQuery) {
+ // Check if it is jQuery object
+ toast.appendChild(html[0]);
+ }
+ else {
+ // Insert as text;
+ toast.innerHTML = html;
+ }
+ // Bind hammer
+ var hammerHandler = new Hammer(toast, {prevent_default: false});
+ hammerHandler.on('pan', function(e) {
+ var deltaX = e.deltaX;
+ var activationDistance = 80;
+
+ // Change toast state
+ if (!toast.classList.contains('panning')){
+ toast.classList.add('panning');
+ }
+
+ var opacityPercent = 1-Math.abs(deltaX / activationDistance);
+ if (opacityPercent < 0)
+ opacityPercent = 0;
+
+ Vel(toast, {left: deltaX, opacity: opacityPercent }, {duration: 50, queue: false, easing: 'easeOutQuad'});
+
+ });
+
+ hammerHandler.on('panend', function(e) {
+ var deltaX = e.deltaX;
+ var activationDistance = 80;
+
+ // If toast dragged past activation point
+ if (Math.abs(deltaX) > activationDistance) {
+ Vel(toast, {marginTop: '-40px'}, { duration: 375,
+ easing: 'easeOutExpo',
+ queue: false,
+ complete: function(){
+ if(typeof(completeCallback) === "function") {
+ completeCallback();
+ }
+ toast.parentNode.removeChild(toast);
+ }
+ });
+
+ } else {
+ toast.classList.remove('panning');
+ // Put toast back into original position
+ Vel(toast, { left: 0, opacity: 1 }, { duration: 300,
+ easing: 'easeOutExpo',
+ queue: false
+ });
+
+ }
+ });
+
+ return toast;
+ }
+};
+;(function ($) {
+
+ var methods = {
+ init : function(options) {
+ var defaults = {
+ menuWidth: 300,
+ edge: 'left',
+ closeOnClick: false,
+ draggable: true,
+ onOpen: null,
+ onClose: null
+ };
+ options = $.extend(defaults, options);
+
+ $(this).each(function(){
+ var $this = $(this);
+ var menuId = $this.attr('data-activates');
+ var menu = $("#"+ menuId);
+
+ // Set to width
+ if (options.menuWidth != 300) {
+ menu.css('width', options.menuWidth);
+ }
+
+ // Add Touch Area
+ var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]');
+ if (options.draggable) {
+ // Regenerate dragTarget
+ if ($dragTarget.length) {
+ $dragTarget.remove();
+ }
+
+ $dragTarget = $('<div class="drag-target"></div>').attr('data-sidenav', menuId);
+ $('body').append($dragTarget);
+ } else {
+ $dragTarget = $();
+ }
+
+ if (options.edge == 'left') {
+ menu.css('transform', 'translateX(-100%)');
+ $dragTarget.css({'left': 0}); // Add Touch Area
+ }
+ else {
+ menu.addClass('right-aligned') // Change text-alignment to right
+ .css('transform', 'translateX(100%)');
+ $dragTarget.css({'right': 0}); // Add Touch Area
+ }
+
+ // If fixed sidenav, bring menu out
+ if (menu.hasClass('fixed')) {
+ if (window.innerWidth > 992) {
+ menu.css('transform', 'translateX(0)');
+ }
+ }
+
+ // Window resize to reset on large screens fixed
+ if (menu.hasClass('fixed')) {
+ $(window).resize( function() {
+ if (window.innerWidth > 992) {
+ // Close menu if window is resized bigger than 992 and user has fixed sidenav
+ if ($('#sidenav-overlay').length !== 0 && menuOut) {
+ removeMenu(true);
+ }
+ else {
+ // menu.removeAttr('style');
+ menu.css('transform', 'translateX(0%)');
+ // menu.css('width', options.menuWidth);
+ }
+ }
+ else if (menuOut === false){
+ if (options.edge === 'left') {
+ menu.css('transform', 'translateX(-100%)');
+ } else {
+ menu.css('transform', 'translateX(100%)');
+ }
+
+ }
+
+ });
+ }
+
+ // if closeOnClick, then add close event for all a tags in side sideNav
+ if (options.closeOnClick === true) {
+ menu.on("click.itemclick", "a:not(.collapsible-header)", function(){
+ if (!(window.innerWidth > 992 && menu.hasClass('fixed'))){
+ removeMenu();
+ }
+ });
+ }
+
+ var removeMenu = function(restoreNav) {
+ panning = false;
+ menuOut = false;
+ // Reenable scrolling
+ $('body').css({
+ overflow: '',
+ width: ''
+ });
+
+ $('#sidenav-overlay').velocity({opacity: 0}, {duration: 200,
+ queue: false, easing: 'easeOutQuad',
+ complete: function() {
+ $(this).remove();
+ } });
+ if (options.edge === 'left') {
+ // Reset phantom div
+ $dragTarget.css({width: '', right: '', left: '0'});
+ menu.velocity(
+ {'translateX': '-100%'},
+ { duration: 200,
+ queue: false,
+ easing: 'easeOutCubic',
+ complete: function() {
+ if (restoreNav === true) {
+ // Restore Fixed sidenav
+ menu.removeAttr('style');
+ menu.css('width', options.menuWidth);
+ }
+ }
+
+ });
+ }
+ else {
+ // Reset phantom div
+ $dragTarget.css({width: '', right: '0', left: ''});
+ menu.velocity(
+ {'translateX': '100%'},
+ { duration: 200,
+ queue: false,
+ easing: 'easeOutCubic',
+ complete: function() {
+ if (restoreNav === true) {
+ // Restore Fixed sidenav
+ menu.removeAttr('style');
+ menu.css('width', options.menuWidth);
+ }
+ }
+ });
+ }
+
+ // Callback
+ if (typeof(options.onClose) === 'function') {
+ options.onClose.call(this, menu);
+ }
+ }
+
+
+
+ // Touch Event
+ var panning = false;
+ var menuOut = false;
+
+ if (options.draggable) {
+ $dragTarget.on('click', function(){
+ if (menuOut) {
+ removeMenu();
+ }
+ });
+
+ $dragTarget.hammer({
+ prevent_default: false
+ }).on('pan', function(e) {
+
+ if (e.gesture.pointerType == "touch") {
+
+ var direction = e.gesture.direction;
+ var x = e.gesture.center.x;
+ var y = e.gesture.center.y;
+ var velocityX = e.gesture.velocityX;
+
+ // Vertical scroll bugfix
+ if (x === 0 && y === 0) {
+ return;
+ }
+
+ // Disable Scrolling
+ var $body = $('body');
+ var $overlay = $('#sidenav-overlay');
+ var oldWidth = $body.innerWidth();
+ $body.css('overflow', 'hidden');
+ $body.width(oldWidth);
+
+ // If overlay does not exist, create one and if it is clicked, close menu
+ if ($overlay.length === 0) {
+ $overlay = $('<div id="sidenav-overlay"></div>');
+ $overlay.css('opacity', 0).click( function(){
+ removeMenu();
+ });
+
+ // Run 'onOpen' when sidenav is opened via touch/swipe if applicable
+ if (typeof(options.onOpen) === 'function') {
+ options.onOpen.call(this, menu);
+ }
+
+ $('body').append($overlay);
+ }
+
+ // Keep within boundaries
+ if (options.edge === 'left') {
+ if (x > options.menuWidth) { x = options.menuWidth; }
+ else if (x < 0) { x = 0; }
+ }
+
+ if (options.edge === 'left') {
+ // Left Direction
+ if (x < (options.menuWidth / 2)) { menuOut = false; }
+ // Right Direction
+ else if (x >= (options.menuWidth / 2)) { menuOut = true; }
+ menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)');
+ }
+ else {
+ // Left Direction
+ if (x < (window.innerWidth - options.menuWidth / 2)) {
+ menuOut = true;
+ }
+ // Right Direction
+ else if (x >= (window.innerWidth - options.menuWidth / 2)) {
+ menuOut = false;
+ }
+ var rightPos = (x - options.menuWidth / 2);
+ if (rightPos < 0) {
+ rightPos = 0;
+ }
+
+ menu.css('transform', 'translateX(' + rightPos + 'px)');
+ }
+
+
+ // Percentage overlay
+ var overlayPerc;
+ if (options.edge === 'left') {
+ overlayPerc = x / options.menuWidth;
+ $overlay.velocity({opacity: overlayPerc }, {duration: 10, queue: false, easing: 'easeOutQuad'});
+ }
+ else {
+ overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth);
+ $overlay.velocity({opacity: overlayPerc }, {duration: 10, queue: false, easing: 'easeOutQuad'});
+ }
+ }
+
+ }).on('panend', function(e) {
+
+ if (e.gesture.pointerType == "touch") {
+ var $overlay = $('#sidenav-overlay');
+ var velocityX = e.gesture.velocityX;
+ var x = e.gesture.center.x;
+ var leftPos = x - options.menuWidth;
+ var rightPos = x - options.menuWidth / 2;
+ if (leftPos > 0 ) {
+ leftPos = 0;
+ }
+ if (rightPos < 0) {
+ rightPos = 0;
+ }
+ panning = false;
+
+ if (options.edge === 'left') {
+ // If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut
+ if ((menuOut && velocityX <= 0.3) || velocityX < -0.5) {
+ // Return menu to open
+ if (leftPos !== 0) {
+ menu.velocity({'translateX': [0, leftPos]}, {duration: 300, queue: false, easing: 'easeOutQuad'});
+ }
+
+ $overlay.velocity({opacity: 1 }, {duration: 50, queue: false, easing: 'easeOutQuad'});
+ $dragTarget.css({width: '50%', right: 0, left: ''});
+ menuOut = true;
+ }
+ else if (!menuOut || velocityX > 0.3) {
+ // Enable Scrolling
+ $('body').css({
+ overflow: '',
+ width: ''
+ });
+ // Slide menu closed
+ menu.velocity({'translateX': [-1 * options.menuWidth - 10, leftPos]}, {duration: 200, queue: false, easing: 'easeOutQuad'});
+ $overlay.velocity({opacity: 0 }, {duration: 200, queue: false, easing: 'easeOutQuad',
+ complete: function () {
+ // Run 'onClose' when sidenav is closed via touch/swipe if applicable
+ if (typeof(options.onClose) === 'function') {
+ options.onClose.call(this, menu);
+ }
+
+ $(this).remove();
+ }});
+ $dragTarget.css({width: '10px', right: '', left: 0});
+ }
+ }
+ else {
+ if ((menuOut && velocityX >= -0.3) || velocityX > 0.5) {
+ // Return menu to open
+ if (rightPos !== 0) {
+ menu.velocity({'translateX': [0, rightPos]}, {duration: 300, queue: false, easing: 'easeOutQuad'});
+ }
+
+ $overlay.velocity({opacity: 1 }, {duration: 50, queue: false, easing: 'easeOutQuad'});
+ $dragTarget.css({width: '50%', right: '', left: 0});
+ menuOut = true;
+ }
+ else if (!menuOut || velocityX < -0.3) {
+ // Enable Scrolling
+ $('body').css({
+ overflow: '',
+ width: ''
+ });
+
+ // Slide menu closed
+ menu.velocity({'translateX': [options.menuWidth + 10, rightPos]}, {duration: 200, queue: false, easing: 'easeOutQuad'});
+ $overlay.velocity({opacity: 0 }, {duration: 200, queue: false, easing: 'easeOutQuad',
+ complete: function () {
+ $(this).remove();
+ }});
+ $dragTarget.css({width: '10px', right: 0, left: ''});
+ }
+ }
+
+ }
+ });
+ }
+
+ $this.off('click.sidenav').on('click.sidenav', function() {
+ if (menuOut === true) {
+ menuOut = false;
+ panning = false;
+ removeMenu();
+ }
+ else {
+
+ // Disable Scrolling
+ var $body = $('body');
+ var $overlay = $('<div id="sidenav-overlay"></div>');
+ var oldWidth = $body.innerWidth();
+ $body.css('overflow', 'hidden');
+ $body.width(oldWidth);
+
+ // Push current drag target on top of DOM tree
+ $('body').append($dragTarget);
+
+ if (options.edge === 'left') {
+ $dragTarget.css({width: '50%', right: 0, left: ''});
+ menu.velocity({'translateX': [0, -1 * options.menuWidth]}, {duration: 300, queue: false, easing: 'easeOutQuad'});
+ }
+ else {
+ $dragTarget.css({width: '50%', right: '', left: 0});
+ menu.velocity({'translateX': [0, options.menuWidth]}, {duration: 300, queue: false, easing: 'easeOutQuad'});
+ }
+
+ $overlay.css('opacity', 0)
+ .click(function(){
+ menuOut = false;
+ panning = false;
+ removeMenu();
+ $overlay.velocity({opacity: 0}, {duration: 300, queue: false, easing: 'easeOutQuad',
+ complete: function() {
+ $(this).remove();
+ } });
+
+ });
+ $('body').append($overlay);
+ $overlay.velocity({opacity: 1}, {duration: 300, queue: false, easing: 'easeOutQuad',
+ complete: function () {
+ menuOut = true;
+ panning = false;
+ }
+ });
+
+ // Callback
+ if (typeof(options.onOpen) === 'function') {
+ options.onOpen.call(this, menu);
+ }
+ }
+
+ return false;
+ });
+ });
+
+
+ },
+ destroy: function () {
+ var $overlay = $('#sidenav-overlay');
+ var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]');
+ $overlay.trigger('click');
+ $dragTarget.remove();
+ $(this).off('click');
+ $overlay.remove();
+ },
+ show : function() {
+ this.trigger('click');
+ },
+ hide : function() {
+ $('#sidenav-overlay').trigger('click');
+ }
+ };
+
+
+ $.fn.sideNav = function(methodOrOptions) {
+ if ( methods[methodOrOptions] ) {
+ return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
+ } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
+ // Default to "init"
+ return methods.init.apply( this, arguments );
+ } else {
+ $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.sideNav' );
+ }
+ }; // Plugin end
+}( jQuery ));
+;/**
+ * Extend jquery with a scrollspy plugin.
+ * This watches the window scroll and fires events when elements are scrolled into viewport.
+ *
+ * throttle() and getTime() taken from Underscore.js
+ * https://github.com/jashkenas/underscore
+ *
+ * @author Copyright 2013 John Smart
+ * @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE
+ * @see https://github.com/thesmart
+ * @version 0.1.2
+ */
+(function($) {
+
+ var jWindow = $(window);
+ var elements = [];
+ var elementsInView = [];
+ var isSpying = false;
+ var ticks = 0;
+ var unique_id = 1;
+ var offset = {
+ top : 0,
+ right : 0,
+ bottom : 0,
+ left : 0,
+ }
+
+ /**
+ * Find elements that are within the boundary
+ * @param {number} top
+ * @param {number} right
+ * @param {number} bottom
+ * @param {number} left
+ * @return {jQuery} A collection of elements
+ */
+ function findElements(top, right, bottom, left) {
+ var hits = $();
+ $.each(elements, function(i, element) {
+ if (element.height() > 0) {
+ var elTop = element.offset().top,
+ elLeft = element.offset().left,
+ elRight = elLeft + element.width(),
+ elBottom = elTop + element.height();
+
+ var isIntersect = !(elLeft > right ||
+ elRight < left ||
+ elTop > bottom ||
+ elBottom < top);
+
+ if (isIntersect) {
+ hits.push(element);
+ }
+ }
+ });
+
+ return hits;
+ }
+
+
+ /**
+ * Called when the user scrolls the window
+ */
+ function onScroll(scrollOffset) {
+ // unique tick id
+ ++ticks;
+
+ // viewport rectangle
+ var top = jWindow.scrollTop(),
+ left = jWindow.scrollLeft(),
+ right = left + jWindow.width(),
+ bottom = top + jWindow.height();
+
+ // determine which elements are in view
+ var intersections = findElements(top+offset.top + scrollOffset || 200, right+offset.right, bottom+offset.bottom, left+offset.left);
+ $.each(intersections, function(i, element) {
+
+ var lastTick = element.data('scrollSpy:ticks');
+ if (typeof lastTick != 'number') {
+ // entered into view
+ element.triggerHandler('scrollSpy:enter');
+ }
+
+ // update tick id
+ element.data('scrollSpy:ticks', ticks);
+ });
+
+ // determine which elements are no longer in view
+ $.each(elementsInView, function(i, element) {
+ var lastTick = element.data('scrollSpy:ticks');
+ if (typeof lastTick == 'number' && lastTick !== ticks) {
+ // exited from view
+ element.triggerHandler('scrollSpy:exit');
+ element.data('scrollSpy:ticks', null);
+ }
+ });
+
+ // remember elements in view for next tick
+ elementsInView = intersections;
+ }
+
+ /**
+ * Called when window is resized
+ */
+ function onWinSize() {
+ jWindow.trigger('scrollSpy:winSize');
+ }
+
+
+ /**
+ * Enables ScrollSpy using a selector
+ * @param {jQuery|string} selector The elements collection, or a selector
+ * @param {Object=} options Optional.
+ throttle : number -> scrollspy throttling. Default: 100 ms
+ offsetTop : number -> offset from top. Default: 0
+ offsetRight : number -> offset from right. Default: 0
+ offsetBottom : number -> offset from bottom. Default: 0
+ offsetLeft : number -> offset from left. Default: 0
+ activeClass : string -> Class name to be added to the active link. Default: active
+ * @returns {jQuery}
+ */
+ $.scrollSpy = function(selector, options) {
+ var defaults = {
+ throttle: 100,
+ scrollOffset: 200, // offset - 200 allows elements near bottom of page to scroll
+ activeClass: 'active',
+ getActiveElement: function(id) {
+ return 'a[href="#' + id + '"]';
+ }
+ };
+ options = $.extend(defaults, options);
+
+ var visible = [];
+ selector = $(selector);
+ selector.each(function(i, element) {
+ elements.push($(element));
+ $(element).data("scrollSpy:id", i);
+ // Smooth scroll to section
+ $('a[href="#' + $(element).attr('id') + '"]').click(function(e) {
+ e.preventDefault();
+ var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1;
+ $('html, body').animate({ scrollTop: offset - options.scrollOffset }, {duration: 400, queue: false, easing: 'easeOutCubic'});
+ });
+ });
+
+ offset.top = options.offsetTop || 0;
+ offset.right = options.offsetRight || 0;
+ offset.bottom = options.offsetBottom || 0;
+ offset.left = options.offsetLeft || 0;
+
+ var throttledScroll = Materialize.throttle(function() {
+ onScroll(options.scrollOffset);
+ }, options.throttle || 100);
+ var readyScroll = function(){
+ $(document).ready(throttledScroll);
+ };
+
+ if (!isSpying) {
+ jWindow.on('scroll', readyScroll);
+ jWindow.on('resize', readyScroll);
+ isSpying = true;
+ }
+
+ // perform a scan once, after current execution context, and after dom is ready
+ setTimeout(readyScroll, 0);
+
+
+ selector.on('scrollSpy:enter', function() {
+ visible = $.grep(visible, function(value) {
+ return value.height() != 0;
+ });
+
+ var $this = $(this);
+
+ if (visible[0]) {
+ $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
+ if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) {
+ visible.unshift($(this));
+ }
+ else {
+ visible.push($(this));
+ }
+ }
+ else {
+ visible.push($(this));
+ }
+
+
+ $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
+ });
+ selector.on('scrollSpy:exit', function() {
+ visible = $.grep(visible, function(value) {
+ return value.height() != 0;
+ });
+
+ if (visible[0]) {
+ $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
+ var $this = $(this);
+ visible = $.grep(visible, function(value) {
+ return value.attr('id') != $this.attr('id');
+ });
+ if (visible[0]) { // Check if empty
+ $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
+ }
+ }
+ });
+
+ return selector;
+ };
+
+ /**
+ * Listen for window resize events
+ * @param {Object=} options Optional. Set { throttle: number } to change throttling. Default: 100 ms
+ * @returns {jQuery} $(window)
+ */
+ $.winSizeSpy = function(options) {
+ $.winSizeSpy = function() { return jWindow; }; // lock from multiple calls
+ options = options || {
+ throttle: 100
+ };
+ return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100));
+ };
+
+ /**
+ * Enables ScrollSpy on a collection of elements
+ * e.g. $('.scrollSpy').scrollSpy()
+ * @param {Object=} options Optional.
+ throttle : number -> scrollspy throttling. Default: 100 ms
+ offsetTop : number -> offset from top. Default: 0
+ offsetRight : number -> offset from right. Default: 0
+ offsetBottom : number -> offset from bottom. Default: 0
+ offsetLeft : number -> offset from left. Default: 0
+ * @returns {jQuery}
+ */
+ $.fn.scrollSpy = function(options) {
+ return $.scrollSpy($(this), options);
+ };
+
+})(jQuery);
+;(function ($) {
+ $(document).ready(function() {
+
+ // Function to update labels of text fields
+ Materialize.updateTextFields = function() {
+ var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
+ $(input_selector).each(function(index, element) {
+ var $this = $(this);
+ if ($(element).val().length > 0 || $(element).is(':focus') || element.autofocus || $this.attr('placeholder') !== undefined) {
+ $this.siblings('label').addClass('active');
+ } else if ($(element)[0].validity) {
+ $this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true);
+ } else {
+ $this.siblings('label').removeClass('active');
+ }
+ });
+ };
+
+ // Text based inputs
+ var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
+
+ // Add active if form auto complete
+ $(document).on('change', input_selector, function () {
+ if($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) {
+ $(this).siblings('label').addClass('active');
+ }
+ validate_field($(this));
+ });
+
+ // Add active if input element has been pre-populated on document ready
+ $(document).ready(function() {
+ Materialize.updateTextFields();
+ });
+
+ // HTML DOM FORM RESET handling
+ $(document).on('reset', function(e) {
+ var formReset = $(e.target);
+ if (formReset.is('form')) {
+ formReset.find(input_selector).removeClass('valid').removeClass('invalid');
+ formReset.find(input_selector).each(function () {
+ if ($(this).attr('value') === '') {
+ $(this).siblings('label').removeClass('active');
+ }
+ });
+
+ // Reset select
+ formReset.find('select.initialized').each(function () {
+ var reset_text = formReset.find('option[selected]').text();
+ formReset.siblings('input.select-dropdown').val(reset_text);
+ });
+ }
+ });
+
+ // Add active when element has focus
+ $(document).on('focus', input_selector, function () {
+ $(this).siblings('label, .prefix').addClass('active');
+ });
+
+ $(document).on('blur', input_selector, function () {
+ var $inputElement = $(this);
+ var selector = ".prefix";
+
+ if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) {
+ selector += ", label";
+ }
+
+ $inputElement.siblings(selector).removeClass('active');
+
+ validate_field($inputElement);
+ });
+
+ window.validate_field = function(object) {
+ var hasLength = object.attr('data-length') !== undefined;
+ var lenAttr = parseInt(object.attr('data-length'));
+ var len = object.val().length;
+
+ if (object.val().length === 0 && object[0].validity.badInput === false) {
+ if (object.hasClass('validate')) {
+ object.removeClass('valid');
+ object.removeClass('invalid');
+ }
+ }
+ else {
+ if (object.hasClass('validate')) {
+ // Check for character counter attributes
+ if ((object.is(':valid') && hasLength && (len <= lenAttr)) || (object.is(':valid') && !hasLength)) {
+ object.removeClass('invalid');
+ object.addClass('valid');
+ }
+ else {
+ object.removeClass('valid');
+ object.addClass('invalid');
+ }
+ }
+ }
+ };
+
+ // Radio and Checkbox focus class
+ var radio_checkbox = 'input[type=radio], input[type=checkbox]';
+ $(document).on('keyup.radio', radio_checkbox, function(e) {
+ // TAB, check if tabbing to radio or checkbox.
+ if (e.which === 9) {
+ $(this).addClass('tabbed');
+ var $this = $(this);
+ $this.one('blur', function(e) {
+
+ $(this).removeClass('tabbed');
+ });
+ return;
+ }
+ });
+
+ // Textarea Auto Resize
+ var hiddenDiv = $('.hiddendiv').first();
+ if (!hiddenDiv.length) {
+ hiddenDiv = $('<div class="hiddendiv common"></div>');
+ $('body').append(hiddenDiv);
+ }
+ var text_area_selector = '.materialize-textarea';
+
+ function textareaAutoResize($textarea) {
+ // Set font properties of hiddenDiv
+
+ var fontFamily = $textarea.css('font-family');
+ var fontSize = $textarea.css('font-size');
+ var lineHeight = $textarea.css('line-height');
+
+ if (fontSize) { hiddenDiv.css('font-size', fontSize); }
+ if (fontFamily) { hiddenDiv.css('font-family', fontFamily); }
+ if (lineHeight) { hiddenDiv.css('line-height', lineHeight); }
+
+ // Set original-height, if none
+ if (!$textarea.data('original-height')) {
+ $textarea.data('original-height', $textarea.height());
+ }
+
+ if ($textarea.attr('wrap') === 'off') {
+ hiddenDiv.css('overflow-wrap', 'normal')
+ .css('white-space', 'pre');
+ }
+
+ hiddenDiv.text($textarea.val() + '\n');
+ var content = hiddenDiv.html().replace(/\n/g, '<br>');
+ hiddenDiv.html(content);
+
+
+ // When textarea is hidden, width goes crazy.
