diff options
| author | Mitch Riedstra <Mitch@riedstra.us> | 2017-10-24 16:59:48 -0400 |
|---|---|---|
| committer | Mitch Riedstra <Mitch@riedstra.us> | 2017-10-24 16:59:48 -0400 |
| commit | 3e8b34be2fdeccf16c8b46f1ee518f970853768d (patch) | |
| tree | abcb7d0cb260790a2b4a746e3959f2e7ee3a33f7 /app | |
| parent | 4ee5893fd9c82228c62306fc7f5babdfc602e4c4 (diff) | |
| download | dispatch-tracker-3e8b34be2fdeccf16c8b46f1ee518f970853768d.tar.gz dispatch-tracker-3e8b34be2fdeccf16c8b46f1ee518f970853768d.tar.xz | |
Adding in materialize source and templates
Diffstat (limited to 'app')
165 files changed, 26499 insertions, 0 deletions
diff --git a/app/dispatch/migrations/0007_invoice_paid.py b/app/dispatch/migrations/0007_invoice_paid.py new file mode 100644 index 0000000..d8fcd81 --- /dev/null +++ b/app/dispatch/migrations/0007_invoice_paid.py @@ -0,0 +1,20 @@ +# -*- coding: utf-8 -*- +# Generated by Django 1.11.5 on 2017-10-24 14:20 +from __future__ import unicode_literals + +from django.db import migrations, models + + +class Migration(migrations.Migration): + + dependencies = [ + ('dispatch', '0006_auto_20171023_2049'), + ] + + operations = [ + migrations.AddField( + model_name='invoice', + name='paid', + field=models.BooleanField(default=False), + ), + ] diff --git a/app/dispatch/migrations/0008_invoiceitem_date.py b/app/dispatch/migrations/0008_invoiceitem_date.py new file mode 100644 index 0000000..892adfe --- /dev/null +++ b/app/dispatch/migrations/0008_invoiceitem_date.py @@ -0,0 +1,22 @@ +# -*- coding: utf-8 -*- +# Generated by Django 1.11.5 on 2017-10-24 15:02 +from __future__ import unicode_literals + +from django.db import migrations, models +import django.utils.timezone + + +class Migration(migrations.Migration): + + dependencies = [ + ('dispatch', '0007_invoice_paid'), + ] + + operations = [ + migrations.AddField( + model_name='invoiceitem', + name='date', + field=models.DateField(default=django.utils.timezone.now), + preserve_default=False, + ), + ] diff --git a/app/dispatch/static/materialize/.sass-cache/219915314f96ba592393ee0f91ebc5ca040988d6/materialize.scssc b/app/dispatch/static/materialize/.sass-cache/219915314f96ba592393ee0f91ebc5ca040988d6/materialize.scssc Binary files differnew file mode 100644 index 0000000..6eeb811 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/219915314f96ba592393ee0f91ebc5ca040988d6/materialize.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_badges.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_badges.scssc Binary files differnew file mode 100644 index 0000000..9dd273c --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_badges.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_buttons.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_buttons.scssc Binary files differnew file mode 100644 index 0000000..f406aa2 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_buttons.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_cards.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_cards.scssc Binary files differnew file mode 100644 index 0000000..360efd1 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_cards.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_carousel.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_carousel.scssc Binary files differnew file mode 100644 index 0000000..6b68919 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_carousel.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_chips.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_chips.scssc Binary files differnew file mode 100644 index 0000000..40ed812 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_chips.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_collapsible.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_collapsible.scssc Binary files differnew file mode 100644 index 0000000..f045762 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_collapsible.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_color.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_color.scssc Binary files differnew file mode 100644 index 0000000..0e6fc12 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_color.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_dropdown.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_dropdown.scssc Binary files differnew file mode 100644 index 0000000..316cc93 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_dropdown.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_global.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_global.scssc Binary files differnew file mode 100644 index 0000000..a39d2c2 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_global.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_grid.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_grid.scssc Binary files differnew file mode 100644 index 0000000..e2dc378 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_grid.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_icons-material-design.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_icons-material-design.scssc Binary files differnew file mode 100644 index 0000000..0ee9872 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_icons-material-design.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_materialbox.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_materialbox.scssc Binary files differnew file mode 100644 index 0000000..897028b --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_materialbox.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_modal.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_modal.scssc Binary files differnew file mode 100644 index 0000000..43dcec6 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_modal.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_navbar.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_navbar.scssc Binary files differnew file mode 100644 index 0000000..c41240d --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_navbar.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_normalize.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_normalize.scssc Binary files differnew file mode 100644 index 0000000..89ab27d --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_normalize.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_preloader.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_preloader.scssc Binary files differnew file mode 100644 index 0000000..7d5da2c --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_preloader.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_pulse.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_pulse.scssc Binary files differnew file mode 100644 index 0000000..d0591b7 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_pulse.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_roboto.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_roboto.scssc Binary files differnew file mode 100644 index 0000000..91d4ed8 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_roboto.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_sideNav.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_sideNav.scssc Binary files differnew file mode 100644 index 0000000..c78a431 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_sideNav.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_slider.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_slider.scssc Binary files differnew file mode 100644 index 0000000..c9809e4 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_slider.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_table_of_contents.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_table_of_contents.scssc Binary files differnew file mode 100644 index 0000000..9cb15fb --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_table_of_contents.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tabs.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tabs.scssc Binary files differnew file mode 100644 index 0000000..1d3ba87 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tabs.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tapTarget.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tapTarget.scssc Binary files differnew file mode 100644 index 0000000..94da382 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tapTarget.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_toast.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_toast.scssc Binary files differnew file mode 100644 index 0000000..a5abca2 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_toast.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tooltip.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tooltip.scssc Binary files differnew file mode 100644 index 0000000..6dfe50d --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tooltip.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_transitions.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_transitions.scssc Binary files differnew file mode 100644 index 0000000..633c052 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_transitions.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_typography.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_typography.scssc Binary files differnew file mode 100644 index 0000000..b5bfe0b --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_typography.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_variables.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_variables.scssc Binary files differnew file mode 100644 index 0000000..d22bf00 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_variables.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_waves.scssc b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_waves.scssc Binary files differnew file mode 100644 index 0000000..54684f6 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_waves.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_checkboxes.scssc b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_checkboxes.scssc Binary files differnew file mode 100644 index 0000000..899c061 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_checkboxes.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_file-input.scssc b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_file-input.scssc Binary files differnew file mode 100644 index 0000000..1122c19 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_file-input.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_forms.scssc b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_forms.scssc Binary files differnew file mode 100644 index 0000000..3ee6f0e --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_forms.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_input-fields.scssc b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_input-fields.scssc Binary files differnew file mode 100644 index 0000000..c0dbb39 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_input-fields.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_radio-buttons.scssc b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_radio-buttons.scssc Binary files differnew file mode 100644 index 0000000..df5efbc --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_radio-buttons.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_range.scssc b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_range.scssc Binary files differnew file mode 100644 index 0000000..e188d04 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_range.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_select.scssc b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_select.scssc Binary files differnew file mode 100644 index 0000000..2974159 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_select.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_switches.scssc b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_switches.scssc Binary files differnew file mode 100644 index 0000000..e776d02 --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_switches.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.date.scssc b/app/dispatch/static/materialize/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.date.scssc Binary files differnew file mode 100644 index 0000000..607e4dc --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.date.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.scssc b/app/dispatch/static/materialize/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.scssc Binary files differnew file mode 100644 index 0000000..145330c --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.scssc diff --git a/app/dispatch/static/materialize/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.time.scssc b/app/dispatch/static/materialize/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.time.scssc Binary files differnew file mode 100644 index 0000000..0335a0d --- /dev/null +++ b/app/dispatch/static/materialize/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.time.scssc diff --git a/app/dispatch/static/materialize/css/materialize.min.css.map b/app/dispatch/static/materialize/css/materialize.min.css.map new file mode 100644 index 0000000..4b48694 --- /dev/null +++ b/app/dispatch/static/materialize/css/materialize.min.css.map @@ -0,0 +1,7 @@ +{ +"version": 3, +"mappings": "AAiXM,gBAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,qBAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,0BAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,oCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,0BAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,oCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,0BAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,oCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,0BAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,oCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,0BAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,oCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,yBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,mCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,yBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,mCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,yBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,mCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,yBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,mCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,IAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,SAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,aAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,uBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,aAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,uBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,aAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,uBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,aAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,uBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,aAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,uBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,aAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,uBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,aAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,uBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,aAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,uBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,KAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,UAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,OAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,YAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,eAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,eAAuB,CAZhC,YAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,iBAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,OAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,YAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,KAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,UAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,WAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,gBAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,KAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,UAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,KAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,UAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,MAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,WAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,YAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,iBAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,KAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,UAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,OAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,YAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,eAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,eAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,MAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,WAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,OAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,YAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,iBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,2BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,YAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,iBAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,sBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,gCAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,qBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,+BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,MAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,WAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,gBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,0BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,UAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,eAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,oBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,8BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,mBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,6BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,mBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,6BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,mBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,6BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,mBAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,6BAAyC,CACvC,KAAK,CAAE,kBAAuB,CAZhC,KAAgB,CACd,gBAAgB,CAAE,kBAAuB,CAE3C,UAAqB,CACnB,KAAK,CAAE,kBAAuB,CAIhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,eAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,eAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,eAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,yBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAJhC,cAA+B,CAC7B,gBAAgB,CAAE,kBAAuB,CAE3C,wBAAyC,CACvC,KAAK,CAAE,kBAAuB,CAQpC,MAAW,CACT,gBAAgB,CAAE,eAAuB,CAE3C,WAAgB,CACd,KAAK,CAAE,eAAuB,CAJhC,MAAW,CACT,gBAAgB,CAAE,eAAuB,CAE3C,WAAgB,CACd,KAAK,CAAE,eAAuB,CAJhC,YAAW,CACT,gBAAgB,CAAE,sBAAuB,CAE3C,iBAAgB,CACd,KAAK,CAAE,sBAAuB,CCzYlC,4EAA4E,AAQ5E,IAAK,CACH,WAAW,CAAE,UAAU,CACvB,oBAAoB,CAAE,IAAI,CAC1B,wBAAwB,CAAE,IAAI,CAOhC,IAAK,CACH,MAAM,CAAE,CAAC,CAaX,0FAYQ,CACN,OAAO,CAAE,KAAK,CAQhB,2BAGM,CACJ,OAAO,CAAE,YAAY,CACrB,cAAc,CAAE,QAAQ,CAQ1B,qBAAsB,CACpB,OAAO,CAAE,IAAI,CACb,MAAM,CAAE,CAAC,CAQX,iBACS,CACP,OAAO,CAAE,IAAI,CAUf,CAAE,CACA,gBAAgB,CAAE,WAAW,CAQ/B,gBACQ,CACN,OAAO,CAAE,CAAC,CAUZ,WAAY,CACV,aAAa,CAAE,UAAU,CAO3B,QACO,CACL,WAAW,CAAE,IAAI,CAOnB,GAAI,CACF,UAAU,CAAE,MAAM,CAQpB,EAAG,CACD,SAAS,CAAE,GAAG,CACd,MAAM,CAAE,QAAQ,CAOlB,IAAK,CACH,UAAU,CAAE,IAAI,CAChB,KAAK,CAAE,IAAI,CAOb,KAAM,CACJ,SAAS,CAAE,GAAG,CAOhB,OACI,CACF,SAAS,CAAE,GAAG,CACd,WAAW,CAAE,CAAC,CACd,QAAQ,CAAE,QAAQ,CAClB,cAAc,CAAE,QAAQ,CAG1B,GAAI,CACF,GAAG,CAAE,MAAM,CAGb,GAAI,CACF,MAAM,CAAE,OAAO,CAUjB,GAAI,CACF,MAAM,CAAE,CAAC,CAOX,cAAe,CACb,QAAQ,CAAE,MAAM,CAUlB,MAAO,CACL,MAAM,CAAE,QAAQ,CAOlB,EAAG,CACD,UAAU,CAAE,WAAW,CACvB,MAAM,CAAE,CAAC,CAOX,GAAI,CACF,QAAQ,CAAE,IAAI,CAOhB,iBAGK,CACH,WAAW,CAAE,oBAAoB,CACjC,SAAS,CAAE,GAAG,CAkBhB,qCAIS,CACP,KAAK,CAAE,OAAO,CACd,IAAI,CAAE,OAAO,CACb,MAAM,CAAE,CAAC,CAOX,MAAO,CACL,QAAQ,CAAE,OAAO,CAUnB,aACO,CACL,cAAc,CAAE,IAAI,CAWtB,yEAGqB,CACnB,kBAAkB,CAAE,MAAM,CAC1B,MAAM,CAAE,OAAO,CAOjB,qCACqB,CACnB,MAAM,CAAE,OAAO,CAOjB,gDACwB,CACtB,MAAM,CAAE,CAAC,CACT,OAAO,CAAE,CAAC,CAQZ,KAAM,CACJ,WAAW,CAAE,MAAM,CAWrB,0CACoB,CAClB,UAAU,CAAE,UAAU,CACtB,OAAO,CAAE,CAAC,CASZ,+FACgD,CAC9C,MAAM,CAAE,IAAI,CAQd,oBAAqB,CACnB,kBAAkB,CAAE,SAAS,CAC7B,UAAU,CAAE,WAAW,CASzB,kGACgD,CAC9C,kBAAkB,CAAE,IAAI,CAO1B,QAAS,CACP,MAAM,CAAE,iBAAiB,CACzB,MAAM,CAAE,KAAK,CACb,OAAO,CAAE,qBAAqB,CAQhC,MAAO,CACL,MAAM,CAAE,CAAC,CACT,OAAO,CAAE,CAAC,CAOZ,QAAS,CACP,QAAQ,CAAE,IAAI,CAQhB,QAAS,CACP,WAAW,CAAE,IAAI,CAUnB,KAAM,CACJ,eAAe,CAAE,QAAQ,CACzB,cAAc,CAAE,CAAC,CAGnB,KACG,CACD,OAAO,CAAE,CAAC,CCpaZ,IAAK,CACJ,UAAU,CAAE,UAAU,CAEvB,kBAAqB,CACpB,UAAU,CAAE,OAAO,CAclB,wBAAwB,CACtB,YAAY,CAAE,CAAC,CACf,eAAe,CAAE,IAAI,CAErB,2BAAO,CACL,eAAe,CAAE,IAAI,CAK3B,CAAE,CACD,KAAK,CCaO,OAA+B,CDZ3C,eAAe,CAAE,IAAI,CAGpB,2BAA2B,CAAE,WAAW,CAK1C,eAAgB,CACd,OAAO,CAAE,IAAI,CACb,WAAW,CAAE,MAAM,CAKrB,SAAU,CACR,KAAK,CAAE,IAAI,CAKb,UAAW,CACT,UAAU,CAAE,eAAe,CAE7B,8GAAW,CACT,UAAU,CAAE,wFAAmG,CAEjH,+DAAgB,CACd,UAAU,CAAE,wFAAmG,CAEjH,UAAW,CACT,UAAU,CAAE,yFAAoG,CAElH,UAAW,CACT,UAAU,CAAE,0FAAqG,CAEnH,iBAAW,CACT,UAAU,CAAE,8FAAyG,CAEvH,UAAW,CACT,UAAU,CAAE,gGAA2G,CAGzH,UAAW,CACT,UAAU,CAAE,eAAe,CAE3B,gBAAQ,CACN,UAAU,CAAE,0DAAiE,CAMjF,QAAS,CACP,MAAM,CAAE,GAAG,CACX,QAAQ,CAAE,MAAM,CAChB,gBAAgB,CCyLM,OAA0B,CDnLlD,UAAW,CACT,MAAM,CAAE,MAAM,CACd,YAAY,CAAE,MAAM,CACpB,WAAW,CAAE,iBAAwB,CAKvC,CAAE,CACA,WAAW,CAAE,OAAO,CAEpB,MAAO,CACL,KAAK,CAAE,IAAI,CACX,YAAY,CAAE,IAAI,CAEpB,OAAQ,CACN,KAAK,CAAE,KAAK,CACZ,WAAW,CAAE,IAAI,CAEnB,MAAO,CACL,SAAS,CAAE,IAAI,CAEjB,OAAQ,CACN,SAAS,CAAE,IAAI,CAEjB,QAAS,CACP,SAAS,CAAE,IAAI,CAEjB,OAAQ,CACN,SAAS,CAAE,IAAI,CAKnB,yCACuB,CACrB,SAAS,CAAE,IAAI,CACf,MAAM,CAAE,IAAI,CAQZ,cAAG,CACD,OAAO,CAAE,YAAY,CACrB,aAAa,CAAE,GAAG,CAClB,UAAU,CAAE,MAAM,CAClB,cAAc,CAAE,GAAG,CACnB,MAAM,CAAE,IAAI,CAEZ,gBAAE,CACA,KAAK,CAAE,IAAI,CACX,OAAO,CAAE,YAAY,CACrB,SAAS,CAAE,MAAM,CACjB,OAAO,CAAE,MAAM,CACf,WAAW,CAAE,IAAI,CAGnB,uBAAW,CAAE,KAAK,CAAE,IAAI,CAExB,qBAAS,CAAE,gBAAgB,CCwKb,OAAc,CDtK5B,yBAAa,CACX,MAAM,CAAE,OAAO,CACf,KAAK,CAAE,IAAI,CAGb,gBAAE,CACA,SAAS,CAAE,IAAI,CAKnB,0BAAe,CACb,OAAO,CAAE,YAAY,CACrB,KAAK,CAAE,IAAI,CAGf,yBAA2B,CACzB,WAAY,CACV,KAAK,CAAE,IAAI,CAEX,uCACQ,CACN,KAAK,CAAE,GAAG,CAGZ,oBAAS,CACP,KAAK,CAAE,GAAG,CACV,QAAQ,CAAE,MAAM,CAChB,WAAW,CAAE,MAAM,EAMzB,WAAY,CACV,SAAS,CAAE,IAAI,CACf,KAAK,CAAE,qBAAqB,CAE5B,kGAEiB,CACf,OAAO,CAAE,YAAY,CACrB,KAAK,CAAE,IAAI,CACX,SAAS,CAAE,IAAI,CAGjB,kBAAS,CACP,OAAO,CAAE,OAAO,CAChB,KAAK,CAAE,qBAAqB,CAC5B,cAAc,CAAE,GAAG,CACnB,OAAO,CAAE,YAAY,CACrB,WAAW,CAAE,gBAAgB,CAC7B,WAAW,CAAE,MAAM,CACnB,UAAU,CAAE,MAAM,CAClB,SAAS,CAAE,IAAI,CACf,MAAM,CAAE,YAAY,CACpB,sBAAsB,CAAE,WAAW,CAGrC,8BAAqB,CACnB,OAAO,CAAE,IAAI,CAGf,sBAAa,CACX,KAAK,CAAE,IAAI,CAKf,mBAAoB,CAClB,QAAQ,CAAE,QAAQ,CAClB,QAAQ,CAAE,MAAM,CAChB,MAAM,CAAE,KAAK,CAEb,6BAAU,CACR,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,CAAC,CACT,OAAO,CAAE,EAAE,CAEX,iCAAI,CACF,OAAO,CAAE,IAAI,CACb,QAAQ,CAAE,QAAQ,CAClB,IAAI,CAAE,GAAG,CACT,MAAM,CAAE,CAAC,CACT,SAAS,CAAE,IAAI,CACf,UAAU,CAAE,IAAI,CAChB,SAAS,CAAE,oBAAkB,CAC7B,SAAS,CAAE,gBAAgB,CAMjC,oBAAsB,CACpB,QAAQ,CAAE,QAAQ,CAEpB,OAAQ,CACN,QAAQ,CAAE,gBAAgB,CAO5B,oBAAqB,CACnB,OAAO,CAAE,CAAC,CAGZ,QAAS,CACP,OAAO,CAAE,CAAC,CACV,gBAAgB,CAAE,KAAK,CAQvB,yBAA0B,CAD5B,2CAA6C,CAEzC,OAAO,CAAE,eAAe,EAI1B,yBAA2B,CAD7B,qBAAsB,CAElB,OAAO,CAAE,eAAe,EAI1B,yBAAyB,CAD3B,mBAAoB,CAEhB,OAAO,CAAE,eAAe,EAI1B,gEAAkF,CADpF,iBAAkB,CAEd,OAAO,CAAE,eAAe,EAI1B,yBAAwB,CAD1B,mBAAoB,CAEhB,OAAO,CAAE,eAAe,EAI1B,yBAAwB,CAD1B,cAAe,CAEX,OAAO,CAAE,gBAAgB,EAI3B,gEAAkF,CADpF,eAAgB,CAEZ,OAAO,CAAE,gBAAgB,EAI3B,yBAA0B,CAD5B,cAAe,CAEX,OAAO,CAAE,gBAAgB,EAI3B,yBAAyB,CAD3B,sBAAuB,CAEnB,OAAO,CAAE,gBAAgB,EAI3B,yBAA2B,CAD7B,wBAAyB,CAErB,OAAO,CAAE,gBAAgB,EAO3B,yBAA0B,CAD5B,qBAAsB,CAElB,UAAU,CAAE,MAAM,EAKtB,YAAa,CACX,WAAW,CAAE,IAAI,CACjB,KAAK,CCjBa,IAAI,CDkBtB,gBAAgB,CCjBA,OAAc,CDmB9B,8BAAkB,CAChB,QAAQ,CAAE,MAAM,CAChB,UAAU,CAAE,IAAI,CAChB,OAAO,CAAE,IAAI,CACb,WAAW,CAAE,MAAM,CACnB,OAAO,CAAE,QAAQ,CACjB,KAAK,CCxBqB,qBAAoB,CDyB9C,gBAAgB,CCxBQ,mBAAkB,CD8B9C,WAAc,CACX,MAAM,CAAE,IAAI,CAGf,KAAM,CACJ,KAAK,CAAC,IAAI,CACV,OAAO,CAAE,KAAK,CAEd,+CACwB,CACtB,aAAa,CAAE,iBAA6B,CAI5C,qCAAoB,CAClB,gBAAgB,CC5EA,OAAO,CD+EzB,yBAAU,CACR,aAAa,CAAE,CAAC,CAIpB,wBAAyB,CACvB,UAAU,CAAE,0BAA0B,CACtC,8BAAQ,CACN,gBAAgB,CCvFA,OAAO,CD4FzB,qDAAyB,CACvB,UAAU,CAAE,MAAM,CAMxB,KAAM,CACJ,aAAa,CAAE,iBAA6B,CAG9C,KAAM,CACJ,OAAO,CAAE,QAAQ,CACjB,OAAO,CAAE,UAAU,CACnB,UAAU,CAAE,IAAI,CAChB,cAAc,CAAE,MAAM,CACtB,aAAa,CAAE,GAAG,CAIpB,yBAA2B,CAEzB,sBAAuB,CACrB,KAAK,CAAE,IAAI,CACX,eAAe,CAAE,QAAQ,CACzB,cAAc,CAAE,CAAC,CACjB,OAAO,CAAE,KAAK,CACd,QAAQ,CAAE,QAAQ,CAElB,sCAAgB,CACd,OAAO,CAAE,OAAO,CAGlB,mDACG,CACD,MAAM,CAAE,CAAC,CACT,cAAc,CAAE,GAAG,CAGrB,yBAAG,CAAE,UAAU,CAAE,IAAI,CACrB,4BAAM,CACJ,OAAO,CAAE,KAAK,CACd,KAAK,CAAE,IAAI,CAEX,+BAAG,CACD,OAAO,CAAE,KAAK,CACd,OAAO,CAAE,UAAU,CAEnB,0CAAW,CACT,OAAO,CAAE,OAAO,CAItB,4BAAM,CACJ,OAAO,CAAE,KAAK,CACd,KAAK,CAAE,IAAI,CACX,QAAQ,CAAE,QAAQ,CAClB,UAAU,CAAE,IAAI,CAChB,WAAW,CAAE,MAAM,CAEnB,+BAAG,CACD,OAAO,CAAE,YAAY,CACrB,cAAc,CAAE,GAAG,CAGvB,yBAAG,CACD,OAAO,CAAE,KAAK,CACd,UAAU,CAAE,KAAK,CAEnB,yBAAG,CACD,OAAO,CAAE,KAAK,CACd,UAAU,CAAE,MAAM,CAClB,UAAU,CAAE,IAAI,CAElB,yBAAG,CAAE,OAAO,CAAE,MAAM,CAGpB,4BAAM,CACJ,MAAM,CAAE,CAAC,CACT,YAAY,CAAE,iBAA6B,CAI3C,kCAAG,CAAE,aAAa,CAAE,CAAC,CAAE,WAAW,CAAE,CAAC,CACrC,kCAAG,CAAE,WAAW,CAAE,CAAC,CAAE,YAAY,CAAE,CAAC,CAAE,aAAa,CAAE,CAAC,CACtD,kCAAG,CAAE,MAAM,CAAE,CAAC,CACd,wCAAS,CAAE,YAAY,CAAE,iBAA6B,EAS5D,WAAY,CACV,MAAM,CAAE,cAA8C,CACtD,MAAM,CAAE,iBAAkC,CAC1C,aAAa,CAAE,GAAG,CAClB,QAAQ,CAAE,MAAM,CAChB,QAAQ,CAAE,QAAQ,CAElB,4BAAiB,CACf,gBAAgB,CCrJE,IAAI,CDsJtB,WAAW,CCjJU,MAAM,CDkJ3B,OAAO,CAAE,SAAS,CAClB,MAAM,CAAE,CAAC,CACT,aAAa,CAAE,iBAAkC,CAGjD,mCAAS,CACP,UAAU,CAAE,IAAI,CAChB,YAAY,CAAE,IAAI,CAClB,QAAQ,CAAE,QAAQ,CAGlB,kIACgC,CAC9B,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,QAAQ,CAAE,MAAM,CAChB,IAAI,CAAE,IAAI,CACV,OAAO,CAAE,YAAY,CACrB,cAAc,CAAE,MAAM,CAExB,4CAAS,CACP,SAAS,CAAE,IAAI,CACf,WAAW,CAAE,IAAI,CACjB,KAAK,CAAE,IAAI,CACX,gBAAgB,CAAE,IAAI,CACtB,UAAU,CAAE,MAAM,CAIpB,0CAAO,CACL,SAAS,CAAE,IAAI,CAGjB,qCAAE,CACA,MAAM,CAAE,CAAC,CAGX,sDAAmB,CACjB,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,IAAI,CACT,KAAK,CAAE,IAAI,CAMf,uCAAa,CACX,aAAa,CAAE,IAAI,CAGrB,mCAAS,CACP,gBAAgB,CChMD,OAAgB,CDiM/B,KAAK,CC1Me,OAA8B,CD4MlD,sDAAmB,CACjB,KAAK,CAAE,IAAI,CAIjB,6BAAiB,CACf,OAAO,CAAE,KAAK,CACd,UAAU,CAAE,IAAI,CAChB,KAAK,CC3MY,OAAgB,CD6M/B,gDAAQ,CACN,gBAAgB,CCtNI,IAAI,CD4N5B,0CAAmB,CACjB,gBAAgB,CChOA,IAAI,CDiOpB,aAAa,CAAE,iBAAkC,CACjD,OAAO,CAAE,SAAS,CAEpB,wCAAiB,CACf,YAAY,CAAE,IAAI,CAEpB,+CAAwB,CACtB,YAAY,CAAE,IAAI,CAMxB,kBAAmB,CACjB,KAAK,CAAE,KAAK,CACZ,KAAK,CCrOc,OAAgB,CDuOrC,wBAAyB,CACvB,MAAM,CAAE,CAAC,CACT,MAAM,CAAE,IAAI,CAMd,gBAAiB,CACb,QAAQ,CAAE,QAAQ,CAClB,cAAc,CAAE,MAAM,CACtB,MAAM,CAAE,CAAC,CACT,QAAQ,CAAE,MAAM,CAEhB,sEAAsB,CACpB,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CAKlB,SAAU,CACN,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,GAAG,CACX,OAAO,CAAE,KAAK,CACd,KAAK,CAAE,IAAI,CACX,gBAAgB,CAAE,OAAiC,CACnD,aAAa,CAAE,GAAG,CAClB,MAAM,CAAE,cAA8C,CACtD,QAAQ,CAAE,MAAM,CAClB,sBAAa,CACX,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,MAAM,CAAE,CAAC,CACT,gBAAgB,CC7QC,OAAgB,CD8QjC,UAAU,CAAE,gBAAgB,CAE9B,wBAAe,CACb,gBAAgB,CCjRC,OAAgB,CDkRjC,+BAAS,CACP,OAAO,CAAE,EAAE,CACX,QAAQ,CAAE,QAAQ,CAClB,gBAAgB,CAAE,OAAO,CACzB,GAAG,CAAE,CAAC,CACN,IAAI,CAAC,CAAC,CACN,MAAM,CAAE,CAAC,CACT,WAAW,CAAE,WAAW,CAExB,SAAS,CAAE,mEAAoE,CAGjF,8BAAQ,CACN,OAAO,CAAE,EAAE,CACX,QAAQ,CAAE,QAAQ,CAClB,gBAAgB,CAAE,OAAO,CACzB,GAAG,CAAE,CAAC,CACN,IAAI,CAAC,CAAC,CACN,MAAM,CAAE,CAAC,CACT,WAAW,CAAE,WAAW,CAExB,SAAS,CAAE,oEAA0E,CACrF,eAAe,CAAE,KAAK,CAI5B,wBAaC,CAZG,EAAG,CACD,IAAI,CAAE,IAAI,CACV,KAAK,CAAC,IAAI,CAEZ,GAAI,CACF,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAEb,IAAK,CACH,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,EAIjB,8BAaC,CAZG,EAAG,CACD,IAAI,CAAE,KAAK,CACX,KAAK,CAAE,IAAI,CAEb,GAAI,CACF,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,GAAG,CAEZ,IAAK,CACH,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,GAAG,EAShB,KAAM,CACJ,OAAO,CAAE,eAAe,CAI1B,WAAY,CACV,UAAU,CAAE,IAAI,CAElB,YAAa,CACX,UAAU,CAAE,KAAK,CAEnB,qBAAuB,CACrB,UAAU,CAAE,MAAM,CAGpB,KAAM,CACJ,KAAK,CAAE,eAAe,CAExB,MAAO,CACL,KAAK,CAAE,gBAAgB,CAIzB,qDAAW,CACT,WAAW,CAAE,IAAI,CAGnB,OAAQ,CACN,aAAa,CAAE,GAAG,CAGpB,aAAc,CACZ,OAAO,CAAE,KAAK,CACd,WAAW,CAAE,IAAI,CACjB,YAAY,CAAE,IAAI,CAGpB,SAAU,CACR,OAAO,CAAE,KAAK,CACd,WAAW,CAAE,MAAM,CACnB,QAAQ,CAAE,MAAM,CAChB,aAAa,CAAE,QAAQ,CAGzB,WAAY,CACV,OAAO,CAAE,YAAY,CE3tBvB,UAAW,CACT,SAAS,CAAE,IAAI,CACf,OAAO,CAAE,KAAK,CACd,WAAW,CAAE,IAAI,CACjB,UAAU,CAAE,MAAM,CAClB,SAAS,CAAE,IAAI,CACf,WAAW,CD4CE,IAAI,CC3CjB,MAAM,CD2CO,IAAI,CC1CjB,KAAK,CJ8TS,OAAO,CI7TrB,KAAK,CAAE,KAAK,CACZ,UAAU,CAAE,UAAU,CAEtB,cAAM,CACJ,WAAW,CAAE,GAAG,CAChB,SAAS,CAAE,MAAM,CACjB,KAAK,CAAE,IAAI,CACX,gBAAgB,CD+UC,OAAgB,CC9UjC,aAAa,CAAE,GAAG,CAEpB,oBAAY,CACV,OAAO,CAAE,MAAM,CAGjB,qCAA6B,CAC3B,OAAO,CAAE,4BAA4B,CAGzC,mBAAoB,CAClB,OAAO,CAAE,YAAY,CACrB,KAAK,CAAE,IAAI,CACX,WAAW,CAAE,GAAG,CAChB,WAAW,CDmBE,IAAI,CClBjB,MAAM,CDkBO,IAAI,CCjBjB,sBAAsB,CAAE,IAAI,CAI9B,2BAA4B,CAC1B,UAAU,CAAE,mBAA2D,CAEzE,uBAAwB,CACtB,WAAW,CAAE,IAAI,CAEnB,oBAAqB,CACnB,UAAU,CAAE,iBAAwD,CC5CtE,eAAgB,CACd,cAAc,CAAE,kBAAkB,CAClC,qBAAqB,CAAE,MAAM,CCH/B,UAAW,CACT,MAAM,CAAE,MAAM,CACd,SAAS,CAAE,MAAM,CACjB,KAAK,CAAE,GAAG,CAEZ,yBAAyB,CACvB,UAAW,CACT,KAAK,CAAE,GAAG,EAGd,yBAAwB,CACtB,UAAW,CACT,KAAK,CAAE,GAAG,EAGd,eAAgB,CACd,WAAW,CAAE,OAAwB,CACrC,YAAY,CAAE,OAAwB,CAGxC,QAAS,CACP,WAAW,CAAE,IAAI,CACjB,cAAc,CAAE,IAAI,CAEpB,eAAS,CACP,OAAO,CAAE,CAAC,CAEZ,mBAAa,CACX,cAAc,CAAE,CAAC,CAEnB,mBAAa,CACX,WAAW,CAAE,CAAC,CAwBlB,IAAK,CACH,WAAW,CAAE,IAAI,CACjB,YAAY,CAAE,IAAI,CAClB,aAAa,CAAE,IAAI,CAGnB,UAAQ,CACN,OAAO,CAAE,EAAE,CACX,OAAO,CAAE,KAAK,CACd,KAAK,CAAE,IAAI,CAGb,SAAK,CACH,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,UAAU,CACtB,OAAO,CAAE,QAAmB,CAC5B,UAAU,CAAE,GAAG,CAEf,mDACkB,CAChB,QAAQ,CAAE,QAAQ,CAMlB,YAAS,CACP,KAAK,CAFA,QAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAyCP,YAAS,CACP,KAAK,CAFA,SAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAyCP,YAAS,CACP,KAAK,CAFA,GAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAyCP,YAAS,CACP,KAAK,CAFA,SAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAyCP,YAAS,CACP,KAAK,CAFA,SAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAyCP,YAAS,CACP,KAAK,CAFA,GAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAyCP,YAAS,CACP,KAAK,CAFA,SAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAyCP,YAAS,CACP,KAAK,CAFA,SAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAyCP,YAAS,CACP,KAAK,CAFA,GAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAyCP,aAAS,CACP,KAAK,CAFA,SAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAyCP,aAAS,CACP,KAAK,CAFA,SAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAyCP,aAAS,CACP,KAAK,CAFA,IAAuC,CA1ClD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAGX,mBAAuB,CACrB,WAAW,CA8CF,QAAuC,CA5ClD,iBAAqB,CACnB,KAAK,CA2CI,QAAuC,CAzClD,iBAAqB,CACnB,IAAI,CAwCK,QAAuC,CA/ClD,mBAAuB,CACrB,WAAW,CA8CF,SAAuC,CA5ClD,iBAAqB,CACnB,KAAK,CA2CI,SAAuC,CAzClD,iBAAqB,CACnB,IAAI,CAwCK,SAAuC,CA/ClD,mBAAuB,CACrB,WAAW,CA8CF,GAAuC,CA5ClD,iBAAqB,CACnB,KAAK,CA2CI,GAAuC,CAzClD,iBAAqB,CACnB,IAAI,CAwCK,GAAuC,CA/ClD,mBAAuB,CACrB,WAAW,CA8CF,SAAuC,CA5ClD,iBAAqB,CACnB,KAAK,CA2CI,SAAuC,CAzClD,iBAAqB,CACnB,IAAI,CAwCK,SAAuC,CA/ClD,mBAAuB,CACrB,WAAW,CA8CF,SAAuC,CA5ClD,iBAAqB,CACnB,KAAK,CA2CI,SAAuC,CAzClD,iBAAqB,CACnB,IAAI,CAwCK,SAAuC,CA/ClD,mBAAuB,CACrB,WAAW,CA8CF,GAAuC,CA5ClD,iBAAqB,CACnB,KAAK,CA2CI,GAAuC,CAzClD,iBAAqB,CACnB,IAAI,CAwCK,GAAuC,CA/ClD,mBAAuB,CACrB,WAAW,CA8CF,SAAuC,CA5ClD,iBAAqB,CACnB,KAAK,CA2CI,SAAuC,CAzClD,iBAAqB,CACnB,IAAI,CAwCK,SAAuC,CA/ClD,mBAAuB,CACrB,WAAW,CA8CF,SAAuC,CA5ClD,iBAAqB,CACnB,KAAK,CA2CI,SAAuC,CAzClD,iBAAqB,CACnB,IAAI,CAwCK,SAAuC,CA/ClD,mBAAuB,CACrB,WAAW,CA8CF,GAAuC,CA5ClD,iBAAqB,CACnB,KAAK,CA2CI,GAAuC,CAzClD,iBAAqB,CACnB,IAAI,CAwCK,GAAuC,CA/ClD,oBAAuB,CACrB,WAAW,CA8CF,SAAuC,CA5ClD,kBAAqB,CACnB,KAAK,CA2CI,SAAuC,CAzClD,kBAAqB,CACnB,IAAI,CAwCK,SAAuC,CA/ClD,oBAAuB,CACrB,WAAW,CA8CF,SAAuC,CA5ClD,kBAAqB,CACnB,KAAK,CA2CI,SAAuC,CAzClD,kBAAqB,CACnB,IAAI,CAwCK,SAAuC,CA/ClD,oBAAuB,CACrB,WAAW,CA8CF,IAAuC,CA5ClD,kBAAqB,CACnB,KAAK,CA2CI,IAAuC,CAzClD,kBAAqB,CACnB,IAAI,CAwCK,IAAuC,CAKhD,yBAAyB,CAKrB,YAAS,CACP,KAAK,CAFA,QAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CA4DL,YAAS,CACP,KAAK,CAFA,SAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CA4DL,YAAS,CACP,KAAK,CAFA,GAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CA4DL,YAAS,CACP,KAAK,CAFA,SAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CA4DL,YAAS,CACP,KAAK,CAFA,SAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CA4DL,YAAS,CACP,KAAK,CAFA,GAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CA4DL,YAAS,CACP,KAAK,CAFA,SAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CA4DL,YAAS,CACP,KAAK,CAFA,SAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CA4DL,YAAS,CACP,KAAK,CAFA,GAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CA4DL,aAAS,CACP,KAAK,CAFA,SAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CA4DL,aAAS,CACP,KAAK,CAFA,SAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CA4DL,aAAS,CACP,KAAK,CAFA,IAAuC,CA7DpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAGX,mBAAuB,CACrB,WAAW,CAiEA,QAAuC,CA/DpD,iBAAqB,CACnB,KAAK,CA8DM,QAAuC,CA5DpD,iBAAqB,CACnB,IAAI,CA2DO,QAAuC,CAlEpD,mBAAuB,CACrB,WAAW,CAiEA,SAAuC,CA/DpD,iBAAqB,CACnB,KAAK,CA8DM,SAAuC,CA5DpD,iBAAqB,CACnB,IAAI,CA2DO,SAAuC,CAlEpD,mBAAuB,CACrB,WAAW,CAiEA,GAAuC,CA/DpD,iBAAqB,CACnB,KAAK,CA8DM,GAAuC,CA5DpD,iBAAqB,CACnB,IAAI,CA2DO,GAAuC,CAlEpD,mBAAuB,CACrB,WAAW,CAiEA,SAAuC,CA/DpD,iBAAqB,CACnB,KAAK,CA8DM,SAAuC,CA5DpD,iBAAqB,CACnB,IAAI,CA2DO,SAAuC,CAlEpD,mBAAuB,CACrB,WAAW,CAiEA,SAAuC,CA/DpD,iBAAqB,CACnB,KAAK,CA8DM,SAAuC,CA5DpD,iBAAqB,CACnB,IAAI,CA2DO,SAAuC,CAlEpD,mBAAuB,CACrB,WAAW,CAiEA,GAAuC,CA/DpD,iBAAqB,CACnB,KAAK,CA8DM,GAAuC,CA5DpD,iBAAqB,CACnB,IAAI,CA2DO,GAAuC,CAlEpD,mBAAuB,CACrB,WAAW,CAiEA,SAAuC,CA/DpD,iBAAqB,CACnB,KAAK,CA8DM,SAAuC,CA5DpD,iBAAqB,CACnB,IAAI,CA2DO,SAAuC,CAlEpD,mBAAuB,CACrB,WAAW,CAiEA,SAAuC,CA/DpD,iBAAqB,CACnB,KAAK,CA8DM,SAAuC,CA5DpD,iBAAqB,CACnB,IAAI,CA2DO,SAAuC,CAlEpD,mBAAuB,CACrB,WAAW,CAiEA,GAAuC,CA/DpD,iBAAqB,CACnB,KAAK,CA8DM,GAAuC,CA5DpD,iBAAqB,CACnB,IAAI,CA2DO,GAAuC,CAlEpD,oBAAuB,CACrB,WAAW,CAiEA,SAAuC,CA/DpD,kBAAqB,CACnB,KAAK,CA8DM,SAAuC,CA5DpD,kBAAqB,CACnB,IAAI,CA2DO,SAAuC,CAlEpD,oBAAuB,CACrB,WAAW,CAiEA,SAAuC,CA/DpD,kBAAqB,CACnB,KAAK,CA8DM,SAAuC,CA5DpD,kBAAqB,CACnB,IAAI,CA2DO,SAAuC,CAlEpD,oBAAuB,CACrB,WAAW,CAiEA,IAAuC,CA/DpD,kBAAqB,CACnB,KAAK,CA8DM,IAAuC,CA5DpD,kBAAqB,CACnB,IAAI,CA2DO,IAAuC,EAMlD,yBAAwB,CAKpB,YAAS,CACP,KAAK,CAFA,QAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAgFL,YAAS,CACP,KAAK,CAFA,SAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAgFL,YAAS,CACP,KAAK,CAFA,GAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAgFL,YAAS,CACP,KAAK,CAFA,SAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAgFL,YAAS,CACP,KAAK,CAFA,SAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAgFL,YAAS,CACP,KAAK,CAFA,GAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAgFL,YAAS,CACP,KAAK,CAFA,SAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAgFL,YAAS,CACP,KAAK,CAFA,SAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAgFL,YAAS,CACP,KAAK,CAFA,GAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAgFL,aAAS,CACP,KAAK,CAFA,SAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAgFL,aAAS,CACP,KAAK,CAFA,SAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAgFL,aAAS,CACP,KAAK,CAFA,IAAuC,CAjFpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAGX,mBAAuB,CACrB,WAAW,CAqFA,QAAuC,CAnFpD,iBAAqB,CACnB,KAAK,CAkFM,QAAuC,CAhFpD,iBAAqB,CACnB,IAAI,CA+EO,QAAuC,CAtFpD,mBAAuB,CACrB,WAAW,CAqFA,SAAuC,CAnFpD,iBAAqB,CACnB,KAAK,CAkFM,SAAuC,CAhFpD,iBAAqB,CACnB,IAAI,CA+EO,SAAuC,CAtFpD,mBAAuB,CACrB,WAAW,CAqFA,GAAuC,CAnFpD,iBAAqB,CACnB,KAAK,CAkFM,GAAuC,CAhFpD,iBAAqB,CACnB,IAAI,CA+EO,GAAuC,CAtFpD,mBAAuB,CACrB,WAAW,CAqFA,SAAuC,CAnFpD,iBAAqB,CACnB,KAAK,CAkFM,SAAuC,CAhFpD,iBAAqB,CACnB,IAAI,CA+EO,SAAuC,CAtFpD,mBAAuB,CACrB,WAAW,CAqFA,SAAuC,CAnFpD,iBAAqB,CACnB,KAAK,CAkFM,SAAuC,CAhFpD,iBAAqB,CACnB,IAAI,CA+EO,SAAuC,CAtFpD,mBAAuB,CACrB,WAAW,CAqFA,GAAuC,CAnFpD,iBAAqB,CACnB,KAAK,CAkFM,GAAuC,CAhFpD,iBAAqB,CACnB,IAAI,CA+EO,GAAuC,CAtFpD,mBAAuB,CACrB,WAAW,CAqFA,SAAuC,CAnFpD,iBAAqB,CACnB,KAAK,CAkFM,SAAuC,CAhFpD,iBAAqB,CACnB,IAAI,CA+EO,SAAuC,CAtFpD,mBAAuB,CACrB,WAAW,CAqFA,SAAuC,CAnFpD,iBAAqB,CACnB,KAAK,CAkFM,SAAuC,CAhFpD,iBAAqB,CACnB,IAAI,CA+EO,SAAuC,CAtFpD,mBAAuB,CACrB,WAAW,CAqFA,GAAuC,CAnFpD,iBAAqB,CACnB,KAAK,CAkFM,GAAuC,CAhFpD,iBAAqB,CACnB,IAAI,CA+EO,GAAuC,CAtFpD,oBAAuB,CACrB,WAAW,CAqFA,SAAuC,CAnFpD,kBAAqB,CACnB,KAAK,CAkFM,SAAuC,CAhFpD,kBAAqB,CACnB,IAAI,CA+EO,SAAuC,CAtFpD,oBAAuB,CACrB,WAAW,CAqFA,SAAuC,CAnFpD,kBAAqB,CACnB,KAAK,CAkFM,SAAuC,CAhFpD,kBAAqB,CACnB,IAAI,CA+EO,SAAuC,CAtFpD,oBAAuB,CACrB,WAAW,CAqFA,IAAuC,CAnFpD,kBAAqB,CACnB,KAAK,CAkFM,IAAuC,CAhFpD,kBAAqB,CACnB,IAAI,CA+EO,IAAuC,EAMlD,0BAA8B,CAK1B,aAAU,CACR,KAAK,CAFA,QAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAoGL,aAAU,CACR,KAAK,CAFA,SAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAoGL,aAAU,CACR,KAAK,CAFA,GAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAoGL,aAAU,CACR,KAAK,CAFA,SAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAoGL,aAAU,CACR,KAAK,CAFA,SAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAoGL,aAAU,CACR,KAAK,CAFA,GAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAoGL,aAAU,CACR,KAAK,CAFA,SAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAoGL,aAAU,CACR,KAAK,CAFA,SAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAoGL,aAAU,CACR,KAAK,CAFA,GAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAoGL,cAAU,CACR,KAAK,CAFA,SAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAoGL,cAAU,CACR,KAAK,CAFA,SAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAoGL,cAAU,CACR,KAAK,CAFA,IAAuC,CArGpD,WAAW,CAAE,IAAI,CACjB,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CAGX,oBAAuB,CACrB,WAAW,CAyGA,QAAuC,CAvGpD,kBAAqB,CACnB,KAAK,CAsGM,QAAuC,CApGpD,kBAAqB,CACnB,IAAI,CAmGO,QAAuC,CA1GpD,oBAAuB,CACrB,WAAW,CAyGA,SAAuC,CAvGpD,kBAAqB,CACnB,KAAK,CAsGM,SAAuC,CApGpD,kBAAqB,CACnB,IAAI,CAmGO,SAAuC,CA1GpD,oBAAuB,CACrB,WAAW,CAyGA,GAAuC,CAvGpD,kBAAqB,CACnB,KAAK,CAsGM,GAAuC,CApGpD,kBAAqB,CACnB,IAAI,CAmGO,GAAuC,CA1GpD,oBAAuB,CACrB,WAAW,CAyGA,SAAuC,CAvGpD,kBAAqB,CACnB,KAAK,CAsGM,SAAuC,CApGpD,kBAAqB,CACnB,IAAI,CAmGO,SAAuC,CA1GpD,oBAAuB,CACrB,WAAW,CAyGA,SAAuC,CAvGpD,kBAAqB,CACnB,KAAK,CAsGM,SAAuC,CApGpD,kBAAqB,CACnB,IAAI,CAmGO,SAAuC,CA1GpD,oBAAuB,CACrB,WAAW,CAyGA,GAAuC,CAvGpD,kBAAqB,CACnB,KAAK,CAsGM,GAAuC,CApGpD,kBAAqB,CACnB,IAAI,CAmGO,GAAuC,CA1GpD,oBAAuB,CACrB,WAAW,CAyGA,SAAuC,CAvGpD,kBAAqB,CACnB,KAAK,CAsGM,SAAuC,CApGpD,kBAAqB,CACnB,IAAI,CAmGO,SAAuC,CA1GpD,oBAAuB,CACrB,WAAW,CAyGA,SAAuC,CAvGpD,kBAAqB,CACnB,KAAK,CAsGM,SAAuC,CApGpD,kBAAqB,CACnB,IAAI,CAmGO,SAAuC,CA1GpD,oBAAuB,CACrB,WAAW,CAyGA,GAAuC,CAvGpD,kBAAqB,CACnB,KAAK,CAsGM,GAAuC,CApGpD,kBAAqB,CACnB,IAAI,CAmGO,GAAuC,CA1GpD,qBAAuB,CACrB,WAAW,CAyGA,SAAuC,CAvGpD,mBAAqB,CACnB,KAAK,CAsGM,SAAuC,CApGpD,mBAAqB,CACnB,IAAI,CAmGO,SAAuC,CA1GpD,qBAAuB,CACrB,WAAW,CAyGA,SAAuC,CAvGpD,mBAAqB,CACnB,KAAK,CAsGM,SAAuC,CApGpD,mBAAqB,CACnB,IAAI,CAmGO,SAAuC,CA1GpD,qBAAuB,CACrB,WAAW,CAyGA,IAAuC,CAvGpD,mBAAqB,CACnB,KAAK,CAsGM,IAAuC,CApGpD,mBAAqB,CACnB,IAAI,CAmGO,IAAuC,ECrJtD,GAAI,CAeF,KAAK,CJgPa,IAAI,CI9OtB,gBAAgB,CJmTA,OAAc,CIlT9B,KAAK,CAAE,IAAI,CACX,MAAM,CJyOe,IAAI,CIxOzB,WAAW,CJyOe,IAAqB,CI5P/C,gBAAe,CACb,MAAM,CAAE,IAAI,CAEZ,6BAAa,CACX,UAAU,CJuPO,IAAI,CItPrB,MAAM,CAAE,IAAI,CAGd,6BAAa,CACX,QAAQ,CAAE,QAAQ,CAClB,WAAW,CAAE,MAAM,CAWvB,KAAE,CAAE,KAAK,CJyOS,IAAI,CIvOtB,kEAEiB,CACf,OAAO,CAAE,KAAK,CACd,SAAS,CAAE,IAAI,CACf,MAAM,CJ+Na,IAAI,CI9NvB,WAAW,CJ+Na,IAAqB,CI5N/C,gBAAa,CACX,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,IAAI,CAGd,yBAAwB,CACtB,qBAAkB,CAAE,OAAO,CAAE,IAAI,EAKnC,oBAAiB,CACf,KAAK,CAAE,IAAI,CACX,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,CAAC,CACV,MAAM,CJ4Ma,IAAI,CI3MvB,MAAM,CAAE,MAAM,CAEd,sBAAE,CACA,MAAM,CJwMW,IAAI,CIvMrB,WAAW,CJwMW,IAAqB,CIlM/C,eAAY,CACV,QAAQ,CAAE,QAAQ,CAClB,KAAK,CJkMW,IAAI,CIjMpB,OAAO,CAAE,YAAY,CACrB,SAAS,CJiMY,MAAM,CIhM3B,OAAO,CAAE,CAAC,CAEV,sBAAS,CACP,IAAI,CAAE,GAAG,CACT,SAAS,CAAE,gBAAgB,CAG7B,yBAA2B,CAZ7B,eAAY,CAaR,IAAI,CAAE,GAAG,CACT,SAAS,CAAE,gBAAgB,CAE3B,0CAAgB,CACd,OAAO,CAAE,CAAC,CACV,SAAS,CAAE,IAAI,CAGjB,oBAAO,CAAE,IAAI,CAAE,MAAM,CACrB,qBAAQ,CACN,KAAK,CAAE,MAAM,CACb,IAAI,CAAE,IAAI,EAId,qBAAQ,CACN,KAAK,CAAE,MAAM,CACb,OAAO,CAAE,CAAC,CAGZ,kHAEiB,CACf,KAAK,CAAE,IAAI,CACX,YAAY,CAAE,IAAI,CAMtB,cAAW,CACT,OAAO,CAAE,YAAY,CACrB,SAAS,CAAE,IAAI,CACf,OAAO,CAAE,MAAM,CAKjB,MAAG,CACD,MAAM,CAAE,CAAC,CAET,SAAG,CACD,UAAU,CAAE,oBAAoB,CAChC,KAAK,CAAE,IAAI,CACX,OAAO,CAAE,CAAC,CAEV,gBAAS,CACP,gBAAgB,CAAE,eAAc,CAGpC,QAAE,CACA,UAAU,CAAE,oBAAoB,CAChC,SAAS,CJkII,IAAI,CIjIjB,KAAK,CJkIS,IAAI,CIjIlB,OAAO,CAAE,KAAK,CACd,OAAO,CAAE,MAAM,CACf,MAAM,CAAE,OAAO,CAEf,0FAA+C,CAC7C,UAAU,CAAE,IAAI,CAChB,WAAW,CAAE,IAAI,CACjB,YAAY,CAAE,IAAI,CAElB,0KAAoB,CAClB,MAAM,CAAE,OAAO,CACf,WAAW,CAAE,OAAO,CAIxB,cAAQ,CACN,gBAAgB,CAAE,eAAc,CAIpC,WAAO,CACL,KAAK,CAAE,IAAI,CAKf,QAAK,CACH,MAAM,CAAE,IAAI,CAGd,gBAAa,CACX,MAAM,CAAE,CAAC,CACT,MAAM,CAAE,IAAI,CAEZ,sBAAM,CACJ,MAAM,CAAE,IAAI,CACZ,SAAS,CAAE,MAAM,CACjB,MAAM,CAAE,IAAI,CACZ,YAAY,CAAE,IAAI,CAElB,wOAC2D,CACzD,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,IAAI,CAIpB,sBAAM,CACJ,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CAEP,wBAAE,CACA,KAAK,CAAE,qBAAoB,CAC3B,UAAU,CAAE,SAAS,CAEvB,+BAAW,CAAE,KAAK,CJ0EJ,IAAI,CIpExB,aAAc,CACZ,QAAQ,CAAE,QAAQ,CAClB,MAAM,CJ+De,IAAI,CI9DzB,OAAO,CAAE,GAAG,CAEZ,iBAAI,CACF,QAAQ,CAAE,KAAK,CAGnB,yBAAyB,CACvB,6BAA8B,CAC5B,UAAU,CJoDE,IAAI,CIlDlB,oEAAwE,CACtE,MAAM,CJiDM,IAAI,CIhDhB,WAAW,CJiDM,IAAc,CI/CjC,aAAc,CACZ,MAAM,CJ6CM,IAAI,EK1PpB,UAOC,CANG,WAAW,CAAE,QAAQ,CACrB,GAAG,CAAE,kIAEyD,CAE9D,WAAW,CAAE,GAAG,CAEpB,UAMC,CALG,WAAW,CAAE,QAAQ,CACrB,GAAG,CAAE,qIAE0D,CAC/D,WAAW,CAAE,GAAG,CAGpB,UAMC,CALG,WAAW,CAAE,QAAQ,CACrB,GAAG,CAAE,2IAE4D,CACjE,WAAW,CAAE,GAAG,CAGpB,UAMC,CALG,WAAW,CAAE,QAAQ,CACrB,GAAG,CAAE,wIAE2D,CAChE,WAAW,CAAE,GAAG,CAGpB,UAMC,CALG,WAAW,CAAE,QAAQ,CACrB,GAAG,CAAE,kIAEyD,CAC9D,WAAW,CAAE,GAAG,CCpCpB,CAAE,CACA,eAAe,CAAE,IAAI,CAGvB,IAAI,CACF,WAAW,CAAE,GAAG,CAchB,WAAW,CAAE,oBAAoB,CACjC,WAAW,CAAE,MAAM,CACnB,KAAK,CNgSK,gBAAmB,CM9S7B,qCAAsC,CAHxC,IAAI,CAIA,SAAS,CAAE,IAAI,EAGjB,yCAAmD,CAPrD,IAAI,CAQA,SAAS,CAAE,MAAM,EAGnB,0CAAkD,CAXpD,IAAI,CAYA,SAAS,CAAE,IAAI,EAOnB,iBAAuB,CACtB,WAAW,CAAE,GAAG,CAChB,WAAW,CAAE,GAAG,CAIjB,6BAAmC,CAAE,WAAW,CAAE,OAAO,CACzD,EAAG,CAAE,SAAS,CNyRA,MAAM,CMzRU,WAAW,CAAE,IAAI,CAAE,MAAM,CAAE,kBAA2C,CACpG,EAAG,CAAE,SAAS,CNyRA,OAAO,CMzRS,WAAW,CAAE,IAAI,CAAE,MAAM,CAAE,oBAA2C,CACpG,EAAG,CAAE,SAAS,CNyRA,OAAO,CMzRS,WAAW,CAAE,IAAI,CAAE,MAAM,CAAE,oBAA2C,CACpG,EAAG,CAAE,SAAS,CNyRA,OAAO,CMzRS,WAAW,CAAE,IAAI,CAAE,MAAM,CAAE,mBAA2C,CACpG,EAAG,CAAE,SAAS,CNyRA,OAAO,CMzRS,WAAW,CAAE,IAAI,CAAE,MAAM,CAAE,kBAA2C,CACpG,EAAG,CAAE,SAAS,CNyRA,IAAI,CMzRY,WAAW,CAAE,IAAI,CAAE,MAAM,CAAE,eAA2C,CAGpG,EAAG,CAAE,UAAU,CAAE,MAAM,CACvB,MAAO,CAAE,WAAW,CAAE,GAAG,CACzB,KAAM,CAAE,SAAS,CAAE,GAAG,CACtB,qCAAO,CAAE,WAAW,CAAE,GAAG,CACzB,KAAM,CAAE,WAAW,CAAE,GAAG,CAGxB,UAAU,CACR,WAAW,CAAE,GAAG,CAGd,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,MAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,OAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,OAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,OAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,QAAyB,EADtC,yCAAiE,CAJrE,UAAU,CAKJ,SAAS,CAAE,OAAyB,EAMxC,yCAA0C,CAX5C,UAAU,CAYN,SAAS,CAAE,MAAM,ECzDrB,iBAAkB,CAUhB,UAAU,CAAE,8DAA6D,CATzE,2BAAY,CACV,SAAS,CAAE,QAAQ,CACnB,UAAU,CAAE,wBAAwB,CAGtC,0BAAW,CACT,SAAS,CAAE,QAAQ,CCNvB,WAAY,CACV,UAAU,CAAE,eAAe,CAC3B,OAAO,CR2FM,IAAI,CQ1FjB,MAAM,CAAE,cAA8C,CACtD,aAAa,CAAE,GAAG,CAElB,gBAAgB,CRwFF,IAAI,CQrFpB,KAAM,CACJ,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,cAA8C,CACtD,gBAAgB,CRkFF,IAAI,CQjFlB,UAAU,CAAE,eAAe,CAC3B,aAAa,CAAE,GAAG,CAIlB,iBAAY,CACV,SAAS,CAAE,IAAI,CACf,WAAW,CAAE,GAAG,CAChB,2BAAY,CACV,MAAM,CAAE,OAAO,CAKnB,oCAA2B,CACzB,QAAQ,CAAE,QAAQ,CAElB,wEAAY,CACV,UAAU,CAAE,GAAG,CACf,QAAQ,CAAE,MAAM,CAElB,kHAA4B,CAC1B,UAAU,CAAE,GAAG,CAEjB,8EAAc,CACZ,UAAU,CAAE,IAAI,CAChB,QAAQ,CAAE,MAAM,CAElB,2EAAa,CACX,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,CAAC,CACT,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,CAAC,CAIZ,WAAQ,CACN,MAAM,CAAE,KAAK,CAGf,YAAS,CACP,MAAM,CAAE,KAAK,CAGf,WAAQ,CACN,MAAM,CAAE,KAAK,CAIf,gBAAa,CAaX,OAAO,CAAE,IAAI,CAXX,yGAAY,CACV,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,IAAI,CAChB,QAAQ,CAAE,OAAO,CAEjB,qHAAI,CACF,MAAM,CAAE,IAAI,CAOlB,4BAAY,CACV,SAAS,CAAE,GAAG,CACd,gCAAI,CACF,aAAa,CAAE,WAAW,CAC1B,SAAS,CAAE,IAAI,CACf,KAAK,CAAE,IAAI,CAIf,8BAAc,CACZ,OAAO,CAAE,IAAI,CACb,cAAc,CAAE,MAAM,CACtB,IAAI,CAAE,CAAC,CACP,QAAQ,CAAE,QAAQ,CAElB,4CAAc,CACZ,SAAS,CAAE,CAAC,CAOhB,gCAAa,CACX,OAAO,CAAE,CAAC,CAGZ,gCAAa,CACX,OAAO,CAAE,CAAC,CACV,cAAc,CAAE,IAAI,CAOxB,iBAAY,CACV,QAAQ,CAAE,QAAQ,CAGlB,qBAAI,CACF,OAAO,CAAE,KAAK,CACd,aAAa,CAAE,WAAW,CAC1B,QAAQ,CAAE,QAAQ,CAClB,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,CAAC,CACR,GAAG,CAAE,CAAC,CACN,MAAM,CAAE,CAAC,CACT,KAAK,CAAE,IAAI,CAGb,6BAAY,CACV,KAAK,CRnCK,IAAI,CQoCd,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,CAAC,CACT,IAAI,CAAE,CAAC,CACP,SAAS,CAAE,IAAI,CACf,OAAO,CRzCE,IAAI,CQ6CjB,mBAAc,CACZ,OAAO,CR9CI,IAAI,CQ+Cf,aAAa,CAAE,WAAW,CAE1B,qBAAE,CACA,MAAM,CAAE,CAAC,CACT,KAAK,CAAE,OAAO,CAEhB,+BAAY,CACV,OAAO,CAAE,KAAK,CACd,WAAW,CAAE,IAAI,CACjB,aAAa,CAAE,GAAG,CAElB,iCAAE,CACA,WAAW,CAAE,IAAI,CAKvB,kBAAa,CAIX,QAAQ,CAAE,QAAQ,CAClB,gBAAgB,CAAE,OAAO,CACzB,UAAU,CAAE,+BAA8B,CAC1C,OAAO,CAAE,SAAkB,CAN3B,6BAAa,CACX,aAAa,CAAE,WAAW,CAO5B,iFAA+C,CAC7C,KAAK,CRxEO,OAA2B,CQyEvC,YAAY,CR3EH,IAAI,CQ4Eb,UAAU,CAAE,cAAc,CAC1B,cAAc,CAAE,SAAS,CAEzB,uFAAQ,CAAE,KAAK,CR5EG,OAA8B,CQgFpD,kBAAa,CACX,OAAO,CRpFI,IAAI,CQqFf,QAAQ,CAAE,QAAQ,CAClB,gBAAgB,CRrFJ,IAAI,CQsFhB,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,IAAI,CAChB,IAAI,CAAE,CAAC,CACP,GAAG,CAAE,IAAI,CACT,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,CAAC,CACV,OAAO,CAAE,IAAI,CAEb,8BAAY,CACV,MAAM,CAAE,OAAO,CACf,OAAO,CAAE,KAAK,CChMpB,gBAAiB,CACf,OAAO,CAAC,KAAK,CACb,QAAQ,CAAE,KAAK,CACf,OAAO,CAAE,KAAK,CAEd,yBAA0B,CAL5B,gBAAiB,CAMb,SAAS,CAAE,IAAI,CACf,MAAM,CAAE,EAAE,EAEZ,gDAAuB,CATzB,gBAAiB,CAUb,IAAI,CAAE,EAAE,CACR,MAAM,CAAE,EAAE,CACV,SAAS,CAAE,GAAG,EAEhB,yBAAwB,CAd1B,gBAAiB,CAeb,GAAG,CAAE,GAAG,CACR,KAAK,CAAE,EAAE,CACT,SAAS,CAAE,GAAG,EAIlB,MAAO,CAEL,aAAa,CAAE,GAAG,CAClB,GAAG,CAAE,IAAI,CACT,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,IAAI,CAChB,QAAQ,CAAE,QAAQ,CAClB,SAAS,CAAC,IAAI,CACd,MAAM,CAAE,IAAI,CACZ,UAAU,CT+QG,IAAI,CS9QjB,WAAW,CAAE,KAAK,CAClB,UAAU,CAAE,SAAS,CACrB,gBAAgB,CT6QJ,OAAO,CS5QnB,OAAO,CAAE,SAAS,CAClB,SAAS,CAAE,MAAM,CACjB,WAAW,CAAE,GAAG,CAChB,KAAK,CT0QY,IAAI,CSzQrB,OAAO,CAAE,IAAI,CACb,WAAW,CAAE,MAAM,CACnB,eAAe,CAAE,aAAa,CAC9B,MAAM,CAAE,OAAO,CAEf,oBAAc,CACZ,KAAK,CToQY,OAAO,CSnQxB,WAAW,CAAE,GAAG,CAChB,YAAY,CAAE,KAAK,CACnB,WAAW,CAAE,IAAI,CAGnB,cAAS,CACP,aAAa,CAAE,IAAI,CAGrB,yBAA0B,CAjC5B,MAAO,CAkCH,KAAK,CAAE,IAAI,CACX,aAAa,CAAE,CAAC,ECxDpB,KAAM,CA4BJ,QAAQ,CAAE,QAAQ,CAClB,UAAU,CAAE,IAAI,CAChB,UAAU,CAAE,MAAM,CAClB,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,gBAAgB,CV+PF,IAAI,CU9PlB,MAAM,CAAE,MAAM,CACd,WAAW,CAAE,MAAM,CAlCnB,sBAAmB,CACjB,gBAAgB,CAAE,WAAW,CAE7B,iHAEsB,CACpB,KAAK,CAAE,qBAAqB,CAG9B,wEACc,CACZ,KAAK,CAAE,IAAI,CAGb,iCAAW,CACT,gBAAgB,CAAE,IAAI,CAI1B,sBAAmB,CACjB,OAAO,CAAE,IAAI,CAEb,2BAAK,CACH,SAAS,CAAE,CAAC,CAahB,UAAK,CACH,OAAO,CAAE,YAAY,CACrB,UAAU,CAAE,MAAM,CAClB,WAAW,CAAE,IAAI,CACjB,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,CAAC,CACV,MAAM,CAAE,CAAC,CACT,cAAc,CAAE,SAAS,CAEzB,YAAE,CAOA,KAAK,CAAE,qBAA0B,CACjC,OAAO,CAAE,KAAK,CACd,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,MAAM,CACf,SAAS,CAAE,IAAI,CACf,aAAa,CAAE,QAAQ,CACvB,QAAQ,CAAE,MAAM,CAChB,UAAU,CAAE,eAAe,CAd3B,sCACS,CACP,gBAAgB,CAAE,WAAW,CAC7B,KAAK,CVkRK,OAAc,CUpQ5B,iDACmB,CACjB,KAAK,CAAE,qBAA0B,CACjC,MAAM,CAAE,OAAO,CAGnB,gBAAW,CACT,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,CAAC,CACT,MAAM,CAAE,GAAG,CACX,gBAAgB,CVoNG,OAAoB,CUnNvC,WAAW,CAAE,WAAW,CAK5B,yBAA2B,CACzB,KAAM,CACJ,OAAO,CAAE,IAAI,CAEb,UAAK,CACH,SAAS,CAAE,CAAC,CAEZ,YAAE,CACA,OAAO,CAAE,MAAM,ECxFvB,iBAAkB,CAChB,OAAO,CAAE,QAAQ,CACjB,SAAS,CAAE,IAAI,CACf,OAAO,CAAE,IAAI,CACb,gBAAgB,CAAE,WAAW,CAC7B,aAAa,CAAE,GAAG,CAClB,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,IAAI,CAChB,WAAW