+ // Approximate with half of window size
+
+ if ($textarea.is(':visible')) {
+ hiddenDiv.css('width', $textarea.width());
+ }
+ else {
+ hiddenDiv.css('width', $(window).width()/2);
+ }
+
+
+ /**
+ * Resize if the new height is greater than the
+ * original height of the textarea
+ */
+ if ($textarea.data('original-height') <= hiddenDiv.height()) {
+ $textarea.css('height', hiddenDiv.height());
+ } else if ($textarea.val().length < $textarea.data('previous-length')) {
+ /**
+ * In case the new height is less than original height, it
+ * means the textarea has less text than before
+ * So we set the height to the original one
+ */
+ $textarea.css('height', $textarea.data('original-height'));
+ }
+ $textarea.data('previous-length', $textarea.val().length);
+ }
+
+ $(text_area_selector).each(function () {
+ var $textarea = $(this);
+ /**
+ * Instead of resizing textarea on document load,
+ * store the original height and the original length
+ */
+ $textarea.data('original-height', $textarea.height());
+ $textarea.data('previous-length', $textarea.val().length);
+ });
+
+ $('body').on('keyup keydown autoresize', text_area_selector, function () {
+ textareaAutoResize($(this));
+ });
+
+ // File Input Path
+ $(document).on('change', '.file-field input[type="file"]', function () {
+ var file_field = $(this).closest('.file-field');
+ var path_input = file_field.find('input.file-path');
+ var files = $(this)[0].files;
+ var file_names = [];
+ for (var i = 0; i < files.length; i++) {
+ file_names.push(files[i].name);
+ }
+ path_input.val(file_names.join(", "));
+ path_input.trigger('change');
+ });
+
+ /****************
+ * Range Input *
+ ****************/
+
+ var range_type = 'input[type=range]';
+ var range_mousedown = false;
+ var left;
+
+ $(range_type).each(function () {
+ var thumb = $('<span class="thumb"><span class="value"></span></span>');
+ $(this).after(thumb);
+ });
+
+ var showRangeBubble = function(thumb) {
+ var paddingLeft = parseInt(thumb.parent().css('padding-left'));
+ var marginLeft = (-7 + paddingLeft) + 'px';
+ thumb.velocity({ height: "30px", width: "30px", top: "-30px", marginLeft: marginLeft}, { duration: 300, easing: 'easeOutExpo' });
+ };
+
+ var calcRangeOffset = function(range) {
+ var width = range.width() - 15;
+ var max = parseFloat(range.attr('max'));
+ var min = parseFloat(range.attr('min'));
+ var percent = (parseFloat(range.val()) - min) / (max - min);
+ return percent * width;
+ }
+
+ var range_wrapper = '.range-field';
+ $(document).on('change', range_type, function(e) {
+ var thumb = $(this).siblings('.thumb');
+ thumb.find('.value').html($(this).val());
+
+ if (!thumb.hasClass('active')) {
+ showRangeBubble(thumb);
+ }
+
+ var offsetLeft = calcRangeOffset($(this));
+ thumb.addClass('active').css('left', offsetLeft);
+ });
+
+ $(document).on('mousedown touchstart', range_type, function(e) {
+ var thumb = $(this).siblings('.thumb');
+
+ // If thumb indicator does not exist yet, create it
+ if (thumb.length <= 0) {
+ thumb = $('<span class="thumb"><span class="value"></span></span>');
+ $(this).after(thumb);
+ }
+
+ // Set indicator value
+ thumb.find('.value').html($(this).val());
+
+ range_mousedown = true;
+ $(this).addClass('active');
+
+ if (!thumb.hasClass('active')) {
+ showRangeBubble(thumb);
+ }
+
+ if (e.type !== 'input') {
+ var offsetLeft = calcRangeOffset($(this));
+ thumb.addClass('active').css('left', offsetLeft);
+ }
+ });
+
+ $(document).on('mouseup touchend', range_wrapper, function() {
+ range_mousedown = false;
+ $(this).removeClass('active');
+ });
+
+ $(document).on('input mousemove touchmove', range_wrapper, function(e) {
+ var thumb = $(this).children('.thumb');
+ var left;
+ var input = $(this).find(range_type);
+
+ if (range_mousedown) {
+ if (!thumb.hasClass('active')) {
+ showRangeBubble(thumb);
+ }
+
+ var offsetLeft = calcRangeOffset(input);
+ thumb.addClass('active').css('left', offsetLeft);
+ thumb.find('.value').html(thumb.siblings(range_type).val());
+ }
+ });
+
+ $(document).on('mouseout touchleave', range_wrapper, function() {
+ if (!range_mousedown) {
+
+ var thumb = $(this).children('.thumb');
+ var paddingLeft = parseInt($(this).css('padding-left'));
+ var marginLeft = (7 + paddingLeft) + 'px';
+
+ if (thumb.hasClass('active')) {
+ thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: marginLeft}, { duration: 100 });
+ }
+ thumb.removeClass('active');
+ }
+ });
+
+ /**************************
+ * Auto complete plugin *
+ *************************/
+ $.fn.autocomplete = function (options) {
+ // Defaults
+ var defaults = {
+ data: {},
+ limit: Infinity,
+ onAutocomplete: null,
+ minLength: 1
+ };
+
+ options = $.extend(defaults, options);
+
+ return this.each(function() {
+ var $input = $(this);
+ var data = options.data,
+ count = 0,
+ activeIndex = -1,
+ oldVal,
+ $inputDiv = $input.closest('.input-field'); // Div to append on
+
+ // Check if data isn't empty
+ if (!$.isEmptyObject(data)) {
+ var $autocomplete = $('<ul class="autocomplete-content dropdown-content"></ul>');
+ var $oldAutocomplete;
+
+ // Append autocomplete element.
+ // Prevent double structure init.
+ if ($inputDiv.length) {
+ $oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first();
+ if (!$oldAutocomplete.length) {
+ $inputDiv.append($autocomplete); // Set ul in body
+ }
+ } else {
+ $oldAutocomplete = $input.next('.autocomplete-content.dropdown-content');
+ if (!$oldAutocomplete.length) {
+ $input.after($autocomplete);
+ }
+ }
+ if ($oldAutocomplete.length) {
+ $autocomplete = $oldAutocomplete;
+ }
+
+ // Highlight partial match.
+ var highlight = function(string, $el) {
+ var img = $el.find('img');
+ var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""),
+ matchEnd = matchStart + string.length - 1,
+ beforeMatch = $el.text().slice(0, matchStart),
+ matchText = $el.text().slice(matchStart, matchEnd + 1),
+ afterMatch = $el.text().slice(matchEnd + 1);
+ $el.html("<span>" + beforeMatch + "<span class='highlight'>" + matchText + "</span>" + afterMatch + "</span>");
+ if (img.length) {
+ $el.prepend(img);
+ }
+ };
+
+ // Reset current element position
+ var resetCurrentElement = function() {
+ activeIndex = -1;
+ $autocomplete.find('.active').removeClass('active');
+ }
+
+ // Remove autocomplete elements
+ var removeAutocomplete = function() {
+ $autocomplete.empty();
+ resetCurrentElement();
+ oldVal = undefined;
+ };
+
+ $input.off('blur.autocomplete').on('blur.autocomplete', function() {
+ removeAutocomplete();
+ });
+
+ // Perform search
+ $input.off('keyup.autocomplete focus.autocomplete').on('keyup.autocomplete focus.autocomplete', function (e) {
+ // Reset count.
+ count = 0;
+ var val = $input.val().toLowerCase();
+
+ // Don't capture enter or arrow key usage.
+ if (e.which === 13 ||
+ e.which === 38 ||
+ e.which === 40) {
+ return;
+ }
+
+
+ // Check if the input isn't empty
+ if (oldVal !== val) {
+ removeAutocomplete();
+
+ if (val.length >= options.minLength) {
+ for(var key in data) {
+ if (data.hasOwnProperty(key) &&
+ key.toLowerCase().indexOf(val) !== -1 &&
+ key.toLowerCase() !== val) {
+ // Break if past limit
+ if (count >= options.limit) {
+ break;
+ }
+
+ var autocompleteOption = $('<li></li>');
+ if (!!data[key]) {
+ autocompleteOption.append('<img src="'+ data[key] +'" class="right circle"><span>'+ key +'</span>');
+ } else {
+ autocompleteOption.append('<span>'+ key +'</span>');
+ }
+
+ $autocomplete.append(autocompleteOption);
+ highlight(val, autocompleteOption);
+ count++;
+ }
+ }
+ }
+ }
+
+ // Update oldVal
+ oldVal = val;
+ });
+
+ $input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) {
+ // Arrow keys and enter key usage
+ var keyCode = e.which,
+ liElement,
+ numItems = $autocomplete.children('li').length,
+ $active = $autocomplete.children('.active').first();
+
+ // select element on Enter
+ if (keyCode === 13 && activeIndex >= 0) {
+ liElement = $autocomplete.children('li').eq(activeIndex);
+ if (liElement.length) {
+ liElement.trigger('mousedown.autocomplete');
+ e.preventDefault();
+ }
+ return;
+ }
+
+ // Capture up and down key
+ if ( keyCode === 38 || keyCode === 40 ) {
+ e.preventDefault();
+
+ if (keyCode === 38 &&
+ activeIndex > 0) {
+ activeIndex--;
+ }
+
+ if (keyCode === 40 &&
+ activeIndex < (numItems - 1)) {
+ activeIndex++;
+ }
+
+ $active.removeClass('active');
+ if (activeIndex >= 0) {
+ $autocomplete.children('li').eq(activeIndex).addClass('active');
+ }
+ }
+ });
+
+ // Set input value
+ $autocomplete.on('mousedown.autocomplete touchstart.autocomplete', 'li', function () {
+ var text = $(this).text().trim();
+ $input.val(text);
+ $input.trigger('change');
+ removeAutocomplete();
+
+ // Handle onAutocomplete callback.
+ if (typeof(options.onAutocomplete) === "function") {
+ options.onAutocomplete.call(this, text);
+ }
+ });
+ }
+ });
+ };
+
+ }); // End of $(document).ready
+
+ /*******************
+ * Select Plugin *
+ ******************/
+ $.fn.material_select = function (callback) {
+ $(this).each(function(){
+ var $select = $(this);
+
+ if ($select.hasClass('browser-default')) {
+ return; // Continue to next (return false breaks out of entire loop)
+ }
+
+ var multiple = $select.attr('multiple') ? true : false,
+ lastID = $select.data('select-id'); // Tear down structure if Select needs to be rebuilt
+
+ if (lastID) {
+ $select.parent().find('span.caret').remove();
+ $select.parent().find('input').remove();
+
+ $select.unwrap();
+ $('ul#select-options-'+lastID).remove();
+ }
+
+ // If destroying the select, remove the selelct-id and reset it to it's uninitialized state.
+ if(callback === 'destroy') {
+ $select.data('select-id', null).removeClass('initialized');
+ return;
+ }
+
+ var uniqueID = Materialize.guid();
+ $select.data('select-id', uniqueID);
+ var wrapper = $('<div class="select-wrapper"></div>');
+ wrapper.addClass($select.attr('class'));
+ var options = $('<ul id="select-options-' + uniqueID +'" class="dropdown-content select-dropdown ' + (multiple ? 'multiple-select-dropdown' : '') + '"></ul>'),
+ selectChildren = $select.children('option, optgroup'),
+ valuesSelected = [],
+ optionsHover = false;
+
+ var label = $select.find('option:selected').html() || $select.find('option:first').html() || "";
+
+ // Function that renders and appends the option taking into
+ // account type and possible image icon.
+ var appendOptionWithIcon = function(select, option, type) {
+ // Add disabled attr if disabled
+ var disabledClass = (option.is(':disabled')) ? 'disabled ' : '';
+ var optgroupClass = (type === 'optgroup-option') ? 'optgroup-option ' : '';
+ var multipleCheckbox = multiple ? '<input type="checkbox"' + disabledClass + '/><label></label>' : '';
+
+ // add icons
+ var icon_url = option.data('icon');
+ var classes = option.attr('class');
+ if (!!icon_url) {
+ var classString = '';
+ if (!!classes) classString = ' class="' + classes + '"';
+
+ // Check for multiple type.
+ options.append($('<li class="' + disabledClass + optgroupClass + '"><img alt="" src="' + icon_url + '"' + classString + '><span>' + multipleCheckbox + option.html() + '</span></li>'));
+ return true;
+ }
+
+ // Check for multiple type.
+ options.append($('<li class="' + disabledClass + optgroupClass + '"><span>' + multipleCheckbox + option.html() + '</span></li>'));
+ };
+
+ /* Create dropdown structure. */
+ if (selectChildren.length) {
+ selectChildren.each(function() {
+ if ($(this).is('option')) {
+ // Direct descendant option.
+ if (multiple) {
+ appendOptionWithIcon($select, $(this), 'multiple');
+
+ } else {
+ appendOptionWithIcon($select, $(this));
+ }
+ } else if ($(this).is('optgroup')) {
+ // Optgroup.
+ var selectOptions = $(this).children('option');
+ options.append($('<li class="optgroup"><span>' + $(this).attr('label') + '</span></li>'));
+
+ selectOptions.each(function() {
+ appendOptionWithIcon($select, $(this), 'optgroup-option');
+ });
+ }
+ });
+ }
+
+ options.find('li:not(.optgroup)').each(function (i) {
+ $(this).click(function (e) {
+ // Check if option element is disabled
+ if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) {
+ var selected = true;
+
+ if (multiple) {
+ $('input[type="checkbox"]', this).prop('checked', function(i, v) { return !v; });
+ selected = toggleEntryFromArray(valuesSelected, i, $select);
+ $newSelect.trigger('focus');
+ } else {
+ options.find('li').removeClass('active');
+ $(this).toggleClass('active');
+ $newSelect.val($(this).text());
+ }
+
+ activateOption(options, $(this));
+ $select.find('option').eq(i).prop('selected', selected);
+ // Trigger onchange() event
+ $select.trigger('change');
+ if (typeof callback !== 'undefined') callback();
+ }
+
+ e.stopPropagation();
+ });
+ });
+
+ // Wrap Elements
+ $select.wrap(wrapper);
+ // Add Select Display Element
+ var dropdownIcon = $('<span class="caret">&#9660;</span>');
+ if ($select.is(':disabled'))
+ dropdownIcon.addClass('disabled');
+
+ // escape double quotes
+ var sanitizedLabelHtml = label.replace(/"/g, '&quot;');
+
+ var $newSelect = $('<input type="text" class="select-dropdown" readonly="true" ' + (($select.is(':disabled')) ? 'disabled' : '') + ' data-activates="select-options-' + uniqueID +'" value="'+ sanitizedLabelHtml +'"/>');
+ $select.before($newSelect);
+ $newSelect.before(dropdownIcon);
+
+ $newSelect.after(options);
+ // Check if section element is disabled
+ if (!$select.is(':disabled')) {
+ $newSelect.dropdown({'hover': false});
+ }
+
+ // Copy tabindex
+ if ($select.attr('tabindex')) {
+ $($newSelect[0]).attr('tabindex', $select.attr('tabindex'));
+ }
+
+ $select.addClass('initialized');
+
+ $newSelect.on({
+ 'focus': function (){
+ if ($('ul.select-dropdown').not(options[0]).is(':visible')) {
+ $('input.select-dropdown').trigger('close');
+ }
+ if (!options.is(':visible')) {
+ $(this).trigger('open', ['focus']);
+ var label = $(this).val();
+ if (multiple && label.indexOf(',') >= 0) {
+ label = label.split(',')[0];
+ }
+
+ var selectedOption = options.find('li').filter(function() {
+ return $(this).text().toLowerCase() === label.toLowerCase();
+ })[0];
+ activateOption(options, selectedOption, true);
+ }
+ },
+ 'click': function (e){
+ e.stopPropagation();
+ }
+ });
+
+ $newSelect.on('blur', function() {
+ if (!multiple) {
+ $(this).trigger('close');
+ }
+ options.find('li.selected').removeClass('selected');
+ });
+
+ options.hover(function() {
+ optionsHover = true;
+ }, function () {
+ optionsHover = false;
+ });
+
+ $(window).on({
+ 'click': function () {
+ multiple && (optionsHover || $newSelect.trigger('close'));
+ }
+ });
+
+ // Add initial multiple selections.
+ if (multiple) {
+ $select.find("option:selected:not(:disabled)").each(function () {
+ var index = $(this).index();
+
+ toggleEntryFromArray(valuesSelected, index, $select);
+ options.find("li").eq(index).find(":checkbox").prop("checked", true);
+ });
+ }
+
+ /**
+ * Make option as selected and scroll to selected position
+ * @param {jQuery} collection Select options jQuery element
+ * @param {Element} newOption element of the new option
+ * @param {Boolean} firstActivation If on first activation of select
+ */
+ var activateOption = function(collection, newOption, firstActivation) {
+ if (newOption) {
+ collection.find('li.selected').removeClass('selected');
+ var option = $(newOption);
+ option.addClass('selected');
+ if (!multiple || !!firstActivation) {
+ options.scrollTo(option);
+ }
+ }
+ };
+
+ // Allow user to search by typing
+ // this array is cleared after 1 second
+ var filterQuery = [],
+ onKeyDown = function(e){
+ // TAB - switch to another input
+ if(e.which == 9){
+ $newSelect.trigger('close');
+ return;
+ }
+
+ // ARROW DOWN WHEN SELECT IS CLOSED - open select options
+ if(e.which == 40 && !options.is(':visible')){
+ $newSelect.trigger('open');
+ return;
+ }
+
+ // ENTER WHEN SELECT IS CLOSED - submit form
+ if(e.which == 13 && !options.is(':visible')){
+ return;
+ }
+
+ e.preventDefault();
+
+ // CASE WHEN USER TYPE LETTERS
+ var letter = String.fromCharCode(e.which).toLowerCase(),
+ nonLetters = [9,13,27,38,40];
+ if (letter && (nonLetters.indexOf(e.which) === -1)) {
+ filterQuery.push(letter);
+
+ var string = filterQuery.join(''),
+ newOption = options.find('li').filter(function() {
+ return $(this).text().toLowerCase().indexOf(string) === 0;
+ })[0];
+
+ if (newOption) {
+ activateOption(options, newOption);
+ }
+ }
+
+ // ENTER - select option and close when select options are opened
+ if (e.which == 13) {
+ var activeOption = options.find('li.selected:not(.disabled)')[0];
+ if(activeOption){
+ $(activeOption).trigger('click');
+ if (!multiple) {
+ $newSelect.trigger('close');
+ }
+ }
+ }
+
+ // ARROW DOWN - move to next not disabled option
+ if (e.which == 40) {
+ if (options.find('li.selected').length) {
+ newOption = options.find('li.selected').next('li:not(.disabled)')[0];
+ } else {
+ newOption = options.find('li:not(.disabled)')[0];
+ }
+ activateOption(options, newOption);
+ }
+
+ // ESC - close options
+ if (e.which == 27) {
+ $newSelect.trigger('close');
+ }
+
+ // ARROW UP - move to previous not disabled option
+ if (e.which == 38) {
+ newOption = options.find('li.selected').prev('li:not(.disabled)')[0];
+ if(newOption)
+ activateOption(options, newOption);
+ }
+
+ // Automaticaly clean filter query so user can search again by starting letters
+ setTimeout(function(){ filterQuery = []; }, 1000);
+ };
+
+ $newSelect.on('keydown', onKeyDown);
+ });
+
+ function toggleEntryFromArray(entriesArray, entryIndex, select) {
+ var index = entriesArray.indexOf(entryIndex),
+ notAdded = index === -1;
+
+ if (notAdded) {
+ entriesArray.push(entryIndex);
+ } else {
+ entriesArray.splice(index, 1);
+ }
+
+ select.siblings('ul.dropdown-content').find('li:not(.optgroup)').eq(entryIndex).toggleClass('active');
+
+ // use notAdded instead of true (to detect if the option is selected or not)
+ select.find('option').eq(entryIndex).prop('selected', notAdded);
+ setValueToInput(entriesArray, select);
+
+ return notAdded;
+ }
+
+ function setValueToInput(entriesArray, select) {
+ var value = '';
+
+ for (var i = 0, count = entriesArray.length; i < count; i++) {
+ var text = select.find('option').eq(entriesArray[i]).text();
+
+ i === 0 ? value += text : value += ', ' + text;
+ }
+
+ if (value === '') {
+ value = select.find('option:disabled').eq(0).text();
+ }
+
+ select.siblings('input.select-dropdown').val(value);
+ }
+ };
+
+}( jQuery ));
+;(function ($) {
+
+ var methods = {
+
+ init : function(options) {
+ var defaults = {
+ indicators: true,
+ height: 400,
+ transition: 500,
+ interval: 6000
+ };
+ options = $.extend(defaults, options);
+
+ return this.each(function() {
+
+ // For each slider, we want to keep track of
+ // which slide is active and its associated content
+ var $this = $(this);
+ var $slider = $this.find('ul.slides').first();
+ var $slides = $slider.find('> li');
+ var $active_index = $slider.find('.active').index();
+ var $active, $indicators, $interval;
+ if ($active_index != -1) { $active = $slides.eq($active_index); }
+
+ // Transitions the caption depending on alignment
+ function captionTransition(caption, duration) {
+ if (caption.hasClass("center-align")) {
+ caption.velocity({opacity: 0, translateY: -100}, {duration: duration, queue: false});
+ }
+ else if (caption.hasClass("right-align")) {
+ caption.velocity({opacity: 0, translateX: 100}, {duration: duration, queue: false});
+ }
+ else if (caption.hasClass("left-align")) {
+ caption.velocity({opacity: 0, translateX: -100}, {duration: duration, queue: false});
+ }
+ }
+
+ // This function will transition the slide to any index of the next slide
+ function moveToSlide(index) {
+ // Wrap around indices.