,CAAE,IAAI,CACjB,OAAO,CAAE,CAAC,CACV,QAAQ,CAAE,QAAQ,CAClB,UAAU,CAAE,MAAM,CAClB,SAAS,CAAE,gBAAgB,CAC3B,QAAQ,CAAE,MAAM,CAChB,IAAI,CAAE,CAAC,CACP,GAAG,CAAE,CAAC,CACN,cAAc,CAAE,IAAI,CACpB,UAAU,CAAE,MAAM,CAGpB,SAAU,CACR,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,CAAC,CACV,MAAM,CAAE,GAAG,CACX,KAAK,CAAE,IAAI,CACX,aAAa,CAAE,WAAW,CAC1B,gBAAgB,CAAE,OAAO,CACzB,OAAO,CAAE,EAAE,CACX,gBAAgB,CAAE,MAAM,CACxB,UAAU,CAAE,MAAM,CC5BpB,yBACU,CACR,MAAM,CZuDQ,IAAI,CYtDlB,aAAa,CZ4DC,GAAG,CY3DjB,OAAO,CAAE,YAAY,CACrB,MAAM,CZwDQ,IAAI,CYvDlB,WAAW,CZuDG,IAAI,CYtDlB,OAAO,CZuDQ,MAAO,CYtDtB,cAAc,CAAE,SAAS,CACzB,cAAc,CAAE,MAAM,CAEtB,2BAA2B,CAAE,WAAW,CAI1C,oSAWoB,CAClB,cAAc,CAAE,IAAI,CACpB,gBAAgB,CAAE,kBAAsC,CACxD,UAAU,CAAE,IAAI,CAChB,KAAK,CAAE,kBAAiC,CACxC,MAAM,CAAE,OAAO,CAEf,8XAAQ,CACN,gBAAgB,CAAE,kBAAsC,CACxD,KAAK,CAAE,kBAAiC,CAK5C,kDAGU,CACR,SAAS,CZeQ,IAAI,CYdrB,OAAO,CAAE,CAAC,CAEV,4DAAE,CACA,SAAS,CZYW,MAAM,CYX1B,WAAW,CAAE,OAAO,CAOtB,+CAAQ,CACN,gBAAgB,CAAE,OAAsC,CAK5D,eAAK,CACH,eAAe,CAAE,IAAI,CACrB,KAAK,CZQe,IAAI,CYPxB,gBAAgB,CZ8RG,OAAgB,CY7RnC,UAAU,CAAE,MAAM,CAClB,cAAc,CAAE,IAAI,CAEpB,UAAU,CAAE,YAAY,CACxB,MAAM,CAAE,OAAO,CAEf,2BAAQ,CACN,gBAAgB,CZFa,OAAsC,CYQvE,aAAc,CAiCZ,OAAO,CAAE,YAAY,CACrB,KAAK,CZ5BiB,IAAI,CY6B1B,QAAQ,CAAE,QAAQ,CAClB,QAAQ,CAAE,MAAM,CAChB,OAAO,CAAE,CAAC,CACV,KAAK,CZ/BgB,IAAI,CYgCzB,MAAM,CZhCe,IAAI,CYiCzB,WAAW,CZjCU,IAAI,CYkCzB,OAAO,CAAE,CAAC,CACV,gBAAgB,CZsOG,OAAgB,CYrOnC,aAAa,CZlCU,GAAG,CYoC1B,UAAU,CAAE,GAAG,CACf,MAAM,CAAE,OAAO,CACf,cAAc,CAAE,MAAM,CA9CtB,mBAAQ,CACN,gBAAgB,CZ8QC,OAAgB,CY1QnC,oBAAS,CACP,aAAa,CAAE,CAAC,CAGlB,uBAAY,CAKV,KAAK,CZPoB,IAAI,CYQ7B,MAAM,CZRmB,IAAI,CYG7B,mCAAc,CACZ,MAAM,CAAE,KAAgC,CAK1C,yBAAE,CACA,WAAW,CZVY,IAAI,CYc/B,yBAAc,CAMZ,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,KAA0B,CAPlC,8BAAO,CACL,KAAK,CAAE,IAAI,CACX,IAAI,CAAE,IAAI,CAwBd,eAAE,CACA,KAAK,CAAE,OAAO,CACd,OAAO,CAAE,YAAY,CACrB,UAAU,CAAE,MAAM,CAClB,KAAK,CZ/Ce,IAAI,CYgDxB,SAAS,CZ1DiB,MAAM,CY2DhC,WAAW,CZhDQ,IAAI,CYqD3B,mBAAoB,CAClB,MAAM,CZnFQ,IAAI,CYuFpB,iBAAkB,CAqEhB,QAAQ,CAAE,KAAK,CACf,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,WAAW,CAAE,IAAI,CACjB,aAAa,CAAE,CAAC,CAChB,OAAO,CAAE,GAAG,CAxEV,2BAAG,CACF,UAAU,CAAE,OAAO,CAItB,4BAAa,CACX,OAAO,CAAE,UAAU,CAEnB,+BAAG,CACD,UAAU,CAAE,KAAK,CACjB,KAAK,CAAE,IAAI,CACX,GAAG,CAAE,GAAG,CACR,SAAS,CAAE,gBAAgB,CAC3B,MAAM,CAAE,IAAI,CACZ,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,KAAK,CAEZ,kCAAG,CACD,OAAO,CAAE,YAAY,CACrB,MAAM,CAAE,aAAa,CAK3B,yBAAU,CAOR,OAAO,CAAE,CAAC,CACV,MAAM,CZ3FmB,IAAI,CYqF3B,oCAAQ,CACN,OAAO,CAAE,CAAC,CAOd,4BAAG,CACD,OAAO,CAAE,IAAI,CACb,GAAG,CAAE,CAAC,CACN,MAAM,CAAE,CAAC,CACT,OAAO,CAAE,CAAC,CAEV,+BAAG,CACD,IAAI,CAAE,CAAC,CACP,OAAO,CAAE,YAAY,CACrB,MAAM,CAAE,CAAC,CACT,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,IAAI,CAEhB,iCAAE,CACA,OAAO,CAAE,KAAK,CACd,QAAQ,CAAE,MAAM,CAChB,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,gBAAgB,CAAE,WAAW,CAC7B,UAAU,CAAE,IAAI,CAChB,KAAK,CAAE,IAAI,CACX,WAAW,CZnHQ,IAAI,CYoHvB,OAAO,CAAE,CAAC,CAEV,mCAAE,CACA,WAAW,CAAE,OAAO,CAc9B,oBAAG,CACD,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,CAAC,CACR,UAAU,CAAE,MAAM,CAClB,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,IAAI,CACZ,MAAM,CAAE,CAAC,CACT,UAAU,CAAE,MAAM,CAElB,uBAAG,CACD,aAAa,CAAE,IAAI,CAGrB,mCAAe,CACb,OAAO,CAAE,CAAC,CAId,+BAAc,CACZ,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,OAAO,CAAE,EAAE,CACX,KAAK,CZ7Jc,IAAI,CY8JvB,MAAM,CZ9Ja,IAAI,CY+JvB,gBAAgB,CZ0GC,OAAgB,CYzGjC,aAAa,CZ9JQ,GAAG,CY+JxB,SAAS,CAAE,QAAQ,CAKvB,SAAU,CACR,UAAU,CAAE,IAAI,CAChB,gBAAgB,CAAE,WAAW,CAC7B,KAAK,CZhLa,OAAO,CYiLzB,MAAM,CAAE,OAAO,CACf,UAAU,CAAE,oBAAoB,CAEhC,+BACQ,CACN,UAAU,CAAE,IAAI,CAGlB,eAAQ,CACN,gBAAgB,CAAE,eAAc,CAGlC,kBAAW,CACT,gBAAgB,CAAE,sBAAsB,CACxC,KAAK,CAAE,kBAAsC,CAC7C,MAAM,CAAE,OAAO,CAKnB,UAAW,CAET,MAAM,CZ1Mc,IAAoB,CY2MxC,WAAW,CZ3MS,IAAoB,CY6MxC,YAAE,CACA,SAAS,CZ/MiB,MAAM,CYoNpC,UAAW,CACT,OAAO,CAAE,KAAK,CCjShB,iBAAkB,CAEhB,gBAAgB,CbgJE,IAAI,Ca/ItB,MAAM,CAAE,CAAC,CACT,OAAO,CAAE,IAAI,CACb,SAAS,CAAE,KAAK,CAChB,UAAU,CAAE,KAAK,CACjB,UAAU,CAAE,IAAI,CAChB,OAAO,CAAE,CAAC,CACV,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,GAAG,CACZ,WAAW,CAAE,aAAa,CAE1B,oBAAG,CACD,KAAK,CAAE,IAAI,CACX,KAAK,CbuSG,gBAAmB,CatS3B,MAAM,CAAE,OAAO,CACf,UAAU,CboIS,IAAI,CanIvB,WAAW,CAAE,MAAM,CACnB,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,IAAI,CAChB,cAAc,CAAE,IAAI,CAEpB,oFAA8B,CAC5B,gBAAgB,Cb2HI,IAAI,CaxH1B,oCAAkB,CAChB,gBAAgB,CAAE,OAAoC,CAGxD,4BAAU,CACR,UAAU,CAAE,CAAC,CACb,MAAM,CAAE,GAAG,CAGb,gDAAgB,CACd,SAAS,CAAE,IAAI,CACf,KAAK,Cb0TU,OAAgB,CazT/B,OAAO,CAAE,KAAK,CACd,WAAW,CAAE,IAAI,CACjB,OAAO,CAAE,SAAuC,CAGlD,+BAAiB,CACf,GAAG,CAAE,GAAG,CACR,IAAI,CAAE,CAAC,CACP,MAAM,CAAE,IAAI,CAId,wBAAU,CACR,MAAM,CAAE,OAAO,CACf,WAAW,CAAE,OAAO,CACpB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,UAAU,CAClB,KAAK,CAAE,IAAI,CAMjB,0DAA6D,CAC3D,GAAG,CAAE,GAAG,CACR,IAAI,CAAE,CAAC,CACP,MAAM,CAAE,IAAI,CChEd;;;;;;;GAOG,AAGH,aAAc,CACZ,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,OAAO,CACf,OAAO,CAAE,YAAY,CACrB,QAAQ,CAAE,MAAM,CAChB,WAAW,CAAE,IAAI,CACjB,2BAA2B,CAAE,WAAW,CACxC,cAAc,CAAE,MAAM,CACtB,OAAO,CAAE,CAAC,CACV,UAAU,CAAE,YAAY,CAExB,2BAAc,CACZ,QAAQ,CAAE,QAAQ,CAClB,aAAa,CAAE,GAAG,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,UAAU,CAAC,KAAK,CAChB,WAAW,CAAC,KAAK,CACjB,OAAO,CAAE,CAAC,CAEV,UAAU,CAAE,eAAe,CAC3B,UAAU,CAAE,iBAAiB,CAC7B,mBAAmB,CAAE,kBAAkB,CACvC,SAAS,CAAE,QAAQ,CACnB,cAAc,CAAE,IAAI,CAItB,uCAA4B,CAC1B,gBAAgB,CAAE,sBAAyB,CAE7C,qCAA0B,CACxB,gBAAgB,CAAE,mBAAsB,CAE1C,wCAA6B,CAC3B,gBAAgB,CAAE,oBAAuB,CAE3C,wCAA6B,CAC3B,gBAAgB,CAAE,mBAAsB,CAE1C,wCAA6B,CAC3B,gBAAgB,CAAE,oBAAwB,CAE5C,uCAA4B,CAC1B,gBAAgB,CAAE,mBAAuB,CAE3C,sCAA2B,CACzB,gBAAgB,CAAE,mBAAuB,CAI3C,uGAAgE,CAC9D,MAAM,CAAE,CAAC,CACT,UAAU,CAAE,MAAM,CAClB,SAAS,CAAE,OAAO,CAClB,cAAc,CAAE,OAAO,CACvB,UAAU,CAAE,IAAI,CAGlB,iBAAI,CACF,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,EAAE,CAIf,mBAAoB,CAClB,UAAU,CAAE,eAAoB,CAGlC,aAAc,CACZ,SAAS,CAAE,aAAa,CACxB,kBAAkB,CAAE,qDAAuD,CAG7E,oBAAqB,CACnB,aAAa,CAAE,KAAK,CACpB,cAAc,CAAE,MAAM,CAEtB,wCAAoB,CAClB,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,OAAO,CAAE,CAAC,CAId,aAAc,CACZ,UAAU,CAAE,MAAM,CAClB,KAAK,CAAE,KAAK,CACZ,MAAM,CAAE,KAAK,CACb,WAAW,CAAE,KAAK,CAClB,aAAa,CAAE,GAAG,CAClB,kBAAkB,CAAE,IAAI,CAG1B,YAAa,CACX,OAAO,CAAE,KAAK,CAIhB,2BAA4B,CAC1B,OAAO,CAAE,EAAE,CChHb,MAAO,CAGL,OAAO,CAAE,IAAI,CACb,QAAQ,CAAE,KAAK,CACf,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,CAAC,CACR,gBAAgB,CAAE,OAAO,CACzB,OAAO,CAAE,CAAC,CACV,UAAU,CAAE,GAAG,CACf,KAAK,CAAE,GAAG,CACV,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,IAAI,CAEhB,aAAa,CAAE,GAAG,CAClB,WAAW,CAAE,YAAY,CAEzB,yBAA2B,CAjB7B,MAAO,CAkBJ,KAAK,CAAE,GAAG,EAGX,uCAAY,CACV,UAAU,CAAE,CAAC,CAGf,qBAAe,CACb,OAAO,CAAE,IAAI,CAEf,mBAAa,CACX,MAAM,CAAE,OAAO,CAGjB,oBAAc,CACZ,aAAa,CAAE,WAAW,CAC1B,gBAAgB,CAAE,OAAO,CACzB,OAAO,CAAE,OAAO,CAChB,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,KAAK,CAEjB,wFAAgB,CACd,MAAM,CAAE,KAAK,CAInB,cAAe,CACb,QAAQ,CAAE,KAAK,CACf,OAAO,CAAE,GAAG,CACZ,GAAG,CAAE,IAAI,CACT,IAAI,CAAE,CAAC,CACP,MAAM,CAAE,CAAC,CACT,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,IAAI,CAChB,OAAO,CAAE,IAAI,CAEb,WAAW,CAAE,OAAO,CAItB,yBAA0B,CACxB,OAAO,CAAE,CAAC,CACV,MAAM,CAAE,GAAG,CAEX,wCAAe,CACb,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,iBAAiB,CACzB,UAAU,CAAE,IAAI,CAChB,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,IAAI,CAGlB,uCAAc,CACZ,UAAU,CAAE,yBAAwB,CACpC,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,CAAC,CAKb,mBAAoB,CAClB,GAAG,CAAE,IAAI,CACT,MAAM,CAAE,KAAK,CACb,MAAM,CAAE,CAAC,CACT,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,GAAG,CACf,aAAa,CAAE,CAAC,CAChB,WAAW,CAAE,eAAe,CCxF9B,YAAa,CACX,UAAU,CAAE,cAAmC,CAC/C,YAAY,CAAE,cAAmC,CACjD,WAAW,CAAE,cAAmC,CAChD,MAAM,CAAE,cAA8C,CAIxD,mBAAoB,CAClB,OAAO,CAAE,IAAI,CACb,MAAM,CAAE,OAAO,CACf,2BAA2B,CAAE,WAAW,CACxC,WAAW,CAAE,GAAG,CAChB,OAAO,CAAE,IAAI,CACb,gBAAgB,ChBoGS,IAAI,CgBnG7B,aAAa,CAAE,cAAmC,CAElD,qBAAE,CACA,KAAK,CAAE,IAAI,CACX,SAAS,CAAE,MAAM,CACjB,OAAO,CAAE,YAAY,CACrB,UAAU,CAAE,MAAM,CAClB,YAAY,CAAE,IAAI,CAItB,iBAAkB,CAChB,OAAO,CAAE,IAAI,CACb,aAAa,CAAE,cAAmC,CAClD,UAAU,CAAE,UAAU,CACtB,OAAO,CAAE,IAAI,CAOb,mDAAa,CACX,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,IAAI,CAEhB,yDAAG,CAAE,OAAO,CAAE,CAAC,CAGjB,iEAAoB,CAClB,gBAAgB,CAAE,WAAW,CAC7B,MAAM,CAAE,IAAI,CACZ,WAAW,CAAE,OAAO,CACpB,MAAM,CAAE,OAAO,CACf,OAAO,CAAE,MAAkB,CAE3B,6EAAQ,CAAE,gBAAgB,CAAE,gBAAe,CAC3C,qEAAE,CAAE,WAAW,CAAE,OAAO,CAG1B,6DAAkB,CAChB,MAAM,CAAE,CAAC,CACT,gBAAgB,ChByDO,IAAI,CgBvD3B,uEAAK,CACH,OAAO,CAAE,eAC2B,CAQ1C,mBAAoB,CAClB,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,IAAI,CAChB,sBAAK,CACH,UAAU,CAAE,0DAAiE,CAE7E,MAAM,CAAE,MAAM,CACd,UAAU,CAAE,iDAAoD,CAElE,6BAAY,CACV,UAAU,CAAE,2DAAkE,CAC9E,MAAM,CAAE,MAAM,CChFlB,KAAM,CACJ,OAAO,CAAE,YAAY,CACrB,MAAM,CAAE,IAAI,CACZ,SAAS,CAAE,IAAI,CACf,WAAW,CAAE,GAAG,CAChB,KAAK,CAAE,eAAc,CACrB,WAAW,CAAE,IAAI,CACjB,OAAO,CAAE,MAAM,CACf,aAAa,CAAE,IAAI,CACnB,gBAAgB,CjBgHF,OAAO,CiB/GrB,aAAa,CjBkHD,GAAG,CiBjHf,YAAY,CjBiHA,GAAG,CiB/Gf,SAAM,CACJ,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,aAAa,CACrB,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,aAAa,CAAE,GAAG,CAGpB,YAAO,CACL,MAAM,CAAE,OAAO,CACf,KAAK,CAAE,KAAK,CACZ,SAAS,CAAE,IAAI,CACf,WAAW,CAAE,IAAI,CACjB,YAAY,CAAE,GAAG,CAIrB,MAAO,CACL,MAAM,CAAE,IAAI,CACZ,aAAa,CAAE,iBAA4B,CAC3C,UAAU,CAAE,IAAI,CAChB,MAAM,CjByIO,UAA2B,CiBxIxC,UAAU,CAAE,IAAI,CAChB,OAAO,CAAE,IAAI,CACb,UAAU,CAAE,OAAO,CAEnB,YAAQ,CACN,aAAa,CAAE,iBAA8B,CAC7C,UAAU,CAAE,iBAA8B,CAG5C,YAAQ,CACN,MAAM,CAAE,IAAI,CAGd,qBAAe,CACb,gBAAgB,CjB0EE,OAAO,CiBzEzB,KAAK,CAAE,IAAI,CAGb,aAAO,CACL,UAAU,CAAE,IAAI,CAChB,MAAM,CAAE,CAAC,CACT,KAAK,CAAE,eAAc,CACrB,OAAO,CAAE,YAAY,CACrB,SAAS,CjB+GK,IAAI,CiB9GlB,MAAM,CjBuGK,IAAI,CiBtGf,WAAW,CAAE,IAAI,CACjB,OAAO,CAAE,CAAC,CACV,MAAM,CAAE,CAAC,CACT,OAAO,CAAE,YAAY,CACrB,KAAK,CAAE,gBAAgB,CAGzB,mBAAa,CACX,MAAM,CAAE,YAAY,CACpB,UAAU,CAAE,eAAe,CAI7B,4BAAsB,CACpB,UAAU,CAAE,CAAC,CACb,aAAa,CAAE,CAAC,CAKpB,gBAAiB,CACf,WAAW,CAAE,IAAI,CACjB,KAAK,CAAE,GAAG,CACV,KAAK,CAAE,iBAAiB,CAE1B,oBAAsB,CACpB,SAAS,CAAE,MAAM,CACjB,SAAS,CAAE,iBAAiB,CCvF9B,cAAe,CAOb,OAAO,CAAE,KAAK,CACd,MAAM,CAAE,OAAO,CACf,QAAQ,CAAE,QAAQ,CAClB,UAAU,CAAE,WAAW,CACvB,2BAA2B,CAAE,MAAM,CATjC,iCAAe,CACb,OAAO,CAAE,EAAE,CAUf,qBAAS,CACP,MAAM,CAAE,QAAQ,CAIpB,oBAAqB,CACnB,QAAQ,CAAC,KAAK,CACd,GAAG,CAAE,CAAC,CACN,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,CAAC,CACT,IAAI,CAAE,CAAC,CACP,gBAAgB,CAAE,OAAO,CACzB,OAAO,CAAE,IAAI,CACb,WAAW,CAAE,OAAO,CAGtB,oBAAqB,CACnB,QAAQ,CAAE,KAAK,CACf,OAAO,CAAE,IAAI,CACb,KAAK,CAAE,IAAI,CACX,WAAW,CAAE,IAAI,CACjB,MAAM,CAAE,CAAC,CACT,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,MAAM,CAClB,OAAO,CAAE,MAAM,CACf,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,IAAI,CACb,sBAAsB,CAAE,WAAW,CCxCrC,YAAa,CACX,OAAO,CnBgMM,iBAAyC,CmB7LxD,YAAa,CACX,OAAO,CAAE,IAAI,CACb,gBAAgB,CnBoDQ,OAA6B,CmBjDvD,KAAM,CACJ,SAAS,CnBmKO,KAAK,CmBlKrB,KAAK,CnBoQW,OAAqB,CoB3QvC,aAAc,CACZ,KAAK,CpB6KkB,OAAiC,CoBxK1D,ifAY8B,CAG5B,gBAAgB,CAAE,WAAW,CAC7B,MAAM,CAAE,IAAI,CACZ,aAAa,CpBwIA,iBAA8B,CoBvI3C,aAAa,CAAE,CAAC,CAChB,OAAO,CAAE,IAAI,CACb,MAAM,CpBmIO,IAAI,CoBlIjB,KAAK,CAAE,IAAI,CACX,SAAS,CpBwIO,IAAI,CoBvIpB,MAAM,CpByIO,UAA2B,CoBxIxC,OAAO,CpByIO,CAAC,CoBxIf,UAAU,CAAE,IAAI,CAChB,UAAU,CAAE,WAAW,CACvB,UAAU,CpBuIO,QAAQ,CoBpIzB,y2CACuB,CACrB,KAAK,CpBoIc,gBAAgB,CoBnInC,aAAa,CpBqIO,2BAAiC,CoBjIvD,qgDAC6B,CAC3B,KAAK,CpB6Hc,gBAAgB,CoBzHrC,+wBAAwB,CACtB,aAAa,CAAE,iBAA4B,CAC3C,UAAU,CAAE,iBAA4B,CAI1C,61BAA8B,CAC5B,KAAK,CpBmSY,OAAgB,CoBvQnC,orBAAmB,CACjB,KAAK,CAAE,IAAI,CASb,i9CACqB,CACnB,OAAO,CAAE,IAAI,CAGf,uoDAC4B,CAC1B,OAAO,CAAE,KAAK,CAMlB,yvCAAmB,CACjB,aAAa,CAAE,iBAA8B,CAC7C,UAAU,CAAE,iBAA8B,CAE5C,+yCAAqB,CACnB,aAAa,CpB6DQ,iBAA6B,CoB5DlD,UAAU,CAAE,iBAA4B,CAE1C,uiDAAwB,CACtB,OAAO,CAAE,kBAAkB,CAC3B,KAAK,CpBwJkB,OAAsB,CoBvJ7C,OAAO,CAAE,CAAC,CACV,SAAS,CAAE,eAAe,CAE5B,6lDAAsB,CACpB,OAAO,CAAE,gBAAgB,CACzB,KAAK,CpBsCa,OAAY,CoBrC9B,OAAO,CAAE,CAAC,CACV,SAAS,CAAE,eAAe,CAE5B,yqBAAmB,CACjB,OAAO,CAAE,KAAK,CACd,OAAO,CAAE,EAAE,CACX,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,IAAI,CACT,IAAI,CAAE,CAAC,CACP,OAAO,CAAE,CAAC,CACV,UAAU,CAAE,wCAAwC,CAKtD,YAAa,CAyBX,QAAQ,CAAE,QAAQ,CAClB,UAAU,CAAE,IAAI,CAxBhB,mBAAS,CACP,OAAO,CAAE,YAAY,CACrB,cAAc,CAAE,MAAM,CACtB,WAAW,CAAE,GAAG,CAEhB,8DACiB,CACf,aAAa,CAAE,IAAI,CAMrB,sBAAM,CACJ,IAAI,CAAE,MAAiB,CAGzB,6EAC4B,CAC1B,KAAK,CAAE,0BAAoC,CAO/C,kBAAM,CACJ,KAAK,CpBmGS,OAAqB,CoBlGnC,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,MAAM,CAAE,IAAI,CACZ,SAAS,CAAE,IAAI,CACf,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,sBAAsB,CAClC,gBAAgB,CAAE,OAAO,CACzB,UAAU,CAAE,OAAO,CACnB,SAAS,CAAE,gBAAgB,CAC3B,cAAc,CAAE,IAAI,CAEpB,0CAA0B,CACxB,SAAS,CAAE,4BAA2B,CACtC,gBAAgB,CAAE,GAAG,CAKzB,oBAAQ,CACN,QAAQ,CAAE,QAAQ,CAClB,KAAK,CpBjCM,IAAI,CoBkCf,SAAS,CAAE,IAAI,CACf,UAAU,CAAE,SAAS,CAErB,2BAAS,CAAE,KAAK,CpByJC,OAAgB,CoBtJnC,+KAIgC,CAC9B,WAAW,CAAE,IAAI,CACjB,KAAK,CAAE,GAAG,CACV,KAAK,CAAE,iBAAiB,CAG1B,4BAAgB,CAAE,WAAW,CAAE,IAAI,CAEnC,yBAA2B,CACzB,4BAAgB,CACd,KAAK,CAAE,GAAG,CACV,KAAK,CAAE,iBAAiB,EAI5B,yBAA0B,CACxB,4BAAgB,CACd,KAAK,CAAE,GAAG,CACV,KAAK,CAAE,iBAAiB,EAQ9B,+BAAgC,CAC9B,OAAO,CAAE,KAAK,CACd,WAAW,CAAE,OAAO,CAEpB,4CAAe,CACb,MAAM,CAAE,OAAO,CACf,YAAY,CAAE,IAAI,CAClB,KAAK,CAAE,iBAAiB,CACxB,MAAM,CAAE,CAAC,CACT,UAAU,CAAE,IAAI,CAGlB,qCAAQ,CACN,gBAAgB,CpBhFD,IAAI,CoBiFnB,MAAM,CAAE,CAAC,CACT,UAAU,CAAE,IAAI,CAChB,KAAK,CAAE,IAAI,CAEX,mKAEoB,CAClB,KAAK,CAAE,IAAI,CAIf,qCAAU,CACR,IAAI,CAAE,IAAI,CAGZ,yGACoB,CAClB,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,KAAK,CAAE,IAAI,CACX,KAAK,CAAE,WAAW,CAClB,MAAM,CAAE,OAAO,CACf,SAAS,CAAE,IAAI,CACf,UAAU,CAAE,SAAS,CAQzB,QAAS,CACP,KAAK,CAAE,IAAI,CACX,MAAM,CpBrHO,IAAI,CoBsHjB,gBAAgB,CAAE,WAAW,CAE7B,6BAAuB,CAYrB,UAAU,CAAE,MAAM,CAClB,OAAO,CAAE,gBAAgB,CACzB,MAAM,CAAE,IAAI,CACZ,UAAU,CpBvIC,IAAI,CoB0Hf,4CAAmB,CAOjB,MAAM,CAAE,IAAI,CANZ,mDAAS,CACP,GAAG,CAAE,iBAAiB,CAExB,oEAA0B,CACxB,SAAS,CAAE,iBAAiB,CAapC,UAAW,CACT,OAAO,CAAE,IAAI,CACb,WAAW,CAAE,QAAQ,CACrB,SAAS,CAAE,UAAU,CACrB,aAAa,CAAE,UAAU,CACzB,WAAW,CAAE,MAAM,CAGnB,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CAKR,qBAAsB,CACpB,UAAU,CAAE,KAAyB,CACrC,aAAa,CpBpJO,IAAI,CoBqJxB,OAAO,CAAE,KAAK,CACd,OAAO,CAAE,CAAC,CACV,QAAQ,CAAE,MAAM,CAGd,mCAAW,CAAE,KAAK,CAAE,IAAI,CAExB,4BAAI,CACF,MAAM,CAAE,IAA0B,CAClC,KAAK,CAAE,IAA0B,CACjC,MAAM,CAAE,QAAQ,CCrUtB,mDACuB,CACrB,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,CAAC,CACV,cAAc,CAAE,IAAI,CAGtB,+DAC+B,CAC7B,QAAQ,CAAE,QAAQ,CAClB,YAAY,CAAE,IAAI,CAClB,MAAM,CAAE,OAAO,CACf,OAAO,CAAE,YAAY,CACrB,MAAM,CAAE,IAAI,CACZ,WAAW,CAAE,IAAI,CACjB,SAAS,CAAE,IAAI,CACf,UAAU,CAAE,SAAS,CACrB,WAAW,CAAE,IAAI,CAGnB,sDAC6B,CAC3B,OAAO,CAAE,EAAE,CACX,QAAQ,CAAE,QAAQ,CAClB,IAAI,CAAE,CAAC,CACP,GAAG,CAAE,CAAC,CACN,MAAM,CAAE,GAAG,CACX,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,CAAC,CACV,UAAU,CAAE,SAAS,CAIvB,kPAK8C,CAC5C,aAAa,CAAE,GAAG,CAGpB,kFAC2C,CACzC,MAAM,CAAE,iBAA4B,CAGtC,wCAA2C,CACzC,SAAS,CAAE,QAAQ,CAIrB,mCAAsC,CACpC,MAAM,CAAE,qBAAqB,CAG/B,2HAE8C,CAC5C,MAAM,CrBwHO,iBAA4B,CqBrH3C,8EAC8C,CAC5C,gBAAgB,CrB2RG,OAAgB,CqBxRrC,kCAAqC,CACnC,SAAS,CAAE,WAAW,CAIxB,2CAA8C,CAC5C,SAAS,CAAE,UAAS,CAItB,wCAA2C,CACzC,UAAU,CAAE,0BAAyB,CAIvC,qDAAwD,CACtD,MAAM,CAAE,0BAA+B,CAGzC,oDAAuD,CACrD,MAAM,CAAE,IAAI,CACZ,gBAAgB,CrBkFK,gBAAgB,CqB9EvC,+FAC+C,CAC7C,gBAAgB,CAAE,WAAW,CAC7B,YAAY,CrB2ES,gBAAgB,CqBxEvC,6BAAgC,CAC9B,KAAK,CrBuEgB,gBAAgB,CqBpEvC,kDAAqD,CACnD,YAAY,CrBmES,gBAAgB,CqBhEvC,2CAA8C,CAC5C,gBAAgB,CrB+DK,gBAAgB,CqB9DrC,YAAY,CrB+De,OAAO,CsB5KpC,MAAO,CACL,aAAa,CAAE,IAAI,CACnB,UAAU,CAAE,IAAI,CAGlB,iBAAkB,CAChB,aAAa,CAAE,CAAC,CAIlB,yDAC0B,CACxB,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,CAAC,CACV,cAAc,CAAE,IAAI,CAMpB,uBAAQ,CACN,QAAQ,CAAE,QAAQ,CAClB,YAAY,CAAE,IAAI,CAClB,MAAM,CAAE,OAAO,CACf,OAAO,CAAE,YAAY,CACrB,MAAM,CAAE,IAAI,CACZ,WAAW,CAAE,IAAI,CACjB,SAAS,CAAE,IAAI,CACf,WAAW,CAAE,IAAI,CAInB,4EACgC,CAC9B,OAAO,CAAE,EAAE,CACX,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,CAAC,CACV,MAAM,CAAE,iBAA4B,CACpC,aAAa,CAAE,GAAG,CAClB,UAAU,CAAE,GAAG,CACf,UAAU,CAAE,GAAG,CAGjB,6CAAgC,CAC9B,MAAM,CAAE,CAAC,CACT,SAAS,CAAE,QAAQ,CAGrB,qDAAwC,CACtC,MAAM,CAAE,IAAI,CACZ,gBAAgB,CtBqHG,gBAAgB,CsBjHrC,0CAA6B,CAC3B,SAAS,CAAE,QAAQ,CACnB,MAAM,CAAE,CAAC,CACT,aAAa,CAAE,GAAG,CAClB,UAAU,CAAE,0BAAyB,CACrC,gBAAgB,CAAE,eAAc,CAKlC,sCAAe,CACb,GAAG,CAAE,IAAI,CACT,IAAI,CAAE,IAAI,CACV,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,qBAAqB,CACjC,WAAW,CAAE,qBAAqB,CAClC,YAAY,CtByGD,iBAA4B,CsBxGvC,aAAa,CtBwGF,iBAA4B,CsBvGvC,SAAS,CAAE,aAAa,CACxB,mBAAmB,CAAE,MAAM,CAC3B,gBAAgB,CAAE,SAAS,CAG7B,+CAA0B,CACxB,YAAY,CAAE,0BAA+B,CAC7C,aAAa,CAAE,0BAA+B,CAMhD,4CAAc,CACZ,GAAG,CAAE,KAAK,CACV,IAAI,CAAE,KAAK,CACX,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,IAAI,CAChB,WAAW,CAAE,IAAI,CACjB,YAAY,CtBmFD,iBAA4B,CsBlFvC,aAAa,CAAE,IAAI,CACnB,SAAS,CAAE,aAAa,CACxB,mBAAmB,CAAE,MAAM,CAC3B,gBAAgB,CAAE,SAAS,CAI7B,qDAA0B,CACxB,YAAY,CAAE,0BAA+B,CAC7C,gBAAgB,CAAE,WAAW,CAO/B,uCAAc,CACZ,aAAa,CAAE,GAAG,CAGpB,gFACc,CACZ,OAAO,CAAE,EAAE,CACX,IAAI,CAAE,CAAC,CACP,QAAQ,CAAE,QAAQ,CAElB,UAAU,CAAE,gGAAgG,CAC5G,OAAO,CAAE,CAAC,CAIZ,sDAA+B,CAC7B,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,CAAC,CACT,MAAM,CAAE,qBAAqB,CAC7B,IAAI,CAAE,GAAG,CACT,GAAG,CAAE,IAAI,CACT,SAAS,CAAE,cAAc,CACzB,gBAAgB,CAAE,SAAS,CAG7B,qDAA8B,CAC5B,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,gBAAgB,CAAE,WAAW,CAC7B,MAAM,CAAE,iBAA4B,CACpC,GAAG,CAAE,GAAG,CACR,OAAO,CAAE,CAAC,CAKV,gDAAe,CACb,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,GAAG,CACT,KAAK,CAAE,GAAG,CACV,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,qBAAqB,CACjC,WAAW,CAAE,qBAAqB,CAClC,YAAY,CAAE,cAA2B,CACzC,aAAa,CAAE,cAA2B,CAC1C,SAAS,CAAE,cAAc,CACzB,gBAAgB,CAAE,SAAS,CAG7B,+CAAc,CACZ,GAAG,CAAE,CAAC,CACN,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,MAAM,CAAE,iBAA0B,CAClC,gBAAgB,CtBoLD,OAAgB,CsBnL/B,OAAO,CAAE,CAAC,CAKd,oDAA6B,CAC3B,aAAa,CAAE,GAAG,CAClB,YAAY,CtBGI,OAAO,CsBFvB,gBAAgB,CAAE,eAAc,CAGlC,4DAAqC,CACnC,aAAa,CAAE,GAAG,CAClB,gBAAgB,CtBsKC,OAAgB,CsBrKjC,YAAY,CtBqKK,OAAgB,CsBjKnC,+DAAwC,CACtC,gBAAgB,CAAE,WAAW,CAC7B,MAAM,CAAE,qBAAqB,CAG/B,8DAAuC,CACrC,YAAY,CAAE,WAAW,CACzB,gBAAgB,CtBtBS,OAAO,CsByBlC,yDAAkC,CAChC,gBAAgB,CAAE,WAAW,CAG/B,wDAAiC,CAC/B,gBAAgB,CtB9BS,OAAO,CsB+BhC,YAAY,CtB/Ba,OAAO,CuB7KpC,iBACU,CACR,2BAA2B,CAAE,WAAW,CACxC,WAAW,CAAE,IAAI,CAGnB,aAAc,CACZ,MAAM,CAAE,OAAO,CAGjB,kCAAmC,CACjC,OAAO,CAAE,CAAC,CACV,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,CAAC,CAET,iDAAmB,CACjB,gBAAgB,CvBwLM,OAA+C,CuBtLrE,gHAAkB,CAChB,IAAI,CAAE,IAAI,CAGZ,uDAAQ,CACN,gBAAgB,CvBsUD,OAAgB,CuBjUrC,oBAAqB,CACnB,OAAO,CAAE,EAAE,CACX,OAAO,CAAE,YAAY,CACrB,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,gBAAgB,CvBwKU,gBAAe,CuBvKzC,aAAa,CvBwKC,IAAI,CuBvKlB,YAAY,CAAE,IAAI,CAClB,UAAU,CAAE,oBAAoB,CAChC,cAAc,CAAE,MAAM,CACtB,MAAM,CAAE,MAAM,CAEd,sDAAkB,CAChB,OAAO,CAAE,EAAE,CACX,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,YAAY,CACrB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,aAAa,CAAE,GAAG,CAClB,IAAI,CAAE,CAAC,CACP,GAAG,CAAE,IAAI,CACT,UAAU,CAAE,6EAA6E,CAG3F,2BAAS,CACP,gBAAgB,CAAE,qBAAqC,CAGzD,0BAAQ,CACN,gBAAgB,CvB+IE,OAAO,CuB9IzB,UAAU,CAAE,kGAA6G,CAK7H,6IAC0E,CACxE,SAAS,CAAE,UAAU,CACrB,gBAAgB,CAAE,qBAAqC,CAGzD,4HACkE,CAChE,SAAS,CAAE,UAAU,CACrB,gBAAgB,CAAE,gBAAe,CAInC,6CAAgD,CAC9C,MAAM,CAAE,OAAO,CACf,gBAAgB,CAAE,gBAAe,CAGnC,2HACoE,CAClE,gBAAgB,CvByFW,OAAO,CwB7KpC,MAAO,CAAE,OAAO,CAAE,IAAI,CACtB,sBAAuB,CAAE,OAAO,CAAE,KAAK,CAEvC,MAAO,CACL,gBAAgB,CxB0LE,qBAAyB,CwBzL3C,KAAK,CAAE,IAAI,CACX,OAAO,CxB4LQ,GAAG,CwB3LlB,MAAM,CxBsLQ,iBAAkB,CwBrLhC,aAAa,CxB2LC,GAAG,CwB1LjB,MAAM,CxBsJO,IAAI,CwBjJjB,mBAAW,CACT,OAAO,CAAE,KAAK,CACd,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,CAAC,CACR,cAAc,CAAE,IAAI,CACpB,MAAM,CAAE,CAAC,CACT,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,OAAO,CAAE,CAAC,CAId,aAAc,CACZ,QAAQ,CAAE,QAAQ,CAGpB,eAAgB,CA+Bd,QAAQ,CAAE,QAAQ,CAVlB,yDACkB,CAChB,KAAK,CAAE,IAAI,CACX,cAAc,CAAE,IAAI,CAStB,qCAAsB,CACpB,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,OAAO,CACf,gBAAgB,CAAE,WAAW,CAC7B,MAAM,CAAE,IAAI,CACZ,aAAa,CxB6FF,iBAA8B,CwB5FzC,OAAO,CAAE,IAAI,CACb,MAAM,CxByFK,IAAI,CwBxFf,WAAW,CxBwFA,IAAI,CwBvFf,KAAK,CAAE,IAAI,CACX,SAAS,CxB6FK,IAAI,CwB5FlB,MAAM,CxB8FK,UAA2B,CwB7FtC,OAAO,CAAE,CAAC,CACV,OAAO,CAAE,KAAK,CACd,WAAW,CAAC,IAAI,CAGlB,0BAAW,CACT,KAAK,CAAE,OAAO,CACd,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,CAAC,CACR,GAAG,CAAE,CAAC,CACN,MAAM,CAAE,CAAC,CACT,MAAM,CAAE,IAAI,CACZ,MAAM,CAAE,MAAM,CACd,SAAS,CAAE,IAAI,CACf,WAAW,CAAE,IAAI,CAGnB,qBAAU,CACR,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,KAAK,CACV,SAAS,CxB4EK,KAAK,CwBvEvB,eAAgB,CACd,KAAK,CxBuEgB,gBAAgB,CwBnErC,kEACU,CACR,KAAK,CxBiEc,gBAAgB,CwB7DvC,8CAA+C,CAC7C,KAAK,CxB4DgB,gBAAgB,CwB3DrC,MAAM,CAAE,OAAO,CACf,WAAW,CAAE,IAAI,CAGnB,iBAAkB,CAChB,KAAK,CxB8EiB,eAAc,CwB3EtC,2FAE6B,CAC3B,KAAK,CxBwEiB,eAAc,CwBvEpC,gBAAgB,CAAE,WAAW,CAK3B,2CAAS,CACP,gBAAgB,CAAE,WAAW,CAG/B,0CAAQ,CACN,gBAAgB,CxByDA,gBAAe,CwBtDjC,6CAAW,CACT,gBAAgB,CxBsDA,gBAAe,CwBhDrC,yBAA0B,CACxB,WAAW,CAAE,IAAI,CACjB,KAAK,CAAE,GAAG,CACV,KAAK,CAAE,iBAAiB,CAG1B,eAAgB,CAAE,WAAW,CAAE,IAAI,CAIjC,uBAAI,CACF,MAAM,CAAE,IAA0B,CAClC,KAAK,CAAE,IAA0B,CACjC,MAAM,CAAE,QAAQ,CAChB,KAAK,CAAE,KAAK,CAKhB,4BAA6B,CAC3B,UAAU,CAAE,cAAkC,CAE9C,0CAAkB,CAChB,KAAK,CAAE,eAAiB,CAG1B,iCAAS,CACP,KAAK,CAAE,eAAiB,CAG1B,iDAAuB,CACrB,YAAY,CAAE,IAAI,CChLtB,WAAY,CACV,QAAQ,CAAE,QAAQ,CAElB,8BAAmB,CACjB,QAAQ,CAAE,MAAM,CAChB,YAAY,CAAE,IAAI,CAGpB,2BAAgB,CAAE,KAAK,CAAE,IAAI,CAE7B,uCAAK,CACH,KAAK,CAAE,IAAI,CACX,MAAM,CzBmJK,IAAI,CyBlJf,WAAW,CzBkJA,IAAI,CyB/IjB,gBAAK,CACH,MAAM,CAAE,OAAO,CAGjB,4BAAiB,CAOf,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,KAAK,CAAE,CAAC,CACR,IAAI,CAAE,CAAC,CACP,MAAM,CAAE,CAAC,CACT,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,CAAC,CACT,OAAO,CAAE,CAAC,CACV,SAAS,CAAE,IAAI,CACf,MAAM,CAAE,OAAO,CACf,OAAO,CAAE,CAAC,CACV,MAAM,CAAE,gBAAgB,CAfxB,wDAA8B,CAC5B,OAAO,CAAE,IAAI,CCxBnB,YAAa,CACX,QAAQ,CAAE,QAAQ,CAGpB,0CAC2B,CAEzB,MAAM,CAAE,OAAO,CAGjB,iBAAkB,CAChB,QAAQ,CAAE,QAAQ,CAClB,gBAAgB,CAAE,WAAW,CAC7B,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,IAAI,CACb,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,MAAM,CACd,OAAO,CAAE,CAAC,CAEV,uBAAQ,CACN,OAAO,CAAE,IAAI,CAIjB,wBAA2B,CACzB,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,IAAI,CACT,IAAI,CAAE,CAAC,CACP,MAAM,CAAE,IAAI,CACZ,MAAM,CAAE,CAAC,CACT,KAAK,CAAE,CAAC,CACR,aAAa,CAAE,GAAG,CAClB,gBAAgB,C1B6TG,OAAgB,C0B5TnC,WAAW,CAAE,GAAG,CAEhB,gBAAgB,CAAE,OAAO,CACzB,SAAS,CAAE,cAAc,CAEzB,+BAAO,CACL,OAAO,CAAE,KAAK,CACd,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,MAAM,CAClB,KAAK,C1BmTY,OAAgB,C0BlTjC,SAAS,CAAE,CAAC,CACZ,SAAS,CAAE,aAAa,CAG1B,+BAAS,CACP,aAAa,CAAE,aAAa,CAE5B,sCAAO,CACL,KAAK,C1B+GQ,IAAI,C0B9GjB,WAAW,CAAE,IAAI,CACjB,UAAU,CAAE,GAAG,CACf,SAAS,CAAE,IAAI,CAMrB,iBAAkB,CAChB,kBAAkB,CAAE,IAAI,CAG1B,gDAAiD,CAC/C,MAAM,C1ByHO,GAAG,C0BxHhB,UAAU,CAAE,OAAO,CACnB,MAAM,CAAE,IAAI,CAGd,uCAAwC,CACtC,kBAAkB,CAAE,IAAI,CACxB,MAAM,CAAE,IAAI,CACZ,MAAM,C1B+GO,IAAI,C0B9GjB,KAAK,C1B+GO,IAAI,C0B9GhB,aAAa,CAAE,GAAG,CAClB,gBAAgB,C1BiRG,OAAgB,C0BhRnC,gBAAgB,CAAE,OAAO,CACzB,MAAM,CAAE,UAAU,CAClB,UAAU,CAAE,GAAG,CAGjB,sDAAuD,CACrD,UAAU,CAAE,IAAI,CAIlB,iBAAkB,CAEhB,MAAM,CAAE,eAAe,CAKzB,mCAAoC,CAClC,MAAM,C1B2FO,GAAG,C0B1FhB,UAAU,CAAE,IAAI,CAChB,MAAM,CAAE,IAAI,CAGd,mCAAoC,CAClC,MAAM,CAAE,IAAI,CACZ,MAAM,C1BkFO,IAAI,C0BjFjB,KAAK,C1BkFO,IAAI,C0BjFhB,aAAa,CAAE,GAAG,CAClB,UAAU,C1BoPS,OAAgB,C0BnPnC,UAAU,CAAE,IAAI,CAIlB,gCAAiC,CAC/B,OAAO,CAAE,cAAc,CACvB,cAAc,CAAE,IAAI,CAGtB,yCAA0C,CACxC,UAAU,CAAE,IAAI,CAIlB,4BAA6B,CAC3B,MAAM,C1BiEO,GAAG,C0B9DhB,UAAU,CAAE,WAAW,CAGvB,YAAY,CAAE,WAAW,CACzB,YAAY,CAAE,KAAK,CAGnB,KAAK,CAAE,WAAW,CAGpB,iCAAkC,CAChC,UAAU,CAAE,IAAI,CAGlB,iCAAkC,CAChC,UAAU,CAAE,IAAI,CAGlB,4BAA6B,CAC3B,MAAM,CAAE,IAAI,CACZ,MAAM,C1BwCO,IAAI,C0BvCjB,KAAK,C1BwCO,IAAI,C0BvChB,aAAa,CAAE,GAAG,CAClB,UAAU,C1B0MS,OAAgB,C0BvMrC,uCAAwC,CACtC,UAAU,CAAE,IAAI,CAGlB,uCAAwC,CACtC,UAAU,CAAE,IAAI,CC1JhB,wBAAQ,CACJ,QAAQ,CAAE,KAAK,CAGnB,qBAAG,CACD,OAAO,CAAE,KAAK,CAEhB,oBAAE,CACA,OAAO,CAAE,YAAY,CACrB,WAAW,CAAE,GAAG,CAChB,KAAK,CAAE,OAAO,CACd,YAAY,CAAE,IAAI,CAClB,MAAM,CAAE,MAAM,CACd,WAAW,CAAE,MAAM,CACnB,cAAc,CAAE,EAAE,CAClB,OAAO,CAAE,YAAY,CAErB,0BAAQ,CACN,KAAK,CAAE,OAAqB,CAC5B,YAAY,CAAE,IAAI,CAClB,WAAW,CAAE,iBAAwB,CAEvC,2BAAS,CACP,WAAW,CAAE,GAAG,CAChB,YAAY,CAAE,IAAI,CAClB,WAAW,CAAE,iBAAwB,CC7B3C,SAAU,CACR,QAAQ,CAAE,KAAK,CACf,KAAK,CAAE,KAAK,CACZ,IAAI,CAAE,CAAC,CACP,GAAG,CAAE,CAAC,CACN,MAAM,CAAE,CAAC,CACT,SAAS,CAAE,iBAAiB,CAC5B,MAAM,CAAE,IAAI,CACZ,MAAM,CAAE,iBAAiB,CACzB,MAAM,CAAE,eAAe,CACvB,cAAc,CAAE,IAAI,CACpB,gBAAgB,C5B4PC,IAAI,C4B3PrB,OAAO,CAAE,GAAG,CACZ,UAAU,CAAE,IAAI,CAChB,WAAW,CAAE,SAAS,CACtB,mBAAmB,CAAE,MAAM,CAC3B,SAAS,CAAE,iBAAiB,CAK5B,uBAAgB,CACd,KAAK,CAAE,CAAC,CACR,SAAS,CAAE,gBAAgB,CAC3B,IAAI,CAAE,IAAI,CACV,SAAS,CAAE,gBAAgB,CAG7B,sBAAa,CACX,MAAM,CAAE,CAAC,CAIX,YAAG,CACD,KAAK,CAAE,IAAI,CACX,WAAW,C5BuOO,IAAoB,C4BrOtC,mBAAS,CAAE,gBAAgB,CAAE,gBAAe,CAG9C,cAAO,CACL,KAAK,C5B6NY,gBAAe,C4B5NhC,OAAO,CAAE,KAAK,CACd,SAAS,C5B0NO,IAAI,C4BzNpB,WAAW,CAAE,GAAG,CAChB,MAAM,C5B4NY,IAAI,C4B3NtB,WAAW,C5B4NO,IAAoB,C4B3NtC,OAAO,CAAE,MAAwB,CAEjC,oBAAQ,CAAE,gBAAgB,CAAE,gBAAe,CAE3C,wHAA+C,CAC7C,MAAM,CAAE,SAAS,CAGnB,gGAEe,CAAE,KAAK,C5BgBJ,IAAI,C4BftB,uBAAW,CAAE,KAAK,C5BsBF,OAAO,C4BpBvB,sFACkB,CAAE,gBAAgB,CAAE,OAAsC,CAC5E,iCAAqB,CAAE,gBAAgB,C5BkStB,OAAgB,C4BhSjC,mHAEqB,CACnB,KAAK,CAAE,IAAI,CACX,MAAM,C5BqMU,IAAI,C4BpMpB,WAAW,C5BqMK,IAAoB,C4BpMpC,MAAM,CAAE,UAA4B,CACpC,KAAK,CAAE,IAAwB,CAC/B,KAAK,CAAE,gBAAe,CAK1B,kBAAS,CACP,MAAM,CAAE,SAA4B,CAGtC,oBAAW,CAKT,MAAM,CAAE,OAAO,CACf,cAAc,CAAE,IAAI,CACpB,KAAK,CAAE,gBAAe,CACtB,SAAS,C5B4KO,IAAI,C4B3KpB,WAAW,CAAE,GAAG,CAChB,WAAW,C5B+KO,IAAoB,C4BxLtC,0BAAQ,CACN,gBAAgB,CAAE,WAAW,CAWjC,wCACU,CACR,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,WAA+C,CACxD,aAAa,CAAE,GAAoB,CAEnC,4CAAM,CAEJ,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,CAAC,CAFV,wDAAQ,CAAE,gBAAgB,CAAE,WAAW,CAKzC,gEAAY,CACV,QAAQ,CAAE,MAAM,CAChB,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,CAAC,CACT,IAAI,CAAE,CAAC,CACP,OAAO,CAAE,EAAE,CAGb,oKAAuB,CACrB,OAAO,CAAE,KAAK,CAGhB,wDAAQ,CACN,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CAGb,2GACO,CACL,SAAS,C5BsIK,IAAI,C4BrIlB,WAAW,CAAE,IAAwB,CAGvC,oDAAM,CACJ,UAAU,CAAE,IAAI,CAChB,WAAW,CAAE,GAAG,CAGlB,sDAAO,CACL,cAAc,CAAE,IAAI,CACpB,WAAW,CAAE,GAAG,CAOtB,YAAa,CACX,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,QAAQ,CAAE,KAAK,CACf,GAAG,CAAE,CAAC,CACN,OAAO,CAAE,GAAG,CAKd,eAAgB,CACd,IAAI,CAAE,CAAC,CACP,SAAS,CAAE,aAAa,CACxB,QAAQ,CAAE,KAAK,CAGf,6BAAgB,CACd,KAAK,CAAE,CAAC,CACR,IAAI,CAAE,IAAI,CAKd,yBAA2B,CAEvB,eAAQ,CACN,SAAS,CAAE,iBAAiB,CAE5B,6BAAgB,CACd,SAAS,CAAE,gBAAgB,CAI/B,WAAE,CACA,OAAO,CAAE,MAAkB,CAG7B,wCACU,CACR,OAAO,CAAE,WAAmC,EAMlD,2HACqE,CACnE,gBAAgB,C5BoIA,OAAc,C4BnI9B,+HAAE,CACA,KAAK,C5BqEU,IAAI,C4BlEvB,2BAA4B,CAC1B,OAAO,CAAE,CAAC,CAIZ,gBAAiB,CACf,QAAQ,CAAE,KAAK,CACf,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,CAAC,CAER,MAAM,CAAE,KAAK,CACb,gBAAgB,CAAE,eAAc,CAChC,OAAO,CAAE,GAAG,CAEZ,WAAW,CAAE,OAAO,CCvLtB,kBAAmB,CACjB,OAAO,CAAE,YAAY,CACrB,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CAEZ,wBAAQ,CACN,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CAGd,sBAAM,CACJ,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CAGd,yBAAS,CAEP,iBAAiB,CAAE,uCAAuC,CAC1D,SAAS,CAAE,uCAAuC,CAItD,mCAEC,CADC,EAAG,CAAE,iBAAiB,CAAE,cAAe,EAGzC,2BAEC,CADC,EAAG,CAAE,SAAS,CAAE,cAAe,EAGjC,cAAe,CACb,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,CAAC,CACV,YAAY,C7B+RO,OAAgB,C6B5RrC,gCACmB,CACjB,YAAY,CAAE,OAAO,CAGvB,8BACkB,CAChB,YAAY,CAAE,OAAO,CAGvB,oCACqB,CACnB,YAAY,CAAE,OAAO,CAGvB,kCACoB,CAClB,YAAY,CAAE,OAAO,CAgBvB,mCAAoC,CAElC,iBAAiB,CAAE,uIAA4I,CAC/J,SAAS,CAAE,uIAA4I,CAGzJ,kCAAmC,CAEjC,iBAAiB,CAAE,sIAA2I,CAC9J,SAAS,CAAE,sIAA2I,CAGxJ,qCAAsC,CAEpC,iBAAiB,CAAE,yIAA8I,CACjK,SAAS,CAAE,yIAA8I,CAG3J,oCAAqC,CAEnC,iBAAiB,CAAE,wIAA6I,CAChK,SAAS,CAAE,wIAA6I,CAG1J,4LAI0C,CAExC,OAAO,CAAE,CAAC,CACV,iBAAiB,CAAE,oEAAsE,CACzF,SAAS,CAAE,oEAAsE,CAGnF,qCASC,CARC,KAAM,CAAE,iBAAiB,CAAE,cAAc,CACzC,GAAM,CAAE,iBAAiB,CAAE,cAAc,CACzC,KAAM,CAAE,iBAAiB,CAAE,cAAc,CACzC,GAAM,CAAE,iBAAiB,CAAE,cAAc,CACzC,KAAM,CAAE,iBAAiB,CAAE,cAAc,CACzC,GAAM,CAAE,iBAAiB,CAAE,cAAc,CACzC,KAAM,CAAE,iBAAiB,CAAE,cAAc,CACzC,EAAM,CAAE,iBAAiB,CAAE,eAAe,EAG5C,6BASC,CARC,KAAM,CAAE,SAAS,CAAE,cAAc,CACjC,GAAM,CAAE,SAAS,CAAE,cAAc,CACjC,KAAM,CAAE,SAAS,CAAE,cAAc,CACjC,GAAM,CAAE,SAAS,CAAE,cAAc,CACjC,KAAM,CAAE,SAAS,CAAE,cAAc,CACjC,GAAM,CAAE,SAAS,CAAE,cAAc,CACjC,KAAM,CAAE,SAAS,CAAE,cAAc,CACjC,EAAM,CAAE,SAAS,CAAE,eAAe,EAGpC,mCAOC,CANC,IAAK,CAAE,OAAO,CAAE,CAAC,CACjB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,IAAK,CAAE,OAAO,CAAE,CAAC,EAGnB,2BAOC,CANC,IAAK,CAAE,OAAO,CAAE,CAAC,CACjB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,IAAK,CAAE,OAAO,CAAE,CAAC,EAGnB,kCAMC,CALC,IAAK,CAAE,OAAO,CAAE,CAAC,CACjB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,EAGlB,0BAMC,CALC,IAAK,CAAE,OAAO,CAAE,CAAC,CACjB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,EAGlB,qCAMC,CALC,IAAK,CAAE,OAAO,CAAE,CAAC,CACjB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,EAGlB,6BAMC,CALC,IAAK,CAAE,OAAO,CAAE,CAAC,CACjB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,EAGlB,oCAMC,CALC,IAAK,CAAE,OAAO,CAAE,CAAC,CACjB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,IAAK,CAAE,OAAO,CAAE,CAAC,EAGnB,4BAMC,CALC,IAAK,CAAE,OAAO,CAAE,CAAC,CACjB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,GAAI,CAAE,OAAO,CAAE,CAAC,CAChB,IAAK,CAAE,OAAO,CAAE,CAAC,EAOnB,UAAW,CACT,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,GAAG,CACT,KAAK,CAAE,GAAG,CACV,MAAM,CAAE,IAAI,CACZ,QAAQ,CAAE,MAAM,CAChB,YAAY,CAAE,OAAO,CAGvB,kBAAmB,CACjB,KAAK,CAAE,KAAK,CACZ,IAAI,CAAE,KAAK,CAGb,eAAgB,CACd,OAAO,CAAE,YAAY,CACrB,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,GAAG,CACV,MAAM,CAAE,IAAI,CACZ,QAAQ,CAAE,MAAM,CAChB,YAAY,CAAE,OAAO,CAErB,uBAAQ,CACN,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,YAAY,CAAE,GAAG,CACjB,YAAY,CAAE,KAAK,CACnB,YAAY,CAAE,OAAO,CACrB,mBAAmB,CAAE,sBAAsB,CAC3C,aAAa,CAAE,GAAG,CAClB,iBAAiB,CAAE,IAAI,CACvB,SAAS,CAAE,IAAI,CACf,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,CAAC,CAGX,4BAAe,CACb,IAAI,CAAE,CAAC,CACP,kBAAkB,CAAE,sBAAsB,CAC1C,iBAAiB,CAAE,cAAc,CACjC,SAAS,CAAE,cAAc,CAE3B,6BAAgB,CACd,IAAI,CAAE,KAAK,CACX,iBAAiB,CAAE,sBAAsB,CACzC,iBAAiB,CAAE,eAAe,CAClC,SAAS,CAAE,eAAe,CAM9B,oCAAqC,CAEnC,iBAAiB,CAAE,2DAA6D,CAChF,SAAS,CAAE,2DAA6D,CAG1E,qCAAsC,CAEpC,iBAAiB,CAAE,4DAA8D,CACjF,SAAS,CAAE,4DAA8D,CAG3E,4BAIC,CAHC,IAAK,CAAE,iBAAiB,CAAE,cAAc,CACxC,GAAI,CAAE,iBAAiB,CAAE,aAAa,CACtC,EAAG,CAAE,iBAAiB,CAAE,cAAc,EAGxC,oBAIC,CAHC,IAAK,CAAE,SAAS,CAAE,cAAc,CAChC,GAAI,CAAE,SAAS,CAAE,aAAa,CAC9B,EAAG,CAAE,SAAS,CAAE,cAAc,EAGhC,6BAIC,CAHC,IAAK,CAAE,iBAAiB,CAAE,eAAe,CACzC,GAAI,CAAE,iBAAiB,CAAE,YAAY,CACrC,EAAG,CAAE,iBAAiB,CAAE,eAAe,EAGzC,qBAIC,CAHC,IAAK,CAAE,SAAS,CAAE,eAAe,CACjC,GAAI,CAAE,SAAS,CAAE,YAAY,CAC7B,EAAG,CAAE,SAAS,CAAE,eAAe,EAGjC,0BAA2B,CAEzB,iBAAiB,CAAE,mFAAsF,CACzG,SAAS,CAAE,mFAAsF,CAGnG,2BAGC,CAFC,IAAK,CAAE,OAAO,CAAE,CAAC,CACjB,EAAG,CAAE,OAAO,CAAE,CAAC,EAGjB,mBAGC,CAFC,IAAK,CAAE,OAAO,CAAE,CAAC,CACjB,EAAG,CAAE,OAAO,CAAE,CAAC,EC5UjB,OAAQ,CACN,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,KAAK,CACb,KAAK,CAAE,IAAI,CAGX,kBAAa,CACX,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,CAAC,CAET,4BAAU,CACR,MAAM,CAAE,IAAI,CAGd,gCAAc,CACZ,OAAO,CAAE,CAAC,CACV,MAAM,CAAE,IAAI,CAIhB,eAAQ,CACN,gBAAgB,C9BsPF,OAAqB,C8BrPnC,MAAM,CAAE,CAAC,CACT,MAAM,CAAE,KAAK,CAEb,kBAAG,CACD,OAAO,CAAE,CAAC,CACV,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,OAAO,CAAE,CAAC,CACV,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,OAAO,CACf,QAAQ,CAAE,MAAM,CAEhB,sBAAI,CACF,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,eAAe,CAAE,KAAK,CACtB,mBAAmB,CAAE,MAAM,CAG7B,2BAAS,CACP,KAAK,CAAE,IAAI,CACX,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,GAAG,CACR,IAAI,CAAE,GAAG,CACT,KAAK,CAAE,GAAG,CACV,OAAO,CAAE,CAAC,CAEV,6BAAE,CAAE,KAAK,C9B0NO,OAA0B,C8BvN5C,yBAAS,CACP,OAAO,CAAE,CAAC,CAMhB,mBAAY,CACV,QAAQ,CAAE,QAAQ,CAClB,UAAU,CAAE,MAAM,CAClB,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,CAAC,CACT,MAAM,CAAE,CAAC,CAET,mCAAgB,CACd,OAAO,CAAE,YAAY,CACrB,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,OAAO,CACf,MAAM,CAAE,IAAI,CACZ,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,MAAM,CACd,gBAAgB,C9BiME,OAA0B,C8B/L5C,UAAU,CAAE,oBAAoB,CAChC,aAAa,CAAE,GAAG,CAElB,0CAAS,CACP,gBAAgB,C9B4LC,OAAsB,C+BlR/C,SAAU,CAqCR,QAAQ,CAAE,MAAM,CAChB,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,C/BgEU,KAAK,C+B/DrB,WAAW,CAAE,KAAK,CAClB,eAAe,CAAE,WAAW,CAC5B,gBAAgB,CAAE,MAAM,CA1CxB,yBAAkB,CAChB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CAEP,8CAAqB,CAKnB,QAAQ,CAAE,QAAQ,CAClB,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,CAAC,CARV,8DAAkB,CAChB,MAAM,CAAE,IAAI,CAUhB,wCAAe,CACb,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,UAAU,C/BoFE,KAAK,C+BnFjB,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CAEP,2CAAG,CACD,SAAS,CAAE,IAAI,CACf,WAAW,CAAE,GAAG,CAChB,WAAW,CAAE,IAAI,CAGnB,0CAAE,CACA,SAAS,CAAE,IAAI,CAarB,wBAAe,CACb,OAAO,CAAE,IAAI,CACb,KAAK,C/B2Da,KAAqB,C+B1DvC,MAAM,C/B0DY,KAAqB,C+BzDvC,QAAQ,CAAE,QAAQ,CAClB,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CAEP,4BAAQ,CACN,KAAK,CAAE,IAAI,CAIf,qBAAY,CACV,QAAQ,CAAE,QAAQ,CAClB,UAAU,CAAE,MAAM,CAClB,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,CAAC,CACT,MAAM,CAAE,CAAC,CAET,qCAAgB,CAKd,OAAO,CAAE,YAAY,CACrB,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,OAAO,CACf,MAAM,CAAE,GAAG,CACX,KAAK,CAAE,GAAG,CACV,MAAM,CAAE,QAAQ,CAChB,gBAAgB,CAAE,qBAAoB,CAEtC,UAAU,CAAE,oBAAoB,CAChC,aAAa,CAAE,GAAG,CAblB,4CAAS,CACP,gBAAgB,CAAE,IAAI,CAiB5B,sGAC2C,CACzC,cAAc,CAAE,IAAI,CCvFxB,mBAAoB,CAClB,KAAK,CAAE,KAAK,CACZ,MAAM,CAAE,KAAK,CACb,QAAQ,CAAE,KAAK,CACf,OAAO,CAAE,IAAI,CACb,UAAU,CAAE,MAAM,CAClB,UAAU,CAAE,iBAAiB,CAG/B,wBAAyB,CACvB,UAAU,CAAE,OAAO,CACnB,UAAU,CAAE,aAAa,CAEzB,oCAAY,CACV,SAAS,CAAE,QAAQ,CACnB,OAAO,CAAE,GAAG,CACZ,UAAU,CACR,yFACqC,CAGzC,iDAAyB,CACvB,SAAS,CAAE,QAAQ,CAErB,gDAAwB,CACtB,UAAU,CAAE,OAAO,CACnB,SAAS,CAAE,0DAA0D,CACrE,UAAU,CACR,4CAEgB,CAItB,WAAY,CACV,QAAQ,CAAE,QAAQ,CAClB,SAAS,CAAE,IAAI,CACf,aAAa,CAAE,GAAG,CAClB,gBAAgB,ChC8RA,OAAc,CgC7R9B,UAAU,CAAE,+FAAiG,CAC7G,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,OAAO,CAAE,CAAC,CACV,SAAS,CAAE,QAAQ,CACnB,UAAU,CACR,yFACqC,CAGzC,mBAAoB,CAClB,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,UAAU,CAGrB,gBAAiB,CAwBf,QAAQ,CAAE,QAAQ,CAClB,aAAa,CAAE,GAAG,CAClB,OAAO,CAAE,KAAK,CAzBd,gDACS,CACP,OAAO,CAAE,EAAE,CACX,OAAO,CAAE,KAAK,CACd,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,aAAa,CAAE,GAAG,CAClB,gBAAgB,CAAE,OAAO,CAE3B,wBAAU,CACR,SAAS,CAAE,QAAQ,CACnB,UAAU,CAAE,aAAa,CAE3B,uBAAS,CACP,UAAU,CAAE,MAAM,CAClB,UAAU,CACR,yCAEa,CACf,OAAO,CAAE,EAAE,CAQf,kBAAmB,CAMjB,GAAG,CAAE,GAAG,CACR,IAAI,CAAE,GAAG,CACT,SAAS,CAAE,qBAAoB,CAE/B,OAAO,CAAE,KAAK,CACd,QAAQ,CAAE,mBAAmB,CAV7B,+FACkB,CAChB,UAAU,CAAE,IAAI,CAWpB,yCAA0C,CACxC,+BAAiC,CAC/B,KAAK,CAAE,KAAK,CACZ,MAAM,CAAE,KAAK,ECpGjB,MAAO,CAgBL,QAAQ,CAAE,OAAO,CACjB,QAAQ,CAAE,QAAQ,CAhBlB,cAAU,CACR,OAAO,CAAE,EAAE,CACX,OAAO,CAAE,KAAK,CACd,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,GAAG,CAAE,CAAC,CACN,IAAI,CAAE,CAAC,CACP,gBAAgB,CAAE,OAAO,CACzB,aAAa,CAAE,OAAO,CACtB,UAAU,CAAE,0BAA0B,CACtC,SAAS,CAAE,0DAA0D,CACrE,OAAO,CAAE,EAAE,CAOf,0BAaC,CAZC,EAAG,CACD,OAAO,CAAE,CAAC,CACV,SAAS,CAAE,QAAQ,CAErB,GAAI,CACF,OAAO,CAAE,CAAC,CACV,SAAS,CAAE,UAAU,CAEvB,IAAK,CACH,OAAO,CAAE,CAAC,CACV,SAAS,CAAE,UAAU,ECzBzB,OAAQ,CACN,SAAS,CAAE,IAAI,CACf,UAAU,CAAE,IAAI,CAChB,WAAW,CAAE,GAAG,CAChB,KAAK,CAAE,OAAO,CACd,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,KAAK,CACd,mBAAmB,CAAE,IAAI,CACzB,gBAAgB,CAAE,IAAI,CACtB,eAAe,CAAE,IAAI,CACrB,WAAW,CAAE,IAAI,CACjB,OAAO,CAAE,IAAI,CAKf,cAAe,CACb,MAAM,CAAE,OAAO,CAKjB,oCAAqC,CACnC,YAAY,CAAE,OAAO,CAKvB,eAAgB,CACd,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,IAAI,CAChB,0BAA0B,CAAE,KAAK,CAGnC;;;GAGG,AAOH,8BACe,CACb,MAAM,CAAE,CAAC,CACT,IAAI,CAAE,CAAC,CACP,KAAK,CAAE,CAAC,CACR,GAAG,CAAE,IAAI,CAKX,eAAgB,CACd,QAAQ,CAAE,KAAK,CACf,kBAAkB,CAAE,uCAAuC,CAC3D,eAAe,CAAE,uCAAuC,CACxD,UAAU,CAAE,uCAAuC,CACnD,2BAA2B,CAAE,MAAM,CAKrC,cAAe,CACb,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,MAAM,CACd,SAAS,CAAE,KAAK,CAGhB,KAAK,CAAE,KAAK,CACZ,UAAU,CAAE,KAAK,CAEjB,UAAU,CAAE,oDAAoD,CAChE,MAAM,CAAE,gBAAgB,CACxB,YAAY,CAAE,CAAC,CACf,OAAO,CAAE,CAAC,CACV,kBAAkB,CAAE,kBAAkB,CACtC,eAAe,CAAE,kBAAkB,CACnC,UAAU,CAAE,kBAAkB,CAEhC,6BAA8B,CAC5B,cAAe,CACb,QAAQ,CAAE,OAAO,CACjB,GAAG,CAAE,IAAI,CACT,MAAM,CAAE,KAAK,CACb,UAAU,CAAE,GAAG,EAGnB,6BAA8B,CAC5B,cAAe,CACb,aAAa,CAAE,IAAI,EAMvB,aAAc,CACZ,OAAO,CAAE,KAAK,CACd,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CAEd,6BAA8B,CAC5B,aAAc,CACZ,OAAO,CAAE,KAAK,EAMlB,YAAa,CACX,UAAU,CAAE,OAAO,CACnB,OAAO,CAAE,UAAU,CACnB,cAAc,CAAE,MAAM,CAOxB,6BAA8B,CAC5B,YAAa,CACX,OAAO,CAAE,KAAK,CAKd,MAAM,CAAE,iBAAiB,CACzB,gBAAgB,CAAE,OAAO,CACzB,mBAAmB,CAAE,CAAC,CACtB,qBAAqB,CAAE,WAAW,CAClC,kBAAkB,CAAE,WAAW,CAC/B,aAAa,CAAE,WAAW,CAC1B,kBAAkB,CAAE,iCAAoC,CACxD,eAAe,CAAE,iCAAoC,CACrD,UAAU,CAAE,iCAAoC,EAepD,+BAAgC,CAC9B,GAAG,CAAE,CAAC,CACN,UAAU,CAAE,WAAW,CACvB,UAAU,CAAE,2FAA2F,CACvG,IAAI,CAAE,CAAC,CACP,UAAU,CAAE,gBAAmB,CAC/B,kBAAkB,CAAE,yBAAyB,CAC7C,eAAe,CAAE,yBAAyB,CAC1C,UAAU,CAAE,yBAAyB,CAEvC,8BAA+B,CAC7B,GAAG,CAAE,CAAC,CACN,UAAU,CAAE,sDAAsD,CAClE,MAAM,CAAE,kBAAkB,CAC1B,YAAY,CAAE,CAAC,CACf,OAAO,CAAE,CAAC,CAEZ,6BAA8B,CAC5B,8BAA+B,CAC7B,GAAG,CAAE,GAAG,CACR,MAAM,CAAE,IAAI,EAWhB,oCAAqC,CACnC,YAAY,CrC/EE,OAAO,CqCkFvB,cAAe,CACb,MAAM,CAAE,MAAM,CACd,SAAS,CAAE,KAAK,CAGlB,6BAA8B,CAC5B,8BAA+B,CAC7B,GAAG,CAAE,GAAG,CACR,MAAM,CAAE,IAAI,EAIhB,yCAA0C,CACzC,YAAa,CACZ,OAAO,CAAC,IAAI,CAEb,cAAe,CACd,KAAK,CAAE,GAAG,CACV,SAAS,CAAC,KAAK,EC3MjB,YAAa,CACX,OAAO,CAAE,CAAC,CACV,aAAa,CAAE,GAAG,CAClB,QAAQ,CAAE,MAAM,CAKlB,eAAgB,CACd,UAAU,CAAE,MAAM,CAClB,QAAQ,CAAE,QAAQ,CAClB,UAAU,CAAE,KAAK,CAKnB,4BACc,CAEZ,OAAO,CAAE,YAAY,CACrB,WAAW,CAAE,KAAK,CAClB,YAAY,CAAE,KAAK,CAKrB,4CACsB,CAEpB,MAAM,CAAE,GAAG,CACX,OAAO,CAAE,CAAC,CACV,WAAW,CAAE,KAAK,CAClB,YAAY,CAAE,KAAK,CAIrB,sCAAuC,CACrC,OAAO,CAAE,MAAM,CACf,gBAAgB,CAAE,OAAO,CACzB,KAAK,CAAE,GAAG,CAEZ,qCAAsC,CACpC,OAAO,CAAE,MAAM,CACf,gBAAgB,CAAE,OAAO,CACzB,KAAK,CAAE,GAAG,CAEZ,wDAC4B,CAC1B,YAAY,CnCiFK,gBAAgB,CmC5EnC,qCACmB,CACjB,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,WAAW,CACpB,KAAK,CAAE,GAAG,CACV,MAAM,CAAE,GAAG,CACX,UAAU,CAAE,WAAW,CACvB,GAAG,CAAE,OAAO,CAQd,kBAAmB,CACjB,IAAI,CAAE,IAAI,CACV,aAAa,CAAE,MAAM,CAOvB,kBAAmB,CACjB,KAAK,CAAE,IAAI,CACX,YAAY,CAAE,MAAM,CAQtB,qHAGoC,CAClC,MAAM,CAAE,OAAO,CACf,UAAU,CAAE,IAAI,CAChB,kBAAkB,CAAE,OAAO,CAC3B,iBAAiB,CAAE,OAAO,CAK5B,cAAe,CACb,UAAU,CAAE,MAAM,CAClB,eAAe,CAAE,QAAQ,CACzB,cAAc,CAAE,CAAC,CACjB,YAAY,CAAE,KAAK,CACnB,SAAS,CAAE,IAAI,CACf,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,KAAK,CACjB,aAAa,CAAE,IAAI,CAKrB,mCAAqC,CACnC,UAAU,CAAE,MAAM,CAQpB,iBAAkB,CAChB,MAAM,CAAE,CAAC,CACT,OAAO,CAAE,CAAC,CAKZ,gBAAiB,CACf,KAAK,CAAE,aAAa,CACpB,SAAS,CAAE,KAAK,CAChB,cAAc,CAAE,KAAK,CACrB,KAAK,CAAE,OAAO,CACd,WAAW,CAAE,GAAG,CAGlB,6BAA8B,CAC5B,gBAAiB,CACf,cAAc,CAAE,IAAI,EAOxB,mBAAoB,CAClB,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,OAAO,CACd,cAAc,CAAE,GAAG,CACnB,OAAO,CAAE,QAAQ,CACjB,WAAW,CAAE,GAAG,CAChB,MAAM,CAAE,qBAAqB,CAc/B,6BAA8B,CAC5B,gBAAgB,CAAE,OAAO,CAI3B,2BAA2B,CACzB,MAAM,CAAE,OAAO,CACf,KAAK,CAAE,IAAI,CACX,WAAW,CAAE,GAAG,CAGlB,sBAAuB,CACrB,OAAO,CAAE,IAAI,CACb,OAAO,CAAE,QAAQ,CACjB,KAAK,CAAE,IAAI,CAGb,4BAA6B,CAC3B,MAAM,CAAE,OAAO,CACf,KAAK,CAAE,OAAO,CAEd,WAAW,CAAE,GAAG,CAOlB,0EAC2C,CACzC,MAAM,CAAE,OAAO,CAKjB,2FAEwC,CAIrC,aAAa,CAAE,GAAG,CACnB,SAAS,CAAE,WAAU,CACrB,UAAU,CAAE,OAAO,CACnB,KAAK,CAAE,OAAO,CAEhB,2FAEwC,CACtC,UAAU,CAAE,OAAO,CACnB,YAAY,CAAE,OAAO,CACrB,KAAK,CAAE,OAAO,CACd,MAAM,CAAE,OAAO,CAEjB,qGACsD,CACpD,UAAU,CAAE,OAAO,CAKrB,eAAgB,CACd,UAAU,CAAE,KAAK,CAEnB,oEAEuB,CACrB,MAAM,CAAE,iBAAiB,CACzB,UAAU,CAAE,OAAO,CACnB,SAAS,CAAE,IAAI,CACf,OAAO,CAAE,OAAO,CAChB,WAAW,CAAE,IAAI,CACjB,KAAK,CAAE,GAAG,CACV,OAAO,CAAE,YAAY,CACrB,cAAc,CAAE,MAAM,CAExB,sFAE6B,CAC3B,MAAM,CAAE,OAAO,CACf,KAAK,CAAE,OAAO,CACd,UAAU,CAAE,OAAO,CACnB,mBAAmB,CAAE,OAAO,CAE9B,sFAE6B,CAC3B,UAAU,CAAE,OAAO,CACnB,YAAY,CnC5HK,gBAAgB,CmC6HjC,OAAO,CAAE,IAAI,CAEf,yFAE8B,CAC5B,QAAQ,CAAE,QAAQ,CAClB,OAAO,CAAE,YAAY,CACrB,MAAM,CAAE,CAAC,CAEX,2DAC8B,CAC5B,OAAO,CAAE,GAAG,CACZ,YAAY,CAAE,KAAK,CAErB,6BAA8B,CAC5B,GAAG,CAAE,OAAO,CACZ,KAAK,CAAE,CAAC,CACR,UAAU,CAAE,oBAAoB,CAChC,WAAW,CAAE,uBAAuB,CAEtC,6BAA8B,CAC5B,GAAG,CAAE,OAAO,CACZ,KAAK,CAAE,KAAK,CACZ,UAAU,CAAE,iBAAiB,CAE/B,6BAA8B,CAC5B,OAAO,CAAE,KAAK,CACd,GAAG,CAAE,MAAM,CACX,cAAc,CAAE,GAAG,CACnB,SAAS,CAAE,KAAK,CAChB,YAAY,CAAE,KAAK,CACnB,KAAK,CAAE,OAAO,CAEhB,uEACuC,CACrC,UAAU,CAAE,OAAO,CACnB,YAAY,CAAE,OAAO,CACrB,KAAK,CAAE,OAAO,CACd,MAAM,CAAE,OAAO,CAEjB,uCAAwC,CACtC,gBAAgB,CAAE,OAAO,CAW3B,qBAAsB,CACpB,UAAU,CAAE,IAAI,CAChB,gBAAgB,CnCsCG,OAAgB,CmCrCnC,KAAK,CAAE,IAAI,CACX,OAAO,CAAE,IAAI,CACb,WAAW,CAAE,GAAG,CAGlB,yCAA0C,CACzC,qBAAsB,CACrB,IAAI,CAAC,CAAC,CAEP,wBAAyB,CACxB,OAAO,CAAC,KAAK,CAEd,2BAA4B,CAC3B,IAAI,CAAC,CAAC,EAIR,iDACyB,CACvB,MAAM,CAAE,OAAO,CACf,KAAK,CAAE,OAAO,CACd,UAAU,CnCvMmB,OAA+C,CmC0M9E,wBAAyB,CACvB,WAAW,CAAE,GAAG,CAChB,SAAS,CnCnNoB,MAAM,CmCoNnC,YAAY,CAAE,GAAG,CACjB,UAAU,CAAE,GAAG,CAGjB,sBAAuB,CAErB,SAAS,CnC1NoB,MAAM,CmC2NnC,WAAW,CAAE,GAAG,CAElB,oBAAqB,CACnB,SAAS,CnC9NoB,MAAM,CmC+NnC,WAAW,CAAE,GAAG,CAChB,YAAY,CAAE,GAAG,CAEnB,qBAAsB,CACpB,SAAS,CAAE,MAAM,CACjB,WAAW,CAAE,GAAG,CAChB,KAAK,CnCjOW,qBAAuB,CmCuOzC,2BAA4B,CAC1B,OAAO,CAAE,MAAM,CAEf,iCAAM,CACJ,MAAM,CAAE,IAAI,CAKhB,cAAe,CACb,UAAU,CAAE,CAAC,CACb,aAAa,CAAE,IAAI,CAGrB,qBAAsB,CACpB,KAAK,CnCzPoB,gBAAkB,CmC0P3C,cAAc,CAAE,KAAK,CACrB,OAAO,CAAE,SAAS,CAClB,WAAW,CAAE,GAAG,CAChB,MAAM,CAAE,qBAAqB,CAE/B,yCAA0C,CACzC,qBAAsB,CACrB,OAAO,CAAE,QAAQ,EAMnB,+BAAgC,CAC9B,KAAK,CnC3Cc,OAAgB,CmC8CrC,qDAAsD,CACpD,KAAK,CAAE,IAAI,CAIb,gBAAiB,CACf,SAAS,CAAE,KAAK,CAIlB,2FAEwC,CAEtC,aAAa,CAAE,GAAG,CAClB,SAAS,CAAE,UAAS,CACpB,gBAAgB,CnC9DG,OAAgB,CmCkEnC,KAAK,CAAE,OAAO,CAHd,6JAAwB,CACtB,gBAAgB,CnCvRW,OAA+C,CmC4R9E,eAAgB,CACd,UAAU,CAAE,KAAK,CACjB,OAAO,CAAE,QAAQ,CAInB,4CAA+C,CAC7C,SAAS,CAAE,MAAM,CACjB,OAAO,CAAE,MAAM,CACf,KAAK,CnC9Ec,OAAgB,CmCgFrC,cAAe,CACd,KAAK,CAAC,OAAO,CACb,KAAK,CAAC,IAAI,CAIX,mDAC0B,CACxB,OAAO,CAAE,GAAG,CACZ,UAAU,CAAE,sBAAsB,CAClC,aAAa,CAAE,sBAAsB,CACrC,YAAY,CAAE,oBAAoB,CAClC,KAAK,CAAE,CAAC,CACR,MAAM,CAAE,CAAC,CACT,OAAO,CAAE,KAAK,CACd,MAAM,CAAE,MAAM,CAEhB,yBAA0B,CACxB,YAAY,CAAE,CAAC,CACf,WAAW,CAAE,oBAAoB,CAEnC,gFAAmF,CACjF,gBAAgB,CnC7Ta,OAA+C,CoCnI9E,aAAc,CACZ,UAAU,CAAE,IAAI,CAChB,OAAO,CAAE,cAAc,CACvB,MAAM,CAAE,CAAC,CAKX,kBAAmB,CACjB,aAAa,CAAE,cAAc,CAC7B,UAAU,CAAE,cAAc,CAC1B,aAAa,CAAE,IAAI,CACnB,QAAQ,CAAE,QAAQ,CAClB,UAAU,CAAE,IAAI,CAChB,OAAO,CAAE,YAAY,CAEvB,4BAA6B,CAC3B,kBAAmB,CACjB,OAAO,CAAE,QAAQ,EAIrB,wBAAyB,CACvB,MAAM,CAAE,OAAO,CACf,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,OAAO,CACnB,YAAY,CAAE,OAAO,CACrB,OAAO,CAAE,EAAE,CAGb,+BAAgC,CAC9B,YAAY,CAAE,OAAO,CACrB,OAAO,CAAE,EAAE,CAEb,sFACiD,CAC/C,MAAM,CAAE,OAAO,CACf,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,OAAO,CAGrB,6GAE8C,CAC5C,UAAU,CAAE,OAAO,CACnB,KAAK,CAAE,IAAI,CACX,OAAO,CAAE,EAAE,CAGb,6GAE8C,CAC5C,UAAU,CAAE,OAAO,CACnB,YAAY,CAAE,OAAO,CACrB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,OAAO,CACf,YAAY,CAAE,IAAI,CAClB,OAAO,CAAE,IAAI,CAKf,oCAAqC,CACnC,OAAO,CAAE,KAAK,CACd,KAAK,CAAE,GAAG,CACV,MAAM,CAAE,UAAU,CAClB,OAAO,CAAE,UAAU,CACnB,UAAU,CAAE,IAAI,CAChB,MAAM,CAAE,CAAC,CACT,WAAW,CAAE,GAAG,CAChB,SAAS,CAAE,KAAK,CAChB,UAAU,CAAE,MAAM,CAClB,cAAc,CAAE,SAAS,CACzB,KAAK,CpC4DkB,gBAAkB,CoC1D3C,qFAC2C,CACzC,KAAK,CAAE,IAAI,CACX,UAAU,CAAE,OAAO,CACnB,UAAU,CAAE,OAAO,CACnB,YAAY,CAAE,OAAO,CACrB,MAAM,CAAE,OAAO,CACf,KAAK,CAAE,IAAI,CACX,OAAO,CAAE,IAAI,CAEf,2CAA4C,CAC1C,GAAG,CAAE,OAAO,CACZ,KAAK,CpC8CkB,gBAAkB,CoC7CzC,SAAS,CAAE,MAAM,CACjB,WAAW,CAAE,IAAI,CAEnB,mGACkD,CAChD,KAAK,CAAE,IAAI,CASb,4BAA6B,CAC3B,SAAS,CAAE,KAAK,CAChB,SAAS,CAAE,KAAK,CAKlB,0BAA2B,CACzB,SAAS,CAAE,GAAG,CACd,UAAU,CAAE,OAAO,CACnB,OAAO,CAAE,CAAC,CAEZ,6BAA8B,CAC5B,0BAA2B,CACzB,aAAa,CAAE,GAAG,EAOtB,oBAAqB,CACpB,SAAS,CAAE,IAAI,CACf,WAAW,CAAE,IAAI,CACjB,UAAU,CAAE,MAAM,CAClB,KAAK,CAAE,qBAAwB,CAC9B,WAAW,CAAE,GAAG,CACjB,KAAK,CAAE,IAAI,CACX,QAAQ,CAAE,QAAQ,CAGnB,uBAAwB,CACtB,SAAS,CAAE,MAAM,CACjB,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,MAAM,CACd,WAAW,CAAE,IAAI,CACjB,WAAW,CAAE,GAAG,CAElB,yCAA0C,CACzC,oBAAqB,CACpB,GAAG,CAAE,GAAG,CAET,uBAAwB,CACtB,QAAQ,CAAE,QAAQ,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,MAAM,CAClB,UAAU,CAAE,MAAM,EAKrB,aAAa,CACZ,KAAK,CAAE,IACR,CACA,uBAAwB,CACtB,YAAY,CAAE,GAAG,CAEnB,yBAA0B,CACxB,WAAW,CAAE,GAAG,CAGlB,6EAE4B,CAC3B,MAAM,CAAE,OAAO,CAEhB,mBAAoB,CACnB,MAAM,CAAE,IAAI,CAEb,kBAAmB,CAClB,gBAAgB,CpCxCW,IAAI,CoCyC/B,aAAa,CAAE,GAAG,CAClB,KAAK,CAAE,KAAK,CACZ,MAAM,CAAE,KAAK,CACb,QAAQ,CAAE,OAAO,CACjB,QAAQ,CAAE,QAAQ,CACjB,MAAM,CAAE,IAAI,CACZ,UAAU,CAAE,IAAI,CAChB,aAAa,CAAE,GAAG,CACnB,WAAW,CAAE,IAAI,CAElB,qCACkB,CACjB,KAAK,CAAE,KAAK,CACZ,MAAM,CAAE,KAAK,CACb,QAAQ,CAAE,QAAQ,CAClB,IAAI,CAAE,IAAI,CACV,GAAG,CAAE,IAAI,CAEV,oBAAqB,CACpB,UAAU,CAAE,MAAM,CAEnB,iBAAkB,CACjB,aAAa,CAAE,GAAG,CAClB,KAAK,CpCjEmB,gBAAkB,CoCkE1C,WAAW,CAAE,IAAI,CACjB,UAAU,CAAE,MAAM,CAClB,KAAK,CAAE,IAAI,CACX,MAAM,CAAE,IAAI,CACZ,QAAQ,CAAE,QAAQ,CAClB,MAAM,CAAE,OAAO,CAEhB,gDACwB,CACvB,gBAAgB,CAAE,qBAAqC,CAExD,iBAAkB,CACjB,kBAAkB,CAAE,sCAAsC,CAC1D,eAAe,CAAE,mCAAmC,CACpD,cAAc,CAAE,kCAAkC,CAClD,aAAa,CAAE,iCAAiC,CAChD,UAAU,CAAE,8BAA8B,CAE3C,qBAAsB,CACrB,OAAO,CAAE,CAAC,CAEX,uCAAwC,CACvC,iBAAiB,CAAE,eAAe,CAClC,cAAc,CAAE,eAAe,CAC/B,aAAa,CAAE,eAAe,CAC9B,YAAY,CAAE,eAAe,CAC7B,SAAS,CAAE,eAAe,CAE3B,yCAA0C,CACzC,iBAAiB,CAAE,eAAa,CAChC,cAAc,CAAE,eAAa,CAC7B,aAAa,CAAE,eAAa,CAC5B,YAAY,CAAE,eAAa,CAC3B,SAAS,CAAE,eAAa,CAEzB,mBAAoB,CACnB,kBAAkB,CAAE,aAAa,CACjC,eAAe,CAAE,aAAa,CAC9B,cAAc,CAAE,aAAa,CAC7B,aAAa,CAAE,aAAa,CAC5B,UAAU,CAAE,aAAa,CAE1B,uBAAwB,CACvB,OAAO,CAAE,IAAI,CAEd,2BAA4B,CAC3B,MAAM,CAAE,IAAI,CACZ,IAAI,CpCoGgB,OAAgB,CoClGrC,sBAAuB,CACtB,MAAM,CAAE,IAAI,CACZ,IAAI,CpCgGgB,OAAgB,CoC9FrC,4BAA6B,CAC5B,IAAI,CpC6FgB,OAAgB,CoC3FrC,wBAAyB,CACxB,MAAM,CpC0Fc,OAAgB,CoCzFpC,YAAY,CAAE,CAAC,CACf,cAAc,CAAE,KAAK", +"sources": ["../sass/components/_color.scss","../sass/components/_normalize.scss","../sass/components/_global.scss","../sass/components/_variables.scss","../sass/components/_badges.scss","../sass/components/_icons-material-design.scss","../sass/components/_grid.scss","../sass/components/_navbar.scss","../sass/components/_roboto.scss","../sass/components/_typography.scss","../sass/components/_transitions.scss","../sass/components/_cards.scss","../sass/components/_toast.scss","../sass/components/_tabs.scss","../sass/components/_tooltip.scss","../sass/components/_buttons.scss","../sass/components/_dropdown.scss","../sass/components/_waves.scss","../sass/components/_modal.scss","../sass/components/_collapsible.scss","../sass/components/_chips.scss","../sass/components/_materialbox.scss","../sass/components/forms/_forms.scss","../sass/components/forms/_input-fields.scss","../sass/components/forms/_radio-buttons.scss","../sass/components/forms/_checkboxes.scss","../sass/components/forms/_switches.scss","../sass/components/forms/_select.scss","../sass/components/forms/_file-input.scss","../sass/components/forms/_range.scss","../sass/components/_table_of_contents.scss","../sass/components/_sideNav.scss","../sass/components/_preloader.scss","../sass/components/_slider.scss","../sass/components/_carousel.scss","../sass/components/_tapTarget.scss","../sass/components/_pulse.scss","../sass/components/date_picker/_default.scss","../sass/components/date_picker/_default.date.scss","../sass/components/date_picker/_default.time.scss"], +"names": [], +"file": "materialize.min.css" +}
\ No newline at end of file diff --git a/app/dispatch/static/materialize/js/animation.js b/app/dispatch/static/materialize/js/animation.js new file mode 100644 index 0000000..b8a532a --- /dev/null +++ b/app/dispatch/static/materialize/js/animation.js @@ -0,0 +1,8 @@ +// Custom Easing
+jQuery.extend( jQuery.easing,
+{
+ easeInOutMaterial: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t + b;
+ return c/4*((t-=2)*t*t + 2) + b;
+ }
+});
\ No newline at end of file diff --git a/app/dispatch/static/materialize/js/bin/materialize.js b/app/dispatch/static/materialize/js/bin/materialize.js new file mode 100644 index 0000000..10df8db --- /dev/null +++ b/app/dispatch/static/materialize/js/bin/materialize.js @@ -0,0 +1,10021 @@ +/*!
+ * Materialize v0.100.2 (http://materializecss.com)
+ * Copyright 2014-2017 Materialize
+ * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
+ */
+var _createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); + +function _classCallCheck(instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } } + +// Check for jQuery. +if (typeof jQuery === 'undefined') { + // Check if require is a defined function. + if (typeof require === 'function') { + jQuery = $ = require('jquery'); + // Else use the dollar sign alias. + } else { + jQuery = $; + } +} +; /*
+ * jQuery Easing v1.4.0 - http://gsgd.co.uk/sandbox/jquery/easing/
+ * Open source under the BSD License.
+ * Copyright © 2008 George McGinley Smith
+ * All rights reserved.
+ * https://raw.github.com/gdsmith/jquery-easing/master/LICENSE
+ */ + +(function (factory) { + if (typeof define === "function" && define.amd) { + define(['jquery'], function ($) { + return factory($); + }); + } else if (typeof module === "object" && typeof module.exports === "object") { + exports = factory(require('jquery')); + } else { + factory(jQuery); + } +})(function ($) { + + // Preserve the original jQuery "swing" easing as "jswing" + $.easing['jswing'] = $.easing['swing']; + + var pow = Math.pow, + sqrt = Math.sqrt, + sin = Math.sin, + cos = Math.cos, + PI = Math.PI, + c1 = 1.70158, + c2 = c1 * 1.525, + c3 = c1 + 1, + c4 = 2 * PI / 3, + c5 = 2 * PI / 4.5; + + // x is the fraction of animation progress, in the range 0..1 + function bounceOut(x) { + var n1 = 7.5625, + d1 = 2.75; + if (x < 1 / d1) { + return n1 * x * x; + } else if (x < 2 / d1) { + return n1 * (x -= 1.5 / d1) * x + .75; + } else if (x < 2.5 / d1) { + return n1 * (x -= 2.25 / d1) * x + .9375; + } else { + return n1 * (x -= 2.625 / d1) * x + .984375; + } + } + + $.extend($.easing, { + def: 'easeOutQuad', + swing: function (x) { + return $.easing[$.easing.def](x); + }, + easeInQuad: function (x) { + return x * x; + }, + easeOutQuad: function (x) { + return 1 - (1 - x) * (1 - x); + }, + easeInOutQuad: function (x) { + return x < 0.5 ? 2 * x * x : 1 - pow(-2 * x + 2, 2) / 2; + }, + easeInCubic: function (x) { + return x * x * x; + }, + easeOutCubic: function (x) { + return 1 - pow(1 - x, 3); + }, + easeInOutCubic: function (x) { + return x < 0.5 ? 4 * x * x * x : 1 - pow(-2 * x + 2, 3) / 2; + }, + easeInQuart: function (x) { + return x * x * x * x; + }, + easeOutQuart: function (x) { + return 1 - pow(1 - x, 4); + }, + easeInOutQuart: function (x) { + return x < 0.5 ? 8 * x * x * x * x : 1 - pow(-2 * x + 2, 4) / 2; + }, + easeInQuint: function (x) { + return x * x * x * x * x; + }, + easeOutQuint: function (x) { + return 1 - pow(1 - x, 5); + }, + easeInOutQuint: function (x) { + return x < 0.5 ? 16 * x * x * x * x * x : 1 - pow(-2 * x + 2, 5) / 2; + }, + easeInSine: function (x) { + return 1 - cos(x * PI / 2); + }, + easeOutSine: function (x) { + return sin(x * PI / 2); + }, + easeInOutSine: function (x) { + return -(cos(PI * x) - 1) / 2; + }, + easeInExpo: function (x) { + return x === 0 ? 0 : pow(2, 10 * x - 10); + }, + easeOutExpo: function (x) { + return x === 1 ? 1 : 1 - pow(2, -10 * x); + }, + easeInOutExpo: function (x) { + return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? pow(2, 20 * x - 10) / 2 : (2 - pow(2, -20 * x + 10)) / 2; + }, + easeInCirc: function (x) { + return 1 - sqrt(1 - pow(x, 2)); + }, + easeOutCirc: function (x) { + return sqrt(1 - pow(x - 1, 2)); + }, + easeInOutCirc: function (x) { + return x < 0.5 ? (1 - sqrt(1 - pow(2 * x, 2))) / 2 : (sqrt(1 - pow(-2 * x + 2, 2)) + 1) / 2; + }, + easeInElastic: function (x) { + return x === 0 ? 0 : x === 1 ? 1 : -pow(2, 10 * x - 10) * sin((x * 10 - 10.75) * c4); + }, + easeOutElastic: function (x) { + return x === 0 ? 0 : x === 1 ? 1 : pow(2, -10 * x) * sin((x * 10 - 0.75) * c4) + 1; + }, + easeInOutElastic: function (x) { + return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ? -(pow(2, 20 * x - 10) * sin((20 * x - 11.125) * c5)) / 2 : pow(2, -20 * x + 10) * sin((20 * x - 11.125) * c5) / 2 + 1; + }, + easeInBack: function (x) { + return c3 * x * x * x - c1 * x * x; + }, + easeOutBack: function (x) { + return 1 + c3 * pow(x - 1, 3) + c1 * pow(x - 1, 2); + }, + easeInOutBack: function (x) { + return x < 0.5 ? pow(2 * x, 2) * ((c2 + 1) * 2 * x - c2) / 2 : (pow(2 * x - 2, 2) * ((c2 + 1) * (x * 2 - 2) + c2) + 2) / 2; + }, + easeInBounce: function (x) { + return 1 - bounceOut(1 - x); + }, + easeOutBounce: bounceOut, + easeInOutBounce: function (x) { + return x < 0.5 ? (1 - bounceOut(1 - 2 * x)) / 2 : (1 + bounceOut(2 * x - 1)) / 2; + } + }); +});; // Custom Easing +jQuery.extend(jQuery.easing, { + easeInOutMaterial: function (x, t, b, c, d) { + if ((t /= d / 2) < 1) return c / 2 * t * t + b; + return c / 4 * ((t -= 2) * t * t + 2) + b; + } +});; /*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */ +/*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */ +/*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */ +jQuery.Velocity ? console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity.") : (!function (e) { + function t(e) { + var t = e.length, + a = r.type(e);return "function" === a || r.isWindow(e) ? !1 : 1 === e.nodeType && t ? !0 : "array" === a || 0 === t || "number" == typeof t && t > 0 && t - 1 in e; + }if (!e.jQuery) { + var r = function (e, t) { + return new r.fn.init(e, t); + };r.isWindow = function (e) { + return null != e && e == e.window; + }, r.type = function (e) { + return null == e ? e + "" : "object" == typeof e || "function" == typeof e ? n[i.call(e)] || "object" : typeof e; + }, r.isArray = Array.isArray || function (e) { + return "array" === r.type(e); + }, r.isPlainObject = function (e) { + var t;if (!e || "object" !== r.type(e) || e.nodeType || r.isWindow(e)) return !1;try { + if (e.constructor && !o.call(e, "constructor") && !o.call(e.constructor.prototype, "isPrototypeOf")) return !1; + } catch (a) { + return !1; + }for (t in e) {}return void 0 === t || o.call(e, t); + }, r.each = function (e, r, a) { + var n, + o = 0, + i = e.length, + s = t(e);if (a) { + if (s) for (; i > o && (n = r.apply(e[o], a), n !== !1); o++) {} else for (o in e) { + if (n = r.apply(e[o], a), n === !1) break; + } + } else if (s) for (; i > o && (n = r.call(e[o], o, e[o]), n !== !1); o++) {} else for (o in e) { + if (n = r.call(e[o], o, e[o]), n === !1) break; + }return e; + }, r.data = function (e, t, n) { + if (void 0 === n) { + var o = e[r.expando], + i = o && a[o];if (void 0 === t) return i;if (i && t in i) return i[t]; + } else if (void 0 !== t) { + var o = e[r.expando] || (e[r.expando] = ++r.uuid);return a[o] = a[o] || {}, a[o][t] = n, n; + } + }, r.removeData = function (e, t) { + var n = e[r.expando], + o = n && a[n];o && r.each(t, function (e, t) { + delete o[t]; + }); + }, r.extend = function () { + var e, + t, + a, + n, + o, + i, + s = arguments[0] || {}, + l = 1, + u = arguments.length, + c = !1;for ("boolean" == typeof s && (c = s, s = arguments[l] || {}, l++), "object" != typeof s && "function" !== r.type(s) && (s = {}), l === u && (s = this, l--); u > l; l++) { + if (null != (o = arguments[l])) for (n in o) { + e = s[n], a = o[n], s !== a && (c && a && (r.isPlainObject(a) || (t = r.isArray(a))) ? (t ? (t = !1, i = e && r.isArray(e) ? e : []) : i = e && r.isPlainObject(e) ? e : {}, s[n] = r.extend(c, i, a)) : void 0 !== a && (s[n] = a)); + } + }return s; + }, r.queue = function (e, a, n) { + function o(e, r) { + var a = r || [];return null != e && (t(Object(e)) ? !function (e, t) { + for (var r = +t.length, a = 0, n = e.length; r > a;) { + e[n++] = t[a++]; + }if (r !== r) for (; void 0 !== t[a];) { + e[n++] = t[a++]; + }return e.length = n, e; + }(a, "string" == typeof e ? [e] : e) : [].push.call(a, e)), a; + }if (e) { + a = (a || "fx") + "queue";var i = r.data(e, a);return n ? (!i || r.isArray(n) ? i = r.data(e, a, o(n)) : i.push(n), i) : i || []; + } + }, r.dequeue = function (e, t) { + r.each(e.nodeType ? [e] : e, function (e, a) { + t = t || "fx";var n = r.queue(a, t), + o = n.shift();"inprogress" === o && (o = n.shift()), o && ("fx" === t && n.unshift("inprogress"), o.call(a, function () { + r.dequeue(a, t); + })); + }); + }, r.fn = r.prototype = { init: function (e) { + if (e.nodeType) return this[0] = e, this;throw new Error("Not a DOM node."); + }, offset: function () { + var t = this[0].getBoundingClientRect ? this[0].getBoundingClientRect() : { top: 0, left: 0 };return { top: t.top + (e.pageYOffset || document.scrollTop || 0) - (document.clientTop || 0), left: t.left + (e.pageXOffset || document.scrollLeft || 0) - (document.clientLeft || 0) }; + }, position: function () { + function e() { + for (var e = this.offsetParent || document; e && "html" === !e.nodeType.toLowerCase && "static" === e.style.position;) { + e = e.offsetParent; + }return e || document; + }var t = this[0], + e = e.apply(t), + a = this.offset(), + n = /^(?:body|html)$/i.test(e.nodeName) ? { top: 0, left: 0 } : r(e).offset();return a.top -= parseFloat(t.style.marginTop) || 0, a.left -= parseFloat(t.style.marginLeft) || 0, e.style && (n.top += parseFloat(e.style.borderTopWidth) || 0, n.left += parseFloat(e.style.borderLeftWidth) || 0), { top: a.top - n.top, left: a.left - n.left }; + } };var a = {};r.expando = "velocity" + new Date().getTime(), r.uuid = 0;for (var n = {}, o = n.hasOwnProperty, i = n.toString, s = "Boolean Number String Function Array Date RegExp Object Error".split(" "), l = 0; l < s.length; l++) { + n["[object " + s[l] + "]"] = s[l].toLowerCase(); + }r.fn.init.prototype = r.fn, e.Velocity = { Utilities: r }; + } +}(window), function (e) { + "object" == typeof module && "object" == typeof module.exports ? module.exports = e() : "function" == typeof define && define.amd ? define(e) : e(); +}(function () { + return function (e, t, r, a) { + function n(e) { + for (var t = -1, r = e ? e.length : 0, a = []; ++t < r;) { + var n = e[t];n && a.push(n); + }return a; + }function o(e) { + return m.isWrapped(e) ? e = [].slice.call(e) : m.isNode(e) && (e = [e]), e; + }function i(e) { + var t = f.data(e, "velocity");return null === t ? a : t; + }function s(e) { + return function (t) { + return Math.round(t * e) * (1 / e); + }; + }function l(e, r, a, n) { + function o(e, t) { + return 1 - 3 * t + 3 * e; + }function i(e, t) { + return 3 * t - 6 * e; + }function s(e) { + return 3 * e; + }function l(e, t, r) { + return ((o(t, r) * e + i(t, r)) * e + s(t)) * e; + }function u(e, t, r) { + return 3 * o(t, r) * e * e + 2 * i(t, r) * e + s(t); + }function c(t, r) { + for (var n = 0; m > n; ++n) { + var o = u(r, e, a);if (0 === o) return r;var i = l(r, e, a) - t;r -= i / o; + }return r; + }function p() { + for (var t = 0; b > t; ++t) { + w[t] = l(t * x, e, a); + } + }function f(t, r, n) { + var o, + i, + s = 0;do { + i = r + (n - r) / 2, o = l(i, e, a) - t, o > 0 ? n = i : r = i; + } while (Math.abs(o) > h && ++s < v);return i; + }function d(t) { + for (var r = 0, n = 1, o = b - 1; n != o && w[n] <= t; ++n) { + r += x; + }--n;var i = (t - w[n]) / (w[n + 1] - w[n]), + s = r + i * x, + l = u(s, e, a);return l >= y ? c(t, s) : 0 == l ? s : f(t, r, r + x); + }function g() { + V = !0, (e != r || a != n) && p(); + }var m = 4, + y = .001, + h = 1e-7, + v = 10, + b = 11, + x = 1 / (b - 1), + S = "Float32Array" in t;if (4 !== arguments.length) return !1;for (var P = 0; 4 > P; ++P) { + if ("number" != typeof arguments[P] || isNaN(arguments[P]) || !isFinite(arguments[P])) return !1; + }e = Math.min(e, 1), a = Math.min(a, 1), e = Math.max(e, 0), a = Math.max(a, 0);var w = S ? new Float32Array(b) : new Array(b), + V = !1, + C = function (t) { + return V || g(), e === r && a === n ? t : 0 === t ? 0 : 1 === t ? 1 : l(d(t), r, n); + };C.getControlPoints = function () { + return [{ x: e, y: r }, { x: a, y: n }]; + };var T = "generateBezier(" + [e, r, a, n] + ")";return C.toString = function () { + return T; + }, C; + }function u(e, t) { + var r = e;return m.isString(e) ? b.Easings[e] || (r = !1) : r = m.isArray(e) && 1 === e.length ? s.apply(null, e) : m.isArray(e) && 2 === e.length ? x.apply(null, e.concat([t])) : m.isArray(e) && 4 === e.length ? l.apply(null, e) : !1, r === !1 && (r = b.Easings[b.defaults.easing] ? b.defaults.easing : v), r; + }function c(e) { + if (e) { + var t = new Date().getTime(), + r = b.State.calls.length;r > 1e4 && (b.State.calls = n(b.State.calls));for (var o = 0; r > o; o++) { + if (b.State.calls[o]) { + var s = b.State.calls[o], + l = s[0], + u = s[2], + d = s[3], + g = !!d, + y = null;d || (d = b.State.calls[o][3] = t - 16);for (var h = Math.min((t - d) / u.duration, 1), v = 0, x = l.length; x > v; v++) { + var P = l[v], + V = P.element;if (i(V)) { + var C = !1;if (u.display !== a && null !== u.display && "none" !== u.display) { + if ("flex" === u.display) { + var T = ["-webkit-box", "-moz-box", "-ms-flexbox", "-webkit-flex"];f.each(T, function (e, t) { + S.setPropertyValue(V, "display", t); + }); + }S.setPropertyValue(V, "display", u.display); + }u.visibility !== a && "hidden" !== u.visibility && S.setPropertyValue(V, "visibility", u.visibility);for (var k in P) { + if ("element" !== k) { + var A, + F = P[k], + j = m.isString(F.easing) ? b.Easings[F.easing] : F.easing;if (1 === h) A = F.endValue;else { + var E = F.endValue - F.startValue;if (A = F.startValue + E * j(h, u, E), !g && A === F.currentValue) continue; + }if (F.currentValue = A, "tween" === k) y = A;else { + if (S.Hooks.registered[k]) { + var H = S.Hooks.getRoot(k), + N = i(V).rootPropertyValueCache[H];N && (F.rootPropertyValue = N); + }var L = S.setPropertyValue(V, k, F.currentValue + (0 === parseFloat(A) ? "" : F.unitType), F.rootPropertyValue, F.scrollData);S.Hooks.registered[k] && (i(V).rootPropertyValueCache[H] = S.Normalizations.registered[H] ? S.Normalizations.registered[H]("extract", null, L[1]) : L[1]), "transform" === L[0] && (C = !0); + } + } + }u.mobileHA && i(V).transformCache.translate3d === a && (i(V).transformCache.translate3d = "(0px, 0px, 0px)", C = !0), C && S.flushTransformCache(V); + } + }u.display !== a && "none" !== u.display && (b.State.calls[o][2].display = !1), u.visibility !== a && "hidden" !== u.visibility && (b.State.calls[o][2].visibility = !1), u.progress && u.progress.call(s[1], s[1], h, Math.max(0, d + u.duration - t), d, y), 1 === h && p(o); + } + } + }b.State.isTicking && w(c); + }function p(e, t) { + if (!b.State.calls[e]) return !1;for (var r = b.State.calls[e][0], n = b.State.calls[e][1], o = b.State.calls[e][2], s = b.State.calls[e][4], l = !1, u = 0, c = r.length; c > u; u++) { + var p = r[u].element;if (t || o.loop || ("none" === o.display && S.setPropertyValue(p, "display", o.display), "hidden" === o.visibility && S.setPropertyValue(p, "visibility", o.visibility)), o.loop !== !0 && (f.queue(p)[1] === a || !/\.velocityQueueEntryFlag/i.test(f.queue(p)[1])) && i(p)) { + i(p).isAnimating = !1, i(p).rootPropertyValueCache = {};var d = !1;f.each(S.Lists.transforms3D, function (e, t) { + var r = /^scale/.test(t) ? 1 : 0, + n = i(p).transformCache[t];i(p).transformCache[t] !== a && new RegExp("^\\(" + r + "[^.]").test(n) && (d = !0, delete i(p).transformCache[t]); + }), o.mobileHA && (d = !0, delete i(p).transformCache.translate3d), d && S.flushTransformCache(p), S.Values.removeClass(p, "velocity-animating"); + }if (!t && o.complete && !o.loop && u === c - 1) try { + o.complete.call(n, n); + } catch (g) { + setTimeout(function () { + throw g; + }, 1); + }s && o.loop !== !0 && s(n), i(p) && o.loop === !0 && !t && (f.each(i(p).tweensContainer, function (e, t) { + /^rotate/.test(e) && 360 === parseFloat(t.endValue) && (t.endValue = 0, t.startValue = 360), /^backgroundPosition/.test(e) && 100 === parseFloat(t.endValue) && "%" === t.unitType && (t.endValue = 0, t.startValue = 100); + }), b(p, "reverse", { loop: !0, delay: o.delay })), o.queue !== !1 && f.dequeue(p, o.queue); + }b.State.calls[e] = !1;for (var m = 0, y = b.State.calls.length; y > m; m++) { + if (b.State.calls[m] !== !1) { + l = !0;break; + } + }l === !1 && (b.State.isTicking = !1, delete b.State.calls, b.State.calls = []); + }var f, + d = function () { + if (r.documentMode) return r.documentMode;for (var e = 7; e > 4; e--) { + var t = r.createElement("div");if (t.innerHTML = "<!--[if IE " + e + "]><span></span><![endif]-->", t.getElementsByTagName("span").length) return t = null, e; + }return a; + }(), + g = function () { + var e = 0;return t.webkitRequestAnimationFrame || t.mozRequestAnimationFrame || function (t) { + var r, + a = new Date().getTime();return r = Math.max(0, 16 - (a - e)), e = a + r, setTimeout(function () { + t(a + r); + }, r); + }; + }(), + m = { isString: function (e) { + return "string" == typeof e; + }, isArray: Array.isArray || function (e) { + return "[object Array]" === Object.prototype.toString.call(e); + }, isFunction: function (e) { + return "[object Function]" === Object.prototype.toString.call(e); + }, isNode: function (e) { + return e && e.nodeType; + }, isNodeList: function (e) { + return "object" == typeof e && /^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e)) && e.length !== a && (0 === e.length || "object" == typeof e[0] && e[0].nodeType > 0); + }, isWrapped: function (e) { + return e && (e.jquery || t.Zepto && t.Zepto.zepto.isZ(e)); + }, isSVG: function (e) { + return t.SVGElement && e instanceof t.SVGElement; + }, isEmptyObject: function (e) { + for (var t in e) { + return !1; + }return !0; + } }, + y = !1;if (e.fn && e.fn.jquery ? (f = e, y = !0) : f = t.Velocity.Utilities, 8 >= d && !y) throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if (7 >= d) return void (jQuery.fn.velocity = jQuery.fn.animate);var h = 400, + v = "swing", + b = { State: { isMobile: /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent), isAndroid: /Android/i.test(navigator.userAgent), isGingerbread: /Android 2\.3\.[3-7]/i.test(navigator.userAgent), isChrome: t.chrome, isFirefox: /Firefox/i.test(navigator.userAgent), prefixElement: r.createElement("div"), prefixMatches: {}, scrollAnchor: null, scrollPropertyLeft: null, scrollPropertyTop: null, isTicking: !1, calls: [] }, CSS: {}, Utilities: f, Redirects: {}, Easings: {}, Promise: t.Promise, defaults: { queue: "", duration: h, easing: v, begin: a, complete: a, progress: a, display: a, visibility: a, loop: !1, delay: !1, mobileHA: !0, _cacheValues: !0 }, init: function (e) { + f.data(e, "velocity", { isSVG: m.isSVG(e), isAnimating: !1, computedStyle: null, tweensContainer: null, rootPropertyValueCache: {}, transformCache: {} }); + }, hook: null, mock: !1, version: { major: 1, minor: 2, patch: 2 }, debug: !1 };t.pageYOffset !== a ? (b.State.scrollAnchor = t, b.State.scrollPropertyLeft = "pageXOffset", b.State.scrollPropertyTop = "pageYOffset") : (b.State.scrollAnchor = r.documentElement || r.body.parentNode || r.body, b.State.scrollPropertyLeft = "scrollLeft", b.State.scrollPropertyTop = "scrollTop");var x = function () { + function e(e) { + return -e.tension * e.x - e.friction * e.v; + }function t(t, r, a) { + var n = { x: t.x + a.dx * r, v: t.v + a.dv * r, tension: t.tension, friction: t.friction };return { dx: n.v, dv: e(n) }; + }function r(r, a) { + var n = { dx: r.v, dv: e(r) }, + o = t(r, .5 * a, n), + i = t(r, .5 * a, o), + s = t(r, a, i), + l = 1 / 6 * (n.dx + 2 * (o.dx + i.dx) + s.dx), + u = 1 / 6 * (n.dv + 2 * (o.dv + i.dv) + s.dv);return r.x = r.x + l * a, r.v = r.v + u * a, r; + }return function a(e, t, n) { + var o, + i, + s, + l = { x: -1, v: 0, tension: null, friction: null }, + u = [0], + c = 0, + p = 1e-4, + f = .016;for (e = parseFloat(e) || 500, t = parseFloat(t) || 20, n = n || null, l.tension = e, l.friction = t, o = null !== n, o ? (c = a(e, t), i = c / n * f) : i = f; s = r(s || l, i), u.push(1 + s.x), c += 16, Math.abs(s.x) > p && Math.abs(s.v) > p;) {}return o ? function (e) { + return u[e * (u.length - 1) | 0]; + } : c; + }; + }();b.Easings = { linear: function (e) { + return e; + }, swing: function (e) { + return .5 - Math.cos(e * Math.PI) / 2; + }, spring: function (e) { + return 1 - Math.cos(4.5 * e * Math.PI) * Math.exp(6 * -e); + } }, f.each([["ease", [.25, .1, .25, 1]], ["ease-in", [.42, 0, 1, 1]], ["ease-out", [0, 0, .58, 1]], ["ease-in-out", [.42, 0, .58, 1]], ["easeInSine", [.47, 0, .745, .715]], ["easeOutSine", [.39, .575, .565, 1]], ["easeInOutSine", [.445, .05, .55, .95]], ["easeInQuad", [.55, .085, .68, .53]], ["easeOutQuad", [.25, .46, .45, .94]], ["easeInOutQuad", [.455, .03, .515, .955]], ["easeInCubic", [.55, .055, .675, .19]], ["easeOutCubic", [.215, .61, .355, 1]], ["easeInOutCubic", [.645, .045, .355, 1]], ["easeInQuart", [.895, .03, .685, .22]], ["easeOutQuart", [.165, .84, .44, 1]], ["easeInOutQuart", [.77, 0, .175, 1]], ["easeInQuint", [.755, .05, .855, .06]], ["easeOutQuint", [.23, 1, .32, 1]], ["easeInOutQuint", [.86, 0, .07, 1]], ["easeInExpo", [.95, .05, .795, .035]], ["easeOutExpo", [.19, 1, .22, 1]], ["easeInOutExpo", [1, 0, 0, 1]], ["easeInCirc", [.6, .04, .98, .335]], ["easeOutCirc", [.075, .82, .165, 1]], ["easeInOutCirc", [.785, .135, .15, .86]]], function (e, t) { + b.Easings[t[0]] = l.apply(null, t[1]); + });var S = b.CSS = { RegEx: { isHex: /^#([A-f\d]{3}){1,2}$/i, valueUnwrap: /^[A-z]+\((.*)\)$/i, wrappedValueAlreadyExtracted: /[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/, valueSplit: /([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi }, Lists: { colors: ["fill", "stroke", "stopColor", "color", "backgroundColor", "borderColor", "borderTopColor", "borderRightColor", "borderBottomColor", "borderLeftColor", "outlineColor"], transformsBase: ["translateX", "translateY", "scale", "scaleX", "scaleY", "skewX", "skewY", "rotateZ"], transforms3D: ["transformPerspective", "translateZ", "scaleZ", "rotateX", "rotateY"] }, Hooks: { templates: { textShadow: ["Color X Y Blur", "black 0px 0px 0px"], boxShadow: ["Color X Y Blur Spread", "black 0px 0px 0px 0px"], clip: ["Top Right Bottom Left", "0px 0px 0px 0px"], backgroundPosition: ["X Y", "0% 0%"], transformOrigin: ["X Y Z", "50% 50% 0px"], perspectiveOrigin: ["X Y", "50% 50%"] }, registered: {}, register: function () { + for (var e = 0; e < S.Lists.colors.length; e++) { + var t = "color" === S.Lists.colors[e] ? "0 0 0 1" : "255 255 255 1";S.Hooks.templates[S.Lists.colors[e]] = ["Red Green Blue Alpha", t]; + }var r, a, n;if (d) for (r in S.Hooks.templates) { + a = S.Hooks.templates[r], n = a[0].split(" ");var o = a[1].match(S.RegEx.valueSplit);"Color" === n[0] && (n.push(n.shift()), o.push(o.shift()), S.Hooks.templates[r] = [n.join(" "), o.join(" ")]); + }for (r in S.Hooks.templates) { + a = S.Hooks.templates[r], n = a[0].split(" ");for (var e in n) { + var i = r + n[e], + s = e;S.Hooks.registered[i] = [r, s]; + } + } + }, getRoot: function (e) { + var t = S.Hooks.registered[e];return t ? t[0] : e; + }, cleanRootPropertyValue: function (e, t) { + return S.RegEx.valueUnwrap.test(t) && (t = t.match(S.RegEx.valueUnwrap)[1]), S.Values.isCSSNullValue(t) && (t = S.Hooks.templates[e][1]), t; + }, extractValue: function (e, t) { + var r = S.Hooks.registered[e];if (r) { + var a = r[0], + n = r[1];return t = S.Hooks.cleanRootPropertyValue(a, t), t.toString().match(S.RegEx.valueSplit)[n]; + }return t; + }, injectValue: function (e, t, r) { + var a = S.Hooks.registered[e];if (a) { + var n, + o, + i = a[0], + s = a[1];return r = S.Hooks.cleanRootPropertyValue(i, r), n = r.toString().match(S.RegEx.valueSplit), n[s] = t, o = n.join(" "); + }return r; + } }, Normalizations: { registered: { clip: function (e, t, r) { + switch (e) {case "name": + return "clip";case "extract": + var a;return S.RegEx.wrappedValueAlreadyExtracted.test(r) ? a = r : (a = r.toString().match(S.RegEx.valueUnwrap), a = a ? a[1].replace(/,(\s+)?/g, " ") : r), a;case "inject": + return "rect(" + r + ")";} + }, blur: function (e, t, r) { + switch (e) {case "name": + return b.State.isFirefox ? "filter" : "-webkit-filter";case "extract": + var a = parseFloat(r);if (!a && 0 !== a) { + var n = r.toString().match(/blur\(([0-9]+[A-z]+)\)/i);a = n ? n[1] : 0; + }return a;case "inject": + return parseFloat(r) ? "blur(" + r + ")" : "none";} + }, opacity: function (e, t, r) { + if (8 >= d) switch (e) {case "name": + return "filter";case "extract": + var a = r.toString().match(/alpha\(opacity=(.*)\)/i);return r = a ? a[1] / 100 : 1;case "inject": + return t.style.zoom = 1, parseFloat(r) >= 1 ? "" : "alpha(opacity=" + parseInt(100 * parseFloat(r), 10) + ")";} else switch (e) {case "name": + return "opacity";case "extract": + return r;case "inject": + return r;} + } }, register: function () { + 9 >= d || b.State.isGingerbread || (S.Lists.transformsBase = S.Lists.transformsBase.concat(S.Lists.transforms3D));for (var e = 0; e < S.Lists.transformsBase.length; e++) { + !function () { + var t = S.Lists.transformsBase[e];S.Normalizations.registered[t] = function (e, r, n) { + switch (e) {case "name": + return "transform";case "extract": + return i(r) === a || i(r).transformCache[t] === a ? /^scale/i.test(t) ? 1 : 0 : i(r).transformCache[t].replace(/[()]/g, "");case "inject": + var o = !1;switch (t.substr(0, t.length - 1)) {case "translate": + o = !/(%|px|em|rem|vw|vh|\d)$/i.test(n);break;case "scal":case "scale": + b.State.isAndroid && i(r).transformCache[t] === a && 1 > n && (n = 1), o = !/(\d)$/i.test(n);break;case "skew": + o = !/(deg|\d)$/i.test(n);break;case "rotate": + o = !/(deg|\d)$/i.test(n);}return o || (i(r).transformCache[t] = "(" + n + ")"), i(r).transformCache[t];} + }; + }(); + }for (var e = 0; e < S.Lists.colors.length; e++) { + !function () { + var t = S.Lists.colors[e];S.Normalizations.registered[t] = function (e, r, n) { + switch (e) {case "name": + return t;case "extract": + var o;if (S.RegEx.wrappedValueAlreadyExtracted.test(n)) o = n;else { + var i, + s = { black: "rgb(0, 0, 0)", blue: "rgb(0, 0, 255)", gray: "rgb(128, 128, 128)", green: "rgb(0, 128, 0)", red: "rgb(255, 0, 0)", white: "rgb(255, 255, 255)" };/^[A-z]+$/i.test(n) ? i = s[n] !== a ? s[n] : s.black : S.RegEx.isHex.test(n) ? i = "rgb(" + S.Values.hexToRgb(n).join(" ") + ")" : /^rgba?\(/i.test(n) || (i = s.black), o = (i || n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g, " "); + }return 8 >= d || 3 !== o.split(" ").length || (o += " 1"), o;case "inject": + return 8 >= d ? 4 === n.split(" ").length && (n = n.split(/\s+/).slice(0, 3).join(" ")) : 3 === n.split(" ").length && (n += " 1"), (8 >= d ? "rgb" : "rgba") + "(" + n.replace(/\s+/g, ",").replace(/\.(\d)+(?=,)/g, "") + ")";} + }; + }(); + } + } }, Names: { camelCase: function (e) { + return e.replace(/-(\w)/g, function (e, t) { + return t.toUpperCase(); + }); + }, SVGAttribute: function (e) { + var t = "width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return (d || b.State.isAndroid && !b.State.isChrome) && (t += "|transform"), new RegExp("^(" + t + ")$", "i").test(e); + }, prefixCheck: function (e) { + if (b.State.prefixMatches[e]) return [b.State.prefixMatches[e], !0];for (var t = ["", "Webkit", "Moz", "ms", "O"], r = 0, a = t.length; a > r; r++) { + var n;if (n = 0 === r ? e : t[r] + e.replace(/^\w/, function (e) { + return e.toUpperCase(); + }), m.isString(b.State.prefixElement.style[n])) return b.State.prefixMatches[e] = n, [n, !0]; + }return [e, !1]; + } }, Values: { hexToRgb: function (e) { + var t, + r = /^#?([a-f\d])([a-f\d])([a-f\d])$/i, + a = /^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return e = e.replace(r, function (e, t, r, a) { + return t + t + r + r + a + a; + }), t = a.exec(e), t ? [parseInt(t[1], 16), parseInt(t[2], 16), parseInt(t[3], 16)] : [0, 0, 0]; + }, isCSSNullValue: function (e) { + return 0 == e || /^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e); + }, getUnitType: function (e) { + return (/^(rotate|skew)/i.test(e) ? "deg" : /(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e) ? "" : "px" + ); + }, getDisplayType: function (e) { + var t = e && e.tagName.toString().toLowerCase();return (/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t) ? "inline" : /^(li)$/i.test(t) ? "list-item" : /^(tr)$/i.test(t) ? "table-row" : /^(table)$/i.test(t) ? "table" : /^(tbody)$/i.test(t) ? "table-row-group" : "block" + ); + }, addClass: function (e, t) { + e.classList ? e.classList.add(t) : e.className += (e.className.length ? " " : "") + t; + }, removeClass: function (e, t) { + e.classList ? e.classList.remove(t) : e.className = e.className.toString().replace(new RegExp("(^|\\s)" + t.split(" ").join("|") + "(\\s|$)", "gi"), " "); + } }, getPropertyValue: function (e, r, n, o) { + function s(e, r) { + function n() { + u && S.setPropertyValue(e, "display", "none"); + }var l = 0;if (8 >= d) l = f.css(e, r);else { + var u = !1;if (/^(width|height)$/.test(r) && 0 === S.getPropertyValue(e, "display") && (u = !0, S.setPropertyValue(e, "display", S.Values.getDisplayType(e))), !o) { + if ("height" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) { + var c = e.offsetHeight - (parseFloat(S.getPropertyValue(e, "borderTopWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderBottomWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingTop")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingBottom")) || 0);return n(), c; + }if ("width" === r && "border-box" !== S.getPropertyValue(e, "boxSizing").toString().toLowerCase()) { + var p = e.offsetWidth - (parseFloat(S.getPropertyValue(e, "borderLeftWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "borderRightWidth")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingLeft")) || 0) - (parseFloat(S.getPropertyValue(e, "paddingRight")) || 0);return n(), p; + } + }var g;g = i(e) === a ? t.getComputedStyle(e, null) : i(e).computedStyle ? i(e).computedStyle : i(e).computedStyle = t.getComputedStyle(e, null), "borderColor" === r && (r = "borderTopColor"), l = 9 === d && "filter" === r ? g.getPropertyValue(r) : g[r], ("" === l || null === l) && (l = e.style[r]), n(); + }if ("auto" === l && /^(top|right|bottom|left)$/i.test(r)) { + var m = s(e, "position");("fixed" === m || "absolute" === m && /top|left/i.test(r)) && (l = f(e).position()[r] + "px"); + }return l; + }var l;if (S.Hooks.registered[r]) { + var u = r, + c = S.Hooks.getRoot(u);n === a && (n = S.getPropertyValue(e, S.Names.prefixCheck(c)[0])), S.Normalizations.registered[c] && (n = S.Normalizations.registered[c]("extract", e, n)), l = S.Hooks.extractValue(u, n); + } else if (S.Normalizations.registered[r]) { + var p, g;p = S.Normalizations.registered[r]("name", e), "transform" !== p && (g = s(e, S.Names.prefixCheck(p)[0]), S.Values.isCSSNullValue(g) && S.Hooks.templates[r] && (g = S.Hooks.templates[r][1])), l = S.Normalizations.registered[r]("extract", e, g); + }if (!/^[\d-]/.test(l)) if (i(e) && i(e).isSVG && S.Names.SVGAttribute(r)) { + if (/^(height|width)$/i.test(r)) try { + l = e.getBBox()[r]; + } catch (m) { + l = 0; + } else l = e.getAttribute(r); + } else l = s(e, S.Names.prefixCheck(r)[0]);return S.Values.isCSSNullValue(l) && (l = 0), b.debug >= 2 && console.log("Get " + r + ": " + l), l; + }, setPropertyValue: function (e, r, a, n, o) { + var s = r;if ("scroll" === r) o.container ? o.container["scroll" + o.direction] = a : "Left" === o.direction ? t.scrollTo(a, o.alternateValue) : t.scrollTo(o.alternateValue, a);else if (S.Normalizations.registered[r] && "transform" === S.Normalizations.registered[r]("name", e)) S.Normalizations.registered[r]("inject", e, a), s = "transform", a = i(e).transformCache[r];else { + if (S.Hooks.registered[r]) { + var l = r, + u = S.Hooks.getRoot(r);n = n || S.getPropertyValue(e, u), a = S.Hooks.injectValue(l, a, n), r = u; + }if (S.Normalizations.registered[r] && (a = S.Normalizations.registered[r]("inject", e, a), r = S.Normalizations.registered[r]("name", e)), s = S.Names.prefixCheck(r)[0], 8 >= d) try { + e.style[s] = a; + } catch (c) { + b.debug && console.log("Browser does not support [" + a + "] for [" + s + "]"); + } else i(e) && i(e).isSVG && S.Names.SVGAttribute(r) ? e.setAttribute(r, a) : e.style[s] = a;b.debug >= 2 && console.log("Set " + r + " (" + s + "): " + a); + }return [s, a]; + }, flushTransformCache: function (e) { + function t(t) { + return parseFloat(S.getPropertyValue(e, t)); + }var r = "";if ((d || b.State.isAndroid && !b.State.isChrome) && i(e).isSVG) { + var a = { translate: [t("translateX"), t("translateY")], skewX: [t("skewX")], skewY: [t("skewY")], scale: 1 !== t("scale") ? [t("scale"), t("scale")] : [t("scaleX"), t("scaleY")], rotate: [t("rotateZ"), 0, 0] };f.each(i(e).transformCache, function (e) { + /^translate/i.test(e) ? e = "translate" : /^scale/i.test(e) ? e = "scale" : /^rotate/i.test(e) && (e = "rotate"), a[e] && (r += e + "(" + a[e].join(" ") + ") ", delete a[e]); + }); + } else { + var n, o;f.each(i(e).transformCache, function (t) { + return n = i(e).transformCache[t], "transformPerspective" === t ? (o = n, !0) : (9 === d && "rotateZ" === t && (t = "rotate"), void (r += t + n + " ")); + }), o && (r = "perspective" + o + " " + r); + }S.setPropertyValue(e, "transform", r); + } };S.Hooks.register(), S.Normalizations.register(), b.hook = function (e, t, r) { + var n = a;return e = o(e), f.each(e, function (e, o) { + if (i(o) === a && b.init(o), r === a) n === a && (n = b.CSS.getPropertyValue(o, t));else { + var s = b.CSS.setPropertyValue(o, t, r);"transform" === s[0] && b.CSS.flushTransformCache(o), n = s; + } + }), n; + };var P = function () { + function e() { + return s ? k.promise || null : l; + }function n() { + function e(e) { + function p(e, t) { + var r = a, + n = a, + i = a;return m.isArray(e) ? (r = e[0], !m.isArray(e[1]) && /^[\d-]/.test(e[1]) || m.isFunction(e[1]) || S.RegEx.isHex.test(e[1]) ? i = e[1] : (m.isString(e[1]) && !S.RegEx.isHex.test(e[1]) || m.isArray(e[1])) && (n = t ? e[1] : u(e[1], s.duration), e[2] !== a && (i = e[2]))) : r = e, t || (n = n || s.easing), m.isFunction(r) && (r = r.call(o, V, w)), m.isFunction(i) && (i = i.call(o, V, w)), [r || 0, n, i]; + }function d(e, t) { + var r, a;return a = (t || "0").toString().toLowerCase().replace(/[%A-z]+$/, function (e) { + return r = e, ""; + }), r || (r = S.Values.getUnitType(e)), [a, r]; + }function h() { + var e = { myParent: o.parentNode || r.body, position: S.getPropertyValue(o, "position"), fontSize: S.getPropertyValue(o, "fontSize") }, + a = e.position === L.lastPosition && e.myParent === L.lastParent, + n = e.fontSize === L.lastFontSize;L.lastParent = e.myParent, L.lastPosition = e.position, L.lastFontSize = e.fontSize;var s = 100, + l = {};if (n && a) l.emToPx = L.lastEmToPx, l.percentToPxWidth = L.lastPercentToPxWidth, l.percentToPxHeight = L.lastPercentToPxHeight;else { + var u = i(o).isSVG ? r.createElementNS("http://www.w3.org/2000/svg", "rect") : r.createElement("div");b.init(u), e.myParent.appendChild(u), f.each(["overflow", "overflowX", "overflowY"], function (e, t) { + b.CSS.setPropertyValue(u, t, "hidden"); + }), b.CSS.setPropertyValue(u, "position", e.position), b.CSS.setPropertyValue(u, "fontSize", e.fontSize), b.CSS.setPropertyValue(u, "boxSizing", "content-box"), f.each(["minWidth", "maxWidth", "width", "minHeight", "maxHeight", "height"], function (e, t) { + b.CSS.setPropertyValue(u, t, s + "%"); + }), b.CSS.setPropertyValue(u, "paddingLeft", s + "em"), l.percentToPxWidth = L.lastPercentToPxWidth = (parseFloat(S.getPropertyValue(u, "width", null, !0)) || 1) / s, l.percentToPxHeight = L.lastPercentToPxHeight = (parseFloat(S.getPropertyValue(u, "height", null, !0)) || 1) / s, l.emToPx = L.lastEmToPx = (parseFloat(S.getPropertyValue(u, "paddingLeft")) || 1) / s, e.myParent.removeChild(u); + }return null === L.remToPx && (L.remToPx = parseFloat(S.getPropertyValue(r.body, "fontSize")) || 16), null === L.vwToPx && (L.vwToPx = parseFloat(t.innerWidth) / 100, L.vhToPx = parseFloat(t.innerHeight) / 100), l.remToPx = L.remToPx, l.vwToPx = L.vwToPx, l.vhToPx = L.vhToPx, b.debug >= 1 && console.log("Unit ratios: " + JSON.stringify(l), o), l; + }if (s.begin && 0 === V) try { + s.begin.call(g, g); + } catch (x) { + setTimeout(function () { + throw x; + }, 1); + }if ("scroll" === A) { + var P, + C, + T, + F = /^x$/i.test(s.axis) ? "Left" : "Top", + j = parseFloat(s.offset) || 0;s.container ? m.isWrapped(s.container) || m.isNode(s.container) ? (s.container = s.container[0] || s.container, P = s.container["scroll" + F], T = P + f(o).position()[F.toLowerCase()] + j) : s.container = null : (P = b.State.scrollAnchor[b.State["scrollProperty" + F]], C = b.State.scrollAnchor[b.State["scrollProperty" + ("Left" === F ? "Top" : "Left")]], T = f(o).offset()[F.toLowerCase()] + j), l = { scroll: { rootPropertyValue: !1, startValue: P, currentValue: P, endValue: T, unitType: "", easing: s.easing, scrollData: { container: s.container, direction: F, alternateValue: C } }, element: o }, b.debug && console.log("tweensContainer (scroll): ", l.scroll, o); + } else if ("reverse" === A) { + if (!i(o).tweensContainer) return void f.dequeue(o, s.queue);"none" === i(o).opts.display && (i(o).opts.display = "auto"), "hidden" === i(o).opts.visibility && (i(o).opts.visibility = "visible"), i(o).opts.loop = !1, i(o).opts.begin = null, i(o).opts.complete = null, v.easing || delete s.easing, v.duration || delete s.duration, s = f.extend({}, i(o).opts, s);var E = f.extend(!0, {}, i(o).tweensContainer);for (var H in E) { + if ("element" !== H) { + var N = E[H].startValue;E[H].startValue = E[H].currentValue = E[H].endValue, E[H].endValue = N, m.isEmptyObject(v) || (E[H].easing = s.easing), b.debug && console.log("reverse tweensContainer (" + H + "): " + JSON.stringify(E[H]), o); + } + }l = E; + } else if ("start" === A) { + var E;i(o).tweensContainer && i(o).isAnimating === !0 && (E = i(o).tweensContainer), f.each(y, function (e, t) { + if (RegExp("^" + S.Lists.colors.join("$|^") + "$").test(e)) { + var r = p(t, !0), + n = r[0], + o = r[1], + i = r[2];if (S.RegEx.isHex.test(n)) { + for (var s = ["Red", "Green", "Blue"], l = S.Values.hexToRgb(n), u = i ? S.Values.hexToRgb(i) : a, c = 0; c < s.length; c++) { + var f = [l[c]];o && f.push(o), u !== a && f.push(u[c]), y[e + s[c]] = f; + }delete y[e]; + } + } + });for (var z in y) { + var O = p(y[z]), + q = O[0], + $ = O[1], + M = O[2];z = S.Names.camelCase(z);var I = S.Hooks.getRoot(z), + B = !1;if (i(o).isSVG || "tween" === I || S.Names.prefixCheck(I)[1] !== !1 || S.Normalizations.registered[I] !== a) { + (s.display !== a && null !== s.display && "none" !== s.display || s.visibility !== a && "hidden" !== s.visibility) && /opacity|filter/.test(z) && !M && 0 !== q && (M = 0), s._cacheValues && E && E[z] ? (M === a && (M = E[z].endValue + E[z].unitType), B = i(o).rootPropertyValueCache[I]) : S.Hooks.registered[z] ? M === a ? (B = S.getPropertyValue(o, I), M = S.getPropertyValue(o, z, B)) : B = S.Hooks.templates[I][1] : M === a && (M = S.getPropertyValue(o, z));var W, + G, + Y, + D = !1;if (W = d(z, M), M = W[0], Y = W[1], W = d(z, q), q = W[0].replace(/^([+-\/*])=/, function (e, t) { + return D = t, ""; + }), G = W[1], M = parseFloat(M) || 0, q = parseFloat(q) || 0, "%" === G && (/^(fontSize|lineHeight)$/.test(z) ? (q /= 100, G = "em") : /^scale/.test(z) ? (q /= 100, G = "") : /(Red|Green|Blue)$/i.test(z) && (q = q / 100 * 255, G = "")), /[\/*]/.test(D)) G = Y;else if (Y !== G && 0 !== M) if (0 === q) G = Y;else { + n = n || h();var Q = /margin|padding|left|right|width|text|word|letter/i.test(z) || /X$/.test(z) || "x" === z ? "x" : "y";switch (Y) {case "%": + M *= "x" === Q ? n.percentToPxWidth : n.percentToPxHeight;break;case "px": + break;default: + M *= n[Y + "ToPx"];}switch (G) {case "%": + M *= 1 / ("x" === Q ? n.percentToPxWidth : n.percentToPxHeight);break;case "px": + break;default: + M *= 1 / n[G + "ToPx"];} + }switch (D) {case "+": + q = M + q;break;case "-": + q = M - q;break;case "*": + q = M * q;break;case "/": + q = M / q;}l[z] = { rootPropertyValue: B, startValue: M, currentValue: M, endValue: q, unitType: G, easing: $ }, b.debug && console.log("tweensContainer (" + z + "): " + JSON.stringify(l[z]), o); + } else b.debug && console.log("Skipping [" + I + "] due to a lack of browser support."); + }l.element = o; + }l.element && (S.Values.addClass(o, "velocity-animating"), R.push(l), "" === s.queue && (i(o).tweensContainer = l, i(o).opts = s), i(o).isAnimating = !0, V === w - 1 ? (b.State.calls.push([R, g, s, null, k.resolver]), b.State.isTicking === !1 && (b.State.isTicking = !0, c())) : V++); + }var n, + o = this, + s = f.extend({}, b.defaults, v), + l = {};switch (i(o) === a && b.init(o), parseFloat(s.delay) && s.queue !== !1 && f.queue(o, s.queue, function (e) { + b.velocityQueueEntryFlag = !0, i(o).delayTimer = { setTimeout: setTimeout(e, parseFloat(s.delay)), next: e }; + }), s.duration.toString().toLowerCase()) {case "fast": + s.duration = 200;break;case "normal": + s.duration = h;break;case "slow": + s.duration = 600;break;default: + s.duration = parseFloat(s.duration) || 1;}b.mock !== !1 && (b.mock === !0 ? s.duration = s.delay = 1 : (s.duration *= parseFloat(b.mock) || 1, s.delay *= parseFloat(b.mock) || 1)), s.easing = u(s.easing, s.duration), s.begin && !m.isFunction(s.begin) && (s.begin = null), s.progress && !m.isFunction(s.progress) && (s.progress = null), s.complete && !m.isFunction(s.complete) && (s.complete = null), s.display !== a && null !== s.display && (s.display = s.display.toString().toLowerCase(), "auto" === s.display && (s.display = b.CSS.Values.getDisplayType(o))), s.visibility !== a && null !== s.visibility && (s.visibility = s.visibility.toString().toLowerCase()), s.mobileHA = s.mobileHA && b.State.isMobile && !b.State.isGingerbread, s.queue === !1 ? s.delay ? setTimeout(e, s.delay) : e() : f.queue(o, s.queue, function (t, r) { + return r === !0 ? (k.promise && k.resolver(g), !0) : (b.velocityQueueEntryFlag = !0, void e(t)); + }), "" !== s.queue && "fx" !== s.queue || "inprogress" === f.queue(o)[0] || f.dequeue(o); + }var s, + l, + d, + g, + y, + v, + x = arguments[0] && (arguments[0].p || f.isPlainObject(arguments[0].properties) && !arguments[0].properties.names || m.isString(arguments[0].properties));if (m.isWrapped(this) ? (s = !1, d = 0, g = this, l = this) : (s = !0, d = 1, g = x ? arguments[0].elements || arguments[0].e : arguments[0]), g = o(g)) { + x ? (y = arguments[0].properties || arguments[0].p, v = arguments[0].options || arguments[0].o) : (y = arguments[d], v = arguments[d + 1]);var w = g.length, + V = 0;if (!/^(stop|finish)$/i.test(y) && !f.isPlainObject(v)) { + var C = d + 1;v = {};for (var T = C; T < arguments.length; T++) { + m.isArray(arguments[T]) || !/^(fast|normal|slow)$/i.test(arguments[T]) && !/^\d/.test(arguments[T]) ? m.isString(arguments[T]) || m.isArray(arguments[T]) ? v.easing = arguments[T] : m.isFunction(arguments[T]) && (v.complete = arguments[T]) : v.duration = arguments[T]; + } + }var k = { promise: null, resolver: null, rejecter: null };s && b.Promise && (k.promise = new b.Promise(function (e, t) { + k.resolver = e, k.rejecter = t; + }));var A;switch (y) {case "scroll": + A = "scroll";break;case "reverse": + A = "reverse";break;case "finish":case "stop": + f.each(g, function (e, t) { + i(t) && i(t).delayTimer && (clearTimeout(i(t).delayTimer.setTimeout), i(t).delayTimer.next && i(t).delayTimer.next(), delete i(t).delayTimer); + });var F = [];return f.each(b.State.calls, function (e, t) { + t && f.each(t[1], function (r, n) { + var o = v === a ? "" : v;return o === !0 || t[2].queue === o || v === a && t[2].queue === !1 ? void f.each(g, function (r, a) { + a === n && ((v === !0 || m.isString(v)) && (f.each(f.queue(a, m.isString(v) ? v : ""), function (e, t) { + m.isFunction(t) && t(null, !0); + }), f.queue(a, m.isString(v) ? v : "", [])), "stop" === y ? (i(a) && i(a).tweensContainer && o !== !1 && f.each(i(a).tweensContainer, function (e, t) { + t.endValue = t.currentValue; + }), F.push(e)) : "finish" === y && (t[2].duration = 1)); + }) : !0; + }); + }), "stop" === y && (f.each(F, function (e, t) { + p(t, !0); + }), k.promise && k.resolver(g)), e();default: + if (!f.isPlainObject(y) || m.isEmptyObject(y)) { + if (m.isString(y) && b.Redirects[y]) { + var j = f.extend({}, v), + E = j.duration, + H = j.delay || 0;return j.backwards === !0 && (g = f.extend(!0, [], g).reverse()), f.each(g, function (e, t) { + parseFloat(j.stagger) ? j.delay = H + parseFloat(j.stagger) * e : m.isFunction(j.stagger) && (j.delay = H + j.stagger.call(t, e, w)), j.drag && (j.duration = parseFloat(E) || (/^(callout|transition)/.test(y) ? 1e3 : h), j.duration = Math.max(j.duration * (j.backwards ? 1 - e / w : (e + 1) / w), .75 * j.duration, 200)), b.Redirects[y].call(t, t, j || {}, e, w, g, k.promise ? k : a); + }), e(); + }var N = "Velocity: First argument (" + y + ") was not a property map, a known action, or a registered redirect. Aborting.";return k.promise ? k.rejecter(new Error(N)) : console.log(N), e(); + }A = "start";}var L = { lastParent: null, lastPosition: null, lastFontSize: null, lastPercentToPxWidth: null, lastPercentToPxHeight: null, lastEmToPx: null, remToPx: null, vwToPx: null, vhToPx: null }, + R = [];f.each(g, function (e, t) { + m.isNode(t) && n.call(t); + });var z, + j = f.extend({}, b.defaults, v);if (j.loop = parseInt(j.loop), z = 2 * j.loop - 1, j.loop) for (var O = 0; z > O; O++) { + var q = { delay: j.delay, progress: j.progress };O === z - 1 && (q.display = j.display, q.visibility = j.visibility, q.complete = j.complete), P(g, "reverse", q); + }return e(); + } + };b = f.extend(P, b), b.animate = P;var w = t.requestAnimationFrame || g;return b.State.isMobile || r.hidden === a || r.addEventListener("visibilitychange", function () { + r.hidden ? (w = function (e) { + return setTimeout(function () { + e(!0); + }, 16); + }, c()) : w = t.requestAnimationFrame || g; + }), e.Velocity = b, e !== t && (e.fn.velocity = P, e.fn.velocity.defaults = b.defaults), f.each(["Down", "Up"], function (e, t) { + b.Redirects["slide" + t] = function (e, r, n, o, i, s) { + var l = f.extend({}, r), + u = l.begin, + c = l.complete, + p = { height: "", marginTop: "", marginBottom: "", paddingTop: "", paddingBottom: "" }, + d = {};l.display === a && (l.display = "Down" === t ? "inline" === b.CSS.Values.getDisplayType(e) ? "inline-block" : "block" : "none"), l.begin = function () { + u && u.call(i, i);for (var r in p) { + d[r] = e.style[r];var a = b.CSS.getPropertyValue(e, r);p[r] = "Down" === t ? [a, 0] : [0, a]; + }d.overflow = e.style.overflow, e.style.overflow = "hidden"; + }, l.complete = function () { + for (var t in d) { + e.style[t] = d[t]; + }c && c.call(i, i), s && s.resolver(i); + }, b(e, p, l); + }; + }), f.each(["In", "Out"], function (e, t) { + b.Redirects["fade" + t] = function (e, r, n, o, i, s) { + var l = f.extend({}, r), + u = { opacity: "In" === t ? 1 : 0 }, + c = l.complete;l.complete = n !== o - 1 ? l.begin = null : function () { + c && c.call(i, i), s && s.resolver(i); + }, l.display === a && (l.display = "In" === t ? "auto" : "none"), b(this, u, l); + }; + }), b; + }(window.jQuery || window.Zepto || window, window, document); +})); +;!function (a, b, c, d) { + "use strict"; + function k(a, b, c) { + return setTimeout(q(a, c), b); + }function l(a, b, c) { + return Array.isArray(a) ? (m(a, c[b], c), !0) : !1; + }function m(a, b, c) { + var e;if (a) if (a.forEach) a.forEach(b, c);else if (a.length !== d) for (e = 0; e < a.length;) { + b.call(c, a[e], e, a), e++; + } else for (e in a) { + a.hasOwnProperty(e) && b.call(c, a[e], e, a); + } + }function n(a, b, c) { + for (var e = Object.keys(b), f = 0; f < e.length;) { + (!c || c && a[e[f]] === d) && (a[e[f]] = b[e[f]]), f++; + }return a; + }function o(a, b) { + return n(a, b, !0); + }function p(a, b, c) { + var e, + d = b.prototype;e = a.prototype = Object.create(d), e.constructor = a, e._super = d, c && n(e, c); + }function q(a, b) { + return function () { + return a.apply(b, arguments); + }; + }function r(a, b) { + return typeof a == g ? a.apply(b ? b[0] || d : d, b) : a; + }function s(a, b) { + return a === d ? b : a; + }function t(a, b, c) { + m(x(b), function (b) { + a.addEventListener(b, c, !1); + }); + }function u(a, b, c) { + m(x(b), function (b) { + a.removeEventListener(b, c, !1); + }); + }function v(a, b) { + for (; a;) { + if (a == b) return !0;a = a.parentNode; + }return !1; + }function w(a, b) { + return a.indexOf(b) > -1; + }function x(a) { + return a.trim().split(/\s+/g); + }function y(a, b, c) { + if (a.indexOf && !c) return a.indexOf(b);for (var d = 0; d < a.length;) { + if (c && a[d][c] == b || !c && a[d] === b) return d;d++; + }return -1; + }function z(a) { + return Array.prototype.slice.call(a, 0); + }function A(a, b, c) { + for (var d = [], e = [], f = 0; f < a.length;) { + var g = b ? a[f][b] : a[f];y(e, g) < 0 && d.push(a[f]), e[f] = g, f++; + }return c && (d = b ? d.sort(function (a, c) { + return a[b] > c[b]; + }) : d.sort()), d; + }function B(a, b) { + for (var c, f, g = b[0].toUpperCase() + b.slice(1), h = 0; h < e.length;) { + if (c = e[h], f = c ? c + g : b, f in a) return f;h++; + }return d; + }function D() { + return C++; + }function E(a) { + var b = a.ownerDocument;return b.defaultView || b.parentWindow; + }function ab(a, b) { + var c = this;this.manager = a, this.callback = b, this.element = a.element, this.target = a.options.inputTarget, this.domHandler = function (b) { + r(a.options.enable, [a]) && c.handler(b); + }, this.init(); + }function bb(a) { + var b, + c = a.options.inputClass;return b = c ? c : H ? wb : I ? Eb : G ? Gb : rb, new b(a, cb); + }function cb(a, b, c) { + var d = c.pointers.length, + e = c.changedPointers.length, + f = b & O && 0 === d - e, + g = b & (Q | R) && 0 === d - e;c.isFirst = !!f, c.isFinal = !!g, f && (a.session = {}), c.eventType = b, db(a, c), a.emit("hammer.input", c), a.recognize(c), a.session.prevInput = c; + }function db(a, b) { + var c = a.session, + d = b.pointers, + e = d.length;c.firstInput || (c.firstInput = gb(b)), e > 1 && !c.firstMultiple ? c.firstMultiple = gb(b) : 1 === e && (c.firstMultiple = !1);var f = c.firstInput, + g = c.firstMultiple, + h = g ? g.center : f.center, + i = b.center = hb(d);b.timeStamp = j(), b.deltaTime = b.timeStamp - f.timeStamp, b.angle = lb(h, i), b.distance = kb(h, i), eb(c, b), b.offsetDirection = jb(b.deltaX, b.deltaY), b.scale = g ? nb(g.pointers, d) : 1, b.rotation = g ? mb(g.pointers, d) : 0, fb(c, b);var k = a.element;v(b.srcEvent.target, k) && (k = b.srcEvent.target), b.target = k; + }function eb(a, b) { + var c = b.center, + d = a.offsetDelta || {}, + e = a.prevDelta || {}, + f = a.prevInput || {};(b.eventType === O || f.eventType === Q) && (e = a.prevDelta = { x: f.deltaX || 0, y: f.deltaY || 0 }, d = a.offsetDelta = { x: c.x, y: c.y }), b.deltaX = e.x + (c.x - d.x), b.deltaY = e.y + (c.y - d.y); + }function fb(a, b) { + var f, + g, + h, + j, + c = a.lastInterval || b, + e = b.timeStamp - c.timeStamp;if (b.eventType != R && (e > N || c.velocity === d)) { + var k = c.deltaX - b.deltaX, + l = c.deltaY - b.deltaY, + m = ib(e, k, l);g = m.x, h = m.y, f = i(m.x) > i(m.y) ? m.x : m.y, j = jb(k, l), a.lastInterval = b; + } else f = c.velocity, g = c.velocityX, h = c.velocityY, j = c.direction;b.velocity = f, b.velocityX = g, b.velocityY = h, b.direction = j; + }function gb(a) { + for (var b = [], c = 0; c < a.pointers.length;) { + b[c] = { clientX: h(a.pointers[c].clientX), clientY: h(a.pointers[c].clientY) }, c++; + }return { timeStamp: j(), pointers: b, center: hb(b), deltaX: a.deltaX, deltaY: a.deltaY }; + }function hb(a) { + var b = a.length;if (1 === b) return { x: h(a[0].clientX), y: h(a[0].clientY) };for (var c = 0, d = 0, e = 0; b > e;) { + c += a[e].clientX, d += a[e].clientY, e++; + }return { x: h(c / b), y: h(d / b) }; + }function ib(a, b, c) { + return { x: b / a || 0, y: c / a || 0 }; + }function jb(a, b) { + return a === b ? S : i(a) >= i(b) ? a > 0 ? T : U : b > 0 ? V : W; + }function kb(a, b, c) { + c || (c = $);var d = b[c[0]] - a[c[0]], + e = b[c[1]] - a[c[1]];return Math.sqrt(d * d + e * e); + }function lb(a, b, c) { + c || (c = $);var d = b[c[0]] - a[c[0]], + e = b[c[1]] - a[c[1]];return 180 * Math.atan2(e, d) / Math.PI; + }function mb(a, b) { + return lb(b[1], b[0], _) - lb(a[1], a[0], _); + }function nb(a, b) { + return kb(b[0], b[1], _) / kb(a[0], a[1], _); + }function rb() { + this.evEl = pb, this.evWin = qb, this.allow = !0, this.pressed = !1, ab.apply(this, arguments); + }function wb() { + this.evEl = ub, this.evWin = vb, ab.apply(this, arguments), this.store = this.manager.session.pointerEvents = []; + }function Ab() { + this.evTarget = yb, this.evWin = zb, this.started = !1, ab.apply(this, arguments); + }function Bb(a, b) { + var c = z(a.touches), + d = z(a.changedTouches);return b & (Q | R) && (c = A(c.concat(d), "identifier", !0)), [c, d]; + }function Eb() { + this.evTarget = Db, this.targetIds = {}, ab.apply(this, arguments); + }function Fb(a, b) { + var c = z(a.touches), + d = this.targetIds;if (b & (O | P) && 1 === c.length) return d[c[0].identifier] = !0, [c, c];var e, + f, + g = z(a.changedTouches), + h = [], + i = this.target;if (f = c.filter(function (a) { + return v(a.target, i); + }), b === O) for (e = 0; e < f.length;) { + d[f[e].identifier] = !0, e++; + }for (e = 0; e < g.length;) { + d[g[e].identifier] && h.push(g[e]), b & (Q | R) && delete d[g[e].identifier], e++; + }return h.length ? [A(f.concat(h), "identifier", !0), h] : void 0; + }function Gb() { + ab.apply(this, arguments);var a = q(this.handler, this);this.touch = new Eb(this.manager, a), this.mouse = new rb(this.manager, a); + }function Pb(a, b) { + this.manager = a, this.set(b); + }function Qb(a) { + if (w(a, Mb)) return Mb;var b = w(a, Nb), + c = w(a, Ob);return b && c ? Nb + " " + Ob : b || c ? b ? Nb : Ob : w(a, Lb) ? Lb : Kb; + }function Yb(a) { + this.id = D(), this.manager = null, this.options = o(a || {}, this.defaults), this.options.enable = s(this.options.enable, !0), this.state = Rb, this.simultaneous = {}, this.requireFail = []; + }function Zb(a) { + return a & Wb ? "cancel" : a & Ub ? "end" : a & Tb ? "move" : a & Sb ? "start" : ""; + }function $b(a) { + return a == W ? "down" : a == V ? "up" : a == T ? "left" : a == U ? "right" : ""; + }function _b(a, b) { + var c = b.manager;return c ? c.get(a) : a; + }function ac() { + Yb.apply(this, arguments); + }function bc() { + ac.apply(this, arguments), this.pX = null, this.pY = null; + }function cc() { + ac.apply(this, arguments); + }function dc() { + Yb.apply(this, arguments), this._timer = null, this._input = null; + }function ec() { + ac.apply(this, arguments); + }function fc() { + ac.apply(this, arguments); + }function gc() { + Yb.apply(this, arguments), this.pTime = !1, this.pCenter = !1, this._timer = null, this._input = null, this.count = 0; + }function hc(a, b) { + return b = b || {}, b.recognizers = s(b.recognizers, hc.defaults.preset), new kc(a, b); + }function kc(a, b) { + b = b || {}, this.options = o(b, hc.defaults), this.options.inputTarget = this.options.inputTarget || a, this.handlers = {}, this.session = {}, this.recognizers = [], this.element = a, this.input = bb(this), this.touchAction = new Pb(this, this.options.touchAction), lc(this, !0), m(b.recognizers, function (a) { + var b = this.add(new a[0](a[1]));a[2] && b.recognizeWith(a[2]), a[3] && b.requireFailure(a[3]); + }, this); + }function lc(a, b) { + var c = a.element;m(a.options.cssProps, function (a, d) { + c.style[B(c.style, d)] = b ? a : ""; + }); + }function mc(a, c) { + var d = b.createEvent("Event");d.initEvent(a, !0, !0), d.gesture = c, c.target.dispatchEvent(d); + }var e = ["", "webkit", "moz", "MS", "ms", "o"], + f = b.createElement("div"), + g = "function", + h = Math.round, + i = Math.abs, + j = Date.now, + C = 1, + F = /mobile|tablet|ip(ad|hone|od)|android/i, + G = "ontouchstart" in a, + H = B(a, "PointerEvent") !== d, + I = G && F.test(navigator.userAgent), + J = "touch", + K = "pen", + L = "mouse", + M = "kinect", + N = 25, + O = 1, + P = 2, + Q = 4, + R = 8, + S = 1, + T = 2, + U = 4, + V = 8, + W = 16, + X = T | U, + Y = V | W, + Z = X | Y, + $ = ["x", "y"], + _ = ["clientX", "clientY"];ab.prototype = { handler: function () {}, init: function () { + this.evEl && t(this.element, this.evEl, this.domHandler), this.evTarget && t(this.target, this.evTarget, this.domHandler), this.evWin && t(E(this.element), this.evWin, this.domHandler); + }, destroy: function () { + this.evEl && u(this.element, this.evEl, this.domHandler), this.evTarget && u(this.target, this.evTarget, this.domHandler), this.evWin && u(E(this.element), this.evWin, this.domHandler); + } };var ob = { mousedown: O, mousemove: P, mouseup: Q }, + pb = "mousedown", + qb = "mousemove mouseup";p(rb, ab, { handler: function (a) { + var b = ob[a.type];b & O && 0 === a.button && (this.pressed = !0), b & P && 1 !== a.which && (b = Q), this.pressed && this.allow && (b & Q && (this.pressed = !1), this.callback(this.manager, b, { pointers: [a], changedPointers: [a], pointerType: L, srcEvent: a })); + } });var sb = { pointerdown: O, pointermove: P, pointerup: Q, pointercancel: R, pointerout: R }, + tb = { 2: J, 3: K, 4: L, 5: M }, + ub = "pointerdown", + vb = "pointermove pointerup pointercancel";a.MSPointerEvent && (ub = "MSPointerDown", vb = "MSPointerMove MSPointerUp MSPointerCancel"), p(wb, ab, { handler: function (a) { + var b = this.store, + c = !1, + d = a.type.toLowerCase().replace("ms", ""), + e = sb[d], + f = tb[a.pointerType] || a.pointerType, + g = f == J, + h = y(b, a.pointerId, "pointerId");e & O && (0 === a.button || g) ? 0 > h && (b.push(a), h = b.length - 1) : e & (Q | R) && (c = !0), 0 > h || (b[h] = a, this.callback(this.manager, e, { pointers: b, changedPointers: [a], pointerType: f, srcEvent: a }), c && b.splice(h, 1)); + } });var xb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R }, + yb = "touchstart", + zb = "touchstart touchmove touchend touchcancel";p(Ab, ab, { handler: function (a) { + var b = xb[a.type];if (b === O && (this.started = !0), this.started) { + var c = Bb.call(this, a, b);b & (Q | R) && 0 === c[0].length - c[1].length && (this.started = !1), this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a }); + } + } });var Cb = { touchstart: O, touchmove: P, touchend: Q, touchcancel: R }, + Db = "touchstart touchmove touchend touchcancel";p(Eb, ab, { handler: function (a) { + var b = Cb[a.type], + c = Fb.call(this, a, b);c && this.callback(this.manager, b, { pointers: c[0], changedPointers: c[1], pointerType: J, srcEvent: a }); + } }), p(Gb, ab, { handler: function (a, b, c) { + var d = c.pointerType == J, + e = c.pointerType == L;if (d) this.mouse.allow = !1;else if (e && !this.mouse.allow) return;b & (Q | R) && (this.mouse.allow = !0), this.callback(a, b, c); + }, destroy: function () { + this.touch.destroy(), this.mouse.destroy(); + } });var Hb = B(f.style, "touchAction"), + Ib = Hb !== d, + Jb = "compute", + Kb = "auto", + Lb = "manipulation", + Mb = "none", + Nb = "pan-x", + Ob = "pan-y";Pb.prototype = { set: function (a) { + a == Jb && (a = this.compute()), Ib && (this.manager.element.style[Hb] = a), this.actions = a.toLowerCase().trim(); + }, update: function () { + this.set(this.manager.options.touchAction); + }, compute: function () { + var a = [];return m(this.manager.recognizers, function (b) { + r(b.options.enable, [b]) && (a = a.concat(b.getTouchAction())); + }), Qb(a.join(" ")); + }, preventDefaults: function (a) { + if (!Ib) { + var b = a.srcEvent, + c = a.offsetDirection;if (this.manager.session.prevented) return b.preventDefault(), void 0;var d = this.actions, + e = w(d, Mb), + f = w(d, Ob), + g = w(d, Nb);return e || f && c & X || g && c & Y ? this.preventSrc(b) : void 0; + } + }, preventSrc: function (a) { + this.manager.session.prevented = !0, a.preventDefault(); + } };var Rb = 1, + Sb = 2, + Tb = 4, + Ub = 8, + Vb = Ub, + Wb = 16, + Xb = 32;Yb.prototype = { defaults: {}, set: function (a) { + return n(this.options, a), this.manager && this.manager.touchAction.update(), this; + }, recognizeWith: function (a) { + if (l(a, "recognizeWith", this)) return this;var b = this.simultaneous;return a = _b(a, this), b[a.id] || (b[a.id] = a, a.recognizeWith(this)), this; + }, dropRecognizeWith: function (a) { + return l(a, "dropRecognizeWith", this) ? this : (a = _b(a, this), delete this.simultaneous[a.id], this); + }, requireFailure: function (a) { + if (l(a, "requireFailure", this)) return this;var b = this.requireFail;return a = _b(a, this), -1 === y(b, a) && (b.push(a), a.requireFailure(this)), this; + }, dropRequireFailure: function (a) { + if (l(a, "dropRequireFailure", this)) return this;a = _b(a, this);var b = y(this.requireFail, a);return b > -1 && this.requireFail.splice(b, 1), this; + }, hasRequireFailures: function () { + return this.requireFail.length > 0; + }, canRecognizeWith: function (a) { + return !!this.simultaneous[a.id]; + }, emit: function (a) { + function d(d) { + b.manager.emit(b.options.event + (d ? Zb(c) : ""), a); + }var b = this, + c = this.state;Ub > c && d(!0), d(), c >= Ub && d(!0); + }, tryEmit: function (a) { + return this.canEmit() ? this.emit(a) : (this.state = Xb, void 0); + }, canEmit: function () { + for (var a = 0; a < this.requireFail.length;) { + if (!(this.requireFail[a].state & (Xb | Rb))) return !1;a++; + }return !0; + }, recognize: function (a) { + var b = n({}, a);return r(this.options.enable, [this, b]) ? (this.state & (Vb | Wb | Xb) && (this.state = Rb), this.state = this.process(b), this.state & (Sb | Tb | Ub | Wb) && this.tryEmit(b), void 0) : (this.reset(), this.state = Xb, void 0); + }, process: function () {}, getTouchAction: function () {}, reset: function () {} }, p(ac, Yb, { defaults: { pointers: 1 }, attrTest: function (a) { + var b = this.options.pointers;return 0 === b || a.pointers.length === b; + }, process: function (a) { + var b = this.state, + c = a.eventType, + d = b & (Sb | Tb), + e = this.attrTest(a);return d && (c & R || !e) ? b | Wb : d || e ? c & Q ? b | Ub : b & Sb ? b | Tb : Sb : Xb; + } }), p(bc, ac, { defaults: { event: "pan", threshold: 10, pointers: 1, direction: Z }, getTouchAction: function () { + var a = this.options.direction, + b = [];return a & X && b.push(Ob), a & Y && b.push(Nb), b; + }, directionTest: function (a) { + var b = this.options, + c = !0, + d = a.distance, + e = a.direction, + f = a.deltaX, + g = a.deltaY;return e & b.direction || (b.direction & X ? (e = 0 === f ? S : 0 > f ? T : U, c = f != this.pX, d = Math.abs(a.deltaX)) : (e = 0 === g ? S : 0 > g ? V : W, c = g != this.pY, d = Math.abs(a.deltaY))), a.direction = e, c && d > b.threshold && e & b.direction; + }, attrTest: function (a) { + return ac.prototype.attrTest.call(this, a) && (this.state & Sb || !(this.state & Sb) && this.directionTest(a)); + }, emit: function (a) { + this.pX = a.deltaX, this.pY = a.deltaY;var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this._super.emit.call(this, a); + } }), p(cc, ac, { defaults: { event: "pinch", threshold: 0, pointers: 2 }, getTouchAction: function () { + return [Mb]; + }, attrTest: function (a) { + return this._super.attrTest.call(this, a) && (Math.abs(a.scale - 1) > this.options.threshold || this.state & Sb); + }, emit: function (a) { + if (this._super.emit.call(this, a), 1 !== a.scale) { + var b = a.scale < 1 ? "in" : "out";this.manager.emit(this.options.event + b, a); + } + } }), p(dc, Yb, { defaults: { event: "press", pointers: 1, time: 500, threshold: 5 }, getTouchAction: function () { + return [Kb]; + }, process: function (a) { + var b = this.options, + c = a.pointers.length === b.pointers, + d = a.distance < b.threshold, + e = a.deltaTime > b.time;if (this._input = a, !d || !c || a.eventType & (Q | R) && !e) this.reset();else if (a.eventType & O) this.reset(), this._timer = k(function () { + this.state = Vb, this.tryEmit(); + }, b.time, this);else if (a.eventType & Q) return Vb;return Xb; + }, reset: function () { + clearTimeout(this._timer); + }, emit: function (a) { + this.state === Vb && (a && a.eventType & Q ? this.manager.emit(this.options.event + "up", a) : (this._input.timeStamp = j(), this.manager.emit(this.options.event, this._input))); + } }), p(ec, ac, { defaults: { event: "rotate", threshold: 0, pointers: 2 }, getTouchAction: function () { + return [Mb]; + }, attrTest: function (a) { + return this._super.attrTest.call(this, a) && (Math.abs(a.rotation) > this.options.threshold || this.state & Sb); + } }), p(fc, ac, { defaults: { event: "swipe", threshold: 10, velocity: .65, direction: X | Y, pointers: 1 }, getTouchAction: function () { + return bc.prototype.getTouchAction.call(this); + }, attrTest: function (a) { + var c, + b = this.options.direction;return b & (X | Y) ? c = a.velocity : b & X ? c = a.velocityX : b & Y && (c = a.velocityY), this._super.attrTest.call(this, a) && b & a.direction && a.distance > this.options.threshold && i(c) > this.options.velocity && a.eventType & Q; + }, emit: function (a) { + var b = $b(a.direction);b && this.manager.emit(this.options.event + b, a), this.manager.emit(this.options.event, a); + } }), p(gc, Yb, { defaults: { event: "tap", pointers: 1, taps: 1, interval: 300, time: 250, threshold: 2, posThreshold: 10 }, getTouchAction: function () { + return [Lb]; + }, process: function (a) { + var b = this.options, + c = a.pointers.length === b.pointers, + d = a.distance < b.threshold, + e = a.deltaTime < b.time;if (this.reset(), a.eventType & O && 0 === this.count) return this.failTimeout();if (d && e && c) { + if (a.eventType != Q) return this.failTimeout();var f = this.pTime ? a.timeStamp - this.pTime < b.interval : !0, + g = !this.pCenter || kb(this.pCenter, a.center) < b.posThreshold;this.pTime = a.timeStamp, this.pCenter = a.center, g && f ? this.count += 1 : this.count = 1, this._input = a;var h = this.count % b.taps;if (0 === h) return this.hasRequireFailures() ? (this._timer = k(function () { + this.state = Vb, this.tryEmit(); + }, b.interval, this), Sb) : Vb; + }return Xb; + }, failTimeout: function () { + return this._timer = k(function () { + this.state = Xb; + }, this.options.interval, this), Xb; + }, reset: function () { + clearTimeout(this._timer); + }, emit: function () { + this.state == Vb && (this._input.tapCount = this.count, this.manager.emit(this.options.event, this._input)); + } }), hc.VERSION = "2.0.4", hc.defaults = { domEvents: !1, touchAction: Jb, enable: !0, inputTarget: null, inputClass: null, preset: [[ec, { enable: !1 }], [cc, { enable: !1 }, ["rotate"]], [fc, { direction: X }], [bc, { direction: X }, ["swipe"]], [gc], [gc, { event: "doubletap", taps: 2 }, ["tap"]], [dc]], cssProps: { userSelect: "default", touchSelect: "none", touchCallout: "none", contentZooming: "none", userDrag: "none", tapHighlightColor: "rgba(0,0,0,0)" } };var ic = 1, + jc = 2;kc.prototype = { set: function (a) { + return n(this.options, a), a.touchAction && this.touchAction.update(), a.inputTarget && (this.input.destroy(), this.input.target = a.inputTarget, this.input.init()), this; + }, stop: function (a) { + this.session.stopped = a ? jc : ic; + }, recognize: function (a) { + var b = this.session;if (!b.stopped) { + this.touchAction.preventDefaults(a);var c, + d = this.recognizers, + e = b.curRecognizer;(!e || e && e.state & Vb) && (e = b.curRecognizer = null);for (var f = 0; f < d.length;) { + c = d[f], b.stopped === jc || e && c != e && !c.canRecognizeWith(e) ? c.reset() : c.recognize(a), !e && c.state & (Sb | Tb | Ub) && (e = b.curRecognizer = c), f++; + } + } + }, get: function (a) { + if (a instanceof Yb) return a;for (var b = this.recognizers, c = 0; c < b.length; c++) { + if (b[c].options.event == a) return b[c]; + }return null; + }, add: function (a) { + if (l(a, "add", this)) return this;var b = this.get(a.options.event);return b && this.remove(b), this.recognizers.push(a), a.manager = this, this.touchAction.update(), a; + }, remove: function (a) { + if (l(a, "remove", this)) return this;var b = this.recognizers;return a = this.get(a), b.splice(y(b, a), 1), this.touchAction.update(), this; + }, on: function (a, b) { + var c = this.handlers;return m(x(a), function (a) { + c[a] = c[a] || [], c[a].push(b); + }), this; + }, off: function (a, b) { + var c = this.handlers;return m(x(a), function (a) { + b ? c[a].splice(y(c[a], b), 1) : delete c[a]; + }), this; + }, emit: function (a, b) { + this.options.domEvents && mc(a, b);var c = this.handlers[a] && this.handlers[a].slice();if (c && c.length) { + b.type = a, b.preventDefault = function () { + b.srcEvent.preventDefault(); + };for (var d = 0; d < c.length;) { + c[d](b), d++; + } + } + }, destroy: function () { + this.element && lc(this, !1), this.handlers = {}, this.session = {}, this.input.destroy(), this.element = null; + } }, n(hc, { INPUT_START: O, INPUT_MOVE: P, INPUT_END: Q, INPUT_CANCEL: R, STATE_POSSIBLE: Rb, STATE_BEGAN: Sb, STATE_CHANGED: Tb, STATE_ENDED: Ub, STATE_RECOGNIZED: Vb, STATE_CANCELLED: Wb, STATE_FAILED: Xb, DIRECTION_NONE: S, DIRECTION_LEFT: T, DIRECTION_RIGHT: U, DIRECTION_UP: V, DIRECTION_DOWN: W, DIRECTION_HORIZONTAL: X, DIRECTION_VERTICAL: Y, DIRECTION_ALL: Z, Manager: kc, Input: ab, TouchAction: Pb, TouchInput: Eb, MouseInput: rb, PointerEventInput: wb, TouchMouseInput: Gb, SingleTouchInput: Ab, Recognizer: Yb, AttrRecognizer: ac, Tap: gc, Pan: bc, Swipe: fc, Pinch: cc, Rotate: ec, Press: dc, on: t, off: u, each: m, merge: o, extend: n, inherit: p, bindFn: q, prefixed: B }), typeof define == g && define.amd ? define(function () { + return hc; + }) : "undefined" != typeof module && module.exports ? module.exports = hc : a[c] = hc; +}(window, document, "Hammer");;(function (factory) { + if (typeof define === 'function' && define.amd) { + define(['jquery', 'hammerjs'], factory); + } else if (typeof exports === 'object') { + factory(require('jquery'), require('hammerjs')); + } else { + factory(jQuery, Hammer); + } +})(function ($, Hammer) { + function hammerify(el, options) { + var $el = $(el); + if (!$el.data("hammer")) { + $el.data("hammer", new Hammer($el[0], options)); + } + } + + $.fn.hammer = function (options) { + return this.each(function () { + hammerify(this, options); + }); + }; + + // extend the emit method to also trigger jQuery events + Hammer.Manager.prototype.emit = function (originalEmit) { + return function (type, data) { + originalEmit.call(this, type, data); + $(this.element).trigger({ + type: type, + gesture: data + }); + }; + }(Hammer.Manager.prototype.emit); +}); +; // Required for Meteor package, the use of window prevents export by Meteor +(function (window) { + if (window.Package) { + Materialize = {}; + } else { + window.Materialize = {}; + } +})(window); + +if (typeof exports !== 'undefined' && !exports.nodeType) { + if (typeof module !== 'undefined' && !module.nodeType && module.exports) { + exports = module.exports = Materialize; + } + exports.default = Materialize; +} + +/*
+ * raf.js
+ * https://github.com/ngryman/raf.js
+ *
+ * original requestAnimationFrame polyfill by Erik Möller
+ * inspired from paul_irish gist and post
+ *
+ * Copyright (c) 2013 ngryman
+ * Licensed under the MIT license.
+ */ +(function (window) { + var lastTime = 0, + vendors = ['webkit', 'moz'], + requestAnimationFrame = window.requestAnimationFrame, + cancelAnimationFrame = window.cancelAnimationFrame, + i = vendors.length; + + // try to un-prefix existing raf + while (--i >= 0 && !requestAnimationFrame) { + requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame']; + cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame']; + } + + // polyfill with setTimeout fallback + // heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945 + if (!requestAnimationFrame || !cancelAnimationFrame) { + requestAnimationFrame = function (callback) { + var now = +Date.now(), + nextTime = Math.max(lastTime + 16, now); + return setTimeout(function () { + callback(lastTime = nextTime); + }, nextTime - now); + }; + + cancelAnimationFrame = clearTimeout; + } + + // export to window + window.requestAnimationFrame = requestAnimationFrame; + window.cancelAnimationFrame = cancelAnimationFrame; +})(window); + +/**
+ * Generate approximated selector string for a jQuery object
+ * @param {jQuery} obj jQuery object to be parsed
+ * @returns {string}
+ */ +Materialize.objectSelectorString = function (obj) { + var tagStr = obj.prop('tagName') || ''; + var idStr = obj.attr('id') || ''; + var classStr = obj.attr('class') || ''; + return (tagStr + idStr + classStr).replace(/\s/g, ''); +}; + +// Unique Random ID +Materialize.guid = function () { + function s4() { + return Math.floor((1 + Math.random()) * 0x10000).toString(16).substring(1); + } + return function () { + return s4() + s4() + '-' + s4() + '-' + s4() + '-' + s4() + '-' + s4() + s4() + s4(); + }; +}(); + +/**
+ * Escapes hash from special characters
+ * @param {string} hash String returned from this.hash
+ * @returns {string}
+ */ +Materialize.escapeHash = function (hash) { + return hash.replace(/(:|\.|\[|\]|,|=)/g, "\\$1"); +}; + +Materialize.elementOrParentIsFixed = function (element) { + var $element = $(element); + var $checkElements = $element.add($element.parents()); + var isFixed = false; + $checkElements.each(function () { + if ($(this).css("position") === "fixed") { + isFixed = true; + return false; + } + }); + return isFixed; +}; + +/**
+ * Get time in ms
+ * @license https://raw.github.com/jashkenas/underscore/master/LICENSE
+ * @type {function}
+ * @return {number}
+ */ +var getTime = Date.now || function () { + return new Date().getTime(); +}; + +/**
+ * Returns a function, that, when invoked, will only be triggered at most once
+ * during a given window of time. Normally, the throttled function will run
+ * as much as it can, without ever going more than once per `wait` duration;
+ * but if you'd like to disable the execution on the leading edge, pass
+ * `{leading: false}`. To disable execution on the trailing edge, ditto.
+ * @license https://raw.github.com/jashkenas/underscore/master/LICENSE
+ * @param {function} func
+ * @param {number} wait
+ * @param {Object=} options
+ * @returns {Function}
+ */ +Materialize.throttle = function (func, wait, options) { + var context, args, result; + var timeout = null; + var previous = 0; + options || (options = {}); + var later = function () { + previous = options.leading === false ? 0 : getTime(); + timeout = null; + result = func.apply(context, args); + context = args = null; + }; + return function () { + var now = getTime(); + if (!previous && options.leading === false) previous = now; + var remaining = wait - (now - previous); + context = this; + args = arguments; + if (remaining <= 0) { + clearTimeout(timeout); + timeout = null; + previous = now; + result = func.apply(context, args); + context = args = null; + } else if (!timeout && options.trailing !== false) { + timeout = setTimeout(later, remaining); + } + return result; + }; +}; + +// Velocity has conflicts when loaded with jQuery, this will check for it +// First, check if in noConflict mode +var Vel; +if (jQuery) { + Vel = jQuery.Velocity; +} else if ($) { + Vel = $.Velocity; +} else { + Vel = Velocity; +} + +if (Vel) { + Materialize.Vel = Vel; +} else { + Materialize.Vel = Velocity; +} +;(function ($) { + $.fn.collapsible = function (options, methodParam) { + var defaults = { + accordion: undefined, + onOpen: undefined, + onClose: undefined + }; + + var methodName = options; + options = $.extend(defaults, options); + + return this.each(function () { + + var $this = $(this); + + var $panel_headers = $(this).find('> li > .collapsible-header'); + + var collapsible_type = $this.data("collapsible"); + + /****************
+ Helper Functions
+ ****************/ + + // Accordion Open + function accordionOpen(object) { + $panel_headers = $this.find('> li > .collapsible-header'); + if (object.hasClass('active')) { + object.parent().addClass('active'); + } else { + object.parent().removeClass('active'); + } + if (object.parent().hasClass('active')) { + object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () { + $(this).css('height', ''); + } }); + } else { + object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () { + $(this).css('height', ''); + } }); + } + + $panel_headers.not(object).removeClass('active').parent().removeClass('active'); + + // Close previously open accordion elements. + $panel_headers.not(object).parent().children('.collapsible-body').stop(true, false).each(function () { + if ($(this).is(':visible')) { + $(this).slideUp({ + duration: 350, + easing: "easeOutQuart", + queue: false, + complete: function () { + $(this).css('height', ''); + execCallbacks($(this).siblings('.collapsible-header')); + } + }); + } + }); + } + + // Expandable Open + function expandableOpen(object) { + if (object.hasClass('active')) { + object.parent().addClass('active'); + } else { + object.parent().removeClass('active'); + } + if (object.parent().hasClass('active')) { + object.siblings('.collapsible-body').stop(true, false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () { + $(this).css('height', ''); + } }); + } else { + object.siblings('.collapsible-body').stop(true, false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function () { + $(this).css('height', ''); + } }); + } + } + + // Open collapsible. object: .collapsible-header + function collapsibleOpen(object, noToggle) { + if (!noToggle) { + object.toggleClass('active'); + } + + if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { + // Handle Accordion + accordionOpen(object); + } else { + // Handle Expandables + expandableOpen(object); + } + + execCallbacks(object); + } + + // Handle callbacks + function execCallbacks(object) { + if (object.hasClass('active')) { + if (typeof options.onOpen === "function") { + options.onOpen.call(this, object.parent()); + } + } else { + if (typeof options.onClose === "function") { + options.onClose.call(this, object.parent()); + } + } + } + + /**
+ * Check if object is children of panel header
+ * @param {Object} object Jquery object
+ * @return {Boolean} true if it is children
+ */ + function isChildrenOfPanelHeader(object) { + + var panelHeader = getPanelHeader(object); + + return panelHeader.length > 0; + } + + /**
+ * Get panel header from a children element
+ * @param {Object} object Jquery object
+ * @return {Object} panel header object
+ */ + function getPanelHeader(object) { + + return object.closest('li > .collapsible-header'); + } + + // Turn off any existing event handlers + function removeEventHandlers() { + $this.off('click.collapse', '> li > .collapsible-header'); + } + + /***** End Helper Functions *****/ + + // Methods + if (methodName === 'destroy') { + removeEventHandlers(); + return; + } else if (methodParam >= 0 && methodParam < $panel_headers.length) { + var $curr_header = $panel_headers.eq(methodParam); + if ($curr_header.length && (methodName === 'open' || methodName === 'close' && $curr_header.hasClass('active'))) { + collapsibleOpen($curr_header); + } + return; + } + + removeEventHandlers(); + + // Add click handler to only direct collapsible header children + $this.on('click.collapse', '> li > .collapsible-header', function (e) { + var element = $(e.target); + + if (isChildrenOfPanelHeader(element)) { + element = getPanelHeader(element); + } + + collapsibleOpen(element); + }); + + // Open first active + if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { + // Handle Accordion + collapsibleOpen($panel_headers.filter('.active').first(), true); + } else { + // Handle Expandables + $panel_headers.filter('.active').each(function () { + collapsibleOpen($(this), true); + }); + } + }); + }; + + $(document).ready(function () { + $('.collapsible').collapsible(); + }); +})(jQuery);;(function ($) { + + // Add posibility to scroll to selected option + // usefull for select for example + $.fn.scrollTo = function (elem) { + $(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top); + return this; + }; + + $.fn.dropdown = function (options) { + var defaults = { + inDuration: 300, + outDuration: 225, + constrainWidth: true, // Constrains width of dropdown to the activator + hover: false, + gutter: 0, // Spacing from edge + belowOrigin: false, + alignment: 'left', + stopPropagation: false + }; + + // Open dropdown. + if (options === "open") { + this.each(function () { + $(this).trigger('open'); + }); + return false; + } + + // Close dropdown. + if (options === "close") { + this.each(function () { + $(this).trigger('close'); + }); + return false; + } + + this.each(function () { + var origin = $(this); + var curr_options = $.extend({}, defaults, options); + var isFocused = false; + + // Dropdown menu + var activates = $("#" + origin.attr('data-activates')); + + function updateOptions() { + if (origin.data('induration') !== undefined) curr_options.inDuration = origin.data('induration'); + if (origin.data('outduration') !== undefined) curr_options.outDuration = origin.data('outduration'); + if (origin.data('constrainwidth') !== undefined) curr_options.constrainWidth = origin.data('constrainwidth'); + if (origin.data('hover') !== undefined) curr_options.hover = origin.data('hover'); + if (origin.data('gutter') !== undefined) curr_options.gutter = origin.data('gutter'); + if (origin.data('beloworigin') !== undefined) curr_options.belowOrigin = origin.data('beloworigin'); + if (origin.data('alignment') !== undefined) curr_options.alignment = origin.data('alignment'); + if (origin.data('stoppropagation') !== undefined) curr_options.stopPropagation = origin.data('stoppropagation'); + } + + updateOptions(); + + // Attach dropdown to its activator + origin.after(activates); + + /*
+ Helper function to position and resize dropdown.
+ Used in hover and click handler.
+ */ + function placeDropdown(eventType) { + // Check for simultaneous focus and click events. + if (eventType === 'focus') { + isFocused = true; + } + + // Check html data attributes + updateOptions(); + + // Set Dropdown state + activates.addClass('active'); + origin.addClass('active'); + + var originWidth = origin[0].getBoundingClientRect().width; + + // Constrain width + if (curr_options.constrainWidth === true) { + activates.css('width', originWidth); + } else { + activates.css('white-space', 'nowrap'); + } + + // Offscreen detection + var windowHeight = window.innerHeight; + var originHeight = origin.innerHeight(); + var offsetLeft = origin.offset().left; + var offsetTop = origin.offset().top - $(window).scrollTop(); + var currAlignment = curr_options.alignment; + var gutterSpacing = 0; + var leftPosition = 0; + + // Below Origin + var verticalOffset = 0; + if (curr_options.belowOrigin === true) { + verticalOffset = originHeight; + } + + // Check for scrolling positioned container. + var scrollYOffset = 0; + var scrollXOffset = 0; + var wrapper = origin.parent(); + if (!wrapper.is('body')) { + if (wrapper[0].scrollHeight > wrapper[0].clientHeight) { + scrollYOffset = wrapper[0].scrollTop; + } + if (wrapper[0].scrollWidth > wrapper[0].clientWidth) { + scrollXOffset = wrapper[0].scrollLeft; + } + } + + if (offsetLeft + activates.innerWidth() > $(window).width()) { + // Dropdown goes past screen on right, force right alignment + currAlignment = 'right'; + } else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) { + // Dropdown goes past screen on left, force left alignment + currAlignment = 'left'; + } + // Vertical bottom offscreen detection + if (offsetTop + activates.innerHeight() > windowHeight) { + // If going upwards still goes offscreen, just crop height of dropdown. + if (offsetTop + originHeight - activates.innerHeight() < 0) { + var adjustedHeight = windowHeight - offsetTop - verticalOffset; + activates.css('max-height', adjustedHeight); + } else { + // Flow upwards. + if (!verticalOffset) { + verticalOffset += originHeight; + } + verticalOffset -= activates.innerHeight(); + } + } + + // Handle edge alignment + if (currAlignment === 'left') { + gutterSpacing = curr_options.gutter; + leftPosition = origin.position().left + gutterSpacing; + } else if (currAlignment === 'right') { + // Material icons fix + activates.stop(true, true).css({ + opacity: 0, + left: 0 + }); + + var offsetRight = origin.position().left + originWidth - activates.width(); + gutterSpacing = -curr_options.gutter; + leftPosition = offsetRight + gutterSpacing; + } + + // Position dropdown + activates.css({ + position: 'absolute', + top: origin.position().top + verticalOffset + scrollYOffset, + left: leftPosition + scrollXOffset + }); + + // Show dropdown + activates.slideDown({ + queue: false, + duration: curr_options.inDuration, + easing: 'easeOutCubic', + complete: function () { + $(this).css('height', ''); + } + }).animate({ opacity: 1 }, { queue: false, duration: curr_options.inDuration, easing: 'easeOutSine' }); + + // Add click close handler to document + setTimeout(function () { + $(document).on('click.' + activates.attr('id'), function (e) { + hideDropdown(); + $(document).off('click.' + activates.attr('id')); + }); + }, 0); + } + + function hideDropdown() { + // Check for simultaneous focus and click events. + isFocused = false; + activates.fadeOut(curr_options.outDuration); + activates.removeClass('active'); + origin.removeClass('active'); + $(document).off('click.' + activates.attr('id')); + setTimeout(function () { + activates.css('max-height', ''); + }, curr_options.outDuration); + } + + // Hover + if (curr_options.hover) { + var open = false; + origin.off('click.' + origin.attr('id')); + // Hover handler to show dropdown + origin.on('mouseenter', function (e) { + // Mouse over + if (open === false) { + placeDropdown(); + open = true; + } + }); + origin.on('mouseleave', function (e) { + // If hover on origin then to something other than dropdown content, then close + var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element + if (!$(toEl).closest('.dropdown-content').is(activates)) { + activates.stop(true, true); + hideDropdown(); + open = false; + } + }); + + activates.on('mouseleave', function (e) { + // Mouse out + var toEl = e.toElement || e.relatedTarget; + if (!$(toEl).closest('.dropdown-button').is(origin)) { + activates.stop(true, true); + hideDropdown(); + open = false; + } + }); + + // Click + } else { + // Click handler to show dropdown + origin.off('click.' + origin.attr('id')); + origin.on('click.' + origin.attr('id'), function (e) { + if (!isFocused) { + if (origin[0] == e.currentTarget && !origin.hasClass('active') && $(e.target).closest('.dropdown-content').length === 0) { + e.preventDefault(); // Prevents button click from moving window + if (curr_options.stopPropagation) { + e.stopPropagation(); + } + placeDropdown('click'); + } + // If origin is clicked and menu is open, close menu + else if (origin.hasClass('active')) { + hideDropdown(); + $(document).off('click.' + activates.attr('id')); + } + } + }); + } // End else + + // Listen to open and close event - useful for select component + origin.on('open', function (e, eventType) { + placeDropdown(eventType); + }); + origin.on('close', hideDropdown); + }); + }; // End dropdown plugin + + $(document).ready(function () { + $('.dropdown-button').dropdown(); + }); +})(jQuery); +;(function ($, Vel) { + 'use strict'; + + var _defaults = { + opacity: 0.5, + inDuration: 250, + outDuration: 250, + ready: undefined, + complete: undefined, + dismissible: true, + startingTop: '4%', + endingTop: '10%' + }; + + /**
+ * @class
+ *
+ */ + + var Modal = function () { + /**
+ * Construct Modal instance and set up overlay
+ * @constructor
+ * @param {jQuery} $el
+ * @param {Object} options
+ */ + function Modal($el, options) { + _classCallCheck(this, Modal); + + // If exists, destroy and reinitialize + if (!!$el[0].M_Modal) { + $el[0].M_Modal.destroy(); + } + + /**
+ * The jQuery element
+ * @type {jQuery}
+ */ + this.$el = $el; + + /**
+ * Options for the modal
+ * @member Modal#options
+ * @prop {Number} [opacity=0.5] - Opacity of the modal overlay
+ * @prop {Number} [inDuration=250] - Length in ms of enter transition
+ * @prop {Number} [outDuration=250] - Length in ms of exit transition
+ * @prop {Function} ready - Callback function called when modal is finished entering
+ * @prop {Function} complete - Callback function called when modal is finished exiting
+ * @prop {Boolean} [dismissible=true] - Allow modal to be dismissed by keyboard or overlay click
+ * @prop {String} [startingTop='4%'] - startingTop
+ * @prop {String} [endingTop='10%'] - endingTop
+ */ + this.options = $.extend({}, Modal.defaults, options); + + /**
+ * Describes open/close state of modal
+ * @type {Boolean}
+ */ + this.isOpen = false; + + this.$el[0].M_Modal = this; + this.id = $el.attr('id'); + this.openingTrigger = undefined; + this.$overlay = $('<div class="modal-overlay"></div>'); + + Modal._increment++; + Modal._count++; + this.$overlay[0].style.zIndex = 1000 + Modal._increment * 2; + this.$el[0].style.zIndex = 1000 + Modal._increment * 2 + 1; + this.setupEventHandlers(); + } + + _createClass(Modal, [{ + key: 'getInstance', + + + /**
+ * Get Instance
+ */ + value: function getInstance() { + return this; + } + + /**
+ * Teardown component
+ */ + + }, { + key: 'destroy', + value: function destroy() { + this.removeEventHandlers(); + this.$el[0].removeAttribute('style'); + if (!!this.$overlay[0].parentNode) { + this.$overlay[0].parentNode.removeChild(this.$overlay[0]); + } + this.$el[0].M_Modal = undefined; + Modal._count--; + } + + /**
+ * Setup Event Handlers
+ */ + + }, { + key: 'setupEventHandlers', + value: function setupEventHandlers() { + this.handleOverlayClickBound = this.handleOverlayClick.bind(this); + this.handleModalCloseClickBound = this.handleModalCloseClick.bind(this); + + if (Modal._count === 1) { + document.body.addEventListener('click', this.handleTriggerClick); + } + this.$overlay[0].addEventListener('click', this.handleOverlayClickBound); + this.$el[0].addEventListener('click', this.handleModalCloseClickBound); + } + + /**
+ * Remove Event Handlers
+ */ + + }, { + key: 'removeEventHandlers', + value: function removeEventHandlers() { + if (Modal._count === 0) { + document.body.removeEventListener('click', this.handleTriggerClick); + } + this.$overlay[0].removeEventListener('click', this.handleOverlayClickBound); + this.$el[0].removeEventListener('click', this.handleModalCloseClickBound); + } + + /**
+ * Handle Trigger Click
+ * @param {Event} e
+ */ + + }, { + key: 'handleTriggerClick', + value: function handleTriggerClick(e) { + var $trigger = $(e.target).closest('.modal-trigger'); + if (e.target && $trigger.length) { + var modalId = $trigger[0].getAttribute('href'); + if (modalId) { + modalId = modalId.slice(1); + } else { + modalId = $trigger[0].getAttribute('data-target'); + } + var modalInstance = document.getElementById(modalId).M_Modal; + if (modalInstance) { + modalInstance.open($trigger); + } + e.preventDefault(); + } + } + + /**
+ * Handle Overlay Click
+ */ + + }, { + key: 'handleOverlayClick', + value: function handleOverlayClick() { + if (this.options.dismissible) { + this.close(); + } + } + + /**
+ * Handle Modal Close Click
+ * @param {Event} e
+ */ + + }, { + key: 'handleModalCloseClick', + value: function handleModalCloseClick(e) { + var $closeTrigger = $(e.target).closest('.modal-close'); + if (e.target && $closeTrigger.length) { + this.close(); + } + } + + /**
+ * Handle Keydown
+ * @param {Event} e
+ */ + + }, { + key: 'handleKeydown', + value: function handleKeydown(e) { + // ESC key + if (e.keyCode === 27 && this.options.dismissible) { + this.close(); + } + } + + /**
+ * Animate in modal
+ */ + + }, { + key: 'animateIn', + value: function animateIn() { + var _this = this; + + // Set initial styles + $.extend(this.$el[0].style, { + display: 'block', + opacity: 0 + }); + $.extend(this.$overlay[0].style, { + display: 'block', + opacity: 0 + }); + + // Animate overlay + Vel(this.$overlay[0], { opacity: this.options.opacity }, { duration: this.options.inDuration, queue: false, ease: 'easeOutCubic' }); + + // Define modal animation options + var enterVelocityOptions = { + duration: this.options.inDuration, + queue: false, + ease: 'easeOutCubic', + // Handle modal ready callback + complete: function () { + if (typeof _this.options.ready === 'function') { + _this.options.ready.call(_this, _this.$el, _this.openingTrigger); + } + } + }; + + // Bottom sheet animation + if (this.$el[0].classList.contains('bottom-sheet')) { + Vel(this.$el[0], { bottom: 0, opacity: 1 }, enterVelocityOptions); + + // Normal modal animation + } else { + Vel.hook(this.$el[0], 'scaleX', 0.7); + this.$el[0].style.top = this.options.startingTop; + Vel(this.$el[0], { top: this.options.endingTop, opacity: 1, scaleX: 1 }, enterVelocityOptions); + } + } + + /**
+ * Animate out modal
+ */ + + }, { + key: 'animateOut', + value: function animateOut() { + var _this2 = this; + + // Animate overlay + Vel(this.$overlay[0], { opacity: 0 }, { duration: this.options.outDuration, queue: false, ease: 'easeOutQuart' }); + + // Define modal animation options + var exitVelocityOptions = { + duration: this.options.outDuration, + queue: false, + ease: 'easeOutCubic', + // Handle modal ready callback + complete: function () { + _this2.$el[0].style.display = 'none'; + // Call complete callback + if (typeof _this2.options.complete === 'function') { + _this2.options.complete.call(_this2, _this2.$el); + } + _this2.$overlay[0].parentNode.removeChild(_this2.$overlay[0]); + } + }; + + // Bottom sheet animation + if (this.$el[0].classList.contains('bottom-sheet')) { + Vel(this.$el[0], { bottom: '-100%', opacity: 0 }, exitVelocityOptions); + + // Normal modal animation + } else { + Vel(this.$el[0], { top: this.options.startingTop, opacity: 0, scaleX: 0.7 }, exitVelocityOptions); + } + } + + /**
+ * Open Modal
+ * @param {jQuery} [$trigger]
+ */ + + }, { + key: 'open', + value: function open($trigger) { + if (this.isOpen) { + return; + } + + this.isOpen = true; + var body = document.body; + body.style.overflow = 'hidden'; + this.$el[0].classList.add('open'); + body.appendChild(this.$overlay[0]); + + // Set opening trigger, undefined indicates modal was opened by javascript + this.openingTrigger = !!$trigger ? $trigger : undefined; + + if (this.options.dismissible) { + this.handleKeydownBound = this.handleKeydown.bind(this); + document.addEventListener('keydown', this.handleKeydownBound); + } + + this.animateIn(); + + return this; + } + + /**
+ * Close Modal
+ */ + + }, { + key: 'close', + value: function close() { + if (!this.isOpen) { + return; + } + + this.isOpen = false; + this.$el[0].classList.remove('open'); + document.body.style.overflow = ''; + + if (this.options.dismissible) { + document.removeEventListener('keydown', this.handleKeydownBound); + } + + this.animateOut(); + + return this; + } + }], [{ + key: 'init', + value: function init($els, options) { + var arr = []; + $els.each(function () { + arr.push(new Modal($(this), options)); + }); + return arr; + } + }, { + key: 'defaults', + get: function () { + return _defaults; + } + }]); + + return Modal; + }(); + + /**
+ * @static
+ * @memberof Modal
+ */ + + + Modal._increment = 0; + + /**
+ * @static
+ * @memberof Modal
+ */ + Modal._count = 0; + + Materialize.Modal = Modal; + + $.fn.modal = function (methodOrOptions) { + // Call plugin method if valid method name is passed in + if (Modal.prototype[methodOrOptions]) { + // Getter methods + if (methodOrOptions.slice(0, 3) === 'get') { + return this.first()[0].M_Modal[methodOrOptions](); + + // Void methods + } else { + return this.each(function () { + this.M_Modal[methodOrOptions](); + }); + } + + // Initialize plugin if options or no argument is passed in + } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { + Modal.init(this, arguments[0]); + return this; + + // Return error if an unrecognized method name is passed in + } else { + $.error('Method ' + methodOrOptions + ' does not exist on jQuery.modal'); + } + }; +})(jQuery, Materialize.Vel); +;(function ($) { + + $.fn.materialbox = function () { + + return this.each(function () { + + if ($(this).hasClass('initialized')) { + return; + } + + $(this).addClass('initialized'); + + var overlayActive = false; + var doneAnimating = true; + var inDuration = 275; + var outDuration = 200; + var origin = $(this); + var placeholder = $('<div></div>').addClass('material-placeholder'); + var originalWidth = 0; + var originalHeight = 0; + var ancestorsChanged; + var ancestor; + var originInlineStyles = origin.attr('style'); + origin.wrap(placeholder); + + // Start click handler + origin.on('click', function () { + var placeholder = origin.parent('.material-placeholder'); + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var originalWidth = origin.width(); + var originalHeight = origin.height(); + + // If already modal, return to original + if (doneAnimating === false) { + returnToOriginal(); + return false; + } else if (overlayActive && doneAnimating === true) { + returnToOriginal(); + return false; + } + + // Set states + doneAnimating = false; + origin.addClass('active'); + overlayActive = true; + + // Set positioning for placeholder + placeholder.css({ + width: placeholder[0].getBoundingClientRect().width, + height: placeholder[0].getBoundingClientRect().height, + position: 'relative', + top: 0, + left: 0 + }); + + // Find ancestor with overflow: hidden; and remove it + ancestorsChanged = undefined; + ancestor = placeholder[0].parentNode; + var count = 0; + while (ancestor !== null && !$(ancestor).is(document)) { + var curr = $(ancestor); + if (curr.css('overflow') !== 'visible') { + curr.css('overflow', 'visible'); + if (ancestorsChanged === undefined) { + ancestorsChanged = curr; + } else { + ancestorsChanged = ancestorsChanged.add(curr); + } + } + ancestor = ancestor.parentNode; + } + + // Set css on origin + origin.css({ + position: 'absolute', + 'z-index': 1000, + 'will-change': 'left, top, width, height' + }).data('width', originalWidth).data('height', originalHeight); + + // Add overlay + var overlay = $('<div id="materialbox-overlay"></div>').css({ + opacity: 0 + }).click(function () { + if (doneAnimating === true) returnToOriginal(); + }); + + // Put before in origin image to preserve z-index layering. + origin.before(overlay); + + // Set dimensions if needed + var overlayOffset = overlay[0].getBoundingClientRect(); + overlay.css({ + width: windowWidth, + height: windowHeight, + left: -1 * overlayOffset.left, + top: -1 * overlayOffset.top + }); + + // Animate Overlay + overlay.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' }); + + // Add and animate caption if it exists + if (origin.data('caption') !== "") { + var $photo_caption = $('<div class="materialbox-caption"></div>'); + $photo_caption.text(origin.data('caption')); + $('body').append($photo_caption); + $photo_caption.css({ "display": "inline" }); + $photo_caption.velocity({ opacity: 1 }, { duration: inDuration, queue: false, easing: 'easeOutQuad' }); + } + + // Resize Image + var ratio = 0; + var widthPercent = originalWidth / windowWidth; + var heightPercent = originalHeight / windowHeight; + var newWidth = 0; + var newHeight = 0; + + if (widthPercent > heightPercent) { + ratio = originalHeight / originalWidth; + newWidth = windowWidth * 0.9; + newHeight = windowWidth * 0.9 * ratio; + } else { + ratio = originalWidth / originalHeight; + newWidth = windowHeight * 0.9 * ratio; + newHeight = windowHeight * 0.9; + } + + // Animate image + set z-index + if (origin.hasClass('responsive-img')) { + origin.velocity({ 'max-width': newWidth, 'width': originalWidth }, { duration: 0, queue: false, + complete: function () { + origin.css({ left: 0, top: 0 }).velocity({ + height: newHeight, + width: newWidth, + left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2, + top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2 + }, { + duration: inDuration, + queue: false, + easing: 'easeOutQuad', + complete: function () { + doneAnimating = true; + } + }); + } // End Complete + }); // End Velocity + } else { + origin.css('left', 0).css('top', 0).velocity({ + height: newHeight, + width: newWidth, + left: $(document).scrollLeft() + windowWidth / 2 - origin.parent('.material-placeholder').offset().left - newWidth / 2, + top: $(document).scrollTop() + windowHeight / 2 - origin.parent('.material-placeholder').offset().top - newHeight / 2 + }, { + duration: inDuration, + queue: false, + easing: 'easeOutQuad', + complete: function () { + doneAnimating = true; + } + }); // End Velocity + } + + // Handle Exit triggers + $(window).on('scroll.materialbox', function () { + if (overlayActive) { + returnToOriginal(); + } + }); + + $(window).on('resize.materialbox', function () { + if (overlayActive) { + returnToOriginal(); + } + }); + + $(document).on('keyup.materialbox', function (e) { + // ESC key + if (e.keyCode === 27 && doneAnimating === true && overlayActive) { + returnToOriginal(); + } + }); + }); // End click handler + + + // This function returns the modaled image to the original spot + function returnToOriginal() { + + doneAnimating = false; + + var placeholder = origin.parent('.material-placeholder'); + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var originalWidth = origin.data('width'); + var originalHeight = origin.data('height'); + + origin.velocity("stop", true); + $('#materialbox-overlay').velocity("stop", true); + $('.materialbox-caption').velocity("stop", true); + + // disable exit handlers + $(window).off('scroll.materialbox'); + $(document).off('keyup.materialbox'); + $(window).off('resize.materialbox'); + + $('#materialbox-overlay').velocity({ opacity: 0 }, { + duration: outDuration, // Delay prevents animation overlapping + queue: false, easing: 'easeOutQuad', + complete: function () { + // Remove Overlay + overlayActive = false; + $(this).remove(); + } + }); + + // Resize Image + origin.velocity({ + width: originalWidth, + height: originalHeight, + left: 0, + top: 0 + }, { + duration: outDuration, + queue: false, easing: 'easeOutQuad', + complete: function () { + placeholder.css({ + height: '', + width: '', + position: '', + top: '', + left: '' + }); + + origin.removeAttr('style'); + origin.attr('style', originInlineStyles); + + // Remove class + origin.removeClass('active'); + doneAnimating = true; + + // Remove overflow overrides on ancestors + if (ancestorsChanged) { + ancestorsChanged.css('overflow', ''); + } + } + }); + + // Remove Caption + reset css settings on image + $('.materialbox-caption').velocity({ opacity: 0 }, { + duration: outDuration, // Delay prevents animation overlapping + queue: false, easing: 'easeOutQuad', + complete: function () { + $(this).remove(); + } + }); + } + }); + }; + + $(document).ready(function () { + $('.materialboxed').materialbox(); + }); +})(jQuery); +;(function ($) { + + $.fn.parallax = function () { + var window_width = $(window).width(); + // Parallax Scripts + return this.each(function (i) { + var $this = $(this); + $this.addClass('parallax'); + + function updateParallax(initial) { + var container_height; + if (window_width < 601) { + container_height = $this.height() > 0 ? $this.height() : $this.children("img").height(); + } else { + container_height = $this.height() > 0 ? $this.height() : 500; + } + var $img = $this.children("img").first(); + var img_height = $img.height(); + var parallax_dist = img_height - container_height; + var bottom = $this.offset().top + container_height; + var top = $this.offset().top; + var scrollTop = $(window).scrollTop(); + var windowHeight = window.innerHeight; + var windowBottom = scrollTop + windowHeight; + var percentScrolled = (windowBottom - top) / (container_height + windowHeight); + var parallax = Math.round(parallax_dist * percentScrolled); + + if (initial) { + $img.css('display', 'block'); + } + if (bottom > scrollTop && top < scrollTop + windowHeight) { + $img.css('transform', "translate3D(-50%," + parallax + "px, 0)"); + } + } + + // Wait for image load + $this.children("img").one("load", function () { + updateParallax(true); + }).each(function () { + if (this.complete) $(this).trigger("load"); + }); + + $(window).scroll(function () { + window_width = $(window).width(); + updateParallax(false); + }); + + $(window).resize(function () { + window_width = $(window).width(); + updateParallax(false); + }); + }); + }; +})(jQuery); +;(function ($) { + + var methods = { + init: function (options) { + var defaults = { + onShow: null, + swipeable: false, + responsiveThreshold: Infinity // breakpoint for swipeable + }; + options = $.extend(defaults, options); + var namespace = Materialize.objectSelectorString($(this)); + + return this.each(function (i) { + + var uniqueNamespace = namespace + i; + + // For each set of tabs, we want to keep track of + // which tab is active and its associated content + var $this = $(this), + window_width = $(window).width(); + + var $active, + $content, + $links = $this.find('li.tab a'), + $tabs_width = $this.width(), + $tabs_content = $(), + $tabs_wrapper, + $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length, + $indicator, + index = 0, + prev_index = 0, + clicked = false, + clickedTimeout, + transition = 300; + + // Finds right attribute for indicator based on active tab. + // el: jQuery Object + var calcRightPos = function (el) { + return Math.ceil($tabs_width - el.position().left - el[0].getBoundingClientRect().width - $this.scrollLeft()); + }; + + // Finds left attribute for indicator based on active tab. + // el: jQuery Object + var calcLeftPos = function (el) { + return Math.floor(el.position().left + $this.scrollLeft()); + }; + + // Animates Indicator to active tab. + // prev_index: Number + var animateIndicator = function (prev_index) { + if (index - prev_index >= 0) { + $indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' }); + $indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 }); + } else { + $indicator.velocity({ "left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad' }); + $indicator.velocity({ "right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad', delay: 90 }); + } + }; + + // Change swipeable according to responsive threshold + if (options.swipeable) { + if (window_width > options.responsiveThreshold) { + options.swipeable = false; + } + } + + // If the location.hash matches one of the links, use that as the active tab. + $active = $($links.filter('[href="' + location.hash + '"]')); + + // If no match is found, use the first link or any with class 'active' as the initial active tab. + if ($active.length === 0) { + $active = $(this).find('li.tab a.active').first(); + } + if ($active.length === 0) { + $active = $(this).find('li.tab a').first(); + } + + $active.addClass('active'); + index = $links.index($active); + if (index < 0) { + index = 0; + } + + if ($active[0] !== undefined) { + $content = $($active[0].hash); + $content.addClass('active'); + } + + // append indicator then set indicator width to tab width + if (!$this.find('.indicator').length) { + $this.append('<li class="indicator"></li>'); + } + $indicator = $this.find('.indicator'); + + // we make sure that the indicator is at the end of the tabs + $this.append($indicator); + + if ($this.is(":visible")) { + // $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)}); + // $indicator.css({"left": index * $tab_width}); + setTimeout(function () { + $indicator.css({ "right": calcRightPos($active) }); + $indicator.css({ "left": calcLeftPos($active) }); + }, 0); + } + $(window).off('resize.tabs-' + uniqueNamespace).on('resize.tabs-' + uniqueNamespace, function () { + $tabs_width = $this.width(); + $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length; + if (index < 0) { + index = 0; + } + if ($tab_width !== 0 && $tabs_width !== 0) { + $indicator.css({ "right": calcRightPos($active) }); + $indicator.css({ "left": calcLeftPos($active) }); + } + }); + + // Initialize Tabs Content. + if (options.swipeable) { + // TODO: Duplicate calls with swipeable? handle multiple div wrapping. + $links.each(function () { + var $curr_content = $(Materialize.escapeHash(this.hash)); + $curr_content.addClass('carousel-item'); + $tabs_content = $tabs_content.add($curr_content); + }); + $tabs_wrapper = $tabs_content.wrapAll('<div class="tabs-content carousel"></div>'); + $tabs_content.css('display', ''); + $('.tabs-content.carousel').carousel({ + fullWidth: true, + noWrap: true, + onCycleTo: function (item) { + if (!clicked) { + var prev_index = index; + index = $tabs_wrapper.index(item); + $active.removeClass('active'); + $active = $links.eq(index); + $active.addClass('active'); + animateIndicator(prev_index); + if (typeof options.onShow === "function") { + options.onShow.call($this[0], $content); + } + } + } + }); + } else { + // Hide the remaining content + $links.not($active).each(function () { + $(Materialize.escapeHash(this.hash)).hide(); + }); + } + + // Bind the click event handler + $this.off('click.tabs').on('click.tabs', 'a', function (e) { + if ($(this).parent().hasClass('disabled')) { + e.preventDefault(); + return; + } + + // Act as regular link if target attribute is specified. + if (!!$(this).attr("target")) { + return; + } + + clicked = true; + $tabs_width = $this.width(); + $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length; + + // Make the old tab inactive. + $active.removeClass('active'); + var $oldContent = $content; + + // Update the variables with the new link and content + $active = $(this); + $content = $(Materialize.escapeHash(this.hash)); + $links = $this.find('li.tab a'); + var activeRect = $active.position(); + + // Make the tab active. + $active.addClass('active'); + prev_index = index; + index = $links.index($(this)); + if (index < 0) { + index = 0; + } + // Change url to current tab + // window.location.hash = $active.attr('href'); + + // Swap content + if (options.swipeable) { + if ($tabs_content.length) { + $tabs_content.carousel('set', index, function () { + if (typeof options.onShow === "function") { + options.onShow.call($this[0], $content); + } + }); + } + } else { + if ($content !== undefined) { + $content.show(); + $content.addClass('active'); + if (typeof options.onShow === "function") { + options.onShow.call(this, $content); + } + } + + if ($oldContent !== undefined && !$oldContent.is($content)) { + $oldContent.hide(); + $oldContent.removeClass('active'); + } + } + + // Reset clicked state + clickedTimeout = setTimeout(function () { + clicked = false; + }, transition); + + // Update indicator + animateIndicator(prev_index); + + // Prevent the anchor's default click action + e.preventDefault(); + }); + }); + }, + select_tab: function (id) { + this.find('a[href="#' + id + '"]').trigger('click'); + } + }; + + $.fn.tabs = function (methodOrOptions) { + if (methods[methodOrOptions]) { + return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1)); + } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { + // Default to "init" + return methods.init.apply(this, arguments); + } else { + $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tabs'); + } + }; + + $(document).ready(function () { + $('ul.tabs').tabs(); + }); +})(jQuery); +;(function ($) { + $.fn.tooltip = function (options) { + var timeout = null, + margin = 5; + + // Defaults + var defaults = { + delay: 350, + tooltip: '', + position: 'bottom', + html: false + }; + + // Remove tooltip from the activator + if (options === "remove") { + this.each(function () { + $('#' + $(this).attr('data-tooltip-id')).remove(); + $(this).removeAttr('data-tooltip-id'); + $(this).off('mouseenter.tooltip mouseleave.tooltip'); + }); + return false; + } + + options = $.extend(defaults, options); + + return this.each(function () { + var tooltipId = Materialize.guid(); + var origin = $(this); + + // Destroy old tooltip + if (origin.attr('data-tooltip-id')) { + $('#' + origin.attr('data-tooltip-id')).remove(); + } + + origin.attr('data-tooltip-id', tooltipId); + + // Get attributes. + var allowHtml, tooltipDelay, tooltipPosition, tooltipText, tooltipEl, backdrop; + var setAttributes = function () { + allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html; + tooltipDelay = origin.attr('data-delay'); + tooltipDelay = tooltipDelay === undefined || tooltipDelay === '' ? options.delay : tooltipDelay; + tooltipPosition = origin.attr('data-position'); + tooltipPosition = tooltipPosition === undefined || tooltipPosition === '' ? options.position : tooltipPosition; + tooltipText = origin.attr('data-tooltip'); + tooltipText = tooltipText === undefined || tooltipText === '' ? options.tooltip : tooltipText; + }; + setAttributes(); + + var renderTooltipEl = function () { + var tooltip = $('<div class="material-tooltip"></div>'); + + // Create Text span + if (allowHtml) { + tooltipText = $('<span></span>').html(tooltipText); + } else { + tooltipText = $('<span></span>').text(tooltipText); + } + + // Create tooltip + tooltip.append(tooltipText).appendTo($('body')).attr('id', tooltipId); + + // Create backdrop + backdrop = $('<div class="backdrop"></div>'); + backdrop.appendTo(tooltip); + return tooltip; + }; + tooltipEl = renderTooltipEl(); + + // Destroy previously binded events + origin.off('mouseenter.tooltip mouseleave.tooltip'); + // Mouse In + var started = false, + timeoutRef; + origin.on({ 'mouseenter.tooltip': function (e) { + var showTooltip = function () { + setAttributes(); + started = true; + tooltipEl.velocity('stop'); + backdrop.velocity('stop'); + tooltipEl.css({ visibility: 'visible', left: '0px', top: '0px' }); + + // Tooltip positioning + var originWidth = origin.outerWidth(); + var originHeight = origin.outerHeight(); + var tooltipHeight = tooltipEl.outerHeight(); + var tooltipWidth = tooltipEl.outerWidth(); + var tooltipVerticalMovement = '0px'; + var tooltipHorizontalMovement = '0px'; + var backdropOffsetWidth = backdrop[0].offsetWidth; + var backdropOffsetHeight = backdrop[0].offsetHeight; + var scaleXFactor = 8; + var scaleYFactor = 8; + var scaleFactor = 0; + var targetTop, targetLeft, newCoordinates; + + if (tooltipPosition === "top") { + // Top Position + targetTop = origin.offset().top - tooltipHeight - margin; + targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + tooltipVerticalMovement = '-10px'; + backdrop.css({ + bottom: 0, + left: 0, + borderRadius: '14px 14px 0 0', + transformOrigin: '50% 100%', + marginTop: tooltipHeight, + marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2 + }); + } + // Left Position + else if (tooltipPosition === "left") { + targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2; + targetLeft = origin.offset().left - tooltipWidth - margin; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + + tooltipHorizontalMovement = '-10px'; + backdrop.css({ + top: '-7px', + right: 0, + width: '14px', + height: '14px', + borderRadius: '14px 0 0 14px', + transformOrigin: '95% 50%', + marginTop: tooltipHeight / 2, + marginLeft: tooltipWidth + }); + } + // Right Position + else if (tooltipPosition === "right") { + targetTop = origin.offset().top + originHeight / 2 - tooltipHeight / 2; + targetLeft = origin.offset().left + originWidth + margin; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + + tooltipHorizontalMovement = '+10px'; + backdrop.css({ + top: '-7px', + left: 0, + width: '14px', + height: '14px', + borderRadius: '0 14px 14px 0', + transformOrigin: '5% 50%', + marginTop: tooltipHeight / 2, + marginLeft: '0px' + }); + } else { + // Bottom Position + targetTop = origin.offset().top + origin.outerHeight() + margin; + targetLeft = origin.offset().left + originWidth / 2 - tooltipWidth / 2; + newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight); + tooltipVerticalMovement = '+10px'; + backdrop.css({ + top: 0, + left: 0, + marginLeft: tooltipWidth / 2 - backdropOffsetWidth / 2 + }); + } + + // Set tooptip css placement + tooltipEl.css({ + top: newCoordinates.y, + left: newCoordinates.x + }); + + // Calculate Scale to fill + scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth); + scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight); + scaleFactor = Math.max(scaleXFactor, scaleYFactor); + + tooltipEl.velocity({ translateY: tooltipVerticalMovement, translateX: tooltipHorizontalMovement }, { duration: 350, queue: false }).velocity({ opacity: 1 }, { duration: 300, delay: 50, queue: false }); + backdrop.css({ visibility: 'visible' }).velocity({ opacity: 1 }, { duration: 55, delay: 0, queue: false }).velocity({ scaleX: scaleFactor, scaleY: scaleFactor }, { duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad' }); + }; + + timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval + + // Mouse Out + }, + 'mouseleave.tooltip': function () { + // Reset State + started = false; + clearTimeout(timeoutRef); + + // Animate back + setTimeout(function () { + if (started !== true) { + tooltipEl.velocity({ + opacity: 0, translateY: 0, translateX: 0 }, { duration: 225, queue: false }); + backdrop.velocity({ opacity: 0, scaleX: 1, scaleY: 1 }, { + duration: 225, + queue: false, + complete: function () { + backdrop.css({ visibility: 'hidden' }); + tooltipEl.css({ visibility: 'hidden' }); + started = false; + } + }); + } + }, 225); + } + }); + }); + }; + + var repositionWithinScreen = function (x, y, width, height) { + var newX = x; + var newY = y; + + if (newX < 0) { + newX = 4; + } else if (newX + width > window.innerWidth) { + newX -= newX + width - window.innerWidth; + } + + if (newY < 0) { + newY = 4; + } else if (newY + height > window.innerHeight + $(window).scrollTop) { + newY -= newY + height - window.innerHeight; + } + + return { x: newX, y: newY }; + }; + + $(document).ready(function () { + $('.tooltipped').tooltip(); + }); +})(jQuery); +; /*!