+ if (index >= $slides.length) index = 0;
+ else if (index < 0) index = $slides.length -1;
+
+ $active_index = $slider.find('.active').index();
+
+ // Only do if index changes
+ if ($active_index != index) {
+ $active = $slides.eq($active_index);
+ $caption = $active.find('.caption');
+
+ $active.removeClass('active');
+ $active.velocity({opacity: 0}, {duration: options.transition, queue: false, easing: 'easeOutQuad',
+ complete: function() {
+ $slides.not('.active').velocity({opacity: 0, translateX: 0, translateY: 0}, {duration: 0, queue: false});
+ } });
+ captionTransition($caption, options.transition);
+
+
+ // Update indicators
+ if (options.indicators) {
+ $indicators.eq($active_index).removeClass('active');
+ }
+
+ $slides.eq(index).velocity({opacity: 1}, {duration: options.transition, queue: false, easing: 'easeOutQuad'});
+ $slides.eq(index).find('.caption').velocity({opacity: 1, translateX: 0, translateY: 0}, {duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad'});
+ $slides.eq(index).addClass('active');
+
+
+ // Update indicators
+ if (options.indicators) {
+ $indicators.eq(index).addClass('active');
+ }
+ }
+ }
+
+ // Set height of slider
+ // If fullscreen, do nothing
+ if (!$this.hasClass('fullscreen')) {
+ if (options.indicators) {
+ // Add height if indicators are present
+ $this.height(options.height + 40);
+ }
+ else {
+ $this.height(options.height);
+ }
+ $slider.height(options.height);
+ }
+
+
+ // Set initial positions of captions
+ $slides.find('.caption').each(function () {
+ captionTransition($(this), 0);
+ });
+
+ // Move img src into background-image
+ $slides.find('img').each(function () {
+ var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==';
+ if ($(this).attr('src') !== placeholderBase64) {
+ $(this).css('background-image', 'url("' + $(this).attr('src') + '")' );
+ $(this).attr('src', placeholderBase64);
+ }
+ });
+
+ // dynamically add indicators
+ if (options.indicators) {
+ $indicators = $('<ul class="indicators"></ul>');
+ $slides.each(function( index ) {
+ var $indicator = $('<li class="indicator-item"></li>');
+
+ // Handle clicks on indicators
+ $indicator.click(function () {
+ var $parent = $slider.parent();
+ var curr_index = $parent.find($(this)).index();
+ moveToSlide(curr_index);
+
+ // reset interval
+ clearInterval($interval);
+ $interval = setInterval(
+ function(){
+ $active_index = $slider.find('.active').index();
+ if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
+ else $active_index += 1;
+
+ moveToSlide($active_index);
+
+ }, options.transition + options.interval
+ );
+ });
+ $indicators.append($indicator);
+ });
+ $this.append($indicators);
+ $indicators = $this.find('ul.indicators').find('li.indicator-item');
+ }
+
+ if ($active) {
+ $active.show();
+ }
+ else {
+ $slides.first().addClass('active').velocity({opacity: 1}, {duration: options.transition, queue: false, easing: 'easeOutQuad'});
+
+ $active_index = 0;
+ $active = $slides.eq($active_index);
+
+ // Update indicators
+ if (options.indicators) {
+ $indicators.eq($active_index).addClass('active');
+ }
+ }
+
+ // Adjust height to current slide
+ $active.find('img').each(function() {
+ $active.find('.caption').velocity({opacity: 1, translateX: 0, translateY: 0}, {duration: options.transition, queue: false, easing: 'easeOutQuad'});
+ });
+
+ // auto scroll
+ $interval = setInterval(
+ function(){
+ $active_index = $slider.find('.active').index();
+ moveToSlide($active_index + 1);
+
+ }, options.transition + options.interval
+ );
+
+
+ // HammerJS, Swipe navigation
+
+ // Touch Event
+ var panning = false;
+ var swipeLeft = false;
+ var swipeRight = false;
+
+ $this.hammer({
+ prevent_default: false
+ }).on('pan', function(e) {
+ if (e.gesture.pointerType === "touch") {
+
+ // reset interval
+ clearInterval($interval);
+
+ var direction = e.gesture.direction;
+ var x = e.gesture.deltaX;
+ var velocityX = e.gesture.velocityX;
+ var velocityY = e.gesture.velocityY;
+
+ $curr_slide = $slider.find('.active');
+ if (Math.abs(velocityX) > Math.abs(velocityY)) {
+ $curr_slide.velocity({ translateX: x
+ }, {duration: 50, queue: false, easing: 'easeOutQuad'});
+ }
+
+ // Swipe Left
+ if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.65)) {
+ swipeRight = true;
+ }
+ // Swipe Right
+ else if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.65)) {
+ swipeLeft = true;
+ }
+
+ // Make Slide Behind active slide visible
+ var next_slide;
+ if (swipeLeft) {
+ next_slide = $curr_slide.next();
+ if (next_slide.length === 0) {
+ next_slide = $slides.first();
+ }
+ next_slide.velocity({ opacity: 1
+ }, {duration: 300, queue: false, easing: 'easeOutQuad'});
+ }
+ if (swipeRight) {
+ next_slide = $curr_slide.prev();
+ if (next_slide.length === 0) {
+ next_slide = $slides.last();
+ }
+ next_slide.velocity({ opacity: 1
+ }, {duration: 300, queue: false, easing: 'easeOutQuad'});
+ }
+
+
+ }
+
+ }).on('panend', function(e) {
+ if (e.gesture.pointerType === "touch") {
+
+ $curr_slide = $slider.find('.active');
+ panning = false;
+ curr_index = $slider.find('.active').index();
+
+ if (!swipeRight && !swipeLeft || $slides.length <=1) {
+ // Return to original spot
+ $curr_slide.velocity({ translateX: 0
+ }, {duration: 300, queue: false, easing: 'easeOutQuad'});
+ }
+ else if (swipeLeft) {
+ moveToSlide(curr_index + 1);
+ $curr_slide.velocity({translateX: -1 * $this.innerWidth() }, {duration: 300, queue: false, easing: 'easeOutQuad',
+ complete: function() {
+ $curr_slide.velocity({opacity: 0, translateX: 0}, {duration: 0, queue: false});
+ } });
+ }
+ else if (swipeRight) {
+ moveToSlide(curr_index - 1);
+ $curr_slide.velocity({translateX: $this.innerWidth() }, {duration: 300, queue: false, easing: 'easeOutQuad',
+ complete: function() {
+ $curr_slide.velocity({opacity: 0, translateX: 0}, {duration: 0, queue: false});
+ } });
+ }
+ swipeLeft = false;
+ swipeRight = false;
+
+ // Restart interval
+ clearInterval($interval);
+ $interval = setInterval(
+ function(){
+ $active_index = $slider.find('.active').index();
+ if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
+ else $active_index += 1;
+
+ moveToSlide($active_index);
+
+ }, options.transition + options.interval
+ );
+ }
+ });
+
+ $this.on('sliderPause', function() {
+ clearInterval($interval);
+ });
+
+ $this.on('sliderStart', function() {
+ clearInterval($interval);
+ $interval = setInterval(
+ function(){
+ $active_index = $slider.find('.active').index();
+ if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
+ else $active_index += 1;
+
+ moveToSlide($active_index);
+
+ }, options.transition + options.interval
+ );
+ });
+
+ $this.on('sliderNext', function() {
+ $active_index = $slider.find('.active').index();
+ moveToSlide($active_index + 1);
+ });
+
+ $this.on('sliderPrev', function() {
+ $active_index = $slider.find('.active').index();
+ moveToSlide($active_index - 1);
+ });
+
+ });
+
+
+
+ },
+ pause : function() {
+ $(this).trigger('sliderPause');
+ },
+ start : function() {
+ $(this).trigger('sliderStart');
+ },
+ next : function() {
+ $(this).trigger('sliderNext');
+ },
+ prev : function() {
+ $(this).trigger('sliderPrev');
+ }
+ };
+
+
+ $.fn.slider = function(methodOrOptions) {
+ if ( methods[methodOrOptions] ) {
+ return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
+ } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
+ // Default to "init"
+ return methods.init.apply( this, arguments );
+ } else {
+ $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.tooltip' );
+ }
+ }; // Plugin end
+}( jQuery ));
+;(function ($) {
+ $(document).ready(function() {
+
+ $(document).on('click.card', '.card', function (e) {
+ if ($(this).find('> .card-reveal').length) {
+ var $card = $(e.target).closest('.card');
+ if ($card.data('initialOverflow') === undefined) {
+ $card.data(
+ 'initialOverflow',
+ $card.css('overflow') === undefined ? '' : $card.css('overflow')
+ );
+ }
+ if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) {
+ // Make Reveal animate down and display none
+ $(this).find('.card-reveal').velocity(
+ {translateY: 0}, {
+ duration: 225,
+ queue: false,
+ easing: 'easeInOutQuad',
+ complete: function() {
+ $(this).css({ display: 'none'});
+ $card.css('overflow', $card.data('initialOverflow'));
+ }
+ }
+ );
+ }
+ else if ($(e.target).is($('.card .activator')) ||
+ $(e.target).is($('.card .activator i')) ) {
+ $card.css('overflow', 'hidden');
+ $(this).find('.card-reveal').css({ display: 'block'}).velocity("stop", false).velocity({translateY: '-100%'}, {duration: 300, queue: false, easing: 'easeInOutQuad'});
+ }
+ }
+ });
+
+ });
+}( jQuery ));
+;(function ($) {
+ var materialChipsDefaults = {
+ data: [],
+ placeholder: '',
+ secondaryPlaceholder: '',
+ autocompleteOptions: {},
+ };
+
+ $(document).ready(function() {
+ // Handle removal of static chips.
+ $(document).on('click', '.chip .close', function(e){
+ var $chips = $(this).closest('.chips');
+ if ($chips.attr('data-initialized')) {
+ return;
+ }
+ $(this).closest('.chip').remove();
+ });
+ });
+
+ $.fn.material_chip = function (options) {
+ var self = this;
+ this.$el = $(this);
+ this.$document = $(document);
+ this.SELS = {
+ CHIPS: '.chips',
+ CHIP: '.chip',
+ INPUT: 'input',
+ DELETE: '.material-icons',
+ SELECTED_CHIP: '.selected',
+ };
+
+ if ('data' === options) {
+ return this.$el.data('chips');
+ }
+
+ var curr_options = $.extend({}, materialChipsDefaults, options);
+ self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteOptions.data);
+
+ // Initialize
+ this.init = function() {
+ var i = 0;
+ var chips;
+ self.$el.each(function(){
+ var $chips = $(this);
+ var chipId = Materialize.guid();
+ self.chipId = chipId;
+
+ if (!curr_options.data || !(curr_options.data instanceof Array)) {
+ curr_options.data = [];
+ }
+ $chips.data('chips', curr_options.data);
+ $chips.attr('data-index', i);
+ $chips.attr('data-initialized', true);
+
+ if (!$chips.hasClass(self.SELS.CHIPS)) {
+ $chips.addClass('chips');
+ }
+
+ self.chips($chips, chipId);
+ i++;
+ });
+ };
+
+ this.handleEvents = function() {
+ var SELS = self.SELS;
+
+ self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function(e){
+ $(e.target).find(SELS.INPUT).focus();
+ });
+
+ self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function(e){
+ var $chip = $(e.target);
+ if ($chip.length) {
+ var wasSelected = $chip.hasClass('selected');
+ var $chips = $chip.closest(SELS.CHIPS);
+ $(SELS.CHIP).removeClass('selected');
+
+ if (!wasSelected) {
+ self.selectChip($chip.index(), $chips);
+ }
+ }
+ });
+
+ self.$document.off('keydown.chips').on('keydown.chips', function(e){
+ if ($(e.target).is('input, textarea')) {
+ return;
+ }
+
+ // delete
+ var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP);
+ var $chips = $chip.closest(SELS.CHIPS);
+ var length = $chip.siblings(SELS.CHIP).length;
+ var index;
+
+ if (!$chip.length) {
+ return;
+ }
+
+ if (e.which === 8 || e.which === 46) {
+ e.preventDefault();
+
+ index = $chip.index();
+ self.deleteChip(index, $chips);
+
+ var selectIndex = null;
+ if ((index + 1) < length) {
+ selectIndex = index;
+ } else if (index === length || (index + 1) === length) {
+ selectIndex = length - 1;
+ }
+
+ if (selectIndex < 0) selectIndex = null;
+
+ if (null !== selectIndex) {
+ self.selectChip(selectIndex, $chips);
+ }
+ if (!length) $chips.find('input').focus();
+
+ // left
+ } else if (e.which === 37) {
+ index = $chip.index() - 1;
+ if (index < 0) {
+ return;
+ }
+ $(SELS.CHIP).removeClass('selected');
+ self.selectChip(index, $chips);
+
+ // right
+ } else if (e.which === 39) {
+ index = $chip.index() + 1;
+ $(SELS.CHIP).removeClass('selected');
+ if (index > length) {
+ $chips.find('input').focus();
+ return;
+ }
+ self.selectChip(index, $chips);
+ }
+ });
+
+ self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function(e){
+ var $currChips = $(e.target).closest(SELS.CHIPS);
+ $currChips.addClass('focus');
+ $currChips.siblings('label, .prefix').addClass('active');
+ $(SELS.CHIP).removeClass('selected');
+ });
+
+ self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function(e){
+ var $currChips = $(e.target).closest(SELS.CHIPS);
+ $currChips.removeClass('focus');
+
+ // Remove active if empty
+ if ($currChips.data('chips') === undefined || !$currChips.data('chips').length) {
+ $currChips.siblings('label').removeClass('active');
+ }
+ $currChips.siblings('.prefix').removeClass('active');
+ });
+
+ self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function(e){
+ var $target = $(e.target);
+ var $chips = $target.closest(SELS.CHIPS);
+ var chipsLength = $chips.children(SELS.CHIP).length;
+
+ // enter
+ if (13 === e.which) {
+ // Override enter if autocompleting.
+ if (self.hasAutocomplete &&
+ $chips.find('.autocomplete-content.dropdown-content').length &&
+ $chips.find('.autocomplete-content.dropdown-content').children().length) {
+ return;
+ }
+
+ e.preventDefault();
+ self.addChip({tag: $target.val()}, $chips);
+ $target.val('');
+ return;
+ }
+
+ // delete or left
+ if ((8 === e.keyCode || 37 === e.keyCode) && '' === $target.val() && chipsLength) {
+ e.preventDefault();
+ self.selectChip(chipsLength - 1, $chips);
+ $target.blur();
+ return;
+ }
+ });
+
+ // Click on delete icon in chip.
+ self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function(e) {
+ var $target = $(e.target);
+ var $chips = $target.closest(SELS.CHIPS);
+ var $chip = $target.closest(SELS.CHIP);
+ e.stopPropagation();
+ self.deleteChip($chip.index(), $chips);
+ $chips.find('input').focus();
+ });
+ };
+
+ this.chips = function($chips, chipId) {
+ $chips.empty();
+ $chips.data('chips').forEach(function(elem){
+ $chips.append(self.renderChip(elem));
+ });
+ $chips.append($('<input id="' + chipId +'" class="input" placeholder="">'));
+ self.setPlaceholder($chips);
+
+ // Set for attribute for label
+ var label = $chips.next('label');
+ if (label.length) {
+ label.attr('for', chipId);
+
+ if ($chips.data('chips')!== undefined && $chips.data('chips').length) {
+ label.addClass('active');
+ }
+ }
+
+ // Setup autocomplete if needed.
+ var input = $('#' + chipId);
+ if (self.hasAutocomplete) {
+ curr_options.autocompleteOptions.onAutocomplete = function(val) {
+ self.addChip({tag: val}, $chips);
+ input.val('');
+ input.focus();
+ }
+ input.autocomplete(curr_options.autocompleteOptions);
+ }
+ };
+
+ /**
+ * Render chip jQuery element.
+ * @param {Object} elem
+ * @return {jQuery}
+ */
+ this.renderChip = function(elem) {
+ if (!elem.tag) return;
+
+ var $renderedChip = $('<div class="chip"></div>');
+ $renderedChip.text(elem.tag);
+ if (elem.image) {
+ $renderedChip.prepend($('<img />').attr('src', elem.image))
+ }
+ $renderedChip.append($('<i class="material-icons close">close</i>'));
+ return $renderedChip;
+ };
+
+ this.setPlaceholder = function($chips) {
+ if ($chips.data('chips') !== undefined && $chips.data('chips').length && curr_options.placeholder) {
+ $chips.find('input').prop('placeholder', curr_options.placeholder);
+
+ } else if (($chips.data('chips') === undefined || !$chips.data('chips').length) && curr_options.secondaryPlaceholder) {
+ $chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder);
+ }
+ };
+
+ this.isValid = function($chips, elem) {
+ var chips = $chips.data('chips');
+ var exists = false;
+ for (var i=0; i < chips.length; i++) {
+ if (chips[i].tag === elem.tag) {
+ exists = true;
+ return;
+ }
+ }
+ return '' !== elem.tag && !exists;
+ };
+
+ this.addChip = function(elem, $chips) {
+ if (!self.isValid($chips, elem)) {
+ return;
+ }
+ var $renderedChip = self.renderChip(elem);
+ var newData = [];
+ var oldData = $chips.data('chips');
+ for (var i = 0; i < oldData.length; i++) {
+ newData.push(oldData[i]);
+ }
+ newData.push(elem);
+
+ $chips.data('chips', newData);
+ $renderedChip.insertBefore($chips.find('input'));
+ $chips.trigger('chip.add', elem);
+ self.setPlaceholder($chips);
+ };
+
+ this.deleteChip = function(chipIndex, $chips) {
+ var chip = $chips.data('chips')[chipIndex];
+ $chips.find('.chip').eq(chipIndex).remove();
+
+ var newData = [];
+ var oldData = $chips.data('chips');
+ for (var i = 0; i < oldData.length; i++) {
+ if (i !== chipIndex) {
+ newData.push(oldData[i]);
+ }
+ }
+
+ $chips.data('chips', newData);
+ $chips.trigger('chip.delete', chip);
+ self.setPlaceholder($chips);
+ };
+
+ this.selectChip = function(chipIndex, $chips) {
+ var $chip = $chips.find('.chip').eq(chipIndex);
+ if ($chip && false === $chip.hasClass('selected')) {
+ $chip.addClass('selected');
+ $chips.trigger('chip.select', $chips.data('chips')[chipIndex]);
+ }
+ };
+
+ this.getChipsElement = function(index, $chips) {
+ return $chips.eq(index);
+ };
+
+ // init
+ this.init();
+
+ this.handleEvents();
+ };
+}( jQuery ));
+;(function ($) {
+ $.fn.pushpin = function (options) {
+ // Defaults
+ var defaults = {
+ top: 0,
+ bottom: Infinity,
+ offset: 0
+ };
+
+ // Remove pushpin event and classes
+ if (options === "remove") {
+ this.each(function () {
+ if (id = $(this).data('pushpin-id')) {
+ $(window).off('scroll.' + id);
+ $(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style');
+ }
+ });
+ return false;
+ }
+
+ options = $.extend(defaults, options);
+
+
+ $index = 0;
+ return this.each(function() {
+ var $uniqueId = Materialize.guid(),
+ $this = $(this),
+ $original_offset = $(this).offset().top;
+
+ function removePinClasses(object) {
+ object.removeClass('pin-top');
+ object.removeClass('pinned');
+ object.removeClass('pin-bottom');
+ }
+
+ function updateElements(objects, scrolled) {
+ objects.each(function () {
+ // Add position fixed (because its between top and bottom)
+ if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) {
+ removePinClasses($(this));
+ $(this).css('top', options.offset);
+ $(this).addClass('pinned');
+ }
+
+ // Add pin-top (when scrolled position is above top)
+ if (scrolled < options.top && !$(this).hasClass('pin-top')) {
+ removePinClasses($(this));
+ $(this).css('top', 0);
+ $(this).addClass('pin-top');
+ }
+
+ // Add pin-bottom (when scrolled position is below bottom)
+ if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) {
+ removePinClasses($(this));
+ $(this).addClass('pin-bottom');
+ $(this).css('top', options.bottom - $original_offset);
+ }
+ });
+ }
+
+ $(this).data('pushpin-id', $uniqueId);
+ updateElements($this, $(window).scrollTop());
+ $(window).on('scroll.' + $uniqueId, function () {
+ var $scrolled = $(window).scrollTop() + options.offset;
+ updateElements($this, $scrolled);
+ });
+
+ });
+
+ };
+}( jQuery ));;(function ($) {
+ $(document).ready(function() {
+
+ // jQuery reverse
+ $.fn.reverse = [].reverse;
+
+ // Hover behaviour: make sure this doesn't work on .click-to-toggle FABs!
+ $(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function(e) {
+ var $this = $(this);
+ openFABMenu($this);
+ });
+ $(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function(e) {
+ var $this = $(this);
+ closeFABMenu($this);
+ });
+
+ // Toggle-on-click behaviour.
+ $(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function(e) {
+ var $this = $(this);
+ var $menu = $this.parent();
+ if ($menu.hasClass('active')) {
+ closeFABMenu($menu);
+ } else {
+ openFABMenu($menu);
+ }
+ });
+
+ // Toolbar transition behaviour.
+ $(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function(e) {
+ var $this = $(this);
+ var $menu = $this.parent();
+ FABtoToolbar($menu);
+ });
+
+ });
+
+ $.fn.extend({
+ openFAB: function() {
+ openFABMenu($(this));
+ },
+ closeFAB: function() {
+ closeFABMenu($(this));
+ },
+ openToolbar: function() {
+ FABtoToolbar($(this));
+ },
+ closeToolbar: function() {
+ toolbarToFAB($(this));
+ }
+ });
+
+
+ var openFABMenu = function (btn) {
+ var $this = btn;
+ if ($this.hasClass('active') === false) {
+
+ // Get direction option
+ var horizontal = $this.hasClass('horizontal');
+ var offsetY, offsetX;
+
+ if (horizontal === true) {
+ offsetX = 40;
+ } else {
+ offsetY = 40;
+ }
+
+ $this.addClass('active');
+ $this.find('ul .btn-floating').velocity(
+ { scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px'},
+ { duration: 0 });
+
+ var time = 0;
+ $this.find('ul .btn-floating').reverse().each( function () {
+ $(this).velocity(
+ { opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0'},
+ { duration: 80, delay: time });
+ time += 40;
+ });
+ }
+ };
+
+ var closeFABMenu = function (btn) {
+ var $this = btn;
+ // Get direction option
+ var horizontal = $this.hasClass('horizontal');
+ var offsetY, offsetX;
+
+ if (horizontal === true) {
+ offsetX = 40;
+ } else {
+ offsetY = 40;
+ }
+
+ $this.removeClass('active');
+ var time = 0;
+ $this.find('ul .btn-floating').velocity("stop", true);
+ $this.find('ul .btn-floating').velocity(
+ { opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px'},
+ { duration: 80 }
+ );
+ };
+
+
+ /**
+ * Transform FAB into toolbar
+ * @param {Object} object jQuery object
+ */
+ var FABtoToolbar = function(btn) {
+ if (btn.attr('data-open') === "true") {
+ return;
+ }
+
+ var offsetX, offsetY, scaleFactor;
+ var windowWidth = window.innerWidth;
+ var windowHeight = window.innerHeight;
+ var btnRect = btn[0].getBoundingClientRect();
+ var anchor = btn.find('> a').first();
+ var menu = btn.find('> ul').first();
+ var backdrop = $('<div class="fab-backdrop"></div>');
+ var fabColor = anchor.css('background-color');
+ anchor.append(backdrop);
+
+ offsetX = btnRect.left - (windowWidth / 2) + (btnRect.width / 2);
+ offsetY = windowHeight - btnRect.bottom;
+ scaleFactor = windowWidth / backdrop.width();
+ btn.attr('data-origin-bottom', btnRect.bottom);
+ btn.attr('data-origin-left', btnRect.left);
+ btn.attr('data-origin-width', btnRect.width);
+
+ // Set initial state
+ btn.addClass('active');
+ btn.attr('data-open', true);
+ btn.css({
+ 'text-align': 'center',
+ width: '100%',
+ bottom: 0,
+ left: 0,
+ transform: 'translateX(' + offsetX + 'px)',
+ transition: 'none'
+ });
+ anchor.css({
+ transform: 'translateY(' + -offsetY + 'px)',
+ transition: 'none'
+ });
+ backdrop.css({
+ 'background-color': fabColor
+ });
+
+
+ setTimeout(function() {
+ btn.css({
+ transform: '',
+ transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s'
+ });
+ anchor.css({
+ overflow: 'visible',
+ transform: '',
+ transition: 'transform .2s'
+ });
+
+ setTimeout(function() {
+ btn.css({
+ overflow: 'hidden',
+ 'background-color': fabColor
+ });
+ backdrop.css({
+ transform: 'scale(' + scaleFactor + ')',
+ transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
+ });
+ menu.find('> li > a').css({
+ opacity: 1
+ });
+
+ // Scroll to close.
+ $(window).on('scroll.fabToolbarClose', function() {
+ toolbarToFAB(btn);
+ $(window).off('scroll.fabToolbarClose');
+ $(document).off('click.fabToolbarClose');
+ });
+
+ $(document).on('click.fabToolbarClose', function(e) {
+ if (!$(e.target).closest(menu).length) {
+ toolbarToFAB(btn);
+ $(window).off('scroll.fabToolbarClose');
+ $(document).off('click.fabToolbarClose');
+ }
+ });
+ }, 100);
+ }, 0);
+ };
+
+ /**
+ * Transform toolbar back into FAB
+ * @param {Object} object jQuery object
+ */
+ var toolbarToFAB = function(btn) {
+ if (btn.attr('data-open') !== "true") {
+ return;
+ }
+
+ var offsetX, offsetY, scaleFactor;
+ var windowWidth = window.innerWidth;
+ var windowHeight = window.innerHeight;
+ var btnWidth = btn.attr('data-origin-width');
+ var btnBottom = btn.attr('data-origin-bottom');
+ var btnLeft = btn.attr('data-origin-left');
+ var anchor = btn.find('> .btn-floating').first();
+ var menu = btn.find('> ul').first();
+ var backdrop = btn.find('.fab-backdrop');
+ var fabColor = anchor.css('background-color');
+
+ offsetX = btnLeft - (windowWidth / 2) + (btnWidth / 2);
+ offsetY = windowHeight - btnBottom;
+ scaleFactor = windowWidth / backdrop.width();
+
+
+ // Hide backdrop
+ btn.removeClass('active');
+ btn.attr('data-open', false);
+ btn.css({
+ 'background-color': 'transparent',
+ transition: 'none'
+ });
+ anchor.css({
+ transition: 'none'
+ });
+ backdrop.css({
+ transform: 'scale(0)',
+ 'background-color': fabColor
+ });
+ menu.find('> li > a').css({
+ opacity: ''
+ });
+
+ setTimeout(function() {
+ backdrop.remove();
+
+ // Set initial state.