+ * Waves v0.6.4
+ * http://fian.my.id/Waves
+ *
+ * Copyright 2014 Alfiana E. Sibuea and other contributors
+ * Released under the MIT license
+ * https://github.com/fians/Waves/blob/master/LICENSE
+ */ + +;(function (window) { + 'use strict'; + + var Waves = Waves || {}; + var $$ = document.querySelectorAll.bind(document); + + // Find exact position of element + function isWindow(obj) { + return obj !== null && obj === obj.window; + } + + function getWindow(elem) { + return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView; + } + + function offset(elem) { + var docElem, + win, + box = { top: 0, left: 0 }, + doc = elem && elem.ownerDocument; + + docElem = doc.documentElement; + + if (typeof elem.getBoundingClientRect !== typeof undefined) { + box = elem.getBoundingClientRect(); + } + win = getWindow(doc); + return { + top: box.top + win.pageYOffset - docElem.clientTop, + left: box.left + win.pageXOffset - docElem.clientLeft + }; + } + + function convertStyle(obj) { + var style = ''; + + for (var a in obj) { + if (obj.hasOwnProperty(a)) { + style += a + ':' + obj[a] + ';'; + } + } + + return style; + } + + var Effect = { + + // Effect delay + duration: 750, + + show: function (e, element) { + + // Disable right click + if (e.button === 2) { + return false; + } + + var el = element || this; + + // Create ripple + var ripple = document.createElement('div'); + ripple.className = 'waves-ripple'; + el.appendChild(ripple); + + // Get click coordinate and element witdh + var pos = offset(el); + var relativeY = e.pageY - pos.top; + var relativeX = e.pageX - pos.left; + var scale = 'scale(' + el.clientWidth / 100 * 10 + ')'; + + // Support for touch devices + if ('touches' in e) { + relativeY = e.touches[0].pageY - pos.top; + relativeX = e.touches[0].pageX - pos.left; + } + + // Attach data to element + ripple.setAttribute('data-hold', Date.now()); + ripple.setAttribute('data-scale', scale); + ripple.setAttribute('data-x', relativeX); + ripple.setAttribute('data-y', relativeY); + + // Set ripple position + var rippleStyle = { + 'top': relativeY + 'px', + 'left': relativeX + 'px' + }; + + ripple.className = ripple.className + ' waves-notransition'; + ripple.setAttribute('style', convertStyle(rippleStyle)); + ripple.className = ripple.className.replace('waves-notransition', ''); + + // Scale the ripple + rippleStyle['-webkit-transform'] = scale; + rippleStyle['-moz-transform'] = scale; + rippleStyle['-ms-transform'] = scale; + rippleStyle['-o-transform'] = scale; + rippleStyle.transform = scale; + rippleStyle.opacity = '1'; + + rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms'; + rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms'; + rippleStyle['-o-transition-duration'] = Effect.duration + 'ms'; + rippleStyle['transition-duration'] = Effect.duration + 'ms'; + + rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)'; + + ripple.setAttribute('style', convertStyle(rippleStyle)); + }, + + hide: function (e) { + TouchHandler.touchup(e); + + var el = this; + var width = el.clientWidth * 1.4; + + // Get first ripple + var ripple = null; + var ripples = el.getElementsByClassName('waves-ripple'); + if (ripples.length > 0) { + ripple = ripples[ripples.length - 1]; + } else { + return false; + } + + var relativeX = ripple.getAttribute('data-x'); + var relativeY = ripple.getAttribute('data-y'); + var scale = ripple.getAttribute('data-scale'); + + // Get delay beetween mousedown and mouse leave + var diff = Date.now() - Number(ripple.getAttribute('data-hold')); + var delay = 350 - diff; + + if (delay < 0) { + delay = 0; + } + + // Fade out ripple after delay + setTimeout(function () { + var style = { + 'top': relativeY + 'px', + 'left': relativeX + 'px', + 'opacity': '0', + + // Duration + '-webkit-transition-duration': Effect.duration + 'ms', + '-moz-transition-duration': Effect.duration + 'ms', + '-o-transition-duration': Effect.duration + 'ms', + 'transition-duration': Effect.duration + 'ms', + '-webkit-transform': scale, + '-moz-transform': scale, + '-ms-transform': scale, + '-o-transform': scale, + 'transform': scale + }; + + ripple.setAttribute('style', convertStyle(style)); + + setTimeout(function () { + try { + el.removeChild(ripple); + } catch (e) { + return false; + } + }, Effect.duration); + }, delay); + }, + + // Little hack to make <input> can perform waves effect + wrapInput: function (elements) { + for (var a = 0; a < elements.length; a++) { + var el = elements[a]; + + if (el.tagName.toLowerCase() === 'input') { + var parent = el.parentNode; + + // If input already have parent just pass through + if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) { + continue; + } + + // Put element class and style to the specified parent + var wrapper = document.createElement('i'); + wrapper.className = el.className + ' waves-input-wrapper'; + + var elementStyle = el.getAttribute('style'); + + if (!elementStyle) { + elementStyle = ''; + } + + wrapper.setAttribute('style', elementStyle); + + el.className = 'waves-button-input'; + el.removeAttribute('style'); + + // Put element as child + parent.replaceChild(wrapper, el); + wrapper.appendChild(el); + } + } + } + }; + + /**
+ * Disable mousedown event for 500ms during and after touch
+ */ + var TouchHandler = { + /* uses an integer rather than bool so there's no issues with
+ * needing to clear timeouts if another touch event occurred
+ * within the 500ms. Cannot mouseup between touchstart and
+ * touchend, nor in the 500ms after touchend. */ + touches: 0, + allowEvent: function (e) { + var allow = true; + + if (e.type === 'touchstart') { + TouchHandler.touches += 1; //push + } else if (e.type === 'touchend' || e.type === 'touchcancel') { + setTimeout(function () { + if (TouchHandler.touches > 0) { + TouchHandler.touches -= 1; //pop after 500ms + } + }, 500); + } else if (e.type === 'mousedown' && TouchHandler.touches > 0) { + allow = false; + } + + return allow; + }, + touchup: function (e) { + TouchHandler.allowEvent(e); + } + }; + + /**
+ * Delegated click handler for .waves-effect element.
+ * returns null when .waves-effect element not in "click tree"
+ */ + function getWavesEffectElement(e) { + if (TouchHandler.allowEvent(e) === false) { + return null; + } + + var element = null; + var target = e.target || e.srcElement; + + while (target.parentNode !== null) { + if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) { + element = target; + break; + } + target = target.parentNode; + } + return element; + } + + /**
+ * Bubble the click and show effect if .waves-effect elem was found
+ */ + function showEffect(e) { + var element = getWavesEffectElement(e); + + if (element !== null) { + Effect.show(e, element); + + if ('ontouchstart' in window) { + element.addEventListener('touchend', Effect.hide, false); + element.addEventListener('touchcancel', Effect.hide, false); + } + + element.addEventListener('mouseup', Effect.hide, false); + element.addEventListener('mouseleave', Effect.hide, false); + element.addEventListener('dragend', Effect.hide, false); + } + } + + Waves.displayEffect = function (options) { + options = options || {}; + + if ('duration' in options) { + Effect.duration = options.duration; + } + + //Wrap input inside <i> tag + Effect.wrapInput($$('.waves-effect')); + + if ('ontouchstart' in window) { + document.body.addEventListener('touchstart', showEffect, false); + } + + document.body.addEventListener('mousedown', showEffect, false); + }; + + /**
+ * Attach Waves to an input element (or any element which doesn't
+ * bubble mouseup/mousedown events).
+ * Intended to be used with dynamically loaded forms/inputs, or
+ * where the user doesn't want a delegated click handler.
+ */ + Waves.attach = function (element) { + //FUTURE: automatically add waves classes and allow users + // to specify them with an options param? Eg. light/classic/button + if (element.tagName.toLowerCase() === 'input') { + Effect.wrapInput([element]); + element = element.parentNode; + } + + if ('ontouchstart' in window) { + element.addEventListener('touchstart', showEffect, false); + } + + element.addEventListener('mousedown', showEffect, false); + }; + + window.Waves = Waves; + + document.addEventListener('DOMContentLoaded', function () { + Waves.displayEffect(); + }, false); +})(window); +;(function ($, Vel) { + 'use strict'; + + var _defaults = { + displayLength: Infinity, + inDuration: 300, + outDuration: 375, + className: undefined, + completeCallback: undefined, + activationPercent: 0.8 + }; + + var Toast = function () { + function Toast(message, displayLength, className, completeCallback) { + _classCallCheck(this, Toast); + + if (!message) { + return; + } + + /**
+ * Options for the toast
+ * @member Toast#options
+ */ + this.options = { + displayLength: displayLength, + className: className, + completeCallback: completeCallback + }; + + this.options = $.extend({}, Toast.defaults, this.options); + this.message = message; + + /**
+ * Describes current pan state toast
+ * @type {Boolean}
+ */ + this.panning = false; + + /**
+ * Time remaining until toast is removed
+ */ + this.timeRemaining = this.options.displayLength; + + if (Toast._toasts.length === 0) { + Toast._createContainer(); + } + + // Create new toast + Toast._toasts.push(this); + var toastElement = this.createToast(); + toastElement.M_Toast = this; + this.el = toastElement; + this._animateIn(); + this.setTimer(); + } + + _createClass(Toast, [{ + key: 'createToast', + + + /**
+ * Create toast and append it to toast container
+ */ + value: function createToast() { + var toast = document.createElement('div'); + toast.classList.add('toast'); + + // Add custom classes onto toast + if (this.options.className) { + var classes = this.options.className.split(' '); + var i = void 0, + count = void 0; + for (i = 0, count = classes.length; i < count; i++) { + toast.classList.add(classes[i]); + } + } + + // Set content + if (typeof HTMLElement === 'object' ? this.message instanceof HTMLElement : this.message && typeof this.message === 'object' && this.message !== null && this.message.nodeType === 1 && typeof this.message.nodeName === 'string') { + toast.appendChild(this.message); + + // Check if it is jQuery object + } else if (this.message instanceof jQuery) { + $(toast).append(this.message); + + // Insert as text; + } else { + toast.innerHTML = this.message; + } + + // Append toasft + Toast._container.appendChild(toast); + return toast; + } + + /**
+ * Animate in toast
+ */ + + }, { + key: '_animateIn', + value: function _animateIn() { + // Animate toast in + Vel(this.el, { top: 0, opacity: 1 }, { + duration: 300, + easing: 'easeOutCubic', + queue: false + }); + } + + /**
+ * Create setInterval which automatically removes toast when timeRemaining >= 0
+ * has been reached
+ */ + + }, { + key: 'setTimer', + value: function setTimer() { + var _this3 = this; + + if (this.timeRemaining !== Infinity) { + this.counterInterval = setInterval(function () { + // If toast is not being dragged, decrease its time remaining + if (!_this3.panning) { + _this3.timeRemaining -= 20; + } + + // Animate toast out + if (_this3.timeRemaining <= 0) { + _this3.remove(); + } + }, 20); + } + } + + /**
+ * Dismiss toast with animation
+ */ + + }, { + key: 'remove', + value: function remove() { + var _this4 = this; + + window.clearInterval(this.counterInterval); + var activationDistance = this.el.offsetWidth * this.options.activationPercent; + + if (this.wasSwiped) { + this.el.style.transition = 'transform .05s, opacity .05s'; + this.el.style.transform = 'translateX(' + activationDistance + 'px)'; + this.el.style.opacity = 0; + } + + Vel(this.el, { opacity: 0, marginTop: '-40px' }, { + duration: this.options.outDuration, + easing: 'easeOutExpo', + queue: false, + complete: function () { + // Call the optional callback + if (typeof _this4.options.completeCallback === 'function') { + _this4.options.completeCallback(); + } + // Remove toast from DOM + _this4.el.parentNode.removeChild(_this4.el); + Toast._toasts.splice(Toast._toasts.indexOf(_this4), 1); + if (Toast._toasts.length === 0) { + Toast._removeContainer(); + } + } + }); + } + }], [{ + key: '_createContainer', + + + /**
+ * Append toast container and add event handlers
+ */ + value: function _createContainer() { + var container = document.createElement('div'); + container.setAttribute('id', 'toast-container'); + + // Add event handler + container.addEventListener('touchstart', Toast._onDragStart); + container.addEventListener('touchmove', Toast._onDragMove); + container.addEventListener('touchend', Toast._onDragEnd); + + container.addEventListener('mousedown', Toast._onDragStart); + document.addEventListener('mousemove', Toast._onDragMove); + document.addEventListener('mouseup', Toast._onDragEnd); + + document.body.appendChild(container); + Toast._container = container; + } + + /**
+ * Remove toast container and event handlers
+ */ + + }, { + key: '_removeContainer', + value: function _removeContainer() { + // Add event handler + document.removeEventListener('mousemove', Toast._onDragMove); + document.removeEventListener('mouseup', Toast._onDragEnd); + + Toast._container.parentNode.removeChild(Toast._container); + Toast._container = null; + } + + /**
+ * Begin drag handler
+ * @param {Event} e
+ */ + + }, { + key: '_onDragStart', + value: function _onDragStart(e) { + if (e.target && $(e.target).closest('.toast').length) { + var $toast = $(e.target).closest('.toast'); + var toast = $toast[0].M_Toast; + toast.panning = true; + Toast._draggedToast = toast; + toast.el.classList.add('panning'); + toast.el.style.transition = ''; + toast.startingXPos = Toast._xPos(e); + toast.time = Date.now(); + toast.xPos = Toast._xPos(e); + } + } + + /**
+ * Drag move handler
+ * @param {Event} e
+ */ + + }, { + key: '_onDragMove', + value: function _onDragMove(e) { + if (!!Toast._draggedToast) { + e.preventDefault(); + var toast = Toast._draggedToast; + toast.deltaX = Math.abs(toast.xPos - Toast._xPos(e)); + toast.xPos = Toast._xPos(e); + toast.velocityX = toast.deltaX / (Date.now() - toast.time); + toast.time = Date.now(); + + var totalDeltaX = toast.xPos - toast.startingXPos; + var activationDistance = toast.el.offsetWidth * toast.options.activationPercent; + toast.el.style.transform = 'translateX(' + totalDeltaX + 'px)'; + toast.el.style.opacity = 1 - Math.abs(totalDeltaX / activationDistance); + } + } + + /**
+ * End drag handler
+ * @param {Event} e
+ */ + + }, { + key: '_onDragEnd', + value: function _onDragEnd(e) { + if (!!Toast._draggedToast) { + var toast = Toast._draggedToast; + toast.panning = false; + toast.el.classList.remove('panning'); + + var totalDeltaX = toast.xPos - toast.startingXPos; + var activationDistance = toast.el.offsetWidth * toast.options.activationPercent; + var shouldBeDismissed = Math.abs(totalDeltaX) > activationDistance || toast.velocityX > 1; + + // Remove toast + if (shouldBeDismissed) { + toast.wasSwiped = true; + toast.remove(); + + // Animate toast back to original position + } else { + toast.el.style.transition = 'transform .2s, opacity .2s'; + toast.el.style.transform = ''; + toast.el.style.opacity = ''; + } + Toast._draggedToast = null; + } + } + + /**
+ * Get x position of mouse or touch event
+ * @param {Event} e
+ */ + + }, { + key: '_xPos', + value: function _xPos(e) { + if (e.targetTouches && e.targetTouches.length >= 1) { + return e.targetTouches[0].clientX; + } + // mouse event + return e.clientX; + } + + /**
+ * Remove all toasts
+ */ + + }, { + key: 'removeAll', + value: function removeAll() { + for (var toastIndex in Toast._toasts) { + Toast._toasts[toastIndex].remove(); + } + } + }, { + key: 'defaults', + get: function () { + return _defaults; + } + }]); + + return Toast; + }(); + + /**
+ * @static
+ * @memberof Toast
+ * @type {Array.<Toast>}
+ */ + + + Toast._toasts = []; + + /**
+ * @static
+ * @memberof Toast
+ */ + Toast._container = null; + + /**
+ * @static
+ * @memberof Toast
+ * @type {Toast}
+ */ + Toast._draggedToast = null; + + Materialize.Toast = Toast; + Materialize.toast = function (message, displayLength, className, completeCallback) { + return new Toast(message, displayLength, className, completeCallback); + }; +})(jQuery, Materialize.Vel); +;(function ($) { + + var methods = { + init: function (options) { + var defaults = { + menuWidth: 300, + edge: 'left', + closeOnClick: false, + draggable: true, + onOpen: null, + onClose: null + }; + options = $.extend(defaults, options); + + $(this).each(function () { + var $this = $(this); + var menuId = $this.attr('data-activates'); + var menu = $("#" + menuId); + + // Set to width + if (options.menuWidth != 300) { + menu.css('width', options.menuWidth); + } + + // Add Touch Area + var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]'); + if (options.draggable) { + // Regenerate dragTarget + if ($dragTarget.length) { + $dragTarget.remove(); + } + + $dragTarget = $('<div class="drag-target"></div>').attr('data-sidenav', menuId); + $('body').append($dragTarget); + } else { + $dragTarget = $(); + } + + if (options.edge == 'left') { + menu.css('transform', 'translateX(-100%)'); + $dragTarget.css({ 'left': 0 }); // Add Touch Area + } else { + menu.addClass('right-aligned') // Change text-alignment to right + .css('transform', 'translateX(100%)'); + $dragTarget.css({ 'right': 0 }); // Add Touch Area + } + + // If fixed sidenav, bring menu out + if (menu.hasClass('fixed')) { + if (window.innerWidth > 992) { + menu.css('transform', 'translateX(0)'); + } + } + + // Window resize to reset on large screens fixed + if (menu.hasClass('fixed')) { + $(window).resize(function () { + if (window.innerWidth > 992) { + // Close menu if window is resized bigger than 992 and user has fixed sidenav + if ($('#sidenav-overlay').length !== 0 && menuOut) { + removeMenu(true); + } else { + // menu.removeAttr('style'); + menu.css('transform', 'translateX(0%)'); + // menu.css('width', options.menuWidth); + } + } else if (menuOut === false) { + if (options.edge === 'left') { + menu.css('transform', 'translateX(-100%)'); + } else { + menu.css('transform', 'translateX(100%)'); + } + } + }); + } + + // if closeOnClick, then add close event for all a tags in side sideNav + if (options.closeOnClick === true) { + menu.on("click.itemclick", "a:not(.collapsible-header)", function () { + if (!(window.innerWidth > 992 && menu.hasClass('fixed'))) { + removeMenu(); + } + }); + } + + var removeMenu = function (restoreNav) { + panning = false; + menuOut = false; + // Reenable scrolling + $('body').css({ + overflow: '', + width: '' + }); + + $('#sidenav-overlay').velocity({ opacity: 0 }, { duration: 200, + queue: false, easing: 'easeOutQuad', + complete: function () { + $(this).remove(); + } }); + if (options.edge === 'left') { + // Reset phantom div + $dragTarget.css({ width: '', right: '', left: '0' }); + menu.velocity({ 'translateX': '-100%' }, { duration: 200, + queue: false, + easing: 'easeOutCubic', + complete: function () { + if (restoreNav === true) { + // Restore Fixed sidenav + menu.removeAttr('style'); + menu.css('width', options.menuWidth); + } + } + + }); + } else { + // Reset phantom div + $dragTarget.css({ width: '', right: '0', left: '' }); + menu.velocity({ 'translateX': '100%' }, { duration: 200, + queue: false, + easing: 'easeOutCubic', + complete: function () { + if (restoreNav === true) { + // Restore Fixed sidenav + menu.removeAttr('style'); + menu.css('width', options.menuWidth); + } + } + }); + } + + // Callback + if (typeof options.onClose === 'function') { + options.onClose.call(this, menu); + } + }; + + // Touch Event + var panning = false; + var menuOut = false; + + if (options.draggable) { + $dragTarget.on('click', function () { + if (menuOut) { + removeMenu(); + } + }); + + $dragTarget.hammer({ + prevent_default: false + }).on('pan', function (e) { + + if (e.gesture.pointerType == "touch") { + + var direction = e.gesture.direction; + var x = e.gesture.center.x; + var y = e.gesture.center.y; + var velocityX = e.gesture.velocityX; + + // Vertical scroll bugfix + if (x === 0 && y === 0) { + return; + } + + // Disable Scrolling + var $body = $('body'); + var $overlay = $('#sidenav-overlay'); + var oldWidth = $body.innerWidth(); + $body.css('overflow', 'hidden'); + $body.width(oldWidth); + + // If overlay does not exist, create one and if it is clicked, close menu + if ($overlay.length === 0) { + $overlay = $('<div id="sidenav-overlay"></div>'); + $overlay.css('opacity', 0).click(function () { + removeMenu(); + }); + + // Run 'onOpen' when sidenav is opened via touch/swipe if applicable + if (typeof options.onOpen === 'function') { + options.onOpen.call(this, menu); + } + + $('body').append($overlay); + } + + // Keep within boundaries + if (options.edge === 'left') { + if (x > options.menuWidth) { + x = options.menuWidth; + } else if (x < 0) { + x = 0; + } + } + + if (options.edge === 'left') { + // Left Direction + if (x < options.menuWidth / 2) { + menuOut = false; + } + // Right Direction + else if (x >= options.menuWidth / 2) { + menuOut = true; + } + menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)'); + } else { + // Left Direction + if (x < window.innerWidth - options.menuWidth / 2) { + menuOut = true; + } + // Right Direction + else if (x >= window.innerWidth - options.menuWidth / 2) { + menuOut = false; + } + var rightPos = x - options.menuWidth / 2; + if (rightPos < 0) { + rightPos = 0; + } + + menu.css('transform', 'translateX(' + rightPos + 'px)'); + } + + // Percentage overlay + var overlayPerc; + if (options.edge === 'left') { + overlayPerc = x / options.menuWidth; + $overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' }); + } else { + overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth); + $overlay.velocity({ opacity: overlayPerc }, { duration: 10, queue: false, easing: 'easeOutQuad' }); + } + } + }).on('panend', function (e) { + + if (e.gesture.pointerType == "touch") { + var $overlay = $('#sidenav-overlay'); + var velocityX = e.gesture.velocityX; + var x = e.gesture.center.x; + var leftPos = x - options.menuWidth; + var rightPos = x - options.menuWidth / 2; + if (leftPos > 0) { + leftPos = 0; + } + if (rightPos < 0) { + rightPos = 0; + } + panning = false; + + if (options.edge === 'left') { + // If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut + if (menuOut && velocityX <= 0.3 || velocityX < -0.5) { + // Return menu to open + if (leftPos !== 0) { + menu.velocity({ 'translateX': [0, leftPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' }); + } + + $overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' }); + $dragTarget.css({ width: '50%', right: 0, left: '' }); + menuOut = true; + } else if (!menuOut || velocityX > 0.3) { + // Enable Scrolling + $('body').css({ + overflow: '', + width: '' + }); + // Slide menu closed + menu.velocity({ 'translateX': [-1 * options.menuWidth - 10, leftPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' }); + $overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad', + complete: function () { + // Run 'onClose' when sidenav is closed via touch/swipe if applicable + if (typeof options.onClose === 'function') { + options.onClose.call(this, menu); + } + + $(this).remove(); + } }); + $dragTarget.css({ width: '10px', right: '', left: 0 }); + } + } else { + if (menuOut && velocityX >= -0.3 || velocityX > 0.5) { + // Return menu to open + if (rightPos !== 0) { + menu.velocity({ 'translateX': [0, rightPos] }, { duration: 300, queue: false, easing: 'easeOutQuad' }); + } + + $overlay.velocity({ opacity: 1 }, { duration: 50, queue: false, easing: 'easeOutQuad' }); + $dragTarget.css({ width: '50%', right: '', left: 0 }); + menuOut = true; + } else if (!menuOut || velocityX < -0.3) { + // Enable Scrolling + $('body').css({ + overflow: '', + width: '' + }); + + // Slide menu closed + menu.velocity({ 'translateX': [options.menuWidth + 10, rightPos] }, { duration: 200, queue: false, easing: 'easeOutQuad' }); + $overlay.velocity({ opacity: 0 }, { duration: 200, queue: false, easing: 'easeOutQuad', + complete: function () { + // Run 'onClose' when sidenav is closed via touch/swipe if applicable + if (typeof options.onClose === 'function') { + options.onClose.call(this, menu); + } + + $(this).remove(); + } }); + $dragTarget.css({ width: '10px', right: 0, left: '' }); + } + } + } + }); + } + + $this.off('click.sidenav').on('click.sidenav', function () { + if (menuOut === true) { + menuOut = false; + panning = false; + removeMenu(); + } else { + + // Disable Scrolling + var $body = $('body'); + var $overlay = $('<div id="sidenav-overlay"></div>'); + var oldWidth = $body.innerWidth(); + $body.css('overflow', 'hidden'); + $body.width(oldWidth); + + // Push current drag target on top of DOM tree + $('body').append($dragTarget); + + if (options.edge === 'left') { + $dragTarget.css({ width: '50%', right: 0, left: '' }); + menu.velocity({ 'translateX': [0, -1 * options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' }); + } else { + $dragTarget.css({ width: '50%', right: '', left: 0 }); + menu.velocity({ 'translateX': [0, options.menuWidth] }, { duration: 300, queue: false, easing: 'easeOutQuad' }); + } + + // Overlay close on click + $overlay.css('opacity', 0).click(function () { + menuOut = false; + panning = false; + removeMenu(); + $overlay.velocity({ opacity: 0 }, { duration: 300, queue: false, easing: 'easeOutQuad', + complete: function () { + $(this).remove(); + } + }); + }); + + // Append body + $('body').append($overlay); + $overlay.velocity({ opacity: 1 }, { duration: 300, queue: false, easing: 'easeOutQuad', + complete: function () { + menuOut = true; + panning = false; + } + }); + + // Callback + if (typeof options.onOpen === 'function') { + options.onOpen.call(this, menu); + } + } + + return false; + }); + }); + }, + destroy: function () { + var $overlay = $('#sidenav-overlay'); + var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]'); + $overlay.trigger('click'); + $dragTarget.remove(); + $(this).off('click'); + $overlay.remove(); + }, + show: function () { + this.trigger('click'); + }, + hide: function () { + $('#sidenav-overlay').trigger('click'); + } + }; + + $.fn.sideNav = function (methodOrOptions) { + if (methods[methodOrOptions]) { + return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1)); + } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { + // Default to "init" + return methods.init.apply(this, arguments); + } else { + $.error('Method ' + methodOrOptions + ' does not exist on jQuery.sideNav'); + } + }; // Plugin end +})(jQuery); +; /**
+ * Extend jquery with a scrollspy plugin.
+ * This watches the window scroll and fires events when elements are scrolled into viewport.
+ *
+ * throttle() and getTime() taken from Underscore.js
+ * https://github.com/jashkenas/underscore
+ *
+ * @author Copyright 2013 John Smart
+ * @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE
+ * @see https://github.com/thesmart
+ * @version 0.1.2
+ */ +(function ($) { + + var jWindow = $(window); + var elements = []; + var elementsInView = []; + var isSpying = false; + var ticks = 0; + var unique_id = 1; + var offset = { + top: 0, + right: 0, + bottom: 0, + left: 0 + + /**
+ * Find elements that are within the boundary
+ * @param {number} top
+ * @param {number} right
+ * @param {number} bottom
+ * @param {number} left
+ * @return {jQuery} A collection of elements
+ */ + };function findElements(top, right, bottom, left) { + var hits = $(); + $.each(elements, function (i, element) { + if (element.height() > 0) { + var elTop = element.offset().top, + elLeft = element.offset().left, + elRight = elLeft + element.width(), + elBottom = elTop + element.height(); + + var isIntersect = !(elLeft > right || elRight < left || elTop > bottom || elBottom < top); + + if (isIntersect) { + hits.push(element); + } + } + }); + + return hits; + } + + /**
+ * Called when the user scrolls the window
+ */ + function onScroll(scrollOffset) { + // unique tick id + ++ticks; + + // viewport rectangle + var top = jWindow.scrollTop(), + left = jWindow.scrollLeft(), + right = left + jWindow.width(), + bottom = top + jWindow.height(); + + // determine which elements are in view + var intersections = findElements(top + offset.top + scrollOffset || 200, right + offset.right, bottom + offset.bottom, left + offset.left); + $.each(intersections, function (i, element) { + + var lastTick = element.data('scrollSpy:ticks'); + if (typeof lastTick != 'number') { + // entered into view + element.triggerHandler('scrollSpy:enter'); + } + + // update tick id + element.data('scrollSpy:ticks', ticks); + }); + + // determine which elements are no longer in view + $.each(elementsInView, function (i, element) { + var lastTick = element.data('scrollSpy:ticks'); + if (typeof lastTick == 'number' && lastTick !== ticks) { + // exited from view + element.triggerHandler('scrollSpy:exit'); + element.data('scrollSpy:ticks', null); + } + }); + + // remember elements in view for next tick + elementsInView = intersections; + } + + /**
+ * Called when window is resized
+ */ + function onWinSize() { + jWindow.trigger('scrollSpy:winSize'); + } + + /**
+ * Enables ScrollSpy using a selector
+ * @param {jQuery|string} selector The elements collection, or a selector
+ * @param {Object=} options Optional.
+ throttle : number -> scrollspy throttling. Default: 100 ms
+ offsetTop : number -> offset from top. Default: 0
+ offsetRight : number -> offset from right. Default: 0
+ offsetBottom : number -> offset from bottom. Default: 0
+ offsetLeft : number -> offset from left. Default: 0
+ activeClass : string -> Class name to be added to the active link. Default: active
+ * @returns {jQuery}
+ */ + $.scrollSpy = function (selector, options) { + var defaults = { + throttle: 100, + scrollOffset: 200, // offset - 200 allows elements near bottom of page to scroll + activeClass: 'active', + getActiveElement: function (id) { + return 'a[href="#' + id + '"]'; + } + }; + options = $.extend(defaults, options); + + var visible = []; + selector = $(selector); + selector.each(function (i, element) { + elements.push($(element)); + $(element).data("scrollSpy:id", i); + // Smooth scroll to section + $('a[href="#' + $(element).attr('id') + '"]').click(function (e) { + e.preventDefault(); + var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1; + $('html, body').animate({ scrollTop: offset - options.scrollOffset }, { duration: 400, queue: false, easing: 'easeOutCubic' }); + }); + }); + + offset.top = options.offsetTop || 0; + offset.right = options.offsetRight || 0; + offset.bottom = options.offsetBottom || 0; + offset.left = options.offsetLeft || 0; + + var throttledScroll = Materialize.throttle(function () { + onScroll(options.scrollOffset); + }, options.throttle || 100); + var readyScroll = function () { + $(document).ready(throttledScroll); + }; + + if (!isSpying) { + jWindow.on('scroll', readyScroll); + jWindow.on('resize', readyScroll); + isSpying = true; + } + + // perform a scan once, after current execution context, and after dom is ready + setTimeout(readyScroll, 0); + + selector.on('scrollSpy:enter', function () { + visible = $.grep(visible, function (value) { + return value.height() != 0; + }); + + var $this = $(this); + + if (visible[0]) { + $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass); + if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) { + visible.unshift($(this)); + } else { + visible.push($(this)); + } + } else { + visible.push($(this)); + } + + $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass); + }); + selector.on('scrollSpy:exit', function () { + visible = $.grep(visible, function (value) { + return value.height() != 0; + }); + + if (visible[0]) { + $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass); + var $this = $(this); + visible = $.grep(visible, function (value) { + return value.attr('id') != $this.attr('id'); + }); + if (visible[0]) { + // Check if empty + $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass); + } + } + }); + + return selector; + }; + + /**
+ * Listen for window resize events
+ * @param {Object=} options Optional. Set { throttle: number } to change throttling. Default: 100 ms
+ * @returns {jQuery} $(window)
+ */ + $.winSizeSpy = function (options) { + $.winSizeSpy = function () { + return jWindow; + }; // lock from multiple calls + options = options || { + throttle: 100 + }; + return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100)); + }; + + /**
+ * Enables ScrollSpy on a collection of elements
+ * e.g. $('.scrollSpy').scrollSpy()
+ * @param {Object=} options Optional.
+ throttle : number -> scrollspy throttling. Default: 100 ms
+ offsetTop : number -> offset from top. Default: 0
+ offsetRight : number -> offset from right. Default: 0
+ offsetBottom : number -> offset from bottom. Default: 0
+ offsetLeft : number -> offset from left. Default: 0
+ * @returns {jQuery}
+ */ + $.fn.scrollSpy = function (options) { + return $.scrollSpy($(this), options); + }; +})(jQuery); +;(function ($) { + $(document).ready(function () { + + // Function to update labels of text fields + Materialize.updateTextFields = function () { + var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea'; + $(input_selector).each(function (index, element) { + var $this = $(this); + if ($(element).val().length > 0 || $(element).is(':focus') || element.autofocus || $this.attr('placeholder') !== undefined) { + $this.siblings('label').addClass('active'); + } else if ($(element)[0].validity) { + $this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true); + } else { + $this.siblings('label').removeClass('active'); + } + }); + }; + + // Text based inputs + var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea'; + + // Add active if form auto complete + $(document).on('change', input_selector, function () { + if ($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) { + $(this).siblings('label').addClass('active'); + } + validate_field($(this)); + }); + + // Add active if input element has been pre-populated on document ready + $(document).ready(function () { + Materialize.updateTextFields(); + }); + + // HTML DOM FORM RESET handling + $(document).on('reset', function (e) { + var formReset = $(e.target); + if (formReset.is('form')) { + formReset.find(input_selector).removeClass('valid').removeClass('invalid'); + formReset.find(input_selector).each(function () { + if ($(this).attr('value') === '') { + $(this).siblings('label').removeClass('active'); + } + }); + + // Reset select + formReset.find('select.initialized').each(function () { + var reset_text = formReset.find('option[selected]').text(); + formReset.siblings('input.select-dropdown').val(reset_text); + }); + } + }); + + // Add active when element has focus + $(document).on('focus', input_selector, function () { + $(this).siblings('label, .prefix').addClass('active'); + }); + + $(document).on('blur', input_selector, function () { + var $inputElement = $(this); + var selector = ".prefix"; + + if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) { + selector += ", label"; + } + + $inputElement.siblings(selector).removeClass('active'); + + validate_field($inputElement); + }); + + window.validate_field = function (object) { + var hasLength = object.attr('data-length') !== undefined; + var lenAttr = parseInt(object.attr('data-length')); + var len = object.val().length; + + if (object.val().length === 0 && object[0].validity.badInput === false && !object.is(':required')) { + if (object.hasClass('validate')) { + object.removeClass('valid'); + object.removeClass('invalid'); + } + } else { + if (object.hasClass('validate')) { + // Check for character counter attributes + if (object.is(':valid') && hasLength && len <= lenAttr || object.is(':valid') && !hasLength) { + object.removeClass('invalid'); + object.addClass('valid'); + } else { + object.removeClass('valid'); + object.addClass('invalid'); + } + } + } + }; + + // Radio and Checkbox focus class + var radio_checkbox = 'input[type=radio], input[type=checkbox]'; + $(document).on('keyup.radio', radio_checkbox, function (e) { + // TAB, check if tabbing to radio or checkbox. + if (e.which === 9) { + $(this).addClass('tabbed'); + var $this = $(this); + $this.one('blur', function (e) { + + $(this).removeClass('tabbed'); + }); + return; + } + }); + + // Textarea Auto Resize + var hiddenDiv = $('.hiddendiv').first(); + if (!hiddenDiv.length) { + hiddenDiv = $('<div class="hiddendiv common"></div>'); + $('body').append(hiddenDiv); + } + var text_area_selector = '.materialize-textarea'; + + function textareaAutoResize($textarea) { + // Set font properties of hiddenDiv + + var fontFamily = $textarea.css('font-family'); + var fontSize = $textarea.css('font-size'); + var lineHeight = $textarea.css('line-height'); + var padding = $textarea.css('padding'); + + if (fontSize) { + hiddenDiv.css('font-size', fontSize); + } + if (fontFamily) { + hiddenDiv.css('font-family', fontFamily); + } + if (lineHeight) { + hiddenDiv.css('line-height', lineHeight); + } + if (padding) { + hiddenDiv.css('padding', padding); + } + + // Set original-height, if none + if (!$textarea.data('original-height')) { + $textarea.data('original-height', $textarea.height()); + } + + if ($textarea.attr('wrap') === 'off') { + hiddenDiv.css('overflow-wrap', 'normal').css('white-space', 'pre'); + } + + hiddenDiv.text($textarea.val() + '\n'); + var content = hiddenDiv.html().replace(/\n/g, '<br>'); + hiddenDiv.html(content); + + // When textarea is hidden, width goes crazy. + // Approximate with half of window size + + if ($textarea.is(':visible')) { + hiddenDiv.css('width', $textarea.width()); + } else { + hiddenDiv.css('width', $(window).width() / 2); + } + + /**
+ * Resize if the new height is greater than the
+ * original height of the textarea
+ */ + if ($textarea.data('original-height') <= hiddenDiv.height()) { + $textarea.css('height', hiddenDiv.height()); + } else if ($textarea.val().length < $textarea.data('previous-length')) { + /**
+ * In case the new height is less than original height, it
+ * means the textarea has less text than before
+ * So we set the height to the original one
+ */ + $textarea.css('height', $textarea.data('original-height')); + } + $textarea.data('previous-length', $textarea.val().length); + } + + $(text_area_selector).each(function () { + var $textarea = $(this); + /**
+ * Instead of resizing textarea on document load,
+ * store the original height and the original length
+ */ + $textarea.data('original-height', $textarea.height()); + $textarea.data('previous-length', $textarea.val().length); + }); + + $('body').on('keyup keydown autoresize', text_area_selector, function () { + textareaAutoResize($(this)); + }); + + // File Input Path + $(document).on('change', '.file-field input[type="file"]', function () { + var file_field = $(this).closest('.file-field'); + var path_input = file_field.find('input.file-path'); + var files = $(this)[0].files; + var file_names = []; + for (var i = 0; i < files.length; i++) { + file_names.push(files[i].name); + } + path_input.val(file_names.join(", ")); + path_input.trigger('change'); + }); + + /****************
+ * Range Input *
+ ****************/ + + var range_type = 'input[type=range]'; + var range_mousedown = false; + var left; + + $(range_type).each(function () { + var thumb = $('<span class="thumb"><span class="value"></span></span>'); + $(this).after(thumb); + }); + + var showRangeBubble = function (thumb) { + var paddingLeft = parseInt(thumb.parent().css('padding-left')); + var marginLeft = -7 + paddingLeft + 'px'; + thumb.velocity({ height: "30px", width: "30px", top: "-30px", marginLeft: marginLeft }, { duration: 300, easing: 'easeOutExpo' }); + }; + + var calcRangeOffset = function (range) { + var width = range.width() - 15; + var max = parseFloat(range.attr('max')); + var min = parseFloat(range.attr('min')); + var percent = (parseFloat(range.val()) - min) / (max - min); + return percent * width; + }; + + var range_wrapper = '.range-field'; + $(document).on('change', range_type, function (e) { + var thumb = $(this).siblings('.thumb'); + thumb.find('.value').html($(this).val()); + + if (!thumb.hasClass('active')) { + showRangeBubble(thumb); + } + + var offsetLeft = calcRangeOffset($(this)); + thumb.addClass('active').css('left', offsetLeft); + }); + + $(document).on('mousedown touchstart', range_type, function (e) { + var thumb = $(this).siblings('.thumb'); + + // If thumb indicator does not exist yet, create it + if (thumb.length <= 0) { + thumb = $('<span class="thumb"><span class="value"></span></span>'); + $(this).after(thumb); + } + + // Set indicator value + thumb.find('.value').html($(this).val()); + + range_mousedown = true; + $(this).addClass('active'); + + if (!thumb.hasClass('active')) { + showRangeBubble(thumb); + } + + if (e.type !== 'input') { + var offsetLeft = calcRangeOffset($(this)); + thumb.addClass('active').css('left', offsetLeft); + } + }); + + $(document).on('mouseup touchend', range_wrapper, function () { + range_mousedown = false; + $(this).removeClass('active'); + }); + + $(document).on('input mousemove touchmove', range_wrapper, function (e) { + var thumb = $(this).children('.thumb'); + var left; + var input = $(this).find(range_type); + + if (range_mousedown) { + if (!thumb.hasClass('active')) { + showRangeBubble(thumb); + } + + var offsetLeft = calcRangeOffset(input); + thumb.addClass('active').css('left', offsetLeft); + thumb.find('.value').html(thumb.siblings(range_type).val()); + } + }); + + $(document).on('mouseout touchleave', range_wrapper, function () { + if (!range_mousedown) { + + var thumb = $(this).children('.thumb'); + var paddingLeft = parseInt($(this).css('padding-left')); + var marginLeft = 7 + paddingLeft + 'px'; + + if (thumb.hasClass('active')) { + thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: marginLeft }, { duration: 100 }); + } + thumb.removeClass('active'); + } + }); + + /**************************
+ * Auto complete plugin *
+ *************************/ + $.fn.autocomplete = function (options) { + // Defaults + var defaults = { + data: {}, + limit: Infinity, + onAutocomplete: null, + minLength: 1 + }; + + options = $.extend(defaults, options); + + return this.each(function () { + var $input = $(this); + var data = options.data, + count = 0, + activeIndex = -1, + oldVal, + $inputDiv = $input.closest('.input-field'); // Div to append on + + // Check if data isn't empty + if (!$.isEmptyObject(data)) { + var $autocomplete = $('<ul class="autocomplete-content dropdown-content"></ul>'); + var $oldAutocomplete; + + // Append autocomplete element. + // Prevent double structure init. + if ($inputDiv.length) { + $oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first(); + if (!$oldAutocomplete.length) { + $inputDiv.append($autocomplete); // Set ul in body + } + } else { + $oldAutocomplete = $input.next('.autocomplete-content.dropdown-content'); + if (!$oldAutocomplete.length) { + $input.after($autocomplete); + } + } + if ($oldAutocomplete.length) { + $autocomplete = $oldAutocomplete; + } + + // Highlight partial match. + var highlight = function (string, $el) { + var img = $el.find('img'); + var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""), + matchEnd = matchStart + string.length - 1, + beforeMatch = $el.text().slice(0, matchStart), + matchText = $el.text().slice(matchStart, matchEnd + 1), + afterMatch = $el.text().slice(matchEnd + 1); + $el.html("<span>" + beforeMatch + "<span class='highlight'>" + matchText + "</span>" + afterMatch + "</span>"); + if (img.length) { + $el.prepend(img); + } + }; + + // Reset current element position + var resetCurrentElement = function () { + activeIndex = -1; + $autocomplete.find('.active').removeClass('active'); + }; + + // Remove autocomplete elements + var removeAutocomplete = function () { + $autocomplete.empty(); + resetCurrentElement(); + oldVal = undefined; + }; + + $input.off('blur.autocomplete').on('blur.autocomplete', function () { + removeAutocomplete(); + }); + + // Perform search + $input.off('keyup.autocomplete focus.autocomplete').on('keyup.autocomplete focus.autocomplete', function (e) { + // Reset count. + count = 0; + var val = $input.val().toLowerCase(); + + // Don't capture enter or arrow key usage. + if (e.which === 13 || e.which === 38 || e.which === 40) { + return; + } + + // Check if the input isn't empty + if (oldVal !== val) { + removeAutocomplete(); + + if (val.length >= options.minLength) { + for (var key in data) { + if (data.hasOwnProperty(key) && key.toLowerCase().indexOf(val) !== -1) { + // Break if past limit + if (count >= options.limit) { + break; + } + + var autocompleteOption = $('<li></li>'); + if (!!data[key]) { + autocompleteOption.append('<img src="' + data[key] + '" class="right circle"><span>' + key + '</span>'); + } else { + autocompleteOption.append('<span>' + key + '</span>'); + } + + $autocomplete.append(autocompleteOption); + highlight(val, autocompleteOption); + count++; + } + } + } + } + + // Update oldVal + oldVal = val; + }); + + $input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) { + // Arrow keys and enter key usage + var keyCode = e.which, + liElement, + numItems = $autocomplete.children('li').length, + $active = $autocomplete.children('.active').first(); + + // select element on Enter + if (keyCode === 13 && activeIndex >= 0) { + liElement = $autocomplete.children('li').eq(activeIndex); + if (liElement.length) { + liElement.trigger('mousedown.autocomplete'); + e.preventDefault(); + } + return; + } + + // Capture up and down key + if (keyCode === 38 || keyCode === 40) { + e.preventDefault(); + + if (keyCode === 38 && activeIndex > 0) { + activeIndex--; + } + + if (keyCode === 40 && activeIndex < numItems - 1) { + activeIndex++; + } + + $active.removeClass('active'); + if (activeIndex >= 0) { + $autocomplete.children('li').eq(activeIndex).addClass('active'); + } + } + }); + + // Set input value + $autocomplete.off('mousedown.autocomplete touchstart.autocomplete').on('mousedown.autocomplete touchstart.autocomplete', 'li', function () { + var text = $(this).text().trim(); + $input.val(text); + $input.trigger('change'); + removeAutocomplete(); + + // Handle onAutocomplete callback. + if (typeof options.onAutocomplete === "function") { + options.onAutocomplete.call(this, text); + } + }); + + // Empty data + } else { + $input.off('keyup.autocomplete focus.autocomplete'); + } + }); + }; + }); // End of $(document).ready + + /*******************
+ * Select Plugin *
+ ******************/ + $.fn.material_select = function (callback) { + $(this).each(function () { + var $select = $(this); + + if ($select.hasClass('browser-default')) { + return; // Continue to next (return false breaks out of entire loop) + } + + var multiple = $select.attr('multiple') ? true : false, + lastID = $select.attr('data-select-id'); // Tear down structure if Select needs to be rebuilt + + if (lastID) { + $select.parent().find('span.caret').remove(); + $select.parent().find('input').remove(); + + $select.unwrap(); + $('ul#select-options-' + lastID).remove(); + } + + // If destroying the select, remove the selelct-id and reset it to it's uninitialized state. + if (callback === 'destroy') { + $select.removeAttr('data-select-id').removeClass('initialized'); + $(window).off('click.select'); + return; + } + + var uniqueID = Materialize.guid(); + $select.attr('data-select-id', uniqueID); + var wrapper = $('<div class="select-wrapper"></div>'); + wrapper.addClass($select.attr('class')); + if ($select.is(':disabled')) wrapper.addClass('disabled'); + var options = $('<ul id="select-options-' + uniqueID + '" class="dropdown-content select-dropdown ' + (multiple ? 'multiple-select-dropdown' : '') + '"></ul>'), + selectChildren = $select.children('option, optgroup'), + valuesSelected = [], + optionsHover = false; + + var label = $select.find('option:selected').html() || $select.find('option:first').html() || ""; + + // Function that renders and appends the option taking into + // account type and possible image icon. + var appendOptionWithIcon = function (select, option, type) { + // Add disabled attr if disabled + var disabledClass = option.is(':disabled') ? 'disabled ' : ''; + var optgroupClass = type === 'optgroup-option' ? 'optgroup-option ' : ''; + var multipleCheckbox = multiple ? '<input type="checkbox"' + disabledClass + '/><label></label>' : ''; + + // add icons + var icon_url = option.data('icon'); + var classes = option.attr('class'); + if (!!icon_url) { + var classString = ''; + if (!!classes) classString = ' class="' + classes + '"'; + + // Check for multiple type. + options.append($('<li class="' + disabledClass + optgroupClass + '"><img alt="" src="' + icon_url + '"' + classString + '><span>' + multipleCheckbox + option.html() + '</span></li>')); + return true; + } + + // Check for multiple type. + options.append($('<li class="' + disabledClass + optgroupClass + '"><span>' + multipleCheckbox + option.html() + '</span></li>')); + }; + + /* Create dropdown structure. */ + if (selectChildren.length) { + selectChildren.each(function () { + if ($(this).is('option')) { + // Direct descendant option. + if (multiple) { + appendOptionWithIcon($select, $(this), 'multiple'); + } else { + appendOptionWithIcon($select, $(this)); + } + } else if ($(this).is('optgroup')) { + // Optgroup. + var selectOptions = $(this).children('option'); + options.append($('<li class="optgroup"><span>' + $(this).attr('label') + '</span></li>')); + + selectOptions.each(function () { + appendOptionWithIcon($select, $(this), 'optgroup-option'); + }); + } + }); + } + + options.find('li:not(.optgroup)').each(function (i) { + $(this).click(function (e) { + // Check if option element is disabled + if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) { + var selected = true; + + if (multiple) { + $('input[type="checkbox"]', this).prop('checked', function (i, v) { + return !v; + }); + selected = toggleEntryFromArray(valuesSelected, i, $select); + $newSelect.trigger('focus'); + } else { + options.find('li').removeClass('active'); + $(this).toggleClass('active'); + $newSelect.val($(this).text()); + } + + activateOption(options, $(this)); + $select.find('option').eq(i).prop('selected', selected); + // Trigger onchange() event + $select.trigger('change'); + if (typeof callback !== 'undefined') callback(); + } + + e.stopPropagation(); + }); + }); + + // Wrap Elements + $select.wrap(wrapper); + // Add Select Display Element + var dropdownIcon = $('<span class="caret">▼</span>'); + + // escape double quotes + var sanitizedLabelHtml = label.replace(/"/g, '"'); + + var $newSelect = $('<input type="text" class="select-dropdown" readonly="true" ' + ($select.is(':disabled') ? 'disabled' : '') + ' data-activates="select-options-' + uniqueID + '" value="' + sanitizedLabelHtml + '"/>'); + $select.before($newSelect); + $newSelect.before(dropdownIcon); + + $newSelect.after(options); + // Check if section element is disabled + if (!$select.is(':disabled')) { + $newSelect.dropdown({ 'hover': false }); + } + + // Copy tabindex + if ($select.attr('tabindex')) { + $($newSelect[0]).attr('tabindex', $select.attr('tabindex')); + } + + $select.addClass('initialized'); + + $newSelect.on({ + 'focus': function () { + if ($('ul.select-dropdown').not(options[0]).is(':visible')) { + $('input.select-dropdown').trigger('close'); + $(window).off('click.select'); + } + if (!options.is(':visible')) { + $(this).trigger('open', ['focus']); + var label = $(this).val(); + if (multiple && label.indexOf(',') >= 0) { + label = label.split(',')[0]; + } + + var selectedOption = options.find('li').filter(function () { + return $(this).text().toLowerCase() === label.toLowerCase(); + })[0]; + activateOption(options, selectedOption, true); + + $(window).off('click.select').on('click.select', function () { + multiple && (optionsHover || $newSelect.trigger('close')); + $(window).off('click.select'); + }); + } + }, + 'click': function (e) { + e.stopPropagation(); + } + }); + + $newSelect.on('blur', function () { + if (!multiple) { + $(this).trigger('close'); + $(window).off('click.select'); + } + options.find('li.selected').removeClass('selected'); + }); + + options.hover(function () { + optionsHover = true; + }, function () { + optionsHover = false; + }); + + // Add initial multiple selections. + if (multiple) { + $select.find("option:selected:not(:disabled)").each(function () { + var index = this.index; + + toggleEntryFromArray(valuesSelected, index, $select); + options.find("li:not(.optgroup)").eq(index).find(":checkbox").prop("checked", true); + }); + } + + /**
+ * Make option as selected and scroll to selected position
+ * @param {jQuery} collection Select options jQuery element
+ * @param {Element} newOption element of the new option
+ * @param {Boolean} firstActivation If on first activation of select
+ */ + var activateOption = function (collection, newOption, firstActivation) { + if (newOption) { + collection.find('li.selected').removeClass('selected'); + var option = $(newOption); + option.addClass('selected'); + if (!multiple || !!firstActivation) { + options.scrollTo(option); + } + } + }; + + // Allow user to search by typing + // this array is cleared after 1 second + var filterQuery = [], + onKeyDown = function (e) { + // TAB - switch to another input + if (e.which == 9) { + $newSelect.trigger('close'); + return; + } + + // ARROW DOWN WHEN SELECT IS CLOSED - open select options + if (e.which == 40 && !options.is(':visible')) { + $newSelect.trigger('open'); + return; + } + + // ENTER WHEN SELECT IS CLOSED - submit form + if (e.which == 13 && !options.is(':visible')) { + return; + } + + e.preventDefault(); + + // CASE WHEN USER TYPE LETTERS + var letter = String.fromCharCode(e.which).toLowerCase(), + nonLetters = [9, 13, 27, 38, 40]; + if (letter && nonLetters.indexOf(e.which) === -1) { + filterQuery.push(letter); + + var string = filterQuery.join(''), + newOption = options.find('li').filter(function () { + return $(this).text().toLowerCase().indexOf(string) === 0; + })[0]; + + if (newOption) { + activateOption(options, newOption); + } + } + + // ENTER - select option and close when select options are opened + if (e.which == 13) { + var activeOption = options.find('li.selected:not(.disabled)')[0]; + if (activeOption) { + $(activeOption).trigger('click'); + if (!multiple) { + $newSelect.trigger('close'); + } + } + } + + // ARROW DOWN - move to next not disabled option + if (e.which == 40) { + if (options.find('li.selected').length) { + newOption = options.find('li.selected').next('li:not(.disabled)')[0]; + } else { + newOption = options.find('li:not(.disabled)')[0]; + } + activateOption(options, newOption); + } + + // ESC - close options + if (e.which == 27) { + $newSelect.trigger('close'); + } + + // ARROW UP - move to previous not disabled option + if (e.which == 38) { + newOption = options.find('li.selected').prev('li:not(.disabled)')[0]; + if (newOption) activateOption(options, newOption); + } + + // Automaticaly clean filter query so user can search again by starting letters + setTimeout(function () { + filterQuery = []; + }, 1000); + }; + + $newSelect.on('keydown', onKeyDown); + }); + + function toggleEntryFromArray(entriesArray, entryIndex, select) { + var index = entriesArray.indexOf(entryIndex), + notAdded = index === -1; + + if (notAdded) { + entriesArray.push(entryIndex); + } else { + entriesArray.splice(index, 1); + } + + select.siblings('ul.dropdown-content').find('li:not(.optgroup)').eq(entryIndex).toggleClass('active'); + + // use notAdded instead of true (to detect if the option is selected or not) + select.find('option').eq(entryIndex).prop('selected', notAdded); + setValueToInput(entriesArray, select); + + return notAdded; + } + + function setValueToInput(entriesArray, select) { + var value = ''; + + for (var i = 0, count = entriesArray.length; i < count; i++) { + var text = select.find('option').eq(entriesArray[i]).text(); + + i === 0 ? value += text : value += ', ' + text; + } + + if (value === '') { + value = select.find('option:disabled').eq(0).text(); + } + + select.siblings('input.select-dropdown').val(value); + } + }; +})(jQuery); +;(function ($) { + + var methods = { + + init: function (options) { + var defaults = { + indicators: true, + height: 400, + transition: 500, + interval: 6000 + }; + options = $.extend(defaults, options); + + return this.each(function () { + + // For each slider, we want to keep track of + // which slide is active and its associated content + var $this = $(this); + var $slider = $this.find('ul.slides').first(); + var $slides = $slider.find('> li'); + var $active_index = $slider.find('.active').index(); + var $active, $indicators, $interval; + if ($active_index != -1) { + $active = $slides.eq($active_index); + } + + // Transitions the caption depending on alignment + function captionTransition(caption, duration) { + if (caption.hasClass("center-align")) { + caption.velocity({ opacity: 0, translateY: -100 }, { duration: duration, queue: false }); + } else if (caption.hasClass("right-align")) { + caption.velocity({ opacity: 0, translateX: 100 }, { duration: duration, queue: false }); + } else if (caption.hasClass("left-align")) { + caption.velocity({ opacity: 0, translateX: -100 }, { duration: duration, queue: false }); + } + } + + // This function will transition the slide to any index of the next slide + function moveToSlide(index) { + // Wrap around indices. + if (index >= $slides.length) index = 0;else if (index < 0) index = $slides.length - 1; + + $active_index = $slider.find('.active').index(); + + // Only do if index changes + if ($active_index != index) { + $active = $slides.eq($active_index); + $caption = $active.find('.caption'); + + $active.removeClass('active'); + $active.velocity({ opacity: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad', + complete: function () { + $slides.not('.active').velocity({ opacity: 0, translateX: 0, translateY: 0 }, { duration: 0, queue: false }); + } }); + captionTransition($caption, options.transition); + + // Update indicators + if (options.indicators) { + $indicators.eq($active_index).removeClass('active'); + } + + $slides.eq(index).velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' }); + $slides.eq(index).find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad' }); + $slides.eq(index).addClass('active'); + + // Update indicators + if (options.indicators) { + $indicators.eq(index).addClass('active'); + } + } + } + + // Set height of slider + // If fullscreen, do nothing + if (!$this.hasClass('fullscreen')) { + if (options.indicators) { + // Add height if indicators are present + $this.height(options.height + 40); + } else { + $this.height(options.height); + } + $slider.height(options.height); + } + + // Set initial positions of captions + $slides.find('.caption').each(function () { + captionTransition($(this), 0); + }); + + // Move img src into background-image + $slides.find('img').each(function () { + var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw=='; + if ($(this).attr('src') !== placeholderBase64) { + $(this).css('background-image', 'url("' + $(this).attr('src') + '")'); + $(this).attr('src', placeholderBase64); + } + }); + + // dynamically add indicators + if (options.indicators) { + $indicators = $('<ul class="indicators"></ul>'); + $slides.each(function (index) { + var $indicator = $('<li class="indicator-item"></li>'); + + // Handle clicks on indicators + $indicator.click(function () { + var $parent = $slider.parent(); + var curr_index = $parent.find($(this)).index(); + moveToSlide(curr_index); + + // reset interval + clearInterval($interval); + $interval = setInterval(function () { + $active_index = $slider.find('.active').index(); + if ($slides.length == $active_index + 1) $active_index = 0; // loop to start + else $active_index += 1; + + moveToSlide($active_index); + }, options.transition + options.interval); + }); + $indicators.append($indicator); + }); + $this.append($indicators); + $indicators = $this.find('ul.indicators').find('li.indicator-item'); + } + + if ($active) { + $active.show(); + } else { + $slides.first().addClass('active').velocity({ opacity: 1 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' }); + + $active_index = 0; + $active = $slides.eq($active_index); + + // Update indicators + if (options.indicators) { + $indicators.eq($active_index).addClass('active'); + } + } + + // Adjust height to current slide + $active.find('img').each(function () { + $active.find('.caption').velocity({ opacity: 1, translateX: 0, translateY: 0 }, { duration: options.transition, queue: false, easing: 'easeOutQuad' }); + }); + + // auto scroll + $interval = setInterval(function () { + $active_index = $slider.find('.active').index(); + moveToSlide($active_index + 1); + }, options.transition + options.interval); + + // HammerJS, Swipe navigation + + // Touch Event + var panning = false; + var swipeLeft = false; + var swipeRight = false; + + $this.hammer({ + prevent_default: false + }).on('pan', function (e) { + if (e.gesture.pointerType === "touch") { + + // reset interval + clearInterval($interval); + + var direction = e.gesture.direction; + var x = e.gesture.deltaX; + var velocityX = e.gesture.velocityX; + var velocityY = e.gesture.velocityY; + + $curr_slide = $slider.find('.active'); + if (Math.abs(velocityX) > Math.abs(velocityY)) { + $curr_slide.velocity({ translateX: x + }, { duration: 50, queue: false, easing: 'easeOutQuad' }); + } + + // Swipe Left + if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.65)) { + swipeRight = true; + } + // Swipe Right + else if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.65)) { + swipeLeft = true; + } + + // Make Slide Behind active slide visible + var next_slide; + if (swipeLeft) { + next_slide = $curr_slide.next(); + if (next_slide.length === 0) { + next_slide = $slides.first(); + } + next_slide.velocity({ opacity: 1 + }, { duration: 300, queue: false, easing: 'easeOutQuad' }); + } + if (swipeRight) { + next_slide = $curr_slide.prev(); + if (next_slide.length === 0) { + next_slide = $slides.last(); + } + next_slide.velocity({ opacity: 1 + }, { duration: 300, queue: false, easing: 'easeOutQuad' }); + } + } + }).on('panend', function (e) { + if (e.gesture.pointerType === "touch") { + + $curr_slide = $slider.find('.active'); + panning = false; + curr_index = $slider.find('.active').index(); + + if (!swipeRight && !swipeLeft || $slides.length <= 1) { + // Return to original spot + $curr_slide.velocity({ translateX: 0 + }, { duration: 300, queue: false, easing: 'easeOutQuad' }); + } else if (swipeLeft) { + moveToSlide(curr_index + 1); + $curr_slide.velocity({ translateX: -1 * $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad', + complete: function () { + $curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false }); + } }); + } else if (swipeRight) { + moveToSlide(curr_index - 1); + $curr_slide.velocity({ translateX: $this.innerWidth() }, { duration: 300, queue: false, easing: 'easeOutQuad', + complete: function () { + $curr_slide.velocity({ opacity: 0, translateX: 0 }, { duration: 0, queue: false }); + } }); + } + swipeLeft = false; + swipeRight = false; + + // Restart interval + clearInterval($interval); + $interval = setInterval(function () { + $active_index = $slider.find('.active').index(); + if ($slides.length == $active_index + 1) $active_index = 0; // loop to start + else $active_index += 1; + + moveToSlide($active_index); + }, options.transition + options.interval); + } + }); + + $this.on('sliderPause', function () { + clearInterval($interval); + }); + + $this.on('sliderStart', function () { + clearInterval($interval); + $interval = setInterval(function () { + $active_index = $slider.find('.active').index(); + if ($slides.length == $active_index + 1) $active_index = 0; // loop to start + else $active_index += 1; + + moveToSlide($active_index); + }, options.transition + options.interval); + }); + + $this.on('sliderNext', function () { + $active_index = $slider.find('.active').index(); + moveToSlide($active_index + 1); + }); + + $this.on('sliderPrev', function () { + $active_index = $slider.find('.active').index(); + moveToSlide($active_index - 1); + }); + }); + }, + pause: function () { + $(this).trigger('sliderPause'); + }, + start: function () { + $(this).trigger('sliderStart'); + }, + next: function () { + $(this).trigger('sliderNext'); + }, + prev: function () { + $(this).trigger('sliderPrev'); + } + }; + + $.fn.slider = function (methodOrOptions) { + if (methods[methodOrOptions]) { + return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1)); + } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { + // Default to "init" + return methods.init.apply(this, arguments); + } else { + $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tooltip'); + } + }; // Plugin end +})(jQuery); +;(function ($) { + $(document).ready(function () { + + $(document).on('click.card', '.card', function (e) { + if ($(this).find('> .card-reveal').length) { + var $card = $(e.target).closest('.card'); + if ($card.data('initialOverflow') === undefined) { + $card.data('initialOverflow', $card.css('overflow') === undefined ? '' : $card.css('overflow')); + } + if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) { + // Make Reveal animate down and display none + $(this).find('.card-reveal').velocity({ translateY: 0 }, { + duration: 225, + queue: false, + easing: 'easeInOutQuad', + complete: function () { + $(this).css({ display: 'none' }); + $card.css('overflow', $card.data('initialOverflow')); + } + }); + } else if ($(e.target).is($('.card .activator')) || $(e.target).is($('.card .activator i'))) { + $card.css('overflow', 'hidden'); + $(this).find('.card-reveal').css({ display: 'block' }).velocity("stop", false).velocity({ translateY: '-100%' }, { duration: 300, queue: false, easing: 'easeInOutQuad' }); + } + } + }); + }); +})(jQuery); +;(function ($) { + var materialChipsDefaults = { + data: [], + placeholder: '', + secondaryPlaceholder: '', + autocompleteOptions: {} + }; + + $(document).ready(function () { + // Handle removal of static chips. + $(document).on('click', '.chip .close', function (e) { + var $chips = $(this).closest('.chips'); + if ($chips.attr('data-initialized')) { + return; + } + $(this).closest('.chip').remove(); + }); + }); + + $.fn.material_chip = function (options) { + var self = this; + this.$el = $(this); + this.$document = $(document); + this.SELS = { + CHIPS: '.chips', + CHIP: '.chip', + INPUT: 'input', + DELETE: '.material-icons', + SELECTED_CHIP: '.selected' + }; + + if ('data' === options) { + return this.$el.data('chips'); + } + + var curr_options = $.extend({}, materialChipsDefaults, options); + self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteOptions.data); + + // Initialize + this.init = function () { + var i = 0; + var chips; + self.$el.each(function () { + var $chips = $(this); + var chipId = Materialize.guid(); + self.chipId = chipId; + + if (!curr_options.data || !(curr_options.data instanceof Array)) { + curr_options.data = []; + } + $chips.data('chips', curr_options.data); + $chips.attr('data-index', i); + $chips.attr('data-initialized', true); + + if (!$chips.hasClass(self.SELS.CHIPS)) { + $chips.addClass('chips'); + } + + self.chips($chips, chipId); + i++; + }); + }; + + this.handleEvents = function () { + var SELS = self.SELS; + + self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function (e) { + $(e.target).find(SELS.INPUT).focus(); + }); + + self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function (e) { + var $chip = $(e.target); + if ($chip.length) { + var wasSelected = $chip.hasClass('selected'); + var $chips = $chip.closest(SELS.CHIPS); + $(SELS.CHIP).removeClass('selected'); + + if (!wasSelected) { + self.selectChip($chip.index(), $chips); + } + } + }); + + self.$document.off('keydown.chips').on('keydown.chips', function (e) { + if ($(e.target).is('input, textarea')) { + return; + } + + // delete + var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP); + var $chips = $chip.closest(SELS.CHIPS); + var length = $chip.siblings(SELS.CHIP).length; + var index; + + if (!$chip.length) { + return; + } + + if (e.which === 8 || e.which === 46) { + e.preventDefault(); + + index = $chip.index(); + self.deleteChip(index, $chips); + + var selectIndex = null; + if (index + 1 < length) { + selectIndex = index; + } else if (index === length || index + 1 === length) { + selectIndex = length - 1; + } + + if (selectIndex < 0) selectIndex = null; + + if (null !== selectIndex) { + self.selectChip(selectIndex, $chips); + } + if (!length) $chips.find('input').focus(); + + // left + } else if (e.which === 37) { + index = $chip.index() - 1; + if (index < 0) { + return; + } + $(SELS.CHIP).removeClass('selected'); + self.selectChip(index, $chips); + + // right + } else if (e.which === 39) { + index = $chip.index() + 1; + $(SELS.CHIP).removeClass('selected'); + if (index > length) { + $chips.find('input').focus(); + return; + } + self.selectChip(index, $chips); + } + }); + + self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) { + var $currChips = $(e.target).closest(SELS.CHIPS); + $currChips.addClass('focus'); + $currChips.siblings('label, .prefix').addClass('active'); + $(SELS.CHIP).removeClass('selected'); + }); + + self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function (e) { + var $currChips = $(e.target).closest(SELS.CHIPS); + $currChips.removeClass('focus'); + + // Remove active if empty + if ($currChips.data('chips') === undefined || !$currChips.data('chips').length) { + $currChips.siblings('label').removeClass('active'); + } + $currChips.siblings('.prefix').removeClass('active'); + }); + + self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function (e) { + var $target = $(e.target); + var $chips = $target.closest(SELS.CHIPS); + var chipsLength = $chips.children(SELS.CHIP).length; + + // enter + if (13 === e.which) { + // Override enter if autocompleting. + if (self.hasAutocomplete && $chips.find('.autocomplete-content.dropdown-content').length && $chips.find('.autocomplete-content.dropdown-content').children().length) { + return; + } + + e.preventDefault(); + self.addChip({ tag: $target.val() }, $chips); + $target.val(''); + return; + } + + // delete or left + if ((8 === e.keyCode || 37 === e.keyCode) && '' === $target.val() && chipsLength) { + e.preventDefault(); + self.selectChip(chipsLength - 1, $chips); + $target.blur(); + return; + } + }); + + // Click on delete icon in chip. + self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function (e) { + var $target = $(e.target); + var $chips = $target.closest(SELS.CHIPS); + var $chip = $target.closest(SELS.CHIP); + e.stopPropagation(); + self.deleteChip($chip.index(), $chips); + $chips.find('input').focus(); + }); + }; + + this.chips = function ($chips, chipId) { + $chips.empty(); + $chips.data('chips').forEach(function (elem) { + $chips.append(self.renderChip(elem)); + }); + $chips.append($('<input id="' + chipId + '" class="input" placeholder="">')); + self.setPlaceholder($chips); + + // Set for attribute for label + var label = $chips.next('label'); + if (label.length) { + label.attr('for', chipId); + + if ($chips.data('chips') !== undefined && $chips.data('chips').length) { + label.addClass('active'); + } + } + + // Setup autocomplete if needed. + var input = $('#' + chipId); + if (self.hasAutocomplete) { + curr_options.autocompleteOptions.onAutocomplete = function (val) { + self.addChip({ tag: val }, $chips); + input.val(''); + input.focus(); + }; + input.autocomplete(curr_options.autocompleteOptions); + } + }; + + /**
+ * Render chip jQuery element.
+ * @param {Object} elem
+ * @return {jQuery}
+ */ + this.renderChip = function (elem) { + if (!elem.tag) return; + + var $renderedChip = $('<div class="chip"></div>'); + $renderedChip.text(elem.tag); + if (elem.image) { + $renderedChip.prepend($('<img />').attr('src', elem.image)); + } + $renderedChip.append($('<i class="material-icons close">close</i>')); + return $renderedChip; + }; + + this.setPlaceholder = function ($chips) { + if ($chips.data('chips') !== undefined && !$chips.data('chips').length && curr_options.placeholder) { + $chips.find('input').prop('placeholder', curr_options.placeholder); + } else if (($chips.data('chips') === undefined || !!$chips.data('chips').length) && curr_options.secondaryPlaceholder) { + $chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder); + } + }; + + this.isValid = function ($chips, elem) { + var chips = $chips.data('chips'); + var exists = false; + for (var i = 0; i < chips.length; i++) { + if (chips[i].tag === elem.tag) { + exists = true; + return; + } + } + return '' !== elem.tag && !exists; + }; + + this.addChip = function (elem, $chips) { + if (!self.isValid($chips, elem)) { + return; + } + var $renderedChip = self.renderChip(elem); + var newData = []; + var oldData = $chips.data('chips'); + for (var i = 0; i < oldData.length; i++) { + newData.push(oldData[i]); + } + newData.push(elem); + + $chips.data('chips', newData); + $renderedChip.insertBefore($chips.find('input')); + $chips.trigger('chip.add', elem); + self.setPlaceholder($chips); + }; + + this.deleteChip = function (chipIndex, $chips) { + var chip = $chips.data('chips')[chipIndex]; + $chips.find('.chip').eq(chipIndex).remove(); + + var newData = []; + var oldData = $chips.data('chips'); + for (var i = 0; i < oldData.length; i++) { + if (i !== chipIndex) { + newData.push(oldData[i]); + } + } + + $chips.data('chips', newData); + $chips.trigger('chip.delete', chip); + self.setPlaceholder($chips); + }; + + this.selectChip = function (chipIndex, $chips) { + var $chip = $chips.find('.chip').eq(chipIndex); + if ($chip && false === $chip.hasClass('selected')) { + $chip.addClass('selected'); + $chips.trigger('chip.select', $chips.data('chips')[chipIndex]); + } + }; + + this.getChipsElement = function (index, $chips) { + return $chips.eq(index); + }; + + // init + this.init(); + + this.handleEvents(); + }; +})(jQuery); +;(function ($) { + $.fn.pushpin = function (options) { + // Defaults + var defaults = { + top: 0, + bottom: Infinity, + offset: 0 + }; + + // Remove pushpin event and classes + if (options === "remove") { + this.each(function () { + if (id = $(this).data('pushpin-id')) { + $(window).off('scroll.' + id); + $(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style'); + } + }); + return false; + } + + options = $.extend(defaults, options); + + $index = 0; + return this.each(function () { + var $uniqueId = Materialize.guid(), + $this = $(this), + $original_offset = $(this).offset().top; + + function removePinClasses(object) { + object.removeClass('pin-top'); + object.removeClass('pinned'); + object.removeClass('pin-bottom'); + } + + function updateElements(objects, scrolled) { + objects.each(function () { + // Add position fixed (because its between top and bottom) + if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) { + removePinClasses($(this)); + $(this).css('top', options.offset); + $(this).addClass('pinned'); + } + + // Add pin-top (when scrolled position is above top) + if (scrolled < options.top && !$(this).hasClass('pin-top')) { + removePinClasses($(this)); + $(this).css('top', 0); + $(this).addClass('pin-top'); + } + + // Add pin-bottom (when scrolled position is below bottom) + if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) { + removePinClasses($(this)); + $(this).addClass('pin-bottom'); + $(this).css('top', options.bottom - $original_offset); + } + }); + } + + $(this).data('pushpin-id', $uniqueId); + updateElements($this, $(window).scrollTop()); + $(window).on('scroll.' + $uniqueId, function () { + var $scrolled = $(window).scrollTop() + options.offset; + updateElements($this, $scrolled); + }); + }); + }; +})(jQuery);;(function ($) { + $(document).ready(function () { + + // jQuery reverse + $.fn.reverse = [].reverse; + + // Hover behaviour: make sure this doesn't work on .click-to-toggle FABs! + $(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) { + var $this = $(this); + openFABMenu($this); + }); + $(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function (e) { + var $this = $(this); + closeFABMenu($this); + }); + + // Toggle-on-click behaviour. + $(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function (e) { + var $this = $(this); + var $menu = $this.parent(); + if ($menu.hasClass('active')) { + closeFABMenu($menu); + } else { + openFABMenu($menu); + } + }); + + // Toolbar transition behaviour. + $(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function (e) { + var $this = $(this); + var $menu = $this.parent(); + FABtoToolbar($menu); + }); + }); + + $.fn.extend({ + openFAB: function () { + openFABMenu($(this)); + }, + closeFAB: function () { + closeFABMenu($(this)); + }, + openToolbar: function () { + FABtoToolbar($(this)); + }, + closeToolbar: function () { + toolbarToFAB($(this)); + } + }); + + var openFABMenu = function (btn) { + var $this = btn; + if ($this.hasClass('active') === false) { + + // Get direction option + var horizontal = $this.hasClass('horizontal'); + var offsetY, offsetX; + + if (horizontal === true) { + offsetX = 40; + } else { + offsetY = 40; + } + + $this.addClass('active'); + $this.find('ul .btn-floating').velocity({ scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 0 }); + + var time = 0; + $this.find('ul .btn-floating').reverse().each(function () { + $(this).velocity({ opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0' }, { duration: 80, delay: time }); + time += 40; + }); + } + }; + + var closeFABMenu = function (btn) { + var $this = btn; + // Get direction option + var horizontal = $this.hasClass('horizontal'); + var offsetY, offsetX; + + if (horizontal === true) { + offsetX = 40; + } else { + offsetY = 40; + } + + $this.removeClass('active'); + var time = 0; + $this.find('ul .btn-floating').velocity("stop", true); + $this.find('ul .btn-floating').velocity({ opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px' }, { duration: 80 }); + }; + + /**
+ * Transform FAB into toolbar
+ * @param {Object} object jQuery object
+ */ + var FABtoToolbar = function (btn) { + if (btn.attr('data-open') === "true") { + return; + } + + var offsetX, offsetY, scaleFactor; + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var btnRect = btn[0].getBoundingClientRect(); + var anchor = btn.find('> a').first(); + var menu = btn.find('> ul').first(); + var backdrop = $('<div class="fab-backdrop"></div>'); + var fabColor = anchor.css('background-color'); + anchor.append(backdrop); + + offsetX = btnRect.left - windowWidth / 2 + btnRect.width / 2; + offsetY = windowHeight - btnRect.bottom; + scaleFactor = windowWidth / backdrop.width(); + btn.attr('data-origin-bottom', btnRect.bottom); + btn.attr('data-origin-left', btnRect.left); + btn.attr('data-origin-width', btnRect.width); + + // Set initial state + btn.addClass('active'); + btn.attr('data-open', true); + btn.css({ + 'text-align': 'center', + width: '100%', + bottom: 0, + left: 0, + transform: 'translateX(' + offsetX + 'px)', + transition: 'none' + }); + anchor.css({ + transform: 'translateY(' + -offsetY + 'px)', + transition: 'none' + }); + backdrop.css({ + 'background-color': fabColor + }); + + setTimeout(function () { + btn.css({ + transform: '', + transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s' + }); + anchor.css({ + overflow: 'visible', + transform: '', + transition: 'transform .2s' + }); + + setTimeout(function () { + btn.css({ + overflow: 'hidden', + 'background-color': fabColor + }); + backdrop.css({ + transform: 'scale(' + scaleFactor + ')', + transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)' + }); + menu.find('> li > a').css({ + opacity: 1 + }); + + // Scroll to close. + $(window).on('scroll.fabToolbarClose', function () { + toolbarToFAB(btn); + $(window).off('scroll.fabToolbarClose'); + $(document).off('click.fabToolbarClose'); + }); + + $(document).on('click.fabToolbarClose', function (e) { + if (!$(e.target).closest(menu).length) { + toolbarToFAB(btn); + $(window).off('scroll.fabToolbarClose'); + $(document).off('click.fabToolbarClose'); + } + }); + }, 100); + }, 0); + }; + + /**
+ * Transform toolbar back into FAB
+ * @param {Object} object jQuery object
+ */ + var toolbarToFAB = function (btn) { + if (btn.attr('data-open') !== "true") { + return; + } + + var offsetX, offsetY, scaleFactor; + var windowWidth = window.innerWidth; + var windowHeight = window.innerHeight; + var btnWidth = btn.attr('data-origin-width'); + var btnBottom = btn.attr('data-origin-bottom'); + var btnLeft = btn.attr('data-origin-left'); + var anchor = btn.find('> .btn-floating').first(); + var menu = btn.find('> ul').first(); + var backdrop = btn.find('.fab-backdrop'); + var fabColor = anchor.css('background-color'); + + offsetX = btnLeft - windowWidth / 2 + btnWidth / 2; + offsetY = windowHeight - btnBottom; + scaleFactor = windowWidth / backdrop.width(); + + // Hide backdrop + btn.removeClass('active'); + btn.attr('data-open', false); + btn.css({ + 'background-color': 'transparent', + transition: 'none' + }); + anchor.css({ + transition: 'none' + }); + backdrop.css({ + transform: 'scale(0)', + 'background-color': fabColor + }); + menu.find('> li > a').css({ + opacity: '' + }); + + setTimeout(function () { + backdrop.remove(); + + // Set initial state. + btn.css({ + 'text-align': '', + width: '', + bottom: '', + left: '', + overflow: '', + 'background-color': '', + transform: 'translate3d(' + -offsetX + 'px,0,0)' + }); + anchor.css({ + overflow: '', + transform: 'translate3d(0,' + offsetY + 'px,0)' + }); + + setTimeout(function () { + btn.css({ + transform: 'translate3d(0,0,0)', + transition: 'transform .2s' + }); + anchor.css({ + transform: 'translate3d(0,0,0)', + transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)' + }); + }, 20); + }, 200); + }; +})(jQuery); +;(function ($) { + // Image transition function + Materialize.fadeInImage = function (selectorOrEl) { + var element; + if (typeof selectorOrEl === 'string') { + element = $(selectorOrEl); + } else if (typeof selectorOrEl === 'object') { + element = selectorOrEl; + } else { + return; + } + element.css({ opacity: 0 }); + $(element).velocity({ opacity: 1 }, { + duration: 650, + queue: false, + easing: 'easeOutSine' + }); + $(element).velocity({ opacity: 1 }, { + duration: 1300, + queue: false, + easing: 'swing', + step: function (now, fx) { + fx.start = 100; + var grayscale_setting = now / 100; + var brightness_setting = 150 - (100 - now) / 1.75; + + if (brightness_setting < 100) { + brightness_setting = 100; + } + if (now >= 0) { + $(this).css({ + "-webkit-filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)", + "filter": "grayscale(" + grayscale_setting + ")" + "brightness(" + brightness_setting + "%)" + }); + } + } + }); + }; + + // Horizontal staggered list + Materialize.showStaggeredList = function (selectorOrEl) { + var element; + if (typeof selectorOrEl === 'string') { + element = $(selectorOrEl); + } else if (typeof selectorOrEl === 'object') { + element = selectorOrEl; + } else { + return; + } + var time = 0; + element.find('li').velocity({ translateX: "-100px" }, { duration: 0 }); + + element.find('li').each(function () { + $(this).velocity({ opacity: "1", translateX: "0" }, { duration: 800, delay: time, easing: [60, 10] }); + time += 120; + }); + }; + + $(document).ready(function () { + // Hardcoded .staggered-list scrollFire + // var staggeredListOptions = []; + // $('ul.staggered-list').each(function (i) { + + // var label = 'scrollFire-' + i; + // $(this).addClass(label); + // staggeredListOptions.push( + // {selector: 'ul.staggered-list.' + label, + // offset: 200, + // callback: 'showStaggeredList("ul.staggered-list.' + label + '")'}); + // }); + // scrollFire(staggeredListOptions); + + // HammerJS, Swipe navigation + + // Touch Event + var swipeLeft = false; + var swipeRight = false; + + // Dismissible Collections + $('.dismissable').each(function () { + $(this).hammer({ + prevent_default: false + }).on('pan', function (e) { + if (e.gesture.pointerType === "touch") { + var $this = $(this); + var direction = e.gesture.direction; + var x = e.gesture.deltaX; + var velocityX = e.gesture.velocityX; + + $this.velocity({ translateX: x + }, { duration: 50, queue: false, easing: 'easeOutQuad' }); + + // Swipe Left + if (direction === 4 && (x > $this.innerWidth() / 2 || velocityX < -0.75)) { + swipeLeft = true; + } + + // Swipe Right + if (direction === 2 && (x < -1 * $this.innerWidth() / 2 || velocityX > 0.75)) { + swipeRight = true; + } + } + }).on('panend', function (e) { + // Reset if collection is moved back into original position + if (Math.abs(e.gesture.deltaX) < $(this).innerWidth() / 2) { + swipeRight = false; + swipeLeft = false; + } + + if (e.gesture.pointerType === "touch") { + var $this = $(this); + if (swipeLeft || swipeRight) { + var fullWidth; + if (swipeLeft) { + fullWidth = $this.innerWidth(); + } else { + fullWidth = -1 * $this.innerWidth(); + } + + $this.velocity({ translateX: fullWidth + }, { duration: 100, queue: false, easing: 'easeOutQuad', complete: function () { + $this.css('border', 'none'); + $this.velocity({ height: 0, padding: 0 + }, { duration: 200, queue: false, easing: 'easeOutQuad', complete: function () { + $this.remove(); + } + }); + } + }); + } else { + $this.velocity({ translateX: 0 + }, { duration: 100, queue: false, easing: 'easeOutQuad' }); + } + swipeLeft = false; + swipeRight = false; + } + }); + }); + + // time = 0 + // // Vertical Staggered list + // $('ul.staggered-list.vertical li').velocity( + // { translateY: "100px"}, + // { duration: 0 }); + + // $('ul.staggered-list.vertical li').each(function() { + // $(this).velocity( + // { opacity: "1", translateY: "0"}, + // { duration: 800, delay: time, easing: [60, 25] }); + // time += 120; + // }); + + // // Fade in and Scale + // $('.fade-in.scale').velocity( + // { scaleX: .4, scaleY: .4, translateX: -600}, + // { duration: 0}); + // $('.fade-in').each(function() { + // $(this).velocity( + // { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0}, + // { duration: 800, easing: [60, 10] }); + // }); + }); +})(jQuery); +;(function ($) { + + var scrollFireEventsHandled = false; + + // Input: Array of JSON objects {selector, offset, callback} + Materialize.scrollFire = function (options) { + var onScroll = function () { + var windowScroll = window.pageYOffset + window.innerHeight; + + for (var i = 0; i < options.length; i++) { + // Get options from each line + var value = options[i]; + var selector = value.selector, + offset = value.offset, + callback = value.callback; + + var currentElement = document.querySelector(selector); + if (currentElement !== null) { + var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset; + + if (windowScroll > elementOffset + offset) { + if (value.done !== true) { + if (typeof callback === 'function') { + callback.call(this, currentElement); + } else if (typeof callback === 'string') { + var callbackFunc = new Function(callback); + callbackFunc(currentElement); + } + value.done = true; + } + } + } + } + }; + + var throttledScroll = Materialize.throttle(function () { + onScroll(); + }, options.throttle || 100); + + if (!scrollFireEventsHandled) { + window.addEventListener("scroll", throttledScroll); + window.addEventListener("resize", throttledScroll); + scrollFireEventsHandled = true; + } + + // perform a scan once, after current execution context, and after dom is ready + setTimeout(throttledScroll, 0); + }; +})(jQuery); +; /*!
+ * pickadate.js v3.5.0, 2014/04/13
+ * By Amsul, http://amsul.ca
+ * Hosted on http://amsul.github.io/pickadate.js
+ * Licensed under MIT
+ */ + +(function (factory) { + + Materialize.Picker = factory(jQuery); +})(function ($) { + + var $window = $(window); + var $document = $(document); + var $html = $(document.documentElement); + + /**
+ * The picker constructor that creates a blank picker.