+ btn.css({
+ 'text-align': '',
+ width: '',
+ bottom: '',
+ left: '',
+ overflow: '',
+ 'background-color': '',
+ transform: 'translate3d(' + -offsetX + 'px,0,0)'
+ });
+ anchor.css({
+ overflow: '',
+ transform: 'translate3d(0,' + offsetY + 'px,0)'
+ });
+
+ setTimeout(function() {
+ btn.css({
+ transform: 'translate3d(0,0,0)',
+ transition: 'transform .2s'
+ });
+ anchor.css({
+ transform: 'translate3d(0,0,0)',
+ transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
+ });
+ }, 20);
+ }, 200);
+ };
+
+
+}( jQuery ));
+;(function ($) {
+ // Image transition function
+ Materialize.fadeInImage = function(selectorOrEl) {
+ var element;
+ if (typeof(selectorOrEl) === 'string') {
+ element = $(selectorOrEl);
+ } else if (typeof(selectorOrEl) === 'object') {
+ element = selectorOrEl;
+ } else {
+ return;
+ }
+ element.css({opacity: 0});
+ $(element).velocity({opacity: 1}, {
+ duration: 650,
+ queue: false,
+ easing: 'easeOutSine'
+ });
+ $(element).velocity({opacity: 1}, {
+ duration: 1300,
+ queue: false,
+ easing: 'swing',
+ step: function(now, fx) {
+ fx.start = 100;
+ var grayscale_setting = now/100;
+ var brightness_setting = 150 - (100 - now)/1.75;
+
+ if (brightness_setting < 100) {
+ brightness_setting = 100;
+ }
+ if (now >= 0) {
+ $(this).css({
+ "-webkit-filter": "grayscale("+grayscale_setting+")" + "brightness("+brightness_setting+"%)",
+ "filter": "grayscale("+grayscale_setting+")" + "brightness("+brightness_setting+"%)"
+ });
+ }
+ }
+ });
+ };
+
+ // Horizontal staggered list
+ Materialize.showStaggeredList = function(selectorOrEl) {
+ var element;
+ if (typeof(selectorOrEl) === 'string') {
+ element = $(selectorOrEl);
+ } else if (typeof(selectorOrEl) === 'object') {
+ element = selectorOrEl;
+ } else {
+ return;
+ }
+ var time = 0;
+ element.find('li').velocity(
+ { translateX: "-100px"},
+ { duration: 0 });
+
+ element.find('li').each(function() {
+ $(this).velocity(
+ { opacity: "1", translateX: "0"},
+ { duration: 800, delay: time, easing: [60, 10] });
+ time += 120;
+ });
+ };
+
+
+ $(document).ready(function() {
+ // Hardcoded .staggered-list scrollFire
+ // var staggeredListOptions = [];
+ // $('ul.staggered-list').each(function (i) {
+
+ // var label = 'scrollFire-' + i;
+ // $(this).addClass(label);
+ // staggeredListOptions.push(
+ // {selector: 'ul.staggered-list.' + label,
+ // offset: 200,
+ // callback: 'showStaggeredList("ul.staggered-list.' + label + '")'});
+ // });
+ // scrollFire(staggeredListOptions);
+
+ // HammerJS, Swipe navigation
+
+ // Touch Event
+ var swipeLeft = false;
+ var swipeRight = false;
+
+
+ // Dismissible Collections
+ $('.dismissable').each(function() {
+ $(this).hammer({
+ prevent_default: false
+ }).on('pan', function(e) {
+ if (e.gesture.pointerType === "touch") {
+ var $this = $(this);
+ var direction = e.gesture.direction;
+ var x = e.gesture.deltaX;
+ var velocityX = e.gesture.velocityX;
+
+ $this.velocity({ translateX: x
+ }, {duration: 50, queue: false, easing: 'easeOutQuad'});
+
+ // Swipe Left
+ if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.75)) {
+ swipeLeft = true;
+ }
+
+ // Swipe Right
+ if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.75)) {
+ swipeRight = true;
+ }
+ }
+ }).on('panend', function(e) {
+ // Reset if collection is moved back into original position
+ if (Math.abs(e.gesture.deltaX) < ($(this).innerWidth() / 2)) {
+ swipeRight = false;
+ swipeLeft = false;
+ }
+
+ if (e.gesture.pointerType === "touch") {
+ var $this = $(this);
+ if (swipeLeft || swipeRight) {
+ var fullWidth;
+ if (swipeLeft) { fullWidth = $this.innerWidth(); }
+ else { fullWidth = -1 * $this.innerWidth(); }
+
+ $this.velocity({ translateX: fullWidth,
+ }, {duration: 100, queue: false, easing: 'easeOutQuad', complete:
+ function() {
+ $this.css('border', 'none');
+ $this.velocity({ height: 0, padding: 0,
+ }, {duration: 200, queue: false, easing: 'easeOutQuad', complete:
+ function() { $this.remove(); }
+ });
+ }
+ });
+ }
+ else {
+ $this.velocity({ translateX: 0,
+ }, {duration: 100, queue: false, easing: 'easeOutQuad'});
+ }
+ swipeLeft = false;
+ swipeRight = false;
+ }
+ });
+
+ });
+
+
+ // time = 0
+ // // Vertical Staggered list
+ // $('ul.staggered-list.vertical li').velocity(
+ // { translateY: "100px"},
+ // { duration: 0 });
+
+ // $('ul.staggered-list.vertical li').each(function() {
+ // $(this).velocity(
+ // { opacity: "1", translateY: "0"},
+ // { duration: 800, delay: time, easing: [60, 25] });
+ // time += 120;
+ // });
+
+ // // Fade in and Scale
+ // $('.fade-in.scale').velocity(
+ // { scaleX: .4, scaleY: .4, translateX: -600},
+ // { duration: 0});
+ // $('.fade-in').each(function() {
+ // $(this).velocity(
+ // { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0},
+ // { duration: 800, easing: [60, 10] });
+ // });
+ });
+}( jQuery ));
+;(function($) {
+
+ var scrollFireEventsHandled = false;
+
+ // Input: Array of JSON objects {selector, offset, callback}
+ Materialize.scrollFire = function(options) {
+ var onScroll = function() {
+ var windowScroll = window.pageYOffset + window.innerHeight;
+
+ for (var i = 0 ; i < options.length; i++) {
+ // Get options from each line
+ var value = options[i];
+ var selector = value.selector,
+ offset = value.offset,
+ callback = value.callback;
+
+ var currentElement = document.querySelector(selector);
+ if ( currentElement !== null) {
+ var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset;
+
+ if (windowScroll > (elementOffset + offset)) {
+ if (value.done !== true) {
+ if (typeof(callback) === 'function') {
+ callback.call(this, currentElement);
+ } else if (typeof(callback) === 'string') {
+ var callbackFunc = new Function(callback);
+ callbackFunc(currentElement);
+ }
+ value.done = true;
+ }
+ }
+ }
+ }
+ };
+
+
+ var throttledScroll = Materialize.throttle(function() {
+ onScroll();
+ }, options.throttle || 100);
+
+ if (!scrollFireEventsHandled) {
+ window.addEventListener("scroll", throttledScroll);
+ window.addEventListener("resize", throttledScroll);
+ scrollFireEventsHandled = true;
+ }
+
+ // perform a scan once, after current execution context, and after dom is ready
+ setTimeout(throttledScroll, 0);
+ };
+
+})(jQuery);
+;/*!
+ * pickadate.js v3.5.0, 2014/04/13
+ * By Amsul, http://amsul.ca
+ * Hosted on http://amsul.github.io/pickadate.js
+ * Licensed under MIT
+ */
+
+(function ( factory ) {
+
+ // AMD.
+ if ( typeof define == 'function' && define.amd )
+ define( 'picker', ['jquery'], factory )
+
+ // Node.js/browserify.
+ else if ( typeof exports == 'object' )
+ module.exports = factory( require('jquery') )
+
+ // Browser globals.
+ else this.Picker = factory( jQuery )
+
+}(function( $ ) {
+
+var $window = $( window )
+var $document = $( document )
+var $html = $( document.documentElement )
+
+
+/**
+ * The picker constructor that creates a blank picker.
+ */
+function PickerConstructor( ELEMENT, NAME, COMPONENT, OPTIONS ) {
+
+ // If there’s no element, return the picker constructor.
+ if ( !ELEMENT ) return PickerConstructor
+
+
+ var
+ IS_DEFAULT_THEME = false,
+
+
+ // The state of the picker.
+ STATE = {
+ id: ELEMENT.id || 'P' + Math.abs( ~~(Math.random() * new Date()) )
+ },
+
+
+ // Merge the defaults and options passed.
+ SETTINGS = COMPONENT ? $.extend( true, {}, COMPONENT.defaults, OPTIONS ) : OPTIONS || {},
+
+
+ // Merge the default classes with the settings classes.
+ CLASSES = $.extend( {}, PickerConstructor.klasses(), SETTINGS.klass ),
+
+
+ // The element node wrapper into a jQuery object.
+ $ELEMENT = $( ELEMENT ),
+
+
+ // Pseudo picker constructor.
+ PickerInstance = function() {
+ return this.start()
+ },
+
+
+ // The picker prototype.
+ P = PickerInstance.prototype = {
+
+ constructor: PickerInstance,
+
+ $node: $ELEMENT,
+
+
+ /**
+ * Initialize everything
+ */
+ start: function() {
+
+ // If it’s already started, do nothing.
+ if ( STATE && STATE.start ) return P
+
+
+ // Update the picker states.
+ STATE.methods = {}
+ STATE.start = true
+ STATE.open = false
+ STATE.type = ELEMENT.type
+
+
+ // Confirm focus state, convert into text input to remove UA stylings,
+ // and set as readonly to prevent keyboard popup.
+ ELEMENT.autofocus = ELEMENT == getActiveElement()
+ ELEMENT.readOnly = !SETTINGS.editable
+ ELEMENT.id = ELEMENT.id || STATE.id
+ if ( ELEMENT.type != 'text' ) {
+ ELEMENT.type = 'text'
+ }
+
+
+ // Create a new picker component with the settings.
+ P.component = new COMPONENT(P, SETTINGS)
+
+
+ // Create the picker root with a holder and then prepare it.
+ P.$root = $( PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"') )
+ prepareElementRoot()
+
+
+ // If there’s a format for the hidden input element, create the element.
+ if ( SETTINGS.formatSubmit ) {
+ prepareElementHidden()
+ }
+
+
+ // Prepare the input element.
+ prepareElement()
+
+
+ // Insert the root as specified in the settings.
+ if ( SETTINGS.container ) $( SETTINGS.container ).append( P.$root )
+ else $ELEMENT.after( P.$root )
+
+
+ // Bind the default component and settings events.
+ P.on({
+ start: P.component.onStart,
+ render: P.component.onRender,
+ stop: P.component.onStop,
+ open: P.component.onOpen,
+ close: P.component.onClose,
+ set: P.component.onSet
+ }).on({
+ start: SETTINGS.onStart,
+ render: SETTINGS.onRender,
+ stop: SETTINGS.onStop,
+ open: SETTINGS.onOpen,
+ close: SETTINGS.onClose,
+ set: SETTINGS.onSet
+ })
+
+
+ // Once we’re all set, check the theme in use.
+ IS_DEFAULT_THEME = isUsingDefaultTheme( P.$root.children()[ 0 ] )
+
+
+ // If the element has autofocus, open the picker.
+ if ( ELEMENT.autofocus ) {
+ P.open()
+ }
+
+
+ // Trigger queued the “start” and “render” events.
+ return P.trigger( 'start' ).trigger( 'render' )
+ }, //start
+
+
+ /**
+ * Render a new picker
+ */
+ render: function( entireComponent ) {
+
+ // Insert a new component holder in the root or box.
+ if ( entireComponent ) P.$root.html( createWrappedComponent() )
+ else P.$root.find( '.' + CLASSES.box ).html( P.component.nodes( STATE.open ) )
+
+ // Trigger the queued “render” events.
+ return P.trigger( 'render' )
+ }, //render
+
+
+ /**
+ * Destroy everything
+ */
+ stop: function() {
+
+ // If it’s already stopped, do nothing.
+ if ( !STATE.start ) return P
+
+ // Then close the picker.
+ P.close()
+
+ // Remove the hidden field.
+ if ( P._hidden ) {
+ P._hidden.parentNode.removeChild( P._hidden )
+ }
+
+ // Remove the root.
+ P.$root.remove()
+
+ // Remove the input class, remove the stored data, and unbind
+ // the events (after a tick for IE - see `P.close`).
+ $ELEMENT.removeClass( CLASSES.input ).removeData( NAME )
+ setTimeout( function() {
+ $ELEMENT.off( '.' + STATE.id )
+ }, 0)
+
+ // Restore the element state
+ ELEMENT.type = STATE.type
+ ELEMENT.readOnly = false
+
+ // Trigger the queued “stop” events.
+ P.trigger( 'stop' )
+
+ // Reset the picker states.
+ STATE.methods = {}
+ STATE.start = false
+
+ return P
+ }, //stop
+
+
+ /**
+ * Open up the picker
+ */
+ open: function( dontGiveFocus ) {
+
+ // If it’s already open, do nothing.
+ if ( STATE.open ) return P
+
+ // Add the “active” class.
+ $ELEMENT.addClass( CLASSES.active )
+ aria( ELEMENT, 'expanded', true )
+
+ // * A Firefox bug, when `html` has `overflow:hidden`, results in
+ // killing transitions :(. So add the “opened” state on the next tick.
+ // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
+ setTimeout( function() {
+
+ // Add the “opened” class to the picker root.
+ P.$root.addClass( CLASSES.opened )
+ aria( P.$root[0], 'hidden', false )
+
+ }, 0 )
+
+ // If we have to give focus, bind the element and doc events.
+ if ( dontGiveFocus !== false ) {
+
+ // Set it as open.
+ STATE.open = true
+
+ // Prevent the page from scrolling.
+ if ( IS_DEFAULT_THEME ) {
+ $html.
+ css( 'overflow', 'hidden' ).
+ css( 'padding-right', '+=' + getScrollbarWidth() )
+ }
+
+ // Pass focus to the root element’s jQuery object.
+ // * Workaround for iOS8 to bring the picker’s root into view.
+ P.$root.eq(0).focus()
+
+ // Bind the document events.
+ $document.on( 'click.' + STATE.id + ' focusin.' + STATE.id, function( event ) {
+
+ var target = event.target
+
+ // If the target of the event is not the element, close the picker picker.
+ // * Don’t worry about clicks or focusins on the root because those don’t bubble up.
+ // Also, for Firefox, a click on an `option` element bubbles up directly
+ // to the doc. So make sure the target wasn't the doc.
+ // * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling,
+ // which causes the picker to unexpectedly close when right-clicking it. So make
+ // sure the event wasn’t a right-click.
+ if ( target != ELEMENT && target != document && event.which != 3 ) {
+
+ // If the target was the holder that covers the screen,
+ // keep the element focused to maintain tabindex.
+ P.close( target === P.$root.children()[0] )
+ }
+
+ }).on( 'keydown.' + STATE.id, function( event ) {
+
+ var
+ // Get the keycode.
+ keycode = event.keyCode,
+
+ // Translate that to a selection change.
+ keycodeToMove = P.component.key[ keycode ],
+
+ // Grab the target.
+ target = event.target
+
+
+ // On escape, close the picker and give focus.
+ if ( keycode == 27 ) {
+ P.close( true )
+ }
+
+
+ // Check if there is a key movement or “enter” keypress on the element.
+ else if ( target == P.$root[0] && ( keycodeToMove || keycode == 13 ) ) {
+
+ // Prevent the default action to stop page movement.
+ event.preventDefault()
+
+ // Trigger the key movement action.
+ if ( keycodeToMove ) {
+ PickerConstructor._.trigger( P.component.key.go, P, [ PickerConstructor._.trigger( keycodeToMove ) ] )
+ }
+
+ // On “enter”, if the highlighted item isn’t disabled, set the value and close.
+ else if ( !P.$root.find( '.' + CLASSES.highlighted ).hasClass( CLASSES.disabled ) ) {
+ P.set( 'select', P.component.item.highlight ).close()
+ }
+ }
+
+
+ // If the target is within the root and “enter” is pressed,
+ // prevent the default action and trigger a click on the target instead.
+ else if ( $.contains( P.$root[0], target ) && keycode == 13 ) {
+ event.preventDefault()
+ target.click()
+ }
+ })
+ }
+
+ // Trigger the queued “open” events.
+ return P.trigger( 'open' )
+ }, //open
+
+
+ /**
+ * Close the picker
+ */
+ close: function( giveFocus ) {
+
+ // If we need to give focus, do it before changing states.
+ if ( giveFocus ) {
+ // ....ah yes! It would’ve been incomplete without a crazy workaround for IE :|
+ // The focus is triggered *after* the close has completed - causing it
+ // to open again. So unbind and rebind the event at the next tick.
+ P.$root.off( 'focus.toOpen' ).eq(0).focus()
+ setTimeout( function() {
+ P.$root.on( 'focus.toOpen', handleFocusToOpenEvent )
+ }, 0 )
+ }
+
+ // Remove the “active” class.
+ $ELEMENT.removeClass( CLASSES.active )
+ aria( ELEMENT, 'expanded', false )
+
+ // * A Firefox bug, when `html` has `overflow:hidden`, results in
+ // killing transitions :(. So remove the “opened” state on the next tick.
+ // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
+ setTimeout( function() {
+
+ // Remove the “opened” and “focused” class from the picker root.
+ P.$root.removeClass( CLASSES.opened + ' ' + CLASSES.focused )
+ aria( P.$root[0], 'hidden', true )
+
+ }, 0 )
+
+ // If it’s already closed, do nothing more.
+ if ( !STATE.open ) return P
+
+ // Set it as closed.
+ STATE.open = false
+
+ // Allow the page to scroll.
+ if ( IS_DEFAULT_THEME ) {
+ $html.
+ css( 'overflow', '' ).
+ css( 'padding-right', '-=' + getScrollbarWidth() )
+ }
+
+ // Unbind the document events.
+ $document.off( '.' + STATE.id )
+
+ // Trigger the queued “close” events.
+ return P.trigger( 'close' )
+ }, //close
+
+
+ /**
+ * Clear the values
+ */
+ clear: function( options ) {
+ return P.set( 'clear', null, options )
+ }, //clear
+
+
+ /**
+ * Set something
+ */
+ set: function( thing, value, options ) {
+
+ var thingItem, thingValue,
+ thingIsObject = $.isPlainObject( thing ),
+ thingObject = thingIsObject ? thing : {}
+
+ // Make sure we have usable options.
+ options = thingIsObject && $.isPlainObject( value ) ? value : options || {}
+
+ if ( thing ) {
+
+ // If the thing isn’t an object, make it one.
+ if ( !thingIsObject ) {
+ thingObject[ thing ] = value
+ }
+
+ // Go through the things of items to set.
+ for ( thingItem in thingObject ) {
+
+ // Grab the value of the thing.
+ thingValue = thingObject[ thingItem ]
+
+ // First, if the item exists and there’s a value, set it.
+ if ( thingItem in P.component.item ) {
+ if ( thingValue === undefined ) thingValue = null
+ P.component.set( thingItem, thingValue, options )
+ }
+
+ // Then, check to update the element value and broadcast a change.
+ if ( thingItem == 'select' || thingItem == 'clear' ) {
+ $ELEMENT.
+ val( thingItem == 'clear' ? '' : P.get( thingItem, SETTINGS.format ) ).
+ trigger( 'change' )
+ }
+ }
+
+ // Render a new picker.
+ P.render()
+ }
+
+ // When the method isn’t muted, trigger queued “set” events and pass the `thingObject`.
+ return options.muted ? P : P.trigger( 'set', thingObject )
+ }, //set
+
+
+ /**
+ * Get something
+ */
+ get: function( thing, format ) {
+
+ // Make sure there’s something to get.
+ thing = thing || 'value'
+
+ // If a picker state exists, return that.
+ if ( STATE[ thing ] != null ) {
+ return STATE[ thing ]
+ }
+
+ // Return the submission value, if that.
+ if ( thing == 'valueSubmit' ) {
+ if ( P._hidden ) {
+ return P._hidden.value
+ }
+ thing = 'value'
+ }
+
+ // Return the value, if that.
+ if ( thing == 'value' ) {
+ return ELEMENT.value
+ }
+
+ // Check if a component item exists, return that.
+ if ( thing in P.component.item ) {
+ if ( typeof format == 'string' ) {
+ var thingValue = P.component.get( thing )
+ return thingValue ?
+ PickerConstructor._.trigger(
+ P.component.formats.toString,
+ P.component,
+ [ format, thingValue ]
+ ) : ''
+ }
+ return P.component.get( thing )
+ }
+ }, //get
+
+
+
+ /**
+ * Bind events on the things.
+ */
+ on: function( thing, method, internal ) {
+
+ var thingName, thingMethod,
+ thingIsObject = $.isPlainObject( thing ),
+ thingObject = thingIsObject ? thing : {}
+
+ if ( thing ) {
+
+ // If the thing isn’t an object, make it one.
+ if ( !thingIsObject ) {
+ thingObject[ thing ] = method
+ }
+
+ // Go through the things to bind to.
+ for ( thingName in thingObject ) {
+
+ // Grab the method of the thing.
+ thingMethod = thingObject[ thingName ]
+
+ // If it was an internal binding, prefix it.
+ if ( internal ) {
+ thingName = '_' + thingName
+ }
+
+ // Make sure the thing methods collection exists.
+ STATE.methods[ thingName ] = STATE.methods[ thingName ] || []
+
+ // Add the method to the relative method collection.
+ STATE.methods[ thingName ].push( thingMethod )
+ }
+ }
+
+ return P
+ }, //on
+
+
+
+ /**
+ * Unbind events on the things.
+ */
+ off: function() {
+ var i, thingName,
+ names = arguments;
+ for ( i = 0, namesCount = names.length; i < namesCount; i += 1 ) {
+ thingName = names[i]
+ if ( thingName in STATE.methods ) {
+ delete STATE.methods[thingName]
+ }
+ }
+ return P
+ },
+
+
+ /**
+ * Fire off method events.
+ */
+ trigger: function( name, data ) {
+ var _trigger = function( name ) {
+ var methodList = STATE.methods[ name ]
+ if ( methodList ) {
+ methodList.map( function( method ) {
+ PickerConstructor._.trigger( method, P, [ data ] )
+ })
+ }
+ }
+ _trigger( '_' + name )
+ _trigger( name )
+ return P
+ } //trigger
+ } //PickerInstance.prototype
+
+
+ /**
+ * Wrap the picker holder components together.
+ */
+ function createWrappedComponent() {
+
+ // Create a picker wrapper holder
+ return PickerConstructor._.node( 'div',
+
+ // Create a picker wrapper node
+ PickerConstructor._.node( 'div',
+
+ // Create a picker frame
+ PickerConstructor._.node( 'div',
+
+ // Create a picker box node
+ PickerConstructor._.node( 'div',
+
+ // Create the components nodes.
+ P.component.nodes( STATE.open ),
+
+ // The picker box class
+ CLASSES.box
+ ),
+
+ // Picker wrap class
+ CLASSES.wrap
+ ),
+
+ // Picker frame class
+ CLASSES.frame
+ ),
+
+ // Picker holder class
+ CLASSES.holder
+ ) //endreturn
+ } //createWrappedComponent
+
+
+
+ /**
+ * Prepare the input element with all bindings.
+ */
+ function prepareElement() {
+
+ $ELEMENT.
+
+ // Store the picker data by component name.
+ data(NAME, P).
+
+ // Add the “input” class name.
+ addClass(CLASSES.input).
+
+ // Remove the tabindex.
+ attr('tabindex', -1).
+
+ // If there’s a `data-value`, update the value of the element.
+ val( $ELEMENT.data('value') ?
+ P.get('select', SETTINGS.format) :
+ ELEMENT.value
+ )
+
+
+ // Only bind keydown events if the element isn’t editable.
+ if ( !SETTINGS.editable ) {
+
+ $ELEMENT.
+
+ // On focus/click, focus onto the root to open it up.
+ on( 'focus.' + STATE.id + ' click.' + STATE.id, function( event ) {
+ event.preventDefault()
+ P.$root.eq(0).focus()
+ }).
+
+ // Handle keyboard event based on the picker being opened or not.
+ on( 'keydown.' + STATE.id, handleKeydownEvent )
+ }
+
+
+ // Update the aria attributes.
+ aria(ELEMENT, {
+ haspopup: true,
+ expanded: false,
+ readonly: false,
+ owns: ELEMENT.id + '_root'
+ })
+ }
+
+
+ /**
+ * Prepare the root picker element with all bindings.
+ */
+ function prepareElementRoot() {
+
+ P.$root.
+
+ on({
+
+ // For iOS8.
+ keydown: handleKeydownEvent,
+
+ // When something within the root is focused, stop from bubbling
+ // to the doc and remove the “focused” state from the root.
+ focusin: function( event ) {
+ P.$root.removeClass( CLASSES.focused )
+ event.stopPropagation()
+ },
+
+ // When something within the root holder is clicked, stop it
+ // from bubbling to the doc.
+ 'mousedown click': function( event ) {
+
+ var target = event.target
+
+ // Make sure the target isn’t the root holder so it can bubble up.
+ if ( target != P.$root.children()[ 0 ] ) {
+
+ event.stopPropagation()
+
+ // * For mousedown events, cancel the default action in order to
+ // prevent cases where focus is shifted onto external elements
+ // when using things like jQuery mobile or MagnificPopup (ref: #249 & #120).
+ // Also, for Firefox, don’t prevent action on the `option` element.
+ if ( event.type == 'mousedown' && !$( target ).is( 'input, select, textarea, button, option' )) {
+
+ event.preventDefault()
+
+ // Re-focus onto the root so that users can click away
+ // from elements focused within the picker.
+ P.$root.eq(0).focus()
+ }
+ }
+ }
+ }).
+
+ // Add/remove the “target” class on focus and blur.
+ on({
+ focus: function() {
+ $ELEMENT.addClass( CLASSES.target )
+ },
+ blur: function() {
+ $ELEMENT.removeClass( CLASSES.target )
+ }
+ }).
+
+ // Open the picker and adjust the root “focused” state
+ on( 'focus.toOpen', handleFocusToOpenEvent ).
+
+ // If there’s a click on an actionable element, carry out the actions.
+ on( 'click', '[data-pick], [data-nav], [data-clear], [data-close]', function() {
+
+ var $target = $( this ),
+ targetData = $target.data(),
+ targetDisabled = $target.hasClass( CLASSES.navDisabled ) || $target.hasClass( CLASSES.disabled ),
+
+ // * For IE, non-focusable elements can be active elements as well
+ // (http://stackoverflow.com/a/2684561).
+ activeElement = getActiveElement()
+ activeElement = activeElement && ( activeElement.type || activeElement.href )
+
+ // If it’s disabled or nothing inside is actively focused, re-focus the element.
+ if ( targetDisabled || activeElement && !$.contains( P.$root[0], activeElement ) ) {
+ P.$root.eq(0).focus()
+ }
+
+ // If something is superficially changed, update the `highlight` based on the `nav`.
+ if ( !targetDisabled && targetData.nav ) {
+ P.set( 'highlight', P.component.item.highlight, { nav: targetData.nav } )
+ }
+
+ // If something is picked, set `select` then close with focus.
+ else if ( !targetDisabled && 'pick' in targetData ) {
+ P.set( 'select', targetData.pick )
+ }
+
+ // If a “clear” button is pressed, empty the values and close with focus.