+ */ + function PickerConstructor(ELEMENT, NAME, COMPONENT, OPTIONS) { + + // If there’s no element, return the picker constructor. + if (!ELEMENT) return PickerConstructor; + + var IS_DEFAULT_THEME = false, + + + // The state of the picker. + STATE = { + id: ELEMENT.id || 'P' + Math.abs(~~(Math.random() * new Date())) + }, + + + // Merge the defaults and options passed. + SETTINGS = COMPONENT ? $.extend(true, {}, COMPONENT.defaults, OPTIONS) : OPTIONS || {}, + + + // Merge the default classes with the settings classes. + CLASSES = $.extend({}, PickerConstructor.klasses(), SETTINGS.klass), + + + // The element node wrapper into a jQuery object. + $ELEMENT = $(ELEMENT), + + + // Pseudo picker constructor. + PickerInstance = function () { + return this.start(); + }, + + + // The picker prototype. + P = PickerInstance.prototype = { + + constructor: PickerInstance, + + $node: $ELEMENT, + + /**
+ * Initialize everything
+ */ + start: function () { + + // If it’s already started, do nothing. + if (STATE && STATE.start) return P; + + // Update the picker states. + STATE.methods = {}; + STATE.start = true; + STATE.open = false; + STATE.type = ELEMENT.type; + + // Confirm focus state, convert into text input to remove UA stylings, + // and set as readonly to prevent keyboard popup. + ELEMENT.autofocus = ELEMENT == getActiveElement(); + ELEMENT.readOnly = !SETTINGS.editable; + ELEMENT.id = ELEMENT.id || STATE.id; + if (ELEMENT.type != 'text') { + ELEMENT.type = 'text'; + } + + // Create a new picker component with the settings. + P.component = new COMPONENT(P, SETTINGS); + + // Create the picker root with a holder and then prepare it. + P.$root = $(PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"')); + prepareElementRoot(); + + // If there’s a format for the hidden input element, create the element. + if (SETTINGS.formatSubmit) { + prepareElementHidden(); + } + + // Prepare the input element. + prepareElement(); + + // Insert the root as specified in the settings. + if (SETTINGS.container) $(SETTINGS.container).append(P.$root);else $ELEMENT.before(P.$root); + + // Bind the default component and settings events. + P.on({ + start: P.component.onStart, + render: P.component.onRender, + stop: P.component.onStop, + open: P.component.onOpen, + close: P.component.onClose, + set: P.component.onSet + }).on({ + start: SETTINGS.onStart, + render: SETTINGS.onRender, + stop: SETTINGS.onStop, + open: SETTINGS.onOpen, + close: SETTINGS.onClose, + set: SETTINGS.onSet + }); + + // Once we’re all set, check the theme in use. + IS_DEFAULT_THEME = isUsingDefaultTheme(P.$root.children()[0]); + + // If the element has autofocus, open the picker. + if (ELEMENT.autofocus) { + P.open(); + } + + // Trigger queued the “start” and “render” events. + return P.trigger('start').trigger('render'); + }, //start + + + /**
+ * Render a new picker
+ */ + render: function (entireComponent) { + + // Insert a new component holder in the root or box. + if (entireComponent) P.$root.html(createWrappedComponent());else P.$root.find('.' + CLASSES.box).html(P.component.nodes(STATE.open)); + + // Trigger the queued “render” events. + return P.trigger('render'); + }, //render + + + /**
+ * Destroy everything
+ */ + stop: function () { + + // If it’s already stopped, do nothing. + if (!STATE.start) return P; + + // Then close the picker. + P.close(); + + // Remove the hidden field. + if (P._hidden) { + P._hidden.parentNode.removeChild(P._hidden); + } + + // Remove the root. + P.$root.remove(); + + // Remove the input class, remove the stored data, and unbind + // the events (after a tick for IE - see `P.close`). + $ELEMENT.removeClass(CLASSES.input).removeData(NAME); + setTimeout(function () { + $ELEMENT.off('.' + STATE.id); + }, 0); + + // Restore the element state + ELEMENT.type = STATE.type; + ELEMENT.readOnly = false; + + // Trigger the queued “stop” events. + P.trigger('stop'); + + // Reset the picker states. + STATE.methods = {}; + STATE.start = false; + + return P; + }, //stop + + + /**
+ * Open up the picker
+ */ + open: function (dontGiveFocus) { + + // If it’s already open, do nothing. + if (STATE.open) return P; + + // Add the “active” class. + $ELEMENT.addClass(CLASSES.active); + aria(ELEMENT, 'expanded', true); + + // * A Firefox bug, when `html` has `overflow:hidden`, results in + // killing transitions :(. So add the “opened” state on the next tick. + // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289 + setTimeout(function () { + + // Add the “opened” class to the picker root. + P.$root.addClass(CLASSES.opened); + aria(P.$root[0], 'hidden', false); + }, 0); + + // If we have to give focus, bind the element and doc events. + if (dontGiveFocus !== false) { + + // Set it as open. + STATE.open = true; + + // Prevent the page from scrolling. + if (IS_DEFAULT_THEME) { + $html.css('overflow', 'hidden').css('padding-right', '+=' + getScrollbarWidth()); + } + + // Pass focus to the root element’s jQuery object. + // * Workaround for iOS8 to bring the picker’s root into view. + P.$root.eq(0).focus(); + + // Bind the document events. + $document.on('click.' + STATE.id + ' focusin.' + STATE.id, function (event) { + + var target = event.target; + + // If the target of the event is not the element, close the picker picker. + // * Don’t worry about clicks or focusins on the root because those don’t bubble up. + // Also, for Firefox, a click on an `option` element bubbles up directly + // to the doc. So make sure the target wasn't the doc. + // * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling, + // which causes the picker to unexpectedly close when right-clicking it. So make + // sure the event wasn’t a right-click. + if (target != ELEMENT && target != document && event.which != 3) { + + // If the target was the holder that covers the screen, + // keep the element focused to maintain tabindex. + P.close(target === P.$root.children()[0]); + } + }).on('keydown.' + STATE.id, function (event) { + + var + // Get the keycode. + keycode = event.keyCode, + + + // Translate that to a selection change. + keycodeToMove = P.component.key[keycode], + + + // Grab the target. + target = event.target; + + // On escape, close the picker and give focus. + if (keycode == 27) { + P.close(true); + } + + // Check if there is a key movement or “enter” keypress on the element. + else if (target == P.$root[0] && (keycodeToMove || keycode == 13)) { + + // Prevent the default action to stop page movement. + event.preventDefault(); + + // Trigger the key movement action. + if (keycodeToMove) { + PickerConstructor._.trigger(P.component.key.go, P, [PickerConstructor._.trigger(keycodeToMove)]); + } + + // On “enter”, if the highlighted item isn’t disabled, set the value and close. + else if (!P.$root.find('.' + CLASSES.highlighted).hasClass(CLASSES.disabled)) { + P.set('select', P.component.item.highlight); + if (SETTINGS.closeOnSelect) { + P.close(true); + } + } + } + + // If the target is within the root and “enter” is pressed, + // prevent the default action and trigger a click on the target instead. + else if ($.contains(P.$root[0], target) && keycode == 13) { + event.preventDefault(); + target.click(); + } + }); + } + + // Trigger the queued “open” events. + return P.trigger('open'); + }, //open + + + /**
+ * Close the picker
+ */ + close: function (giveFocus) { + + // If we need to give focus, do it before changing states. + if (giveFocus) { + // ....ah yes! It would’ve been incomplete without a crazy workaround for IE :| + // The focus is triggered *after* the close has completed - causing it + // to open again. So unbind and rebind the event at the next tick. + P.$root.off('focus.toOpen').eq(0).focus(); + setTimeout(function () { + P.$root.on('focus.toOpen', handleFocusToOpenEvent); + }, 0); + } + + // Remove the “active” class. + $ELEMENT.removeClass(CLASSES.active); + aria(ELEMENT, 'expanded', false); + + // * A Firefox bug, when `html` has `overflow:hidden`, results in + // killing transitions :(. So remove the “opened” state on the next tick. + // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289 + setTimeout(function () { + + // Remove the “opened” and “focused” class from the picker root. + P.$root.removeClass(CLASSES.opened + ' ' + CLASSES.focused); + aria(P.$root[0], 'hidden', true); + }, 0); + + // If it’s already closed, do nothing more. + if (!STATE.open) return P; + + // Set it as closed. + STATE.open = false; + + // Allow the page to scroll. + if (IS_DEFAULT_THEME) { + $html.css('overflow', '').css('padding-right', '-=' + getScrollbarWidth()); + } + + // Unbind the document events. + $document.off('.' + STATE.id); + + // Trigger the queued “close” events. + return P.trigger('close'); + }, //close + + + /**
+ * Clear the values
+ */ + clear: function (options) { + return P.set('clear', null, options); + }, //clear + + + /**
+ * Set something
+ */ + set: function (thing, value, options) { + + var thingItem, + thingValue, + thingIsObject = $.isPlainObject(thing), + thingObject = thingIsObject ? thing : {}; + + // Make sure we have usable options. + options = thingIsObject && $.isPlainObject(value) ? value : options || {}; + + if (thing) { + + // If the thing isn’t an object, make it one. + if (!thingIsObject) { + thingObject[thing] = value; + } + + // Go through the things of items to set. + for (thingItem in thingObject) { + + // Grab the value of the thing. + thingValue = thingObject[thingItem]; + + // First, if the item exists and there’s a value, set it. + if (thingItem in P.component.item) { + if (thingValue === undefined) thingValue = null; + P.component.set(thingItem, thingValue, options); + } + + // Then, check to update the element value and broadcast a change. + if (thingItem == 'select' || thingItem == 'clear') { + $ELEMENT.val(thingItem == 'clear' ? '' : P.get(thingItem, SETTINGS.format)).trigger('change'); + } + } + + // Render a new picker. + P.render(); + } + + // When the method isn’t muted, trigger queued “set” events and pass the `thingObject`. + return options.muted ? P : P.trigger('set', thingObject); + }, //set + + + /**
+ * Get something
+ */ + get: function (thing, format) { + + // Make sure there’s something to get. + thing = thing || 'value'; + + // If a picker state exists, return that. + if (STATE[thing] != null) { + return STATE[thing]; + } + + // Return the submission value, if that. + if (thing == 'valueSubmit') { + if (P._hidden) { + return P._hidden.value; + } + thing = 'value'; + } + + // Return the value, if that. + if (thing == 'value') { + return ELEMENT.value; + } + + // Check if a component item exists, return that. + if (thing in P.component.item) { + if (typeof format == 'string') { + var thingValue = P.component.get(thing); + return thingValue ? PickerConstructor._.trigger(P.component.formats.toString, P.component, [format, thingValue]) : ''; + } + return P.component.get(thing); + } + }, //get + + + /**
+ * Bind events on the things.
+ */ + on: function (thing, method, internal) { + + var thingName, + thingMethod, + thingIsObject = $.isPlainObject(thing), + thingObject = thingIsObject ? thing : {}; + + if (thing) { + + // If the thing isn’t an object, make it one. + if (!thingIsObject) { + thingObject[thing] = method; + } + + // Go through the things to bind to. + for (thingName in thingObject) { + + // Grab the method of the thing. + thingMethod = thingObject[thingName]; + + // If it was an internal binding, prefix it. + if (internal) { + thingName = '_' + thingName; + } + + // Make sure the thing methods collection exists. + STATE.methods[thingName] = STATE.methods[thingName] || []; + + // Add the method to the relative method collection. + STATE.methods[thingName].push(thingMethod); + } + } + + return P; + }, //on + + + /**
+ * Unbind events on the things.
+ */ + off: function () { + var i, + thingName, + names = arguments; + for (i = 0, namesCount = names.length; i < namesCount; i += 1) { + thingName = names[i]; + if (thingName in STATE.methods) { + delete STATE.methods[thingName]; + } + } + return P; + }, + + /**
+ * Fire off method events.
+ */ + trigger: function (name, data) { + var _trigger = function (name) { + var methodList = STATE.methods[name]; + if (methodList) { + methodList.map(function (method) { + PickerConstructor._.trigger(method, P, [data]); + }); + } + }; + _trigger('_' + name); + _trigger(name); + return P; + } //trigger + //PickerInstance.prototype + + + /**
+ * Wrap the picker holder components together.
+ */ + };function createWrappedComponent() { + + // Create a picker wrapper holder + return PickerConstructor._.node('div', + + // Create a picker wrapper node + PickerConstructor._.node('div', + + // Create a picker frame + PickerConstructor._.node('div', + + // Create a picker box node + PickerConstructor._.node('div', + + // Create the components nodes. + P.component.nodes(STATE.open), + + // The picker box class + CLASSES.box), + + // Picker wrap class + CLASSES.wrap), + + // Picker frame class + CLASSES.frame), + + // Picker holder class + CLASSES.holder); //endreturn + } //createWrappedComponent + + + /**
+ * Prepare the input element with all bindings.
+ */ + function prepareElement() { + + $ELEMENT. + + // Store the picker data by component name. + data(NAME, P). + + // Add the “input” class name. + addClass(CLASSES.input). + + // Remove the tabindex. + attr('tabindex', -1). + + // If there’s a `data-value`, update the value of the element. + val($ELEMENT.data('value') ? P.get('select', SETTINGS.format) : ELEMENT.value); + + // Only bind keydown events if the element isn’t editable. + if (!SETTINGS.editable) { + + $ELEMENT. + + // On focus/click, focus onto the root to open it up. + on('focus.' + STATE.id + ' click.' + STATE.id, function (event) { + event.preventDefault(); + P.$root.eq(0).focus(); + }). + + // Handle keyboard event based on the picker being opened or not. + on('keydown.' + STATE.id, handleKeydownEvent); + } + + // Update the aria attributes. + aria(ELEMENT, { + haspopup: true, + expanded: false, + readonly: false, + owns: ELEMENT.id + '_root' + }); + } + + /**
+ * Prepare the root picker element with all bindings.
+ */ + function prepareElementRoot() { + + P.$root.on({ + + // For iOS8. + keydown: handleKeydownEvent, + + // When something within the root is focused, stop from bubbling + // to the doc and remove the “focused” state from the root. + focusin: function (event) { + P.$root.removeClass(CLASSES.focused); + event.stopPropagation(); + }, + + // When something within the root holder is clicked, stop it + // from bubbling to the doc. + 'mousedown click': function (event) { + + var target = event.target; + + // Make sure the target isn’t the root holder so it can bubble up. + if (target != P.$root.children()[0]) { + + event.stopPropagation(); + + // * For mousedown events, cancel the default action in order to + // prevent cases where focus is shifted onto external elements + // when using things like jQuery mobile or MagnificPopup (ref: #249 & #120). + // Also, for Firefox, don’t prevent action on the `option` element. + if (event.type == 'mousedown' && !$(target).is('input, select, textarea, button, option')) { + + event.preventDefault(); + + // Re-focus onto the root so that users can click away + // from elements focused within the picker. + P.$root.eq(0).focus(); + } + } + } + }). + + // Add/remove the “target” class on focus and blur. + on({ + focus: function () { + $ELEMENT.addClass(CLASSES.target); + }, + blur: function () { + $ELEMENT.removeClass(CLASSES.target); + } + }). + + // Open the picker and adjust the root “focused” state + on('focus.toOpen', handleFocusToOpenEvent). + + // If there’s a click on an actionable element, carry out the actions. + on('click', '[data-pick], [data-nav], [data-clear], [data-close]', function () { + + var $target = $(this), + targetData = $target.data(), + targetDisabled = $target.hasClass(CLASSES.navDisabled) || $target.hasClass(CLASSES.disabled), + + + // * For IE, non-focusable elements can be active elements as well + // (http://stackoverflow.com/a/2684561). + activeElement = getActiveElement(); + activeElement = activeElement && (activeElement.type || activeElement.href) && activeElement; + + // If it’s disabled or nothing inside is actively focused, re-focus the element. + if (targetDisabled || activeElement && !$.contains(P.$root[0], activeElement)) { + P.$root.eq(0).focus(); + } + + // If something is superficially changed, update the `highlight` based on the `nav`. + if (!targetDisabled && targetData.nav) { + P.set('highlight', P.component.item.highlight, { nav: targetData.nav }); + } + + // If something is picked, set `select` then close with focus. + else if (!targetDisabled && 'pick' in targetData) { + P.set('select', targetData.pick); + if (SETTINGS.closeOnSelect) { + P.close(true); + } + } + + // If a “clear” button is pressed, empty the values and close with focus. + else if (targetData.clear) { + P.clear(); + if (SETTINGS.closeOnSelect) { + P.close(true); + } + } else if (targetData.close) { + P.close(true); + } + }); //P.$root + + aria(P.$root[0], 'hidden', true); + } + + /**
+ * Prepare the hidden input element along with all bindings.
+ */ + function prepareElementHidden() { + + var name; + + if (SETTINGS.hiddenName === true) { + name = ELEMENT.name; + ELEMENT.name = ''; + } else { + name = [typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : '', typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit']; + name = name[0] + ELEMENT.name + name[1]; + } + + P._hidden = $('<input ' + 'type=hidden ' + + + // Create the name using the original input’s with a prefix and suffix. + 'name="' + name + '"' + ( + + // If the element has a value, set the hidden value as well. + $ELEMENT.data('value') || ELEMENT.value ? ' value="' + P.get('select', SETTINGS.formatSubmit) + '"' : '') + '>')[0]; + + $ELEMENT. + + // If the value changes, update the hidden input with the correct format. + on('change.' + STATE.id, function () { + P._hidden.value = ELEMENT.value ? P.get('select', SETTINGS.formatSubmit) : ''; + }); + + // Insert the hidden input as specified in the settings. + if (SETTINGS.container) $(SETTINGS.container).append(P._hidden);else $ELEMENT.before(P._hidden); + } + + // For iOS8. + function handleKeydownEvent(event) { + + var keycode = event.keyCode, + + + // Check if one of the delete keys was pressed. + isKeycodeDelete = /^(8|46)$/.test(keycode); + + // For some reason IE clears the input value on “escape”. + if (keycode == 27) { + P.close(); + return false; + } + + // Check if `space` or `delete` was pressed or the picker is closed with a key movement. + if (keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode]) { + + // Prevent it from moving the page and bubbling to doc. + event.preventDefault(); + event.stopPropagation(); + + // If `delete` was pressed, clear the values and close the picker. + // Otherwise open the picker. + if (isKeycodeDelete) { + P.clear().close(); + } else { + P.open(); + } + } + } + + // Separated for IE + function handleFocusToOpenEvent(event) { + + // Stop the event from propagating to the doc. + event.stopPropagation(); + + // If it’s a focus event, add the “focused” class to the root. + if (event.type == 'focus') { + P.$root.addClass(CLASSES.focused); + } + + // And then finally open the picker. + P.open(); + } + + // Return a new picker instance. + return new PickerInstance(); + } //PickerConstructor + + + /**
+ * The default classes and prefix to use for the HTML classes.
+ */ + PickerConstructor.klasses = function (prefix) { + prefix = prefix || 'picker'; + return { + + picker: prefix, + opened: prefix + '--opened', + focused: prefix + '--focused', + + input: prefix + '__input', + active: prefix + '__input--active', + target: prefix + '__input--target', + + holder: prefix + '__holder', + + frame: prefix + '__frame', + wrap: prefix + '__wrap', + + box: prefix + '__box' + }; + }; //PickerConstructor.klasses + + + /**
+ * Check if the default theme is being used.
+ */ + function isUsingDefaultTheme(element) { + + var theme, + prop = 'position'; + + // For IE. + if (element.currentStyle) { + theme = element.currentStyle[prop]; + } + + // For normal browsers. + else if (window.getComputedStyle) { + theme = getComputedStyle(element)[prop]; + } + + return theme == 'fixed'; + } + + /**
+ * Get the width of the browser’s scrollbar.
+ * Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js
+ */ + function getScrollbarWidth() { + + if ($html.height() <= $window.height()) { + return 0; + } + + var $outer = $('<div style="visibility:hidden;width:100px" />').appendTo('body'); + + // Get the width without scrollbars. + var widthWithoutScroll = $outer[0].offsetWidth; + + // Force adding scrollbars. + $outer.css('overflow', 'scroll'); + + // Add the inner div. + var $inner = $('<div style="width:100%" />').appendTo($outer); + + // Get the width with scrollbars. + var widthWithScroll = $inner[0].offsetWidth; + + // Remove the divs. + $outer.remove(); + + // Return the difference between the widths. + return widthWithoutScroll - widthWithScroll; + } + + /**
+ * PickerConstructor helper methods.
+ */ + PickerConstructor._ = { + + /**
+ * Create a group of nodes. Expects:
+ * `
+ {
+ min: {Integer},
+ max: {Integer},
+ i: {Integer},
+ node: {String},
+ item: {Function}
+ }
+ * `
+ */ + group: function (groupObject) { + + var + // Scope for the looped object + loopObjectScope, + + + // Create the nodes list + nodesList = '', + + + // The counter starts from the `min` + counter = PickerConstructor._.trigger(groupObject.min, groupObject); + + // Loop from the `min` to `max`, incrementing by `i` + for (; counter <= PickerConstructor._.trigger(groupObject.max, groupObject, [counter]); counter += groupObject.i) { + + // Trigger the `item` function within scope of the object + loopObjectScope = PickerConstructor._.trigger(groupObject.item, groupObject, [counter]); + + // Splice the subgroup and create nodes out of the sub nodes + nodesList += PickerConstructor._.node(groupObject.node, loopObjectScope[0], // the node + loopObjectScope[1], // the classes + loopObjectScope[2] // the attributes + ); + } + + // Return the list of nodes + return nodesList; + }, //group + + + /**
+ * Create a dom node string
+ */ + node: function (wrapper, item, klass, attribute) { + + // If the item is false-y, just return an empty string + if (!item) return ''; + + // If the item is an array, do a join + item = $.isArray(item) ? item.join('') : item; + + // Check for the class + klass = klass ? ' class="' + klass + '"' : ''; + + // Check for any attributes + attribute = attribute ? ' ' + attribute : ''; + + // Return the wrapped item + return '<' + wrapper + klass + attribute + '>' + item + '</' + wrapper + '>'; + }, //node + + + /**
+ * Lead numbers below 10 with a zero.
+ */ + lead: function (number) { + return (number < 10 ? '0' : '') + number; + }, + + /**
+ * Trigger a function otherwise return the value.
+ */ + trigger: function (callback, scope, args) { + return typeof callback == 'function' ? callback.apply(scope, args || []) : callback; + }, + + /**
+ * If the second character is a digit, length is 2 otherwise 1.
+ */ + digits: function (string) { + return (/\d/.test(string[1]) ? 2 : 1 + ); + }, + + /**
+ * Tell if something is a date object.
+ */ + isDate: function (value) { + return {}.toString.call(value).indexOf('Date') > -1 && this.isInteger(value.getDate()); + }, + + /**
+ * Tell if something is an integer.
+ */ + isInteger: function (value) { + return {}.toString.call(value).indexOf('Number') > -1 && value % 1 === 0; + }, + + /**
+ * Create ARIA attribute strings.
+ */ + ariaAttr: ariaAttr //PickerConstructor._ + + + /**
+ * Extend the picker with a component and defaults.
+ */ + };PickerConstructor.extend = function (name, Component) { + + // Extend jQuery. + $.fn[name] = function (options, action) { + + // Grab the component data. + var componentData = this.data(name); + + // If the picker is requested, return the data object. + if (options == 'picker') { + return componentData; + } + + // If the component data exists and `options` is a string, carry out the action. + if (componentData && typeof options == 'string') { + return PickerConstructor._.trigger(componentData[options], componentData, [action]); + } + + // Otherwise go through each matched element and if the component + // doesn’t exist, create a new picker using `this` element + // and merging the defaults and options with a deep copy. + return this.each(function () { + var $this = $(this); + if (!$this.data(name)) { + new PickerConstructor(this, name, Component, options); + } + }); + }; + + // Set the defaults. + $.fn[name].defaults = Component.defaults; + }; //PickerConstructor.extend + + + function aria(element, attribute, value) { + if ($.isPlainObject(attribute)) { + for (var key in attribute) { + ariaSet(element, key, attribute[key]); + } + } else { + ariaSet(element, attribute, value); + } + } + function ariaSet(element, attribute, value) { + element.setAttribute((attribute == 'role' ? '' : 'aria-') + attribute, value); + } + function ariaAttr(attribute, data) { + if (!$.isPlainObject(attribute)) { + attribute = { attribute: data }; + } + data = ''; + for (var key in attribute) { + var attr = (key == 'role' ? '' : 'aria-') + key, + attrVal = attribute[key]; + data += attrVal == null ? '' : attr + '="' + attribute[key] + '"'; + } + return data; + } + + // IE8 bug throws an error for activeElements within iframes. + function getActiveElement() { + try { + return document.activeElement; + } catch (err) {} + } + + // Expose the picker constructor. + return PickerConstructor; +}); +; /*!
+ * Date picker for pickadate.js v3.5.0
+ * http://amsul.github.io/pickadate.js/date.htm
+ */ + +(function (factory) { + factory(Materialize.Picker, jQuery); +})(function (Picker, $) { + + /**
+ * Globals and constants
+ */ + var DAYS_IN_WEEK = 7, + WEEKS_IN_CALENDAR = 6, + _ = Picker._; + + /**
+ * The date picker constructor
+ */ + function DatePicker(picker, settings) { + + var calendar = this, + element = picker.$node[0], + elementValue = element.value, + elementDataValue = picker.$node.data('value'), + valueString = elementDataValue || elementValue, + formatString = elementDataValue ? settings.formatSubmit : settings.format, + isRTL = function () { + + return element.currentStyle ? + + // For IE. + element.currentStyle.direction == 'rtl' : + + // For normal browsers. + getComputedStyle(picker.$root[0]).direction == 'rtl'; + }; + + calendar.settings = settings; + calendar.$node = picker.$node; + + // The queue of methods that will be used to build item objects. + calendar.queue = { + min: 'measure create', + max: 'measure create', + now: 'now create', + select: 'parse create validate', + highlight: 'parse navigate create validate', + view: 'parse create validate viewset', + disable: 'deactivate', + enable: 'activate' + + // The component's item object. + };calendar.item = {}; + + calendar.item.clear = null; + calendar.item.disable = (settings.disable || []).slice(0); + calendar.item.enable = -function (collectionDisabled) { + return collectionDisabled[0] === true ? collectionDisabled.shift() : -1; + }(calendar.item.disable); + + calendar.set('min', settings.min).set('max', settings.max).set('now'); + + // When there’s a value, set the `select`, which in turn + // also sets the `highlight` and `view`. + if (valueString) { + calendar.set('select', valueString, { format: formatString }); + } + + // If there’s no value, default to highlighting “today”. + else { + calendar.set('select', null).set('highlight', calendar.item.now); + } + + // The keycode to movement mapping. + calendar.key = { + 40: 7, // Down + 38: -7, // Up + 39: function () { + return isRTL() ? -1 : 1; + }, // Right + 37: function () { + return isRTL() ? 1 : -1; + }, // Left + go: function (timeChange) { + var highlightedObject = calendar.item.highlight, + targetDate = new Date(highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange); + calendar.set('highlight', targetDate, { interval: timeChange }); + this.render(); + } + + // Bind some picker events. + };picker.on('render', function () { + picker.$root.find('.' + settings.klass.selectMonth).on('change', function () { + var value = this.value; + if (value) { + picker.set('highlight', [picker.get('view').year, value, picker.get('highlight').date]); + picker.$root.find('.' + settings.klass.selectMonth).trigger('focus'); + } + }); + picker.$root.find('.' + settings.klass.selectYear).on('change', function () { + var value = this.value; + if (value) { + picker.set('highlight', [value, picker.get('view').month, picker.get('highlight').date]); + picker.$root.find('.' + settings.klass.selectYear).trigger('focus'); + } + }); + }, 1).on('open', function () { + var includeToday = ''; + if (calendar.disabled(calendar.get('now'))) { + includeToday = ':not(.' + settings.klass.buttonToday + ')'; + } + picker.$root.find('button' + includeToday + ', select').attr('disabled', false); + }, 1).on('close', function () { + picker.$root.find('button, select').attr('disabled', true); + }, 1); + } //DatePicker + + + /**
+ * Set a datepicker item object.
+ */ + DatePicker.prototype.set = function (type, value, options) { + + var calendar = this, + calendarItem = calendar.item; + + // If the value is `null` just set it immediately. + if (value === null) { + if (type == 'clear') type = 'select'; + calendarItem[type] = value; + return calendar; + } + + // Otherwise go through the queue of methods, and invoke the functions. + // Update this as the time unit, and set the final value as this item. + // * In the case of `enable`, keep the queue but set `disable` instead. + // And in the case of `flip`, keep the queue but set `enable` instead. + calendarItem[type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type] = calendar.queue[type].split(' ').map(function (method) { + value = calendar[method](type, value, options); + return value; + }).pop(); + + // Check if we need to cascade through more updates. + if (type == 'select') { + calendar.set('highlight', calendarItem.select, options); + } else if (type == 'highlight') { + calendar.set('view', calendarItem.highlight, options); + } else if (type.match(/^(flip|min|max|disable|enable)$/)) { + if (calendarItem.select && calendar.disabled(calendarItem.select)) { + calendar.set('select', calendarItem.select, options); + } + if (calendarItem.highlight && calendar.disabled(calendarItem.highlight)) { + calendar.set('highlight', calendarItem.highlight, options); + } + } + + return calendar; + }; //DatePicker.prototype.set + + + /**
+ * Get a datepicker item object.
+ */ + DatePicker.prototype.get = function (type) { + return this.item[type]; + }; //DatePicker.prototype.get + + + /**
+ * Create a picker date object.
+ */ + DatePicker.prototype.create = function (type, value, options) { + + var isInfiniteValue, + calendar = this; + + // If there’s no value, use the type as the value. + value = value === undefined ? type : value; + + // If it’s infinity, update the value. + if (value == -Infinity || value == Infinity) { + isInfiniteValue = value; + } + + // If it’s an object, use the native date object. + else if ($.isPlainObject(value) && _.isInteger(value.pick)) { + value = value.obj; + } + + // If it’s an array, convert it into a date and make sure + // that it’s a valid date – otherwise default to today. + else if ($.isArray(value)) { + value = new Date(value[0], value[1], value[2]); + value = _.isDate(value) ? value : calendar.create().obj; + } + + // If it’s a number or date object, make a normalized date. + else if (_.isInteger(value) || _.isDate(value)) { + value = calendar.normalize(new Date(value), options); + } + + // If it’s a literal true or any other case, set it to now. + else /*if ( value === true )*/{ + value = calendar.now(type, value, options); + } + + // Return the compiled object. + return { + year: isInfiniteValue || value.getFullYear(), + month: isInfiniteValue || value.getMonth(), + date: isInfiniteValue || value.getDate(), + day: isInfiniteValue || value.getDay(), + obj: isInfiniteValue || value, + pick: isInfiniteValue || value.getTime() + }; + }; //DatePicker.prototype.create + + + /**
+ * Create a range limit object using an array, date object,
+ * literal “true”, or integer relative to another time.
+ */ + DatePicker.prototype.createRange = function (from, to) { + + var calendar = this, + createDate = function (date) { + if (date === true || $.isArray(date) || _.isDate(date)) { + return calendar.create(date); + } + return date; + }; + + // Create objects if possible. + if (!_.isInteger(from)) { + from = createDate(from); + } + if (!_.isInteger(to)) { + to = createDate(to); + } + + // Create relative dates. + if (_.isInteger(from) && $.isPlainObject(to)) { + from = [to.year, to.month, to.date + from]; + } else if (_.isInteger(to) && $.isPlainObject(from)) { + to = [from.year, from.month, from.date + to]; + } + + return { + from: createDate(from), + to: createDate(to) + }; + }; //DatePicker.prototype.createRange + + + /**
+ * Check if a date unit falls within a date range object.
+ */ + DatePicker.prototype.withinRange = function (range, dateUnit) { + range = this.createRange(range.from, range.to); + return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick; + }; + + /**
+ * Check if two date range objects overlap.
+ */ + DatePicker.prototype.overlapRanges = function (one, two) { + + var calendar = this; + + // Convert the ranges into comparable dates. + one = calendar.createRange(one.from, one.to); + two = calendar.createRange(two.from, two.to); + + return calendar.withinRange(one, two.from) || calendar.withinRange(one, two.to) || calendar.withinRange(two, one.from) || calendar.withinRange(two, one.to); + }; + + /**
+ * Get the date today.
+ */ + DatePicker.prototype.now = function (type, value, options) { + value = new Date(); + if (options && options.rel) { + value.setDate(value.getDate() + options.rel); + } + return this.normalize(value, options); + }; + + /**
+ * Navigate to next/prev month.
+ */ + DatePicker.prototype.navigate = function (type, value, options) { + + var targetDateObject, + targetYear, + targetMonth, + targetDate, + isTargetArray = $.isArray(value), + isTargetObject = $.isPlainObject(value), + viewsetObject = this.item.view; /*,
+ safety = 100*/ + + if (isTargetArray || isTargetObject) { + + if (isTargetObject) { + targetYear = value.year; + targetMonth = value.month; + targetDate = value.date; + } else { + targetYear = +value[0]; + targetMonth = +value[1]; + targetDate = +value[2]; + } + + // If we’re navigating months but the view is in a different + // month, navigate to the view’s year and month. + if (options && options.nav && viewsetObject && viewsetObject.month !== targetMonth) { + targetYear = viewsetObject.year; + targetMonth = viewsetObject.month; + } + + // Figure out the expected target year and month. + targetDateObject = new Date(targetYear, targetMonth + (options && options.nav ? options.nav : 0), 1); + targetYear = targetDateObject.getFullYear(); + targetMonth = targetDateObject.getMonth(); + + // If the month we’re going to doesn’t have enough days, + // keep decreasing the date until we reach the month’s last date. + while ( /*safety &&*/new Date(targetYear, targetMonth, targetDate).getMonth() !== targetMonth) { + targetDate -= 1; + /*safety -= 1
+ if ( !safety ) {
+ throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.'
+ }*/ + } + + value = [targetYear, targetMonth, targetDate]; + } + + return value; + }; //DatePicker.prototype.navigate + + + /**
+ * Normalize a date by setting the hours to midnight.
+ */ + DatePicker.prototype.normalize = function (value /*, options*/) { + value.setHours(0, 0, 0, 0); + return value; + }; + + /**
+ * Measure the range of dates.
+ */ + DatePicker.prototype.measure = function (type, value /*, options*/) { + + var calendar = this; + + // If it’s anything false-y, remove the limits. + if (!value) { + value = type == 'min' ? -Infinity : Infinity; + } + + // If it’s a string, parse it. + else if (typeof value == 'string') { + value = calendar.parse(type, value); + } + + // If it's an integer, get a date relative to today. + else if (_.isInteger(value)) { + value = calendar.now(type, value, { rel: value }); + } + + return value; + }; ///DatePicker.prototype.measure + + + /**
+ * Create a viewset object based on navigation.
+ */ + DatePicker.prototype.viewset = function (type, dateObject /*, options*/) { + return this.create([dateObject.year, dateObject.month, 1]); + }; + + /**
+ * Validate a date as enabled and shift if needed.
+ */ + DatePicker.prototype.validate = function (type, dateObject, options) { + + var calendar = this, + + + // Keep a reference to the original date. + originalDateObject = dateObject, + + + // Make sure we have an interval. + interval = options && options.interval ? options.interval : 1, + + + // Check if the calendar enabled dates are inverted. + isFlippedBase = calendar.item.enable === -1, + + + // Check if we have any enabled dates after/before now. + hasEnabledBeforeTarget, + hasEnabledAfterTarget, + + + // The min & max limits. + minLimitObject = calendar.item.min, + maxLimitObject = calendar.item.max, + + + // Check if we’ve reached the limit during shifting. + reachedMin, + reachedMax, + + + // Check if the calendar is inverted and at least one weekday is enabled. + hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter(function (value) { + + // If there’s a date, check where it is relative to the target. + if ($.isArray(value)) { + var dateTime = calendar.create(value).pick; + if (dateTime < dateObject.pick) hasEnabledBeforeTarget = true;else if (dateTime > dateObject.pick) hasEnabledAfterTarget = true; + } + + // Return only integers for enabled weekdays. + return _.isInteger(value); + }).length; /*,
+ safety = 100*/ + + // Cases to validate for: + // [1] Not inverted and date disabled. + // [2] Inverted and some dates enabled. + // [3] Not inverted and out of range. + // + // Cases to **not** validate for: + // • Navigating months. + // • Not inverted and date enabled. + // • Inverted and all dates disabled. + // • ..and anything else. + if (!options || !options.nav) if ( + /* 1 */!isFlippedBase && calendar.disabled(dateObject) || + /* 2 */isFlippedBase && calendar.disabled(dateObject) && (hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget) || + /* 3 */!isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick)) { + + // When inverted, flip the direction if there aren’t any enabled weekdays + // and there are no enabled dates in the direction of the interval. + if (isFlippedBase && !hasEnabledWeekdays && (!hasEnabledAfterTarget && interval > 0 || !hasEnabledBeforeTarget && interval < 0)) { + interval *= -1; + } + + // Keep looping until we reach an enabled date. + while ( /*safety &&*/calendar.disabled(dateObject)) { + + /*safety -= 1
+ if ( !safety ) {
+ throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.'
+ }*/ + + // If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval. + if (Math.abs(interval) > 1 && (dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month)) { + dateObject = originalDateObject; + interval = interval > 0 ? 1 : -1; + } + + // If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit. + if (dateObject.pick <= minLimitObject.pick) { + reachedMin = true; + interval = 1; + dateObject = calendar.create([minLimitObject.year, minLimitObject.month, minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1)]); + } else if (dateObject.pick >= maxLimitObject.pick) { + reachedMax = true; + interval = -1; + dateObject = calendar.create([maxLimitObject.year, maxLimitObject.month, maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1)]); + } + + // If we’ve reached both limits, just break out of the loop. + if (reachedMin && reachedMax) { + break; + } + + // Finally, create the shifted date using the interval and keep looping. + dateObject = calendar.create([dateObject.year, dateObject.month, dateObject.date + interval]); + } + } //endif + + + // Return the date object settled on. + return dateObject; + }; //DatePicker.prototype.validate + + + /**
+ * Check if a date is disabled.
+ */ + DatePicker.prototype.disabled = function (dateToVerify) { + + var calendar = this, + + + // Filter through the disabled dates to check if this is one. + isDisabledMatch = calendar.item.disable.filter(function (dateToDisable) { + + // If the date is a number, match the weekday with 0index and `firstDay` check. + if (_.isInteger(dateToDisable)) { + return dateToVerify.day === (calendar.settings.firstDay ? dateToDisable : dateToDisable - 1) % 7; + } + + // If it’s an array or a native JS date, create and match the exact date. + if ($.isArray(dateToDisable) || _.isDate(dateToDisable)) { + return dateToVerify.pick === calendar.create(dateToDisable).pick; + } + + // If it’s an object, match a date within the “from” and “to” range. + if ($.isPlainObject(dateToDisable)) { + return calendar.withinRange(dateToDisable, dateToVerify); + } + }); + + // If this date matches a disabled date, confirm it’s not inverted. + isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function (dateToDisable) { + return $.isArray(dateToDisable) && dateToDisable[3] == 'inverted' || $.isPlainObject(dateToDisable) && dateToDisable.inverted; + }).length; + + // Check the calendar “enabled” flag and respectively flip the + // disabled state. Then also check if it’s beyond the min/max limits. + return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch || dateToVerify.pick < calendar.item.min.pick || dateToVerify.pick > calendar.item.max.pick; + }; //DatePicker.prototype.disabled + + + /**
+ * Parse a string into a usable type.
+ */ + DatePicker.prototype.parse = function (type, value, options) { + + var calendar = this, + parsingObject = {}; + + // If it’s already parsed, we’re good. + if (!value || typeof value != 'string') { + return value; + } + + // We need a `.format` to parse the value with. + if (!(options && options.format)) { + options = options || {}; + options.format = calendar.settings.format; + } + + // Convert the format into an array and then map through it. + calendar.formats.toArray(options.format).map(function (label) { + + var + // Grab the formatting label. + formattingLabel = calendar.formats[label], + + + // The format length is from the formatting label function or the + // label length without the escaping exclamation (!) mark. + formatLength = formattingLabel ? _.trigger(formattingLabel, calendar, [value, parsingObject]) : label.replace(/^!/, '').length; + + // If there's a format label, split the value up to the format length. + // Then add it to the parsing object with appropriate label. + if (formattingLabel) { + parsingObject[label] = value.substr(0, formatLength); + } + + // Update the value as the substring from format length to end. + value = value.substr(formatLength); + }); + + // Compensate for month 0index. + return [parsingObject.yyyy || parsingObject.yy, +(parsingObject.mm || parsingObject.m) - 1, parsingObject.dd || parsingObject.d]; + }; //DatePicker.prototype.parse + + + /**
+ * Various formats to display the object in.
+ */ + DatePicker.prototype.formats = function () { + + // Return the length of the first word in a collection. + function getWordLengthFromCollection(string, collection, dateObject) { + + // Grab the first word from the string. + var word = string.match(/\w+/)[0]; + + // If there's no month index, add it to the date object + if (!dateObject.mm && !dateObject.m) { + dateObject.m = collection.indexOf(word) + 1; + } + + // Return the length of the word. + return word.length; + } + + // Get the length of the first word in a string. + function getFirstWordLength(string) { + return string.match(/\w+/)[0].length; + } + + return { + + d: function (string, dateObject) { + + // If there's string, then get the digits length. + // Otherwise return the selected date. + return string ? _.digits(string) : dateObject.date; + }, + dd: function (string, dateObject) { + + // If there's a string, then the length is always 2. + // Otherwise return the selected date with a leading zero. + return string ? 2 : _.lead(dateObject.date); + }, + ddd: function (string, dateObject) { + + // If there's a string, then get the length of the first word. + // Otherwise return the short selected weekday. + return string ? getFirstWordLength(string) : this.settings.weekdaysShort[dateObject.day]; + }, + dddd: function (string, dateObject) { + + // If there's a string, then get the length of the first word. + // Otherwise return the full selected weekday. + return string ? getFirstWordLength(string) : this.settings.weekdaysFull[dateObject.day]; + }, + m: function (string, dateObject) { + + // If there's a string, then get the length of the digits + // Otherwise return the selected month with 0index compensation. + return string ? _.digits(string) : dateObject.month + 1; + }, + mm: function (string, dateObject) { + + // If there's a string, then the length is always 2. + // Otherwise return the selected month with 0index and leading zero. + return string ? 2 : _.lead(dateObject.month + 1); + }, + mmm: function (string, dateObject) { + + var collection = this.settings.monthsShort; + + // If there's a string, get length of the relevant month from the short + // months collection. Otherwise return the selected month from that collection. + return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month]; + }, + mmmm: function (string, dateObject) { + + var collection = this.settings.monthsFull; + + // If there's a string, get length of the relevant month from the full + // months collection. Otherwise return the selected month from that collection. + return string ? getWordLengthFromCollection(string, collection, dateObject) : collection[dateObject.month]; + }, + yy: function (string, dateObject) { + + // If there's a string, then the length is always 2. + // Otherwise return the selected year by slicing out the first 2 digits. + return string ? 2 : ('' + dateObject.year).slice(2); + }, + yyyy: function (string, dateObject) { + + // If there's a string, then the length is always 4. + // Otherwise return the selected year. + return string ? 4 : dateObject.year; + }, + + // Create an array by splitting the formatting string passed. + toArray: function (formatString) { + return formatString.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g); + }, + + // Format an object into a string using the formatting options. + toString: function (formatString, itemObject) { + var calendar = this; + return calendar.formats.toArray(formatString).map(function (label) { + return _.trigger(calendar.formats[label], calendar, [0, itemObject]) || label.replace(/^!/, ''); + }).join(''); + } + }; + }(); //DatePicker.prototype.formats + + + /**
+ * Check if two date units are the exact.
+ */ + DatePicker.prototype.isDateExact = function (one, two) { + + var calendar = this; + + // When we’re working with weekdays, do a direct comparison. + if (_.isInteger(one) && _.isInteger(two) || typeof one == 'boolean' && typeof two == 'boolean') { + return one === two; + } + + // When we’re working with date representations, compare the “pick” value. + if ((_.isDate(one) || $.isArray(one)) && (_.isDate(two) || $.isArray(two))) { + return calendar.create(one).pick === calendar.create(two).pick; + } + + // When we’re working with range objects, compare the “from” and “to”. + if ($.isPlainObject(one) && $.isPlainObject(two)) { + return calendar.isDateExact(one.from, two.from) && calendar.isDateExact(one.to, two.to); + } + + return false; + }; + + /**
+ * Check if two date units overlap.
+ */ + DatePicker.prototype.isDateOverlap = function (one, two) { + + var calendar = this, + firstDay = calendar.settings.firstDay ? 1 : 0; + + // When we’re working with a weekday index, compare the days. + if (_.isInteger(one) && (_.isDate(two) || $.isArray(two))) { + one = one % 7 + firstDay; + return one === calendar.create(two).day + 1; + } + if (_.isInteger(two) && (_.isDate(one) || $.isArray(one))) { + two = two % 7 + firstDay; + return two === calendar.create(one).day + 1; + } + + // When we’re working with range objects, check if the ranges overlap. + if ($.isPlainObject(one) && $.isPlainObject(two)) { + return calendar.overlapRanges(one, two); + } + + return false; + }; + + /**
+ * Flip the “enabled” state.
+ */ + DatePicker.prototype.flipEnable = function (val) { + var itemObject = this.item; + itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1); + }; + + /**
+ * Mark a collection of dates as “disabled”.
+ */ + DatePicker.prototype.deactivate = function (type, datesToDisable) { + + var calendar = this, + disabledItems = calendar.item.disable.slice(0); + + // If we’re flipping, that’s all we need to do. + if (datesToDisable == 'flip') { + calendar.flipEnable(); + } else if (datesToDisable === false) { + calendar.flipEnable(1); + disabledItems = []; + } else if (datesToDisable === true) { + calendar.flipEnable(-1); + disabledItems = []; + } + + // Otherwise go through the dates to disable. + else { + + datesToDisable.map(function (unitToDisable) { + + var matchFound; + + // When we have disabled items, check for matches. + // If something is matched, immediately break out. + for (var index = 0; index < disabledItems.length; index += 1) { + if (calendar.isDateExact(unitToDisable, disabledItems[index])) { + matchFound = true; + break; + } + } + + // If nothing was found, add the validated unit to the collection. + if (!matchFound) { + if (_.isInteger(unitToDisable) || _.isDate(unitToDisable) || $.isArray(unitToDisable) || $.isPlainObject(unitToDisable) && unitToDisable.from && unitToDisable.to) { + disabledItems.push(unitToDisable); + } + } + }); + } + + // Return the updated collection. + return disabledItems; + }; //DatePicker.prototype.deactivate + + + /**
+ * Mark a collection of dates as “enabled”.
+ */ + DatePicker.prototype.activate = function (type, datesToEnable) { + + var calendar = this, + disabledItems = calendar.item.disable, + disabledItemsCount = disabledItems.length; + + // If we’re flipping, that’s all we need to do. + if (datesToEnable == 'flip') { + calendar.flipEnable(); + } else if (datesToEnable === true) { + calendar.flipEnable(1); + disabledItems = []; + } else if (datesToEnable === false) { + calendar.flipEnable(-1); + disabledItems = []; + } + + // Otherwise go through the disabled dates. + else { + + datesToEnable.map(function (unitToEnable) { + + var matchFound, disabledUnit, index, isExactRange; + + // Go through the disabled items and try to find a match. + for (index = 0; index < disabledItemsCount; index += 1) { + + disabledUnit = disabledItems[index]; + + // When an exact match is found, remove it from the collection. + if (calendar.isDateExact(disabledUnit, unitToEnable)) { + matchFound = disabledItems[index] = null; + isExactRange = true; + break; + } + + // When an overlapped match is found, add the “inverted” state to it. + else if (calendar.isDateOverlap(disabledUnit, unitToEnable)) { + if ($.isPlainObject(unitToEnable)) { + unitToEnable.inverted = true; + matchFound = unitToEnable; + } else if ($.isArray(unitToEnable)) { + matchFound = unitToEnable; + if (!matchFound[3]) matchFound.push('inverted'); + } else if (_.isDate(unitToEnable)) { + matchFound = [unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted']; + } + break; + } + } + + // If a match was found, remove a previous duplicate entry. + if (matchFound) for (index = 0; index < disabledItemsCount; index += 1) { + if (calendar.isDateExact(disabledItems[index], unitToEnable)) { + disabledItems[index] = null; + break; + } + } + + // In the event that we’re dealing with an exact range of dates, + // make sure there are no “inverted” dates because of it. + if (isExactRange) for (index = 0; index < disabledItemsCount; index += 1) { + if (calendar.isDateOverlap(disabledItems[index], unitToEnable)) { + disabledItems[index] = null; + break; + } + } + + // If something is still matched, add it into the collection. + if (matchFound) { + disabledItems.push(matchFound); + } + }); + } + + // Return the updated collection. + return disabledItems.filter(function (val) { + return val != null; + }); + }; //DatePicker.prototype.activate + + + /**
+ * Create a string for the nodes in the picker.
+ */ + DatePicker.prototype.nodes = function (isOpen) { + + var calendar = this, + settings = calendar.settings, + calendarItem = calendar.item, + nowObject = calendarItem.now, + selectedObject = calendarItem.select, + highlightedObject = calendarItem.highlight, + viewsetObject = calendarItem.view, + disabledCollection = calendarItem.disable, + minLimitObject = calendarItem.min, + maxLimitObject = calendarItem.max, + + + // Create the calendar table head using a copy of weekday labels collection. + // * We do a copy so we don't mutate the original array. + tableHead = function (collection, fullCollection) { + + // If the first day should be Monday, move Sunday to the end. + if (settings.firstDay) { + collection.push(collection.shift()); + fullCollection.push(fullCollection.shift()); + } + + // Create and return the table head group. + return _.node('thead', _.node('tr', _.group({ + min: 0, + max: DAYS_IN_WEEK - 1, + i: 1, + node: 'th', + item: function (counter) { + return [collection[counter], settings.klass.weekdays, 'scope=col title="' + fullCollection[counter] + '"']; + } + }))); //endreturn + + // Materialize modified + }((settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter).slice(0), settings.weekdaysFull.slice(0)), + //tableHead + + + // Create the nav for next/prev month. + createMonthNav = function (next) { + + // Otherwise, return the created month tag. + return _.node('div', ' ', settings.klass['nav' + (next ? 'Next' : 'Prev')] + ( + + // If the focused month is outside the range, disabled the button. + next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month || !next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month ? ' ' + settings.klass.navDisabled : ''), 'data-nav=' + (next || -1) + ' ' + _.ariaAttr({ + role: 'button', + controls: calendar.$node[0].id + '_table' + }) + ' ' + 'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev) + '"'); //endreturn + }, + //createMonthNav + + + // Create the month label. + //Materialize modified + createMonthLabel = function (override) { + + var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull; + + // Materialize modified + if (override == "short_months") { + monthsCollection = settings.monthsShort; + } + + // If there are months to select, add a dropdown menu. + if (settings.selectMonths && override == undefined) { + + return _.node('select', _.group({ + min: 0, + max: 11, + i: 1, + node: 'option', + item: function (loopedMonth) { + + return [ + + // The looped month and no classes. + monthsCollection[loopedMonth], 0, + + // Set the value and selected index. + 'value=' + loopedMonth + (viewsetObject.month == loopedMonth ? ' selected' : '') + (viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month || viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month ? ' disabled' : '')]; + } + }), settings.klass.selectMonth + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelMonthSelect + '"'); + } + + // Materialize modified + if (override == "short_months") if (selectedObject != null) return monthsCollection[selectedObject.month];else return monthsCollection[viewsetObject.month]; + + // If there's a need for a month selector + return _.node('div', monthsCollection[viewsetObject.month], settings.klass.month); + }, + //createMonthLabel + + + // Create the year label. + // Materialize modified + createYearLabel = function (override) { + + var focusedYear = viewsetObject.year, + + + // If years selector is set to a literal "true", set it to 5. Otherwise + // divide in half to get half before and half after focused year. + numberYears = settings.selectYears === true ? 5 : ~~(settings.selectYears / 2); + + // If there are years to select, add a dropdown menu. + if (numberYears) { + + var minYear = minLimitObject.year, + maxYear = maxLimitObject.year, + lowestYear = focusedYear - numberYears, + highestYear = focusedYear + numberYears; + + // If the min year is greater than the lowest year, increase the highest year + // by the difference and set the lowest year to the min year. + if (minYear > lowestYear) { + highestYear += minYear - lowestYear; + lowestYear = minYear; + } + + // If the max year is less than the highest year, decrease the lowest year + // by the lower of the two: available and needed years. Then set the + // highest year to the max year. + if (maxYear < highestYear) { + + var availableYears = lowestYear - minYear, + neededYears = highestYear - maxYear; + + lowestYear -= availableYears > neededYears ? neededYears : availableYears; + highestYear = maxYear; + } + + if (settings.selectYears && override == undefined) { + return _.node('select', _.group({ + min: lowestYear, + max: highestYear, + i: 1, + node: 'option', + item: function (loopedYear) { + return [ + + // The looped year and no classes. + loopedYear, 0, + + // Set the value and selected index. + 'value=' + loopedYear + (focusedYear == loopedYear ? ' selected' : '')]; + } + }), settings.klass.selectYear + ' browser-default', (isOpen ? '' : 'disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' + 'title="' + settings.labelYearSelect + '"'); + } + } + + // Materialize modified + if (override === 'raw' && selectedObject != null) { + return _.node('div', selectedObject.year); + } + + // Otherwise just return the year focused + return _.node('div', focusedYear, settings.klass.year); + }; //createYearLabel + + + // Materialize modified + createDayLabel = function () { + if (selectedObject != null) return selectedObject.date;else return nowObject.date; + }; + createWeekdayLabel = function () { + var display_day; + + if (selectedObject != null) display_day = selectedObject.day;else display_day = nowObject.day; + var weekday = settings.weekdaysShort[display_day]; + return weekday; + }; + + // Create and return the entire calendar. + + return _.node( + // Date presentation View + 'div', _.node( + // Div for Year + 'div', createYearLabel("raw"), settings.klass.year_display) + _.node('span', createWeekdayLabel() + ', ', "picker__weekday-display") + _.node( + // Div for short Month + 'span', createMonthLabel("short_months") + ' ', settings.klass.month_display) + _.node( + // Div for Day + 'span', createDayLabel(), settings.klass.day_display), settings.klass.date_display) + + // Calendar container + _.node('div', _.node('div', _.node('div', (settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel()) + createMonthNav() + createMonthNav(1), settings.klass.header) + _.node('table', tableHead + _.node('tbody', _.group({ + min: 0, + max: WEEKS_IN_CALENDAR - 1, + i: 1, + node: 'tr', + item: function (rowCounter) { + + // If Monday is the first day and the month starts on Sunday, shift the date back a week. + var shiftDateBy = settings.firstDay && calendar.create([viewsetObject.year, viewsetObject.month, 1]).day === 0 ? -7 : 0; + + return [_.group({ + min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index + max: function () { + return this.min + DAYS_IN_WEEK - 1; + }, + i: 1, + node: 'td', + item: function (targetDate) { + + // Convert the time date from a relative date to a target date. + targetDate = calendar.create([viewsetObject.year, viewsetObject.month, targetDate + (settings.firstDay ? 1 : 0)]); + + var isSelected = selectedObject && selectedObject.pick == targetDate.pick, + isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick, + isDisabled = disabledCollection && calendar.disabled(targetDate) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick, + formattedDate = _.trigger(calendar.formats.toString, calendar, [settings.format, targetDate]); + + return [_.node('div', targetDate.date, function (klasses) { + + // Add the `infocus` or `outfocus` classes based on month in view. + klasses.push(viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus); + + // Add the `today` class if needed. + if (nowObject.pick == targetDate.pick) { + klasses.push(settings.klass.now); + } + + // Add the `selected` class if something's selected and the time matches. + if (isSelected) { + klasses.push(settings.klass.selected); + } + + // Add the `highlighted` class if something's highlighted and the time matches. + if (isHighlighted) { + klasses.push(settings.klass.highlighted); + } + + // Add the `disabled` class if something's disabled and the object matches. + if (isDisabled) { + klasses.push(settings.klass.disabled); + } + + return klasses.join(' '); + }([settings.klass.day]), 'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({ + role: 'gridcell', + label: formattedDate, + selected: isSelected && calendar.$node.val() === formattedDate ? true : null, + activedescendant: isHighlighted ? true : null, + disabled: isDisabled ? true : null + }) + ' ' + (isDisabled ? '' : 'tabindex="0"')), '', _.ariaAttr({ role: 'presentation' })]; //endreturn + } + })]; //endreturn + } + })), settings.klass.table, 'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({ + role: 'grid', + controls: calendar.$node[0].id, + readonly: true + })), settings.klass.calendar_container) // end calendar + + + + + // * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”. + _.node('div', _.node('button', settings.today, "btn-flat picker__today waves-effect", 'type=button data-pick=' + nowObject.pick + (isOpen && !calendar.disabled(nowObject) ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.clear, "btn-flat picker__clear waves-effect", 'type=button data-clear=1' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })) + _.node('button', settings.close, "btn-flat picker__close waves-effect", 'type=button data-close=true ' + (isOpen ? '' : ' disabled') + ' ' + _.ariaAttr({ controls: calendar.$node[0].id })), settings.klass.footer), 'picker__container__wrapper'); //endreturn + }; //DatePicker.prototype.nodes + + + /**
+ * The date picker defaults.
+ */ + DatePicker.defaults = function (prefix) { + + return { + + // The title label to use for the month nav buttons + labelMonthNext: 'Next month', + labelMonthPrev: 'Previous month', + + // The title label to use for the dropdown selectors + labelMonthSelect: 'Select a month', + labelYearSelect: 'Select a year', + + // Months and weekdays + monthsFull: ['January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December'], + monthsShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], + weekdaysFull: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], + weekdaysShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], + + // Materialize modified + weekdaysLetter: ['S', 'M', 'T', 'W', 'T', 'F', 'S'], + + // Today and clear + today: 'Today', + clear: 'Clear', + close: 'Ok', + + // Picker close behavior (Prevent a change in behaviour for backwards compatibility) + closeOnSelect: false, + + // The format to show on the `input` element + format: 'd mmmm, yyyy', + + // Classes + klass: { + + table: prefix + 'table', + + header: prefix + 'header', + + // Materialize Added klasses + date_display: prefix + 'date-display', + day_display: prefix + 'day-display', + month_display: prefix + 'month-display', + year_display: prefix + 'year-display', + calendar_container: prefix + 'calendar-container', + // end + + + navPrev: prefix + 'nav--prev', + navNext: prefix + 'nav--next', + navDisabled: prefix + 'nav--disabled', + + month: prefix + 'month', + year: prefix + 'year', + + selectMonth: prefix + 'select--month', + selectYear: prefix + 'select--year', + + weekdays: prefix + 'weekday', + + day: prefix + 'day', + disabled: prefix + 'day--disabled', + selected: prefix + 'day--selected', + highlighted: prefix + 'day--highlighted', + now: prefix + 'day--today', + infocus: prefix + 'day--infocus', + outfocus: prefix + 'day--outfocus', + + footer: prefix + 'footer', + + buttonClear: prefix + 'button--clear', + buttonToday: prefix + 'button--today', + buttonClose: prefix + 'button--close' + } + }; + }(Picker.klasses().picker + '__'); + + /**
+ * Extend the picker to add the date picker.
+ */ + Picker.extend('pickadate', DatePicker); +}); +; /*!
+ * ClockPicker v0.0.7 (http://weareoutman.github.io/clockpicker/)
+ * Copyright 2014 Wang Shenwei.
+ * Licensed under MIT (https://github.com/weareoutman/clockpicker/blob/gh-pages/LICENSE)
+ *
+ * Further modified
+ * Copyright 2015 Ching Yaw Hao.
+ */ + +(function ($) { + var $win = $(window), + $doc = $(document); + + // Can I use inline svg ? + var svgNS = 'http://www.w3.org/2000/svg', + svgSupported = 'SVGAngle' in window && function () { + var supported, + el = document.createElement('div'); + el.innerHTML = '<svg/>'; + supported = (el.firstChild && el.firstChild.namespaceURI) == svgNS; + el.innerHTML = ''; + return supported; + }(); + + // Can I use transition ? + var transitionSupported = function () { + var style = document.createElement('div').style; + return 'transition' in style || 'WebkitTransition' in style || 'MozTransition' in style || 'msTransition' in style || 'OTransition' in style; + }(); + + // Listen touch events in touch screen device, instead of mouse events in desktop. + var touchSupported = 'ontouchstart' in window, + mousedownEvent = 'mousedown' + (touchSupported ? ' touchstart' : ''), + mousemoveEvent = 'mousemove.clockpicker' + (touchSupported ? ' touchmove.clockpicker' : ''), + mouseupEvent = 'mouseup.clockpicker' + (touchSupported ? ' touchend.clockpicker' : ''); + + // Vibrate the device if supported + var vibrate = navigator.vibrate ? 'vibrate' : navigator.webkitVibrate ? 'webkitVibrate' : null; + + function createSvgElement(name) { + return document.createElementNS(svgNS, name); + } + + function leadingZero(num) { + return (num < 10 ? '0' : '') + num; + } + + // Get a unique id + var idCounter = 0; + function uniqueId(prefix) { + var id = ++idCounter + ''; + return prefix ? prefix + id : id; + } + + // Clock size + var dialRadius = 135, + outerRadius = 105, + + // innerRadius = 80 on 12 hour clock + innerRadius = 70, + tickRadius = 20, + diameter = dialRadius * 2, + duration = transitionSupported ? 350 : 1; + + // Popover template + var tpl = ['<div class="clockpicker picker">', '<div class="picker__holder">', '<div class="picker__frame">', '<div class="picker__wrap">', '<div class="picker__box">', '<div class="picker__date-display">', '<div class="clockpicker-display">', '<div class="clockpicker-display-column">', '<span class="clockpicker-span-hours text-primary"></span>', ':', '<span class="clockpicker-span-minutes"></span>', '</div>', '<div class="clockpicker-display-column clockpicker-display-am-pm">', '<div class="clockpicker-span-am-pm"></div>', '</div>', '</div>', '</div>', '<div class="picker__container__wrapper">', '<div class="picker__calendar-container">', '<div class="clockpicker-plate">', '<div class="clockpicker-canvas"></div>', '<div class="clockpicker-dial clockpicker-hours"></div>', '<div class="clockpicker-dial clockpicker-minutes clockpicker-dial-out"></div>', '</div>', '<div class="clockpicker-am-pm-block">', '</div>', '</div>', '<div class="picker__footer">', '</div>', '</div>', '</div>', '</div>', '</div>', '</div>', '</div>'].join(''); + + // ClockPicker + function ClockPicker(element, options) { + var popover = $(tpl), + plate = popover.find('.clockpicker-plate'), + holder = popover.find('.picker__holder'), + hoursView = popover.find('.clockpicker-hours'), + minutesView = popover.find('.clockpicker-minutes'), + amPmBlock = popover.find('.clockpicker-am-pm-block'), + isInput = element.prop('tagName') === 'INPUT', + input = isInput ? element : element.find('input'), + label = $("label[for=" + input.attr("id") + "]"), + self = this; + + this.id = uniqueId('cp'); + this.element = element; + this.holder = holder; + this.options = options; + this.isAppended = false; + this.isShown = false; + this.currentView = 'hours'; + this.isInput = isInput; + this.input = input; + this.label = label; + this.popover = popover; + this.plate = plate; + this.hoursView = hoursView; + this.minutesView = minutesView; + this.amPmBlock = amPmBlock; + this.spanHours = popover.find('.clockpicker-span-hours'); + this.spanMinutes = popover.find('.clockpicker-span-minutes'); + this.spanAmPm = popover.find('.clockpicker-span-am-pm'); + this.footer = popover.find('.picker__footer'); + this.amOrPm = "PM"; + + // Setup for for 12 hour clock if option is selected + if (options.twelvehour) { + if (!options.ampmclickable) { + this.spanAmPm.empty(); + $('<div id="click-am">AM</div>').appendTo(this.spanAmPm); + $('<div id="click-pm">PM</div>').appendTo(this.spanAmPm); + } else { + this.spanAmPm.empty(); + $('<div id="click-am">AM</div>').on("click", function () { + self.spanAmPm.children('#click-am').addClass("text-primary"); + self.spanAmPm.children('#click-pm').removeClass("text-primary"); + self.amOrPm = "AM"; + }).appendTo(this.spanAmPm); + $('<div id="click-pm">PM</div>').on("click", function () { + self.spanAmPm.children('#click-pm').addClass("text-primary"); + self.spanAmPm.children('#click-am').removeClass("text-primary"); + self.amOrPm = 'PM'; + }).appendTo(this.spanAmPm); + } + } + + // Add buttons to footer + $('<button type="button" class="btn-flat picker__clear" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.cleartext + '</button>').click($.proxy(this.clear, this)).appendTo(this.footer); + $('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.canceltext + '</button>').click($.proxy(this.hide, this)).appendTo(this.footer); + $('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour ? '3' : '1') + '">' + options.donetext + '</button>').click($.proxy(this.done, this)).appendTo(this.footer); + + this.spanHours.click($.proxy(this.toggleView, this, 'hours')); + this.spanMinutes.click($.proxy(this.toggleView, this, 'minutes')); + + // Show or toggle + input.on('focus.clockpicker click.clockpicker', $.proxy(this.show, this)); + + // Build ticks + var tickTpl = $('<div class="clockpicker-tick"></div>'), + i, + tick, + radian, + radius; + + // Hours view + if (options.twelvehour) { + for (i = 1; i < 13; i += 1) { + tick = tickTpl.clone(); + radian = i / 6 * Math.PI; + radius = outerRadius; + tick.css({ + left: dialRadius + Math.sin(radian) * radius - tickRadius, + top: dialRadius - Math.cos(radian) * radius - tickRadius + }); + tick.html(i === 0 ? '00' : i); + hoursView.append(tick); + tick.on(mousedownEvent, mousedown); + } + } else { + for (i = 0; i < 24; i += 1) { + tick = tickTpl.clone(); + radian = i / 6 * Math.PI; + var inner = i > 0 && i < 13; + radius = inner ? innerRadius : outerRadius; + tick.css({ + left: dialRadius + Math.sin(radian) * radius - tickRadius, + top: dialRadius - Math.cos(radian) * radius - tickRadius + }); + tick.html(i === 0 ? '00' : i); + hoursView.append(tick); + tick.on(mousedownEvent, mousedown); + } + } + + // Minutes view + for (i = 0; i < 60; i += 5) { + tick = tickTpl.clone(); + radian = i / 30 * Math.PI; + tick.css({ + left: dialRadius + Math.sin(radian) * outerRadius - tickRadius, + top: dialRadius - Math.cos(radian) * outerRadius - tickRadius + }); + tick.html(leadingZero(i)); + minutesView.append(tick); + tick.on(mousedownEvent, mousedown); + } + + // Clicking on minutes view space + plate.on(mousedownEvent, function (e) { + if ($(e.target).closest('.clockpicker-tick').length === 0) { + mousedown(e, true); + } + }); + + // Mousedown or touchstart + function mousedown(e, space) { + var offset = plate.offset(), + isTouch = /^touch/.test(e.type), + x0 = offset.left + dialRadius, + y0 = offset.top + dialRadius, + dx = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0, + dy = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0, + z = Math.sqrt(dx * dx + dy * dy), + moved = false; + + // When clicking on minutes view space, check the mouse position + if (space && (z < outerRadius - tickRadius || z > outerRadius + tickRadius)) { + return; + } + e.preventDefault(); + + // Set cursor style of body after 200ms + var movingTimer = setTimeout(function () { + self.popover.addClass('clockpicker-moving'); + }, 200); + + // Clock + self.setHand(dx, dy, !space, true); + + // Mousemove on document + $doc.off(mousemoveEvent).on(mousemoveEvent, function (e) { + e.preventDefault(); + var isTouch = /^touch/.test(e.type), + x = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0, + y = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0; + if (!moved && x === dx && y === dy) { + // Clicking in chrome on windows will trigger a mousemove event + return; + } + moved = true; + self.setHand(x, y, false, true); + }); + + // Mouseup on document + $doc.off(mouseupEvent).on(mouseupEvent, function (e) { + $doc.off(mouseupEvent); + e.preventDefault(); + var isTouch = /^touch/.test(e.type), + x = (isTouch ? e.originalEvent.changedTouches[0] : e).pageX - x0, + y = (isTouch ? e.originalEvent.changedTouches[0] : e).pageY - y0; + if ((space || moved) && x === dx && y === dy) { + self.setHand(x, y); + } + + if (self.currentView === 'hours') { + self.toggleView('minutes', duration / 2); + } else if (options.autoclose) { + self.minutesView.addClass('clockpicker-dial-out'); + setTimeout(function () { + self.done(); + }, duration / 2); + } + plate.prepend(canvas); + + // Reset cursor style of body + clearTimeout(movingTimer); + self.popover.removeClass('clockpicker-moving'); + + // Unbind mousemove event + $doc.off(mousemoveEvent); + }); + } + + if (svgSupported) { + // Draw clock hands and others + var canvas = popover.find('.clockpicker-canvas'), + svg = createSvgElement('svg'); + svg.setAttribute('class', 'clockpicker-svg'); + svg.setAttribute('width', diameter); + svg.setAttribute('height', diameter); + var g = createSvgElement('g'); + g.setAttribute('transform', 'translate(' + dialRadius + ',' + dialRadius + ')'); + var bearing = createSvgElement('circle'); + bearing.setAttribute('class', 'clockpicker-canvas-bearing'); + bearing.setAttribute('cx', 0); + bearing.setAttribute('cy', 0); + bearing.setAttribute('r', 4); + var hand = createSvgElement('line'); + hand.setAttribute('x1', 0); + hand.setAttribute('y1', 0); + var bg = createSvgElement('circle'); + bg.setAttribute('class', 'clockpicker-canvas-bg'); + bg.setAttribute('r', tickRadius); + g.appendChild(hand); + g.appendChild(bg); + g.appendChild(bearing); + svg.appendChild(g); + canvas.append(svg); + + this.hand = hand; + this.bg = bg; + this.bearing = bearing; + this.g = g; + this.canvas = canvas; + } + + raiseCallback(this.options.init); + } + + function raiseCallback(callbackFunction) { + if (callbackFunction && typeof callbackFunction === "function") callbackFunction(); + } + + // Default options + ClockPicker.DEFAULTS = { + 'default': '', // default time, 'now' or '13:14' e.g. + fromnow: 0, // set default time to * milliseconds from now (using with default = 'now') + donetext: 'Ok', // done button text + cleartext: 'Clear', + canceltext: 'Cancel', + autoclose: false, // auto close when minute is selected + ampmclickable: true, // set am/pm button on itself + darktheme: false, // set to dark theme + twelvehour: true, // change to 12 hour AM/PM clock from 24 hour + vibrate: true // vibrate the device when dragging clock hand + }; + + // Show or hide popover + ClockPicker.prototype.toggle = function () { + this[this.isShown ? 'hide' : 'show'](); + }; + + // Set popover position + ClockPicker.prototype.locate = function () { + var element = this.element, + popover = this.popover, + offset = element.offset(), + width = element.outerWidth(), + height = element.outerHeight(), + align = this.options.align, + self = this; + + popover.show(); + }; + + // Show popover + ClockPicker.prototype.show = function (e) { + // Not show again + if (this.isShown) { + return; + } + raiseCallback(this.options.beforeShow); + $(':input').each(function () { + $(this).attr('tabindex', -1); + }); + var self = this; + // Initialize + this.input.blur(); + this.popover.addClass('picker--opened'); + this.input.addClass('picker__input picker__input--active'); + $(document.body).css('overflow', 'hidden'); + // Get the time + var value = ((this.input.prop('value') || this.options['default'] || '') + '').split(':'); + if (this.options.twelvehour && !(typeof value[1] === 'undefined')) { + if (value[1].indexOf("AM") > 0) { + this.amOrPm = 'AM'; + } else { + this.amOrPm = 'PM'; + } + value[1] = value[1].replace("AM", "").replace("PM", ""); + } + if (value[0] === 'now') { + var now = new Date(+new Date() + this.options.fromnow); + value = [now.getHours(), now.getMinutes()]; + if (this.options.twelvehour) { + this.amOrPm = value[0] >= 12 && value[0] < 24 ? 'PM' : 'AM'; + } + } + this.hours = +value[0] || 0; + this.minutes = +value[1] || 0; + this.spanHours.html(this.hours); + this.spanMinutes.html(leadingZero(this.minutes)); + if (!this.isAppended) { + + // Append popover to input by default + var containerEl = document.querySelector(this.options.container); + if (this.options.container && containerEl) { + containerEl.appendChild(this.popover[0]); + } else { + this.popover.insertAfter(this.input); + } + + if (this.options.twelvehour) { + if (this.amOrPm === 'PM') { + this.spanAmPm.children('#click-pm').addClass("text-primary"); + this.spanAmPm.children('#click-am').removeClass("text-primary"); + } else { + this.spanAmPm.children('#click-am').addClass("text-primary"); + this.spanAmPm.children('#click-pm').removeClass("text-primary"); + } + } + // Reset position when resize + $win.on('resize.clockpicker' + this.id, function () { + if (self.isShown) { + self.locate(); + } + }); + this.isAppended = true; + } + // Toggle to hours view + this.toggleView('hours'); + // Set position + this.locate(); + this.isShown = true; + // Hide when clicking or tabbing on any element except the clock and input + $doc.on('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id, function (e) { + var target = $(e.target); + if (target.closest(self.popover.find('.picker__wrap')).length === 0 && target.closest(self.input).length === 0) { + self.hide(); + } + }); + // Hide when ESC is pressed + $doc.on('keyup.clockpicker.' + this.id, function (e) { + if (e.keyCode === 27) { + self.hide(); + } + }); + raiseCallback(this.options.afterShow); + }; + // Hide popover + ClockPicker.prototype.hide = function () { + raiseCallback(this.options.beforeHide); + this.input.removeClass('picker__input picker__input--active'); + this.popover.removeClass('picker--opened'); + $(document.body).css('overflow', 'visible'); + this.isShown = false; + $(':input').each(function (index) { + $(this).attr('tabindex', index + 1); + }); + // Unbinding events on document + $doc.off('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id); + $doc.off('keyup.clockpicker.' + this.id); + this.popover.hide(); + raiseCallback(this.options.afterHide); + }; + // Toggle to hours or minutes view + ClockPicker.prototype.toggleView = function (view, delay) { + var raiseAfterHourSelect = false; + if (view === 'minutes' && $(this.hoursView).css("visibility") === "visible") { + raiseCallback(this.options.beforeHourSelect); + raiseAfterHourSelect = true; + } + var isHours = view === 'hours', + nextView = isHours ? this.hoursView : this.minutesView, + hideView = isHours ? this.minutesView : this.hoursView; + this.currentView = view; + + this.spanHours.toggleClass('text-primary', isHours); + this.spanMinutes.toggleClass('text-primary', !isHours); + + // Let's make transitions + hideView.addClass('clockpicker-dial-out'); + nextView.css('visibility', 'visible').removeClass('clockpicker-dial-out'); + + // Reset clock hand + this.resetClock(delay); + + // After transitions ended + clearTimeout(this.toggleViewTimer); + this.toggleViewTimer = setTimeout(function () { + hideView.css('visibility', 'hidden'); + }, duration); + + if (raiseAfterHourSelect) { + raiseCallback(this.options.afterHourSelect); + } + }; + + // Reset clock hand + ClockPicker.prototype.resetClock = function (delay) { + var view = this.currentView, + value = this[view], + isHours = view === 'hours', + unit = Math.PI / (isHours ? 6 : 30), + radian = value * unit, + radius = isHours && value > 0 && value < 13 ? innerRadius : outerRadius, + x = Math.sin(radian) * radius, + y = -Math.cos(radian) * radius, + self = this; + + if (svgSupported && delay) { + self.canvas.addClass('clockpicker-canvas-out'); + setTimeout(function () { + self.canvas.removeClass('clockpicker-canvas-out'); + self.setHand(x, y); + }, delay); + } else this.setHand(x, y); + }; + + // Set clock hand to (x, y) + ClockPicker.prototype.setHand = function (x, y, roundBy5, dragging) { + var radian = Math.atan2(x, -y), + isHours = this.currentView === 'hours', + unit = Math.PI / (isHours || roundBy5 ? 6 : 30), + z = Math.sqrt(x * x + y * y), + options = this.options, + inner = isHours && z < (outerRadius + innerRadius) / 2, + radius = inner ? innerRadius : outerRadius, + value; + + if (options.twelvehour) { + radius = outerRadius; + } + + // Radian should in range [0, 2PI] + if (radian < 0) { + radian = Math.PI * 2 + radian; + } + + // Get the round value + value = Math.round(radian / unit); + + // Get the round radian + radian = value * unit; + + // Correct the hours or minutes + if (options.twelvehour) { + if (isHours) { + if (value === 0) value = 12; + } else { + if (roundBy5) value *= 5; + if (value === 60) value = 0; + } + } else { + if (isHours) { + if (value === 12) value = 0; + value = inner ? value === 0 ? 12 : value : value === 0 ? 0 : value + 12; + } else { + if (roundBy5) value *= 5; + if (value === 60) value = 0; + } + } + + // Once hours or minutes changed, vibrate the device + if (this[this.currentView] !== value) { + if (vibrate && this.options.vibrate) { + // Do not vibrate too frequently + if (!this.vibrateTimer) { + navigator[vibrate](10); + this.vibrateTimer = setTimeout($.proxy(function () { + this.vibrateTimer = null; + }, this), 100); + } + } + } + + this[this.currentView] = value; + if (isHours) { + this['spanHours'].html(value); + } else { + this['spanMinutes'].html(leadingZero(value)); + } + + // If svg is not supported, just add an active class to the tick + if (!svgSupported) { + this[isHours ? 'hoursView' : 'minutesView'].find('.clockpicker-tick').each(function () { + var tick = $(this); + tick.toggleClass('active', value === +tick.html()); + }); + return; + } + + // Set clock hand and others' position + var cx1 = Math.sin(radian) * (radius - tickRadius), + cy1 = -Math.cos(radian) * (radius - tickRadius), + cx2 = Math.sin(radian) * radius, + cy2 = -Math.cos(radian) * radius; + this.hand.setAttribute('x2', cx1); + this.hand.setAttribute('y2', cy1); + this.bg.setAttribute('cx', cx2); + this.bg.setAttribute('cy', cy2); + }; + + // Hours and minutes are selected + ClockPicker.prototype.done = function () { + raiseCallback(this.options.beforeDone); + this.hide(); + this.label.addClass('active'); + + var last = this.input.prop('value'), + value = leadingZero(this.hours) + ':' + leadingZero(this.minutes); + if (this.options.twelvehour) { + value = value + this.amOrPm; + } + + this.input.prop('value', value); + if (value !== last) { + this.input.triggerHandler('change'); + if (!this.isInput) { + this.element.trigger('change'); + } + } + + if (this.options.autoclose) this.input.trigger('blur'); + + raiseCallback(this.options.afterDone); + }; + + // Clear input field + ClockPicker.prototype.clear = function () { + this.hide(); + this.label.removeClass('active'); + + var last = this.input.prop('value'), + value = ''; + + this.input.prop('value', value); + if (value !== last) { + this.input.triggerHandler('change'); + if (!this.isInput) { + this.element.trigger('change'); + } + } + + if (this.options.autoclose) { + this.input.trigger('blur'); + } + }; + + // Remove clockpicker from input + ClockPicker.prototype.remove = function () { + this.element.removeData('clockpicker'); + this.input.off('focus.clockpicker click.clockpicker'); + if (this.isShown) { + this.hide(); + } + if (this.isAppended) { + $win.off('resize.clockpicker' + this.id); + this.popover.remove(); + } + }; + + // Extends $.fn.clockpicker + $.fn.pickatime = function (option) { + var args = Array.prototype.slice.call(arguments, 1); + return this.each(function () { + var $this = $(this), + data = $this.data('clockpicker'); + if (!data) { + var options = $.extend({}, ClockPicker.DEFAULTS, $this.data(), typeof option == 'object' && option); + $this.data('clockpicker', new ClockPicker($this, options)); + } else { + // Manual operatsions. show, hide, remove, e.g. + if (typeof data[option] === 'function') { + data[option].apply(data, args); + } + } + }); + }; +})(jQuery); +;(function ($) { + + $.fn.characterCounter = function () { + return this.each(function () { + var $input = $(this); + var $counterElement = $input.parent().find('span[class="character-counter"]'); + + // character counter has already been added appended to the parent container + if ($counterElement.length) { + return; + } + + var itHasLengthAttribute = $input.attr('data-length') !== undefined; + + if (itHasLengthAttribute) { + $input.on('input', updateCounter); + $input.on('focus', updateCounter); + $input.on('blur', removeCounterElement); + + addCounterElement($input); + } + }); + }; + + function updateCounter() { + var maxLength = +$(this).attr('data-length'), + actualLength = +$(this).val().length, + isValidLength = actualLength <= maxLength; + + $(this).parent().find('span[class="character-counter"]').html(actualLength + '/' + maxLength); + + addInputStyle(isValidLength, $(this)); + } + + function addCounterElement($input) { + var $counterElement = $input.parent().find('span[class="character-counter"]'); + + if ($counterElement.length) { + return; + } + + $counterElement = $('<span/>').addClass('character-counter').css('float', 'right').css('font-size', '12px').css('height', 1); + + $input.parent().append($counterElement); + } + + function removeCounterElement() { + $(this).parent().find('span[class="character-counter"]').html(''); + } + + function addInputStyle(isValidLength, $input) { + var inputHasInvalidClass = $input.hasClass('invalid'); + if (isValidLength && inputHasInvalidClass) { + $input.removeClass('invalid'); + } else if (!isValidLength && !inputHasInvalidClass) { + $input.removeClass('valid'); + $input.addClass('invalid'); + } + } + + $(document).ready(function () { + $('input, textarea').characterCounter(); + }); +})(jQuery); +;(function ($) { + + var methods = { + + init: function (options) { + var defaults = { + duration: 200, // ms + dist: -100, // zoom scale TODO: make this more intuitive as an option + shift: 0, // spacing for center image + padding: 0, // Padding between non center items + fullWidth: false, // Change to full width styles + indicators: false, // Toggle indicators + noWrap: false, // Don't wrap around and cycle through items. + onCycleTo: null // Callback for when a new slide is cycled to. + }; + options = $.extend(defaults, options); + var namespace = Materialize.objectSelectorString($(this)); + + return this.each(function (i) { + + var images, item_width, item_height, offset, center, pressed, dim, count, reference, referenceY, amplitude, target, velocity, scrolling, xform, frame, timestamp, ticker, dragged, vertical_dragged; + var $indicators = $('<ul class="indicators"></ul>'); + var scrollingTimeout = null; + var oneTimeCallback = null; + + // Initialize + var view = $(this); + var hasMultipleSlides = view.find('.carousel-item').length > 1; + var showIndicators = (view.attr('data-indicators') || options.indicators) && hasMultipleSlides; + var noWrap = view.attr('data-no-wrap') || options.noWrap || !hasMultipleSlides; + var uniqueNamespace = view.attr('data-namespace') || namespace + i; + view.attr('data-namespace', uniqueNamespace); + + // Options + var setCarouselHeight = function (imageOnly) { + var firstSlide = view.find('.carousel-item.active').length ? view.find('.carousel-item.active').first() : view.find('.carousel-item').first(); + var firstImage = firstSlide.find('img').first(); + if (firstImage.length) { + if (firstImage[0].complete) { + // If image won't trigger the load event + var imageHeight = firstImage.height(); + if (imageHeight > 0) { + view.css('height', firstImage.height()); + } else { + // If image still has no height, use the natural dimensions to calculate + var naturalWidth = firstImage[0].naturalWidth; + var naturalHeight = firstImage[0].naturalHeight; + var adjustedHeight = view.width() / naturalWidth * naturalHeight; + view.css('height', adjustedHeight); + } + } else { + // Get height when image is loaded normally + firstImage.on('load', function () { + view.css('height', $(this).height()); + }); + } + } else if (!imageOnly) { + var slideHeight = firstSlide.height(); + view.css('height', slideHeight); + } + }; + + if (options.fullWidth) { + options.dist = 0; + setCarouselHeight(); + + // Offset fixed items when indicators. + if (showIndicators) { + view.find('.carousel-fixed-item').addClass('with-indicators'); + } + } + + // Don't double initialize. + if (view.hasClass('initialized')) { + // Recalculate variables + $(window).trigger('resize'); + + // Redraw carousel. + view.trigger('carouselNext', [0.000001]); + return true; + } + + view.addClass('initialized'); + pressed = false; + offset = target = 0; + images = []; + item_width = view.find('.carousel-item').first().innerWidth(); + item_height = view.find('.carousel-item').first().innerHeight(); + dim = item_width * 2 + options.padding; + + view.find('.carousel-item').each(function (i) { + images.push($(this)[0]); + if (showIndicators) { + var $indicator = $('<li class="indicator-item"></li>'); + + // Add active to first by default. + if (i === 0) { + $indicator.addClass('active'); + } + + // Handle clicks on indicators. + $indicator.click(function (e) { + e.stopPropagation(); + + var index = $(this).index(); + cycleTo(index); + }); + $indicators.append($indicator); + } + }); + + if (showIndicators) { + view.append($indicators); + } + count = images.length; + + function setupEvents() { + if (typeof window.ontouchstart !== 'undefined') { + view.on('touchstart.carousel', tap); + view.on('touchmove.carousel', drag); + view.on('touchend.carousel', release); + } + view.on('mousedown.carousel', tap); + view.on('mousemove.carousel', drag); + view.on('mouseup.carousel', release); + view.on('mouseleave.carousel', release); + view.on('click.carousel', click); + } + + function xpos(e) { + // touch event + if (e.targetTouches && e.targetTouches.length >= 1) { + return e.targetTouches[0].clientX; + } + + // mouse event + return e.clientX; + } + + function ypos(e) { + // touch event + if (e.targetTouches && e.targetTouches.length >= 1) { + return e.targetTouches[0].clientY; + } + + // mouse event + return e.clientY; + } + + function wrap(x) { + return x >= count ? x % count : x < 0 ? wrap(count + x % count) : x; + } + + function scroll(x) { + // Track scrolling state + scrolling = true; + if (!view.hasClass('scrolling')) { + view.addClass('scrolling'); + } + if (scrollingTimeout != null) { + window.clearTimeout(scrollingTimeout); + } + scrollingTimeout = window.setTimeout(function () { + scrolling = false; + view.removeClass('scrolling'); + }, options.duration); + + // Start actual scroll + var i, half, delta, dir, tween, el, alignment, xTranslation; + var lastCenter = center; + + offset = typeof x === 'number' ? x : offset; + center = Math.floor((offset + dim / 2) / dim); + delta = offset - center * dim; + dir = delta < 0 ? 1 : -1; + tween = -dir * delta * 2 / dim; + half = count >> 1; + + if (!options.fullWidth) { + alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) '; + alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)'; + } else { + alignment = 'translateX(0)'; + } + + // Set indicator active + if (showIndicators) { + var diff = center % count; + var activeIndicator = $indicators.find('.indicator-item.active'); + if (activeIndicator.index() !== diff) { + activeIndicator.removeClass('active'); + $indicators.find('.indicator-item').eq(diff).addClass('active'); + } + } + + // center + // Don't show wrapped items. + if (!noWrap || center >= 0 && center < count) { + el = images[wrap(center)]; + + // Add active class to center item. + if (!$(el).hasClass('active')) { + view.find('.carousel-item').removeClass('active'); + $(el).addClass('active'); + } + el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween * i + 'px)' + ' translateZ(' + options.dist * tween + 'px)'; + el.style.zIndex = 0; + if (options.fullWidth) { + tweenedOpacity = 1; + } else { + tweenedOpacity = 1 - 0.2 * tween; + } + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + + for (i = 1; i <= half; ++i) { + // right side + if (options.fullWidth) { + zTranslation = options.dist; + tweenedOpacity = i === half && delta < 0 ? 1 - tween : 1; + } else { + zTranslation = options.dist * (i * 2 + tween * dir); + tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir); + } + // Don't show wrapped items. + if (!noWrap || center + i < count) { + el = images[wrap(center + i)]; + el.style[xform] = alignment + ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)'; + el.style.zIndex = -i; + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + + // left side + if (options.fullWidth) { + zTranslation = options.dist; + tweenedOpacity = i === half && delta > 0 ? 1 - tween : 1; + } else { + zTranslation = options.dist * (i * 2 - tween * dir); + tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir); + } + // Don't show wrapped items. + if (!noWrap || center - i >= 0) { + el = images[wrap(center - i)]; + el.style[xform] = alignment + ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' + ' translateZ(' + zTranslation + 'px)'; + el.style.zIndex = -i; + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + } + + // center + // Don't show wrapped items. + if (!noWrap || center >= 0 && center < count) { + el = images[wrap(center)]; + el.style[xform] = alignment + ' translateX(' + -delta / 2 + 'px)' + ' translateX(' + dir * options.shift * tween + 'px)' + ' translateZ(' + options.dist * tween + 'px)'; + el.style.zIndex = 0; + if (options.fullWidth) { + tweenedOpacity = 1; + } else { + tweenedOpacity = 1 - 0.2 * tween; + } + el.style.opacity = tweenedOpacity; + el.style.display = 'block'; + } + + // onCycleTo callback + if (lastCenter !== center && typeof options.onCycleTo === "function") { + var $curr_item = view.find('.carousel-item').eq(wrap(center)); + options.onCycleTo.call(this, $curr_item, dragged); + } + + // One time callback + if (typeof oneTimeCallback === "function") { + oneTimeCallback.call(this, $curr_item, dragged); + oneTimeCallback = null; + } + } + + function track() { + var now, elapsed, delta, v; + + now = Date.now(); + elapsed = now - timestamp; + timestamp = now; + delta = offset - frame; + frame = offset; + + v = 1000 * delta / (1 + elapsed); + velocity = 0.8 * v + 0.2 * velocity; + } + + function autoScroll() { + var elapsed, delta; + + if (amplitude) { + elapsed = Date.now() - timestamp; + delta = amplitude * Math.exp(-elapsed / options.duration); + if (delta > 2 || delta < -2) { + scroll(target - delta); + requestAnimationFrame(autoScroll); + } else { + scroll(target); + } + } + } + + function click(e) { + // Disable clicks if carousel was dragged. + if (dragged) { + e.preventDefault(); + e.stopPropagation(); + return false; + } else if (!options.fullWidth) { + var clickedIndex = $(e.target).closest('.carousel-item').index(); + var diff = wrap(center) - clickedIndex; + + // Disable clicks if carousel was shifted by click + if (diff !== 0) { + e.preventDefault(); + e.stopPropagation(); + } + cycleTo(clickedIndex); + } + } + + function cycleTo(n) { + var diff = center % count - n; + + // Account for wraparound. + if (!noWrap) { + if (diff < 0) { + if (Math.abs(diff + count) < Math.abs(diff)) { + diff += count; + } + } else if (diff > 0) { + if (Math.abs(diff - count) < diff) { + diff -= count; + } + } + } + + // Call prev or next accordingly. + if (diff < 0) { + view.trigger('carouselNext', [Math.abs(diff)]); + } else if (diff > 0) { + view.trigger('carouselPrev', [diff]); + } + } + + function tap(e) { + // Fixes firefox draggable image bug + if (e.type === 'mousedown' && $(e.target).is('img')) { + e.preventDefault(); + } + pressed = true; + dragged = false; + vertical_dragged = false; + reference = xpos(e); + referenceY = ypos(e); + + velocity = amplitude = 0; + frame = offset; + timestamp = Date.now(); + clearInterval(ticker); + ticker = setInterval(track, 100); + } + + function drag(e) { + var x, delta, deltaY; + if (pressed) { + x = xpos(e); + y = ypos(e); + delta = reference - x; + deltaY = Math.abs(referenceY - y); + if (deltaY < 30 && !vertical_dragged) { + // If vertical scrolling don't allow dragging. + if (delta > 2 || delta < -2) { + dragged = true; + reference = x; + scroll(offset + delta); + } + } else if (dragged) { + // If dragging don't allow vertical scroll. + e.preventDefault(); + e.stopPropagation(); + return false; + } else { + // Vertical scrolling. + vertical_dragged = true; + } + } + + if (dragged) { + // If dragging don't allow vertical scroll. + e.preventDefault(); + e.stopPropagation(); + return false; + } + } + + function release(e) { + if (pressed) { + pressed = false; + } else { + return; + } + + clearInterval(ticker); + target = offset; + if (velocity > 10 || velocity < -10) { + amplitude = 0.9 * velocity; + target = offset + amplitude; + } + target = Math.round(target / dim) * dim; + + // No wrap of items. + if (noWrap) { + if (target >= dim * (count - 1)) { + target = dim * (count - 1); + } else if (target < 0) { + target = 0; + } + } + amplitude = target - offset; + timestamp = Date.now(); + requestAnimationFrame(autoScroll); + + if (dragged) { + e.preventDefault(); + e.stopPropagation(); + } + return false; + } + + xform = 'transform'; + ['webkit', 'Moz', 'O', 'ms'].every(function (prefix) { + var e = prefix + 'Transform'; + if (typeof document.body.style[e] !== 'undefined') { + xform = e; + return false; + } + return true; + }); + + var throttledResize = Materialize.throttle(function () { + if (options.fullWidth) { + item_width = view.find('.carousel-item').first().innerWidth(); + var imageHeight = view.find('.carousel-item.active').height(); + dim = item_width * 2 + options.padding; + offset = center * 2 * item_width; + target = offset; + setCarouselHeight(true); + } else { + scroll(); + } + }, 200); + $(window).off('resize.carousel-' + uniqueNamespace).on('resize.carousel-' + uniqueNamespace, throttledResize); + + setupEvents(); + scroll(offset); + + $(this).on('carouselNext', function (e, n, callback) { + if (n === undefined) { + n = 1; + } + if (typeof callback === "function") { + oneTimeCallback = callback; + } + + target = dim * Math.round(offset / dim) + dim * n; + if (offset !== target) { + amplitude = target - offset; + timestamp = Date.now(); + requestAnimationFrame(autoScroll); + } + }); + + $(this).on('carouselPrev', function (e, n, callback) { + if (n === undefined) { + n = 1; + } + if (typeof callback === "function") { + oneTimeCallback = callback; + } + + target = dim * Math.round(offset / dim) - dim * n; + if (offset !== target) { + amplitude = target - offset; + timestamp = Date.now(); + requestAnimationFrame(autoScroll); + } + }); + + $(this).on('carouselSet', function (e, n, callback) { + if (n === undefined) { + n = 0; + } + if (typeof callback === "function") { + oneTimeCallback = callback; + } + + cycleTo(n); + }); + }); + }, + next: function (n, callback) { + $(this).trigger('carouselNext', [n, callback]); + }, + prev: function (n, callback) { + $(this).trigger('carouselPrev', [n, callback]); + }, + set: function (n, callback) { + $(this).trigger('carouselSet', [n, callback]); + }, + destroy: function () { + var uniqueNamespace = $(this).attr('data-namespace'); + $(this).removeAttr('data-namespace'); + $(this).removeClass('initialized'); + $(this).find('.indicators').remove(); + + // Remove event handlers + $(this).off('carouselNext carouselPrev carouselSet'); + $(window).off('resize.carousel-' + uniqueNamespace); + if (typeof window.ontouchstart !== 'undefined') { + $(this).off('touchstart.carousel touchmove.carousel touchend.carousel'); + } + $(this).off('mousedown.carousel mousemove.carousel mouseup.carousel mouseleave.carousel click.carousel'); + } + }; + + $.fn.carousel = function (methodOrOptions) { + if (methods[methodOrOptions]) { + return methods[methodOrOptions].apply(this, Array.prototype.slice.call(arguments, 1)); + } else if (typeof methodOrOptions === 'object' || !methodOrOptions) { + // Default to "init" + return methods.init.apply(this, arguments); + } else { + $.error('Method ' + methodOrOptions + ' does not exist on jQuery.carousel'); + } + }; // Plugin end +})(jQuery); +;(function ($) { + + var methods = { + init: function (options) { + return this.each(function () { + var origin = $('#' + $(this).attr('data-activates')); + var screen = $('body'); + + // Creating tap target + var tapTargetEl = $(this); + var tapTargetWrapper = tapTargetEl.parent('.tap-target-wrapper'); + var tapTargetWave = tapTargetWrapper.find('.tap-target-wave'); + var tapTargetOriginEl = tapTargetWrapper.find('.tap-target-origin'); + var tapTargetContentEl = tapTargetEl.find('.tap-target-content'); + + // Creating wrapper + if (!tapTargetWrapper.length) { + tapTargetWrapper = tapTargetEl.wrap($('<div class="tap-target-wrapper"></div>')).parent(); + } + + // Creating content + if (!tapTargetContentEl.length) { + tapTargetContentEl = $('<div class="tap-target-content"></div>'); + tapTargetEl.append(tapTargetContentEl); + } + + // Creating foreground wave + if (!tapTargetWave.length) { + tapTargetWave = $('<div class="tap-target-wave"></div>'); + + // Creating origin + if (!tapTargetOriginEl.length) { + tapTargetOriginEl = origin.clone(true, true); + tapTargetOriginEl.addClass('tap-target-origin'); + tapTargetOriginEl.removeAttr('id'); + tapTargetOriginEl.removeAttr('style'); + tapTargetWave.append(tapTargetOriginEl); + } + + tapTargetWrapper.append(tapTargetWave); + } + + // Open + var openTapTarget = function () { + if (tapTargetWrapper.is('.open')) { + return; + } + + // Adding open class + tapTargetWrapper.addClass('open'); + + setTimeout(function () { + tapTargetOriginEl.off('click.tapTarget').on('click.tapTarget', function (e) { + closeTapTarget(); + tapTargetOriginEl.off('click.tapTarget'); + }); + + $(document).off('click.tapTarget').on('click.tapTarget', function (e) { + closeTapTarget(); + $(document).off('click.tapTarget'); + }); + + var throttledCalc = Materialize.throttle(function () { + calculateTapTarget(); + }, 200); + $(window).off('resize.tapTarget').on('resize.tapTarget', throttledCalc); + }, 0); + }; + + // Close + var closeTapTarget = function () { + if (!tapTargetWrapper.is('.open')) { + return; + } + + tapTargetWrapper.removeClass('open'); + tapTargetOriginEl.off('click.tapTarget'); + $(document).off('click.tapTarget'); + $(window).off('resize.tapTarget'); + }; + + // Pre calculate + var calculateTapTarget = function () { + // Element or parent is fixed position? + var isFixed = origin.css('position') === 'fixed'; + if (!isFixed) { + var parents = origin.parents(); + for (var i = 0; i < parents.length; i++) { + isFixed = $(parents[i]).css('position') == 'fixed'; + if (isFixed) { + break; + } + } + } + + // Calculating origin + var originWidth = origin.outerWidth(); + var originHeight = origin.outerHeight(); + var originTop = isFixed ? origin.offset().top - $(document).scrollTop() : origin.offset().top; + var originLeft = isFixed ? origin.offset().left - $(document).scrollLeft() : origin.offset().left; + + // Calculating screen + var windowWidth = $(window).width(); + var windowHeight = $(window).height(); + var centerX = windowWidth / 2; + var centerY = windowHeight / 2; + var isLeft = originLeft <= centerX; + var isRight = originLeft > centerX; + var isTop = originTop <= centerY; + var isBottom = originTop > centerY; + var isCenterX = originLeft >= windowWidth * 0.25 && originLeft <= windowWidth * 0.75; + var isCenterY = originTop >= windowHeight * 0.25 && originTop <= windowHeight * 0.75; + + // Calculating tap target + var tapTargetWidth = tapTargetEl.outerWidth(); + var tapTargetHeight = tapTargetEl.outerHeight(); + var tapTargetTop = originTop + originHeight / 2 - tapTargetHeight / 2; + var tapTargetLeft = originLeft + originWidth / 2 - tapTargetWidth / 2; + var tapTargetPosition = isFixed ? 'fixed' : 'absolute'; + + // Calculating content + var tapTargetTextWidth = isCenterX ? tapTargetWidth : tapTargetWidth / 2 + originWidth; + var tapTargetTextHeight = tapTargetHeight / 2; + var tapTargetTextTop = isTop ? tapTargetHeight / 2 : 0; + var tapTargetTextBottom = 0; + var tapTargetTextLeft = isLeft && !isCenterX ? tapTargetWidth / 2 - originWidth : 0; + var tapTargetTextRight = 0; + var tapTargetTextPadding = originWidth; + var tapTargetTextAlign = isBottom ? 'bottom' : 'top'; + + // Calculating wave + var tapTargetWaveWidth = originWidth > originHeight ? originWidth * 2 : originWidth * 2; + var tapTargetWaveHeight = tapTargetWaveWidth; + var tapTargetWaveTop = tapTargetHeight / 2 - tapTargetWaveHeight / 2; + var tapTargetWaveLeft = tapTargetWidth / 2 - tapTargetWaveWidth / 2; + + // Setting tap target + var tapTargetWrapperCssObj = {}; + tapTargetWrapperCssObj.top = isTop ? tapTargetTop : ''; + tapTargetWrapperCssObj.right = isRight ? windowWidth - tapTargetLeft - tapTargetWidth : ''; + tapTargetWrapperCssObj.bottom = isBottom ? windowHeight - tapTargetTop - tapTargetHeight : ''; + tapTargetWrapperCssObj.left = isLeft ? tapTargetLeft : ''; + tapTargetWrapperCssObj.position = tapTargetPosition; + tapTargetWrapper.css(tapTargetWrapperCssObj); + + // Setting content + tapTargetContentEl.css({ + width: tapTargetTextWidth, + height: tapTargetTextHeight, + top: tapTargetTextTop, + right: tapTargetTextRight, + bottom: tapTargetTextBottom, + left: tapTargetTextLeft, + padding: tapTargetTextPadding, + verticalAlign: tapTargetTextAlign + }); + + // Setting wave + tapTargetWave.css({ + top: tapTargetWaveTop, + left: tapTargetWaveLeft, + width: tapTargetWaveWidth, + height: tapTargetWaveHeight + }); + }; + + if (options == 'open') { + calculateTapTarget(); + openTapTarget(); + } + + if (options == 'close') closeTapTarget(); + }); + }, + open: function () {}, + close: function () {} + }; + + $.fn.tapTarget = function (methodOrOptions) { + if (methods[methodOrOptions] || typeof methodOrOptions === 'object') return methods.init.apply(this, arguments); + + $.error('Method ' + methodOrOptions + ' does not exist on jQuery.tap-target'); + }; +})(jQuery); diff --git a/app/dispatch/static/materialize/js/bin/materialize.min.js b/app/dispatch/static/materialize/js/bin/materialize.min.js new file mode 100644 index 0000000..c1a6d7e --- /dev/null +++ b/app/dispatch/static/materialize/js/bin/materialize.min.js @@ -0,0 +1,6 @@ +/*!