+ else if ( targetData.clear ) {
+ P.clear().close( true )
+ }
+
+ else if ( targetData.close ) {
+ P.close( true )
+ }
+
+ }) //P.$root
+
+ aria( P.$root[0], 'hidden', true )
+ }
+
+
+ /**
+ * Prepare the hidden input element along with all bindings.
+ */
+ function prepareElementHidden() {
+
+ var name
+
+ if ( SETTINGS.hiddenName === true ) {
+ name = ELEMENT.name
+ ELEMENT.name = ''
+ }
+ else {
+ name = [
+ typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : '',
+ typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit'
+ ]
+ name = name[0] + ELEMENT.name + name[1]
+ }
+
+ P._hidden = $(
+ '<input ' +
+ 'type=hidden ' +
+
+ // Create the name using the original input’s with a prefix and suffix.
+ 'name="' + name + '"' +
+
+ // If the element has a value, set the hidden value as well.
+ (
+ $ELEMENT.data('value') || ELEMENT.value ?
+ ' value="' + P.get('select', SETTINGS.formatSubmit) + '"' :
+ ''
+ ) +
+ '>'
+ )[0]
+
+ $ELEMENT.
+
+ // If the value changes, update the hidden input with the correct format.
+ on('change.' + STATE.id, function() {
+ P._hidden.value = ELEMENT.value ?
+ P.get('select', SETTINGS.formatSubmit) :
+ ''
+ })
+
+
+ // Insert the hidden input as specified in the settings.
+ if ( SETTINGS.container ) $( SETTINGS.container ).append( P._hidden )
+ else $ELEMENT.after( P._hidden )
+ }
+
+
+ // For iOS8.
+ function handleKeydownEvent( event ) {
+
+ var keycode = event.keyCode,
+
+ // Check if one of the delete keys was pressed.
+ isKeycodeDelete = /^(8|46)$/.test(keycode)
+
+ // For some reason IE clears the input value on “escape”.
+ if ( keycode == 27 ) {
+ P.close()
+ return false
+ }
+
+ // Check if `space` or `delete` was pressed or the picker is closed with a key movement.
+ if ( keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode] ) {
+
+ // Prevent it from moving the page and bubbling to doc.
+ event.preventDefault()
+ event.stopPropagation()
+
+ // If `delete` was pressed, clear the values and close the picker.
+ // Otherwise open the picker.
+ if ( isKeycodeDelete ) { P.clear().close() }
+ else { P.open() }
+ }
+ }
+
+
+ // Separated for IE
+ function handleFocusToOpenEvent( event ) {
+
+ // Stop the event from propagating to the doc.
+ event.stopPropagation()
+
+ // If it’s a focus event, add the “focused” class to the root.
+ if ( event.type == 'focus' ) {
+ P.$root.addClass( CLASSES.focused )
+ }
+
+ // And then finally open the picker.
+ P.open()
+ }
+
+
+ // Return a new picker instance.
+ return new PickerInstance()
+} //PickerConstructor
+
+
+
+/**
+ * The default classes and prefix to use for the HTML classes.
+ */
+PickerConstructor.klasses = function( prefix ) {
+ prefix = prefix || 'picker'
+ return {
+
+ picker: prefix,
+ opened: prefix + '--opened',
+ focused: prefix + '--focused',
+
+ input: prefix + '__input',
+ active: prefix + '__input--active',
+ target: prefix + '__input--target',
+
+ holder: prefix + '__holder',
+
+ frame: prefix + '__frame',
+ wrap: prefix + '__wrap',
+
+ box: prefix + '__box'
+ }
+} //PickerConstructor.klasses
+
+
+
+/**
+ * Check if the default theme is being used.
+ */
+function isUsingDefaultTheme( element ) {
+
+ var theme,
+ prop = 'position'
+
+ // For IE.
+ if ( element.currentStyle ) {
+ theme = element.currentStyle[prop]
+ }
+
+ // For normal browsers.
+ else if ( window.getComputedStyle ) {
+ theme = getComputedStyle( element )[prop]
+ }
+
+ return theme == 'fixed'
+}
+
+
+
+/**
+ * Get the width of the browser’s scrollbar.
+ * Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js
+ */
+function getScrollbarWidth() {
+
+ if ( $html.height() <= $window.height() ) {
+ return 0
+ }
+
+ var $outer = $( '<div style="visibility:hidden;width:100px" />' ).
+ appendTo( 'body' )
+
+ // Get the width without scrollbars.
+ var widthWithoutScroll = $outer[0].offsetWidth
+
+ // Force adding scrollbars.
+ $outer.css( 'overflow', 'scroll' )
+
+ // Add the inner div.
+ var $inner = $( '<div style="width:100%" />' ).appendTo( $outer )
+
+ // Get the width with scrollbars.
+ var widthWithScroll = $inner[0].offsetWidth
+
+ // Remove the divs.
+ $outer.remove()
+
+ // Return the difference between the widths.
+ return widthWithoutScroll - widthWithScroll
+}
+
+
+
+/**
+ * PickerConstructor helper methods.
+ */
+PickerConstructor._ = {
+
+ /**
+ * Create a group of nodes. Expects:
+ * `
+ {
+ min: {Integer},
+ max: {Integer},
+ i: {Integer},
+ node: {String},
+ item: {Function}
+ }
+ * `
+ */
+ group: function( groupObject ) {
+
+ var
+ // Scope for the looped object
+ loopObjectScope,
+
+ // Create the nodes list
+ nodesList = '',
+
+ // The counter starts from the `min`
+ counter = PickerConstructor._.trigger( groupObject.min, groupObject )
+
+
+ // Loop from the `min` to `max`, incrementing by `i`
+ for ( ; counter <= PickerConstructor._.trigger( groupObject.max, groupObject, [ counter ] ); counter += groupObject.i ) {
+
+ // Trigger the `item` function within scope of the object
+ loopObjectScope = PickerConstructor._.trigger( groupObject.item, groupObject, [ counter ] )
+
+ // Splice the subgroup and create nodes out of the sub nodes
+ nodesList += PickerConstructor._.node(
+ groupObject.node,
+ loopObjectScope[ 0 ], // the node
+ loopObjectScope[ 1 ], // the classes
+ loopObjectScope[ 2 ] // the attributes
+ )
+ }
+
+ // Return the list of nodes
+ return nodesList
+ }, //group
+
+
+ /**
+ * Create a dom node string
+ */
+ node: function( wrapper, item, klass, attribute ) {
+
+ // If the item is false-y, just return an empty string
+ if ( !item ) return ''
+
+ // If the item is an array, do a join
+ item = $.isArray( item ) ? item.join( '' ) : item
+
+ // Check for the class
+ klass = klass ? ' class="' + klass + '"' : ''
+
+ // Check for any attributes
+ attribute = attribute ? ' ' + attribute : ''
+
+ // Return the wrapped item
+ return '<' + wrapper + klass + attribute + '>' + item + '</' + wrapper + '>'
+ }, //node
+
+
+ /**
+ * Lead numbers below 10 with a zero.
+ */
+ lead: function( number ) {
+ return ( number < 10 ? '0': '' ) + number
+ },
+
+
+ /**
+ * Trigger a function otherwise return the value.
+ */
+ trigger: function( callback, scope, args ) {
+ return typeof callback == 'function' ? callback.apply( scope, args || [] ) : callback
+ },
+
+
+ /**
+ * If the second character is a digit, length is 2 otherwise 1.
+ */
+ digits: function( string ) {
+ return ( /\d/ ).test( string[ 1 ] ) ? 2 : 1
+ },
+
+
+ /**
+ * Tell if something is a date object.
+ */
+ isDate: function( value ) {
+ return {}.toString.call( value ).indexOf( 'Date' ) > -1 && this.isInteger( value.getDate() )
+ },
+
+
+ /**
+ * Tell if something is an integer.
+ */
+ isInteger: function( value ) {
+ return {}.toString.call( value ).indexOf( 'Number' ) > -1 && value % 1 === 0
+ },
+
+
+ /**
+ * Create ARIA attribute strings.
+ */
+ ariaAttr: ariaAttr
+} //PickerConstructor._
+
+
+
+/**
+ * Extend the picker with a component and defaults.
+ */
+PickerConstructor.extend = function( name, Component ) {
+
+ // Extend jQuery.
+ $.fn[ name ] = function( options, action ) {
+
+ // Grab the component data.
+ var componentData = this.data( name )
+
+ // If the picker is requested, return the data object.
+ if ( options == 'picker' ) {
+ return componentData
+ }
+
+ // If the component data exists and `options` is a string, carry out the action.
+ if ( componentData && typeof options == 'string' ) {
+ return PickerConstructor._.trigger( componentData[ options ], componentData, [ action ] )
+ }
+
+ // Otherwise go through each matched element and if the component
+ // doesn’t exist, create a new picker using `this` element
+ // and merging the defaults and options with a deep copy.
+ return this.each( function() {
+ var $this = $( this )
+ if ( !$this.data( name ) ) {
+ new PickerConstructor( this, name, Component, options )
+ }
+ })
+ }
+
+ // Set the defaults.
+ $.fn[ name ].defaults = Component.defaults
+} //PickerConstructor.extend
+
+
+
+function aria(element, attribute, value) {
+ if ( $.isPlainObject(attribute) ) {
+ for ( var key in attribute ) {
+ ariaSet(element, key, attribute[key])
+ }
+ }
+ else {
+ ariaSet(element, attribute, value)
+ }
+}
+function ariaSet(element, attribute, value) {
+ element.setAttribute(
+ (attribute == 'role' ? '' : 'aria-') + attribute,
+ value
+ )
+}
+function ariaAttr(attribute, data) {
+ if ( !$.isPlainObject(attribute) ) {
+ attribute = { attribute: data }
+ }
+ data = ''
+ for ( var key in attribute ) {
+ var attr = (key == 'role' ? '' : 'aria-') + key,
+ attrVal = attribute[key]
+ data += attrVal == null ? '' : attr + '="' + attribute[key] + '"'
+ }
+ return data
+}
+
+// IE8 bug throws an error for activeElements within iframes.
+function getActiveElement() {
+ try {
+ return document.activeElement
+ } catch ( err ) { }
+}
+
+
+
+// Expose the picker constructor.
+return PickerConstructor
+
+
+}));
+
+;/*!
+ * Date picker for pickadate.js v3.5.0
+ * http://amsul.github.io/pickadate.js/date.htm
+ */
+
+(function ( factory ) {
+
+ // AMD.
+ if ( typeof define == 'function' && define.amd )
+ define( ['picker', 'jquery'], factory )
+
+ // Node.js/browserify.
+ else if ( typeof exports == 'object' )
+ module.exports = factory( require('./picker.js'), require('jquery') )
+
+ // Browser globals.
+ else factory( Picker, jQuery )
+
+}(function( Picker, $ ) {
+
+
+/**
+ * Globals and constants
+ */
+var DAYS_IN_WEEK = 7,
+ WEEKS_IN_CALENDAR = 6,
+ _ = Picker._;
+
+
+
+/**
+ * The date picker constructor
+ */
+function DatePicker( picker, settings ) {
+
+ var calendar = this,
+ element = picker.$node[ 0 ],
+ elementValue = element.value,
+ elementDataValue = picker.$node.data( 'value' ),
+ valueString = elementDataValue || elementValue,
+ formatString = elementDataValue ? settings.formatSubmit : settings.format,
+ isRTL = function() {
+
+ return element.currentStyle ?
+
+ // For IE.
+ element.currentStyle.direction == 'rtl' :
+
+ // For normal browsers.
+ getComputedStyle( picker.$root[0] ).direction == 'rtl'
+ }
+
+ calendar.settings = settings
+ calendar.$node = picker.$node
+
+ // The queue of methods that will be used to build item objects.
+ calendar.queue = {
+ min: 'measure create',
+ max: 'measure create',
+ now: 'now create',
+ select: 'parse create validate',
+ highlight: 'parse navigate create validate',
+ view: 'parse create validate viewset',
+ disable: 'deactivate',
+ enable: 'activate'
+ }
+
+ // The component's item object.
+ calendar.item = {}
+
+ calendar.item.clear = null
+ calendar.item.disable = ( settings.disable || [] ).slice( 0 )
+ calendar.item.enable = -(function( collectionDisabled ) {
+ return collectionDisabled[ 0 ] === true ? collectionDisabled.shift() : -1
+ })( calendar.item.disable )
+
+ calendar.
+ set( 'min', settings.min ).
+ set( 'max', settings.max ).
+ set( 'now' )
+
+ // When there’s a value, set the `select`, which in turn
+ // also sets the `highlight` and `view`.
+ if ( valueString ) {
+ calendar.set( 'select', valueString, { format: formatString })
+ }
+
+ // If there’s no value, default to highlighting “today”.
+ else {
+ calendar.
+ set( 'select', null ).
+ set( 'highlight', calendar.item.now )
+ }
+
+
+ // The keycode to movement mapping.
+ calendar.key = {
+ 40: 7, // Down
+ 38: -7, // Up
+ 39: function() { return isRTL() ? -1 : 1 }, // Right
+ 37: function() { return isRTL() ? 1 : -1 }, // Left
+ go: function( timeChange ) {
+ var highlightedObject = calendar.item.highlight,
+ targetDate = new Date( highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange )
+ calendar.set(
+ 'highlight',
+ targetDate,
+ { interval: timeChange }
+ )
+ this.render()
+ }
+ }
+
+
+ // Bind some picker events.
+ picker.
+ on( 'render', function() {
+ picker.$root.find( '.' + settings.klass.selectMonth ).on( 'change', function() {
+ var value = this.value
+ if ( value ) {
+ picker.set( 'highlight', [ picker.get( 'view' ).year, value, picker.get( 'highlight' ).date ] )
+ picker.$root.find( '.' + settings.klass.selectMonth ).trigger( 'focus' )
+ }
+ })
+ picker.$root.find( '.' + settings.klass.selectYear ).on( 'change', function() {
+ var value = this.value
+ if ( value ) {
+ picker.set( 'highlight', [ value, picker.get( 'view' ).month, picker.get( 'highlight' ).date ] )
+ picker.$root.find( '.' + settings.klass.selectYear ).trigger( 'focus' )
+ }
+ })
+ }, 1 ).
+ on( 'open', function() {
+ var includeToday = ''
+ if ( calendar.disabled( calendar.get('now') ) ) {
+ includeToday = ':not(.' + settings.klass.buttonToday + ')'
+ }
+ picker.$root.find( 'button' + includeToday + ', select' ).attr( 'disabled', false )
+ }, 1 ).
+ on( 'close', function() {
+ picker.$root.find( 'button, select' ).attr( 'disabled', true )
+ }, 1 )
+
+} //DatePicker
+
+
+/**
+ * Set a datepicker item object.
+ */
+DatePicker.prototype.set = function( type, value, options ) {
+
+ var calendar = this,
+ calendarItem = calendar.item
+
+ // If the value is `null` just set it immediately.
+ if ( value === null ) {
+ if ( type == 'clear' ) type = 'select'
+ calendarItem[ type ] = value
+ return calendar
+ }
+
+ // Otherwise go through the queue of methods, and invoke the functions.
+ // Update this as the time unit, and set the final value as this item.
+ // * In the case of `enable`, keep the queue but set `disable` instead.
+ // And in the case of `flip`, keep the queue but set `enable` instead.
+ calendarItem[ ( type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type ) ] = calendar.queue[ type ].split( ' ' ).map( function( method ) {
+ value = calendar[ method ]( type, value, options )
+ return value
+ }).pop()
+
+ // Check if we need to cascade through more updates.
+ if ( type == 'select' ) {
+ calendar.set( 'highlight', calendarItem.select, options )
+ }
+ else if ( type == 'highlight' ) {
+ calendar.set( 'view', calendarItem.highlight, options )
+ }
+ else if ( type.match( /^(flip|min|max|disable|enable)$/ ) ) {
+ if ( calendarItem.select && calendar.disabled( calendarItem.select ) ) {
+ calendar.set( 'select', calendarItem.select, options )
+ }
+ if ( calendarItem.highlight && calendar.disabled( calendarItem.highlight ) ) {
+ calendar.set( 'highlight', calendarItem.highlight, options )
+ }
+ }
+
+ return calendar
+} //DatePicker.prototype.set
+
+
+/**
+ * Get a datepicker item object.
+ */
+DatePicker.prototype.get = function( type ) {
+ return this.item[ type ]
+} //DatePicker.prototype.get
+
+
+/**
+ * Create a picker date object.
+ */
+DatePicker.prototype.create = function( type, value, options ) {
+
+ var isInfiniteValue,
+ calendar = this
+
+ // If there’s no value, use the type as the value.
+ value = value === undefined ? type : value
+
+
+ // If it’s infinity, update the value.
+ if ( value == -Infinity || value == Infinity ) {
+ isInfiniteValue = value
+ }
+
+ // If it’s an object, use the native date object.
+ else if ( $.isPlainObject( value ) && _.isInteger( value.pick ) ) {
+ value = value.obj
+ }
+
+ // If it’s an array, convert it into a date and make sure
+ // that it’s a valid date – otherwise default to today.
+ else if ( $.isArray( value ) ) {
+ value = new Date( value[ 0 ], value[ 1 ], value[ 2 ] )
+ value = _.isDate( value ) ? value : calendar.create().obj
+ }
+
+ // If it’s a number or date object, make a normalized date.
+ else if ( _.isInteger( value ) || _.isDate( value ) ) {
+ value = calendar.normalize( new Date( value ), options )
+ }
+
+ // If it’s a literal true or any other case, set it to now.
+ else /*if ( value === true )*/ {
+ value = calendar.now( type, value, options )
+ }
+
+ // Return the compiled object.
+ return {
+ year: isInfiniteValue || value.getFullYear(),
+ month: isInfiniteValue || value.getMonth(),
+ date: isInfiniteValue || value.getDate(),
+ day: isInfiniteValue || value.getDay(),
+ obj: isInfiniteValue || value,
+ pick: isInfiniteValue || value.getTime()
+ }
+} //DatePicker.prototype.create
+
+
+/**
+ * Create a range limit object using an array, date object,
+ * literal “true”, or integer relative to another time.
+ */
+DatePicker.prototype.createRange = function( from, to ) {
+
+ var calendar = this,
+ createDate = function( date ) {
+ if ( date === true || $.isArray( date ) || _.isDate( date ) ) {
+ return calendar.create( date )
+ }
+ return date
+ }
+
+ // Create objects if possible.
+ if ( !_.isInteger( from ) ) {
+ from = createDate( from )
+ }
+ if ( !_.isInteger( to ) ) {
+ to = createDate( to )
+ }
+
+ // Create relative dates.
+ if ( _.isInteger( from ) && $.isPlainObject( to ) ) {
+ from = [ to.year, to.month, to.date + from ];
+ }
+ else if ( _.isInteger( to ) && $.isPlainObject( from ) ) {
+ to = [ from.year, from.month, from.date + to ];
+ }
+
+ return {
+ from: createDate( from ),
+ to: createDate( to )
+ }
+} //DatePicker.prototype.createRange
+
+
+/**
+ * Check if a date unit falls within a date range object.
+ */
+DatePicker.prototype.withinRange = function( range, dateUnit ) {
+ range = this.createRange(range.from, range.to)
+ return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick
+}
+
+
+/**
+ * Check if two date range objects overlap.
+ */
+DatePicker.prototype.overlapRanges = function( one, two ) {
+
+ var calendar = this
+
+ // Convert the ranges into comparable dates.
+ one = calendar.createRange( one.from, one.to )
+ two = calendar.createRange( two.from, two.to )
+
+ return calendar.withinRange( one, two.from ) || calendar.withinRange( one, two.to ) ||
+ calendar.withinRange( two, one.from ) || calendar.withinRange( two, one.to )
+}
+
+
+/**
+ * Get the date today.
+ */
+DatePicker.prototype.now = function( type, value, options ) {
+ value = new Date()
+ if ( options && options.rel ) {
+ value.setDate( value.getDate() + options.rel )
+ }
+ return this.normalize( value, options )
+}
+
+
+/**
+ * Navigate to next/prev month.
+ */
+DatePicker.prototype.navigate = function( type, value, options ) {
+
+ var targetDateObject,
+ targetYear,
+ targetMonth,
+ targetDate,
+ isTargetArray = $.isArray( value ),
+ isTargetObject = $.isPlainObject( value ),
+ viewsetObject = this.item.view/*,
+ safety = 100*/
+
+
+ if ( isTargetArray || isTargetObject ) {
+
+ if ( isTargetObject ) {
+ targetYear = value.year
+ targetMonth = value.month
+ targetDate = value.date
+ }
+ else {
+ targetYear = +value[0]
+ targetMonth = +value[1]
+ targetDate = +value[2]
+ }
+
+ // If we’re navigating months but the view is in a different
+ // month, navigate to the view’s year and month.
+ if ( options && options.nav && viewsetObject && viewsetObject.month !== targetMonth ) {
+ targetYear = viewsetObject.year
+ targetMonth = viewsetObject.month
+ }
+
+ // Figure out the expected target year and month.
+ targetDateObject = new Date( targetYear, targetMonth + ( options && options.nav ? options.nav : 0 ), 1 )
+ targetYear = targetDateObject.getFullYear()
+ targetMonth = targetDateObject.getMonth()
+
+ // If the month we’re going to doesn’t have enough days,
+ // keep decreasing the date until we reach the month’s last date.
+ while ( /*safety &&*/ new Date( targetYear, targetMonth, targetDate ).getMonth() !== targetMonth ) {
+ targetDate -= 1
+ /*safety -= 1
+ if ( !safety ) {
+ throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.'
+ }*/
+ }
+
+ value = [ targetYear, targetMonth, targetDate ]
+ }
+
+ return value
+} //DatePicker.prototype.navigate
+
+
+/**
+ * Normalize a date by setting the hours to midnight.
+ */
+DatePicker.prototype.normalize = function( value/*, options*/ ) {
+ value.setHours( 0, 0, 0, 0 )
+ return value
+}
+
+
+/**
+ * Measure the range of dates.
+ */
+DatePicker.prototype.measure = function( type, value/*, options*/ ) {
+
+ var calendar = this
+
+ // If it’s anything false-y, remove the limits.
+ if ( !value ) {
+ value = type == 'min' ? -Infinity : Infinity
+ }
+
+ // If it’s a string, parse it.
+ else if ( typeof value == 'string' ) {
+ value = calendar.parse( type, value )
+ }
+
+ // If it's an integer, get a date relative to today.
+ else if ( _.isInteger( value ) ) {
+ value = calendar.now( type, value, { rel: value } )
+ }
+
+ return value
+} ///DatePicker.prototype.measure
+
+
+/**
+ * Create a viewset object based on navigation.
+ */
+DatePicker.prototype.viewset = function( type, dateObject/*, options*/ ) {
+ return this.create([ dateObject.year, dateObject.month, 1 ])
+}
+
+
+/**
+ * Validate a date as enabled and shift if needed.
+ */
+DatePicker.prototype.validate = function( type, dateObject, options ) {
+
+ var calendar = this,
+
+ // Keep a reference to the original date.
+ originalDateObject = dateObject,
+
+ // Make sure we have an interval.
+ interval = options && options.interval ? options.interval : 1,
+
+ // Check if the calendar enabled dates are inverted.
+ isFlippedBase = calendar.item.enable === -1,
+
+ // Check if we have any enabled dates after/before now.
+ hasEnabledBeforeTarget, hasEnabledAfterTarget,
+
+ // The min & max limits.
+ minLimitObject = calendar.item.min,
+ maxLimitObject = calendar.item.max,
+
+ // Check if we’ve reached the limit during shifting.
+ reachedMin, reachedMax,
+
+ // Check if the calendar is inverted and at least one weekday is enabled.
+ hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter( function( value ) {
+
+ // If there’s a date, check where it is relative to the target.
+ if ( $.isArray( value ) ) {
+ var dateTime = calendar.create( value ).pick
+ if ( dateTime < dateObject.pick ) hasEnabledBeforeTarget = true
+ else if ( dateTime > dateObject.pick ) hasEnabledAfterTarget = true
+ }
+
+ // Return only integers for enabled weekdays.
+ return _.isInteger( value )
+ }).length/*,
+
+ safety = 100*/
+
+
+
+ // Cases to validate for:
+ // [1] Not inverted and date disabled.
+ // [2] Inverted and some dates enabled.
+ // [3] Not inverted and out of range.
+ //
+ // Cases to **not** validate for:
+ // • Navigating months.
+ // • Not inverted and date enabled.
+ // • Inverted and all dates disabled.
+ // • ..and anything else.
+ if ( !options || !options.nav ) if (
+ /* 1 */ ( !isFlippedBase && calendar.disabled( dateObject ) ) ||
+ /* 2 */ ( isFlippedBase && calendar.disabled( dateObject ) && ( hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget ) ) ||
+ /* 3 */ ( !isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick) )
+ ) {
+
+
+ // When inverted, flip the direction if there aren’t any enabled weekdays
+ // and there are no enabled dates in the direction of the interval.
+ if ( isFlippedBase && !hasEnabledWeekdays && ( ( !hasEnabledAfterTarget && interval > 0 ) || ( !hasEnabledBeforeTarget && interval < 0 ) ) ) {
+ interval *= -1
+ }
+
+
+ // Keep looping until we reach an enabled date.
+ while ( /*safety &&*/ calendar.disabled( dateObject ) ) {
+
+ /*safety -= 1
+ if ( !safety ) {
+ throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.'
+ }*/
+
+
+ // If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval.
+ if ( Math.abs( interval ) > 1 && ( dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month ) ) {
+ dateObject = originalDateObject
+ interval = interval > 0 ? 1 : -1
+ }
+
+
+ // If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit.
+ if ( dateObject.pick <= minLimitObject.pick ) {
+ reachedMin = true
+ interval = 1
+ dateObject = calendar.create([
+ minLimitObject.year,
+ minLimitObject.month,
+ minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1)
+ ])
+ }
+ else if ( dateObject.pick >= maxLimitObject.pick ) {
+ reachedMax = true
+ interval = -1
+ dateObject = calendar.create([
+ maxLimitObject.year,
+ maxLimitObject.month,
+ maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1)
+ ])
+ }
+
+
+ // If we’ve reached both limits, just break out of the loop.
+ if ( reachedMin && reachedMax ) {
+ break
+ }
+
+
+ // Finally, create the shifted date using the interval and keep looping.
+ dateObject = calendar.create([ dateObject.year, dateObject.month, dateObject.date + interval ])
+ }
+
+ } //endif
+
+
+ // Return the date object settled on.
+ return dateObject
+} //DatePicker.prototype.validate
+
+
+/**
+ * Check if a date is disabled.
+ */
+DatePicker.prototype.disabled = function( dateToVerify ) {
+
+ var
+ calendar = this,
+
+ // Filter through the disabled dates to check if this is one.
+ isDisabledMatch = calendar.item.disable.filter( function( dateToDisable ) {
+
+ // If the date is a number, match the weekday with 0index and `firstDay` check.
+ if ( _.isInteger( dateToDisable ) ) {
+ return dateToVerify.day === ( calendar.settings.firstDay ? dateToDisable : dateToDisable - 1 ) % 7
+ }
+
+ // If it’s an array or a native JS date, create and match the exact date.
+ if ( $.isArray( dateToDisable ) || _.isDate( dateToDisable ) ) {
+ return dateToVerify.pick === calendar.create( dateToDisable ).pick
+ }
+
+ // If it’s an object, match a date within the “from” and “to” range.
+ if ( $.isPlainObject( dateToDisable ) ) {
+ return calendar.withinRange( dateToDisable, dateToVerify )
+ }
+ })
+
+ // If this date matches a disabled date, confirm it’s not inverted.
+ isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function( dateToDisable ) {
+ return $.isArray( dateToDisable ) && dateToDisable[3] == 'inverted' ||
+ $.isPlainObject( dateToDisable ) && dateToDisable.inverted
+ }).length
+
+ // Check the calendar “enabled” flag and respectively flip the
+ // disabled state. Then also check if it’s beyond the min/max limits.
+ return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch ||
+ dateToVerify.pick < calendar.item.min.pick ||
+ dateToVerify.pick > calendar.item.max.pick
+
+} //DatePicker.prototype.disabled
+
+
+/**
+ * Parse a string into a usable type.
+ */
+DatePicker.prototype.parse = function( type, value, options ) {
+
+ var calendar = this,
+ parsingObject = {}
+
+ // If it’s already parsed, we’re good.
+ if ( !value || typeof value != 'string' ) {
+ return value
+ }
+
+ // We need a `.format` to parse the value with.
+ if ( !( options && options.format ) ) {
+ options = options || {}
+ options.format = calendar.settings.format
+ }
+
+ // Convert the format into an array and then map through it.
+ calendar.formats.toArray( options.format ).map( function( label ) {
+
+ var
+ // Grab the formatting label.
+ formattingLabel = calendar.formats[ label ],
+
+ // The format length is from the formatting label function or the
+ // label length without the escaping exclamation (!) mark.
+ formatLength = formattingLabel ? _.trigger( formattingLabel, calendar, [ value, parsingObject ] ) : label.replace( /^!/, '' ).length
+
+ // If there's a format label, split the value up to the format length.
+ // Then add it to the parsing object with appropriate label.
+ if ( formattingLabel ) {
+ parsingObject[ label ] = value.substr( 0, formatLength )
+ }
+
+ // Update the value as the substring from format length to end.
+ value = value.substr( formatLength )
+ })
+
+ // Compensate for month 0index.
+ return [
+ parsingObject.yyyy || parsingObject.yy,
+ +( parsingObject.mm || parsingObject.m ) - 1,
+ parsingObject.dd || parsingObject.d
+ ]
+} //DatePicker.prototype.parse
+
+
+/**
+ * Various formats to display the object in.
+ */
+DatePicker.prototype.formats = (function() {
+
+ // Return the length of the first word in a collection.
+ function getWordLengthFromCollection( string, collection, dateObject ) {
+
+ // Grab the first word from the string.
+ var word = string.match( /\w+/ )[ 0 ]
+
+ // If there's no month index, add it to the date object
+ if ( !dateObject.mm && !dateObject.m ) {
+ dateObject.m = collection.indexOf( word ) + 1
+ }
+
+ // Return the length of the word.
+ return word.length
+ }
+
+ // Get the length of the first word in a string.
+ function getFirstWordLength( string ) {
+ return string.match( /\w+/ )[ 0 ].length
+ }
+
+ return {
+
+ d: function( string, dateObject ) {
+
+ // If there's string, then get the digits length.
+ // Otherwise return the selected date.
+ return string ? _.digits( string ) : dateObject.date
+ },
+ dd: function( string, dateObject ) {
+
+ // If there's a string, then the length is always 2.
+ // Otherwise return the selected date with a leading zero.
+ return string ? 2 : _.lead( dateObject.date )
+ },
+ ddd: function( string, dateObject ) {
+
+ // If there's a string, then get the length of the first word.
+ // Otherwise return the short selected weekday.
+ return string ? getFirstWordLength( string ) : this.settings.weekdaysShort[ dateObject.day ]
+ },
+ dddd: function( string, dateObject ) {
+
+ // If there's a string, then get the length of the first word.
+ // Otherwise return the full selected weekday.
+ return string ? getFirstWordLength( string ) : this.settings.weekdaysFull[ dateObject.day ]
+ },
+ m: function( string, dateObject ) {
+
+ // If there's a string, then get the length of the digits
+ // Otherwise return the selected month with 0index compensation.
+ return string ? _.digits( string ) : dateObject.month + 1
+ },
+ mm: function( string, dateObject ) {
+
+ // If there's a string, then the length is always 2.
+ // Otherwise return the selected month with 0index and leading zero.
+ return string ? 2 : _.lead( dateObject.month + 1 )
+ },
+ mmm: function( string, dateObject ) {
+
+ var collection = this.settings.monthsShort
+
+ // If there's a string, get length of the relevant month from the short
+ // months collection. Otherwise return the selected month from that collection.
+ return string ? getWordLengthFromCollection( string, collection, dateObject ) : collection[ dateObject.month ]
+ },
+ mmmm: function( string, dateObject ) {
+
+ var collection = this.settings.monthsFull
+
+ // If there's a string, get length of the relevant month from the full
+ // months collection. Otherwise return the selected month from that collection.
+ return string ? getWordLengthFromCollection( string, collection, dateObject ) : collection[ dateObject.month ]
+ },
+ yy: function( string, dateObject ) {
+
+ // If there's a string, then the length is always 2.
+ // Otherwise return the selected year by slicing out the first 2 digits.
+ return string ? 2 : ( '' + dateObject.year ).slice( 2 )
+ },
+ yyyy: function( string, dateObject ) {
+
+ // If there's a string, then the length is always 4.
+ // Otherwise return the selected year.
+ return string ? 4 : dateObject.year
+ },
+
+ // Create an array by splitting the formatting string passed.
+ toArray: function( formatString ) { return formatString.split( /(d{1,4}|m{1,4}|y{4}|yy|!.)/g ) },
+
+ // Format an object into a string using the formatting options.
+ toString: function ( formatString, itemObject ) {
+ var calendar = this
+ return calendar.formats.toArray( formatString ).map( function( label ) {
+ return _.trigger( calendar.formats[ label ], calendar, [ 0, itemObject ] ) || label.replace( /^!/, '' )
+ }).join( '' )
+ }
+ }
+})() //DatePicker.prototype.formats
+
+
+
+
+/**
+ * Check if two date units are the exact.
+ */
+DatePicker.prototype.isDateExact = function( one, two ) {
+
+ var calendar = this
+
+ // When we’re working with weekdays, do a direct comparison.
+ if (
+ ( _.isInteger( one ) && _.isInteger( two ) ) ||
+ ( typeof one == 'boolean' && typeof two == 'boolean' )
+ ) {
+ return one === two
+ }
+
+ // When we’re working with date representations, compare the “pick” value.
+ if (
+ ( _.isDate( one ) || $.isArray( one ) ) &&
+ ( _.isDate( two ) || $.isArray( two ) )
+ ) {
+ return calendar.create( one ).pick === calendar.create( two ).pick
+ }
+
+ // When we’re working with range objects, compare the “from” and “to”.
+ if ( $.isPlainObject( one ) && $.isPlainObject( two ) ) {
+ return calendar.isDateExact( one.from, two.from ) && calendar.isDateExact( one.to, two.to )
+ }
+
+ return false
+}
+
+
+/**
+ * Check if two date units overlap.
+ */
+DatePicker.prototype.isDateOverlap = function( one, two ) {
+
+ var calendar = this,
+ firstDay = calendar.settings.firstDay ? 1 : 0
+
+ // When we’re working with a weekday index, compare the days.
+ if ( _.isInteger( one ) && ( _.isDate( two ) || $.isArray( two ) ) ) {
+ one = one % 7 + firstDay
+ return one === calendar.create( two ).day + 1
+ }
+ if ( _.isInteger( two ) && ( _.isDate( one ) || $.isArray( one ) ) ) {
+ two = two % 7 + firstDay
+ return two === calendar.create( one ).day + 1
+ }
+
+ // When we’re working with range objects, check if the ranges overlap.
+ if ( $.isPlainObject( one ) && $.isPlainObject( two ) ) {
+ return calendar.overlapRanges( one, two )
+ }
+
+ return false
+}
+
+
+/**
+ * Flip the “enabled” state.
+ */
+DatePicker.prototype.flipEnable = function(val) {
+ var itemObject = this.item
+ itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1)
+}
+
+
+/**
+ * Mark a collection of dates as “disabled”.
+ */
+DatePicker.prototype.deactivate = function( type, datesToDisable ) {
+
+ var calendar = this,
+ disabledItems = calendar.item.disable.slice(0)
+
+
+ // If we’re flipping, that’s all we need to do.
+ if ( datesToDisable == 'flip' ) {
+ calendar.flipEnable()
+ }
+
+ else if ( datesToDisable === false ) {
+ calendar.flipEnable(1)
+ disabledItems = []
+ }
+
+ else if ( datesToDisable === true ) {
+ calendar.flipEnable(-1)
+ disabledItems = []
+ }
+
+ // Otherwise go through the dates to disable.
+ else {
+
+ datesToDisable.map(function( unitToDisable ) {
+
+ var matchFound
+
+ // When we have disabled items, check for matches.
+ // If something is matched, immediately break out.
+ for ( var index = 0; index < disabledItems.length; index += 1 ) {
+ if ( calendar.isDateExact( unitToDisable, disabledItems[index] ) ) {
+ matchFound = true
+ break
+ }
+ }
+
+ // If nothing was found, add the validated unit to the collection.
+ if ( !matchFound ) {
+ if (
+ _.isInteger( unitToDisable ) ||
+ _.isDate( unitToDisable ) ||
+ $.isArray( unitToDisable ) ||
+ ( $.isPlainObject( unitToDisable ) && unitToDisable.from && unitToDisable.to )
+ ) {
+ disabledItems.push( unitToDisable )
+ }
+ }
+ })
+ }
+
+ // Return the updated collection.
+ return disabledItems
+} //DatePicker.prototype.deactivate
+
+
+/**
+ * Mark a collection of dates as “enabled”.
+ */
+DatePicker.prototype.activate = function( type, datesToEnable ) {
+
+ var calendar = this,
+ disabledItems = calendar.item.disable,
+ disabledItemsCount = disabledItems.length
+
+ // If we’re flipping, that’s all we need to do.
+ if ( datesToEnable == 'flip' ) {
+ calendar.flipEnable()
+ }
+
+ else if ( datesToEnable === true ) {
+ calendar.flipEnable(1)
+ disabledItems = []
+ }
+
+ else if ( datesToEnable === false ) {
+ calendar.flipEnable(-1)
+ disabledItems = []
+ }
+
+ // Otherwise go through the disabled dates.
+ else {
+
+ datesToEnable.map(function( unitToEnable ) {
+
+ var matchFound,
+ disabledUnit,
+ index,
+ isExactRange
+
+ // Go through the disabled items and try to find a match.
+ for ( index = 0; index < disabledItemsCount; index += 1 ) {
+
+ disabledUnit = disabledItems[index]
+
+ // When an exact match is found, remove it from the collection.
+ if ( calendar.isDateExact( disabledUnit, unitToEnable ) ) {
+ matchFound = disabledItems[index] = null
+ isExactRange = true
+ break
+ }
+
+ // When an overlapped match is found, add the “inverted” state to it.
+ else if ( calendar.isDateOverlap( disabledUnit, unitToEnable ) ) {
+ if ( $.isPlainObject( unitToEnable ) ) {
+ unitToEnable.inverted = true
+ matchFound = unitToEnable
+ }
+ else if ( $.isArray( unitToEnable ) ) {
+ matchFound = unitToEnable
+ if ( !matchFound[3] ) matchFound.push( 'inverted' )
+ }
+ else if ( _.isDate( unitToEnable ) ) {
+ matchFound = [ unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted' ]
+ }
+ break
+ }
+ }
+
+ // If a match was found, remove a previous duplicate entry.
+ if ( matchFound ) for ( index = 0; index < disabledItemsCount; index += 1 ) {
+ if ( calendar.isDateExact( disabledItems[index], unitToEnable ) ) {
+ disabledItems[index] = null
+ break
+ }
+ }
+
+ // In the event that we’re dealing with an exact range of dates,
+ // make sure there are no “inverted” dates because of it.
+ if ( isExactRange ) for ( index = 0; index < disabledItemsCount; index += 1 ) {
+ if ( calendar.isDateOverlap( disabledItems[index], unitToEnable ) ) {
+ disabledItems[index] = null
+ break
+ }
+ }
+
+ // If something is still matched, add it into the collection.
+ if ( matchFound ) {
+ disabledItems.push( matchFound )
+ }
+ })
+ }
+
+ // Return the updated collection.
+ return disabledItems.filter(function( val ) { return val != null })
+} //DatePicker.prototype.activate
+
+
+/**
+ * Create a string for the nodes in the picker.
+ */
+DatePicker.prototype.nodes = function( isOpen ) {
+
+ var
+ calendar = this,
+ settings = calendar.settings,
+ calendarItem = calendar.item,
+ nowObject = calendarItem.now,
+ selectedObject = calendarItem.select,
+ highlightedObject = calendarItem.highlight,
+ viewsetObject = calendarItem.view,
+ disabledCollection = calendarItem.disable,
+ minLimitObject = calendarItem.min,
+ maxLimitObject = calendarItem.max,
+
+
+ // Create the calendar table head using a copy of weekday labels collection.
+ // * We do a copy so we don't mutate the original array.
+ tableHead = (function( collection, fullCollection ) {
+
+ // If the first day should be Monday, move Sunday to the end.
+ if ( settings.firstDay ) {
+ collection.push( collection.shift() )
+ fullCollection.push( fullCollection.shift() )
+ }
+
+ // Create and return the table head group.
+ return _.node(
+ 'thead',
+ _.node(
+ 'tr',
+ _.group({
+ min: 0,
+ max: DAYS_IN_WEEK - 1,
+ i: 1,
+ node: 'th',
+ item: function( counter ) {
+ return [
+ collection[ counter ],
+ settings.klass.weekdays,
+ 'scope=col title="' + fullCollection[ counter ] + '"'
+ ]
+ }
+ })
+ )
+ ) //endreturn
+
+ // Materialize modified
+ })( ( settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter ).slice( 0 ), settings.weekdaysFull.slice( 0 ) ), //tableHead
+
+
+ // Create the nav for next/prev month.
+ createMonthNav = function( next ) {
+
+ // Otherwise, return the created month tag.
+ return _.node(
+ 'div',
+ ' ',
+ settings.klass[ 'nav' + ( next ? 'Next' : 'Prev' ) ] + (
+
+ // If the focused month is outside the range, disabled the button.
+ ( next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month ) ||
+ ( !next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month ) ?
+ ' ' + settings.klass.navDisabled : ''
+ ),
+ 'data-nav=' + ( next || -1 ) + ' ' +
+ _.ariaAttr({
+ role: 'button',
+ controls: calendar.$node[0].id + '_table'
+ }) + ' ' +
+ 'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev ) + '"'
+ ) //endreturn
+ }, //createMonthNav
+
+
+ // Create the month label.
+ //Materialize modified
+ createMonthLabel = function(override) {
+
+ var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull
+
+ // Materialize modified
+ if (override == "short_months") {
+ monthsCollection = settings.monthsShort;
+ }
+
+ // If there are months to select, add a dropdown menu.
+ if ( settings.selectMonths && override == undefined) {
+
+ return _.node( 'select',
+ _.group({
+ min: 0,
+ max: 11,
+ i: 1,
+ node: 'option',
+ item: function( loopedMonth ) {
+
+ return [
+
+ // The looped month and no classes.
+ monthsCollection[ loopedMonth ], 0,
+
+ // Set the value and selected index.
+ 'value=' + loopedMonth +
+ ( viewsetObject.month == loopedMonth ? ' selected' : '' ) +
+ (
+ (
+ ( viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month ) ||
+ ( viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month )
+ ) ?
+ ' disabled' : ''
+ )
+ ]
+ }
+ }),
+ settings.klass.selectMonth + ' browser-default',
+ ( isOpen ? '' : 'disabled' ) + ' ' +
+ _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' +
+ 'title="' + settings.labelMonthSelect + '"'
+ )
+ }
+
+ // Materialize modified
+ if (override == "short_months")
+ if (selectedObject != null)
+ return monthsCollection[ selectedObject.month ];
+ else return monthsCollection[ viewsetObject.month ];
+
+ // If there's a need for a month selector
+ return _.node( 'div', monthsCollection[ viewsetObject.month ], settings.klass.month )
+ }, //createMonthLabel
+
+
+ // Create the year label.
+ // Materialize modified
+ createYearLabel = function(override) {
+
+ var focusedYear = viewsetObject.year,
+
+ // If years selector is set to a literal "true", set it to 5. Otherwise
+ // divide in half to get half before and half after focused year.
+ numberYears = settings.selectYears === true ? 5 : ~~( settings.selectYears / 2 )
+
+ // If there are years to select, add a dropdown menu.
+ if ( numberYears ) {
+
+ var
+ minYear = minLimitObject.year,
+ maxYear = maxLimitObject.year,
+ lowestYear = focusedYear - numberYears,
+ highestYear = focusedYear + numberYears
+
+ // If the min year is greater than the lowest year, increase the highest year
+ // by the difference and set the lowest year to the min year.
+ if ( minYear > lowestYear ) {
+ highestYear += minYear - lowestYear
+ lowestYear = minYear
+ }
+
+ // If the max year is less than the highest year, decrease the lowest year
+ // by the lower of the two: available and needed years. Then set the
+ // highest year to the max year.
+ if ( maxYear < highestYear ) {
+
+ var availableYears = lowestYear - minYear,
+ neededYears = highestYear - maxYear
+
+ lowestYear -= availableYears > neededYears ? neededYears : availableYears
+ highestYear = maxYear
+ }
+
+ if ( settings.selectYears && override == undefined ) {
+ return _.node( 'select',
+ _.group({
+ min: lowestYear,
+ max: highestYear,
+ i: 1,
+ node: 'option',
+ item: function( loopedYear ) {
+ return [
+
+ // The looped year and no classes.
+ loopedYear, 0,
+
+ // Set the value and selected index.
+ 'value=' + loopedYear + ( focusedYear == loopedYear ? ' selected' : '' )
+ ]
+ }
+ }),
+ settings.klass.selectYear + ' browser-default',
+ ( isOpen ? '' : 'disabled' ) + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' +
+ 'title="' + settings.labelYearSelect + '"'
+ )
+ }
+ }
+
+ // Materialize modified
+ if (override == "raw")
+ return _.node( 'div', focusedYear )
+
+ // Otherwise just return the year focused
+ return _.node( 'div', focusedYear, settings.klass.year )
+ } //createYearLabel
+
+
+ // Materialize modified
+ createDayLabel = function() {
+ if (selectedObject != null)
+ return selectedObject.date
+ else return nowObject.date
+ }
+ createWeekdayLabel = function() {
+ var display_day;
+
+ if (selectedObject != null)
+ display_day = selectedObject.day;
+ else
+ display_day = nowObject.day;
+ var weekday = settings.weekdaysShort[ display_day ];
+ return weekday
+ }
+
+
+ // Create and return the entire calendar.
+
+return _.node(
+ // Date presentation View
+ 'div',
+ _.node(
+ // Div for Year
+ 'div',
+ createYearLabel("raw") ,
+ settings.klass.year_display
+ )+
+ _.node(
+ 'span',
+ createWeekdayLabel() + ', ',
+ "picker__weekday-display"
+ )+
+ _.node(
+ // Div for short Month
+ 'span',
+ createMonthLabel("short_months") + ' ',
+ settings.klass.month_display
+ )+
+ _.node(
+ // Div for Day
+ 'span',
+ createDayLabel() ,
+ settings.klass.day_display
+ ),
+ settings.klass.date_display
+ )+
+ // Calendar container
+ _.node('div',
+ _.node('div',
+ _.node('div',
+ ( settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel() ) +
+ createMonthNav() + createMonthNav( 1 ),
+ settings.klass.header
+ ) + _.node(
+ 'table',
+ tableHead +
+ _.node(
+ 'tbody',
+ _.group({
+ min: 0,
+ max: WEEKS_IN_CALENDAR - 1,
+ i: 1,
+ node: 'tr',
+ item: function( rowCounter ) {
+
+ // If Monday is the first day and the month starts on Sunday, shift the date back a week.
+ var shiftDateBy = settings.firstDay && calendar.create([ viewsetObject.year, viewsetObject.month, 1 ]).day === 0 ? -7 : 0
+
+ return [
+ _.group({
+ min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index
+ max: function() {
+ return this.min + DAYS_IN_WEEK - 1
+ },
+ i: 1,
+ node: 'td',
+ item: function( targetDate ) {
+
+ // Convert the time date from a relative date to a target date.
+ targetDate = calendar.create([ viewsetObject.year, viewsetObject.month, targetDate + ( settings.firstDay ? 1 : 0 ) ])
+
+ var isSelected = selectedObject && selectedObject.pick == targetDate.pick,
+ isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick,
+ isDisabled = disabledCollection && calendar.disabled( targetDate ) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick,
+ formattedDate = _.trigger( calendar.formats.toString, calendar, [ settings.format, targetDate ] )
+
+ return [
+ _.node(
+ 'div',
+ targetDate.date,
+ (function( klasses ) {
+
+ // Add the `infocus` or `outfocus` classes based on month in view.
+ klasses.push( viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus )
+
+ // Add the `today` class if needed.
+ if ( nowObject.pick == targetDate.pick ) {
+ klasses.push( settings.klass.now )
+ }
+
+ // Add the `selected` class if something's selected and the time matches.
+ if ( isSelected ) {
+ klasses.push( settings.klass.selected )
+ }
+
+ // Add the `highlighted` class if something's highlighted and the time matches.
+ if ( isHighlighted ) {
+ klasses.push( settings.klass.highlighted )
+ }
+
+ // Add the `disabled` class if something's disabled and the object matches.
+ if ( isDisabled ) {
+ klasses.push( settings.klass.disabled )
+ }
+
+ return klasses.join( ' ' )
+ })([ settings.klass.day ]),
+ 'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({
+ role: 'gridcell',
+ label: formattedDate,
+ selected: isSelected && calendar.$node.val() === formattedDate ? true : null,
+ activedescendant: isHighlighted ? true : null,
+ disabled: isDisabled ? true : null
+ })
+ ),
+ '',
+ _.ariaAttr({ role: 'presentation' })
+ ] //endreturn
+ }
+ })
+ ] //endreturn
+ }
+ })
+ ),
+ settings.klass.table,
+ 'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({
+ role: 'grid',
+ controls: calendar.$node[0].id,
+ readonly: true
+ })
+ )
+ , settings.klass.calendar_container) // end calendar
+
+ +
+
+ // * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”.
+ _.node(
+ 'div',
+ _.node( 'button', settings.today, "btn-flat picker__today waves-effect",
+ 'type=button data-pick=' + nowObject.pick +
+ ( isOpen && !calendar.disabled(nowObject) ? '' : ' disabled' ) + ' ' +
+ _.ariaAttr({ controls: calendar.$node[0].id }) ) +
+ _.node( 'button', settings.clear, "btn-flat picker__clear waves-effect",
+ 'type=button data-clear=1' +
+ ( isOpen ? '' : ' disabled' ) + ' ' +
+ _.ariaAttr({ controls: calendar.$node[0].id }) ) +
+ _.node('button', settings.close, "btn-flat picker__close waves-effect",
+ 'type=button data-close=true ' +
+ ( isOpen ? '' : ' disabled' ) + ' ' +
+ _.ariaAttr({ controls: calendar.$node[0].id }) ),
+ settings.klass.footer
+ ), 'picker__container__wrapper'
+ ) //endreturn
+} //DatePicker.prototype.nodes
+
+
+
+
+/**
+ * The date picker defaults.