+ * Materialize v0.100.2 (http://materializecss.com)
+ * Copyright 2014-2017 Materialize
+ * MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
+ */
+function _classCallCheck(t,e){if(!(t instanceof e))throw new TypeError("Cannot call a class as a function")}var _createClass=function(){function t(t,e){for(var i=0;i<e.length;i++){var n=e[i];n.enumerable=n.enumerable||!1,n.configurable=!0,"value"in n&&(n.writable=!0),Object.defineProperty(t,n.key,n)}}return function(e,i,n){return i&&t(e.prototype,i),n&&t(e,n),e}}();"undefined"==typeof jQuery&&("function"==typeof require?jQuery=$=require("jquery"):jQuery=$),function(t){"function"==typeof define&&define.amd?define(["jquery"],function(e){return t(e)}):"object"==typeof module&&"object"==typeof module.exports?exports=t(require("jquery")):t(jQuery)}(function(t){function e(t){var e=7.5625,i=2.75;return t<1/i?e*t*t:t<2/i?e*(t-=1.5/i)*t+.75:t<2.5/i?e*(t-=2.25/i)*t+.9375:e*(t-=2.625/i)*t+.984375}t.easing.jswing=t.easing.swing;var i=Math.pow,n=Math.sqrt,o=Math.sin,a=Math.cos,r=Math.PI,s=1.70158,l=1.525*s,c=2*r/3,u=2*r/4.5;t.extend(t.easing,{def:"easeOutQuad",swing:function(e){return t.easing[t.easing.def](e)},easeInQuad:function(t){return t*t},easeOutQuad:function(t){return 1-(1-t)*(1-t)},easeInOutQuad:function(t){return t<.5?2*t*t:1-i(-2*t+2,2)/2},easeInCubic:function(t){return t*t*t},easeOutCubic:function(t){return 1-i(1-t,3)},easeInOutCubic:function(t){return t<.5?4*t*t*t:1-i(-2*t+2,3)/2},easeInQuart:function(t){return t*t*t*t},easeOutQuart:function(t){return 1-i(1-t,4)},easeInOutQuart:function(t){return t<.5?8*t*t*t*t:1-i(-2*t+2,4)/2},easeInQuint:function(t){return t*t*t*t*t},easeOutQuint:function(t){return 1-i(1-t,5)},easeInOutQuint:function(t){return t<.5?16*t*t*t*t*t:1-i(-2*t+2,5)/2},easeInSine:function(t){return 1-a(t*r/2)},easeOutSine:function(t){return o(t*r/2)},easeInOutSine:function(t){return-(a(r*t)-1)/2},easeInExpo:function(t){return 0===t?0:i(2,10*t-10)},easeOutExpo:function(t){return 1===t?1:1-i(2,-10*t)},easeInOutExpo:function(t){return 0===t?0:1===t?1:t<.5?i(2,20*t-10)/2:(2-i(2,-20*t+10))/2},easeInCirc:function(t){return 1-n(1-i(t,2))},easeOutCirc:function(t){return n(1-i(t-1,2))},easeInOutCirc:function(t){return t<.5?(1-n(1-i(2*t,2)))/2:(n(1-i(-2*t+2,2))+1)/2},easeInElastic:function(t){return 0===t?0:1===t?1:-i(2,10*t-10)*o((10*t-10.75)*c)},easeOutElastic:function(t){return 0===t?0:1===t?1:i(2,-10*t)*o((10*t-.75)*c)+1},easeInOutElastic:function(t){return 0===t?0:1===t?1:t<.5?-i(2,20*t-10)*o((20*t-11.125)*u)/2:i(2,-20*t+10)*o((20*t-11.125)*u)/2+1},easeInBack:function(t){return 2.70158*t*t*t-s*t*t},easeOutBack:function(t){return 1+2.70158*i(t-1,3)+s*i(t-1,2)},easeInOutBack:function(t){return t<.5?i(2*t,2)*(7.189819*t-l)/2:(i(2*t-2,2)*((l+1)*(2*t-2)+l)+2)/2},easeInBounce:function(t){return 1-e(1-t)},easeOutBounce:e,easeInOutBounce:function(t){return t<.5?(1-e(1-2*t))/2:(1+e(2*t-1))/2}})}),jQuery.extend(jQuery.easing,{easeInOutMaterial:function(t,e,i,n,o){return(e/=o/2)<1?n/2*e*e+i:n/4*((e-=2)*e*e+2)+i}}),jQuery.Velocity?console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity."):(function(t){function e(t){var e=t.length,n=i.type(t);return"function"!==n&&!i.isWindow(t)&&(!(1!==t.nodeType||!e)||("array"===n||0===e||"number"==typeof e&&e>0&&e-1 in t))}if(!t.jQuery){var i=function(t,e){return new i.fn.init(t,e)};i.isWindow=function(t){return null!=t&&t==t.window},i.type=function(t){return null==t?t+"":"object"==typeof t||"function"==typeof t?o[r.call(t)]||"object":typeof t},i.isArray=Array.isArray||function(t){return"array"===i.type(t)},i.isPlainObject=function(t){var e;if(!t||"object"!==i.type(t)||t.nodeType||i.isWindow(t))return!1;try{if(t.constructor&&!a.call(t,"constructor")&&!a.call(t.constructor.prototype,"isPrototypeOf"))return!1}catch(t){return!1}for(e in t);return void 0===e||a.call(t,e)},i.each=function(t,i,n){var o=0,a=t.length,r=e(t);if(n){if(r)for(;a>o&&!1!==i.apply(t[o],n);o++);else for(o in t)if(!1===i.apply(t[o],n))break}else if(r)for(;a>o&&!1!==i.call(t[o],o,t[o]);o++);else for(o in t)if(!1===i.call(t[o],o,t[o]))break;return t},i.data=function(t,e,o){if(void 0===o){var a=(r=t[i.expando])&&n[r];if(void 0===e)return a;if(a&&e in a)return a[e]}else if(void 0!==e){var r=t[i.expando]||(t[i.expando]=++i.uuid);return n[r]=n[r]||{},n[r][e]=o,o}},i.removeData=function(t,e){var o=t[i.expando],a=o&&n[o];a&&i.each(e,function(t,e){delete a[e]})},i.extend=function(){var t,e,n,o,a,r,s=arguments[0]||{},l=1,c=arguments.length,u=!1;for("boolean"==typeof s&&(u=s,s=arguments[l]||{},l++),"object"!=typeof s&&"function"!==i.type(s)&&(s={}),l===c&&(s=this,l--);c>l;l++)if(null!=(a=arguments[l]))for(o in a)t=s[o],s!==(n=a[o])&&(u&&n&&(i.isPlainObject(n)||(e=i.isArray(n)))?(e?(e=!1,r=t&&i.isArray(t)?t:[]):r=t&&i.isPlainObject(t)?t:{},s[o]=i.extend(u,r,n)):void 0!==n&&(s[o]=n));return s},i.queue=function(t,n,o){if(t){n=(n||"fx")+"queue";var a=i.data(t,n);return o?(!a||i.isArray(o)?a=i.data(t,n,function(t,i){var n=i||[];return null!=t&&(e(Object(t))?function(t,e){for(var i=+e.length,n=0,o=t.length;i>n;)t[o++]=e[n++];if(i!==i)for(;void 0!==e[n];)t[o++]=e[n++];t.length=o}(n,"string"==typeof t?[t]:t):[].push.call(n,t)),n}(o)):a.push(o),a):a||[]}},i.dequeue=function(t,e){i.each(t.nodeType?[t]:t,function(t,n){e=e||"fx";var o=i.queue(n,e),a=o.shift();"inprogress"===a&&(a=o.shift()),a&&("fx"===e&&o.unshift("inprogress"),a.call(n,function(){i.dequeue(n,e)}))})},i.fn=i.prototype={init:function(t){if(t.nodeType)return this[0]=t,this;throw new Error("Not a DOM node.")},offset:function(){var e=this[0].getBoundingClientRect?this[0].getBoundingClientRect():{top:0,left:0};return{top:e.top+(t.pageYOffset||document.scrollTop||0)-(document.clientTop||0),left:e.left+(t.pageXOffset||document.scrollLeft||0)-(document.clientLeft||0)}},position:function(){function t(){for(var t=this.offsetParent||document;t&&"html"===!t.nodeType.toLowerCase&&"static"===t.style.position;)t=t.offsetParent;return t||document}var e=this[0],t=t.apply(e),n=this.offset(),o=/^(?:body|html)$/i.test(t.nodeName)?{top:0,left:0}:i(t).offset();return n.top-=parseFloat(e.style.marginTop)||0,n.left-=parseFloat(e.style.marginLeft)||0,t.style&&(o.top+=parseFloat(t.style.borderTopWidth)||0,o.left+=parseFloat(t.style.borderLeftWidth)||0),{top:n.top-o.top,left:n.left-o.left}}};var n={};i.expando="velocity"+(new Date).getTime(),i.uuid=0;for(var o={},a=o.hasOwnProperty,r=o.toString,s="Boolean Number String Function Array Date RegExp Object Error".split(" "),l=0;l<s.length;l++)o["[object "+s[l]+"]"]=s[l].toLowerCase();i.fn.init.prototype=i.fn,t.Velocity={Utilities:i}}}(window),function(t){"object"==typeof module&&"object"==typeof module.exports?module.exports=t():"function"==typeof define&&define.amd?define(t):t()}(function(){return function(t,e,i,n){function o(t){for(var e=-1,i=t?t.length:0,n=[];++e<i;){var o=t[e];o&&n.push(o)}return n}function a(t){return v.isWrapped(t)?t=[].slice.call(t):v.isNode(t)&&(t=[t]),t}function r(t){var e=p.data(t,"velocity");return null===e?n:e}function s(t){return function(e){return Math.round(e*t)*(1/t)}}function l(t,i,n,o){function a(t,e){return 1-3*e+3*t}function r(t,e){return 3*e-6*t}function s(t){return 3*t}function l(t,e,i){return((a(e,i)*t+r(e,i))*t+s(e))*t}function c(t,e,i){return 3*a(e,i)*t*t+2*r(e,i)*t+s(e)}function u(e,i){for(var o=0;v>o;++o){var a=c(i,t,n);if(0===a)return i;i-=(l(i,t,n)-e)/a}return i}function d(){for(var e=0;b>e;++e)C[e]=l(e*w,t,n)}function p(e,i,o){var a,r,s=0;do{(a=l(r=i+(o-i)/2,t,n)-e)>0?o=r:i=r}while(Math.abs(a)>g&&++s<y);return r}function h(e){for(var i=0,o=1,a=b-1;o!=a&&C[o]<=e;++o)i+=w;var r=i+(e-C[--o])/(C[o+1]-C[o])*w,s=c(r,t,n);return s>=m?u(e,r):0==s?r:p(e,i,i+w)}function f(){T=!0,(t!=i||n!=o)&&d()}var v=4,m=.001,g=1e-7,y=10,b=11,w=1/(b-1),k="Float32Array"in e;if(4!==arguments.length)return!1;for(var x=0;4>x;++x)if("number"!=typeof arguments[x]||isNaN(arguments[x])||!isFinite(arguments[x]))return!1;t=Math.min(t,1),n=Math.min(n,1),t=Math.max(t,0),n=Math.max(n,0);var C=k?new Float32Array(b):new Array(b),T=!1,S=function(e){return T||f(),t===i&&n===o?e:0===e?0:1===e?1:l(h(e),i,o)};S.getControlPoints=function(){return[{x:t,y:i},{x:n,y:o}]};var P="generateBezier("+[t,i,n,o]+")";return S.toString=function(){return P},S}function c(t,e){var i=t;return v.isString(t)?b.Easings[t]||(i=!1):i=v.isArray(t)&&1===t.length?s.apply(null,t):v.isArray(t)&&2===t.length?w.apply(null,t.concat([e])):!(!v.isArray(t)||4!==t.length)&&l.apply(null,t),!1===i&&(i=b.Easings[b.defaults.easing]?b.defaults.easing:y),i}function u(t){if(t){var e=(new Date).getTime(),i=b.State.calls.length;i>1e4&&(b.State.calls=o(b.State.calls));for(var a=0;i>a;a++)if(b.State.calls[a]){var s=b.State.calls[a],l=s[0],c=s[2],h=s[3],f=!!h,m=null;h||(h=b.State.calls[a][3]=e-16);for(var g=Math.min((e-h)/c.duration,1),y=0,w=l.length;w>y;y++){var x=l[y],T=x.element;if(r(T)){var S=!1;if(c.display!==n&&null!==c.display&&"none"!==c.display){if("flex"===c.display){var P=["-webkit-box","-moz-box","-ms-flexbox","-webkit-flex"];p.each(P,function(t,e){k.setPropertyValue(T,"display",e)})}k.setPropertyValue(T,"display",c.display)}c.visibility!==n&&"hidden"!==c.visibility&&k.setPropertyValue(T,"visibility",c.visibility);for(var A in x)if("element"!==A){var O,E=x[A],_=v.isString(E.easing)?b.Easings[E.easing]:E.easing;if(1===g)O=E.endValue;else{var M=E.endValue-E.startValue;if(O=E.startValue+M*_(g,c,M),!f&&O===E.currentValue)continue}if(E.currentValue=O,"tween"===A)m=O;else{if(k.Hooks.registered[A]){var I=k.Hooks.getRoot(A),D=r(T).rootPropertyValueCache[I];D&&(E.rootPropertyValue=D)}var q=k.setPropertyValue(T,A,E.currentValue+(0===parseFloat(O)?"":E.unitType),E.rootPropertyValue,E.scrollData);k.Hooks.registered[A]&&(r(T).rootPropertyValueCache[I]=k.Normalizations.registered[I]?k.Normalizations.registered[I]("extract",null,q[1]):q[1]),"transform"===q[0]&&(S=!0)}}c.mobileHA&&r(T).transformCache.translate3d===n&&(r(T).transformCache.translate3d="(0px, 0px, 0px)",S=!0),S&&k.flushTransformCache(T)}}c.display!==n&&"none"!==c.display&&(b.State.calls[a][2].display=!1),c.visibility!==n&&"hidden"!==c.visibility&&(b.State.calls[a][2].visibility=!1),c.progress&&c.progress.call(s[1],s[1],g,Math.max(0,h+c.duration-e),h,m),1===g&&d(a)}}b.State.isTicking&&C(u)}function d(t,e){if(!b.State.calls[t])return!1;for(var i=b.State.calls[t][0],o=b.State.calls[t][1],a=b.State.calls[t][2],s=b.State.calls[t][4],l=!1,c=0,u=i.length;u>c;c++){var d=i[c].element;if(e||a.loop||("none"===a.display&&k.setPropertyValue(d,"display",a.display),"hidden"===a.visibility&&k.setPropertyValue(d,"visibility",a.visibility)),!0!==a.loop&&(p.queue(d)[1]===n||!/\.velocityQueueEntryFlag/i.test(p.queue(d)[1]))&&r(d)){r(d).isAnimating=!1,r(d).rootPropertyValueCache={};var h=!1;p.each(k.Lists.transforms3D,function(t,e){var i=/^scale/.test(e)?1:0,o=r(d).transformCache[e];r(d).transformCache[e]!==n&&new RegExp("^\\("+i+"[^.]").test(o)&&(h=!0,delete r(d).transformCache[e])}),a.mobileHA&&(h=!0,delete r(d).transformCache.translate3d),h&&k.flushTransformCache(d),k.Values.removeClass(d,"velocity-animating")}if(!e&&a.complete&&!a.loop&&c===u-1)try{a.complete.call(o,o)}catch(t){setTimeout(function(){throw t},1)}s&&!0!==a.loop&&s(o),r(d)&&!0===a.loop&&!e&&(p.each(r(d).tweensContainer,function(t,e){/^rotate/.test(t)&&360===parseFloat(e.endValue)&&(e.endValue=0,e.startValue=360),/^backgroundPosition/.test(t)&&100===parseFloat(e.endValue)&&"%"===e.unitType&&(e.endValue=0,e.startValue=100)}),b(d,"reverse",{loop:!0,delay:a.delay})),!1!==a.queue&&p.dequeue(d,a.queue)}b.State.calls[t]=!1;for(var f=0,v=b.State.calls.length;v>f;f++)if(!1!==b.State.calls[f]){l=!0;break}!1===l&&(b.State.isTicking=!1,delete b.State.calls,b.State.calls=[])}var p,h=function(){if(i.documentMode)return i.documentMode;for(var t=7;t>4;t--){var e=i.createElement("div");if(e.innerHTML="\x3c!--[if IE "+t+"]><span></span><![endif]--\x3e",e.getElementsByTagName("span").length)return e=null,t}return n}(),f=function(){var t=0;return e.webkitRequestAnimationFrame||e.mozRequestAnimationFrame||function(e){var i,n=(new Date).getTime();return i=Math.max(0,16-(n-t)),t=n+i,setTimeout(function(){e(n+i)},i)}}(),v={isString:function(t){return"string"==typeof t},isArray:Array.isArray||function(t){return"[object Array]"===Object.prototype.toString.call(t)},isFunction:function(t){return"[object Function]"===Object.prototype.toString.call(t)},isNode:function(t){return t&&t.nodeType},isNodeList:function(t){return"object"==typeof t&&/^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(t))&&t.length!==n&&(0===t.length||"object"==typeof t[0]&&t[0].nodeType>0)},isWrapped:function(t){return t&&(t.jquery||e.Zepto&&e.Zepto.zepto.isZ(t))},isSVG:function(t){return e.SVGElement&&t instanceof e.SVGElement},isEmptyObject:function(t){for(var e in t)return!1;return!0}},m=!1;if(t.fn&&t.fn.jquery?(p=t,m=!0):p=e.Velocity.Utilities,8>=h&&!m)throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");{if(!(7>=h)){var g=400,y="swing",b={State:{isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),isAndroid:/Android/i.test(navigator.userAgent),isGingerbread:/Android 2\.3\.[3-7]/i.test(navigator.userAgent),isChrome:e.chrome,isFirefox:/Firefox/i.test(navigator.userAgent),prefixElement:i.createElement("div"),prefixMatches:{},scrollAnchor:null,scrollPropertyLeft:null,scrollPropertyTop:null,isTicking:!1,calls:[]},CSS:{},Utilities:p,Redirects:{},Easings:{},Promise:e.Promise,defaults:{queue:"",duration:g,easing:y,begin:n,complete:n,progress:n,display:n,visibility:n,loop:!1,delay:!1,mobileHA:!0,_cacheValues:!0},init:function(t){p.data(t,"velocity",{isSVG:v.isSVG(t),isAnimating:!1,computedStyle:null,tweensContainer:null,rootPropertyValueCache:{},transformCache:{}})},hook:null,mock:!1,version:{major:1,minor:2,patch:2},debug:!1};e.pageYOffset!==n?(b.State.scrollAnchor=e,b.State.scrollPropertyLeft="pageXOffset",b.State.scrollPropertyTop="pageYOffset"):(b.State.scrollAnchor=i.documentElement||i.body.parentNode||i.body,b.State.scrollPropertyLeft="scrollLeft",b.State.scrollPropertyTop="scrollTop");var w=function(){function t(t){return-t.tension*t.x-t.friction*t.v}function e(e,i,n){var o={x:e.x+n.dx*i,v:e.v+n.dv*i,tension:e.tension,friction:e.friction};return{dx:o.v,dv:t(o)}}function i(i,n){var o={dx:i.v,dv:t(i)},a=e(i,.5*n,o),r=e(i,.5*n,a),s=e(i,n,r),l=1/6*(o.dx+2*(a.dx+r.dx)+s.dx),c=1/6*(o.dv+2*(a.dv+r.dv)+s.dv);return i.x=i.x+l*n,i.v=i.v+c*n,i}return function t(e,n,o){var a,r,s,l={x:-1,v:0,tension:null,friction:null},c=[0],u=0;for(e=parseFloat(e)||500,n=parseFloat(n)||20,o=o||null,l.tension=e,l.friction=n,(a=null!==o)?(u=t(e,n),r=u/o*.016):r=.016;s=i(s||l,r),c.push(1+s.x),u+=16,Math.abs(s.x)>1e-4&&Math.abs(s.v)>1e-4;);return a?function(t){return c[t*(c.length-1)|0]}:u}}();b.Easings={linear:function(t){return t},swing:function(t){return.5-Math.cos(t*Math.PI)/2},spring:function(t){return 1-Math.cos(4.5*t*Math.PI)*Math.exp(6*-t)}},p.each([["ease",[.25,.1,.25,1]],["ease-in",[.42,0,1,1]],["ease-out",[0,0,.58,1]],["ease-in-out",[.42,0,.58,1]],["easeInSine",[.47,0,.745,.715]],["easeOutSine",[.39,.575,.565,1]],["easeInOutSine",[.445,.05,.55,.95]],["easeInQuad",[.55,.085,.68,.53]],["easeOutQuad",[.25,.46,.45,.94]],["easeInOutQuad",[.455,.03,.515,.955]],["easeInCubic",[.55,.055,.675,.19]],["easeOutCubic",[.215,.61,.355,1]],["easeInOutCubic",[.645,.045,.355,1]],["easeInQuart",[.895,.03,.685,.22]],["easeOutQuart",[.165,.84,.44,1]],["easeInOutQuart",[.77,0,.175,1]],["easeInQuint",[.755,.05,.855,.06]],["easeOutQuint",[.23,1,.32,1]],["easeInOutQuint",[.86,0,.07,1]],["easeInExpo",[.95,.05,.795,.035]],["easeOutExpo",[.19,1,.22,1]],["easeInOutExpo",[1,0,0,1]],["easeInCirc",[.6,.04,.98,.335]],["easeOutCirc",[.075,.82,.165,1]],["easeInOutCirc",[.785,.135,.15,.86]]],function(t,e){b.Easings[e[0]]=l.apply(null,e[1])});var k=b.CSS={RegEx:{isHex:/^#([A-f\d]{3}){1,2}$/i,valueUnwrap:/^[A-z]+\((.*)\)$/i,wrappedValueAlreadyExtracted:/[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/,valueSplit:/([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi},Lists:{colors:["fill","stroke","stopColor","color","backgroundColor","borderColor","borderTopColor","borderRightColor","borderBottomColor","borderLeftColor","outlineColor"],transformsBase:["translateX","translateY","scale","scaleX","scaleY","skewX","skewY","rotateZ"],transforms3D:["transformPerspective","translateZ","scaleZ","rotateX","rotateY"]},Hooks:{templates:{textShadow:["Color X Y Blur","black 0px 0px 0px"],boxShadow:["Color X Y Blur Spread","black 0px 0px 0px 0px"],clip:["Top Right Bottom Left","0px 0px 0px 0px"],backgroundPosition:["X Y","0% 0%"],transformOrigin:["X Y Z","50% 50% 0px"],perspectiveOrigin:["X Y","50% 50%"]},registered:{},register:function(){for(a=0;a<k.Lists.colors.length;a++){var t="color"===k.Lists.colors[a]?"0 0 0 1":"255 255 255 1";k.Hooks.templates[k.Lists.colors[a]]=["Red Green Blue Alpha",t]}var e,i,n;if(h)for(e in k.Hooks.templates){n=(i=k.Hooks.templates[e])[0].split(" ");var o=i[1].match(k.RegEx.valueSplit);"Color"===n[0]&&(n.push(n.shift()),o.push(o.shift()),k.Hooks.templates[e]=[n.join(" "),o.join(" ")])}for(e in k.Hooks.templates){n=(i=k.Hooks.templates[e])[0].split(" ");for(var a in n){var r=e+n[a],s=a;k.Hooks.registered[r]=[e,s]}}},getRoot:function(t){var e=k.Hooks.registered[t];return e?e[0]:t},cleanRootPropertyValue:function(t,e){return k.RegEx.valueUnwrap.test(e)&&(e=e.match(k.RegEx.valueUnwrap)[1]),k.Values.isCSSNullValue(e)&&(e=k.Hooks.templates[t][1]),e},extractValue:function(t,e){var i=k.Hooks.registered[t];if(i){var n=i[0],o=i[1];return(e=k.Hooks.cleanRootPropertyValue(n,e)).toString().match(k.RegEx.valueSplit)[o]}return e},injectValue:function(t,e,i){var n=k.Hooks.registered[t];if(n){var o,a=n[0],r=n[1];return i=k.Hooks.cleanRootPropertyValue(a,i),o=i.toString().match(k.RegEx.valueSplit),o[r]=e,o.join(" ")}return i}},Normalizations:{registered:{clip:function(t,e,i){switch(t){case"name":return"clip";case"extract":var n;return k.RegEx.wrappedValueAlreadyExtracted.test(i)?n=i:(n=i.toString().match(k.RegEx.valueUnwrap),n=n?n[1].replace(/,(\s+)?/g," "):i),n;case"inject":return"rect("+i+")"}},blur:function(t,e,i){switch(t){case"name":return b.State.isFirefox?"filter":"-webkit-filter";case"extract":var n=parseFloat(i);if(!n&&0!==n){var o=i.toString().match(/blur\(([0-9]+[A-z]+)\)/i);n=o?o[1]:0}return n;case"inject":return parseFloat(i)?"blur("+i+")":"none"}},opacity:function(t,e,i){if(8>=h)switch(t){case"name":return"filter";case"extract":var n=i.toString().match(/alpha\(opacity=(.*)\)/i);return i=n?n[1]/100:1;case"inject":return e.style.zoom=1,parseFloat(i)>=1?"":"alpha(opacity="+parseInt(100*parseFloat(i),10)+")"}else switch(t){case"name":return"opacity";case"extract":case"inject":return i}}},register:function(){9>=h||b.State.isGingerbread||(k.Lists.transformsBase=k.Lists.transformsBase.concat(k.Lists.transforms3D));for(t=0;t<k.Lists.transformsBase.length;t++)!function(){var e=k.Lists.transformsBase[t];k.Normalizations.registered[e]=function(t,i,o){switch(t){case"name":return"transform";case"extract":return r(i)===n||r(i).transformCache[e]===n?/^scale/i.test(e)?1:0:r(i).transformCache[e].replace(/[()]/g,"");case"inject":var a=!1;switch(e.substr(0,e.length-1)){case"translate":a=!/(%|px|em|rem|vw|vh|\d)$/i.test(o);break;case"scal":case"scale":b.State.isAndroid&&r(i).transformCache[e]===n&&1>o&&(o=1),a=!/(\d)$/i.test(o);break;case"skew":a=!/(deg|\d)$/i.test(o);break;case"rotate":a=!/(deg|\d)$/i.test(o)}return a||(r(i).transformCache[e]="("+o+")"),r(i).transformCache[e]}}}();for(var t=0;t<k.Lists.colors.length;t++)!function(){var e=k.Lists.colors[t];k.Normalizations.registered[e]=function(t,i,o){switch(t){case"name":return e;case"extract":var a;if(k.RegEx.wrappedValueAlreadyExtracted.test(o))a=o;else{var r,s={black:"rgb(0, 0, 0)",blue:"rgb(0, 0, 255)",gray:"rgb(128, 128, 128)",green:"rgb(0, 128, 0)",red:"rgb(255, 0, 0)",white:"rgb(255, 255, 255)"};/^[A-z]+$/i.test(o)?r=s[o]!==n?s[o]:s.black:k.RegEx.isHex.test(o)?r="rgb("+k.Values.hexToRgb(o).join(" ")+")":/^rgba?\(/i.test(o)||(r=s.black),a=(r||o).toString().match(k.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g," ")}return 8>=h||3!==a.split(" ").length||(a+=" 1"),a;case"inject":return 8>=h?4===o.split(" ").length&&(o=o.split(/\s+/).slice(0,3).join(" ")):3===o.split(" ").length&&(o+=" 1"),(8>=h?"rgb":"rgba")+"("+o.replace(/\s+/g,",").replace(/\.(\d)+(?=,)/g,"")+")"}}}()}},Names:{camelCase:function(t){return t.replace(/-(\w)/g,function(t,e){return e.toUpperCase()})},SVGAttribute:function(t){var e="width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return(h||b.State.isAndroid&&!b.State.isChrome)&&(e+="|transform"),new RegExp("^("+e+")$","i").test(t)},prefixCheck:function(t){if(b.State.prefixMatches[t])return[b.State.prefixMatches[t],!0];for(var e=["","Webkit","Moz","ms","O"],i=0,n=e.length;n>i;i++){var o;if(o=0===i?t:e[i]+t.replace(/^\w/,function(t){return t.toUpperCase()}),v.isString(b.State.prefixElement.style[o]))return b.State.prefixMatches[t]=o,[o,!0]}return[t,!1]}},Values:{hexToRgb:function(t){var e,i=/^#?([a-f\d])([a-f\d])([a-f\d])$/i,n=/^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return t=t.replace(i,function(t,e,i,n){return e+e+i+i+n+n}),e=n.exec(t),e?[parseInt(e[1],16),parseInt(e[2],16),parseInt(e[3],16)]:[0,0,0]},isCSSNullValue:function(t){return 0==t||/^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(t)},getUnitType:function(t){return/^(rotate|skew)/i.test(t)?"deg":/(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(t)?"":"px"},getDisplayType:function(t){var e=t&&t.tagName.toString().toLowerCase();return/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(e)?"inline":/^(li)$/i.test(e)?"list-item":/^(tr)$/i.test(e)?"table-row":/^(table)$/i.test(e)?"table":/^(tbody)$/i.test(e)?"table-row-group":"block"},addClass:function(t,e){t.classList?t.classList.add(e):t.className+=(t.className.length?" ":"")+e},removeClass:function(t,e){t.classList?t.classList.remove(e):t.className=t.className.toString().replace(new RegExp("(^|\\s)"+e.split(" ").join("|")+"(\\s|$)","gi")," ")}},getPropertyValue:function(t,i,o,a){function s(t,i){function o(){c&&k.setPropertyValue(t,"display","none")}var l=0;if(8>=h)l=p.css(t,i);else{var c=!1;if(/^(width|height)$/.test(i)&&0===k.getPropertyValue(t,"display")&&(c=!0,k.setPropertyValue(t,"display",k.Values.getDisplayType(t))),!a){if("height"===i&&"border-box"!==k.getPropertyValue(t,"boxSizing").toString().toLowerCase()){var u=t.offsetHeight-(parseFloat(k.getPropertyValue(t,"borderTopWidth"))||0)-(parseFloat(k.getPropertyValue(t,"borderBottomWidth"))||0)-(parseFloat(k.getPropertyValue(t,"paddingTop"))||0)-(parseFloat(k.getPropertyValue(t,"paddingBottom"))||0);return o(),u}if("width"===i&&"border-box"!==k.getPropertyValue(t,"boxSizing").toString().toLowerCase()){var d=t.offsetWidth-(parseFloat(k.getPropertyValue(t,"borderLeftWidth"))||0)-(parseFloat(k.getPropertyValue(t,"borderRightWidth"))||0)-(parseFloat(k.getPropertyValue(t,"paddingLeft"))||0)-(parseFloat(k.getPropertyValue(t,"paddingRight"))||0);return o(),d}}var f;f=r(t)===n?e.getComputedStyle(t,null):r(t).computedStyle?r(t).computedStyle:r(t).computedStyle=e.getComputedStyle(t,null),"borderColor"===i&&(i="borderTopColor"),(""===(l=9===h&&"filter"===i?f.getPropertyValue(i):f[i])||null===l)&&(l=t.style[i]),o()}if("auto"===l&&/^(top|right|bottom|left)$/i.test(i)){var v=s(t,"position");("fixed"===v||"absolute"===v&&/top|left/i.test(i))&&(l=p(t).position()[i]+"px")}return l}var l;if(k.Hooks.registered[i]){var c=i,u=k.Hooks.getRoot(c);o===n&&(o=k.getPropertyValue(t,k.Names.prefixCheck(u)[0])),k.Normalizations.registered[u]&&(o=k.Normalizations.registered[u]("extract",t,o)),l=k.Hooks.extractValue(c,o)}else if(k.Normalizations.registered[i]){var d,f;"transform"!==(d=k.Normalizations.registered[i]("name",t))&&(f=s(t,k.Names.prefixCheck(d)[0]),k.Values.isCSSNullValue(f)&&k.Hooks.templates[i]&&(f=k.Hooks.templates[i][1])),l=k.Normalizations.registered[i]("extract",t,f)}if(!/^[\d-]/.test(l))if(r(t)&&r(t).isSVG&&k.Names.SVGAttribute(i))if(/^(height|width)$/i.test(i))try{l=t.getBBox()[i]}catch(t){l=0}else l=t.getAttribute(i);else l=s(t,k.Names.prefixCheck(i)[0]);return k.Values.isCSSNullValue(l)&&(l=0),b.debug>=2&&console.log("Get "+i+": "+l),l},setPropertyValue:function(t,i,n,o,a){var s=i;if("scroll"===i)a.container?a.container["scroll"+a.direction]=n:"Left"===a.direction?e.scrollTo(n,a.alternateValue):e.scrollTo(a.alternateValue,n);else if(k.Normalizations.registered[i]&&"transform"===k.Normalizations.registered[i]("name",t))k.Normalizations.registered[i]("inject",t,n),s="transform",n=r(t).transformCache[i];else{if(k.Hooks.registered[i]){var l=i,c=k.Hooks.getRoot(i);o=o||k.getPropertyValue(t,c),n=k.Hooks.injectValue(l,n,o),i=c}if(k.Normalizations.registered[i]&&(n=k.Normalizations.registered[i]("inject",t,n),i=k.Normalizations.registered[i]("name",t)),s=k.Names.prefixCheck(i)[0],8>=h)try{t.style[s]=n}catch(t){b.debug&&console.log("Browser does not support ["+n+"] for ["+s+"]")}else r(t)&&r(t).isSVG&&k.Names.SVGAttribute(i)?t.setAttribute(i,n):t.style[s]=n;b.debug>=2&&console.log("Set "+i+" ("+s+"): "+n)}return[s,n]},flushTransformCache:function(t){function e(e){return parseFloat(k.getPropertyValue(t,e))}var i="";if((h||b.State.isAndroid&&!b.State.isChrome)&&r(t).isSVG){var n={translate:[e("translateX"),e("translateY")],skewX:[e("skewX")],skewY:[e("skewY")],scale:1!==e("scale")?[e("scale"),e("scale")]:[e("scaleX"),e("scaleY")],rotate:[e("rotateZ"),0,0]};p.each(r(t).transformCache,function(t){/^translate/i.test(t)?t="translate":/^scale/i.test(t)?t="scale":/^rotate/i.test(t)&&(t="rotate"),n[t]&&(i+=t+"("+n[t].join(" ")+") ",delete n[t])})}else{var o,a;p.each(r(t).transformCache,function(e){return o=r(t).transformCache[e],"transformPerspective"===e?(a=o,!0):(9===h&&"rotateZ"===e&&(e="rotate"),void(i+=e+o+" "))}),a&&(i="perspective"+a+" "+i)}k.setPropertyValue(t,"transform",i)}};k.Hooks.register(),k.Normalizations.register(),b.hook=function(t,e,i){var o=n;return t=a(t),p.each(t,function(t,a){if(r(a)===n&&b.init(a),i===n)o===n&&(o=b.CSS.getPropertyValue(a,e));else{var s=b.CSS.setPropertyValue(a,e,i);"transform"===s[0]&&b.CSS.flushTransformCache(a),o=s}}),o};var x=function(){function t(){return s?P.promise||null:l}function o(){function t(t){function d(t,e){var i=n,o=n,r=n;return v.isArray(t)?(i=t[0],!v.isArray(t[1])&&/^[\d-]/.test(t[1])||v.isFunction(t[1])||k.RegEx.isHex.test(t[1])?r=t[1]:(v.isString(t[1])&&!k.RegEx.isHex.test(t[1])||v.isArray(t[1]))&&(o=e?t[1]:c(t[1],s.duration),t[2]!==n&&(r=t[2]))):i=t,e||(o=o||s.easing),v.isFunction(i)&&(i=i.call(a,T,C)),v.isFunction(r)&&(r=r.call(a,T,C)),[i||0,o,r]}function h(t,e){var i,n;return n=(e||"0").toString().toLowerCase().replace(/[%A-z]+$/,function(t){return i=t,""}),i||(i=k.Values.getUnitType(t)),[n,i]}if(s.begin&&0===T)try{s.begin.call(f,f)}catch(t){setTimeout(function(){throw t},1)}if("scroll"===A){var g,w,x,S=/^x$/i.test(s.axis)?"Left":"Top",O=parseFloat(s.offset)||0;s.container?v.isWrapped(s.container)||v.isNode(s.container)?(s.container=s.container[0]||s.container,g=s.container["scroll"+S],x=g+p(a).position()[S.toLowerCase()]+O):s.container=null:(g=b.State.scrollAnchor[b.State["scrollProperty"+S]],w=b.State.scrollAnchor[b.State["scrollProperty"+("Left"===S?"Top":"Left")]],x=p(a).offset()[S.toLowerCase()]+O),l={scroll:{rootPropertyValue:!1,startValue:g,currentValue:g,endValue:x,unitType:"",easing:s.easing,scrollData:{container:s.container,direction:S,alternateValue:w}},element:a},b.debug&&console.log("tweensContainer (scroll): ",l.scroll,a)}else if("reverse"===A){if(!r(a).tweensContainer)return void p.dequeue(a,s.queue);"none"===r(a).opts.display&&(r(a).opts.display="auto"),"hidden"===r(a).opts.visibility&&(r(a).opts.visibility="visible"),r(a).opts.loop=!1,r(a).opts.begin=null,r(a).opts.complete=null,y.easing||delete s.easing,y.duration||delete s.duration,s=p.extend({},r(a).opts,s);M=p.extend(!0,{},r(a).tweensContainer);for(var E in M)if("element"!==E){var _=M[E].startValue;M[E].startValue=M[E].currentValue=M[E].endValue,M[E].endValue=_,v.isEmptyObject(y)||(M[E].easing=s.easing),b.debug&&console.log("reverse tweensContainer ("+E+"): "+JSON.stringify(M[E]),a)}l=M}else if("start"===A){var M;r(a).tweensContainer&&!0===r(a).isAnimating&&(M=r(a).tweensContainer),p.each(m,function(t,e){if(RegExp("^"+k.Lists.colors.join("$|^")+"$").test(t)){var i=d(e,!0),o=i[0],a=i[1],r=i[2];if(k.RegEx.isHex.test(o)){for(var s=["Red","Green","Blue"],l=k.Values.hexToRgb(o),c=r?k.Values.hexToRgb(r):n,u=0;u<s.length;u++){var p=[l[u]];a&&p.push(a),c!==n&&p.push(c[u]),m[t+s[u]]=p}delete m[t]}}});for(var q in m){var z=d(m[q]),V=z[0],H=z[1],L=z[2];q=k.Names.camelCase(q);var j=k.Hooks.getRoot(q),$=!1;if(r(a).isSVG||"tween"===j||!1!==k.Names.prefixCheck(j)[1]||k.Normalizations.registered[j]!==n){(s.display!==n&&null!==s.display&&"none"!==s.display||s.visibility!==n&&"hidden"!==s.visibility)&&/opacity|filter/.test(q)&&!L&&0!==V&&(L=0),s._cacheValues&&M&&M[q]?(L===n&&(L=M[q].endValue+M[q].unitType),$=r(a).rootPropertyValueCache[j]):k.Hooks.registered[q]?L===n?($=k.getPropertyValue(a,j),L=k.getPropertyValue(a,q,$)):$=k.Hooks.templates[j][1]:L===n&&(L=k.getPropertyValue(a,q));var N,W,F,Q=!1;if(N=h(q,L),L=N[0],F=N[1],N=h(q,V),V=N[0].replace(/^([+-\/*])=/,function(t,e){return Q=e,""}),W=N[1],L=parseFloat(L)||0,V=parseFloat(V)||0,"%"===W&&(/^(fontSize|lineHeight)$/.test(q)?(V/=100,W="em"):/^scale/.test(q)?(V/=100,W=""):/(Red|Green|Blue)$/i.test(q)&&(V=V/100*255,W="")),/[\/*]/.test(Q))W=F;else if(F!==W&&0!==L)if(0===V)W=F;else{o=o||function(){var t={myParent:a.parentNode||i.body,position:k.getPropertyValue(a,"position"),fontSize:k.getPropertyValue(a,"fontSize")},n=t.position===I.lastPosition&&t.myParent===I.lastParent,o=t.fontSize===I.lastFontSize;I.lastParent=t.myParent,I.lastPosition=t.position,I.lastFontSize=t.fontSize;var s=100,l={};if(o&&n)l.emToPx=I.lastEmToPx,l.percentToPxWidth=I.lastPercentToPxWidth,l.percentToPxHeight=I.lastPercentToPxHeight;else{var c=r(a).isSVG?i.createElementNS("http://www.w3.org/2000/svg","rect"):i.createElement("div");b.init(c),t.myParent.appendChild(c),p.each(["overflow","overflowX","overflowY"],function(t,e){b.CSS.setPropertyValue(c,e,"hidden")}),b.CSS.setPropertyValue(c,"position",t.position),b.CSS.setPropertyValue(c,"fontSize",t.fontSize),b.CSS.setPropertyValue(c,"boxSizing","content-box"),p.each(["minWidth","maxWidth","width","minHeight","maxHeight","height"],function(t,e){b.CSS.setPropertyValue(c,e,s+"%")}),b.CSS.setPropertyValue(c,"paddingLeft",s+"em"),l.percentToPxWidth=I.lastPercentToPxWidth=(parseFloat(k.getPropertyValue(c,"width",null,!0))||1)/s,l.percentToPxHeight=I.lastPercentToPxHeight=(parseFloat(k.getPropertyValue(c,"height",null,!0))||1)/s,l.emToPx=I.lastEmToPx=(parseFloat(k.getPropertyValue(c,"paddingLeft"))||1)/s,t.myParent.removeChild(c)}return null===I.remToPx&&(I.remToPx=parseFloat(k.getPropertyValue(i.body,"fontSize"))||16),null===I.vwToPx&&(I.vwToPx=parseFloat(e.innerWidth)/100,I.vhToPx=parseFloat(e.innerHeight)/100),l.remToPx=I.remToPx,l.vwToPx=I.vwToPx,l.vhToPx=I.vhToPx,b.debug>=1&&console.log("Unit ratios: "+JSON.stringify(l),a),l}();var X=/margin|padding|left|right|width|text|word|letter/i.test(q)||/X$/.test(q)||"x"===q?"x":"y";switch(F){case"%":L*="x"===X?o.percentToPxWidth:o.percentToPxHeight;break;case"px":break;default:L*=o[F+"ToPx"]}switch(W){case"%":L*=1/("x"===X?o.percentToPxWidth:o.percentToPxHeight);break;case"px":break;default:L*=1/o[W+"ToPx"]}}switch(Q){case"+":V=L+V;break;case"-":V=L-V;break;case"*":V*=L;break;case"/":V=L/V}l[q]={rootPropertyValue:$,startValue:L,currentValue:L,endValue:V,unitType:W,easing:H},b.debug&&console.log("tweensContainer ("+q+"): "+JSON.stringify(l[q]),a)}else b.debug&&console.log("Skipping ["+j+"] due to a lack of browser support.")}l.element=a}l.element&&(k.Values.addClass(a,"velocity-animating"),D.push(l),""===s.queue&&(r(a).tweensContainer=l,r(a).opts=s),r(a).isAnimating=!0,T===C-1?(b.State.calls.push([D,f,s,null,P.resolver]),!1===b.State.isTicking&&(b.State.isTicking=!0,u())):T++)}var o,a=this,s=p.extend({},b.defaults,y),l={};switch(r(a)===n&&b.init(a),parseFloat(s.delay)&&!1!==s.queue&&p.queue(a,s.queue,function(t){b.velocityQueueEntryFlag=!0,r(a).delayTimer={setTimeout:setTimeout(t,parseFloat(s.delay)),next:t}}),s.duration.toString().toLowerCase()){case"fast":s.duration=200;break;case"normal":s.duration=g;break;case"slow":s.duration=600;break;default:s.duration=parseFloat(s.duration)||1}!1!==b.mock&&(!0===b.mock?s.duration=s.delay=1:(s.duration*=parseFloat(b.mock)||1,s.delay*=parseFloat(b.mock)||1)),s.easing=c(s.easing,s.duration),s.begin&&!v.isFunction(s.begin)&&(s.begin=null),s.progress&&!v.isFunction(s.progress)&&(s.progress=null),s.complete&&!v.isFunction(s.complete)&&(s.complete=null),s.display!==n&&null!==s.display&&(s.display=s.display.toString().toLowerCase(),"auto"===s.display&&(s.display=b.CSS.Values.getDisplayType(a))),s.visibility!==n&&null!==s.visibility&&(s.visibility=s.visibility.toString().toLowerCase()),s.mobileHA=s.mobileHA&&b.State.isMobile&&!b.State.isGingerbread,!1===s.queue?s.delay?setTimeout(t,s.delay):t():p.queue(a,s.queue,function(e,i){return!0===i?(P.promise&&P.resolver(f),!0):(b.velocityQueueEntryFlag=!0,void t(e))}),""!==s.queue&&"fx"!==s.queue||"inprogress"===p.queue(a)[0]||p.dequeue(a)}var s,l,h,f,m,y,w=arguments[0]&&(arguments[0].p||p.isPlainObject(arguments[0].properties)&&!arguments[0].properties.names||v.isString(arguments[0].properties));if(v.isWrapped(this)?(s=!1,h=0,f=this,l=this):(s=!0,h=1,f=w?arguments[0].elements||arguments[0].e:arguments[0]),f=a(f)){w?(m=arguments[0].properties||arguments[0].p,y=arguments[0].options||arguments[0].o):(m=arguments[h],y=arguments[h+1]);var C=f.length,T=0;if(!/^(stop|finish)$/i.test(m)&&!p.isPlainObject(y)){y={};for(var S=h+1;S<arguments.length;S++)v.isArray(arguments[S])||!/^(fast|normal|slow)$/i.test(arguments[S])&&!/^\d/.test(arguments[S])?v.isString(arguments[S])||v.isArray(arguments[S])?y.easing=arguments[S]:v.isFunction(arguments[S])&&(y.complete=arguments[S]):y.duration=arguments[S]}var P={promise:null,resolver:null,rejecter:null};s&&b.Promise&&(P.promise=new b.Promise(function(t,e){P.resolver=t,P.rejecter=e}));var A;switch(m){case"scroll":A="scroll";break;case"reverse":A="reverse";break;case"finish":case"stop":p.each(f,function(t,e){r(e)&&r(e).delayTimer&&(clearTimeout(r(e).delayTimer.setTimeout),r(e).delayTimer.next&&r(e).delayTimer.next(),delete r(e).delayTimer)});var O=[];return p.each(b.State.calls,function(t,e){e&&p.each(e[1],function(i,o){var a=y===n?"":y;return!0!==a&&e[2].queue!==a&&(y!==n||!1!==e[2].queue)||void p.each(f,function(i,n){n===o&&((!0===y||v.isString(y))&&(p.each(p.queue(n,v.isString(y)?y:""),function(t,e){v.isFunction(e)&&e(null,!0)}),p.queue(n,v.isString(y)?y:"",[])),"stop"===m?(r(n)&&r(n).tweensContainer&&!1!==a&&p.each(r(n).tweensContainer,function(t,e){e.endValue=e.currentValue}),O.push(t)):"finish"===m&&(e[2].duration=1))})})}),"stop"===m&&(p.each(O,function(t,e){d(e,!0)}),P.promise&&P.resolver(f)),t();default:if(!p.isPlainObject(m)||v.isEmptyObject(m)){if(v.isString(m)&&b.Redirects[m]){var E=(z=p.extend({},y)).duration,_=z.delay||0;return!0===z.backwards&&(f=p.extend(!0,[],f).reverse()),p.each(f,function(t,e){parseFloat(z.stagger)?z.delay=_+parseFloat(z.stagger)*t:v.isFunction(z.stagger)&&(z.delay=_+z.stagger.call(e,t,C)),z.drag&&(z.duration=parseFloat(E)||(/^(callout|transition)/.test(m)?1e3:g),z.duration=Math.max(z.duration*(z.backwards?1-t/C:(t+1)/C),.75*z.duration,200)),b.Redirects[m].call(e,e,z||{},t,C,f,P.promise?P:n)}),t()}var M="Velocity: First argument ("+m+") was not a property map, a known action, or a registered redirect. Aborting.";return P.promise?P.rejecter(new Error(M)):console.log(M),t()}A="start"}var I={lastParent:null,lastPosition:null,lastFontSize:null,lastPercentToPxWidth:null,lastPercentToPxHeight:null,lastEmToPx:null,remToPx:null,vwToPx:null,vhToPx:null},D=[];p.each(f,function(t,e){v.isNode(e)&&o.call(e)});var q,z=p.extend({},b.defaults,y);if(z.loop=parseInt(z.loop),q=2*z.loop-1,z.loop)for(var V=0;q>V;V++){var H={delay:z.delay,progress:z.progress};V===q-1&&(H.display=z.display,H.visibility=z.visibility,H.complete=z.complete),x(f,"reverse",H)}return t()}};(b=p.extend(x,b)).animate=x;var C=e.requestAnimationFrame||f;return b.State.isMobile||i.hidden===n||i.addEventListener("visibilitychange",function(){i.hidden?(C=function(t){return setTimeout(function(){t(!0)},16)},u()):C=e.requestAnimationFrame||f}),t.Velocity=b,t!==e&&(t.fn.velocity=x,t.fn.velocity.defaults=b.defaults),p.each(["Down","Up"],function(t,e){b.Redirects["slide"+e]=function(t,i,o,a,r,s){var l=p.extend({},i),c=l.begin,u=l.complete,d={height:"",marginTop:"",marginBottom:"",paddingTop:"",paddingBottom:""},h={};l.display===n&&(l.display="Down"===e?"inline"===b.CSS.Values.getDisplayType(t)?"inline-block":"block":"none"),l.begin=function(){c&&c.call(r,r);for(var i in d){h[i]=t.style[i];var n=b.CSS.getPropertyValue(t,i);d[i]="Down"===e?[n,0]:[0,n]}h.overflow=t.style.overflow,t.style.overflow="hidden"},l.complete=function(){for(var e in h)t.style[e]=h[e];u&&u.call(r,r),s&&s.resolver(r)},b(t,d,l)}}),p.each(["In","Out"],function(t,e){b.Redirects["fade"+e]=function(t,i,o,a,r,s){var l=p.extend({},i),c={opacity:"In"===e?1:0},u=l.complete;l.complete=o!==a-1?l.begin=null:function(){u&&u.call(r,r),s&&s.resolver(r)},l.display===n&&(l.display="In"===e?"auto":"none"),b(this,c,l)}}),b}jQuery.fn.velocity=jQuery.fn.animate}}(window.jQuery||window.Zepto||window,window,document)})),function(t,e,i,n){"use strict";function o(t,e,i){return setTimeout(u(t,i),e)}function a(t,e,i){return!!Array.isArray(t)&&(r(t,i[e],i),!0)}function r(t,e,i){var o;if(t)if(t.forEach)t.forEach(e,i);else if(t.length!==n)for(o=0;o<t.length;)e.call(i,t[o],o,t),o++;else for(o in t)t.hasOwnProperty(o)&&e.call(i,t[o],o,t)}function s(t,e,i){for(var o=Object.keys(e),a=0;a<o.length;)(!i||i&&t[o[a]]===n)&&(t[o[a]]=e[o[a]]),a++;return t}function l(t,e){return s(t,e,!0)}function c(t,e,i){var n,o=e.prototype;(n=t.prototype=Object.create(o)).constructor=t,n._super=o,i&&s(n,i)}function u(t,e){return function(){return t.apply(e,arguments)}}function d(t,e){return typeof t==ut?t.apply(e?e[0]||n:n,e):t}function p(t,e){return t===n?e:t}function h(t,e,i){r(g(e),function(e){t.addEventListener(e,i,!1)})}function f(t,e,i){r(g(e),function(e){t.removeEventListener(e,i,!1)})}function v(t,e){for(;t;){if(t==e)return!0;t=t.parentNode}return!1}function m(t,e){return t.indexOf(e)>-1}function g(t){return t.trim().split(/\s+/g)}function y(t,e,i){if(t.indexOf&&!i)return t.indexOf(e);for(var n=0;n<t.length;){if(i&&t[n][i]==e||!i&&t[n]===e)return n;n++}return-1}function b(t){return Array.prototype.slice.call(t,0)}function w(t,e,i){for(var n=[],o=[],a=0;a<t.length;){var r=e?t[a][e]:t[a];y(o,r)<0&&n.push(t[a]),o[a]=r,a++}return i&&(n=e?n.sort(function(t,i){return t[e]>i[e]}):n.sort()),n}function k(t,e){for(var i,o,a=e[0].toUpperCase()+e.slice(1),r=0;r<lt.length;){if(i=lt[r],(o=i?i+a:e)in t)return o;r++}return n}function x(){return ft++}function C(t){var e=t.ownerDocument;return e.defaultView||e.parentWindow}function T(t,e){var i=this;this.manager=t,this.callback=e,this.element=t.element,this.target=t.options.inputTarget,this.domHandler=function(e){d(t.options.enable,[t])&&i.handler(e)},this.init()}function S(t){var e=t.options.inputClass;return new(e||(gt?j:yt?W:mt?Q:L))(t,P)}function P(t,e,i){var n=i.pointers.length,o=i.changedPointers.length,a=e&xt&&0==n-o,r=e&(Tt|St)&&0==n-o;i.isFirst=!!a,i.isFinal=!!r,a&&(t.session={}),i.eventType=e,A(t,i),t.emit("hammer.input",i),t.recognize(i),t.session.prevInput=i}function A(t,e){var i=t.session,n=e.pointers,o=n.length;i.firstInput||(i.firstInput=_(e)),o>1&&!i.firstMultiple?i.firstMultiple=_(e):1===o&&(i.firstMultiple=!1);var a=i.firstInput,r=i.firstMultiple,s=r?r.center:a.center,l=e.center=M(n);e.timeStamp=ht(),e.deltaTime=e.timeStamp-a.timeStamp,e.angle=z(s,l),e.distance=q(s,l),O(i,e),e.offsetDirection=D(e.deltaX,e.deltaY),e.scale=r?H(r.pointers,n):1,e.rotation=r?V(r.pointers,n):0,E(i,e);var c=t.element;v(e.srcEvent.target,c)&&(c=e.srcEvent.target),e.target=c}function O(t,e){var i=e.center,n=t.offsetDelta||{},o=t.prevDelta||{},a=t.prevInput||{};(e.eventType===xt||a.eventType===Tt)&&(o=t.prevDelta={x:a.deltaX||0,y:a.deltaY||0},n=t.offsetDelta={x:i.x,y:i.y}),e.deltaX=o.x+(i.x-n.x),e.deltaY=o.y+(i.y-n.y)}function E(t,e){var i,o,a,r,s=t.lastInterval||e,l=e.timeStamp-s.timeStamp;if(e.eventType!=St&&(l>kt||s.velocity===n)){var c=s.deltaX-e.deltaX,u=s.deltaY-e.deltaY,d=I(l,c,u);o=d.x,a=d.y,i=pt(d.x)>pt(d.y)?d.x:d.y,r=D(c,u),t.lastInterval=e}else i=s.velocity,o=s.velocityX,a=s.velocityY,r=s.direction;e.velocity=i,e.velocityX=o,e.velocityY=a,e.direction=r}function _(t){for(var e=[],i=0;i<t.pointers.length;)e[i]={clientX:dt(t.pointers[i].clientX),clientY:dt(t.pointers[i].clientY)},i++;return{timeStamp:ht(),pointers:e,center:M(e),deltaX:t.deltaX,deltaY:t.deltaY}}function M(t){var e=t.length;if(1===e)return{x:dt(t[0].clientX),y:dt(t[0].clientY)};for(var i=0,n=0,o=0;e>o;)i+=t[o].clientX,n+=t[o].clientY,o++;return{x:dt(i/e),y:dt(n/e)}}function I(t,e,i){return{x:e/t||0,y:i/t||0}}function D(t,e){return t===e?Pt:pt(t)>=pt(e)?t>0?At:Ot:e>0?Et:_t}function q(t,e,i){i||(i=qt);var n=e[i[0]]-t[i[0]],o=e[i[1]]-t[i[1]];return Math.sqrt(n*n+o*o)}function z(t,e,i){i||(i=qt);var n=e[i[0]]-t[i[0]],o=e[i[1]]-t[i[1]];return 180*Math.atan2(o,n)/Math.PI}function V(t,e){return z(e[1],e[0],zt)-z(t[1],t[0],zt)}function H(t,e){return q(e[0],e[1],zt)/q(t[0],t[1],zt)}function L(){this.evEl=Ht,this.evWin=Lt,this.allow=!0,this.pressed=!1,T.apply(this,arguments)}function j(){this.evEl=Nt,this.evWin=Wt,T.apply(this,arguments),this.store=this.manager.session.pointerEvents=[]}function $(){this.evTarget=Qt,this.evWin=Xt,this.started=!1,T.apply(this,arguments)}function N(t,e){var i=b(t.touches),n=b(t.changedTouches);return e&(Tt|St)&&(i=w(i.concat(n),"identifier",!0)),[i,n]}function W(){this.evTarget=Yt,this.targetIds={},T.apply(this,arguments)}function F(t,e){var i=b(t.touches),n=this.targetIds;if(e&(xt|Ct)&&1===i.length)return n[i[0].identifier]=!0,[i,i];var o,a,r=b(t.changedTouches),s=[],l=this.target;if(a=i.filter(function(t){return v(t.target,l)}),e===xt)for(o=0;o<a.length;)n[a[o].identifier]=!0,o++;for(o=0;o<r.length;)n[r[o].identifier]&&s.push(r[o]),e&(Tt|St)&&delete n[r[o].identifier],o++;return s.length?[w(a.concat(s),"identifier",!0),s]:void 0}function Q(){T.apply(this,arguments);var t=u(this.handler,this);this.touch=new W(this.manager,t),this.mouse=new L(this.manager,t)}function X(t,e){this.manager=t,this.set(e)}function R(t){if(m(t,Kt))return Kt;var e=m(t,te),i=m(t,ee);return e&&i?te+" "+ee:e||i?e?te:ee:m(t,Jt)?Jt:Zt}function Y(t){this.id=x(),this.manager=null,this.options=l(t||{},this.defaults),this.options.enable=p(this.options.enable,!0),this.state=ie,this.simultaneous={},this.requireFail=[]}function B(t){return t&se?"cancel":t&ae?"end":t&oe?"move":t&ne?"start":""}function U(t){return t==_t?"down":t==Et?"up":t==At?"left":t==Ot?"right":""}function G(t,e){var i=e.manager;return i?i.get(t):t}function Z(){Y.apply(this,arguments)}function J(){Z.apply(this,arguments),this.pX=null,this.pY=null}function K(){Z.apply(this,arguments)}function tt(){Y.apply(this,arguments),this._timer=null,this._input=null}function et(){Z.apply(this,arguments)}function it(){Z.apply(this,arguments)}function nt(){Y.apply(this,arguments),this.pTime=!1,this.pCenter=!1,this._timer=null,this._input=null,this.count=0}function ot(t,e){return e=e||{},e.recognizers=p(e.recognizers,ot.defaults.preset),new at(t,e)}function at(t,e){e=e||{},this.options=l(e,ot.defaults),this.options.inputTarget=this.options.inputTarget||t,this.handlers={},this.session={},this.recognizers=[],this.element=t,this.input=S(this),this.touchAction=new X(this,this.options.touchAction),rt(this,!0),r(e.recognizers,function(t){var e=this.add(new t[0](t[1]));t[2]&&e.recognizeWith(t[2]),t[3]&&e.requireFailure(t[3])},this)}function rt(t,e){var i=t.element;r(t.options.cssProps,function(t,n){i.style[k(i.style,n)]=e?t:""})}function st(t,i){var n=e.createEvent("Event");n.initEvent(t,!0,!0),n.gesture=i,i.target.dispatchEvent(n)}var lt=["","webkit","moz","MS","ms","o"],ct=e.createElement("div"),ut="function",dt=Math.round,pt=Math.abs,ht=Date.now,ft=1,vt=/mobile|tablet|ip(ad|hone|od)|android/i,mt="ontouchstart"in t,gt=k(t,"PointerEvent")!==n,yt=mt&&vt.test(navigator.userAgent),bt="touch",wt="mouse",kt=25,xt=1,Ct=2,Tt=4,St=8,Pt=1,At=2,Ot=4,Et=8,_t=16,Mt=At|Ot,It=Et|_t,Dt=Mt|It,qt=["x","y"],zt=["clientX","clientY"];T.prototype={handler:function(){},init:function(){this.evEl&&h(this.element,this.evEl,this.domHandler),this.evTarget&&h(this.target,this.evTarget,this.domHandler),this.evWin&&h(C(this.element),this.evWin,this.domHandler)},destroy:function(){this.evEl&&f(this.element,this.evEl,this.domHandler),this.evTarget&&f(this.target,this.evTarget,this.domHandler),this.evWin&&f(C(this.element),this.evWin,this.domHandler)}};var Vt={mousedown:xt,mousemove:Ct,mouseup:Tt},Ht="mousedown",Lt="mousemove mouseup";c(L,T,{handler:function(t){var e=Vt[t.type];e&xt&&0===t.button&&(this.pressed=!0),e&Ct&&1!==t.which&&(e=Tt),this.pressed&&this.allow&&(e&Tt&&(this.pressed=!1),this.callback(this.manager,e,{pointers:[t],changedPointers:[t],pointerType:wt,srcEvent:t}))}});var jt={pointerdown:xt,pointermove:Ct,pointerup:Tt,pointercancel:St,pointerout:St},$t={2:bt,3:"pen",4:wt,5:"kinect"},Nt="pointerdown",Wt="pointermove pointerup pointercancel";t.MSPointerEvent&&(Nt="MSPointerDown",Wt="MSPointerMove MSPointerUp MSPointerCancel"),c(j,T,{handler:function(t){var e=this.store,i=!1,n=t.type.toLowerCase().replace("ms",""),o=jt[n],a=$t[t.pointerType]||t.pointerType,r=a==bt,s=y(e,t.pointerId,"pointerId");o&xt&&(0===t.button||r)?0>s&&(e.push(t),s=e.length-1):o&(Tt|St)&&(i=!0),0>s||(e[s]=t,this.callback(this.manager,o,{pointers:e,changedPointers:[t],pointerType:a,srcEvent:t}),i&&e.splice(s,1))}});var Ft={touchstart:xt,touchmove:Ct,touchend:Tt,touchcancel:St},Qt="touchstart",Xt="touchstart touchmove touchend touchcancel";c($,T,{handler:function(t){var e=Ft[t.type];if(e===xt&&(this.started=!0),this.started){var i=N.call(this,t,e);e&(Tt|St)&&0==i[0].length-i[1].length&&(this.started=!1),this.callback(this.manager,e,{pointers:i[0],changedPointers:i[1],pointerType:bt,srcEvent:t})}}});var Rt={touchstart:xt,touchmove:Ct,touchend:Tt,touchcancel:St},Yt="touchstart touchmove touchend touchcancel";c(W,T,{handler:function(t){var e=Rt[t.type],i=F.call(this,t,e);i&&this.callback(this.manager,e,{pointers:i[0],changedPointers:i[1],pointerType:bt,srcEvent:t})}}),c(Q,T,{handler:function(t,e,i){var n=i.pointerType==bt,o=i.pointerType==wt;if(n)this.mouse.allow=!1;else if(o&&!this.mouse.allow)return;e&(Tt|St)&&(this.mouse.allow=!0),this.callback(t,e,i)},destroy:function(){this.touch.destroy(),this.mouse.destroy()}});var Bt=k(ct.style,"touchAction"),Ut=Bt!==n,Gt="compute",Zt="auto",Jt="manipulation",Kt="none",te="pan-x",ee="pan-y";X.prototype={set:function(t){t==Gt&&(t=this.compute()),Ut&&(this.manager.element.style[Bt]=t),this.actions=t.toLowerCase().trim()},update:function(){this.set(this.manager.options.touchAction)},compute:function(){var t=[];return r(this.manager.recognizers,function(e){d(e.options.enable,[e])&&(t=t.concat(e.getTouchAction()))}),R(t.join(" "))},preventDefaults:function(t){if(!Ut){var e=t.srcEvent,i=t.offsetDirection;if(this.manager.session.prevented)return void e.preventDefault();var n=this.actions,o=m(n,Kt),a=m(n,ee),r=m(n,te);return o||a&&i&Mt||r&&i&It?this.preventSrc(e):void 0}},preventSrc:function(t){this.manager.session.prevented=!0,t.preventDefault()}};var ie=1,ne=2,oe=4,ae=8,re=ae,se=16;Y.prototype={defaults:{},set:function(t){return s(this.options,t),this.manager&&this.manager.touchAction.update(),this},recognizeWith:function(t){if(a(t,"recognizeWith",this))return this;var e=this.simultaneous;return t=G(t,this),e[t.id]||(e[t.id]=t,t.recognizeWith(this)),this},dropRecognizeWith:function(t){return a(t,"dropRecognizeWith",this)?this:(t=G(t,this),delete this.simultaneous[t.id],this)},requireFailure:function(t){if(a(t,"requireFailure",this))return this;var e=this.requireFail;return t=G(t,this),-1===y(e,t)&&(e.push(t),t.requireFailure(this)),this},dropRequireFailure:function(t){if(a(t,"dropRequireFailure",this))return this;t=G(t,this);var e=y(this.requireFail,t);return e>-1&&this.requireFail.splice(e,1),this},hasRequireFailures:function(){return this.requireFail.length>0},canRecognizeWith:function(t){return!!this.simultaneous[t.id]},emit:function(t){function e(e){i.manager.emit(i.options.event+(e?B(n):""),t)}var i=this,n=this.state;ae>n&&e(!0),e(),n>=ae&&e(!0)},tryEmit:function(t){return this.canEmit()?this.emit(t):void(this.state=32)},canEmit:function(){for(var t=0;t<this.requireFail.length;){if(!(this.requireFail[t].state&(32|ie)))return!1;t++}return!0},recognize:function(t){var e=s({},t);return d(this.options.enable,[this,e])?(this.state&(re|se|32)&&(this.state=ie),this.state=this.process(e),void(this.state&(ne|oe|ae|se)&&this.tryEmit(e))):(this.reset(),void(this.state=32))},process:function(){},getTouchAction:function(){},reset:function(){}},c(Z,Y,{defaults:{pointers:1},attrTest:function(t){var e=this.options.pointers;return 0===e||t.pointers.length===e},process:function(t){var e=this.state,i=t.eventType,n=e&(ne|oe),o=this.attrTest(t);return n&&(i&St||!o)?e|se:n||o?i&Tt?e|ae:e&ne?e|oe:ne:32}}),c(J,Z,{defaults:{event:"pan",threshold:10,pointers:1,direction:Dt},getTouchAction:function(){var t=this.options.direction,e=[];return t&Mt&&e.push(ee),t&It&&e.push(te),e},directionTest:function(t){var e=this.options,i=!0,n=t.distance,o=t.direction,a=t.deltaX,r=t.deltaY;return o&e.direction||(e.direction&Mt?(o=0===a?Pt:0>a?At:Ot,i=a!=this.pX,n=Math.abs(t.deltaX)):(o=0===r?Pt:0>r?Et:_t,i=r!=this.pY,n=Math.abs(t.deltaY))),t.direction=o,i&&n>e.threshold&&o&e.direction},attrTest:function(t){return Z.prototype.attrTest.call(this,t)&&(this.state&ne||!(this.state&ne)&&this.directionTest(t))},emit:function(t){this.pX=t.deltaX,this.pY=t.deltaY;var e=U(t.direction);e&&this.manager.emit(this.options.event+e,t),this._super.emit.call(this,t)}}),c(K,Z,{defaults:{event:"pinch",threshold:0,pointers:2},getTouchAction:function(){return[Kt]},attrTest:function(t){return this._super.attrTest.call(this,t)&&(Math.abs(t.scale-1)>this.options.threshold||this.state&ne)},emit:function(t){if(this._super.emit.call(this,t),1!==t.scale){var e=t.scale<1?"in":"out";this.manager.emit(this.options.event+e,t)}}}),c(tt,Y,{defaults:{event:"press",pointers:1,time:500,threshold:5},getTouchAction:function(){return[Zt]},process:function(t){var e=this.options,i=t.pointers.length===e.pointers,n=t.distance<e.threshold,a=t.deltaTime>e.time;if(this._input=t,!n||!i||t.eventType&(Tt|St)&&!a)this.reset();else if(t.eventType&xt)this.reset(),this._timer=o(function(){this.state=re,this.tryEmit()},e.time,this);else if(t.eventType&Tt)return re;return 32},reset:function(){clearTimeout(this._timer)},emit:function(t){this.state===re&&(t&&t.eventType&Tt?this.manager.emit(this.options.event+"up",t):(this._input.timeStamp=ht(),this.manager.emit(this.options.event,this._input)))}}),c(et,Z,{defaults:{event:"rotate",threshold:0,pointers:2},getTouchAction:function(){return[Kt]},attrTest:function(t){return this._super.attrTest.call(this,t)&&(Math.abs(t.rotation)>this.options.threshold||this.state&ne)}}),c(it,Z,{defaults:{event:"swipe",threshold:10,velocity:.65,direction:Mt|It,pointers:1},getTouchAction:function(){return J.prototype.getTouchAction.call(this)},attrTest:function(t){var e,i=this.options.direction;return i&(Mt|It)?e=t.velocity:i&Mt?e=t.velocityX:i&It&&(e=t.velocityY),this._super.attrTest.call(this,t)&&i&t.direction&&t.distance>this.options.threshold&&pt(e)>this.options.velocity&&t.eventType&Tt},emit:function(t){var e=U(t.direction);e&&this.manager.emit(this.options.event+e,t),this.manager.emit(this.options.event,t)}}),c(nt,Y,{defaults:{event:"tap",pointers:1,taps:1,interval:300,time:250,threshold:2,posThreshold:10},getTouchAction:function(){return[Jt]},process:function(t){var e=this.options,i=t.pointers.length===e.pointers,n=t.distance<e.threshold,a=t.deltaTime<e.time;if(this.reset(),t.eventType&xt&&0===this.count)return this.failTimeout();if(n&&a&&i){if(t.eventType!=Tt)return this.failTimeout();var r=!this.pTime||t.timeStamp-this.pTime<e.interval,s=!this.pCenter||q(this.pCenter,t.center)<e.posThreshold;if(this.pTime=t.timeStamp,this.pCenter=t.center,s&&r?this.count+=1:this.count=1,this._input=t,0===this.count%e.taps)return this.hasRequireFailures()?(this._timer=o(function(){this.state=re,this.tryEmit()},e.interval,this),ne):re}return 32},failTimeout:function(){return this._timer=o(function(){this.state=32},this.options.interval,this),32},reset:function(){clearTimeout(this._timer)},emit:function(){this.state==re&&(this._input.tapCount=this.count,this.manager.emit(this.options.event,this._input))}}),ot.VERSION="2.0.4",ot.defaults={domEvents:!1,touchAction:Gt,enable:!0,inputTarget:null,inputClass:null,preset:[[et,{enable:!1}],[K,{enable:!1},["rotate"]],[it,{direction:Mt}],[J,{direction:Mt},["swipe"]],[nt],[nt,{event:"doubletap",taps:2},["tap"]],[tt]],cssProps:{userSelect:"default",touchSelect:"none",touchCallout:"none",contentZooming:"none",userDrag:"none",tapHighlightColor:"rgba(0,0,0,0)"}};at.prototype={set:function(t){return s(this.options,t),t.touchAction&&this.touchAction.update(),t.inputTarget&&(this.input.destroy(),this.input.target=t.inputTarget,this.input.init()),this},stop:function(t){this.session.stopped=t?2:1},recognize:function(t){var e=this.session;if(!e.stopped){this.touchAction.preventDefaults(t);var i,n=this.recognizers,o=e.curRecognizer;(!o||o&&o.state&re)&&(o=e.curRecognizer=null);for(var a=0;a<n.length;)i=n[a],2===e.stopped||o&&i!=o&&!i.canRecognizeWith(o)?i.reset():i.recognize(t),!o&&i.state&(ne|oe|ae)&&(o=e.curRecognizer=i),a++}},get:function(t){if(t instanceof Y)return t;for(var e=this.recognizers,i=0;i<e.length;i++)if(e[i].options.event==t)return e[i];return null},add:function(t){if(a(t,"add",this))return this;var e=this.get(t.options.event);return e&&this.remove(e),this.recognizers.push(t),t.manager=this,this.touchAction.update(),t},remove:function(t){if(a(t,"remove",this))return this;var e=this.recognizers;return t=this.get(t),e.splice(y(e,t),1),this.touchAction.update(),this},on:function(t,e){var i=this.handlers;return r(g(t),function(t){i[t]=i[t]||[],i[t].push(e)}),this},off:function(t,e){var i=this.handlers;return r(g(t),function(t){e?i[t].splice(y(i[t],e),1):delete i[t]}),this},emit:function(t,e){this.options.domEvents&&st(t,e);var i=this.handlers[t]&&this.handlers[t].slice();if(i&&i.length){e.type=t,e.preventDefault=function(){e.srcEvent.preventDefault()};for(var n=0;n<i.length;)i[n](e),n++}},destroy:function(){this.element&&rt(this,!1),this.handlers={},this.session={},this.input.destroy(),this.element=null}},s(ot,{INPUT_START:xt,INPUT_MOVE:Ct,INPUT_END:Tt,INPUT_CANCEL:St,STATE_POSSIBLE:ie,STATE_BEGAN:ne,STATE_CHANGED:oe,STATE_ENDED:ae,STATE_RECOGNIZED:re,STATE_CANCELLED:se,STATE_FAILED:32,DIRECTION_NONE:Pt,DIRECTION_LEFT:At,DIRECTION_RIGHT:Ot,DIRECTION_UP:Et,DIRECTION_DOWN:_t,DIRECTION_HORIZONTAL:Mt,DIRECTION_VERTICAL:It,DIRECTION_ALL:Dt,Manager:at,Input:T,TouchAction:X,TouchInput:W,MouseInput:L,PointerEventInput:j,TouchMouseInput:Q,SingleTouchInput:$,Recognizer:Y,AttrRecognizer:Z,Tap:nt,Pan:J,Swipe:it,Pinch:K,Rotate:et,Press:tt,on:h,off:f,each:r,merge:l,extend:s,inherit:c,bindFn:u,prefixed:k}),typeof define==ut&&define.amd?define(function(){return ot}):"undefined"!=typeof module&&module.exports?module.exports=ot:t.Hammer=ot}(window,document),function(t){"function"==typeof define&&define.amd?define(["jquery","hammerjs"],t):"object"==typeof exports?t(require("jquery"),require("hammerjs")):t(jQuery,Hammer)}(function(t,e){function i(i,n){var o=t(i);o.data("hammer")||o.data("hammer",new e(o[0],n))}t.fn.hammer=function(t){return this.each(function(){i(this,t)})},e.Manager.prototype.emit=function(e){return function(i,n){e.call(this,i,n),t(this.element).trigger({type:i,gesture:n})}}(e.Manager.prototype.emit)}),function(t){t.Package?Materialize={}:t.Materialize={}}(window),"undefined"==typeof exports||exports.nodeType||("undefined"!=typeof module&&!module.nodeType&&module.exports&&(exports=module.exports=Materialize),exports.default=Materialize),function(t){for(var e=0,i=["webkit","moz"],n=t.requestAnimationFrame,o=t.cancelAnimationFrame,a=i.length;--a>=0&&!n;)n=t[i[a]+"RequestAnimationFrame"],o=t[i[a]+"CancelRequestAnimationFrame"];n&&o||(n=function(t){var i=+Date.now(),n=Math.max(e+16,i);return setTimeout(function(){t(e=n)},n-i)},o=clearTimeout),t.requestAnimationFrame=n,t.cancelAnimationFrame=o}(window),Materialize.objectSelectorString=function(t){return((t.prop("tagName")||"")+(t.attr("id")||"")+(t.attr("class")||"")).replace(/\s/g,"")},Materialize.guid=function(){function t(){return Math.floor(65536*(1+Math.random())).toString(16).substring(1)}return function(){return t()+t()+"-"+t()+"-"+t()+"-"+t()+"-"+t()+t()+t()}}(),Materialize.escapeHash=function(t){return t.replace(/(:|\.|\[|\]|,|=)/g,"\\$1")},Materialize.elementOrParentIsFixed=function(t){var e=$(t),i=!1;return e.add(e.parents()).each(function(){if("fixed"===$(this).css("position"))return i=!0,!1}),i};var getTime=Date.now||function(){return(new Date).getTime()};Materialize.throttle=function(t,e,i){var n,o,a,r=null,s=0;i||(i={});var l=function(){s=!1===i.leading?0:getTime(),r=null,a=t.apply(n,o),n=o=null};return function(){var c=getTime();s||!1!==i.leading||(s=c);var u=e-(c-s);return n=this,o=arguments,u<=0?(clearTimeout(r),r=null,s=c,a=t.apply(n,o),n=o=null):r||!1===i.trailing||(r=setTimeout(l,u)),a}};var Vel;Vel=jQuery?jQuery.Velocity:$?$.Velocity:Velocity,Materialize.Vel=Vel||Velocity,function(t){t.fn.collapsible=function(e,i){var n={accordion:void 0,onOpen:void 0,onClose:void 0},o=e;return e=t.extend(n,e),this.each(function(){function n(e){p=d.find("> li > .collapsible-header"),e.hasClass("active")?e.parent().addClass("active"):e.parent().removeClass("active"),e.parent().hasClass("active")?e.siblings(".collapsible-body").stop(!0,!1).slideDown({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height","")}}):e.siblings(".collapsible-body").stop(!0,!1).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height","")}}),p.not(e).removeClass("active").parent().removeClass("active"),p.not(e).parent().children(".collapsible-body").stop(!0,!1).each(function(){t(this).is(":visible")&&t(this).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height",""),s(t(this).siblings(".collapsible-header"))}})})}function a(e){e.hasClass("active")?e.parent().addClass("active"):e.parent().removeClass("active"),e.parent().hasClass("active")?e.siblings(".collapsible-body").stop(!0,!1).slideDown({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height","")}}):e.siblings(".collapsible-body").stop(!0,!1).slideUp({duration:350,easing:"easeOutQuart",queue:!1,complete:function(){t(this).css("height","")}})}function r(t,i){i||t.toggleClass("active"),e.accordion||"accordion"===h||void 0===h?n(t):a(t),s(t)}function s(t){t.hasClass("active")?"function"==typeof e.onOpen&&e.onOpen.call(this,t.parent()):"function"==typeof e.onClose&&e.onClose.call(this,t.parent())}function l(t){return c(t).length>0}function c(t){return t.closest("li > .collapsible-header")}function u(){d.off("click.collapse","> li > .collapsible-header")}var d=t(this),p=t(this).find("> li > .collapsible-header"),h=d.data("collapsible");if("destroy"!==o)if(i>=0&&i<p.length){var f=p.eq(i);f.length&&("open"===o||"close"===o&&f.hasClass("active"))&&r(f)}else u(),d.on("click.collapse","> li > .collapsible-header",function(e){var i=t(e.target);l(i)&&(i=c(i)),r(i)}),e.accordion||"accordion"===h||void 0===h?r(p.filter(".active").first(),!0):p.filter(".active").each(function(){r(t(this),!0)});else u()})},t(document).ready(function(){t(".collapsible").collapsible()})}(jQuery),function(t){t.fn.scrollTo=function(e){return t(this).scrollTop(t(this).scrollTop()-t(this).offset().top+t(e).offset().top),this},t.fn.dropdown=function(e){var i={inDuration:300,outDuration:225,constrainWidth:!0,hover:!1,gutter:0,belowOrigin:!1,alignment:"left",stopPropagation:!1};return"open"===e?(this.each(function(){t(this).trigger("open")}),!1):"close"===e?(this.each(function(){t(this).trigger("close")}),!1):void this.each(function(){function n(){void 0!==r.data("induration")&&(s.inDuration=r.data("induration")),void 0!==r.data("outduration")&&(s.outDuration=r.data("outduration")),void 0!==r.data("constrainwidth")&&(s.constrainWidth=r.data("constrainwidth")),void 0!==r.data("hover")&&(s.hover=r.data("hover")),void 0!==r.data("gutter")&&(s.gutter=r.data("gutter")),void 0!==r.data("beloworigin")&&(s.belowOrigin=r.data("beloworigin")),void 0!==r.data("alignment")&&(s.alignment=r.data("alignment")),void 0!==r.data("stoppropagation")&&(s.stopPropagation=r.data("stoppropagation"))}function o(e){"focus"===e&&(l=!0),n(),c.addClass("active"),r.addClass("active");var i=r[0].getBoundingClientRect().width;!0===s.constrainWidth?c.css("width",i):c.css("white-space","nowrap");var o=window.innerHeight,u=r.innerHeight(),d=r.offset().left,p=r.offset().top-t(window).scrollTop(),h=s.alignment,f=0,v=0,m=0;!0===s.belowOrigin&&(m=u);var g=0,y=0,b=r.parent();if(b.is("body")||(b[0].scrollHeight>b[0].clientHeight&&(g=b[0].scrollTop),b[0].scrollWidth>b[0].clientWidth&&(y=b[0].scrollLeft)),d+c.innerWidth()>t(window).width()?h="right":d-c.innerWidth()+r.innerWidth()<0&&(h="left"),p+c.innerHeight()>o)if(p+u-c.innerHeight()<0){var w=o-p-m;c.css("max-height",w)}else m||(m+=u),m-=c.innerHeight();"left"===h?(f=s.gutter,v=r.position().left+f):"right"===h&&(c.stop(!0,!0).css({opacity:0,left:0}),v=r.position().left+i-c.width()+(f=-s.gutter)),c.css({position:"absolute",top:r.position().top+m+g,left:v+y}),c.slideDown({queue:!1,duration:s.inDuration,easing:"easeOutCubic",complete:function(){t(this).css("height","")}}).animate({opacity:1},{queue:!1,duration:s.inDuration,easing:"easeOutSine"}),setTimeout(function(){t(document).on("click."+c.attr("id"),function(e){a(),t(document).off("click."+c.attr("id"))})},0)}function a(){l=!1,c.fadeOut(s.outDuration),c.removeClass("active"),r.removeClass("active"),t(document).off("click."+c.attr("id")),setTimeout(function(){c.css("max-height","")},s.outDuration)}var r=t(this),s=t.extend({},i,e),l=!1,c=t("#"+r.attr("data-activates"));if(n(),r.after(c),s.hover){var u=!1;r.off("click."+r.attr("id")),r.on("mouseenter",function(t){!1===u&&(o(),u=!0)}),r.on("mouseleave",function(e){var i=e.toElement||e.relatedTarget;t(i).closest(".dropdown-content").is(c)||(c.stop(!0,!0),a(),u=!1)}),c.on("mouseleave",function(e){var i=e.toElement||e.relatedTarget;t(i).closest(".dropdown-button").is(r)||(c.stop(!0,!0),a(),u=!1)})}else r.off("click."+r.attr("id")),r.on("click."+r.attr("id"),function(e){l||(r[0]!=e.currentTarget||r.hasClass("active")||0!==t(e.target).closest(".dropdown-content").length?r.hasClass("active")&&(a(),t(document).off("click."+c.attr("id"))):(e.preventDefault(),s.stopPropagation&&e.stopPropagation(),o("click")))});r.on("open",function(t,e){o(e)}),r.on("close",a)})},t(document).ready(function(){t(".dropdown-button").dropdown()})}(jQuery),function(t,e){"use strict";var i={opacity:.5,inDuration:250,outDuration:250,ready:void 0,complete:void 0,dismissible:!0,startingTop:"4%",endingTop:"10%"},n=function(){function n(e,i){_classCallCheck(this,n),e[0].M_Modal&&e[0].M_Modal.destroy(),this.$el=e,this.options=t.extend({},n.defaults,i),this.isOpen=!1,this.$el[0].M_Modal=this,this.id=e.attr("id"),this.openingTrigger=void 0,this.$overlay=t('<div class="modal-overlay"></div>'),n._increment++,n._count++,this.$overlay[0].style.zIndex=1e3+2*n._increment,this.$el[0].style.zIndex=1e3+2*n._increment+1,this.setupEventHandlers()}return _createClass(n,[{key:"getInstance",value:function(){return this}},{key:"destroy",value:function(){this.removeEventHandlers(),this.$el[0].removeAttribute("style"),this.$overlay[0].parentNode&&this.$overlay[0].parentNode.removeChild(this.$overlay[0]),this.$el[0].M_Modal=void 0,n._count--}},{key:"setupEventHandlers",value:function(){this.handleOverlayClickBound=this.handleOverlayClick.bind(this),this.handleModalCloseClickBound=this.handleModalCloseClick.bind(this),1===n._count&&document.body.addEventListener("click",this.handleTriggerClick),this.$overlay[0].addEventListener("click",this.handleOverlayClickBound),this.$el[0].addEventListener("click",this.handleModalCloseClickBound)}},{key:"removeEventHandlers",value:function(){0===n._count&&document.body.removeEventListener("click",this.handleTriggerClick),this.$overlay[0].removeEventListener("click",this.handleOverlayClickBound),this.$el[0].removeEventListener("click",this.handleModalCloseClickBound)}},{key:"handleTriggerClick",value:function(e){var i=t(e.target).closest(".modal-trigger");if(e.target&&i.length){var n=i[0].getAttribute("href");n=n?n.slice(1):i[0].getAttribute("data-target");var o=document.getElementById(n).M_Modal;o&&o.open(i),e.preventDefault()}}},{key:"handleOverlayClick",value:function(){this.options.dismissible&&this.close()}},{key:"handleModalCloseClick",value:function(e){var i=t(e.target).closest(".modal-close");e.target&&i.length&&this.close()}},{key:"handleKeydown",value:function(t){27===t.keyCode&&this.options.dismissible&&this.close()}},{key:"animateIn",value:function(){var i=this;t.extend(this.$el[0].style,{display:"block",opacity:0}),t.extend(this.$overlay[0].style,{display:"block",opacity:0}),e(this.$overlay[0],{opacity:this.options.opacity},{duration:this.options.inDuration,queue:!1,ease:"easeOutCubic"});var n={duration:this.options.inDuration,queue:!1,ease:"easeOutCubic",complete:function(){"function"==typeof i.options.ready&&i.options.ready.call(i,i.$el,i.openingTrigger)}};this.$el[0].classList.contains("bottom-sheet")?e(this.$el[0],{bottom:0,opacity:1},n):(e.hook(this.$el[0],"scaleX",.7),this.$el[0].style.top=this.options.startingTop,e(this.$el[0],{top:this.options.endingTop,opacity:1,scaleX:1},n))}},{key:"animateOut",value:function(){var t=this;e(this.$overlay[0],{opacity:0},{duration:this.options.outDuration,queue:!1,ease:"easeOutQuart"});var i={duration:this.options.outDuration,queue:!1,ease:"easeOutCubic",complete:function(){t.$el[0].style.display="none","function"==typeof t.options.complete&&t.options.complete.call(t,t.$el),t.$overlay[0].parentNode.removeChild(t.$overlay[0])}};this.$el[0].classList.contains("bottom-sheet")?e(this.$el[0],{bottom:"-100%",opacity:0},i):e(this.$el[0],{top:this.options.startingTop,opacity:0,scaleX:.7},i)}},{key:"open",value:function(t){if(!this.isOpen){this.isOpen=!0;var e=document.body;return e.style.overflow="hidden",this.$el[0].classList.add("open"),e.appendChild(this.$overlay[0]),this.openingTrigger=t||void 0,this.options.dismissible&&(this.handleKeydownBound=this.handleKeydown.bind(this),document.addEventListener("keydown",this.handleKeydownBound)),this.animateIn(),this}}},{key:"close",value:function(){if(this.isOpen)return this.isOpen=!1,this.$el[0].classList.remove("open"),document.body.style.overflow="",this.options.dismissible&&document.removeEventListener("keydown",this.handleKeydownBound),this.animateOut(),this}}],[{key:"init",value:function(e,i){var o=[];return e.each(function(){o.push(new n(t(this),i))}),o}},{key:"defaults",get:function(){return i}}]),n}();n._increment=0,n._count=0,Materialize.Modal=n,t.fn.modal=function(e){return n.prototype[e]?"get"===e.slice(0,3)?this.first()[0].M_Modal[e]():this.each(function(){this.M_Modal[e]()}):"object"!=typeof e&&e?void t.error("Method "+e+" does not exist on jQuery.modal"):(n.init(this,arguments[0]),this)}}(jQuery,Materialize.Vel),function(t){t.fn.materialbox=function(){return this.each(function(){function e(){a=!1;var e=s.parent(".material-placeholder"),n=(window.innerWidth,window.innerHeight,s.data("width")),l=s.data("height");s.velocity("stop",!0),t("#materialbox-overlay").velocity("stop",!0),t(".materialbox-caption").velocity("stop",!0),t(window).off("scroll.materialbox"),t(document).off("keyup.materialbox"),t(window).off("resize.materialbox"),t("#materialbox-overlay").velocity({opacity:0},{duration:r,queue:!1,easing:"easeOutQuad",complete:function(){o=!1,t(this).remove()}}),s.velocity({width:n,height:l,left:0,top:0},{duration:r,queue:!1,easing:"easeOutQuad",complete:function(){e.css({height:"",width:"",position:"",top:"",left:""}),s.removeAttr("style"),s.attr("style",c),s.removeClass("active"),a=!0,i&&i.css("overflow","")}}),t(".materialbox-caption").velocity({opacity:0},{duration:r,queue:!1,easing:"easeOutQuad",complete:function(){t(this).remove()}})}if(!t(this).hasClass("initialized")){t(this).addClass("initialized");var i,n,o=!1,a=!0,r=200,s=t(this),l=t("<div></div>").addClass("material-placeholder"),c=s.attr("style");s.wrap(l),s.on("click",function(){var r=s.parent(".material-placeholder"),l=window.innerWidth,c=window.innerHeight,u=s.width(),d=s.height();if(!1===a)return e(),!1;if(o&&!0===a)return e(),!1;a=!1,s.addClass("active"),o=!0,r.css({width:r[0].getBoundingClientRect().width,height:r[0].getBoundingClientRect().height,position:"relative",top:0,left:0}),i=void 0,n=r[0].parentNode;for(;null!==n&&!t(n).is(document);){var p=t(n);"visible"!==p.css("overflow")&&(p.css("overflow","visible"),i=void 0===i?p:i.add(p)),n=n.parentNode}s.css({position:"absolute","z-index":1e3,"will-change":"left, top, width, height"}).data("width",u).data("height",d);var h=t('<div id="materialbox-overlay"></div>').css({opacity:0}).click(function(){!0===a&&e()});s.before(h);var f=h[0].getBoundingClientRect();if(h.css({width:l,height:c,left:-1*f.left,top:-1*f.top}),h.velocity({opacity:1},{duration:275,queue:!1,easing:"easeOutQuad"}),""!==s.data("caption")){var v=t('<div class="materialbox-caption"></div>');v.text(s.data("caption")),t("body").append(v),v.css({display:"inline"}),v.velocity({opacity:1},{duration:275,queue:!1,easing:"easeOutQuad"})}var m=0,g=0;u/l>d/c?(m=.9*l,g=.9*l*(d/u)):(m=.9*c*(u/d),g=.9*c),s.hasClass("responsive-img")?s.velocity({"max-width":m,width:u},{duration:0,queue:!1,complete:function(){s.css({left:0,top:0}).velocity({height:g,width:m,left:t(document).scrollLeft()+l/2-s.parent(".material-placeholder").offset().left-m/2,top:t(document).scrollTop()+c/2-s.parent(".material-placeholder").offset().top-g/2},{duration:275,queue:!1,easing:"easeOutQuad",complete:function(){a=!0}})}}):s.css("left",0).css("top",0).velocity({height:g,width:m,left:t(document).scrollLeft()+l/2-s.parent(".material-placeholder").offset().left-m/2,top:t(document).scrollTop()+c/2-s.parent(".material-placeholder").offset().top-g/2},{duration:275,queue:!1,easing:"easeOutQuad",complete:function(){a=!0}}),t(window).on("scroll.materialbox",function(){o&&e()}),t(window).on("resize.materialbox",function(){o&&e()}),t(document).on("keyup.materialbox",function(t){27===t.keyCode&&!0===a&&o&&e()})})}})},t(document).ready(function(){t(".materialboxed").materialbox()})}(jQuery),function(t){t.fn.parallax=function(){var e=t(window).width();return this.each(function(i){function n(i){var n;n=e<601?o.height()>0?o.height():o.children("img").height():o.height()>0?o.height():500;var a=o.children("img").first(),r=a.height()-n,s=o.offset().top+n,l=o.offset().top,c=t(window).scrollTop(),u=window.innerHeight,d=(c+u-l)/(n+u),p=Math.round(r*d);i&&a.css("display","block"),s>c&&l<c+u&&a.css("transform","translate3D(-50%,"+p+"px, 0)")}var o=t(this);o.addClass("parallax"),o.children("img").one("load",function(){n(!0)}).each(function(){this.complete&&t(this).trigger("load")}),t(window).scroll(function(){e=t(window).width(),n(!1)}),t(window).resize(function(){e=t(window).width(),n(!1)})})}}(jQuery),function(t){var e={init:function(e){var i={onShow:null,swipeable:!1,responsiveThreshold:1/0};e=t.extend(i,e);var n=Materialize.objectSelectorString(t(this));return this.each(function(i){var o,a,r,s,l,c=n+i,u=t(this),d=t(window).width(),p=u.find("li.tab a"),h=u.width(),f=t(),v=Math.max(h,u[0].scrollWidth)/p.length,m=0,g=0,y=!1,b=function(t){return Math.ceil(h-t.position().left-t[0].getBoundingClientRect().width-u.scrollLeft())},w=function(t){return Math.floor(t.position().left+u.scrollLeft())},k=function(t){m-t>=0?(s.velocity({right:b(o)},{duration:300,queue:!1,easing:"easeOutQuad"}),s.velocity({left:w(o)},{duration:300,queue:!1,easing:"easeOutQuad",delay:90})):(s.velocity({left:w(o)},{duration:300,queue:!1,easing:"easeOutQuad"}),s.velocity({right:b(o)},{duration:300,queue:!1,easing:"easeOutQuad",delay:90}))};e.swipeable&&d>e.responsiveThreshold&&(e.swipeable=!1),0===(o=t(p.filter('[href="'+location.hash+'"]'))).length&&(o=t(this).find("li.tab a.active").first()),0===o.length&&(o=t(this).find("li.tab a").first()),o.addClass("active"),(m=p.index(o))<0&&(m=0),void 0!==o[0]&&(a=t(o[0].hash)).addClass("active"),u.find(".indicator").length||u.append('<li class="indicator"></li>'),s=u.find(".indicator"),u.append(s),u.is(":visible")&&setTimeout(function(){s.css({right:b(o)}),s.css({left:w(o)})},0),t(window).off("resize.tabs-"+c).on("resize.tabs-"+c,function(){h=u.width(),v=Math.max(h,u[0].scrollWidth)/p.length,m<0&&(m=0),0!==v&&0!==h&&(s.css({right:b(o)}),s.css({left:w(o)}))}),e.swipeable?(p.each(function(){var e=t(Materialize.escapeHash(this.hash));e.addClass("carousel-item"),f=f.add(e)}),r=f.wrapAll('<div class="tabs-content carousel"></div>'),f.css("display",""),t(".tabs-content.carousel").carousel({fullWidth:!0,noWrap:!0,onCycleTo:function(t){if(!y){var i=m;m=r.index(t),o.removeClass("active"),(o=p.eq(m)).addClass("active"),k(i),"function"==typeof e.onShow&&e.onShow.call(u[0],a)}}})):p.not(o).each(function(){t(Materialize.escapeHash(this.hash)).hide()}),u.off("click.tabs").on("click.tabs","a",function(i){if(t(this).parent().hasClass("disabled"))i.preventDefault();else if(!t(this).attr("target")){y=!0,h=u.width(),v=Math.max(h,u[0].scrollWidth)/p.length,o.removeClass("active");var n=a;o=t(this),a=t(Materialize.escapeHash(this.hash)),p=u.find("li.tab a");o.position();o.addClass("active"),g=m,(m=p.index(t(this)))<0&&(m=0),e.swipeable?f.length&&f.carousel("set",m,function(){"function"==typeof e.onShow&&e.onShow.call(u[0],a)}):(void 0!==a&&(a.show(),a.addClass("active"),"function"==typeof e.onShow&&e.onShow.call(this,a)),void 0===n||n.is(a)||(n.hide(),n.removeClass("active"))),l=setTimeout(function(){y=!1},300),k(g),i.preventDefault()}})})},select_tab:function(t){this.find('a[href="#'+t+'"]').trigger("click")}};t.fn.tabs=function(i){return e[i]?e[i].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof i&&i?void t.error("Method "+i+" does not exist on jQuery.tabs"):e.init.apply(this,arguments)},t(document).ready(function(){t("ul.tabs").tabs()})}(jQuery),function(t){t.fn.tooltip=function(i){var n={delay:350,tooltip:"",position:"bottom",html:!1};return"remove"===i?