+ */
+DatePicker.defaults = (function( prefix ) {
+
+ return {
+
+ // The title label to use for the month nav buttons
+ labelMonthNext: 'Next month',
+ labelMonthPrev: 'Previous month',
+
+ // The title label to use for the dropdown selectors
+ labelMonthSelect: 'Select a month',
+ labelYearSelect: 'Select a year',
+
+ // Months and weekdays
+ monthsFull: [ 'January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December' ],
+ monthsShort: [ 'Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec' ],
+ weekdaysFull: [ 'Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday' ],
+ weekdaysShort: [ 'Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat' ],
+
+ // Materialize modified
+ weekdaysLetter: [ 'S', 'M', 'T', 'W', 'T', 'F', 'S' ],
+
+ // Today and clear
+ today: 'Today',
+ clear: 'Clear',
+ close: 'Ok',
+
+ // The format to show on the `input` element
+ format: 'd mmmm, yyyy',
+
+ // Classes
+ klass: {
+
+ table: prefix + 'table',
+
+ header: prefix + 'header',
+
+
+ // Materialize Added klasses
+ date_display: prefix + 'date-display',
+ day_display: prefix + 'day-display',
+ month_display: prefix + 'month-display',
+ year_display: prefix + 'year-display',
+ calendar_container: prefix + 'calendar-container',
+ // end
+
+
+
+ navPrev: prefix + 'nav--prev',
+ navNext: prefix + 'nav--next',
+ navDisabled: prefix + 'nav--disabled',
+
+ month: prefix + 'month',
+ year: prefix + 'year',
+
+ selectMonth: prefix + 'select--month',
+ selectYear: prefix + 'select--year',
+
+ weekdays: prefix + 'weekday',
+
+ day: prefix + 'day',
+ disabled: prefix + 'day--disabled',
+ selected: prefix + 'day--selected',
+ highlighted: prefix + 'day--highlighted',
+ now: prefix + 'day--today',
+ infocus: prefix + 'day--infocus',
+ outfocus: prefix + 'day--outfocus',
+
+ footer: prefix + 'footer',
+
+ buttonClear: prefix + 'button--clear',
+ buttonToday: prefix + 'button--today',
+ buttonClose: prefix + 'button--close'
+ }
+ }
+})( Picker.klasses().picker + '__' )
+
+
+
+
+
+/**
+ * Extend the picker to add the date picker.
+ */
+Picker.extend( 'pickadate', DatePicker )
+
+
+}));
+;/*!
+ * ClockPicker v0.0.7 (http://weareoutman.github.io/clockpicker/)
+ * Copyright 2014 Wang Shenwei.
+ * Licensed under MIT (https://github.com/weareoutman/clockpicker/blob/gh-pages/LICENSE)
+ *
+ * Further modified
+ * Copyright 2015 Ching Yaw Hao.
+ */
+
+;(function(){
+ var $ = window.jQuery,
+ $win = $(window),
+ $doc = $(document);
+
+ // Can I use inline svg ?
+ var svgNS = 'http://www.w3.org/2000/svg',
+ svgSupported = 'SVGAngle' in window && (function() {
+ var supported,
+ el = document.createElement('div');
+ el.innerHTML = '<svg/>';
+ supported = (el.firstChild && el.firstChild.namespaceURI) == svgNS;
+ el.innerHTML = '';
+ return supported;
+ })();
+
+ // Can I use transition ?
+ var transitionSupported = (function() {
+ var style = document.createElement('div').style;
+ return 'transition' in style ||
+ 'WebkitTransition' in style ||
+ 'MozTransition' in style ||
+ 'msTransition' in style ||
+ 'OTransition' in style;
+ })();
+
+ // Listen touch events in touch screen device, instead of mouse events in desktop.
+ var touchSupported = 'ontouchstart' in window,
+ mousedownEvent = 'mousedown' + ( touchSupported ? ' touchstart' : ''),
+ mousemoveEvent = 'mousemove.clockpicker' + ( touchSupported ? ' touchmove.clockpicker' : ''),
+ mouseupEvent = 'mouseup.clockpicker' + ( touchSupported ? ' touchend.clockpicker' : '');
+
+ // Vibrate the device if supported
+ var vibrate = navigator.vibrate ? 'vibrate' : navigator.webkitVibrate ? 'webkitVibrate' : null;
+
+ function createSvgElement(name) {
+ return document.createElementNS(svgNS, name);
+ }
+
+ function leadingZero(num) {
+ return (num < 10 ? '0' : '') + num;
+ }
+
+ // Get a unique id
+ var idCounter = 0;
+ function uniqueId(prefix) {
+ var id = ++idCounter + '';
+ return prefix ? prefix + id : id;
+ }
+
+ // Clock size
+ var dialRadius = 135,
+ outerRadius = 105,
+ // innerRadius = 80 on 12 hour clock
+ innerRadius = 80,
+ tickRadius = 20,
+ diameter = dialRadius * 2,
+ duration = transitionSupported ? 350 : 1;
+
+ // Popover template
+ var tpl = [
+ '<div class="clockpicker picker">',
+ '<div class="picker__holder">',
+ '<div class="picker__frame">',
+ '<div class="picker__wrap">',
+ '<div class="picker__box">',
+ '<div class="picker__date-display">',
+ '<div class="clockpicker-display">',
+ '<div class="clockpicker-display-column">',
+ '<span class="clockpicker-span-hours text-primary"></span>',
+ ':',
+ '<span class="clockpicker-span-minutes"></span>',
+ '</div>',
+ '<div class="clockpicker-display-column clockpicker-display-am-pm">',
+ '<div class="clockpicker-span-am-pm"></div>',
+ '</div>',
+ '</div>',
+ '</div>',
+ '<div class="picker__container__wrapper">',
+ '<div class="picker__calendar-container">',
+ '<div class="clockpicker-plate">',
+ '<div class="clockpicker-canvas"></div>',
+ '<div class="clockpicker-dial clockpicker-hours"></div>',
+ '<div class="clockpicker-dial clockpicker-minutes clockpicker-dial-out"></div>',
+ '</div>',
+ '<div class="clockpicker-am-pm-block">',
+ '</div>',
+ '</div>',
+ '<div class="picker__footer">',
+ '</div>',
+ '</div>',
+ '</div>',
+ '</div>',
+ '</div>',
+ '</div>',
+ '</div>'
+ ].join('');
+
+ // ClockPicker
+ function ClockPicker(element, options) {
+ var popover = $(tpl),
+ plate = popover.find('.clockpicker-plate'),
+ holder = popover.find('.picker__holder'),
+ hoursView = popover.find('.clockpicker-hours'),
+ minutesView = popover.find('.clockpicker-minutes'),
+ amPmBlock = popover.find('.clockpicker-am-pm-block'),
+ isInput = element.prop('tagName') === 'INPUT',
+ input = isInput ? element : element.find('input'),
+ label = $("label[for=" + input.attr("id") + "]"),
+ self = this;
+
+ this.id = uniqueId('cp');
+ this.element = element;
+ this.holder = holder;
+ this.options = options;
+ this.isAppended = false;
+ this.isShown = false;
+ this.currentView = 'hours';
+ this.isInput = isInput;
+ this.input = input;
+ this.label = label;
+ this.popover = popover;
+ this.plate = plate;
+ this.hoursView = hoursView;
+ this.minutesView = minutesView;
+ this.amPmBlock = amPmBlock;
+ this.spanHours = popover.find('.clockpicker-span-hours');
+ this.spanMinutes = popover.find('.clockpicker-span-minutes');
+ this.spanAmPm = popover.find('.clockpicker-span-am-pm');
+ this.footer = popover.find('.picker__footer');
+ this.amOrPm = "PM";
+
+ // Setup for for 12 hour clock if option is selected
+ if (options.twelvehour) {
+ if (!options.ampmclickable) {
+ this.spanAmPm.empty();
+ $('<div id="click-am">AM</div>').appendTo(this.spanAmPm);
+ $('<div id="click-pm">PM</div>').appendTo(this.spanAmPm);
+ }
+ else {
+ this.spanAmPm.empty();
+ $('<div id="click-am">AM</div>').on("click", function() {
+ self.spanAmPm.children('#click-am').addClass("text-primary");
+ self.spanAmPm.children('#click-pm').removeClass("text-primary");
+ self.amOrPm = "AM";
+ }).appendTo(this.spanAmPm);
+ $('<div id="click-pm">PM</div>').on("click", function() {
+ self.spanAmPm.children('#click-pm').addClass("text-primary");
+ self.spanAmPm.children('#click-am').removeClass("text-primary");
+ self.amOrPm = 'PM';
+ }).appendTo(this.spanAmPm);
+ }
+ }
+
+ // Add buttons to footer
+ $('<button type="button" class="btn-flat picker__clear" tabindex="' + (options.twelvehour? '3' : '1') + '">' + options.cleartext + '</button>').click($.proxy(this.clear, this)).appendTo(this.footer);
+ $('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour? '3' : '1') + '">' + options.canceltext + '</button>').click($.proxy(this.hide, this)).appendTo(this.footer);
+ $('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour? '3' : '1') + '">' + options.donetext + '</button>').click($.proxy(this.done, this)).appendTo(this.footer);
+
+ this.spanHours.click($.proxy(this.toggleView, this, 'hours'));
+ this.spanMinutes.click($.proxy(this.toggleView, this, 'minutes'));
+
+ // Show or toggle
+ input.on('focus.clockpicker click.clockpicker', $.proxy(this.show, this));
+
+ // Build ticks
+ var tickTpl = $('<div class="clockpicker-tick"></div>'),
+ i, tick, radian, radius;
+
+ // Hours view
+ if (options.twelvehour) {
+ for (i = 1; i < 13; i += 1) {
+ tick = tickTpl.clone();
+ radian = i / 6 * Math.PI;
+ radius = outerRadius;
+ tick.css({
+ left: dialRadius + Math.sin(radian) * radius - tickRadius,
+ top: dialRadius - Math.cos(radian) * radius - tickRadius
+ });
+ tick.html(i === 0 ? '00' : i);
+ hoursView.append(tick);
+ tick.on(mousedownEvent, mousedown);
+ }
+ } else {
+ for (i = 0; i < 24; i += 1) {
+ tick = tickTpl.clone();
+ radian = i / 6 * Math.PI;
+ var inner = i > 0 && i < 13;
+ radius = inner ? innerRadius : outerRadius;
+ tick.css({
+ left: dialRadius + Math.sin(radian) * radius - tickRadius,
+ top: dialRadius - Math.cos(radian) * radius - tickRadius
+ });
+ tick.html(i === 0 ? '00' : i);
+ hoursView.append(tick);
+ tick.on(mousedownEvent, mousedown);
+ }
+ }
+
+ // Minutes view
+ for (i = 0; i < 60; i += 5) {
+ tick = tickTpl.clone();
+ radian = i / 30 * Math.PI;
+ tick.css({
+ left: dialRadius + Math.sin(radian) * outerRadius - tickRadius,
+ top: dialRadius - Math.cos(radian) * outerRadius - tickRadius
+ });
+ tick.html(leadingZero(i));
+ minutesView.append(tick);
+ tick.on(mousedownEvent, mousedown);
+ }
+
+ // Clicking on minutes view space
+ plate.on(mousedownEvent, function(e) {
+ if ($(e.target).closest('.clockpicker-tick').length === 0) {
+ mousedown(e, true);
+ }
+ });
+
+ // Mousedown or touchstart
+ function mousedown(e, space) {
+ var offset = plate.offset(),
+ isTouch = /^touch/.test(e.type),
+ x0 = offset.left + dialRadius,
+ y0 = offset.top + dialRadius,
+ dx = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
+ dy = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0,
+ z = Math.sqrt(dx * dx + dy * dy),
+ moved = false;
+
+ // When clicking on minutes view space, check the mouse position
+ if (space && (z < outerRadius - tickRadius || z > outerRadius + tickRadius)) {
+ return;
+ }
+ e.preventDefault();
+
+ // Set cursor style of body after 200ms
+ var movingTimer = setTimeout(function(){
+ self.popover.addClass('clockpicker-moving');
+ }, 200);
+
+ // Clock
+ self.setHand(dx, dy, !space, true);
+
+ // Mousemove on document
+ $doc.off(mousemoveEvent).on(mousemoveEvent, function(e){
+ e.preventDefault();
+ var isTouch = /^touch/.test(e.type),
+ x = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
+ y = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0;
+ if (! moved && x === dx && y === dy) {
+ // Clicking in chrome on windows will trigger a mousemove event
+ return;
+ }
+ moved = true;
+ self.setHand(x, y, false, true);
+ });
+
+ // Mouseup on document
+ $doc.off(mouseupEvent).on(mouseupEvent, function(e) {
+ $doc.off(mouseupEvent);
+ e.preventDefault();
+ var isTouch = /^touch/.test(e.type),
+ x = (isTouch ? e.originalEvent.changedTouches[0] : e).pageX - x0,
+ y = (isTouch ? e.originalEvent.changedTouches[0] : e).pageY - y0;
+ if ((space || moved) && x === dx && y === dy) {
+ self.setHand(x, y);
+ }
+
+ if (self.currentView === 'hours') {
+ self.toggleView('minutes', duration / 2);
+ } else if (options.autoclose) {
+ self.minutesView.addClass('clockpicker-dial-out');
+ setTimeout(function(){
+ self.done();
+ }, duration / 2);
+ }
+ plate.prepend(canvas);
+
+ // Reset cursor style of body
+ clearTimeout(movingTimer);
+ self.popover.removeClass('clockpicker-moving');
+
+ // Unbind mousemove event
+ $doc.off(mousemoveEvent);
+ });
+ }
+
+ if (svgSupported) {
+ // Draw clock hands and others
+ var canvas = popover.find('.clockpicker-canvas'),
+ svg = createSvgElement('svg');
+ svg.setAttribute('class', 'clockpicker-svg');
+ svg.setAttribute('width', diameter);
+ svg.setAttribute('height', diameter);
+ var g = createSvgElement('g');
+ g.setAttribute('transform', 'translate(' + dialRadius + ',' + dialRadius + ')');
+ var bearing = createSvgElement('circle');
+ bearing.setAttribute('class', 'clockpicker-canvas-bearing');
+ bearing.setAttribute('cx', 0);
+ bearing.setAttribute('cy', 0);
+ bearing.setAttribute('r', 4);
+ var hand = createSvgElement('line');
+ hand.setAttribute('x1', 0);
+ hand.setAttribute('y1', 0);
+ var bg = createSvgElement('circle');
+ bg.setAttribute('class', 'clockpicker-canvas-bg');
+ bg.setAttribute('r', tickRadius);
+ g.appendChild(hand);
+ g.appendChild(bg);
+ g.appendChild(bearing);
+ svg.appendChild(g);
+ canvas.append(svg);
+
+ this.hand = hand;
+ this.bg = bg;
+ this.bearing = bearing;
+ this.g = g;
+ this.canvas = canvas;
+ }
+
+ raiseCallback(this.options.init);
+ }
+
+ function raiseCallback(callbackFunction) {
+ if (callbackFunction && typeof callbackFunction === "function")
+ callbackFunction();
+ }
+
+ // Default options
+ ClockPicker.DEFAULTS = {
+ 'default': '', // default time, 'now' or '13:14' e.g.
+ fromnow: 0, // set default time to * milliseconds from now (using with default = 'now')
+ donetext: 'Ok', // done button text
+ cleartext: 'Clear',
+ canceltext: 'Cancel',
+ autoclose: false, // auto close when minute is selected
+ ampmclickable: true, // set am/pm button on itself
+ darktheme: false, // set to dark theme
+ twelvehour: true, // change to 12 hour AM/PM clock from 24 hour
+ vibrate: true // vibrate the device when dragging clock hand
+ };
+
+ // Show or hide popover
+ ClockPicker.prototype.toggle = function() {
+ this[this.isShown ? 'hide' : 'show']();
+ };
+
+ // Set popover position
+ ClockPicker.prototype.locate = function() {
+ var element = this.element,
+ popover = this.popover,
+ offset = element.offset(),
+ width = element.outerWidth(),
+ height = element.outerHeight(),
+ align = this.options.align,
+ self = this;
+
+ popover.show();
+ };
+
+ // Show popover
+ ClockPicker.prototype.show = function(e){
+ // Not show again
+ if (this.isShown) {
+ return;
+ }
+ raiseCallback(this.options.beforeShow);
+ $(':input').each(function() {
+ $(this).attr('tabindex', -1);
+ })
+ var self = this;
+ // Initialize
+ this.input.blur();
+ this.popover.addClass('picker--opened');
+ this.input.addClass('picker__input picker__input--active');
+ $(document.body).css('overflow', 'hidden');
+ // Get the time
+ var value = ((this.input.prop('value') || this.options['default'] || '') + '').split(':');
+ if (this.options.twelvehour && !(typeof value[1] === 'undefined')) {
+ if (value[1].indexOf("AM") > 0){
+ this.amOrPm = 'AM';
+ } else {
+ this.amOrPm = 'PM';
+ }
+ value[1] = value[1].replace("AM", "").replace("PM", "");
+ }
+ if (value[0] === 'now') {
+ var now = new Date(+ new Date() + this.options.fromnow);
+ value = [
+ now.getHours(),
+ now.getMinutes()
+ ];
+ }
+ this.hours = + value[0] || 0;
+ this.minutes = + value[1] || 0;
+ this.spanHours.html(this.hours);
+ this.spanMinutes.html(leadingZero(this.minutes));
+ if (!this.isAppended) {
+ // Append popover to body
+ this.popover.insertAfter(this.input);
+ if (this.options.twelvehour) {
+ if (this.amOrPm === 'PM'){
+ this.spanAmPm.children('#click-pm').addClass("text-primary");
+ this.spanAmPm.children('#click-am').removeClass("text-primary");
+ } else {
+ this.spanAmPm.children('#click-am').addClass("text-primary");
+ this.spanAmPm.children('#click-pm').removeClass("text-primary");
+ }
+ }
+ // Reset position when resize
+ $win.on('resize.clockpicker' + this.id, function() {
+ if (self.isShown) {
+ self.locate();
+ }
+ });
+ this.isAppended = true;
+ }
+ // Toggle to hours view
+ this.toggleView('hours');
+ // Set position
+ this.locate();
+ this.isShown = true;
+ // Hide when clicking or tabbing on any element except the clock and input
+ $doc.on('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id, function(e) {
+ var target = $(e.target);
+ if (target.closest(self.popover.find('.picker__wrap')).length === 0 && target.closest(self.input).length === 0) {
+ self.hide();
+ }
+ });
+ // Hide when ESC is pressed
+ $doc.on('keyup.clockpicker.' + this.id, function(e){
+ if (e.keyCode === 27) {
+ self.hide();
+ }
+ });
+ raiseCallback(this.options.afterShow);
+ };
+ // Hide popover
+ ClockPicker.prototype.hide = function() {
+ raiseCallback(this.options.beforeHide);
+ this.input.removeClass('picker__input picker__input--active');
+ this.popover.removeClass('picker--opened');
+ $(document.body).css('overflow', 'visible');
+ this.isShown = false;
+ $(':input').each(function(index) {
+ $(this).attr('tabindex', index + 1);
+ });
+ // Unbinding events on document
+ $doc.off('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id);
+ $doc.off('keyup.clockpicker.' + this.id);
+ this.popover.hide();
+ raiseCallback(this.options.afterHide);
+ };
+ // Toggle to hours or minutes view
+ ClockPicker.prototype.toggleView = function(view, delay) {
+ var raiseAfterHourSelect = false;
+ if (view === 'minutes' && $(this.hoursView).css("visibility") === "visible") {
+ raiseCallback(this.options.beforeHourSelect);
+ raiseAfterHourSelect = true;
+ }
+ var isHours = view === 'hours',
+ nextView = isHours ? this.hoursView : this.minutesView,
+ hideView = isHours ? this.minutesView : this.hoursView;
+ this.currentView = view;
+
+ this.spanHours.toggleClass('text-primary', isHours);
+ this.spanMinutes.toggleClass('text-primary', ! isHours);
+
+ // Let's make transitions
+ hideView.addClass('clockpicker-dial-out');
+ nextView.css('visibility', 'visible').removeClass('clockpicker-dial-out');
+
+ // Reset clock hand
+ this.resetClock(delay);
+
+ // After transitions ended
+ clearTimeout(this.toggleViewTimer);
+ this.toggleViewTimer = setTimeout(function() {
+ hideView.css('visibility', 'hidden');
+ }, duration);
+
+ if (raiseAfterHourSelect) {
+ raiseCallback(this.options.afterHourSelect);
+ }
+ };
+
+ // Reset clock hand
+ ClockPicker.prototype.resetClock = function(delay) {
+ var view = this.currentView,
+ value = this[view],
+ isHours = view === 'hours',
+ unit = Math.PI / (isHours ? 6 : 30),
+ radian = value * unit,
+ radius = isHours && value > 0 && value < 13 ? innerRadius : outerRadius,
+ x = Math.sin(radian) * radius,
+ y = - Math.cos(radian) * radius,
+ self = this;
+
+ if (svgSupported && delay) {
+ self.canvas.addClass('clockpicker-canvas-out');
+ setTimeout(function(){
+ self.canvas.removeClass('clockpicker-canvas-out');
+ self.setHand(x, y);
+ }, delay);
+ } else
+ this.setHand(x, y);
+ };
+
+ // Set clock hand to (x, y)
+ ClockPicker.prototype.setHand = function(x, y, roundBy5, dragging) {
+ var radian = Math.atan2(x, - y),
+ isHours = this.currentView === 'hours',
+ unit = Math.PI / (isHours || roundBy5? 6 : 30),
+ z = Math.sqrt(x * x + y * y),
+ options = this.options,
+ inner = isHours && z < (outerRadius + innerRadius) / 2,
+ radius = inner ? innerRadius : outerRadius,
+ value;
+
+ if (options.twelvehour) {
+ radius = outerRadius;
+ }
+
+ // Radian should in range [0, 2PI]
+ if (radian < 0) {
+ radian = Math.PI * 2 + radian;
+ }
+
+ // Get the round value
+ value = Math.round(radian / unit);
+
+ // Get the round radian
+ radian = value * unit;
+
+ // Correct the hours or minutes
+ if (options.twelvehour) {
+ if (isHours) {
+ if (value === 0)
+ value = 12;
+ } else {
+ if (roundBy5)
+ value *= 5;
+ if (value === 60)
+ value = 0;
+ }
+ } else {
+ if (isHours) {
+ if (value === 12)
+ value = 0;
+ value = inner ? (value === 0 ? 12 : value) : value === 0 ? 0 : value + 12;
+ } else {
+ if (roundBy5)
+ value *= 5;
+ if (value === 60)
+ value = 0;
+ }
+ }
+
+ // Once hours or minutes changed, vibrate the device
+ if (this[this.currentView] !== value) {
+ if (vibrate && this.options.vibrate) {
+ // Do not vibrate too frequently
+ if (!this.vibrateTimer) {
+ navigator[vibrate](10);
+ this.vibrateTimer = setTimeout($.proxy(function(){
+ this.vibrateTimer = null;
+ }, this), 100);
+ }
+ }
+ }
+
+ this[this.currentView] = value;
+ if (isHours) {
+ this['spanHours'].html(value);
+ } else {
+ this['spanMinutes'].html(leadingZero(value));
+ }
+
+ // If svg is not supported, just add an active class to the tick
+ if (!svgSupported) {
+ this[isHours ? 'hoursView' : 'minutesView'].find('.clockpicker-tick').each(function(){
+ var tick = $(this);
+ tick.toggleClass('active', value === + tick.html());
+ });
+ return;
+ }
+
+ // Set clock hand and others' position
+ var cx1 = Math.sin(radian) * (radius - tickRadius),
+ cy1 = - Math.cos(radian) * (radius - tickRadius),
+ cx2 = Math.sin(radian) * radius,
+ cy2 = - Math.cos(radian) * radius;
+ this.hand.setAttribute('x2', cx1);
+ this.hand.setAttribute('y2', cy1);
+ this.bg.setAttribute('cx', cx2);
+ this.bg.setAttribute('cy', cy2);
+ };
+
+ // Hours and minutes are selected
+ ClockPicker.prototype.done = function() {
+ raiseCallback(this.options.beforeDone);
+ this.hide();
+ this.label.addClass('active');
+
+ var last = this.input.prop('value'),
+ value = leadingZero(this.hours) + ':' + leadingZero(this.minutes);
+ if (this.options.twelvehour) {
+ value = value + this.amOrPm;
+ }
+
+ this.input.prop('value', value);
+ if (value !== last) {
+ this.input.triggerHandler('change');
+ if (!this.isInput) {
+ this.element.trigger('change');
+ }
+ }
+
+ if (this.options.autoclose)
+ this.input.trigger('blur');
+
+ raiseCallback(this.options.afterDone);
+ };
+
+ // Clear input field
+ ClockPicker.prototype.clear = function() {
+ this.hide();
+ this.label.removeClass('active');
+
+ var last = this.input.prop('value'),
+ value = '';
+
+ this.input.prop('value', value);
+ if (value !== last) {
+ this.input.triggerHandler('change');
+ if (! this.isInput) {
+ this.element.trigger('change');
+ }
+ }
+
+ if (this.options.autoclose) {
+ this.input.trigger('blur');
+ }
+ };
+
+ // Remove clockpicker from input
+ ClockPicker.prototype.remove = function() {
+ this.element.removeData('clockpicker');
+ this.input.off('focus.clockpicker click.clockpicker');
+ if (this.isShown) {
+ this.hide();
+ }
+ if (this.isAppended) {
+ $win.off('resize.clockpicker' + this.id);
+ this.popover.remove();
+ }
+ };
+
+ // Extends $.fn.clockpicker
+ $.fn.pickatime = function(option){
+ var args = Array.prototype.slice.call(arguments, 1);
+ return this.each(function(){
+ var $this = $(this),
+ data = $this.data('clockpicker');
+ if (!data) {
+ var options = $.extend({}, ClockPicker.DEFAULTS, $this.data(), typeof option == 'object' && option);
+ $this.data('clockpicker', new ClockPicker($this, options));
+ } else {
+ // Manual operatsions. show, hide, remove, e.g.