(this.each(function(){t("#"+t(this).attr("data-tooltip-id")).remove(),t(this).removeAttr("data-tooltip-id"),t(this).off("mouseenter.tooltip mouseleave.tooltip")}),!1):(i=t.extend(n,i),this.each(function(){var n=Materialize.guid(),o=t(this);o.attr("data-tooltip-id")&&t("#"+o.attr("data-tooltip-id")).remove(),o.attr("data-tooltip-id",n);var a,r,s,l,c,u,d=function(){a=o.attr("data-html")?"true"===o.attr("data-html"):i.html,r=o.attr("data-delay"),r=void 0===r||""===r?i.delay:r,s=o.attr("data-position"),s=void 0===s||""===s?i.position:s,l=o.attr("data-tooltip"),l=void 0===l||""===l?i.tooltip:l};d();c=function(){var e=t('<div class="material-tooltip"></div>');return l=a?t("<span></span>").html(l):t("<span></span>").text(l),e.append(l).appendTo(t("body")).attr("id",n),(u=t('<div class="backdrop"></div>')).appendTo(e),e}(),o.off("mouseenter.tooltip mouseleave.tooltip");var p,h=!1;o.on({"mouseenter.tooltip":function(t){p=setTimeout(function(){d(),h=!0,c.velocity("stop"),u.velocity("stop"),c.css({visibility:"visible",left:"0px",top:"0px"});var t,i,n,a=o.outerWidth(),r=o.outerHeight(),l=c.outerHeight(),p=c.outerWidth(),f="0px",v="0px",m=u[0].offsetWidth,g=u[0].offsetHeight,y=8,b=8,w=0;"top"===s?(t=o.offset().top-l-5,i=o.offset().left+a/2-p/2,n=e(i,t,p,l),f="-10px",u.css({bottom:0,left:0,borderRadius:"14px 14px 0 0",transformOrigin:"50% 100%",marginTop:l,marginLeft:p/2-m/2})):"left"===s?(t=o.offset().top+r/2-l/2,i=o.offset().left-p-5,n=e(i,t,p,l),v="-10px",u.css({top:"-7px",right:0,width:"14px",height:"14px",borderRadius:"14px 0 0 14px",transformOrigin:"95% 50%",marginTop:l/2,marginLeft:p})):"right"===s?(t=o.offset().top+r/2-l/2,i=o.offset().left+a+5,n=e(i,t,p,l),v="+10px",u.css({top:"-7px",left:0,width:"14px",height:"14px",borderRadius:"0 14px 14px 0",transformOrigin:"5% 50%",marginTop:l/2,marginLeft:"0px"})):(t=o.offset().top+o.outerHeight()+5,i=o.offset().left+a/2-p/2,n=e(i,t,p,l),f="+10px",u.css({top:0,left:0,marginLeft:p/2-m/2})),c.css({top:n.y,left:n.x}),y=Math.SQRT2*p/parseInt(m),b=Math.SQRT2*l/parseInt(g),w=Math.max(y,b),c.velocity({translateY:f,translateX:v},{duration:350,queue:!1}).velocity({opacity:1},{duration:300,delay:50,queue:!1}),u.css({visibility:"visible"}).velocity({opacity:1},{duration:55,delay:0,queue:!1}).velocity({scaleX:w,scaleY:w},{duration:300,delay:0,queue:!1,easing:"easeInOutQuad"})},r)},"mouseleave.tooltip":function(){h=!1,clearTimeout(p),setTimeout(function(){!0!==h&&(c.velocity({opacity:0,translateY:0,translateX:0},{duration:225,queue:!1}),u.velocity({opacity:0,scaleX:1,scaleY:1},{duration:225,queue:!1,complete:function(){u.css({visibility:"hidden"}),c.css({visibility:"hidden"}),h=!1}}))},225)}})}))};var e=function(e,i,n,o){var a=e,r=i;return a<0?a=4:a+n>window.innerWidth&&(a-=a+n-window.innerWidth),r<0?r=4:r+o>window.innerHeight+t(window).scrollTop&&(r-=r+o-window.innerHeight),{x:a,y:r}};t(document).ready(function(){t(".tooltipped").tooltip()})}(jQuery),function(t){"use strict";function e(t){return null!==t&&t===t.window}function i(t){return e(t)?t:9===t.nodeType&&t.defaultView}function n(t){var e,n,o={top:0,left:0},a=t&&t.ownerDocument;return e=a.documentElement,void 0!==t.getBoundingClientRect&&(o=t.getBoundingClientRect()),n=i(a),{top:o.top+n.pageYOffset-e.clientTop,left:o.left+n.pageXOffset-e.clientLeft}}function o(t){var e="";for(var i in t)t.hasOwnProperty(i)&&(e+=i+":"+t[i]+";");return e}function a(t){if(!1===u.allowEvent(t))return null;for(var e=null,i=t.target||t.srcElement;null!==i.parentNode;){if(!(i instanceof SVGElement)&&-1!==i.className.indexOf("waves-effect")){e=i;break}i=i.parentNode}return e}function r(e){var i=a(e);null!==i&&(c.show(e,i),"ontouchstart"in t&&(i.addEventListener("touchend",c.hide,!1),i.addEventListener("touchcancel",c.hide,!1)),i.addEventListener("mouseup",c.hide,!1),i.addEventListener("mouseleave",c.hide,!1),i.addEventListener("dragend",c.hide,!1))}var s=s||{},l=document.querySelectorAll.bind(document),c={duration:750,show:function(t,e){if(2===t.button)return!1;var i=e||this,a=document.createElement("div");a.className="waves-ripple",i.appendChild(a);var r=n(i),s=t.pageY-r.top,l=t.pageX-r.left,u="scale("+i.clientWidth/100*10+")";"touches"in t&&(s=t.touches[0].pageY-r.top,l=t.touches[0].pageX-r.left),a.setAttribute("data-hold",Date.now()),a.setAttribute("data-scale",u),a.setAttribute("data-x",l),a.setAttribute("data-y",s);var d={top:s+"px",left:l+"px"};a.className=a.className+" waves-notransition",a.setAttribute("style",o(d)),a.className=a.className.replace("waves-notransition",""),d["-webkit-transform"]=u,d["-moz-transform"]=u,d["-ms-transform"]=u,d["-o-transform"]=u,d.transform=u,d.opacity="1",d["-webkit-transition-duration"]=c.duration+"ms",d["-moz-transition-duration"]=c.duration+"ms",d["-o-transition-duration"]=c.duration+"ms",d["transition-duration"]=c.duration+"ms",d["-webkit-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",d["-moz-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",d["-o-transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",d["transition-timing-function"]="cubic-bezier(0.250, 0.460, 0.450, 0.940)",a.setAttribute("style",o(d))},hide:function(t){u.touchup(t);var e=this,i=(e.clientWidth,null),n=e.getElementsByClassName("waves-ripple");if(!(n.length>0))return!1;var a=(i=n[n.length-1]).getAttribute("data-x"),r=i.getAttribute("data-y"),s=i.getAttribute("data-scale"),l=350-(Date.now()-Number(i.getAttribute("data-hold")));l<0&&(l=0),setTimeout(function(){var t={top:r+"px",left:a+"px",opacity:"0","-webkit-transition-duration":c.duration+"ms","-moz-transition-duration":c.duration+"ms","-o-transition-duration":c.duration+"ms","transition-duration":c.duration+"ms","-webkit-transform":s,"-moz-transform":s,"-ms-transform":s,"-o-transform":s,transform:s};i.setAttribute("style",o(t)),setTimeout(function(){try{e.removeChild(i)}catch(t){return!1}},c.duration)},l)},wrapInput:function(t){for(var e=0;e<t.length;e++){var i=t[e];if("input"===i.tagName.toLowerCase()){var n=i.parentNode;if("i"===n.tagName.toLowerCase()&&-1!==n.className.indexOf("waves-effect"))continue;var o=document.createElement("i");o.className=i.className+" waves-input-wrapper";var a=i.getAttribute("style");a||(a=""),o.setAttribute("style",a),i.className="waves-button-input",i.removeAttribute("style"),n.replaceChild(o,i),o.appendChild(i)}}}},u={touches:0,allowEvent:function(t){var e=!0;return"touchstart"===t.type?u.touches+=1:"touchend"===t.type||"touchcancel"===t.type?setTimeout(function(){u.touches>0&&(u.touches-=1)},500):"mousedown"===t.type&&u.touches>0&&(e=!1),e},touchup:function(t){u.allowEvent(t)}};s.displayEffect=function(e){"duration"in(e=e||{})&&(c.duration=e.duration),c.wrapInput(l(".waves-effect")),"ontouchstart"in t&&document.body.addEventListener("touchstart",r,!1),document.body.addEventListener("mousedown",r,!1)},s.attach=function(e){"input"===e.tagName.toLowerCase()&&(c.wrapInput([e]),e=e.parentNode),"ontouchstart"in t&&e.addEventListener("touchstart",r,!1),e.addEventListener("mousedown",r,!1)},t.Waves=s,document.addEventListener("DOMContentLoaded",function(){s.displayEffect()},!1)}(window),function(t,e){"use strict";var i={displayLength:1/0,inDuration:300,outDuration:375,className:void 0,completeCallback:void 0,activationPercent:.8},n=function(){function n(e,i,o,a){if(_classCallCheck(this,n),e){this.options={displayLength:i,className:o,completeCallback:a},this.options=t.extend({},n.defaults,this.options),this.message=e,this.panning=!1,this.timeRemaining=this.options.displayLength,0===n._toasts.length&&n._createContainer(),n._toasts.push(this);var r=this.createToast();r.M_Toast=this,this.el=r,this._animateIn(),this.setTimer()}}return _createClass(n,[{key:"createToast",value:function(){var e=document.createElement("div");if(e.classList.add("toast"),this.options.className){var i=this.options.className.split(" "),o=void 0,a=void 0;for(o=0,a=i.length;o<a;o++)e.classList.add(i[o])}return("object"==typeof HTMLElement?this.message instanceof HTMLElement:this.message&&"object"==typeof this.message&&null!==this.message&&1===this.message.nodeType&&"string"==typeof this.message.nodeName)?e.appendChild(this.message):this.message instanceof jQuery?t(e).append(this.message):e.innerHTML=this.message,n._container.appendChild(e),e}},{key:"_animateIn",value:function(){e(this.el,{top:0,opacity:1},{duration:300,easing:"easeOutCubic",queue:!1})}},{key:"setTimer",value:function(){var t=this;this.timeRemaining!==1/0&&(this.counterInterval=setInterval(function(){t.panning||(t.timeRemaining-=20),t.timeRemaining<=0&&t.remove()},20))}},{key:"remove",value:function(){var t=this;window.clearInterval(this.counterInterval);var i=this.el.offsetWidth*this.options.activationPercent;this.wasSwiped&&(this.el.style.transition="transform .05s, opacity .05s",this.el.style.transform="translateX("+i+"px)",this.el.style.opacity=0),e(this.el,{opacity:0,marginTop:"-40px"},{duration:this.options.outDuration,easing:"easeOutExpo",queue:!1,complete:function(){"function"==typeof t.options.completeCallback&&t.options.completeCallback(),t.el.parentNode.removeChild(t.el),n._toasts.splice(n._toasts.indexOf(t),1),0===n._toasts.length&&n._removeContainer()}})}}],[{key:"_createContainer",value:function(){var t=document.createElement("div");t.setAttribute("id","toast-container"),t.addEventListener("touchstart",n._onDragStart),t.addEventListener("touchmove",n._onDragMove),t.addEventListener("touchend",n._onDragEnd),t.addEventListener("mousedown",n._onDragStart),document.addEventListener("mousemove",n._onDragMove),document.addEventListener("mouseup",n._onDragEnd),document.body.appendChild(t),n._container=t}},{key:"_removeContainer",value:function(){document.removeEventListener("mousemove",n._onDragMove),document.removeEventListener("mouseup",n._onDragEnd),n._container.parentNode.removeChild(n._container),n._container=null}},{key:"_onDragStart",value:function(e){if(e.target&&t(e.target).closest(".toast").length){var i=t(e.target).closest(".toast")[0].M_Toast;i.panning=!0,n._draggedToast=i,i.el.classList.add("panning"),i.el.style.transition="",i.startingXPos=n._xPos(e),i.time=Date.now(),i.xPos=n._xPos(e)}}},{key:"_onDragMove",value:function(t){if(n._draggedToast){t.preventDefault();var e=n._draggedToast;e.deltaX=Math.abs(e.xPos-n._xPos(t)),e.xPos=n._xPos(t),e.velocityX=e.deltaX/(Date.now()-e.time),e.time=Date.now();var i=e.xPos-e.startingXPos,o=e.el.offsetWidth*e.options.activationPercent;e.el.style.transform="translateX("+i+"px)",e.el.style.opacity=1-Math.abs(i/o)}}},{key:"_onDragEnd",value:function(t){if(n._draggedToast){var e=n._draggedToast;e.panning=!1,e.el.classList.remove("panning");var i=e.xPos-e.startingXPos,o=e.el.offsetWidth*e.options.activationPercent;Math.abs(i)>o||e.velocityX>1?(e.wasSwiped=!0,e.remove()):(e.el.style.transition="transform .2s, opacity .2s",e.el.style.transform="",e.el.style.opacity=""),n._draggedToast=null}}},{key:"_xPos",value:function(t){return t.targetTouches&&t.targetTouches.length>=1?t.targetTouches[0].clientX:t.clientX}},{key:"removeAll",value:function(){for(var t in n._toasts)n._toasts[t].remove()}},{key:"defaults",get:function(){return i}}]),n}();n._toasts=[],n._container=null,n._draggedToast=null,Materialize.Toast=n,Materialize.toast=function(t,e,i,o){return new n(t,e,i,o)}}(jQuery,Materialize.Vel),function(t){var e={init:function(e){var i={menuWidth:300,edge:"left",closeOnClick:!1,draggable:!0,onOpen:null,onClose:null};e=t.extend(i,e),t(this).each(function(){var i=t(this),n=i.attr("data-activates"),o=t("#"+n);300!=e.menuWidth&&o.css("width",e.menuWidth);var a=t('.drag-target[data-sidenav="'+n+'"]');e.draggable?(a.length&&a.remove(),a=t('<div class="drag-target"></div>').attr("data-sidenav",n),t("body").append(a)):a=t(),"left"==e.edge?(o.css("transform","translateX(-100%)"),a.css({left:0})):(o.addClass("right-aligned").css("transform","translateX(100%)"),a.css({right:0})),o.hasClass("fixed")&&window.innerWidth>992&&o.css("transform","translateX(0)"),o.hasClass("fixed")&&t(window).resize(function(){window.innerWidth>992?0!==t("#sidenav-overlay").length&&l?r(!0):o.css("transform","translateX(0%)"):!1===l&&("left"===e.edge?o.css("transform","translateX(-100%)"):o.css("transform","translateX(100%)"))}),!0===e.closeOnClick&&o.on("click.itemclick","a:not(.collapsible-header)",function(){window.innerWidth>992&&o.hasClass("fixed")||r()});var r=function(i){s=!1,l=!1,t("body").css({overflow:"",width:""}),t("#sidenav-overlay").velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){t(this).remove()}}),"left"===e.edge?(a.css({width:"",right:"",left:"0"}),o.velocity({translateX:"-100%"},{duration:200,queue:!1,easing:"easeOutCubic",complete:function(){!0===i&&(o.removeAttr("style"),o.css("width",e.menuWidth))}})):(a.css({width:"",right:"0",left:""}),o.velocity({translateX:"100%"},{duration:200,queue:!1,easing:"easeOutCubic",complete:function(){!0===i&&(o.removeAttr("style"),o.css("width",e.menuWidth))}})),"function"==typeof e.onClose&&e.onClose.call(this,o)},s=!1,l=!1;e.draggable&&(a.on("click",function(){l&&r()}),a.hammer({prevent_default:!1}).on("pan",function(i){if("touch"==i.gesture.pointerType){i.gesture.direction;var n=i.gesture.center.x,a=i.gesture.center.y;i.gesture.velocityX;if(0===n&&0===a)return;var s=t("body"),c=t("#sidenav-overlay"),u=s.innerWidth();if(s.css("overflow","hidden"),s.width(u),0===c.length&&((c=t('<div id="sidenav-overlay"></div>')).css("opacity",0).click(function(){r()}),"function"==typeof e.onOpen&&e.onOpen.call(this,o),t("body").append(c)),"left"===e.edge&&(n>e.menuWidth?n=e.menuWidth:n<0&&(n=0)),"left"===e.edge)n<e.menuWidth/2?l=!1:n>=e.menuWidth/2&&(l=!0),o.css("transform","translateX("+(n-e.menuWidth)+"px)");else{n<window.innerWidth-e.menuWidth/2?l=!0:n>=window.innerWidth-e.menuWidth/2&&(l=!1);var d=n-e.menuWidth/2;d<0&&(d=0),o.css("transform","translateX("+d+"px)")}var p;"left"===e.edge?(p=n/e.menuWidth,c.velocity({opacity:p},{duration:10,queue:!1,easing:"easeOutQuad"})):(p=Math.abs((n-window.innerWidth)/e.menuWidth),c.velocity({opacity:p},{duration:10,queue:!1,easing:"easeOutQuad"}))}}).on("panend",function(i){if("touch"==i.gesture.pointerType){var n=t("#sidenav-overlay"),r=i.gesture.velocityX,c=i.gesture.center.x,u=c-e.menuWidth,d=c-e.menuWidth/2;u>0&&(u=0),d<0&&(d=0),s=!1,"left"===e.edge?l&&r<=.3||r<-.5?(0!==u&&o.velocity({translateX:[0,u]},{duration:300,queue:!1,easing:"easeOutQuad"}),n.velocity({opacity:1},{duration:50,queue:!1,easing:"easeOutQuad"}),a.css({width:"50%",right:0,left:""}),l=!0):(!l||r>.3)&&(t("body").css({overflow:"",width:""}),o.velocity({translateX:[-1*e.menuWidth-10,u]},{duration:200,queue:!1,easing:"easeOutQuad"}),n.velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){"function"==typeof e.onClose&&e.onClose.call(this,o),t(this).remove()}}),a.css({width:"10px",right:"",left:0})):l&&r>=-.3||r>.5?(0!==d&&o.velocity({translateX:[0,d]},{duration:300,queue:!1,easing:"easeOutQuad"}),n.velocity({opacity:1},{duration:50,queue:!1,easing:"easeOutQuad"}),a.css({width:"50%",right:"",left:0}),l=!0):(!l||r<-.3)&&(t("body").css({overflow:"",width:""}),o.velocity({translateX:[e.menuWidth+10,d]},{duration:200,queue:!1,easing:"easeOutQuad"}),n.velocity({opacity:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){"function"==typeof e.onClose&&e.onClose.call(this,o),t(this).remove()}}),a.css({width:"10px",right:0,left:""}))}})),i.off("click.sidenav").on("click.sidenav",function(){if(!0===l)l=!1,s=!1,r();else{var i=t("body"),n=t('<div id="sidenav-overlay"></div>'),c=i.innerWidth();i.css("overflow","hidden"),i.width(c),t("body").append(a),"left"===e.edge?(a.css({width:"50%",right:0,left:""}),o.velocity({translateX:[0,-1*e.menuWidth]},{duration:300,queue:!1,easing:"easeOutQuad"})):(a.css({width:"50%",right:"",left:0}),o.velocity({translateX:[0,e.menuWidth]},{duration:300,queue:!1,easing:"easeOutQuad"})),n.css("opacity",0).click(function(){l=!1,s=!1,r(),n.velocity({opacity:0},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){t(this).remove()}})}),t("body").append(n),n.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){l=!0,s=!1}}),"function"==typeof e.onOpen&&e.onOpen.call(this,o)}return!1})})},destroy:function(){var e=t("#sidenav-overlay"),i=t('.drag-target[data-sidenav="'+t(this).attr("data-activates")+'"]');e.trigger("click"),i.remove(),t(this).off("click"),e.remove()},show:function(){this.trigger("click")},hide:function(){t("#sidenav-overlay").trigger("click")}};t.fn.sideNav=function(i){return e[i]?e[i].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof i&&i?void t.error("Method "+i+" does not exist on jQuery.sideNav"):e.init.apply(this,arguments)}}(jQuery),function(t){function e(e,i,n,o){var r=t();return t.each(a,function(t,a){if(a.height()>0){var s=a.offset().top,l=a.offset().left,c=l+a.width(),u=s+a.height();!(l>i||c<o||s>n||u<e)&&r.push(a)}}),r}function i(i){++l;var n=o.scrollTop(),a=o.scrollLeft(),s=a+o.width(),u=n+o.height(),d=e(n+c.top+i||200,s+c.right,u+c.bottom,a+c.left);t.each(d,function(t,e){"number"!=typeof e.data("scrollSpy:ticks")&&e.triggerHandler("scrollSpy:enter"),e.data("scrollSpy:ticks",l)}),t.each(r,function(t,e){var i=e.data("scrollSpy:ticks");"number"==typeof i&&i!==l&&(e.triggerHandler("scrollSpy:exit"),e.data("scrollSpy:ticks",null))}),r=d}function n(){o.trigger("scrollSpy:winSize")}var o=t(window),a=[],r=[],s=!1,l=0,c={top:0,right:0,bottom:0,left:0};t.scrollSpy=function(e,n){var r={throttle:100,scrollOffset:200,activeClass:"active",getActiveElement:function(t){return'a[href="#'+t+'"]'}};n=t.extend(r,n);var l=[];(e=t(e)).each(function(e,i){a.push(t(i)),t(i).data("scrollSpy:id",e),t('a[href="#'+t(i).attr("id")+'"]').click(function(e){e.preventDefault();var i=t(Materialize.escapeHash(this.hash)).offset().top+1;t("html, body").animate({scrollTop:i-n.scrollOffset},{duration:400,queue:!1,easing:"easeOutCubic"})})}),c.top=n.offsetTop||0,c.right=n.offsetRight||0,c.bottom=n.offsetBottom||0,c.left=n.offsetLeft||0;var u=Materialize.throttle(function(){i(n.scrollOffset)},n.throttle||100),d=function(){t(document).ready(u)};return s||(o.on("scroll",d),o.on("resize",d),s=!0),setTimeout(d,0),e.on("scrollSpy:enter",function(){l=t.grep(l,function(t){return 0!=t.height()});var e=t(this);l[0]?(t(n.getActiveElement(l[0].attr("id"))).removeClass(n.activeClass),e.data("scrollSpy:id")<l[0].data("scrollSpy:id")?l.unshift(t(this)):l.push(t(this))):l.push(t(this)),t(n.getActiveElement(l[0].attr("id"))).addClass(n.activeClass)}),e.on("scrollSpy:exit",function(){if((l=t.grep(l,function(t){return 0!=t.height()}))[0]){t(n.getActiveElement(l[0].attr("id"))).removeClass(n.activeClass);var e=t(this);(l=t.grep(l,function(t){return t.attr("id")!=e.attr("id")}))[0]&&t(n.getActiveElement(l[0].attr("id"))).addClass(n.activeClass)}}),e},t.winSizeSpy=function(e){return t.winSizeSpy=function(){return o},e=e||{throttle:100},o.on("resize",Materialize.throttle(n,e.throttle||100))},t.fn.scrollSpy=function(e){return t.scrollSpy(t(this),e)}}(jQuery),function(t){t(document).ready(function(){function e(e){var i=e.css("font-family"),o=e.css("font-size"),a=e.css("line-height"),r=e.css("padding");o&&n.css("font-size",o),i&&n.css("font-family",i),a&&n.css("line-height",a),r&&n.css("padding",r),e.data("original-height")||e.data("original-height",e.height()),"off"===e.attr("wrap")&&n.css("overflow-wrap","normal").css("white-space","pre"),n.text(e.val()+"\n");var s=n.html().replace(/\n/g,"<br>");n.html(s),e.is(":visible")?n.css("width",e.width()):n.css("width",t(window).width()/2),e.data("original-height")<=n.height()?e.css("height",n.height()):e.val().length<e.data("previous-length")&&e.css("height",e.data("original-height")),e.data("previous-length",e.val().length)}Materialize.updateTextFields=function(){t("input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea").each(function(e,i){var n=t(this);t(i).val().length>0||t(i).is(":focus")||i.autofocus||void 0!==n.attr("placeholder")?n.siblings("label").addClass("active"):t(i)[0].validity?n.siblings("label").toggleClass("active",!0===t(i)[0].validity.badInput):n.siblings("label").removeClass("active")})};var i="input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea";t(document).on("change",i,function(){0===t(this).val().length&&void 0===t(this).attr("placeholder")||t(this).siblings("label").addClass("active"),validate_field(t(this))}),t(document).ready(function(){Materialize.updateTextFields()}),t(document).on("reset",function(e){var n=t(e.target);n.is("form")&&(n.find(i).removeClass("valid").removeClass("invalid"),n.find(i).each(function(){""===t(this).attr("value")&&t(this).siblings("label").removeClass("active")}),n.find("select.initialized").each(function(){var t=n.find("option[selected]").text();n.siblings("input.select-dropdown").val(t)}))}),t(document).on("focus",i,function(){t(this).siblings("label, .prefix").addClass("active")}),t(document).on("blur",i,function(){var e=t(this),i=".prefix";0===e.val().length&&!0!==e[0].validity.badInput&&void 0===e.attr("placeholder")&&(i+=", label"),e.siblings(i).removeClass("active"),validate_field(e)}),window.validate_field=function(t){var e=void 0!==t.attr("data-length"),i=parseInt(t.attr("data-length")),n=t.val().length;0!==t.val().length||!1!==t[0].validity.badInput||t.is(":required")?t.hasClass("validate")&&(t.is(":valid")&&e&&n<=i||t.is(":valid")&&!e?(t.removeClass("invalid"),t.addClass("valid")):(t.removeClass("valid"),t.addClass("invalid"))):t.hasClass("validate")&&(t.removeClass("valid"),t.removeClass("invalid"))};t(document).on("keyup.radio","input[type=radio], input[type=checkbox]",function(e){if(9===e.which)return t(this).addClass("tabbed"),void t(this).one("blur",function(e){t(this).removeClass("tabbed")})});var n=t(".hiddendiv").first();n.length||(n=t('<div class="hiddendiv common"></div>'),t("body").append(n));t(".materialize-textarea").each(function(){var e=t(this);e.data("original-height",e.height()),e.data("previous-length",e.val().length)}),t("body").on("keyup keydown autoresize",".materialize-textarea",function(){e(t(this))}),t(document).on("change",'.file-field input[type="file"]',function(){for(var e=t(this).closest(".file-field").find("input.file-path"),i=t(this)[0].files,n=[],o=0;o<i.length;o++)n.push(i[o].name);e.val(n.join(", ")),e.trigger("change")});var o="input[type=range]",a=!1;t(o).each(function(){var e=t('<span class="thumb"><span class="value"></span></span>');t(this).after(e)});var r=function(t){var e=-7+parseInt(t.parent().css("padding-left"))+"px";t.velocity({height:"30px",width:"30px",top:"-30px",marginLeft:e},{duration:300,easing:"easeOutExpo"})},s=function(t){var e=t.width()-15,i=parseFloat(t.attr("max")),n=parseFloat(t.attr("min"));return(parseFloat(t.val())-n)/(i-n)*e};t(document).on("change",o,function(e){var i=t(this).siblings(".thumb");i.find(".value").html(t(this).val()),i.hasClass("active")||r(i);var n=s(t(this));i.addClass("active").css("left",n)}),t(document).on("mousedown touchstart",o,function(e){var i=t(this).siblings(".thumb");if(i.length<=0&&(i=t('<span class="thumb"><span class="value"></span></span>'),t(this).after(i)),i.find(".value").html(t(this).val()),a=!0,t(this).addClass("active"),i.hasClass("active")||r(i),"input"!==e.type){var n=s(t(this));i.addClass("active").css("left",n)}}),t(document).on("mouseup touchend",".range-field",function(){a=!1,t(this).removeClass("active")}),t(document).on("input mousemove touchmove",".range-field",function(e){var i=t(this).children(".thumb"),n=t(this).find(o);if(a){i.hasClass("active")||r(i);var l=s(n);i.addClass("active").css("left",l),i.find(".value").html(i.siblings(o).val())}}),t(document).on("mouseout touchleave",".range-field",function(){if(!a){var e=t(this).children(".thumb"),i=7+parseInt(t(this).css("padding-left"))+"px";e.hasClass("active")&&e.velocity({height:"0",width:"0",top:"10px",marginLeft:i},{duration:100}),e.removeClass("active")}}),t.fn.autocomplete=function(e){var i={data:{},limit:1/0,onAutocomplete:null,minLength:1};return e=t.extend(i,e),this.each(function(){var i,n=t(this),o=e.data,a=0,r=-1,s=n.closest(".input-field");if(t.isEmptyObject(o))n.off("keyup.autocomplete focus.autocomplete");else{var l,c=t('<ul class="autocomplete-content dropdown-content"></ul>');s.length?(l=s.children(".autocomplete-content.dropdown-content").first()).length||s.append(c):(l=n.next(".autocomplete-content.dropdown-content")).length||n.after(c),l.length&&(c=l);var u=function(t,e){var i=e.find("img"),n=e.text().toLowerCase().indexOf(""+t.toLowerCase()),o=n+t.length-1,a=e.text().slice(0,n),r=e.text().slice(n,o+1),s=e.text().slice(o+1);e.html("<span>"+a+"<span class='highlight'>"+r+"</span>"+s+"</span>"),i.length&&e.prepend(i)},d=function(){r=-1,c.find(".active").removeClass("active")},p=function(){c.empty(),d(),i=void 0};n.off("blur.autocomplete").on("blur.autocomplete",function(){p()}),n.off("keyup.autocomplete focus.autocomplete").on("keyup.autocomplete focus.autocomplete",function(r){a=0;var s=n.val().toLowerCase();if(13!==r.which&&38!==r.which&&40!==r.which){if(i!==s&&(p(),s.length>=e.minLength))for(var l in o)if(o.hasOwnProperty(l)&&-1!==l.toLowerCase().indexOf(s)){if(a>=e.limit)break;var d=t("<li></li>");o[l]?d.append('<img src="'+o[l]+'" class="right circle"><span>'+l+"</span>"):d.append("<span>"+l+"</span>"),c.append(d),u(s,d),a++}i=s}}),n.off("keydown.autocomplete").on("keydown.autocomplete",function(t){var e,i=t.which,n=c.children("li").length,o=c.children(".active").first();13===i&&r>=0?(e=c.children("li").eq(r)).length&&(e.trigger("mousedown.autocomplete"),t.preventDefault()):38!==i&&40!==i||(t.preventDefault(),38===i&&r>0&&r--,40===i&&r<n-1&&r++,o.removeClass("active"),r>=0&&c.children("li").eq(r).addClass("active"))}),c.off("mousedown.autocomplete touchstart.autocomplete").on("mousedown.autocomplete touchstart.autocomplete","li",function(){var i=t(this).text().trim();n.val(i),n.trigger("change"),p(),"function"==typeof e.onAutocomplete&&e.onAutocomplete.call(this,i)})}})}}),t.fn.material_select=function(e){function i(t,e,i){var o=t.indexOf(e),a=-1===o;return a?t.push(e):t.splice(o,1),i.siblings("ul.dropdown-content").find("li:not(.optgroup)").eq(e).toggleClass("active"),i.find("option").eq(e).prop("selected",a),n(t,i),a}function n(t,e){for(var i="",n=0,o=t.length;n<o;n++){var a=e.find("option").eq(t[n]).text();i+=0===n?a:", "+a}""===i&&(i=e.find("option:disabled").eq(0).text()),e.siblings("input.select-dropdown").val(i)}t(this).each(function(){var n=t(this);if(!n.hasClass("browser-default")){var o=!!n.attr("multiple"),a=n.attr("data-select-id");if(a&&(n.parent().find("span.caret").remove(),n.parent().find("input").remove(),n.unwrap(),t("ul#select-options-"+a).remove()),"destroy"===e)return n.removeAttr("data-select-id").removeClass("initialized"),void t(window).off("click.select");var r=Materialize.guid();n.attr("data-select-id",r);var s=t('<div class="select-wrapper"></div>');s.addClass(n.attr("class")),n.is(":disabled")&&s.addClass("disabled");var l=t('<ul id="select-options-'+r+'" class="dropdown-content select-dropdown '+(o?"multiple-select-dropdown":"")+'"></ul>'),c=n.children("option, optgroup"),u=[],d=!1,p=n.find("option:selected").html()||n.find("option:first").html()||"",h=function(e,i,n){var a=i.is(":disabled")?"disabled ":"",r="optgroup-option"===n?"optgroup-option ":"",s=o?'<input type="checkbox"'+a+"/><label></label>":"",c=i.data("icon"),u=i.attr("class");if(c){var d="";return u&&(d=' class="'+u+'"'),l.append(t('<li class="'+a+r+'"><img alt="" src="'+c+'"'+d+"><span>"+s+i.html()+"</span></li>")),!0}l.append(t('<li class="'+a+r+'"><span>'+s+i.html()+"</span></li>"))};c.length&&c.each(function(){if(t(this).is("option"))o?h(0,t(this),"multiple"):h(0,t(this));else if(t(this).is("optgroup")){var e=t(this).children("option");l.append(t('<li class="optgroup"><span>'+t(this).attr("label")+"</span></li>")),e.each(function(){h(0,t(this),"optgroup-option")})}}),l.find("li:not(.optgroup)").each(function(a){t(this).click(function(r){if(!t(this).hasClass("disabled")&&!t(this).hasClass("optgroup")){var s=!0;o?(t('input[type="checkbox"]',this).prop("checked",function(t,e){return!e}),s=i(u,a,n),m.trigger("focus")):(l.find("li").removeClass("active"),t(this).toggleClass("active"),m.val(t(this).text())),g(l,t(this)),n.find("option").eq(a).prop("selected",s),n.trigger("change"),void 0!==e&&e()}r.stopPropagation()})}),n.wrap(s);var f=t('<span class="caret">▼</span>'),v=p.replace(/"/g,"""),m=t('<input type="text" class="select-dropdown" readonly="true" '+(n.is(":disabled")?"disabled":"")+' data-activates="select-options-'+r+'" value="'+v+'"/>');n.before(m),m.before(f),m.after(l),n.is(":disabled")||m.dropdown({hover:!1}),n.attr("tabindex")&&t(m[0]).attr("tabindex",n.attr("tabindex")),n.addClass("initialized"),m.on({focus:function(){if(t("ul.select-dropdown").not(l[0]).is(":visible")&&(t("input.select-dropdown").trigger("close"),t(window).off("click.select")),!l.is(":visible")){t(this).trigger("open",["focus"]);var e=t(this).val();o&&e.indexOf(",")>=0&&(e=e.split(",")[0]);var i=l.find("li").filter(function(){return t(this).text().toLowerCase()===e.toLowerCase()})[0];g(l,i,!0),t(window).off("click.select").on("click.select",function(){o&&(d||m.trigger("close")),t(window).off("click.select")})}},click:function(t){t.stopPropagation()}}),m.on("blur",function(){o||(t(this).trigger("close"),t(window).off("click.select")),l.find("li.selected").removeClass("selected")}),l.hover(function(){d=!0},function(){d=!1}),o&&n.find("option:selected:not(:disabled)").each(function(){var t=this.index;i(u,t,n),l.find("li:not(.optgroup)").eq(t).find(":checkbox").prop("checked",!0)});var g=function(e,i,n){if(i){e.find("li.selected").removeClass("selected");var a=t(i);a.addClass("selected"),o&&!n||l.scrollTo(a)}},y=[];m.on("keydown",function(e){if(9!=e.which)if(40!=e.which||l.is(":visible")){if(13!=e.which||l.is(":visible")){e.preventDefault();var i=String.fromCharCode(e.which).toLowerCase(),n=[9,13,27,38,40];if(i&&-1===n.indexOf(e.which)){y.push(i);var a=y.join(""),r=l.find("li").filter(function(){return 0===t(this).text().toLowerCase().indexOf(a)})[0];r&&g(l,r)}if(13==e.which){var s=l.find("li.selected:not(.disabled)")[0];s&&(t(s).trigger("click"),o||m.trigger("close"))}40==e.which&&(r=l.find("li.selected").length?l.find("li.selected").next("li:not(.disabled)")[0]:l.find("li:not(.disabled)")[0],g(l,r)),27==e.which&&m.trigger("close"),38==e.which&&(r=l.find("li.selected").prev("li:not(.disabled)")[0])&&g(l,r),setTimeout(function(){y=[]},1e3)}}else m.trigger("open");else m.trigger("close")})}})}}(jQuery),function(t){var e={init:function(e){var i={indicators:!0,height:400,transition:500,interval:6e3};return e=t.extend(i,e),this.each(function(){function i(t,e){t.hasClass("center-align")?t.velocity({opacity:0,translateY:-100},{duration:e,queue:!1}):t.hasClass("right-align")?t.velocity({opacity:0,translateX:100},{duration:e,queue:!1}):t.hasClass("left-align")&&t.velocity({opacity:0,translateX:-100},{duration:e,queue:!1})}function n(t){t>=c.length?t=0:t<0&&(t=c.length-1),(u=l.find(".active").index())!=t&&(o=c.eq(u),$caption=o.find(".caption"),o.removeClass("active"),o.velocity({opacity:0},{duration:e.transition,queue:!1,easing:"easeOutQuad",complete:function(){c.not(".active").velocity({opacity:0,translateX:0,translateY:0},{duration:0,queue:!1})}}),i($caption,e.transition),e.indicators&&a.eq(u).removeClass("active"),c.eq(t).velocity({opacity:1},{duration:e.transition,queue:!1,easing:"easeOutQuad"}),c.eq(t).find(".caption").velocity({opacity:1,translateX:0,translateY:0},{duration:e.transition,delay:e.transition,queue:!1,easing:"easeOutQuad"}),c.eq(t).addClass("active"),e.indicators&&a.eq(t).addClass("active"))}var o,a,r,s=t(this),l=s.find("ul.slides").first(),c=l.find("> li"),u=l.find(".active").index();-1!=u&&(o=c.eq(u)),s.hasClass("fullscreen")||(e.indicators?s.height(e.height+40):s.height(e.height),l.height(e.height)),c.find(".caption").each(function(){i(t(this),0)}),c.find("img").each(function(){var e="data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==";t(this).attr("src")!==e&&(t(this).css("background-image",'url("'+t(this).attr("src")+'")'),t(this).attr("src",e))}),e.indicators&&(a=t('<ul class="indicators"></ul>'),c.each(function(i){var o=t('<li class="indicator-item"></li>');o.click(function(){n(l.parent().find(t(this)).index()),clearInterval(r),r=setInterval(function(){u=l.find(".active").index(),c.length==u+1?u=0:u+=1,n(u)},e.transition+e.interval)}),a.append(o)}),s.append(a),a=s.find("ul.indicators").find("li.indicator-item")),o?o.show():(c.first().addClass("active").velocity({opacity:1},{duration:e.transition,queue:!1,easing:"easeOutQuad"}),u=0,o=c.eq(u),e.indicators&&a.eq(u).addClass("active")),o.find("img").each(function(){o.find(".caption").velocity({opacity:1,translateX:0,translateY:0},{duration:e.transition,queue:!1,easing:"easeOutQuad"})}),r=setInterval(function(){n((u=l.find(".active").index())+1)},e.transition+e.interval);var d=!1,p=!1,h=!1;s.hammer({prevent_default:!1}).on("pan",function(t){if("touch"===t.gesture.pointerType){clearInterval(r);var e=t.gesture.direction,i=t.gesture.deltaX,n=t.gesture.velocityX,o=t.gesture.velocityY;$curr_slide=l.find(".active"),Math.abs(n)>Math.abs(o)&&$curr_slide.velocity({translateX:i},{duration:50,queue:!1,easing:"easeOutQuad"}),4===e&&(i>s.innerWidth()/2||n<-.65)?h=!0:2===e&&(i<-1*s.innerWidth()/2||n>.65)&&(p=!0);var a;p&&(0===(a=$curr_slide.next()).length&&(a=c.first()),a.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad"})),h&&(0===(a=$curr_slide.prev()).length&&(a=c.last()),a.velocity({opacity:1},{duration:300,queue:!1,easing:"easeOutQuad"}))}}).on("panend",function(t){"touch"===t.gesture.pointerType&&($curr_slide=l.find(".active"),d=!1,curr_index=l.find(".active").index(),!h&&!p||c.length<=1?$curr_slide.velocity({translateX:0},{duration:300,queue:!1,easing:"easeOutQuad"}):p?(n(curr_index+1),$curr_slide.velocity({translateX:-1*s.innerWidth()},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){$curr_slide.velocity({opacity:0,translateX:0},{duration:0,queue:!1})}})):h&&(n(curr_index-1),$curr_slide.velocity({translateX:s.innerWidth()},{duration:300,queue:!1,easing:"easeOutQuad",complete:function(){$curr_slide.velocity({opacity:0,translateX:0},{duration:0,queue:!1})}})),p=!1,h=!1,clearInterval(r),r=setInterval(function(){u=l.find(".active").index(),c.length==u+1?u=0:u+=1,n(u)},e.transition+e.interval))}),s.on("sliderPause",function(){clearInterval(r)}),s.on("sliderStart",function(){clearInterval(r),r=setInterval(function(){u=l.find(".active").index(),c.length==u+1?u=0:u+=1,n(u)},e.transition+e.interval)}),s.on("sliderNext",function(){n((u=l.find(".active").index())+1)}),s.on("sliderPrev",function(){n((u=l.find(".active").index())-1)})})},pause:function(){t(this).trigger("sliderPause")},start:function(){t(this).trigger("sliderStart")},next:function(){t(this).trigger("sliderNext")},prev:function(){t(this).trigger("sliderPrev")}};t.fn.slider=function(i){return e[i]?e[i].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof i&&i?void t.error("Method "+i+" does not exist on jQuery.tooltip"):e.init.apply(this,arguments)}}(jQuery),function(t){t(document).ready(function(){t(document).on("click.card",".card",function(e){if(t(this).find("> .card-reveal").length){var i=t(e.target).closest(".card");void 0===i.data("initialOverflow")&&i.data("initialOverflow",void 0===i.css("overflow")?"":i.css("overflow")),t(e.target).is(t(".card-reveal .card-title"))||t(e.target).is(t(".card-reveal .card-title i"))?t(this).find(".card-reveal").velocity({translateY:0},{duration:225,queue:!1,easing:"easeInOutQuad",complete:function(){t(this).css({display:"none"}),i.css("overflow",i.data("initialOverflow"))}}):(t(e.target).is(t(".card .activator"))||t(e.target).is(t(".card .activator i")))&&(i.css("overflow","hidden"),t(this).find(".card-reveal").css({display:"block"}).velocity("stop",!1).velocity({translateY:"-100%"},{duration:300,queue:!1,easing:"easeInOutQuad"}))}})})}(jQuery),function(t){var e={data:[],placeholder:"",secondaryPlaceholder:"",autocompleteOptions:{}};t(document).ready(function(){t(document).on("click",".chip .close",function(e){t(this).closest(".chips").attr("data-initialized")||t(this).closest(".chip").remove()})}),t.fn.material_chip=function(i){var n=this;if(this.$el=t(this),this.$document=t(document),this.SELS={CHIPS:".chips",CHIP:".chip",INPUT:"input",DELETE:".material-icons",SELECTED_CHIP:".selected"},"data"===i)return this.$el.data("chips");var o=t.extend({},e,i);n.hasAutocomplete=!t.isEmptyObject(o.autocompleteOptions.data),this.init=function(){var e=0;n.$el.each(function(){var i=t(this),a=Materialize.guid();n.chipId=a,o.data&&o.data instanceof Array||(o.data=[]),i.data("chips",o.data),i.attr("data-index",e),i.attr("data-initialized",!0),i.hasClass(n.SELS.CHIPS)||i.addClass("chips"),n.chips(i,a),e++})},this.handleEvents=function(){var e=n.SELS;n.$document.off("click.chips-focus",e.CHIPS).on("click.chips-focus",e.CHIPS,function(i){t(i.target).find(e.INPUT).focus()}),n.$document.off("click.chips-select",e.CHIP).on("click.chips-select",e.CHIP,function(i){var o=t(i.target);if(o.length){var a=o.hasClass("selected"),r=o.closest(e.CHIPS);t(e.CHIP).removeClass("selected"),a||n.selectChip(o.index(),r)}}),n.$document.off("keydown.chips").on("keydown.chips",function(i){if(!t(i.target).is("input, textarea")){var o,a=n.$document.find(e.CHIP+e.SELECTED_CHIP),r=a.closest(e.CHIPS),s=a.siblings(e.CHIP).length;if(a.length)if(8===i.which||46===i.which){i.preventDefault(),o=a.index(),n.deleteChip(o,r);var l=null;o+1<s?l=o:o!==s&&o+1!==s||(l=s-1),l<0&&(l=null),null!==l&&n.selectChip(l,r),s||r.find("input").focus()}else if(37===i.which){if((o=a.index()-1)<0)return;t(e.CHIP).removeClass("selected"),n.selectChip(o,r)}else if(39===i.which){if(o=a.index()+1,t(e.CHIP).removeClass("selected"),o>s)return void r.find("input").focus();n.selectChip(o,r)}}}),n.$document.off("focusin.chips",e.CHIPS+" "+e.INPUT).on("focusin.chips",e.CHIPS+" "+e.INPUT,function(i){var n=t(i.target).closest(e.CHIPS);n.addClass("focus"),n.siblings("label, .prefix").addClass("active"),t(e.CHIP).removeClass("selected")}),n.$document.off("focusout.chips",e.CHIPS+" "+e.INPUT).on("focusout.chips",e.CHIPS+" "+e.INPUT,function(i){var n=t(i.target).closest(e.CHIPS);n.removeClass("focus"),void 0!==n.data("chips")&&n.data("chips").length||n.siblings("label").removeClass("active"),n.siblings(".prefix").removeClass("active")}),n.$document.off("keydown.chips-add",e.CHIPS+" "+e.INPUT).on("keydown.chips-add",e.CHIPS+" "+e.INPUT,function(i){var o=t(i.target),a=o.closest(e.CHIPS),r=a.children(e.CHIP).length;if(13===i.which){if(n.hasAutocomplete&&a.find(".autocomplete-content.dropdown-content").length&&a.find(".autocomplete-content.dropdown-content").children().length)return;return i.preventDefault(),n.addChip({tag:o.val()},a),void o.val("")}if((8===i.keyCode||37===i.keyCode)&&""===o.val()&&r)return i.preventDefault(),n.selectChip(r-1,a),void o.blur()}),n.$document.off("click.chips-delete",e.CHIPS+" "+e.DELETE).on("click.chips-delete",e.CHIPS+" "+e.DELETE,function(i){var o=t(i.target),a=o.closest(e.CHIPS),r=o.closest(e.CHIP);i.stopPropagation(),n.deleteChip(r.index(),a),a.find("input").focus()})},this.chips=function(e,i){e.empty(),e.data("chips").forEach(function(t){e.append(n.renderChip(t))}),e.append(t('<input id="'+i+'" class="input" placeholder="">')),n.setPlaceholder(e);var a=e.next("label");a.length&&(a.attr("for",i),void 0!==e.data("chips")&&e.data("chips").length&&a.addClass("active"));var r=t("#"+i);n.hasAutocomplete&&(o.autocompleteOptions.onAutocomplete=function(t){n.addChip({tag:t},e),r.val(""),r.focus()},r.autocomplete(o.autocompleteOptions))},this.renderChip=function(e){if(e.tag){var i=t('<div class="chip"></div>');return i.text(e.tag),e.image&&i.prepend(t("<img />").attr("src",e.image)),i.append(t('<i class="material-icons close">close</i>')),i}},this.setPlaceholder=function(t){void 0!==t.data("chips")&&!t.data("chips").length&&o.placeholder?t.find("input").prop("placeholder",o.placeholder):(void 0===t.data("chips")||t.data("chips").length)&&o.secondaryPlaceholder&&t.find("input").prop("placeholder",o.secondaryPlaceholder)},this.isValid=function(t,e){for(var i=t.data("chips"),n=!1,o=0;o<i.length;o++)if(i[o].tag===e.tag)return void(n=!0);return""!==e.tag&&!n},this.addChip=function(t,e){if(n.isValid(e,t)){for(var i=n.renderChip(t),o=[],a=e.data("chips"),r=0;r<a.length;r++)o.push(a[r]);o.push(t),e.data("chips",o),i.insertBefore(e.find("input")),e.trigger("chip.add",t),n.setPlaceholder(e)}},this.deleteChip=function(t,e){var i=e.data("chips")[t];e.find(".chip").eq(t).remove();for(var o=[],a=e.data("chips"),r=0;r<a.length;r++)r!==t&&o.push(a[r]);e.data("chips",o),e.trigger("chip.delete",i),n.setPlaceholder(e)},this.selectChip=function(t,e){var i=e.find(".chip").eq(t);i&&!1===i.hasClass("selected")&&(i.addClass("selected"),e.trigger("chip.select",e.data("chips")[t]))},this.getChipsElement=function(t,e){return e.eq(t)},this.init(),this.handleEvents()}}(jQuery),function(t){t.fn.pushpin=function(e){var i={top:0,bottom:1/0,offset:0};return"remove"===e?(this.each(function(){(id=t(this).data("pushpin-id"))&&(t(window).off("scroll."+id),t(this).removeData("pushpin-id").removeClass("pin-top pinned pin-bottom").removeAttr("style"))}),!1):(e=t.extend(i,e),$index=0,this.each(function(){function i(t){t.removeClass("pin-top"),t.removeClass("pinned"),t.removeClass("pin-bottom")}function n(n,o){n.each(function(){e.top<=o&&e.bottom>=o&&!t(this).hasClass("pinned")&&(i(t(this)),t(this).css("top",e.offset),t(this).addClass("pinned")),o<e.top&&!t(this).hasClass("pin-top")&&(i(t(this)),t(this).css("top",0),t(this).addClass("pin-top")),o>e.bottom&&!t(this).hasClass("pin-bottom")&&(i(t(this)),t(this).addClass("pin-bottom"),t(this).css("top",e.bottom-r))})}var o=Materialize.guid(),a=t(this),r=t(this).offset().top;t(this).data("pushpin-id",o),n(a,t(window).scrollTop()),t(window).on("scroll."+o,function(){var i=t(window).scrollTop()+e.offset;n(a,i)})}))}}(jQuery),function(t){t(document).ready(function(){t.fn.reverse=[].reverse,t(document).on("mouseenter.fixedActionBtn",".fixed-action-btn:not(.click-to-toggle):not(.toolbar)",function(i){var n=t(this);e(n)}),t(document).on("mouseleave.fixedActionBtn",".fixed-action-btn:not(.click-to-toggle):not(.toolbar)",function(e){var n=t(this);i(n)}),t(document).on("click.fabClickToggle",".fixed-action-btn.click-to-toggle > a",function(n){var o=t(this).parent();o.hasClass("active")?i(o):e(o)}),t(document).on("click.fabToolbar",".fixed-action-btn.toolbar > a",function(e){var i=t(this).parent();n(i)})}),t.fn.extend({openFAB:function(){e(t(this))},closeFAB:function(){i(t(this))},openToolbar:function(){n(t(this))},closeToolbar:function(){o(t(this))}});var e=function(e){var i=e;if(!1===i.hasClass("active")){var n,o;!0===i.hasClass("horizontal")?o=40:n=40,i.addClass("active"),i.find("ul .btn-floating").velocity({scaleY:".4",scaleX:".4",translateY:n+"px",translateX:o+"px"},{duration:0});var a=0;i.find("ul .btn-floating").reverse().each(function(){t(this).velocity({opacity:"1",scaleX:"1",scaleY:"1",translateY:"0",translateX:"0"},{duration:80,delay:a}),a+=40})}},i=function(t){var e,i,n=t;!0===n.hasClass("horizontal")?i=40:e=40,n.removeClass("active");n.find("ul .btn-floating").velocity("stop",!0),n.find("ul .btn-floating").velocity({opacity:"0",scaleX:".4",scaleY:".4",translateY:e+"px",translateX:i+"px"},{duration:80})},n=function(e){if("true"!==e.attr("data-open")){var i,n,a,r=window.innerWidth,s=window.innerHeight,l=e[0].getBoundingClientRect(),c=e.find("> a").first(),u=e.find("> ul").first(),d=t('<div class="fab-backdrop"></div>'),p=c.css("background-color");c.append(d),i=l.left-r/2+l.width/2,n=s-l.bottom,a=r/d.width(),e.attr("data-origin-bottom",l.bottom),e.attr("data-origin-left",l.left),e.attr("data-origin-width",l.width),e.addClass("active"),e.attr("data-open",!0),e.css({"text-align":"center",width:"100%",bottom:0,left:0,transform:"translateX("+i+"px)",transition:"none"}),c.css({transform:"translateY("+-n+"px)",transition:"none"}),d.css({"background-color":p}),setTimeout(function(){e.css({transform:"",transition:"transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s"}),c.css({overflow:"visible",transform:"",transition:"transform .2s"}),setTimeout(function(){e.css({overflow:"hidden","background-color":p}),d.css({transform:"scale("+a+")",transition:"transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)"}),u.find("> li > a").css({opacity:1}),t(window).on("scroll.fabToolbarClose",function(){o(e),t(window).off("scroll.fabToolbarClose"),t(document).off("click.fabToolbarClose")}),t(document).on("click.fabToolbarClose",function(i){t(i.target).closest(u).length||(o(e),t(window).off("scroll.fabToolbarClose"),t(document).off("click.fabToolbarClose"))})},100)},0)}},o=function(t){if("true"===t.attr("data-open")){var e,i,n=window.innerWidth,o=window.innerHeight,a=t.attr("data-origin-width"),r=t.attr("data-origin-bottom"),s=t.attr("data-origin-left"),l=t.find("> .btn-floating").first(),c=t.find("> ul").first(),u=t.find(".fab-backdrop"),d=l.css("background-color");e=s-n/2+a/2,i=o-r,n/u.width(),t.removeClass("active"),t.attr("data-open",!1),t.css({"background-color":"transparent",transition:"none"}),l.css({transition:"none"}),u.css({transform:"scale(0)","background-color":d}),c.find("> li > a").css({opacity:""}),setTimeout(function(){u.remove(),t.css({"text-align":"",width:"",bottom:"",left:"",overflow:"","background-color":"",transform:"translate3d("+-e+"px,0,0)"}),l.css({overflow:"",transform:"translate3d(0,"+i+"px,0)"}),setTimeout(function(){t.css({transform:"translate3d(0,0,0)",transition:"transform .2s"}),l.css({transform:"translate3d(0,0,0)",transition:"transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)"})},20)},200)}}}(jQuery),function(t){Materialize.fadeInImage=function(e){var i;if("string"==typeof e)i=t(e);else{if("object"!=typeof e)return;i=e}i.css({opacity:0}),t(i).velocity({opacity:1},{duration:650,queue:!1,easing:"easeOutSine"}),t(i).velocity({opacity:1},{duration:1300,queue:!1,easing:"swing",step:function(e,i){i.start=100;var n=e/100,o=150-(100-e)/1.75;o<100&&(o=100),e>=0&&t(this).css({"-webkit-filter":"grayscale("+n+")brightness("+o+"%)",filter:"grayscale("+n+")brightness("+o+"%)"})}})},Materialize.showStaggeredList=function(e){var i;if("string"==typeof e)i=t(e);else{if("object"!=typeof e)return;i=e}var n=0;i.find("li").velocity({translateX:"-100px"},{duration:0}),i.find("li").each(function(){t(this).velocity({opacity:"1",translateX:"0"},{duration:800,delay:n,easing:[60,10]}),n+=120})},t(document).ready(function(){var e=!1,i=!1;t(".dismissable").each(function(){t(this).hammer({prevent_default:!1}).on("pan",function(n){if("touch"===n.gesture.pointerType){var o=t(this),a=n.gesture.direction,r=n.gesture.deltaX,s=n.gesture.velocityX;o.velocity({translateX:r},{duration:50,queue:!1,easing:"easeOutQuad"}),4===a&&(r>o.innerWidth()/2||s<-.75)&&(e=!0),2===a&&(r<-1*o.innerWidth()/2||s>.75)&&(i=!0)}}).on("panend",function(n){if(Math.abs(n.gesture.deltaX)<t(this).innerWidth()/2&&(i=!1,e=!1),"touch"===n.gesture.pointerType){var o=t(this);if(e||i){var a;a=e?o.innerWidth():-1*o.innerWidth(),o.velocity({translateX:a},{duration:100,queue:!1,easing:"easeOutQuad",complete:function(){o.css("border","none"),o.velocity({height:0,padding:0},{duration:200,queue:!1,easing:"easeOutQuad",complete:function(){o.remove()}})}})}else o.velocity({translateX:0},{duration:100,queue:!1,easing:"easeOutQuad"});e=!1,i=!1}})})})}(jQuery),function(t){var e=!1;Materialize.scrollFire=function(t){var i=function(){for(var e=window.pageYOffset+window.innerHeight,i=0;i<t.length;i++){var n=t[i],o=n.selector,a=n.offset,r=n.callback,s=document.querySelector(o);null!==s&&e>s.getBoundingClientRect().top+window.pageYOffset+a&&!0!==n.done&&("function"==typeof r?r.call(this,s):"string"==typeof r&&new Function(r)(s),n.done=!0)}},n=Materialize.throttle(function(){i()},t.throttle||100);e||(window.addEventListener("scroll",n),window.addEventListener("resize",n),e=!0),setTimeout(n,0)}}(jQuery),function(t){Materialize.Picker=t(jQuery)}(function(t){function e(a,s,u,d){function p(){return e._.node("div",e._.node("div",e._.node("div",e._.node("div",T.component.nodes(b.open),k.box),k.wrap),k.frame),k.holder)}function h(){x.data(s,T).addClass(k.input).attr("tabindex",-1).val(x.data("value")?T.get("select",w.format):a.value),w.editable||x.on("focus."+b.id+" click."+b.id,function(t){t.preventDefault(),T.$root.eq(0).focus()}).on("keydown."+b.id,m),o(a,{haspopup:!0,expanded:!1,readonly:!1,owns:a.id+"_root"})}function f(){T.$root.on({keydown:m,focusin:function(t){T.$root.removeClass(k.focused),t.stopPropagation()},"mousedown click":function(e){var i=e.target;i!=T.$root.children()[0]&&(e.stopPropagation(),"mousedown"!=e.type||t(i).is("input, select, textarea, button, option")||(e.preventDefault(),T.$root.eq(0).focus()))}}).on({focus:function(){x.addClass(k.target)},blur:function(){x.removeClass(k.target)}}).on("focus.toOpen",g).on("click","[data-pick], [data-nav], [data-clear], [data-close]",function(){var e=t(this),i=e.data(),n=e.hasClass(k.navDisabled)||e.hasClass(k.disabled),o=r();o=o&&(o.type||o.href)&&o,(n||o&&!t.contains(T.$root[0],o))&&T.$root.eq(0).focus(),!n&&i.nav?T.set("highlight",T.component.item.highlight,{nav:i.nav}):!n&&"pick"in i?(T.set("select",i.pick),w.closeOnSelect&&T.close(!0)):i.clear?(T.clear(),w.closeOnSelect&&T.close(!0)):i.close&&T.close(!0)}),o(T.$root[0],"hidden",!0)}function v(){var e;!0===w.hiddenName?(e=a.name,a.name=""):e=(e=["string"==typeof w.hiddenPrefix?w.hiddenPrefix:"","string"==typeof w.hiddenSuffix?w.hiddenSuffix:"_submit"])[0]+a.name+e[1],T._hidden=t('<input type=hidden name="'+e+'"'+(x.data("value")||a.value?' value="'+T.get("select",w.formatSubmit)+'"':"")+">")[0],x.on("change."+b.id,function(){T._hidden.value=a.value?T.get("select",w.formatSubmit):""}),w.container?t(w.container).append(T._hidden):x.before(T._hidden)}function m(t){var e=t.keyCode,i=/^(8|46)$/.test(e);if(27==e)return T.close(),!1;(32==e||i||!b.open&&T.component.key[e])&&(t.preventDefault(),t.stopPropagation(),i?T.clear().close():T.open())}function g(t){t.stopPropagation(),"focus"==t.type&&T.$root.addClass(k.focused),T.open()}if(!a)return e;var y=!1,b={id:a.id||"P"+Math.abs(~~(Math.random()*new Date))},w=u?t.extend(!0,{},u.defaults,d):d||{},k=t.extend({},e.klasses(),w.klass),x=t(a),C=function(){return this.start()},T=C.prototype={constructor:C,$node:x,start:function(){return b&&b.start?T:(b.methods={},b.start=!0,b.open=!1,b.type=a.type,a.autofocus=a==r(),a.readOnly=!w.editable,a.id=a.id||b.id,"text"!=a.type&&(a.type="text"),T.component=new u(T,w),T.$root=t(e._.node("div",p(),k.picker,'id="'+a.id+'_root" tabindex="0"')),f(),w.formatSubmit&&v(),h(),w.container?t(w.container).append(T.$root):x.before(T.$root),T.on({start:T.component.onStart,render:T.component.onRender,stop:T.component.onStop,open:T.component.onOpen,close:T.component.onClose,set:T.component.onSet}).on({start:w.onStart,render:w.onRender,stop:w.onStop,open:w.onOpen,close:w.onClose,set:w.onSet}),y=i(T.$root.children()[0]),a.autofocus&&T.open(),T.trigger("start").trigger("render"))},render:function(t){return t?T.$root.html(p()):T.$root.find("."+k.box).html(T.component.nodes(b.open)),T.trigger("render")},stop:function(){return b.start?(T.close(),T._hidden&&T._hidden.parentNode.removeChild(T._hidden),T.$root.remove(),x.removeClass(k.input).removeData(s),setTimeout(function(){x.off("."+b.id)},0),a.type=b.type,a.readOnly=!1,T.trigger("stop"),b.methods={},b.start=!1,T):T},open:function(i){return b.open?T:(x.addClass(k.active),o(a,"expanded",!0),setTimeout(function(){T.$root.addClass(k.opened),o(T.$root[0],"hidden",!1)},0),!1!==i&&(b.open=!0,y&&c.css("overflow","hidden").css("padding-right","+="+n()),T.$root.eq(0).focus(),l.on("click."+b.id+" focusin."+b.id,function(t){var e=t.target;e!=a&&e!=document&&3!=t.which&&T.close(e===T.$root.children()[0])}).on("keydown."+b.id,function(i){var n=i.keyCode,o=T.component.key[n],a=i.target;27==n?T.close(!0):a!=T.$root[0]||!o&&13!=n?t.contains(T.$root[0],a)&&13==n&&(i.preventDefault(),a.click()):(i.preventDefault(),o?e._.trigger(T.component.key.go,T,[e._.trigger(o)]):T.$root.find("."+k.highlighted).hasClass(k.disabled)||(T.set("select",T.component.item.highlight),w.closeOnSelect&&T.close(!0)))})),T.trigger("open"))},close:function(t){return t&&(T.$root.off("focus.toOpen").eq(0).focus(),setTimeout(function(){T.$root.on("focus.toOpen",g)},0)),x.removeClass(k.active),o(a,"expanded",!1),setTimeout(function(){T.$root.removeClass(k.opened+" "+k.focused),o(T.$root[0],"hidden",!0)},0),b.open?(b.open=!1,y&&c.css("overflow","").css("padding-right","-="+n()),l.off("."+b.id),T.trigger("close")):T},clear:function(t){return T.set("clear",null,t)},set:function(e,i,n){var o,a,r=t.isPlainObject(e),s=r?e:{};if(n=r&&t.isPlainObject(i)?i:n||{},e){r||(s[e]=i);for(o in s)a=s[o],o in T.component.item&&(void 0===a&&(a=null),T.component.set(o,a,n)),"select"!=o&&"clear"!=o||x.val("clear"==o?"":T.get(o,w.format)).trigger("change");T.render()}return n.muted?T:T.trigger("set",s)},get:function(t,i){if(t=t||"value",null!=b[t])return b[t];if("valueSubmit"==t){if(T._hidden)return T._hidden.value;t="value"}if("value"==t)return a.value;if(t in T.component.item){if("string"==typeof i){var n=T.component.get(t);return n?e._.trigger(T.component.formats.toString,T.component,[i,n]):""}return T.component.get(t)}},on:function(e,i,n){var o,a,r=t.isPlainObject(e),s=r?e:{};if(e){r||(s[e]=i);for(o in s)a=s[o],n&&(o="_"+o),b.methods[o]=b.methods[o]||[],b.methods[o].push(a)}return T},off:function(){var t,e,i=arguments;for(t=0,namesCount=i.length;t<namesCount;t+=1)(e=i[t])in b.methods&&delete b.methods[e];return T},trigger:function(t,i){var n=function(t){var n=b.methods[t];n&&n.map(function(t){e._.trigger(t,T,[i])})};return n("_"+t),n(t),T}};return new C}function i(t){var e;return t.currentStyle?e=t.currentStyle.position:window.getComputedStyle&&(e=getComputedStyle(t).position),"fixed"==e}function n(){if(c.height()<=s.height())return 0;var e=t('<div style="visibility:hidden;width:100px" />').appendTo("body"),i=e[0].offsetWidth;e.css("overflow","scroll");var n=t('<div style="width:100%" />').appendTo(e)[0].offsetWidth;return e.remove(),i-n}function o(e,i,n){if(t.isPlainObject(i))for(var o in i)a(e,o,i[o]);else a(e,i,n)}function a(t,e,i){t.setAttribute(("role"==e?"":"aria-")+e,i)}function r(){try{return document.activeElement}catch(t){}}var s=t(window),l=t(document),c=t(document.documentElement);return e.klasses=function(t){return t=t||"picker",{picker:t,opened:t+"--opened",focused:t+"--focused",input:t+"__input",active:t+"__input--active",target:t+"__input--target",holder:t+"__holder",frame:t+"__frame",wrap:t+"__wrap",box:t+"__box"}},e._={group:function(t){for(var i,n="",o=e._.trigger(t.min,t);o<=e._.trigger(t.max,t,[o]);o+=t.i)i=e._.trigger(t.item,t,[o]),n+=e._.node(t.node,i[0],i[1],i[2]);return n},node:function(e,i,n,o){return i?(i=t.isArray(i)?i.join(""):i,n=n?' class="'+n+'"':"",o=o?" "+o:"","<"+e+n+o+">"+i+"</"+e+">"):""},lead:function(t){return(t<10?"0":"")+t},trigger:function(t,e,i){return"function"==typeof t?t.apply(e,i||[]):t},digits:function(t){return/\d/.test(t[1])?2:1},isDate:function(t){return{}.toString.call(t).indexOf("Date")>-1&&this.isInteger(t.getDate())},isInteger:function(t){return{}.toString.call(t).indexOf("Number")>-1&&t%1==0},ariaAttr:function(e,i){t.isPlainObject(e)||(e={attribute:i}),i="";for(var n in e){var o=("role"==n?"":"aria-")+n;i+=null==e[n]?"":o+'="'+e[n]+'"'}return i}},e.extend=function(i,n){t.fn[i]=function(o,a){var r=this.data(i);return"picker"==o?r:r&&"string"==typeof o?e._.trigger(r[o],r,[a]):this.each(function(){t(this).data(i)||new e(this,i,n,o)})},t.fn[i].defaults=n.defaults},e}),function(t){t(Materialize.Picker,jQuery)}(function(t,e){function i(t,e){var i=this,n=t.$node[0],o=n.value,a=t.$node.data("value"),r=a||o,s=a?e.formatSubmit:e.format,l=function(){return n.currentStyle?"rtl"==n.currentStyle.direction:"rtl"==getComputedStyle(t.$root[0]).direction};i.settings=e,i.$node=t.$node,i.queue={min:"measure create",max:"measure create",now:"now create",select:"parse create validate",highlight:"parse navigate create validate",view:"parse create validate viewset",disable:"deactivate",enable:"activate"},i.item={},i.item.clear=null,i.item.disable=(e.disable||[]).slice(0),i.item.enable=-function(t){return!0===t[0]?t.shift():-1}(i.item.disable),i.set("min",e.min).set("max",e.max).set("now"),r?i.set("select",r,{format:s}):i.set("select",null).set("highlight",i.item.now),i.key={40:7,38:-7,39:function(){return l()?-1:1},37:function(){return l()?1:-1},go:function(t){var e=i.item.highlight,n=new Date(e.year,e.month,e.date+t);i.set("highlight",n,{interval:t}),this.render()}},t.on("render",function(){t.$root.find("."+e.klass.selectMonth).on("change",function(){var i=this.value;i&&(t.set("highlight",[t.get("view").year,i,t.get("highlight").date]),t.$root.find("."+e.klass.selectMonth).trigger("focus"))}),t.$root.find("."+e.klass.selectYear).on("change",function(){var i=this.value;i&&(t.set("highlight",[i,t.get("view").month,t.get("highlight").date]),t.$root.find("."+e.klass.selectYear).trigger("focus"))})},1).on("open",function(){var n="";i.disabled(i.get("now"))&&(n=":not(."+e.klass.buttonToday+")"),t.$root.find("button"+n+", select").attr("disabled",!1)},1).on("close",function(){t.$root.find("button, select").attr("disabled",!0)},1)}var n=t._;i.prototype.set=function(t,e,i){var n=this,o=n.item;return null===e?("clear"==t&&(t="select"),o[t]=e,n):(o["enable"==t?"disable":"flip"==t?"enable":t]=n.queue[t].split(" ").map(function(o){return e=n[o](t,e,i)}).pop(),"select"==t?n.set("highlight",o.select,i):"highlight"==t?n.set("view",o.highlight,i):t.match(/^(flip|min|max|disable|enable)$/)&&(o.select&&n.disabled(o.select)&&n.set("select",o.select,i),o.highlight&&n.disabled(o.highlight)&&n.set("highlight",o.highlight,i)),n)},i.prototype.get=function(t){return this.item[t]},i.prototype.create=function(t,i,o){var a,r=this;return i=void 0===i?t:i,i==-1/0||i==1/0?a=i:e.isPlainObject(i)&&n.isInteger(i.pick)?i=i.obj:e.isArray(i)?(i=new Date(i[0],i[1],i[2]),i=n.isDate(i)?i:r.create().obj):i=n.isInteger(i)||n.isDate(i)?r.normalize(new Date(i),o):r.now(t,i,o),{year:a||i.getFullYear(),month:a||i.getMonth(),date:a||i.getDate(),day:a||i.getDay(),obj:a||i,pick:a||i.getTime()}},i.prototype.createRange=function(t,i){var o=this,a=function(t){return!0===t||e.isArray(t)||n.isDate(t)?o.create(t):t};return n.isInteger(t)||(t=a(t)),n.isInteger(i)||(i=a(i)),n.isInteger(t)&&e.isPlainObject(i)?t=[i.year,i.month,i.date+t]:n.isInteger(i)&&e.isPlainObject(t)&&(i=[t.year,t.month,t.date+i]),{from:a(t),to:a(i)}},i.prototype.withinRange=function(t,e){return t=this.createRange(t.from,t.to),e.pick>=t.from.pick&&e.pick<=t.to.pick},i.prototype.overlapRanges=function(t,e){var i=this;return t=i.createRange(t.from,t.to),e=i.createRange(e.from,e.to),i.withinRange(t,e.from)||i.withinRange(t,e.to)||i.withinRange(e,t.from)||i.withinRange(e,t.to)},i.prototype.now=function(t,e,i){return e=new Date,i&&i.rel&&e.setDate(e.getDate()+i.rel),this.normalize(e,i)},i.prototype.navigate=function(t,i,n){var o,a,r,s,l=e.isArray(i),c=e.isPlainObject(i),u=this.item.view;if(l||c){for(c?(a=i.year,r=i.month,s=i.date):(a=+i[0],r=+i[1],s=+i[2]),n&&n.nav&&u&&u.month!==r&&(a=u.year,r=u.month),a=(o=new Date(a,r+(n&&n.nav?n.nav:0),1)).getFullYear(),r=o.getMonth();new Date(a,r,s).getMonth()!==r;)s-=1;i=[a,r,s]}return i},i.prototype.normalize=function(t){return t.setHours(0,0,0,0),t},i.prototype.measure=function(t,e){var i=this;return e?"string"==typeof e?e=i.parse(t,e):n.isInteger(e)&&(e=i.now(t,e,{rel:e})):e="min"==t?-1/0:1/0,e},i.prototype.viewset=function(t,e){return this.create([e.year,e.month,1])},i.prototype.validate=function(t,i,o){var a,r,s,l,c=this,u=i,d=o&&o.interval?o.interval:1,p=-1===c.item.enable,h=c.item.min,f=c.item.max,v=p&&c.item.disable.filter(function(t){if(e.isArray(t)){var o=c.create(t).pick;o<i.pick?a=!0:o>i.pick&&(r=!0)}return n.isInteger(t)}).length;if((!o||!o.nav)&&(!p&&c.disabled(i)||p&&c.disabled(i)&&(v||a||r)||!p&&(i.pick<=h.pick||i.pick>=f.pick)))for(p&&!v&&(!r&&d>0||!a&&d<0)&&(d*=-1);c.disabled(i)&&(Math.abs(d)>1&&(i.month<u.month||i.month>u.month)&&(i=u,d=d>0?1:-1),i.pick<=h.pick?(s=!0,d=1,i=c.create([h.year,h.month,h.date+(i.pick===h.pick?0:-1)])):i.pick>=f.pick&&(l=!0,d=-1,i=c.create([f.year,f.month,f.date+(i.pick===f.pick?0:1)])),!s||!l);)i=c.create([i.year,i.month,i.date+d]);return i},i.prototype.disabled=function(t){var i=this,o=i.item.disable.filter(function(o){return n.isInteger(o)?t.day===(i.settings.firstDay?o:o-1)%7:e.isArray(o)||n.isDate(o)?t.pick===i.create(o).pick:e.isPlainObject(o)?i.withinRange(o,t):void 0});return o=o.length&&!o.filter(function(t){return e.isArray(t)&&"inverted"==t[3]||e.isPlainObject(t)&&t.inverted}).length,-1===i.item.enable?!o:o||t.pick<i.item.min.pick||t.pick>i.item.max.pick},i.prototype.parse=function(t,e,i){var o=this,a={};return e&&"string"==typeof e?(i&&i.format||((i=i||{}).format=o.settings.format),o.formats.toArray(i.format).map(function(t){var i=o.formats[t],r=i?n.trigger(i,o,[e,a]):t.replace(/^!/,"").length;i&&(a[t]=e.substr(0,r)),e=e.substr(r)}),[a.yyyy||a.yy,+(a.mm||a.m)-1,a.dd||a.d]):e},i.prototype.formats=function(){function t(t,e,i){var n=t.match(/\w+/)[0];return i.mm||i.m||(i.m=e.indexOf(n)+1),n.length}function e(t){return t.match(/\w+/)[0].length}return{d:function(t,e){return t?n.digits(t):e.date},dd:function(t,e){return t?2:n.lead(e.date)},ddd:function(t,i){return t?e(t):this.settings.weekdaysShort[i.day]},dddd:function(t,i){return t?e(t):this.settings.weekdaysFull[i.day]},m:function(t,e){return t?n.digits(t):e.month+1},mm:function(t,e){return t?2:n.lead(e.month+1)},mmm:function(e,i){var n=this.settings.monthsShort;return e?t(e,n,i):n[i.month]},mmmm:function(e,i){var n=this.settings.monthsFull;return e?t(e,n,i):n[i.month]},yy:function(t,e){return t?2:(""+e.year).slice(2)},yyyy:function(t,e){return t?4:e.year},toArray:function(t){return t.split(/(d{1,4}|m{1,4}|y{4}|yy|!.)/g)},toString:function(t,e){var i=this;return i.formats.toArray(t).map(function(t){return n.trigger(i.formats[t],i,[0,e])||t.replace(/^!/,"")}).join("")}}}(),i.prototype.isDateExact=function(t,i){var o=this;return n.isInteger(t)&&n.isInteger(i)||"boolean"==typeof t&&"boolean"==typeof i?t===i:(n.isDate(t)||e.isArray(t))&&(n.isDate(i)||e.isArray(i))?o.create(t).pick===o.create(i).pick:!(!e.isPlainObject(t)||!e.isPlainObject(i))&&(o.isDateExact(t.from,i.from)&&o.isDateExact(t.to,i.to))},i.prototype.isDateOverlap=function(t,i){var o=this,a=o.settings.firstDay?1:0;return n.isInteger(t)&&(n.isDate(i)||e.isArray(i))?(t=t%7+a)===o.create(i).day+1:n.isInteger(i)&&(n.isDate(t)||e.isArray(t))?(i=i%7+a)===o.create(t).day+1:!(!e.isPlainObject(t)||!e.isPlainObject(i))&&o.overlapRanges(t,i)},i.prototype.flipEnable=function(t){var e=this.item;e.enable=t||(-1==e.enable?1:-1)},i.prototype.deactivate=function(t,i){var o=this,a=o.item.disable.slice(0);return"flip"==i?o.flipEnable():!1===i?(o.flipEnable(1),a=[]):!0===i?(o.flipEnable(-1),a=[]):i.map(function(t){for(var i,r=0;r<a.length;r+=1)if(o.isDateExact(t,a[r])){i=!0;break}i||(n.isInteger(t)||n.isDate(t)||e.isArray(t)||e.isPlainObject(t)&&t.from&&t.to)&&a.push(t)}),a},i.prototype.activate=function(t,i){var o=this,a=o.item.disable,r=a.length;return"flip"==i?o.flipEnable():!0===i?(o.flipEnable(1),a=[]):!1===i?(o.flipEnable(-1),a=[]):i.map(function(t){var i,s,l,c;for(l=0;l<r;l+=1){if(s=a[l],o.isDateExact(s,t)){i=a[l]=null,c=!0;break}if(o.isDateOverlap(s,t)){e.isPlainObject(t)?(t.inverted=!0,i=t):e.isArray(t)?(i=t)[3]||i.push("inverted"):n.isDate(t)&&(i=[t.getFullYear(),t.getMonth(),t.getDate(),"inverted"]);break}}if(i)for(l=0;l<r;l+=1)if(o.isDateExact(a[l],t)){a[l]=null;break}if(c)for(l=0;l<r;l+=1)if(o.isDateOverlap(a[l],t)){a[l]=null;break}i&&a.push(i)}),a.filter(function(t){return null!=t})},i.prototype.nodes=function(t){var e=this,i=e.settings,o=e.item,a=o.now,r=o.select,s=o.highlight,l=o.view,c=o.disable,u=o.min,d=o.max,p=function(t,e){return i.firstDay&&(t.push(t.shift()),e.push(e.shift())),n.node("thead",n.node("tr",n.group({min:0,max:6,i:1,node:"th",item:function(n){return[t[n],i.klass.weekdays,'scope=col title="'+e[n]+'"']}})))}((i.showWeekdaysFull?i.weekdaysFull:i.weekdaysLetter).slice(0),i.weekdaysFull.slice(0)),h=function(t){return n.node("div"," ",i.klass["nav"+(t?"Next":"Prev")]+(t&&l.year>=d.year&&l.month>=d.month||!t&&l.year<=u.year&&l.month<=u.month?" "+i.klass.navDisabled:""),"data-nav="+(t||-1)+" "+n.ariaAttr({role:"button",controls:e.$node[0].id+"_table"})+' title="'+(t?i.labelMonthNext:i.labelMonthPrev)+'"')},f=function(o){var a=i.showMonthsShort?i.monthsShort:i.monthsFull;return"short_months"==o&&(a=i.monthsShort),i.selectMonths&&void 0==o?n.node("select",n.group({min:0,max:11,i:1,node:"option",item:function(t){return[a[t],0,"value="+t+(l.month==t?" selected":"")+(l.year==u.year&&t<u.month||l.year==d.year&&t>d.month?" disabled":"")]}}),i.klass.selectMonth+" browser-default",(t?"":"disabled")+" "+n.ariaAttr({controls:e.$node[0].id+"_table"})+' title="'+i.labelMonthSelect+'"'):"short_months"==o?null!=r?a[r.month]:a[l.month]:n.node("div",a[l.month],i.klass.month)},v=function(o){var a=l.year,s=!0===i.selectYears?5:~~(i.selectYears/2);if(s){var c=u.year,p=d.year,h=a-s,f=a+s;if(c>h&&(f+=c-h,h=c),p<f){var v=h-c,m=f-p;h-=v>m?m:v,f=p}if(i.selectYears&&void 0==o)return n.node("select",n.group({min:h,max:f,i:1,node:"option",item:function(t){return[t,0,"value="+t+(a==t?" selected":"")]}}),i.klass.selectYear+" browser-default",(t?"":"disabled")+" "+n.ariaAttr({controls:e.$node[0].id+"_table"})+' title="'+i.labelYearSelect+'"')}return"raw"===o&&null!=r?n.node("div",r.year):n.node("div",a,i.klass.year)};return createDayLabel=function(){return null!=r?r.date:a.date},createWeekdayLabel=function(){var t;return t=null!=r?r.day:a.day,i.weekdaysShort[t]},n.node("div",n.node("div",v("raw"),i.klass.year_display)+n.node("span",createWeekdayLabel()+", ","picker__weekday-display")+n.node("span",f("short_months")+" ",i.klass.month_display)+n.node("span",createDayLabel(),i.klass.day_display),i.klass.date_display)+n.node("div",n.node("div",n.node("div",(i.selectYears,f()+v()+h()+h(1)),i.klass.header)+n.node("table",p+n.node("tbody",n.group({min:0,max:5,i:1,node:"tr",item:function(t){var o=i.firstDay&&0===e.create([l.year,l.month,1]).day?-7:0;return[n.group({min:7*t-l.day+o+1,max:function(){return this.min+7-1},i:1,node:"td",item:function(t){t=e.create([l.year,l.month,t+(i.firstDay?1:0)]);var o=r&&r.pick==t.pick,p=s&&s.pick==t.pick,h=c&&e.disabled(t)||t.pick<u.pick||t.pick>d.pick,f=n.trigger(e.formats.toString,e,[i.format,t]);return[n.node("div",t.date,function(e){return e.push(l.month==t.month?i.klass.infocus:i.klass.outfocus),a.pick==t.pick&&e.push(i.klass.now),o&&e.push(i.klass.selected),p&&e.push(i.klass.highlighted),h&&e.push(i.klass.disabled),e.join(" ")}([i.klass.day]),"data-pick="+t.pick+" "+n.ariaAttr({role:"gridcell",label:f,selected:!(!o||e.$node.val()!==f)||null,activedescendant:!!p||null,disabled:!!h||null})+" "+(h?"":'tabindex="0"')),"",n.ariaAttr({role:"presentation"})]}})]}})),i.klass.table,'id="'+e.$node[0].id+'_table" '+n.ariaAttr({role:"grid",controls:e.$node[0].id,readonly:!0})),i.klass.calendar_container)+n.node("div",n.node("button",i.today,"btn-flat picker__today waves-effect","type=button data-pick="+a.pick+(t&&!e.disabled(a)?"":" disabled")+" "+n.ariaAttr({controls:e.$node[0].id}))+n.node("button",i.clear,"btn-flat picker__clear waves-effect","type=button data-clear=1"+(t?"":" disabled")+" "+n.ariaAttr({controls:e.$node[0].id}))+n.node("button",i.close,"btn-flat picker__close waves-effect","type=button data-close=true "+(t?"":" disabled")+" "+n.ariaAttr({controls:e.$node[0].id})),i.klass.footer),"picker__container__wrapper")},i.defaults=function(t){return{labelMonthNext:"Next month",labelMonthPrev:"Previous month",labelMonthSelect:"Select a month",labelYearSelect:"Select a year",monthsFull:["January","February","March","April","May","June","July","August","September","October","November","December"],monthsShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],weekdaysFull:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],weekdaysShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],weekdaysLetter:["S","M","T","W","T","F","S"],today:"Today",clear:"Clear",close:"Ok",closeOnSelect:!1,format:"d mmmm, yyyy",klass:{table:t+"table",header:t+"header",date_display:t+"date-display",day_display:t+"day-display",month_display:t+"month-display",year_display:t+"year-display",calendar_container:t+"calendar-container",navPrev:t+"nav--prev",navNext:t+"nav--next",navDisabled:t+"nav--disabled",month:t+"month",year:t+"year",selectMonth:t+"select--month",selectYear:t+"select--year",weekdays:t+"weekday",day:t+"day",disabled:t+"day--disabled",selected:t+"day--selected",highlighted:t+"day--highlighted",now:t+"day--today",infocus:t+"day--infocus",outfocus:t+"day--outfocus",footer:t+"footer",buttonClear:t+"button--clear",buttonToday:t+"button--today",buttonClose:t+"button--close"}}}(t.klasses().picker+"__"),t.extend("pickadate",i)}),function(t){function e(t){return document.createElementNS(l,t)}function i(t){return(t<10?"0":"")+t}function n(t){var e=++m+"";return t?t+e:e}function o(o,r){function l(t,e){var i=d.offset(),n=/^touch/.test(t.type),o=i.left+g,a=i.top+g,l=(n?t.originalEvent.touches[0]:t).pageX-o,c=(n?t.originalEvent.touches[0]:t).pageY-a,u=Math.sqrt(l*l+c*c),p=!1;if(!e||!(u<y-w||u>y+w)){t.preventDefault();var v=setTimeout(function(){E.popover.addClass("clockpicker-moving")},200);E.setHand(l,c,!e,!0),s.off(h).on(h,function(t){t.preventDefault();var e=/^touch/.test(t.type),i=(e?t.originalEvent.touches[0]:t).pageX-o,n=(e?t.originalEvent.touches[0]:t).pageY-a;(p||i!==l||n!==c)&&(p=!0,E.setHand(i,n,!1,!0))}),s.off(f).on(f,function(t){s.off(f),t.preventDefault();var i=/^touch/.test(t.type),n=(i?t.originalEvent.changedTouches[0]:t).pageX-o,u=(i?t.originalEvent.changedTouches[0]:t).pageY-a;(e||p)&&n===l&&u===c&&E.setHand(n,u),"hours"===E.currentView?E.toggleView("minutes",x/2):r.autoclose&&(E.minutesView.addClass("clockpicker-dial-out"),setTimeout(function(){E.done()},x/2)),d.prepend(z),clearTimeout(v),E.popover.removeClass("clockpicker-moving"),s.off(h)})}}var u=t(C),d=u.find(".clockpicker-plate"),v=u.find(".picker__holder"),m=u.find(".clockpicker-hours"),T=u.find(".clockpicker-minutes"),S=u.find(".clockpicker-am-pm-block"),P="INPUT"===o.prop("tagName"),A=P?o:o.find("input"),O=t("label[for="+A.attr("id")+"]"),E=this;this.id=n("cp"),this.element=o,this.holder=v,this.options=r,this.isAppended=!1,this.isShown=!1,this.currentView="hours",this.isInput=P,this.input=A,this.label=O,this.popover=u,this.plate=d,this.hoursView=m,this.minutesView=T,this.amPmBlock=S,this.spanHours=u.find(".clockpicker-span-hours"),this.spanMinutes=u.find(".clockpicker-span-minutes"),this.spanAmPm=u.find(".clockpicker-span-am-pm"),this.footer=u.find(".picker__footer"),this.amOrPm="PM",r.twelvehour&&(r.ampmclickable?(this.spanAmPm.empty(),t('<div id="click-am">AM</div>').on("click",function(){E.spanAmPm.children("#click-am").addClass("text-primary"),E.spanAmPm.children("#click-pm").removeClass("text-primary"),E.amOrPm="AM"}).appendTo(this.spanAmPm),t('<div id="click-pm">PM</div>').on("click",function(){E.spanAmPm.children("#click-pm").addClass("text-primary"),E.spanAmPm.children("#click-am").removeClass("text-primary"),E.amOrPm="PM"}).appendTo(this.spanAmPm)):(this.spanAmPm.empty(),t('<div id="click-am">AM</div>').appendTo(this.spanAmPm),t('<div id="click-pm">PM</div>').appendTo(this.spanAmPm))),t('<button type="button" class="btn-flat picker__clear" tabindex="'+(r.twelvehour?"3":"1")+'">'+r.cleartext+"</button>").click(t.proxy(this.clear,this)).appendTo(this.footer),t('<button type="button" class="btn-flat picker__close" tabindex="'+(r.twelvehour?"3":"1")+'">'+r.canceltext+"</button>").click(t.proxy(this.hide,this)).appendTo(this.footer),t('<button type="button" class="btn-flat picker__close" tabindex="'+(r.twelvehour?"3":"1")+'">'+r.donetext+"</button>").click(t.proxy(this.done,this)).appendTo(this.footer),this.spanHours.click(t.proxy(this.toggleView,this,"hours")),this.spanMinutes.click(t.proxy(this.toggleView,this,"minutes")),A.on("focus.clockpicker click.clockpicker",t.proxy(this.show,this));var _,M,I,D,q=t('<div class="clockpicker-tick"></div>');if(r.twelvehour)for(_=1;_<13;_+=1)M=q.clone(),I=_/6*Math.PI,D=y,M.css({left:g+Math.sin(I)*D-w,top:g-Math.cos(I)*D-w}),M.html(0===_?"00":_),m.append(M),M.on(p,l);else for(_=0;_<24;_+=1)M=q.clone(),I=_/6*Math.PI,D=_>0&&_<13?b:y,M.css({left:g+Math.sin(I)*D-w,top:g-Math.cos(I)*D-w}),M.html(0===_?"00":_),m.append(M),M.on(p,l);for(_=0;_<60;_+=5)M=q.clone(),I=_/30*Math.PI,M.css({left:g+Math.sin(I)*y-w,top:g-Math.cos(I)*y-w}),M.html(i(_)),T.append(M),M.on(p,l);if(d.on(p,function(e){0===t(e.target).closest(".clockpicker-tick").length&&l(e,!0)}),c){var z=u.find(".clockpicker-canvas"),V=e("svg");V.setAttribute("class","clockpicker-svg"),V.setAttribute("width",k),V.setAttribute("height",k);var H=e("g");H.setAttribute("transform","translate("+g+","+g+")");var L=e("circle");L.setAttribute("class","clockpicker-canvas-bearing"),L.setAttribute("cx",0),L.setAttribute("cy",0),L.setAttribute("r",4);var j=e("line");j.setAttribute("x1",0),j.setAttribute("y1",0);var $=e("circle");$.setAttribute("class","clockpicker-canvas-bg"),$.setAttribute("r",w),H.appendChild(j),H.appendChild($),H.appendChild(L),V.appendChild(H),z.append(V),this.hand=j,this.bg=$,this.bearing=L,this.g=H,this.canvas=z}a(this.options.init)}function a(t){t&&"function"==typeof t&&t()}var r=t(window),s=t(document),l="http://www.w3.org/2000/svg",c="SVGAngle"in window&&function(){var t,e=document.createElement("div");return e.innerHTML="<svg/>",t=(e.firstChild&&e.firstChild.namespaceURI)==l,e.innerHTML="",t}(),u=function(){var t=document.createElement("div").style;return"transition"in t||"WebkitTransition"in t||"MozTransition"in t||"msTransition"in t||"OTransition"in t}(),d="ontouchstart"in window,p="mousedown"+(d?" touchstart":""),h="mousemove.clockpicker"+(d?" touchmove.clockpicker":""),f="mouseup.clockpicker"+(d?" touchend.clockpicker":""),v=navigator.vibrate?"vibrate":navigator.webkitVibrate?"webkitVibrate":null,m=0,g=135,y=105,b=70,w=20,k=2*g,x=u?350:1,C=['<div class="clockpicker picker">','<div class="picker__holder">','<div class="picker__frame">','<div class="picker__wrap">','<div class="picker__box">','<div class="picker__date-display">','<div class="clockpicker-display">','<div class="clockpicker-display-column">','<span class="clockpicker-span-hours text-primary"></span>',":",'<span class="clockpicker-span-minutes"></span>',"</div>",'<div class="clockpicker-display-column clockpicker-display-am-pm">','<div class="clockpicker-span-am-pm"></div>',"</div>","</div>","</div>",'<div class="picker__container__wrapper">','<div class="picker__calendar-container">','<div class="clockpicker-plate">','<div class="clockpicker-canvas"></div>','<div class="clockpicker-dial clockpicker-hours"></div>','<div class="clockpicker-dial clockpicker-minutes clockpicker-dial-out"></div>',"</div>",'<div class="clockpicker-am-pm-block">',"</div>","</div>",'<div class="picker__footer">',"</div>","</div>","</div>","</div>","</div>","</div>","</div>"].join("");o.DEFAULTS={default:"",fromnow:0,donetext:"Ok",cleartext:"Clear",canceltext:"Cancel",autoclose:!1,ampmclickable:!0,darktheme:!1,twelvehour:!0,vibrate:!0},o.prototype.toggle=function(){this[this.isShown?"hide":"show"]()},o.prototype.locate=function(){var t=this.element,e=this.popover;t.offset(),t.outerWidth(),t.outerHeight(),this.options.align;e.show()},o.prototype.show=function(e){if(!this.isShown){a(this.options.beforeShow),t(":input").each(function(){t(this).attr("tabindex",-1)});var n=this;this.input.blur(),this.popover.addClass("picker--opened"),this.input.addClass("picker__input picker__input--active"),t(document.body).css("overflow","hidden");var o=((this.input.prop("value")||this.options.default||"")+"").split(":");if(this.options.twelvehour&&void 0!