+ if (typeof data[option] === 'function') {
+ data[option].apply(data, args);
+ }
+ }
+ });
+ };
+}());
+;(function ($) {
+
+ $.fn.characterCounter = function(){
+ return this.each(function(){
+ var $input = $(this);
+ var $counterElement = $input.parent().find('span[class="character-counter"]');
+
+ // character counter has already been added appended to the parent container
+ if ($counterElement.length) {
+ return;
+ }
+
+ var itHasLengthAttribute = $input.attr('data-length') !== undefined;
+
+ if(itHasLengthAttribute){
+ $input.on('input', updateCounter);
+ $input.on('focus', updateCounter);
+ $input.on('blur', removeCounterElement);
+
+ addCounterElement($input);
+ }
+
+ });
+ };
+
+ function updateCounter(){
+ var maxLength = +$(this).attr('data-length'),
+ actualLength = +$(this).val().length,
+ isValidLength = actualLength <= maxLength;
+
+ $(this).parent().find('span[class="character-counter"]')
+ .html( actualLength + '/' + maxLength);
+
+ addInputStyle(isValidLength, $(this));
+ }
+
+ function addCounterElement($input) {
+ var $counterElement = $input.parent().find('span[class="character-counter"]');
+
+ if ($counterElement.length) {
+ return;
+ }
+
+ $counterElement = $('<span/>')
+ .addClass('character-counter')
+ .css('float','right')
+ .css('font-size','12px')
+ .css('height', 1);
+
+ $input.parent().append($counterElement);
+ }
+
+ function removeCounterElement(){
+ $(this).parent().find('span[class="character-counter"]').html('');
+ }
+
+ function addInputStyle(isValidLength, $input){
+ var inputHasInvalidClass = $input.hasClass('invalid');
+ if (isValidLength && inputHasInvalidClass) {
+ $input.removeClass('invalid');
+ }
+ else if(!isValidLength && !inputHasInvalidClass){
+ $input.removeClass('valid');
+ $input.addClass('invalid');
+ }
+ }
+
+ $(document).ready(function(){
+ $('input, textarea').characterCounter();
+ });
+
+}( jQuery ));
+;(function ($) {
+
+ var methods = {
+
+ init : function(options) {
+ var defaults = {
+ duration: 200, // ms
+ dist: -100, // zoom scale TODO: make this more intuitive as an option
+ shift: 0, // spacing for center image
+ padding: 0, // Padding between non center items
+ fullWidth: false, // Change to full width styles
+ indicators: false, // Toggle indicators
+ noWrap: false, // Don't wrap around and cycle through items.
+ onCycleTo: null // Callback for when a new slide is cycled to.
+ };
+ options = $.extend(defaults, options);
+ var namespace = Materialize.objectSelectorString($(this));
+
+ return this.each(function(i) {
+
+ var uniqueNamespace = namespace+i;
+ var images, item_width, item_height, offset, center, pressed, dim, count,
+ reference, referenceY, amplitude, target, velocity, scrolling,
+ xform, frame, timestamp, ticker, dragged, vertical_dragged;
+ var $indicators = $('<ul class="indicators"></ul>');
+ var scrollingTimeout = null;
+ var oneTimeCallback = null;
+
+
+ // Initialize
+ var view = $(this);
+ var showIndicators = view.attr('data-indicators') || options.indicators;
+
+
+ // Options
+ var setCarouselHeight = function() {
+ var firstImage = view.find('.carousel-item img').first();
+ if (firstImage.length) {
+ if (firstImage.prop('complete')) {
+ view.css('height', firstImage.height());
+ } else {
+ firstImage.on('load', function(){
+ view.css('height', $(this).height());
+ });
+ }
+ } else {
+ var imageHeight = view.find('.carousel-item').first().height();
+ view.css('height', imageHeight);
+ }
+ };
+
+ if (options.fullWidth) {
+ options.dist = 0;
+ setCarouselHeight();
+
+ // Offset fixed items when indicators.
+ if (showIndicators) {
+ view.find('.carousel-fixed-item').addClass('with-indicators');
+ }
+ }
+
+
+ // Don't double initialize.
+ if (view.hasClass('initialized')) {
+ // Recalculate variables
+ $(window).trigger('resize');
+
+ // Redraw carousel.
+ $(this).trigger('carouselNext', [0.000001]);
+ return true;
+ }
+
+
+ view.addClass('initialized');
+ pressed = false;
+ offset = target = 0;
+ images = [];
+ item_width = view.find('.carousel-item').first().innerWidth();
+ item_height = view.find('.carousel-item').first().innerHeight();
+ dim = item_width * 2 + options.padding;
+
+ view.find('.carousel-item').each(function (i) {
+ images.push($(this)[0]);
+ if (showIndicators) {
+ var $indicator = $('<li class="indicator-item"></li>');
+
+ // Add active to first by default.
+ if (i === 0) {
+ $indicator.addClass('active');
+ }
+
+ // Handle clicks on indicators.
+ $indicator.click(function (e) {
+ e.stopPropagation();
+
+ var index = $(this).index();
+ cycleTo(index);
+ });
+ $indicators.append($indicator);
+ }
+ });
+
+ if (showIndicators) {
+ view.append($indicators);
+ }
+ count = images.length;
+
+
+ function setupEvents() {
+ if (typeof window.ontouchstart !== 'undefined') {
+ view[0].addEventListener('touchstart', tap);
+ view[0].addEventListener('touchmove', drag);
+ view[0].addEventListener('touchend', release);
+ }
+ view[0].addEventListener('mousedown', tap);
+ view[0].addEventListener('mousemove', drag);
+ view[0].addEventListener('mouseup', release);
+ view[0].addEventListener('mouseleave', release);
+ view[0].addEventListener('click', click);
+ }
+
+ function xpos(e) {
+ // touch event
+ if (e.targetTouches && (e.targetTouches.length >= 1)) {
+ return e.targetTouches[0].clientX;
+ }
+
+ // mouse event
+ return e.clientX;
+ }
+
+ function ypos(e) {
+ // touch event
+ if (e.targetTouches && (e.targetTouches.length >= 1)) {
+ return e.targetTouches[0].clientY;
+ }
+
+ // mouse event
+ return e.clientY;
+ }
+
+ function wrap(x) {
+ return (x >= count) ? (x % count) : (x < 0) ? wrap(count + (x % count)) : x;
+ }
+
+ function scroll(x) {
+ // Track scrolling state
+ scrolling = true;
+ if (!view.hasClass('scrolling')) {
+ view.addClass('scrolling');
+ }
+ if (scrollingTimeout != null) {
+ window.clearTimeout(scrollingTimeout);
+ }
+ scrollingTimeout = window.setTimeout(function() {
+ scrolling = false;
+ view.removeClass('scrolling');
+ }, options.duration);
+
+ // Start actual scroll
+ var i, half, delta, dir, tween, el, alignment, xTranslation;
+ var lastCenter = center;
+
+ offset = (typeof x === 'number') ? x : offset;
+ center = Math.floor((offset + dim / 2) / dim);
+ delta = offset - center * dim;
+ dir = (delta < 0) ? 1 : -1;
+ tween = -dir * delta * 2 / dim;
+ half = count >> 1;
+
+ if (!options.fullWidth) {
+ alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) ';
+ alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)';
+ } else {
+ alignment = 'translateX(0)';
+ }
+
+ // Set indicator active
+ if (showIndicators) {
+ var diff = (center % count);
+ var activeIndicator = $indicators.find('.indicator-item.active');
+ if (activeIndicator.index() !== diff) {
+ activeIndicator.removeClass('active');
+ $indicators.find('.indicator-item').eq(diff).addClass('active');
+ }
+ }
+
+ // center
+ // Don't show wrapped items.
+ if (!options.noWrap || (center >= 0 && center < count)) {
+ el = images[wrap(center)];
+
+ // Add active class to center item.
+ if (!$(el).hasClass('active')) {
+ view.find('.carousel-item').removeClass('active');
+ $(el).addClass('active');
+ }
+ el.style[xform] = alignment +
+ ' translateX(' + (-delta / 2) + 'px)' +
+ ' translateX(' + (dir * options.shift * tween * i) + 'px)' +
+ ' translateZ(' + (options.dist * tween) + 'px)';
+ el.style.zIndex = 0;
+ if (options.fullWidth) { tweenedOpacity = 1; }
+ else { tweenedOpacity = 1 - 0.2 * tween; }
+ el.style.opacity = tweenedOpacity;
+ el.style.display = 'block';
+ }
+
+ for (i = 1; i <= half; ++i) {
+ // right side
+ if (options.fullWidth) {
+ zTranslation = options.dist;
+ tweenedOpacity = (i === half && delta < 0) ? 1 - tween : 1;
+ } else {
+ zTranslation = options.dist * (i * 2 + tween * dir);
+ tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir);
+ }
+ // Don't show wrapped items.
+ if (!options.noWrap || center + i < count) {
+ el = images[wrap(center + i)];
+ el.style[xform] = alignment +
+ ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' +
+ ' translateZ(' + zTranslation + 'px)';
+ el.style.zIndex = -i;
+ el.style.opacity = tweenedOpacity;
+ el.style.display = 'block';
+ }
+
+
+ // left side
+ if (options.fullWidth) {
+ zTranslation = options.dist;
+ tweenedOpacity = (i === half && delta > 0) ? 1 - tween : 1;
+ } else {
+ zTranslation = options.dist * (i * 2 - tween * dir);
+ tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir);
+ }
+ // Don't show wrapped items.
+ if (!options.noWrap || center - i >= 0) {
+ el = images[wrap(center - i)];
+ el.style[xform] = alignment +
+ ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' +
+ ' translateZ(' + zTranslation + 'px)';
+ el.style.zIndex = -i;
+ el.style.opacity = tweenedOpacity;
+ el.style.display = 'block';
+ }
+ }
+
+ // center
+ // Don't show wrapped items.
+ if (!options.noWrap || (center >= 0 && center < count)) {
+ el = images[wrap(center)];
+ el.style[xform] = alignment +
+ ' translateX(' + (-delta / 2) + 'px)' +
+ ' translateX(' + (dir * options.shift * tween) + 'px)' +
+ ' translateZ(' + (options.dist * tween) + 'px)';
+ el.style.zIndex = 0;
+ if (options.fullWidth) { tweenedOpacity = 1; }
+ else { tweenedOpacity = 1 - 0.2 * tween; }
+ el.style.opacity = tweenedOpacity;
+ el.style.display = 'block';
+ }
+
+ // onCycleTo callback
+ if (lastCenter !== center &&
+ typeof(options.onCycleTo) === "function") {
+ var $curr_item = view.find('.carousel-item').eq(wrap(center));
+ options.onCycleTo.call(this, $curr_item, dragged);
+ }
+
+ // One time callback
+ if (typeof(oneTimeCallback) === "function") {
+ oneTimeCallback.call(this, $curr_item, dragged);
+ oneTimeCallback = null;
+ }
+ }
+
+ function track() {
+ var now, elapsed, delta, v;
+
+ now = Date.now();
+ elapsed = now - timestamp;
+ timestamp = now;
+ delta = offset - frame;
+ frame = offset;
+
+ v = 1000 * delta / (1 + elapsed);
+ velocity = 0.8 * v + 0.2 * velocity;
+ }
+
+ function autoScroll() {
+ var elapsed, delta;
+
+ if (amplitude) {
+ elapsed = Date.now() - timestamp;
+ delta = amplitude * Math.exp(-elapsed / options.duration);
+ if (delta > 2 || delta < -2) {
+ scroll(target - delta);
+ requestAnimationFrame(autoScroll);
+ } else {
+ scroll(target);
+ }
+ }
+ }
+
+ function click(e) {
+ // Disable clicks if carousel was dragged.
+ if (dragged) {
+ e.preventDefault();
+ e.stopPropagation();
+ return false;
+
+ } else if (!options.fullWidth) {
+ var clickedIndex = $(e.target).closest('.carousel-item').index();
+ var diff = wrap(center) - clickedIndex;
+
+ // Disable clicks if carousel was shifted by click
+ if (diff !== 0) {
+ e.preventDefault();
+ e.stopPropagation();
+ }
+ cycleTo(clickedIndex);
+ }
+ }
+
+ function cycleTo(n) {
+ var diff = (center % count) - n;
+
+ // Account for wraparound.
+ if (!options.noWrap) {
+ if (diff < 0) {
+ if (Math.abs(diff + count) < Math.abs(diff)) { diff += count; }
+
+ } else if (diff > 0) {
+ if (Math.abs(diff - count) < diff) { diff -= count; }
+ }
+ }
+
+ // Call prev or next accordingly.
+ if (diff < 0) {
+ view.trigger('carouselNext', [Math.abs(diff)]);
+
+ } else if (diff > 0) {
+ view.trigger('carouselPrev', [diff]);
+ }
+ }
+
+ function tap(e) {
+ if (e.type === 'mousedown') {
+ e.preventDefault();
+ }
+ pressed = true;
+ dragged = false;
+ vertical_dragged = false;
+ reference = xpos(e);
+ referenceY = ypos(e);
+
+ velocity = amplitude = 0;
+ frame = offset;
+ timestamp = Date.now();
+ clearInterval(ticker);
+ ticker = setInterval(track, 100);
+ }
+
+ function drag(e) {
+ var x, delta, deltaY;
+ if (pressed) {
+ x = xpos(e);
+ y = ypos(e);
+ delta = reference - x;
+ deltaY = Math.abs(referenceY - y);
+ if (deltaY < 30 && !vertical_dragged) {
+ // If vertical scrolling don't allow dragging.
+ if (delta > 2 || delta < -2) {
+ dragged = true;
+ reference = x;
+ scroll(offset + delta);
+ }
+
+ } else if (dragged) {
+ // If dragging don't allow vertical scroll.
+ e.preventDefault();
+ e.stopPropagation();
+ return false;
+
+ } else {
+ // Vertical scrolling.
+ vertical_dragged = true;
+ }
+ }
+
+ if (dragged) {
+ // If dragging don't allow vertical scroll.
+ e.preventDefault();
+ e.stopPropagation();
+ return false;
+ }
+ }
+
+ function release(e) {
+ if (pressed) {
+ pressed = false;
+ } else {
+ return;
+ }
+
+ clearInterval(ticker);
+ target = offset;
+ if (velocity > 10 || velocity < -10) {
+ amplitude = 0.9 * velocity;
+ target = offset + amplitude;
+ }
+ target = Math.round(target / dim) * dim;
+
+ // No wrap of items.
+ if (options.noWrap) {
+ if (target >= dim * (count - 1)) {
+ target = dim * (count - 1);
+ } else if (target < 0) {
+ target = 0;
+ }
+ }
+ amplitude = target - offset;
+ timestamp = Date.now();
+ requestAnimationFrame(autoScroll);
+
+ if (dragged) {
+ e.preventDefault();
+ e.stopPropagation();
+ }
+ return false;
+ }
+
+ xform = 'transform';
+ ['webkit', 'Moz', 'O', 'ms'].every(function (prefix) {
+ var e = prefix + 'Transform';
+ if (typeof document.body.style[e] !== 'undefined') {
+ xform = e;
+ return false;
+ }
+ return true;
+ });
+
+
+ $(window).off('resize.carousel-'+uniqueNamespace).on('resize.carousel-'+uniqueNamespace, function() {
+ if (options.fullWidth) {
+ item_width = view.find('.carousel-item').first().innerWidth();
+ item_height = view.find('.carousel-item').first().innerHeight();
+ dim = item_width * 2 + options.padding;
+ offset = center * 2 * item_width;
+ target = offset;
+ } else {
+ scroll();
+ }
+ });
+
+ setupEvents();
+ scroll(offset);
+
+ $(this).on('carouselNext', function(e, n, callback) {
+ if (n === undefined) {
+ n = 1;
+ }
+ if (typeof(callback) === "function") {
+ oneTimeCallback = callback;
+ }
+
+ target = (dim * Math.round(offset / dim)) + (dim * n);
+ if (offset !== target) {
+ amplitude = target - offset;
+ timestamp = Date.now();
+ requestAnimationFrame(autoScroll);
+ }
+ });
+
+ $(this).on('carouselPrev', function(e, n, callback) {
+ if (n === undefined) {
+ n = 1;
+ }
+ if (typeof(callback) === "function") {
+ oneTimeCallback = callback;
+ }
+
+ target = (dim * Math.round(offset / dim)) - (dim * n);
+ if (offset !== target) {
+ amplitude = target - offset;
+ timestamp = Date.now();
+ requestAnimationFrame(autoScroll);
+ }
+ });
+
+ $(this).on('carouselSet', function(e, n, callback) {
+ if (n === undefined) {
+ n = 0;
+ }
+ if (typeof(callback) === "function") {
+ oneTimeCallback = callback;
+ }
+
+ cycleTo(n);
+ });
+
+ });
+
+
+
+ },
+ next : function(n, callback) {
+ $(this).trigger('carouselNext', [n, callback]);
+ },
+ prev : function(n, callback) {
+ $(this).trigger('carouselPrev', [n, callback]);
+ },
+ set : function(n, callback) {
+ $(this).trigger('carouselSet', [n, callback]);
+ }
+ };
+
+
+ $.fn.carousel = function(methodOrOptions) {
+ if ( methods[methodOrOptions] ) {
+ return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
+ } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
+ // Default to "init"
+ return methods.init.apply( this, arguments );
+ } else {
+ $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.carousel' );
+ }
+ }; // Plugin end
+}( jQuery ));
+;(function ($) {
+
+ var methods = {
+ init: function (options) {
+ return this.each(function() {
+ var origin = $('#'+$(this).attr('data-activates'));
+ var screen = $('body');
+
+ // Creating tap target
+ var tapTargetEl = $(this);
+ var tapTargetWrapper = tapTargetEl.parent('.tap-target-wrapper');
+ var tapTargetWave = tapTargetWrapper.find('.tap-target-wave');
+ var tapTargetOriginEl = tapTargetWrapper.find('.tap-target-origin');
+ var tapTargetContentEl = tapTargetEl.find('.tap-target-content');
+
+ // Creating wrapper
+ if (!tapTargetWrapper.length) {
+ tapTargetWrapper = tapTargetEl.wrap($('<div class="tap-target-wrapper"></div>')).parent();
+ }
+
+ // Creating content
+ if (!tapTargetContentEl.length) {
+ tapTargetContentEl = $('<div class="tap-target-content"></div>');
+ tapTargetEl.append(tapTargetContentEl);
+ }
+
+ // Creating foreground wave
+ if (!tapTargetWave.length) {
+ tapTargetWave = $('<div class="tap-target-wave"></div>');
+
+ // Creating origin
+ if (!tapTargetOriginEl.length) {
+ tapTargetOriginEl = origin.clone(true, true);
+ tapTargetOriginEl.addClass('tap-target-origin');
+ tapTargetOriginEl.removeAttr('id');
+ tapTargetOriginEl.removeAttr('style');
+ tapTargetWave.append(tapTargetOriginEl);
+ }
+
+ tapTargetWrapper.append(tapTargetWave);
+ }
+
+ // Open
+ var openTapTarget = function() {
+ if (tapTargetWrapper.is('.open')) {
+ return;
+ }
+
+ // Adding open class
+ tapTargetWrapper.addClass('open');
+
+ setTimeout(function() {
+ tapTargetOriginEl.off('click.tapTarget').on('click.tapTarget', function(e) {
+ closeTapTarget();
+ tapTargetOriginEl.off('click.tapTarget');
+ });
+
+ $(document).off('click.tapTarget').on('click.tapTarget', function(e) {
+ closeTapTarget();
+ $(document).off('click.tapTarget');
+ });
+
+ var throttledCalc = Materialize.throttle(function() {
+ calculateTapTarget();
+ }, 200);
+ $(window).off('resize.tapTarget').on('resize.tapTarget', throttledCalc);
+ }, 0);
+ };
+
+ // Close
+ var closeTapTarget = function(){
+ if (!tapTargetWrapper.is('.open')) {
+ return;
+ }
+
+ tapTargetWrapper.removeClass('open');
+ tapTargetOriginEl.off('click.tapTarget')
+ $(document).off('click.tapTarget');
+ $(window).off('resize.tapTarget');
+ };
+
+ // Pre calculate
+ var calculateTapTarget = function() {
+ // Element or parent is fixed position?
+ var isFixed = origin.css('position') === 'fixed';
+ if (!isFixed) {
+ var parents = origin.parents();
+ for(var i = 0; i < parents.length; i++) {
+ isFixed = $(parents[i]).css('position') == 'fixed';
+ if (isFixed) {
+ break;
+ }
+ }
+ }
+
+ // Calculating origin
+ var originWidth = origin.outerWidth();
+ var originHeight = origin.outerHeight();
+ var originTop = isFixed ? origin.offset().top - $(document).scrollTop() : origin.offset().top;
+ var originLeft = isFixed ? origin.offset().left - $(document).scrollLeft() : origin.offset().left;
+
+ // Calculating screen
+ var windowWidth = $(window).width();
+ var windowHeight = $(window).height();
+ var centerX = windowWidth / 2;
+ var centerY = windowHeight / 2;
+ var isLeft = originLeft <= centerX;
+ var isRight = originLeft > centerX;
+ var isTop = originTop <= centerY;
+ var isBottom = originTop > centerY;
+ var isCenterX = originLeft >= windowWidth*0.25 && originLeft <= windowWidth*0.75;
+ var isCenterY = originTop >= windowHeight*0.25 && originTop <= windowHeight*0.75;
+
+ // Calculating tap target
+ var tapTargetWidth = tapTargetEl.outerWidth();
+ var tapTargetHeight = tapTargetEl.outerHeight();
+ var tapTargetTop = originTop + originHeight/2 - tapTargetHeight/2;
+ var tapTargetLeft = originLeft + originWidth/2 - tapTargetWidth/2;
+ var tapTargetPosition = isFixed ? 'fixed' : 'absolute';
+
+ // Calculating content
+ var tapTargetTextWidth = isCenterX ? tapTargetWidth : tapTargetWidth/2 + originWidth;
+ var tapTargetTextHeight = tapTargetHeight/2;
+ var tapTargetTextTop = isTop ? tapTargetHeight/2 : 0;
+ var tapTargetTextBottom = 0;
+ var tapTargetTextLeft = isLeft && !isCenterX ? tapTargetWidth/2 - originWidth : 0;
+ var tapTargetTextRight = 0;
+ var tapTargetTextPadding = originWidth;
+ var tapTargetTextAlign = isBottom ? 'bottom' : 'top';
+
+ // Calculating wave
+ var tapTargetWaveWidth = originWidth > originHeight ? originWidth*2 : originWidth*2;
+ var tapTargetWaveHeight = tapTargetWaveWidth;
+ var tapTargetWaveTop = tapTargetHeight/2 - tapTargetWaveHeight/2;
+ var tapTargetWaveLeft = tapTargetWidth/2 - tapTargetWaveWidth/2;
+
+ // Setting tap target
+ var tapTargetWrapperCssObj = {};
+ tapTargetWrapperCssObj.top = isTop ? tapTargetTop : '';
+ tapTargetWrapperCssObj.right = isRight ? windowWidth - tapTargetLeft - tapTargetWidth : '';
+ tapTargetWrapperCssObj.bottom = isBottom ? windowHeight - tapTargetTop - tapTargetHeight : '';
+ tapTargetWrapperCssObj.left = isLeft ? tapTargetLeft : '';
+ tapTargetWrapperCssObj.position = tapTargetPosition;
+ tapTargetWrapper.css(tapTargetWrapperCssObj);
+
+ // Setting content
+ tapTargetContentEl.css({
+ width: tapTargetTextWidth,
+ height: tapTargetTextHeight,
+ top: tapTargetTextTop,
+ right: tapTargetTextRight,
+ bottom: tapTargetTextBottom,
+ left: tapTargetTextLeft,
+ padding: tapTargetTextPadding,
+ verticalAlign: tapTargetTextAlign
+ });
+
+ // Setting wave
+ tapTargetWave.css({
+ top: tapTargetWaveTop,
+ left: tapTargetWaveLeft,
+ width: tapTargetWaveWidth,
+ height: tapTargetWaveHeight
+ });
+ }
+
+ if (options == 'open') {
+ calculateTapTarget();
+ openTapTarget();
+ }
+
+ if (options == 'close')
+ closeTapTarget();
+ });
+ },
+ open: function() {},
+ close: function() {}
+ };
+
+ $.fn.tapTarget = function(methodOrOptions) {
+ if (methods[methodOrOptions] || typeof methodOrOptions === 'object')
+ return methods.init.apply( this, arguments );
+
+ $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.tap-target' );
+ };
+
+}( jQuery ));