==o[1]&&(o[1].indexOf("AM")>0?this.amOrPm="AM":this.amOrPm="PM",o[1]=o[1].replace("AM","").replace("PM","")),"now"===o[0]){var l=new Date(+new Date+this.options.fromnow);o=[l.getHours(),l.getMinutes()],this.options.twelvehour&&(this.amOrPm=o[0]>=12&&o[0]<24?"PM":"AM")}if(this.hours=+o[0]||0,this.minutes=+o[1]||0,this.spanHours.html(this.hours),this.spanMinutes.html(i(this.minutes)),!this.isAppended){var c=document.querySelector(this.options.container);this.options.container&&c?c.appendChild(this.popover[0]):this.popover.insertAfter(this.input),this.options.twelvehour&&("PM"===this.amOrPm?(this.spanAmPm.children("#click-pm").addClass("text-primary"),this.spanAmPm.children("#click-am").removeClass("text-primary")):(this.spanAmPm.children("#click-am").addClass("text-primary"),this.spanAmPm.children("#click-pm").removeClass("text-primary"))),r.on("resize.clockpicker"+this.id,function(){n.isShown&&n.locate()}),this.isAppended=!0}this.toggleView("hours"),this.locate(),this.isShown=!0,s.on("click.clockpicker."+this.id+" focusin.clockpicker."+this.id,function(e){var i=t(e.target);0===i.closest(n.popover.find(".picker__wrap")).length&&0===i.closest(n.input).length&&n.hide()}),s.on("keyup.clockpicker."+this.id,function(t){27===t.keyCode&&n.hide()}),a(this.options.afterShow)}},o.prototype.hide=function(){a(this.options.beforeHide),this.input.removeClass("picker__input picker__input--active"),this.popover.removeClass("picker--opened"),t(document.body).css("overflow","visible"),this.isShown=!1,t(":input").each(function(e){t(this).attr("tabindex",e+1)}),s.off("click.clockpicker."+this.id+" focusin.clockpicker."+this.id),s.off("keyup.clockpicker."+this.id),this.popover.hide(),a(this.options.afterHide)},o.prototype.toggleView=function(e,i){var n=!1;"minutes"===e&&"visible"===t(this.hoursView).css("visibility")&&(a(this.options.beforeHourSelect),n=!0);var o="hours"===e,r=o?this.hoursView:this.minutesView,s=o?this.minutesView:this.hoursView;this.currentView=e,this.spanHours.toggleClass("text-primary",o),this.spanMinutes.toggleClass("text-primary",!o),s.addClass("clockpicker-dial-out"),r.css("visibility","visible").removeClass("clockpicker-dial-out"),this.resetClock(i),clearTimeout(this.toggleViewTimer),this.toggleViewTimer=setTimeout(function(){s.css("visibility","hidden")},x),n&&a(this.options.afterHourSelect)},o.prototype.resetClock=function(t){var e=this.currentView,i=this[e],n="hours"===e,o=i*(Math.PI/(n?6:30)),a=n&&i>0&&i<13?b:y,r=Math.sin(o)*a,s=-Math.cos(o)*a,l=this;c&&t?(l.canvas.addClass("clockpicker-canvas-out"),setTimeout(function(){l.canvas.removeClass("clockpicker-canvas-out"),l.setHand(r,s)},t)):this.setHand(r,s)},o.prototype.setHand=function(e,n,o,a){var r,s=Math.atan2(e,-n),l="hours"===this.currentView,u=Math.PI/(l||o?6:30),d=Math.sqrt(e*e+n*n),p=this.options,h=l&&d<(y+b)/2,f=h?b:y;if(p.twelvehour&&(f=y),s<0&&(s=2*Math.PI+s),r=Math.round(s/u),s=r*u,p.twelvehour?l?0===r&&(r=12):(o&&(r*=5),60===r&&(r=0)):l?(12===r&&(r=0),r=h?0===r?12:r:0===r?0:r+12):(o&&(r*=5),60===r&&(r=0)),this[this.currentView]!==r&&v&&this.options.vibrate&&(this.vibrateTimer||(navigator[v](10),this.vibrateTimer=setTimeout(t.proxy(function(){this.vibrateTimer=null},this),100))),this[this.currentView]=r,l?this.spanHours.html(r):this.spanMinutes.html(i(r)),c){var m=Math.sin(s)*(f-w),g=-Math.cos(s)*(f-w),k=Math.sin(s)*f,x=-Math.cos(s)*f;this.hand.setAttribute("x2",m),this.hand.setAttribute("y2",g),this.bg.setAttribute("cx",k),this.bg.setAttribute("cy",x)}else this[l?"hoursView":"minutesView"].find(".clockpicker-tick").each(function(){var e=t(this);e.toggleClass("active",r===+e.html())})},o.prototype.done=function(){a(this.options.beforeDone),this.hide(),this.label.addClass("active");var t=this.input.prop("value"),e=i(this.hours)+":"+i(this.minutes);this.options.twelvehour&&(e+=this.amOrPm),this.input.prop("value",e),e!==t&&(this.input.triggerHandler("change"),this.isInput||this.element.trigger("change")),this.options.autoclose&&this.input.trigger("blur"),a(this.options.afterDone)},o.prototype.clear=function(){this.hide(),this.label.removeClass("active");var t=this.input.prop("value");this.input.prop("value",""),""!==t&&(this.input.triggerHandler("change"),this.isInput||this.element.trigger("change")),this.options.autoclose&&this.input.trigger("blur")},o.prototype.remove=function(){this.element.removeData("clockpicker"),this.input.off("focus.clockpicker click.clockpicker"),this.isShown&&this.hide(),this.isAppended&&(r.off("resize.clockpicker"+this.id),this.popover.remove())},t.fn.pickatime=function(e){var i=Array.prototype.slice.call(arguments,1);return this.each(function(){var n=t(this),a=n.data("clockpicker");if(a)"function"==typeof a[e]&&a[e].apply(a,i);else{var r=t.extend({},o.DEFAULTS,n.data(),"object"==typeof e&&e);n.data("clockpicker",new o(n,r))}})}}(jQuery),function(t){function e(){var e=+t(this).attr("data-length"),i=+t(this).val().length,n=i<=e;t(this).parent().find('span[class="character-counter"]').html(i+"/"+e),o(n,t(this))}function i(e){var i=e.parent().find('span[class="character-counter"]');i.length||(i=t("<span/>").addClass("character-counter").css("float","right").css("font-size","12px").css("height",1),e.parent().append(i))}function n(){t(this).parent().find('span[class="character-counter"]').html("")}function o(t,e){var i=e.hasClass("invalid");t&&i?e.removeClass("invalid"):t||i||(e.removeClass("valid"),e.addClass("invalid"))}t.fn.characterCounter=function(){return this.each(function(){var o=t(this);o.parent().find('span[class="character-counter"]').length||void 0!==o.attr("data-length")&&(o.on("input",e),o.on("focus",e),o.on("blur",n),i(o))})},t(document).ready(function(){t("input, textarea").characterCounter()})}(jQuery),function(t){var e={init:function(e){var i={duration:200,dist:-100,shift:0,padding:0,fullWidth:!1,indicators:!1,noWrap:!1,onCycleTo:null};e=t.extend(i,e);var n=Materialize.objectSelectorString(t(this));return this.each(function(i){function o(t){return t.targetTouches&&t.targetTouches.length>=1?t.targetTouches[0].clientX:t.clientX}function a(t){return t.targetTouches&&t.targetTouches.length>=1?t.targetTouches[0].clientY:t.clientY}function r(t){return t>=C?t%C:t<0?r(C+t%C):t}function s(i){E=!0,j.hasClass("scrolling")||j.addClass("scrolling"),null!=H&&window.clearTimeout(H),H=window.setTimeout(function(){E=!1,j.removeClass("scrolling")},e.duration);var n,o,a,s,l,c,u,d=w;if(b="number"==typeof i?i:b,w=Math.floor((b+x/2)/x),a=b-w*x,s=a<0?1:-1,l=-s*a*2/x,o=C>>1,e.fullWidth?u="translateX(0)":(u="translateX("+(j[0].clientWidth-m)/2+"px) ",u+="translateY("+(j[0].clientHeight-g)/2+"px)"),N){var p=w%C,h=V.find(".indicator-item.active");h.index()!==p&&(h.removeClass("active"),V.find(".indicator-item").eq(p).addClass("active"))}for((!W||w>=0&&w<C)&&(c=v[r(w)],t(c).hasClass("active")||(j.find(".carousel-item").removeClass("active"),t(c).addClass("active")),c.style[_]=u+" translateX("+-a/2+"px) translateX("+s*e.shift*l*n+"px) translateZ("+e.dist*l+"px)",c.style.zIndex=0,e.fullWidth?tweenedOpacity=1:tweenedOpacity=1-.2*l,c.style.opacity=tweenedOpacity,c.style.display="block"),n=1;n<=o;++n)e.fullWidth?(zTranslation=e.dist,tweenedOpacity=n===o&&a<0?1-l:1):(zTranslation=e.dist*(2*n+l*s),tweenedOpacity=1-.2*(2*n+l*s)),(!W||w+n<C)&&((c=v[r(w+n)]).style[_]=u+" translateX("+(e.shift+(x*n-a)/2)+"px) translateZ("+zTranslation+"px)",c.style.zIndex=-n,c.style.opacity=tweenedOpacity,c.style.display="block"),e.fullWidth?(zTranslation=e.dist,tweenedOpacity=n===o&&a>0?1-l:1):(zTranslation=e.dist*(2*n-l*s),tweenedOpacity=1-.2*(2*n-l*s)),(!W||w-n>=0)&&((c=v[r(w-n)]).style[_]=u+" translateX("+(-e.shift+(-x*n-a)/2)+"px) translateZ("+zTranslation+"px)",c.style.zIndex=-n,c.style.opacity=tweenedOpacity,c.style.display="block");if((!W||w>=0&&w<C)&&((c=v[r(w)]).style[_]=u+" translateX("+-a/2+"px) translateX("+s*e.shift*l+"px) translateZ("+e.dist*l+"px)",c.style.zIndex=0,e.fullWidth?tweenedOpacity=1:tweenedOpacity=1-.2*l,c.style.opacity=tweenedOpacity,c.style.display="block"),d!==w&&"function"==typeof e.onCycleTo){var f=j.find(".carousel-item").eq(r(w));e.onCycleTo.call(this,f,q)}"function"==typeof L&&(L.call(this,f,q),L=null)}function l(){var t,e,i;e=(t=Date.now())-I,I=t,i=b-M,M=b,O=.8*(1e3*i/(1+e))+.2*O}function c(){var t,i;P&&(t=Date.now()-I,(i=P*Math.exp(-t/e.duration))>2||i<-2?(s(A-i),requestAnimationFrame(c)):s(A))}function u(i){if(q)return i.preventDefault(),i.stopPropagation(),!1;if(!e.fullWidth){var n=t(i.target).closest(".carousel-item").index();0!==r(w)-n&&(i.preventDefault(),i.stopPropagation()),d(n)}}function d(t){var e=w%C-t;W||(e<0?Math.abs(e+C)<Math.abs(e)&&(e+=C):e>0&&Math.abs(e-C)<e&&(e-=C)),e<0?j.trigger("carouselNext",[Math.abs(e)]):e>0&&j.trigger("carouselPrev",[e])}function p(e){"mousedown"===e.type&&t(e.target).is("img")&&e.preventDefault(),k=!0,q=!1,z=!1,T=o(e),S=a(e),O=P=0,M=b,I=Date.now(),clearInterval(D),D=setInterval(l,100)}function h(t){var e,i;if(k)if(e=o(t),y=a(t),i=T-e,Math.abs(S-y)<30&&!z)(i>2||i<-2)&&(q=!0,T=e,s(b+i));else{if(q)return t.preventDefault(),t.stopPropagation(),!1;z=!0}if(q)return t.preventDefault(),t.stopPropagation(),!1}function f(t){if(k)return k=!1,clearInterval(D),A=b,(O>10||O<-10)&&(A=b+(P=.9*O)),A=Math.round(A/x)*x,W&&(A>=x*(C-1)?A=x*(C-1):A<0&&(A=0)),P=A-b,I=Date.now(),requestAnimationFrame(c),q&&(t.preventDefault(),t.stopPropagation()),!1}var v,m,g,b,w,k,x,C,T,S,P,A,O,E,_,M,I,D,q,z,V=t('<ul class="indicators"></ul>'),H=null,L=null,j=t(this),$=j.find(".carousel-item").length>1,N=(j.attr("data-indicators")||e.indicators)&&$,W=j.attr("data-no-wrap")||e.noWrap||!$,F=j.attr("data-namespace")||n+i;j.attr("data-namespace",F);var Q=function(e){var i=j.find(".carousel-item.active").length?j.find(".carousel-item.active").first():j.find(".carousel-item").first(),n=i.find("img").first();if(n.length)if(n[0].complete)if(n.height()>0)j.css("height",n.height());else{var o=n[0].naturalWidth,a=n[0].naturalHeight,r=j.width()/o*a;j.css("height",r)}else n.on("load",function(){j.css("height",t(this).height())});else if(!e){var s=i.height();j.css("height",s)}};if(e.fullWidth&&(e.dist=0,Q(),N&&j.find(".carousel-fixed-item").addClass("with-indicators")),j.hasClass("initialized"))return t(window).trigger("resize"),j.trigger("carouselNext",[1e-6]),!0;j.addClass("initialized"),k=!1,b=A=0,v=[],m=j.find(".carousel-item").first().innerWidth(),g=j.find(".carousel-item").first().innerHeight(),x=2*m+e.padding,j.find(".carousel-item").each(function(e){if(v.push(t(this)[0]),N){var i=t('<li class="indicator-item"></li>');0===e&&i.addClass("active"),i.click(function(e){e.stopPropagation(),d(t(this).index())}),V.append(i)}}),N&&j.append(V),C=v.length,_="transform",["webkit","Moz","O","ms"].every(function(t){var e=t+"Transform";return void 0===document.body.style[e]||(_=e,!1)});var X=Materialize.throttle(function(){if(e.fullWidth){m=j.find(".carousel-item").first().innerWidth();j.find(".carousel-item.active").height();x=2*m+e.padding,A=b=2*w*m,Q(!0)}else s()},200);t(window).off("resize.carousel-"+F).on("resize.carousel-"+F,X),void 0!==window.ontouchstart&&(j.on("touchstart.carousel",p),j.on("touchmove.carousel",h),j.on("touchend.carousel",f)),j.on("mousedown.carousel",p),j.on("mousemove.carousel",h),j.on("mouseup.carousel",f),j.on("mouseleave.carousel",f),j.on("click.carousel",u),s(b),t(this).on("carouselNext",function(t,e,i){void 0===e&&(e=1),"function"==typeof i&&(L=i),A=x*Math.round(b/x)+x*e,b!==A&&(P=A-b,I=Date.now(),requestAnimationFrame(c))}),t(this).on("carouselPrev",function(t,e,i){void 0===e&&(e=1),"function"==typeof i&&(L=i),A=x*Math.round(b/x)-x*e,b!==A&&(P=A-b,I=Date.now(),requestAnimationFrame(c))}),t(this).on("carouselSet",function(t,e,i){void 0===e&&(e=0),"function"==typeof i&&(L=i),d(e)})})},next:function(e,i){t(this).trigger("carouselNext",[e,i])},prev:function(e,i){t(this).trigger("carouselPrev",[e,i])},set:function(e,i){t(this).trigger("carouselSet",[e,i])},destroy:function(){var e=t(this).attr("data-namespace");t(this).removeAttr("data-namespace"),t(this).removeClass("initialized"),t(this).find(".indicators").remove(),t(this).off("carouselNext carouselPrev carouselSet"),t(window).off("resize.carousel-"+e),void 0!==window.ontouchstart&&t(this).off("touchstart.carousel touchmove.carousel touchend.carousel"),t(this).off("mousedown.carousel mousemove.carousel mouseup.carousel mouseleave.carousel click.carousel")}};t.fn.carousel=function(i){return e[i]?e[i].apply(this,Array.prototype.slice.call(arguments,1)):"object"!=typeof i&&i?void t.error("Method "+i+" does not exist on jQuery.carousel"):e.init.apply(this,arguments)}}(jQuery),function(t){var e={init:function(e){return this.each(function(){var i=t("#"+t(this).attr("data-activates")),n=(t("body"),t(this)),o=n.parent(".tap-target-wrapper"),a=o.find(".tap-target-wave"),r=o.find(".tap-target-origin"),s=n.find(".tap-target-content");o.length||(o=n.wrap(t('<div class="tap-target-wrapper"></div>')).parent()),s.length||(s=t('<div class="tap-target-content"></div>'),n.append(s)),a.length||(a=t('<div class="tap-target-wave"></div>'),r.length||((r=i.clone(!0,!0)).addClass("tap-target-origin"),r.removeAttr("id"),r.removeAttr("style"),a.append(r)),o.append(a));var l=function(){o.is(".open")&&(o.removeClass("open"),r.off("click.tapTarget"),t(document).off("click.tapTarget"),t(window).off("resize.tapTarget"))},c=function(){var e="fixed"===i.css("position");if(!e)for(var r=i.parents(),l=0;l<r.length&&!(e="fixed"==t(r[l]).css("position"));l++);var c=i.outerWidth(),u=i.outerHeight(),d=e?i.offset().top-t(document).scrollTop():i.offset().top,p=e?i.offset().left-t(document).scrollLeft():i.offset().left,h=t(window).width(),f=t(window).height(),v=h/2,m=f/2,g=p<=v,y=p>v,b=d<=m,w=d>m,k=p>=.25*h&&p<=.75*h,x=n.outerWidth(),C=n.outerHeight(),T=d+u/2-C/2,S=p+c/2-x/2,P=e?"fixed":"absolute",A=k?x:x/2+c,O=C/2,E=b?C/2:0,_=g&&!k?x/2-c:0,M=c,I=w?"bottom":"top",D=2*c,q=D,z=C/2-q/2,V=x/2-D/2,H={};H.top=b?T:"",H.right=y?h-S-x:"",H.bottom=w?f-T-C:"",H.left=g?S:"",H.position=P,o.css(H),s.css({width:A,height:O,top:E,right:0,bottom:0,left:_,padding:M,verticalAlign:I}),a.css({top:z,left:V,width:D,height:q})};"open"==e&&(c(),o.is(".open")||(o.addClass("open"),setTimeout(function(){r.off("click.tapTarget").on("click.tapTarget",function(t){l(),r.off("click.tapTarget")}),t(document).off("click.tapTarget").on("click.tapTarget",function(e){l(),t(document).off("click.tapTarget")});var e=Materialize.throttle(function(){c()},200);t(window).off("resize.tapTarget").on("resize.tapTarget",e)},0))),"close"==e&&l()})},open:function(){},close:function(){}};t.fn.tapTarget=function(i){if(e[i]||"object"==typeof i)return e.init.apply(this,arguments);t.error("Method "+i+" does not exist on jQuery.tap-target")}}(jQuery);
\ No newline at end of file diff --git a/app/dispatch/static/materialize/js/buttons.js b/app/dispatch/static/materialize/js/buttons.js new file mode 100644 index 0000000..ca923d2 --- /dev/null +++ b/app/dispatch/static/materialize/js/buttons.js @@ -0,0 +1,267 @@ +(function ($) {
+ $(document).ready(function() {
+
+ // jQuery reverse
+ $.fn.reverse = [].reverse;
+
+ // Hover behaviour: make sure this doesn't work on .click-to-toggle FABs!
+ $(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function(e) {
+ var $this = $(this);
+ openFABMenu($this);
+ });
+ $(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function(e) {
+ var $this = $(this);
+ closeFABMenu($this);
+ });
+
+ // Toggle-on-click behaviour.
+ $(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function(e) {
+ var $this = $(this);
+ var $menu = $this.parent();
+ if ($menu.hasClass('active')) {
+ closeFABMenu($menu);
+ } else {
+ openFABMenu($menu);
+ }
+ });
+
+ // Toolbar transition behaviour.
+ $(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function(e) {
+ var $this = $(this);
+ var $menu = $this.parent();
+ FABtoToolbar($menu);
+ });
+
+ });
+
+ $.fn.extend({
+ openFAB: function() {
+ openFABMenu($(this));
+ },
+ closeFAB: function() {
+ closeFABMenu($(this));
+ },
+ openToolbar: function() {
+ FABtoToolbar($(this));
+ },
+ closeToolbar: function() {
+ toolbarToFAB($(this));
+ }
+ });
+
+
+ var openFABMenu = function (btn) {
+ var $this = btn;
+ if ($this.hasClass('active') === false) {
+
+ // Get direction option
+ var horizontal = $this.hasClass('horizontal');
+ var offsetY, offsetX;
+
+ if (horizontal === true) {
+ offsetX = 40;
+ } else {
+ offsetY = 40;
+ }
+
+ $this.addClass('active');
+ $this.find('ul .btn-floating').velocity(
+ { scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px'},
+ { duration: 0 });
+
+ var time = 0;
+ $this.find('ul .btn-floating').reverse().each( function () {
+ $(this).velocity(
+ { opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0'},
+ { duration: 80, delay: time });
+ time += 40;
+ });
+ }
+ };
+
+ var closeFABMenu = function (btn) {
+ var $this = btn;
+ // Get direction option
+ var horizontal = $this.hasClass('horizontal');
+ var offsetY, offsetX;
+
+ if (horizontal === true) {
+ offsetX = 40;
+ } else {
+ offsetY = 40;
+ }
+
+ $this.removeClass('active');
+ var time = 0;
+ $this.find('ul .btn-floating').velocity("stop", true);
+ $this.find('ul .btn-floating').velocity(
+ { opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px'},
+ { duration: 80 }
+ );
+ };
+
+
+ /**
+ * Transform FAB into toolbar
+ * @param {Object} object jQuery object
+ */
+ var FABtoToolbar = function(btn) {
+ if (btn.attr('data-open') === "true") {
+ return;
+ }
+
+ var offsetX, offsetY, scaleFactor;
+ var windowWidth = window.innerWidth;
+ var windowHeight = window.innerHeight;
+ var btnRect = btn[0].getBoundingClientRect();
+ var anchor = btn.find('> a').first();
+ var menu = btn.find('> ul').first();
+ var backdrop = $('<div class="fab-backdrop"></div>');
+ var fabColor = anchor.css('background-color');
+ anchor.append(backdrop);
+
+ offsetX = btnRect.left - (windowWidth / 2) + (btnRect.width / 2);
+ offsetY = windowHeight - btnRect.bottom;
+ scaleFactor = windowWidth / backdrop.width();
+ btn.attr('data-origin-bottom', btnRect.bottom);
+ btn.attr('data-origin-left', btnRect.left);
+ btn.attr('data-origin-width', btnRect.width);
+
+ // Set initial state
+ btn.addClass('active');
+ btn.attr('data-open', true);
+ btn.css({
+ 'text-align': 'center',
+ width: '100%',
+ bottom: 0,
+ left: 0,
+ transform: 'translateX(' + offsetX + 'px)',
+ transition: 'none'
+ });
+ anchor.css({
+ transform: 'translateY(' + -offsetY + 'px)',
+ transition: 'none'
+ });
+ backdrop.css({
+ 'background-color': fabColor
+ });
+
+
+ setTimeout(function() {
+ btn.css({
+ transform: '',
+ transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s'
+ });
+ anchor.css({
+ overflow: 'visible',
+ transform: '',
+ transition: 'transform .2s'
+ });
+
+ setTimeout(function() {
+ btn.css({
+ overflow: 'hidden',
+ 'background-color': fabColor
+ });
+ backdrop.css({
+ transform: 'scale(' + scaleFactor + ')',
+ transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
+ });
+ menu.find('> li > a').css({
+ opacity: 1
+ });
+
+ // Scroll to close.
+ $(window).on('scroll.fabToolbarClose', function() {
+ toolbarToFAB(btn);
+ $(window).off('scroll.fabToolbarClose');
+ $(document).off('click.fabToolbarClose');
+ });
+
+ $(document).on('click.fabToolbarClose', function(e) {
+ if (!$(e.target).closest(menu).length) {
+ toolbarToFAB(btn);
+ $(window).off('scroll.fabToolbarClose');
+ $(document).off('click.fabToolbarClose');
+ }
+ });
+ }, 100);
+ }, 0);
+ };
+
+ /**
+ * Transform toolbar back into FAB
+ * @param {Object} object jQuery object
+ */
+ var toolbarToFAB = function(btn) {
+ if (btn.attr('data-open') !== "true") {
+ return;
+ }
+
+ var offsetX, offsetY, scaleFactor;
+ var windowWidth = window.innerWidth;
+ var windowHeight = window.innerHeight;
+ var btnWidth = btn.attr('data-origin-width');
+ var btnBottom = btn.attr('data-origin-bottom');
+ var btnLeft = btn.attr('data-origin-left');
+ var anchor = btn.find('> .btn-floating').first();
+ var menu = btn.find('> ul').first();
+ var backdrop = btn.find('.fab-backdrop');
+ var fabColor = anchor.css('background-color');
+
+ offsetX = btnLeft - (windowWidth / 2) + (btnWidth / 2);
+ offsetY = windowHeight - btnBottom;
+ scaleFactor = windowWidth / backdrop.width();
+
+
+ // Hide backdrop
+ btn.removeClass('active');
+ btn.attr('data-open', false);
+ btn.css({
+ 'background-color': 'transparent',
+ transition: 'none'
+ });
+ anchor.css({
+ transition: 'none'
+ });
+ backdrop.css({
+ transform: 'scale(0)',
+ 'background-color': fabColor
+ });
+ menu.find('> li > a').css({
+ opacity: ''
+ });
+
+ setTimeout(function() {
+ backdrop.remove();
+
+ // Set initial state.
+ btn.css({
+ 'text-align': '',
+ width: '',
+ bottom: '',
+ left: '',
+ overflow: '',
+ 'background-color': '',
+ transform: 'translate3d(' + -offsetX + 'px,0,0)'
+ });
+ anchor.css({
+ overflow: '',
+ transform: 'translate3d(0,' + offsetY + 'px,0)'
+ });
+
+ setTimeout(function() {
+ btn.css({
+ transform: 'translate3d(0,0,0)',
+ transition: 'transform .2s'
+ });
+ anchor.css({
+ transform: 'translate3d(0,0,0)',
+ transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
+ });
+ }, 20);
+ }, 200);
+ };
+
+
+}( jQuery ));
diff --git a/app/dispatch/static/materialize/js/cards.js b/app/dispatch/static/materialize/js/cards.js new file mode 100644 index 0000000..7e06f94 --- /dev/null +++ b/app/dispatch/static/materialize/js/cards.js @@ -0,0 +1,36 @@ +(function ($) {
+ $(document).ready(function() {
+
+ $(document).on('click.card', '.card', function (e) {
+ if ($(this).find('> .card-reveal').length) {
+ var $card = $(e.target).closest('.card');
+ if ($card.data('initialOverflow') === undefined) {
+ $card.data(
+ 'initialOverflow',
+ $card.css('overflow') === undefined ? '' : $card.css('overflow')
+ );
+ }
+ if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) {
+ // Make Reveal animate down and display none
+ $(this).find('.card-reveal').velocity(
+ {translateY: 0}, {
+ duration: 225,
+ queue: false,
+ easing: 'easeInOutQuad',
+ complete: function() {
+ $(this).css({ display: 'none'});
+ $card.css('overflow', $card.data('initialOverflow'));
+ }
+ }
+ );
+ }
+ else if ($(e.target).is($('.card .activator')) ||
+ $(e.target).is($('.card .activator i')) ) {
+ $card.css('overflow', 'hidden');
+ $(this).find('.card-reveal').css({ display: 'block'}).velocity("stop", false).velocity({translateY: '-100%'}, {duration: 300, queue: false, easing: 'easeInOutQuad'});
+ }
+ }
+ });
+
+ });
+}( jQuery ));
diff --git a/app/dispatch/static/materialize/js/carousel.js b/app/dispatch/static/materialize/js/carousel.js new file mode 100644 index 0000000..44bb118 --- /dev/null +++ b/app/dispatch/static/materialize/js/carousel.js @@ -0,0 +1,565 @@ +(function ($) {
+
+ var methods = {
+
+ init : function(options) {
+ var defaults = {
+ duration: 200, // ms
+ dist: -100, // zoom scale TODO: make this more intuitive as an option
+ shift: 0, // spacing for center image
+ padding: 0, // Padding between non center items
+ fullWidth: false, // Change to full width styles
+ indicators: false, // Toggle indicators
+ noWrap: false, // Don't wrap around and cycle through items.
+ onCycleTo: null // Callback for when a new slide is cycled to.
+ };
+ options = $.extend(defaults, options);
+ var namespace = Materialize.objectSelectorString($(this));
+
+ return this.each(function(i) {
+
+ var images, item_width, item_height, offset, center, pressed, dim, count,
+ reference, referenceY, amplitude, target, velocity, scrolling,
+ xform, frame, timestamp, ticker, dragged, vertical_dragged;
+ var $indicators = $('<ul class="indicators"></ul>');
+ var scrollingTimeout = null;
+ var oneTimeCallback = null;
+
+
+ // Initialize
+ var view = $(this);
+ var hasMultipleSlides = view.find('.carousel-item').length > 1;
+ var showIndicators = (view.attr('data-indicators') || options.indicators) && hasMultipleSlides;
+ var noWrap = (view.attr('data-no-wrap') || options.noWrap) || !hasMultipleSlides;
+ var uniqueNamespace = view.attr('data-namespace') || namespace+i;
+ view.attr('data-namespace', uniqueNamespace);
+
+
+ // Options
+ var setCarouselHeight = function(imageOnly) {
+ var firstSlide = view.find('.carousel-item.active').length ? view.find('.carousel-item.active').first() : view.find('.carousel-item').first();
+ var firstImage = firstSlide.find('img').first();
+ if (firstImage.length) {
+ if (firstImage[0].complete) {
+ // If image won't trigger the load event
+ var imageHeight = firstImage.height();
+ if (imageHeight > 0) {
+ view.css('height', firstImage.height());
+ } else {
+ // If image still has no height, use the natural dimensions to calculate
+ var naturalWidth = firstImage[0].naturalWidth;
+ var naturalHeight = firstImage[0].naturalHeight;
+ var adjustedHeight = (view.width() / naturalWidth) * naturalHeight;
+ view.css('height', adjustedHeight);
+ }
+ } else {
+ // Get height when image is loaded normally
+ firstImage.on('load', function(){
+ view.css('height', $(this).height());
+ });
+ }
+ } else if (!imageOnly) {
+ var slideHeight = firstSlide.height();
+ view.css('height', slideHeight);
+ }
+ };
+
+ if (options.fullWidth) {
+ options.dist = 0;
+ setCarouselHeight();
+
+ // Offset fixed items when indicators.
+ if (showIndicators) {
+ view.find('.carousel-fixed-item').addClass('with-indicators');
+ }
+ }
+
+
+ // Don't double initialize.
+ if (view.hasClass('initialized')) {
+ // Recalculate variables
+ $(window).trigger('resize');
+
+ // Redraw carousel.
+ view.trigger('carouselNext', [0.000001]);
+ return true;
+ }
+
+
+ view.addClass('initialized');
+ pressed = false;
+ offset = target = 0;
+ images = [];
+ item_width = view.find('.carousel-item').first().innerWidth();
+ item_height = view.find('.carousel-item').first().innerHeight();
+ dim = item_width * 2 + options.padding;
+
+ view.find('.carousel-item').each(function (i) {
+ images.push($(this)[0]);
+ if (showIndicators) {
+ var $indicator = $('<li class="indicator-item"></li>');
+
+ // Add active to first by default.
+ if (i === 0) {
+ $indicator.addClass('active');
+ }
+
+ // Handle clicks on indicators.
+ $indicator.click(function (e) {
+ e.stopPropagation();
+
+ var index = $(this).index();
+ cycleTo(index);
+ });
+ $indicators.append($indicator);
+ }
+ });
+
+ if (showIndicators) {
+ view.append($indicators);
+ }
+ count = images.length;
+
+
+ function setupEvents() {
+ if (typeof window.ontouchstart !== 'undefined') {
+ view.on('touchstart.carousel', tap);
+ view.on('touchmove.carousel', drag);
+ view.on('touchend.carousel', release);
+ }
+ view.on('mousedown.carousel', tap);
+ view.on('mousemove.carousel', drag);
+ view.on('mouseup.carousel', release);
+ view.on('mouseleave.carousel', release);
+ view.on('click.carousel', click);
+ }
+
+ function xpos(e) {
+ // touch event
+ if (e.targetTouches && (e.targetTouches.length >= 1)) {
+ return e.targetTouches[0].clientX;
+ }
+
+ // mouse event
+ return e.clientX;
+ }
+
+ function ypos(e) {
+ // touch event
+ if (e.targetTouches && (e.targetTouches.length >= 1)) {
+ return e.targetTouches[0].clientY;
+ }
+
+ // mouse event
+ return e.clientY;
+ }
+
+ function wrap(x) {
+ return (x >= count) ? (x % count) : (x < 0) ? wrap(count + (x % count)) : x;
+ }
+
+ function scroll(x) {
+ // Track scrolling state
+ scrolling = true;
+ if (!view.hasClass('scrolling')) {
+ view.addClass('scrolling');
+ }
+ if (scrollingTimeout != null) {
+ window.clearTimeout(scrollingTimeout);
+ }
+ scrollingTimeout = window.setTimeout(function() {
+ scrolling = false;
+ view.removeClass('scrolling');
+ }, options.duration);
+
+ // Start actual scroll
+ var i, half, delta, dir, tween, el, alignment, xTranslation;
+ var lastCenter = center;
+
+ offset = (typeof x === 'number') ? x : offset;
+ center = Math.floor((offset + dim / 2) / dim);
+ delta = offset - center * dim;
+ dir = (delta < 0) ? 1 : -1;
+ tween = -dir * delta * 2 / dim;
+ half = count >> 1;
+
+ if (!options.fullWidth) {
+ alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) ';
+ alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)';
+ } else {
+ alignment = 'translateX(0)';
+ }
+
+ // Set indicator active
+ if (showIndicators) {
+ var diff = (center % count);
+ var activeIndicator = $indicators.find('.indicator-item.active');
+ if (activeIndicator.index() !== diff) {
+ activeIndicator.removeClass('active');
+ $indicators.find('.indicator-item').eq(diff).addClass('active');
+ }
+ }
+
+ // center
+ // Don't show wrapped items.
+ if (!noWrap || (center >= 0 && center < count)) {
+ el = images[wrap(center)];
+
+ // Add active class to center item.
+ if (!$(el).hasClass('active')) {
+ view.find('.carousel-item').removeClass('active');
+ $(el).addClass('active');
+ }
+ el.style[xform] = alignment +
+ ' translateX(' + (-delta / 2) + 'px)' +
+ ' translateX(' + (dir * options.shift * tween * i) + 'px)' +
+ ' translateZ(' + (options.dist * tween) + 'px)';
+ el.style.zIndex = 0;
+ if (options.fullWidth) { tweenedOpacity = 1; }
+ else { tweenedOpacity = 1 - 0.2 * tween; }
+ el.style.opacity = tweenedOpacity;
+ el.style.display = 'block';
+ }
+
+ for (i = 1; i <= half; ++i) {
+ // right side
+ if (options.fullWidth) {
+ zTranslation = options.dist;
+ tweenedOpacity = (i === half && delta < 0) ? 1 - tween : 1;
+ } else {
+ zTranslation = options.dist * (i * 2 + tween * dir);
+ tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir);
+ }
+ // Don't show wrapped items.
+ if (!noWrap || center + i < count) {
+ el = images[wrap(center + i)];
+ el.style[xform] = alignment +
+ ' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' +
+ ' translateZ(' + zTranslation + 'px)';
+ el.style.zIndex = -i;
+ el.style.opacity = tweenedOpacity;
+ el.style.display = 'block';
+ }
+
+
+ // left side
+ if (options.fullWidth) {
+ zTranslation = options.dist;
+ tweenedOpacity = (i === half && delta > 0) ? 1 - tween : 1;
+ } else {
+ zTranslation = options.dist * (i * 2 - tween * dir);
+ tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir);
+ }
+ // Don't show wrapped items.
+ if (!noWrap || center - i >= 0) {
+ el = images[wrap(center - i)];
+ el.style[xform] = alignment +
+ ' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' +
+ ' translateZ(' + zTranslation + 'px)';
+ el.style.zIndex = -i;
+ el.style.opacity = tweenedOpacity;
+ el.style.display = 'block';
+ }
+ }
+
+ // center
+ // Don't show wrapped items.
+ if (!noWrap || (center >= 0 && center < count)) {
+ el = images[wrap(center)];
+ el.style[xform] = alignment +
+ ' translateX(' + (-delta / 2) + 'px)' +
+ ' translateX(' + (dir * options.shift * tween) + 'px)' +
+ ' translateZ(' + (options.dist * tween) + 'px)';
+ el.style.zIndex = 0;
+ if (options.fullWidth) { tweenedOpacity = 1; }
+ else { tweenedOpacity = 1 - 0.2 * tween; }
+ el.style.opacity = tweenedOpacity;
+ el.style.display = 'block';
+ }
+
+ // onCycleTo callback
+ if (lastCenter !== center &&
+ typeof(options.onCycleTo) === "function") {
+ var $curr_item = view.find('.carousel-item').eq(wrap(center));
+ options.onCycleTo.call(this, $curr_item, dragged);
+ }
+
+ // One time callback
+ if (typeof(oneTimeCallback) === "function") {
+ oneTimeCallback.call(this, $curr_item, dragged);
+ oneTimeCallback = null;
+ }
+ }
+
+ function track() {
+ var now, elapsed, delta, v;
+
+ now = Date.now();
+ elapsed = now - timestamp;
+ timestamp = now;
+ delta = offset - frame;
+ frame = offset;
+
+ v = 1000 * delta / (1 + elapsed);
+ velocity = 0.8 * v + 0.2 * velocity;
+ }
+
+ function autoScroll() {
+ var elapsed, delta;
+
+ if (amplitude) {
+ elapsed = Date.now() - timestamp;
+ delta = amplitude * Math.exp(-elapsed / options.duration);
+ if (delta > 2 || delta < -2) {
+ scroll(target - delta);
+ requestAnimationFrame(autoScroll);
+ } else {
+ scroll(target);
+ }
+ }
+ }
+
+ function click(e) {
+ // Disable clicks if carousel was dragged.
+ if (dragged) {
+ e.preventDefault();
+ e.stopPropagation();
+ return false;
+
+ } else if (!options.fullWidth) {
+ var clickedIndex = $(e.target).closest('.carousel-item').index();
+ var diff = wrap(center) - clickedIndex;
+
+ // Disable clicks if carousel was shifted by click
+ if (diff !== 0) {
+ e.preventDefault();
+ e.stopPropagation();
+ }
+ cycleTo(clickedIndex);
+ }
+ }
+
+ function cycleTo(n) {
+ var diff = (center % count) - n;
+
+ // Account for wraparound.
+ if (!noWrap) {
+ if (diff < 0) {
+ if (Math.abs(diff + count) < Math.abs(diff)) { diff += count; }
+
+ } else if (diff > 0) {
+ if (Math.abs(diff - count) < diff) { diff -= count; }
+ }
+ }
+
+ // Call prev or next accordingly.
+ if (diff < 0) {
+ view.trigger('carouselNext', [Math.abs(diff)]);
+
+ } else if (diff > 0) {
+ view.trigger('carouselPrev', [diff]);
+ }
+ }
+
+ function tap(e) {
+ // Fixes firefox draggable image bug
+ if (e.type === 'mousedown' && $(e.target).is('img')) {
+ e.preventDefault();
+ }
+ pressed = true;
+ dragged = false;
+ vertical_dragged = false;
+ reference = xpos(e);
+ referenceY = ypos(e);
+
+ velocity = amplitude = 0;
+ frame = offset;
+ timestamp = Date.now();
+ clearInterval(ticker);
+ ticker = setInterval(track, 100);
+ }
+
+ function drag(e) {
+ var x, delta, deltaY;
+ if (pressed) {
+ x = xpos(e);
+ y = ypos(e);
+ delta = reference - x;
+ deltaY = Math.abs(referenceY - y);
+ if (deltaY < 30 && !vertical_dragged) {
+ // If vertical scrolling don't allow dragging.
+ if (delta > 2 || delta < -2) {
+ dragged = true;
+ reference = x;
+ scroll(offset + delta);
+ }
+
+ } else if (dragged) {
+ // If dragging don't allow vertical scroll.
+ e.preventDefault();
+ e.stopPropagation();
+ return false;
+
+ } else {
+ // Vertical scrolling.
+ vertical_dragged = true;
+ }
+ }
+
+ if (dragged) {
+ // If dragging don't allow vertical scroll.
+ e.preventDefault();
+ e.stopPropagation();
+ return false;
+ }
+ }
+
+ function release(e) {
+ if (pressed) {
+ pressed = false;
+ } else {
+ return;
+ }
+
+ clearInterval(ticker);
+ target = offset;
+ if (velocity > 10 || velocity < -10) {
+ amplitude = 0.9 * velocity;
+ target = offset + amplitude;
+ }
+ target = Math.round(target / dim) * dim;
+
+ // No wrap of items.
+ if (noWrap) {
+ if (target >= dim * (count - 1)) {
+ target = dim * (count - 1);
+ } else if (target < 0) {
+ target = 0;
+ }
+ }
+ amplitude = target - offset;
+ timestamp = Date.now();
+ requestAnimationFrame(autoScroll);
+
+ if (dragged) {
+ e.preventDefault();
+ e.stopPropagation();
+ }
+ return false;
+ }
+
+ xform = 'transform';
+ ['webkit', 'Moz', 'O', 'ms'].every(function (prefix) {
+ var e = prefix + 'Transform';
+ if (typeof document.body.style[e] !== 'undefined') {
+ xform = e;
+ return false;
+ }
+ return true;
+ });
+
+
+ var throttledResize = Materialize.throttle(function() {
+ if (options.fullWidth) {
+ item_width = view.find('.carousel-item').first().innerWidth();
+ var imageHeight = view.find('.carousel-item.active').height();
+ dim = item_width * 2 + options.padding;
+ offset = center * 2 * item_width;
+ target = offset;
+ setCarouselHeight(true);
+ } else {
+ scroll();
+ }
+ }, 200);
+ $(window)
+ .off('resize.carousel-'+uniqueNamespace)
+ .on('resize.carousel-'+uniqueNamespace, throttledResize);
+
+ setupEvents();
+ scroll(offset);
+
+ $(this).on('carouselNext', function(e, n, callback) {
+ if (n === undefined) {
+ n = 1;
+ }
+ if (typeof(callback) === "function") {
+ oneTimeCallback = callback;
+ }
+
+ target = (dim * Math.round(offset / dim)) + (dim * n);
+ if (offset !== target) {
+ amplitude = target - offset;
+ timestamp = Date.now();
+ requestAnimationFrame(autoScroll);
+ }
+ });
+
+ $(this).on('carouselPrev', function(e, n, callback) {
+ if (n === undefined) {
+ n = 1;
+ }
+ if (typeof(callback) === "function") {
+ oneTimeCallback = callback;
+ }
+
+ target = (dim * Math.round(offset / dim)) - (dim * n);
+ if (offset !== target) {
+ amplitude = target - offset;
+ timestamp = Date.now();
+ requestAnimationFrame(autoScroll);
+ }
+ });
+
+ $(this).on('carouselSet', function(e, n, callback) {
+ if (n === undefined) {
+ n = 0;
+ }
+ if (typeof(callback) === "function") {
+ oneTimeCallback = callback;
+ }
+
+ cycleTo(n);
+ });
+
+ });
+
+
+
+ },
+ next : function(n, callback) {
+ $(this).trigger('carouselNext', [n, callback]);
+ },
+ prev : function(n, callback) {
+ $(this).trigger('carouselPrev', [n, callback]);
+ },
+ set : function(n, callback) {
+ $(this).trigger('carouselSet', [n, callback]);
+ },
+ destroy : function() {
+ var uniqueNamespace = $(this).attr('data-namespace');
+ $(this).removeAttr('data-namespace');
+ $(this).removeClass('initialized');
+ $(this).find('.indicators').remove();
+
+ // Remove event handlers
+ $(this).off('carouselNext carouselPrev carouselSet');
+ $(window).off('resize.carousel-'+uniqueNamespace);
+ if (typeof window.ontouchstart !== 'undefined') {
+ $(this).off('touchstart.carousel touchmove.carousel touchend.carousel');
+ }
+ $(this).off('mousedown.carousel mousemove.carousel mouseup.carousel mouseleave.carousel click.carousel');
+ }
+ };
+
+
+ $.fn.carousel = function(methodOrOptions) {
+ if ( methods[methodOrOptions] ) {
+ return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
+ } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
+ // Default to "init"
+ return methods.init.apply( this, arguments );
+ } else {
+ $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.carousel' );
+ }
+ }; // Plugin end
+}( jQuery ));
diff --git a/app/dispatch/static/materialize/js/character_counter.js b/app/dispatch/static/materialize/js/character_counter.js new file mode 100644 index 0000000..5a36cdf --- /dev/null +++ b/app/dispatch/static/materialize/js/character_counter.js @@ -0,0 +1,72 @@ +(function ($) {
+
+ $.fn.characterCounter = function(){
+ return this.each(function(){
+ var $input = $(this);
+ var $counterElement = $input.parent().find('span[class="character-counter"]');
+
+ // character counter has already been added appended to the parent container
+ if ($counterElement.length) {
+ return;
+ }
+
+ var itHasLengthAttribute = $input.attr('data-length') !== undefined;
+
+ if(itHasLengthAttribute){
+ $input.on('input', updateCounter);
+ $input.on('focus', updateCounter);
+ $input.on('blur', removeCounterElement);
+
+ addCounterElement($input);
+ }
+
+ });
+ };
+
+ function updateCounter(){
+ var maxLength = +$(this).attr('data-length'),
+ actualLength = +$(this).val().length,
+ isValidLength = actualLength <= maxLength;
+
+ $(this).parent().find('span[class="character-counter"]')
+ .html( actualLength + '/' + maxLength);
+
+ addInputStyle(isValidLength, $(this));
+ }
+
+ function addCounterElement($input) {
+ var $counterElement = $input.parent().find('span[class="character-counter"]');
+
+ if ($counterElement.length) {
+ return;
+ }
+
+ $counterElement = $('<span/>')
+ .addClass('character-counter')
+ .css('float','right')
+ .css('font-size','12px')
+ .css('height', 1);
+
+ $input.parent().append($counterElement);
+ }
+
+ function removeCounterElement(){
+ $(this).parent().find('span[class="character-counter"]').html('');
+ }
+
+ function addInputStyle(isValidLength, $input){
+ var inputHasInvalidClass = $input.hasClass('invalid');
+ if (isValidLength && inputHasInvalidClass) {
+ $input.removeClass('invalid');
+ }
+ else if(!isValidLength && !inputHasInvalidClass){
+ $input.removeClass('valid');
+ $input.addClass('invalid');
+ }
+ }
+
+ $(document).ready(function(){
+ $('input, textarea').characterCounter();
+ });
+
+}( jQuery ));
diff --git a/app/dispatch/static/materialize/js/chips.js b/app/dispatch/static/materialize/js/chips.js new file mode 100644 index 0000000..59c7d94 --- /dev/null +++ b/app/dispatch/static/materialize/js/chips.js @@ -0,0 +1,318 @@ +(function ($) {
+ var materialChipsDefaults = {
+ data: [],
+ placeholder: '',
+ secondaryPlaceholder: '',
+ autocompleteOptions: {},
+ };
+
+ $(document).ready(function() {
+ // Handle removal of static chips.
+ $(document).on('click', '.chip .close', function(e){
+ var $chips = $(this).closest('.chips');
+ if ($chips.attr('data-initialized')) {
+ return;
+ }
+ $(this).closest('.chip').remove();
+ });
+ });
+
+ $.fn.material_chip = function (options) {
+ var self = this;
+ this.$el = $(this);
+ this.$document = $(document);
+ this.SELS = {
+ CHIPS: '.chips',
+ CHIP: '.chip',
+ INPUT: 'input',
+ DELETE: '.material-icons',
+ SELECTED_CHIP: '.selected',
+ };
+
+ if ('data' === options) {
+ return this.$el.data('chips');
+ }
+
+ var curr_options = $.extend({}, materialChipsDefaults, options);
+ self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteOptions.data);
+
+ // Initialize
+ this.init = function() {
+ var i = 0;
+ var chips;
+ self.$el.each(function(){
+ var $chips = $(this);
+ var chipId = Materialize.guid();
+ self.chipId = chipId;
+
+ if (!curr_options.data || !(curr_options.data instanceof Array)) {
+ curr_options.data = [];
+ }
+ $chips.data('chips', curr_options.data);
+ $chips.attr('data-index', i);
+ $chips.attr('data-initialized', true);
+
+ if (!$chips.hasClass(self.SELS.CHIPS)) {
+ $chips.addClass('chips');
+ }
+
+ self.chips($chips, chipId);
+ i++;
+ });
+ };
+
+ this.handleEvents = function() {
+ var SELS = self.SELS;
+
+ self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function(e){
+ $(e.target).find(SELS.INPUT).focus();
+ });
+
+ self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function(e){
+ var $chip = $(e.target);
+ if ($chip.length) {
+ var wasSelected = $chip.hasClass('selected');
+ var $chips = $chip.closest(SELS.CHIPS);
+ $(SELS.CHIP).removeClass('selected');
+
+ if (!wasSelected) {
+ self.selectChip($chip.index(), $chips);
+ }
+ }
+ });
+
+ self.$document.off('keydown.chips').on('keydown.chips', function(e){
+ if ($(e.target).is('input, textarea')) {
+ return;
+ }
+
+ // delete
+ var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP);
+ var $chips = $chip.closest(SELS.CHIPS);
+ var length = $chip.siblings(SELS.CHIP).length;
+ var index;
+
+ if (!$chip.length) {
+ return;
+ }
+
+ if (e.which === 8 || e.which === 46) {
+ e.preventDefault();
+
+ index = $chip.index();
+ self.deleteChip(index, $chips);
+
+ var selectIndex = null;
+ if ((index + 1) < length) {
+ selectIndex = index;
+ } else if (index === length || (index + 1) === length) {
+ selectIndex = length - 1;
+ }
+
+ if (selectIndex < 0) selectIndex = null;
+
+ if (null !== selectIndex) {
+ self.selectChip(selectIndex, $chips);
+ }
+ if (!length) $chips.find('input').focus();
+
+ // left
+ } else if (e.which === 37) {
+ index = $chip.index() - 1;
+ if (index < 0) {
+ return;
+ }
+ $(SELS.CHIP).removeClass('selected');
+ self.selectChip(index, $chips);
+
+ // right
+ } else if (e.which === 39) {
+ index = $chip.index() + 1;
+ $(SELS.CHIP).removeClass('selected');
+ if (index > length) {
+ $chips.find('input').focus();
+ return;
+ }
+ self.selectChip(index, $chips);
+ }
+ });
+
+ self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function(e){
+ var $currChips = $(e.target).closest(SELS.CHIPS);
+ $currChips.addClass('focus');
+ $currChips.siblings('label, .prefix').addClass('active');
+ $(SELS.CHIP).removeClass('selected');
+ });
+
+ self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function(e){
+ var $currChips = $(e.target).closest(SELS.CHIPS);
+ $currChips.removeClass('focus');
+
+ // Remove active if empty
+ if ($currChips.data('chips') === undefined || !$currChips.data('chips').length) {
+ $currChips.siblings('label').removeClass('active');
+ }
+ $currChips.siblings('.prefix').removeClass('active');
+ });
+
+ self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function(e){
+ var $target = $(e.target);
+ var $chips = $target.closest(SELS.CHIPS);
+ var chipsLength = $chips.children(SELS.CHIP).length;
+
+ // enter
+ if (13 === e.which) {
+ // Override enter if autocompleting.
+ if (self.hasAutocomplete &&
+ $chips.find('.autocomplete-content.dropdown-content').length &&
+ $chips.find('.autocomplete-content.dropdown-content').children().length) {
+ return;
+ }
+
+ e.preventDefault();
+ self.addChip({tag: $target.val()}, $chips);
+ $target.val('');
+ return;
+ }
+
+ // delete or left
+ if ((8 === e.keyCode || 37 === e.keyCode) && '' === $target.val() && chipsLength) {
+ e.preventDefault();
+ self.selectChip(chipsLength - 1, $chips);
+ $target.blur();
+ return;
+ }
+ });
+
+ // Click on delete icon in chip.
+ self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function(e) {
+ var $target = $(e.target);
+ var $chips = $target.closest(SELS.CHIPS);
+ var $chip = $target.closest(SELS.CHIP);
+ e.stopPropagation();
+ self.deleteChip($chip.index(), $chips);
+ $chips.find('input').focus();
+ });
+ };
+
+ this.chips = function($chips, chipId) {
+ $chips.empty();
+ $chips.data('chips').forEach(function(elem){
+ $chips.append(self.renderChip(elem));
+ });
+ $chips.append($('<input id="' + chipId +'" class="input" placeholder="">'));
+ self.setPlaceholder($chips);
+
+ // Set for attribute for label
+ var label = $chips.next('label');
+ if (label.length) {
+ label.attr('for', chipId);
+
+ if ($chips.data('chips')!== undefined && $chips.data('chips').length) {
+ label.addClass('active');
+ }
+ }
+
+ // Setup autocomplete if needed.
+ var input = $('#' + chipId);
+ if (self.hasAutocomplete) {
+ curr_options.autocompleteOptions.onAutocomplete = function(val) {
+ self.addChip({tag: val}, $chips);
+ input.val('');
+ input.focus();
+ }
+ input.autocomplete(curr_options.autocompleteOptions);
+ }
+ };
+
+ /**
+ * Render chip jQuery element.
+ * @param {Object} elem
+ * @return {jQuery}
+ */
+ this.renderChip = function(elem) {
+ if (!elem.tag) return;
+
+ var $renderedChip = $('<div class="chip"></div>');
+ $renderedChip.text(elem.tag);
+ if (elem.image) {
+ $renderedChip.prepend($('<img />').attr('src', elem.image))
+ }
+ $renderedChip.append($('<i class="material-icons close">close</i>'));
+ return $renderedChip;
+ };
+
+ this.setPlaceholder = function($chips) {
+ if (($chips.data('chips') !== undefined && !$chips.data('chips').length) && curr_options.placeholder) {
+ $chips.find('input').prop('placeholder', curr_options.placeholder);
+
+ } else if (($chips.data('chips') === undefined || !!$chips.data('chips').length) && curr_options.secondaryPlaceholder) {
+ $chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder);
+ }
+ };
+
+ this.isValid = function($chips, elem) {
+ var chips = $chips.data('chips');
+ var exists = false;
+ for (var i=0; i < chips.length; i++) {
+ if (chips[i].tag === elem.tag) {
+ exists = true;
+ return;
+ }
+ }
+ return '' !== elem.tag && !exists;
+ };
+
+ this.addChip = function(elem, $chips) {
+ if (!self.isValid($chips, elem)) {
+ return;
+ }
+ var $renderedChip = self.renderChip(elem);
+ var newData = [];
+ var oldData = $chips.data('chips');
+ for (var i = 0; i < oldData.length; i++) {
+ newData.push(oldData[i]);
+ }
+ newData.push(elem);
+
+ $chips.data('chips', newData);
+ $renderedChip.insertBefore($chips.find('input'));
+ $chips.trigger('chip.add', elem);
+ self.setPlaceholder($chips);
+ };
+
+ this.deleteChip = function(chipIndex, $chips) {
+ var chip = $chips.data('chips')[chipIndex];
+ $chips.find('.chip').eq(chipIndex).remove();
+
+ var newData = [];
+ var oldData = $chips.data('chips');
+ for (var i = 0; i < oldData.length; i++) {
+ if (i !== chipIndex) {
+ newData.push(oldData[i]);
+ }
+ }
+
+ $chips.data('chips', newData);
+ $chips.trigger('chip.delete', chip);
+ self.setPlaceholder($chips);
+ };
+
+ this.selectChip = function(chipIndex, $chips) {
+ var $chip = $chips.find('.chip').eq(chipIndex);
+ if ($chip && false === $chip.hasClass('selected')) {
+ $chip.addClass('selected');
+ $chips.trigger('chip.select', $chips.data('chips')[chipIndex]);
+ }
+ };
+
+ this.getChipsElement = function(index, $chips) {
+ return $chips.eq(index);
+ };
+
+ // init
+ this.init();
+
+ this.handleEvents();
+ };
+}( jQuery ));
diff --git a/app/dispatch/static/materialize/js/collapsible.js b/app/dispatch/static/materialize/js/collapsible.js new file mode 100644 index 0000000..8782ea2 --- /dev/null +++ b/app/dispatch/static/materialize/js/collapsible.js @@ -0,0 +1,183 @@ +(function ($) {
+ $.fn.collapsible = function(options, methodParam) {
+ var defaults = {
+ accordion: undefined,
+ onOpen: undefined,
+ onClose: undefined
+ };
+
+ var methodName = options;
+ options = $.extend(defaults, options);
+
+
+ return this.each(function() {
+
+ var $this = $(this);
+
+ var $panel_headers = $(this).find('> li > .collapsible-header');
+
+ var collapsible_type = $this.data("collapsible");
+
+ /****************
+ Helper Functions
+ ****************/
+
+ // Accordion Open
+ function accordionOpen(object) {
+ $panel_headers = $this.find('> li > .collapsible-header');
+ if (object.hasClass('active')) {
+ object.parent().addClass('active');
+ }
+ else {
+ object.parent().removeClass('active');
+ }
+ if (object.parent().hasClass('active')){
+ object.siblings('.collapsible-body').stop(true,false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}});
+ }
+ else{
+ object.siblings('.collapsible-body').stop(true,false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}});
+ }
+
+ $panel_headers.not(object).removeClass('active').parent().removeClass('active');
+
+ // Close previously open accordion elements.
+ $panel_headers.not(object).parent().children('.collapsible-body').stop(true,false).each(function() {
+ if ($(this).is(':visible')) {
+ $(this).slideUp({
+ duration: 350,
+ easing: "easeOutQuart",
+ queue: false,
+ complete:
+ function() {
+ $(this).css('height', '');
+ execCallbacks($(this).siblings('.collapsible-header'));
+ }
+ });
+ }
+ });
+ }
+
+ // Expandable Open
+ function expandableOpen(object) {
+ if (object.hasClass('active')) {
+ object.parent().addClass('active');
+ }
+ else {
+ object.parent().removeClass('active');
+ }
+ if (object.parent().hasClass('active')){
+ object.siblings('.collapsible-body').stop(true,false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}});
+ }
+ else {
+ object.siblings('.collapsible-body').stop(true,false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}});
+ }
+ }
+
+ // Open collapsible. object: .collapsible-header
+ function collapsibleOpen(object, noToggle) {
+ if (!noToggle) {
+ object.toggleClass('active');
+ }
+
+ if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion
+ accordionOpen(object);
+ } else { // Handle Expandables
+ expandableOpen(object);
+ }
+
+ execCallbacks(object);
+ }
+
+ // Handle callbacks
+ function execCallbacks(object) {
+ if (object.hasClass('active')) {
+ if (typeof(options.onOpen) === "function") {
+ options.onOpen.call(this, object.parent());
+ }
+ } else {
+ if (typeof(options.onClose) === "function") {
+ options.onClose.call(this, object.parent());
+ }
+ }
+ }
+
+ /**
+ * Check if object is children of panel header
+ * @param {Object} object Jquery object
+ * @return {Boolean} true if it is children
+ */
+ function isChildrenOfPanelHeader(object) {
+
+ var panelHeader = getPanelHeader(object);
+
+ return panelHeader.length > 0;
+ }
+
+ /**
+ * Get panel header from a children element
+ * @param {Object} object Jquery object
+ * @return {Object} panel header object
+ */
+ function getPanelHeader(object) {
+
+ return object.closest('li > .collapsible-header');
+ }
+
+
+ // Turn off any existing event handlers
+ function removeEventHandlers() {
+ $this.off('click.collapse', '> li > .collapsible-header');
+ }
+
+ /***** End Helper Functions *****/
+
+
+ // Methods
+ if (methodName === 'destroy') {
+ removeEventHandlers();
+ return;
+ } else if (methodParam >= 0 &&
+ methodParam < $panel_headers.length) {
+ var $curr_header = $panel_headers.eq(methodParam);
+ if ($curr_header.length &&
+ (methodName === 'open' ||
+ (methodName === 'close' &&
+ $curr_header.hasClass('active')))) {
+ collapsibleOpen($curr_header);
+ }
+ return;
+ }
+
+
+ removeEventHandlers();
+
+
+ // Add click handler to only direct collapsible header children
+ $this.on('click.collapse', '> li > .collapsible-header', function(e) {
+ var element = $(e.target);
+
+ if (isChildrenOfPanelHeader(element)) {
+ element = getPanelHeader(element);
+ }
+
+ collapsibleOpen(element);
+ });
+
+
+ // Open first active
+ if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion
+ collapsibleOpen($panel_headers.filter('.active').first(), true);
+
+ } else { // Handle Expandables
+ $panel_headers.filter('.active').each(function() {
+ collapsibleOpen($(this), true);
+ });
+ }
+
+ });
+ };
+
+ $(document).ready(function(){
+ $('.collapsible').collapsible();
+ });
+}( jQuery ));
\ No newline at end of file diff --git a/app/dispatch/static/materialize/js/date_picker/picker.date.js b/app/dispatch/static/materialize/js/date_picker/picker.date.js new file mode 100644 index 0000000..1a7fbe9 --- /dev/null +++ b/app/dispatch/static/materialize/js/date_picker/picker.date.js @@ -0,0 +1,1429 @@ +/*!
+ * Date picker for pickadate.js v3.5.0
+ * http://amsul.github.io/pickadate.js/date.htm
+ */
+
+(function ( factory ) {
+ factory( Materialize.Picker, jQuery )
+
+}(function( Picker, $ ) {
+
+
+/**
+ * Globals and constants
+ */
+var DAYS_IN_WEEK = 7,
+ WEEKS_IN_CALENDAR = 6,
+ _ = Picker._;
+
+
+
+/**
+ * The date picker constructor
+ */
+function DatePicker( picker, settings ) {
+
+ var calendar = this,
+ element = picker.$node[ 0 ],
+ elementValue = element.value,
+ elementDataValue = picker.$node.data( 'value' ),
+ valueString = elementDataValue || elementValue,
+ formatString = elementDataValue ? settings.formatSubmit : settings.format,
+ isRTL = function() {
+
+ return element.currentStyle ?
+
+ // For IE.
+ element.currentStyle.direction == 'rtl' :
+
+ // For normal browsers.
+ getComputedStyle( picker.$root[0] ).direction == 'rtl'
+ }
+
+ calendar.settings = settings
+ calendar.$node = picker.$node
+
+ // The queue of methods that will be used to build item objects.
+ calendar.queue = {
+ min: 'measure create',
+ max: 'measure create',
+ now: 'now create',
+ select: 'parse create validate',
+ highlight: 'parse navigate create validate',
+ view: 'parse create validate viewset',
+ disable: 'deactivate',
+ enable: 'activate'
+ }
+
+ // The component's item object.
+ calendar.item = {}
+
+ calendar.item.clear = null
+ calendar.item.disable = ( settings.disable || [] ).slice( 0 )
+ calendar.item.enable = -(function( collectionDisabled ) {
+ return collectionDisabled[ 0 ] === true ? collectionDisabled.shift() : -1
+ })( calendar.item.disable )
+
+ calendar.
+ set( 'min', settings.min ).
+ set( 'max', settings.max ).
+ set( 'now' )
+
+ // When there’s a value, set the `select`, which in turn
+ // also sets the `highlight` and `view`.
+ if ( valueString ) {
+ calendar.set( 'select', valueString, { format: formatString })
+ }
+
+ // If there’s no value, default to highlighting “today”.
+ else {
+ calendar.
+ set( 'select', null ).
+ set( 'highlight', calendar.item.now )
+ }
+
+
+ // The keycode to movement mapping.
+ calendar.key = {
+ 40: 7, // Down
+ 38: -7, // Up
+ 39: function() { return isRTL() ? -1 : 1 }, // Right
+ 37: function() { return isRTL() ? 1 : -1 }, // Left
+ go: function( timeChange ) {
+ var highlightedObject = calendar.item.highlight,
+ targetDate = new Date( highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange )
+ calendar.set(
+ 'highlight',
+ targetDate,
+ { interval: timeChange }
+ )
+ this.render()
+ }
+ }
+
+
+ // Bind some picker events.
+ picker.
+ on( 'render', function() {
+ picker.$root.find( '.' + settings.klass.selectMonth ).on( 'change', function() {
+ var value = this.value
+ if ( value ) {
+ picker.set( 'highlight', [ picker.get( 'view' ).year, value, picker.get( 'highlight' ).date ] )
+ picker.$root.find( '.' + settings.klass.selectMonth ).trigger( 'focus' )
+ }
+ })
+ picker.$root.find( '.' + settings.klass.selectYear ).on( 'change', function() {
+ var value = this.value
+ if ( value ) {
+ picker.set( 'highlight', [ value, picker.get( 'view' ).month, picker.get( 'highlight' ).date ] )
+ picker.$root.find( '.' + settings.klass.selectYear ).trigger( 'focus' )
+ }
+ })
+ }, 1 ).
+ on( 'open', function() {
+ var includeToday = ''
+ if ( calendar.disabled( calendar.get('now') ) ) {
+ includeToday = ':not(.' + settings.klass.buttonToday + ')'
+ }
+ picker.$root.find( 'button' + includeToday + ', select' ).attr( 'disabled', false )
+ }, 1 ).
+ on( 'close', function() {
+ picker.$root.find( 'button, select' ).attr( 'disabled', true )
+ }, 1 )
+
+} //DatePicker
+
+
+/**
+ * Set a datepicker item object.
+ */
+DatePicker.prototype.set = function( type, value, options ) {
+
+ var calendar = this,
+ calendarItem = calendar.item
+
+ // If the value is `null` just set it immediately.
+ if ( value === null ) {
+ if ( type == 'clear' ) type = 'select'
+ calendarItem[ type ] = value
+ return calendar
+ }
+
+ // Otherwise go through the queue of methods, and invoke the functions.
+ // Update this as the time unit, and set the final value as this item.
+ // * In the case of `enable`, keep the queue but set `disable` instead.
+ // And in the case of `flip`, keep the queue but set `enable` instead.
+ calendarItem[ ( type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type ) ] = calendar.queue[ type ].split( ' ' ).map( function( method ) {
+ value = calendar[ method ]( type, value, options )
+ return value
+ }).pop()
+
+ // Check if we need to cascade through more updates.
+ if ( type == 'select' ) {
+ calendar.set( 'highlight', calendarItem.select, options )
+ }
+ else if ( type == 'highlight' ) {
+ calendar.set( 'view', calendarItem.highlight, options )
+ }
+ else if ( type.match( /^(flip|min|max|disable|enable)$/ ) ) {
+ if ( calendarItem.select && calendar.disabled( calendarItem.select ) ) {
+ calendar.set( 'select', calendarItem.select, options )
+ }
+ if ( calendarItem.highlight && calendar.disabled( calendarItem.highlight ) ) {
+ calendar.set( 'highlight', calendarItem.highlight, options )
+ }
+ }
+
+ return calendar
+} //DatePicker.prototype.set
+
+
+/**
+ * Get a datepicker item object.
+ */
+DatePicker.prototype.get = function( type ) {
+ return this.item[ type ]
+} //DatePicker.prototype.get
+
+
+/**
+ * Create a picker date object.
+ */
+DatePicker.prototype.create = function( type, value, options ) {
+
+ var isInfiniteValue,
+ calendar = this
+
+ // If there’s no value, use the type as the value.
+ value = value === undefined ? type : value
+
+
+ // If it’s infinity, update the value.
+ if ( value == -Infinity || value == Infinity ) {
+ isInfiniteValue = value
+ }
+
+ // If it’s an object, use the native date object.
+ else if ( $.isPlainObject( value ) && _.isInteger( value.pick ) ) {
+ value = value.obj
+ }
+
+ // If it’s an array, convert it into a date and make sure
+ // that it’s a valid date – otherwise default to today.
+ else if ( $.isArray( value ) ) {
+ value = new Date( value[ 0 ], value[ 1 ], value[ 2 ] )
+ value = _.isDate( value ) ? value : calendar.create().obj
+ }
+
+ // If it’s a number or date object, make a normalized date.
+ else if ( _.isInteger( value ) || _.isDate( value ) ) {
+ value = calendar.normalize( new Date( value ), options )
+ }
+
+ // If it’s a literal true or any other case, set it to now.
+ else /*if ( value === true )*/ {
+ value = calendar.now( type, value, options )
+ }
+
+ // Return the compiled object.
+ return {
+ year: isInfiniteValue || value.getFullYear(),
+ month: isInfiniteValue || value.getMonth(),
+ date: isInfiniteValue || value.getDate(),
+ day: isInfiniteValue || value.getDay(),
+ obj: isInfiniteValue || value,
+ pick: isInfiniteValue || value.getTime()
+ }
+} //DatePicker.prototype.create
+
+
+/**
+ * Create a range limit object using an array, date object,
+ * literal “true”, or integer relative to another time.
+ */
+DatePicker.prototype.createRange = function( from, to ) {
+
+ var calendar = this,
+ createDate = function( date ) {
+ if ( date === true || $.isArray( date ) || _.isDate( date ) ) {
+ return calendar.create( date )
+ }
+ return date
+ }
+
+ // Create objects if possible.
+ if ( !_.isInteger( from ) ) {
+ from = createDate( from )
+ }
+ if ( !_.isInteger( to ) ) {
+ to = createDate( to )
+ }
+
+ // Create relative dates.
+ if ( _.isInteger( from ) && $.isPlainObject( to ) ) {
+ from = [ to.year, to.month, to.date + from ];
+ }
+ else if ( _.isInteger( to ) && $.isPlainObject( from ) ) {
+ to = [ from.year, from.month, from.date + to ];
+ }
+
+ return {
+ from: createDate( from ),
+ to: createDate( to )
+ }
+} //DatePicker.prototype.createRange
+
+
+/**
+ * Check if a date unit falls within a date range object.
+ */
+DatePicker.prototype.withinRange = function( range, dateUnit ) {
+ range = this.createRange(range.from, range.to)
+ return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick
+}
+
+
+/**
+ * Check if two date range objects overlap.
+ */
+DatePicker.prototype.overlapRanges = function( one, two ) {
+
+ var calendar = this
+
+ // Convert the ranges into comparable dates.
+ one = calendar.createRange( one.from, one.to )
+ two = calendar.createRange( two.from, two.to )
+
+ return calendar.withinRange( one, two.from ) || calendar.withinRange( one, two.to ) ||
+ calendar.withinRange( two, one.from ) || calendar.withinRange( two, one.to )
+}
+
+
+/**
+ * Get the date today.
+ */
+DatePicker.prototype.now = function( type, value, options ) {
+ value = new Date()
+ if ( options && options.rel ) {
+ value.setDate( value.getDate() + options.rel )
+ }
+ return this.normalize( value, options )
+}
+
+
+/**
+ * Navigate to next/prev month.
+ */
+DatePicker.prototype.navigate = function( type, value, options ) {
+
+ var targetDateObject,
+ targetYear,
+ targetMonth,
+ targetDate,
+ isTargetArray = $.isArray( value ),
+ isTargetObject = $.isPlainObject( value ),
+ viewsetObject = this.item.view/*,
+ safety = 100*/
+
+
+ if ( isTargetArray || isTargetObject ) {
+
+ if ( isTargetObject ) {
+ targetYear = value.year
+ targetMonth = value.month
+ targetDate = value.date
+ }
+ else {
+ targetYear = +value[0]
+ targetMonth = +value[1]
+ targetDate = +value[2]
+ }
+
+ // If we’re navigating months but the view is in a different
+ // month, navigate to the view’s year and month.
+ if ( options && options.nav && viewsetObject && viewsetObject.month !== targetMonth ) {
+ targetYear = viewsetObject.year
+ targetMonth = viewsetObject.month
+ }
+
+ // Figure out the expected target year and month.
+ targetDateObject = new Date( targetYear, targetMonth + ( options && options.nav ? options.nav : 0 ), 1 )
+ targetYear = targetDateObject.getFullYear()
+ targetMonth = targetDateObject.getMonth()
+
+ // If the month we’re going to doesn’t have enough days,
+ // keep decreasing the date until we reach the month’s last date.
+ while ( /*safety &&*/ new Date( targetYear, targetMonth, targetDate ).getMonth() !== targetMonth ) {
+ targetDate -= 1
+ /*safety -= 1
+ if ( !safety ) {
+ throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.'
+ }*/
+ }
+
+ value = [ targetYear, targetMonth, targetDate ]
+ }
+
+ return value
+} //DatePicker.prototype.navigate
+
+
+/**
+ * Normalize a date by setting the hours to midnight.
+ */
+DatePicker.prototype.normalize = function( value/*, options*/ ) {
+ value.setHours( 0, 0, 0, 0 )
+ return value
+}
+
+
+/**
+ * Measure the range of dates.
+ */
+DatePicker.prototype.measure = function( type, value/*, options*/ ) {
+
+ var calendar = this
+
+ // If it’s anything false-y, remove the limits.
+ if ( !value ) {
+ value = type == 'min' ? -Infinity : Infinity
+ }
+
+ // If it’s a string, parse it.
+ else if ( typeof value == 'string' ) {
+ value = calendar.parse( type, value )
+ }
+
+ // If it's an integer, get a date relative to today.
+ else if ( _.isInteger( value ) ) {
+ value = calendar.now( type, value, { rel: value } )
+ }
+
+ return value
+} ///DatePicker.prototype.measure
+
+
+/**
+ * Create a viewset object based on navigation.
+ */
+DatePicker.prototype.viewset = function( type, dateObject/*, options*/ ) {
+ return this.create([ dateObject.year, dateObject.month, 1 ])
+}
+
+
+/**
+ * Validate a date as enabled and shift if needed.
+ */
+DatePicker.prototype.validate = function( type, dateObject, options ) {
+
+ var calendar = this,
+
+ // Keep a reference to the original date.
+ originalDateObject = dateObject,
+
+ // Make sure we have an interval.
+ interval = options && options.interval ? options.interval : 1,
+
+ // Check if the calendar enabled dates are inverted.
+ isFlippedBase = calendar.item.enable === -1,
+
+ // Check if we have any enabled dates after/before now.
+ hasEnabledBeforeTarget, hasEnabledAfterTarget,
+
+ // The min & max limits.
+ minLimitObject = calendar.item.min,
+ maxLimitObject = calendar.item.max,
+
+ // Check if we’ve reached the limit during shifting.
+ reachedMin, reachedMax,
+
+ // Check if the calendar is inverted and at least one weekday is enabled.
+ hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter( function( value ) {
+
+ // If there’s a date, check where it is relative to the target.
+ if ( $.isArray( value ) ) {
+ var dateTime = calendar.create( value ).pick
+ if ( dateTime < dateObject.pick ) hasEnabledBeforeTarget = true
+ else if ( dateTime > dateObject.pick ) hasEnabledAfterTarget = true
+ }
+
+ // Return only integers for enabled weekdays.
+ return _.isInteger( value )
+ }).length/*,
+
+ safety = 100*/
+
+
+
+ // Cases to validate for:
+ // [1] Not inverted and date disabled.
+ // [2] Inverted and some dates enabled.
+ // [3] Not inverted and out of range.
+ //
+ // Cases to **not** validate for:
+ // • Navigating months.
+ // • Not inverted and date enabled.
+ // • Inverted and all dates disabled.
+ // • ..and anything else.
+ if ( !options || !options.nav ) if (
+ /* 1 */ ( !isFlippedBase && calendar.disabled( dateObject ) ) ||
+ /* 2 */ ( isFlippedBase && calendar.disabled( dateObject ) && ( hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget ) ) ||
+ /* 3 */ ( !isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick) )
+ ) {
+
+
+ // When inverted, flip the direction if there aren’t any enabled weekdays
+ // and there are no enabled dates in the direction of the interval.
+ if ( isFlippedBase && !hasEnabledWeekdays && ( ( !hasEnabledAfterTarget && interval > 0 ) || ( !hasEnabledBeforeTarget && interval < 0 ) ) ) {
+ interval *= -1
+ }
+
+
+ // Keep looping until we reach an enabled date.
+ while ( /*safety &&*/ calendar.disabled( dateObject ) ) {
+
+ /*safety -= 1
+ if ( !safety ) {
+ throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.'
+ }*/
+
+
+ // If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval.
+ if ( Math.abs( interval ) > 1 && ( dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month ) ) {
+ dateObject = originalDateObject
+ interval = interval > 0 ? 1 : -1
+ }
+
+
+ // If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit.
+ if ( dateObject.pick <= minLimitObject.pick ) {
+ reachedMin = true
+ interval = 1
+ dateObject = calendar.create([
+ minLimitObject.year,
+ minLimitObject.month,
+ minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1)
+ ])
+ }
+ else if ( dateObject.pick >= maxLimitObject.pick ) {
+ reachedMax = true
+ interval = -1
+ dateObject = calendar.create([
+ maxLimitObject.year,
+ maxLimitObject.month,
+ maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1)
+ ])
+ }
+
+
+ // If we’ve reached both limits, just break out of the loop.
+ if ( reachedMin && reachedMax ) {
+ break
+ }
+
+
+ // Finally, create the shifted date using the interval and keep looping.
+ dateObject = calendar.create([ dateObject.year, dateObject.month, dateObject.date + interval ])
+ }
+
+ } //endif
+
+
+ // Return the date object settled on.
+ return dateObject
+} //DatePicker.prototype.validate
+
+
+/**
+ * Check if a date is disabled.
+ */
+DatePicker.prototype.disabled = function( dateToVerify ) {
+
+ var
+ calendar = this,
+
+ // Filter through the disabled dates to check if this is one.
+ isDisabledMatch = calendar.item.disable.filter( function( dateToDisable ) {
+
+ // If the date is a number, match the weekday with 0index and `firstDay` check.
+ if ( _.isInteger( dateToDisable ) ) {
+ return dateToVerify.day === ( calendar.settings.firstDay ? dateToDisable : dateToDisable - 1 ) % 7
+ }
+
+ // If it’s an array or a native JS date, create and match the exact date.
+ if ( $.isArray( dateToDisable ) || _.isDate( dateToDisable ) ) {
+ return dateToVerify.pick === calendar.create( dateToDisable ).pick
+ }
+
+ // If it’s an object, match a date within the “from” and “to” range.
+ if ( $.isPlainObject( dateToDisable ) ) {
+ return calendar.withinRange( dateToDisable, dateToVerify )
+ }
+ })
+
+ // If this date matches a disabled date, confirm it’s not inverted.
+ isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function( dateToDisable ) {
+ return $.isArray( dateToDisable ) && dateToDisable[3] == 'inverted' ||
+ $.isPlainObject( dateToDisable ) && dateToDisable.inverted
+ }).length
+
+ // Check the calendar “enabled” flag and respectively flip the
+ // disabled state. Then also check if it’s beyond the min/max limits.
+ return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch ||
+ dateToVerify.pick < calendar.item.min.pick ||
+ dateToVerify.pick > calendar.item.max.pick
+
+} //DatePicker.prototype.disabled
+
+
+/**
+ * Parse a string into a usable type.
+ */
+DatePicker.prototype.parse = function( type, value, options ) {
+
+ var calendar = this,
+ parsingObject = {}
+
+ // If it’s already parsed, we’re good.
+ if ( !value || typeof value != 'string' ) {
+ return value
+ }
+
+ // We need a `.format` to parse the value with.
+ if ( !( options && options.format ) ) {
+ options = options || {}
+ options.format = calendar.settings.format
+ }
+
+ // Convert the format into an array and then map through it.
+ calendar.formats.toArray( options.format ).map( function( label ) {
+
+ var
+ // Grab the formatting label.
+ formattingLabel = calendar.formats[ label ],
+
+ // The format length is from the formatting label function or the
+ // label length without the escaping exclamation (!) mark.
+ formatLength = formattingLabel ? _.trigger( formattingLabel, calendar, [ value, parsingObject ] ) : label.replace( /^!/, '' ).length
+
+ // If there's a format label, split the value up to the format length.
+ // Then add it to the parsing object with appropriate label.
+ if ( formattingLabel ) {
+ parsingObject[ label ] = value.substr( 0, formatLength )
+ }
+
+ // Update the value as the substring from format length to end.
+ value = value.substr( formatLength )
+ })
+
+ // Compensate for month 0index.
+ return [
+ parsingObject.yyyy || parsingObject.yy,
+ +( parsingObject.mm || parsingObject.m ) - 1,
+ parsingObject.dd || parsingObject.d
+ ]
+} //DatePicker.prototype.parse
+
+
+/**
+ * Various formats to display the object in.
+ */
+DatePicker.prototype.formats = (function() {
+
+ // Return the length of the first word in a collection.
+ function getWordLengthFromCollection( string, collection, dateObject ) {
+
+ // Grab the first word from the string.
+ var word = string.match( /\w+/ )[ 0 ]
+
+ // If there's no month index, add it to the date object
+ if ( !dateObject.mm && !dateObject.m ) {
+ dateObject.m = collection.indexOf( word ) + 1
+ }
+
+ // Return the length of the word.
+ return word.length
+ }
+
+ // Get the length of the first word in a string.
+ function getFirstWordLength( string ) {
+ return string.match( /\w+/ )[ 0 ].length
+ }
+
+ return {
+
+ d: function( string, dateObject ) {
+
+ // If there's string, then get the digits length.
+ // Otherwise return the selected date.
+ return string ? _.digits( string ) : dateObject.date
+ },
+ dd: function( string, dateObject ) {
+
+ // If there's a string, then the length is always 2.
+ // Otherwise return the selected date with a leading zero.
+ return string ? 2 : _.lead( dateObject.date )
+ },
+ ddd: function( string, dateObject ) {
+
+ // If there's a string, then get the length of the first word.
+ // Otherwise return the short selected weekday.
+ return string ? getFirstWordLength( string ) : this.settings.weekdaysShort[ dateObject.day ]
+ },
+ dddd: function( string, dateObject ) {
+
+ // If there's a string, then get the length of the first word.
+ // Otherwise return the full selected weekday.
+ return string ? getFirstWordLength( string ) : this.settings.weekdaysFull[ dateObject.day ]
+ },
+ m: function( string, dateObject ) {
+
+ // If there's a string, then get the length of the digits
+ // Otherwise return the selected month with 0index compensation.
+ return string ? _.digits( string ) : dateObject.month + 1
+ },
+ mm: function( string, dateObject ) {
+
+ // If there's a string, then the length is always 2.
+ // Otherwise return the selected month with 0index and leading zero.
+ return string ? 2 : _.lead( dateObject.month + 1 )
+ },
+ mmm: function( string, dateObject ) {
+
+ var collection = this.settings.monthsShort
+
+ // If there's a string, get length of the relevant month from the short
+ // months collection. Otherwise return the selected month from that collection.
+ return string ? getWordLengthFromCollection( string, collection, dateObject ) : collection[ dateObject.month ]
+ },
+ mmmm: function( string, dateObject ) {
+
+ var collection = this.settings.monthsFull
+
+ // If there's a string, get length of the relevant month from the full
+ // months collection. Otherwise return the selected month from that collection.
+ return string ? getWordLengthFromCollection( string, collection, dateObject ) : collection[ dateObject.month ]
+ },
+ yy: function( string, dateObject ) {
+
+ // If there's a string, then the length is always 2.
+ // Otherwise return the selected year by slicing out the first 2 digits.
+ return string ? 2 : ( '' + dateObject.year ).slice( 2 )
+ },
+ yyyy: function( string, dateObject ) {
+
+ // If there's a string, then the length is always 4.
+ // Otherwise return the selected year.
+ return string ? 4 : dateObject.year
+ },
+
+ // Create an array by splitting the formatting string passed.
+ toArray: function( formatString ) { return formatString.split( /(d{1,4}|m{1,4}|y{4}|yy|!.)/g ) },
+
+ // Format an object into a string using the formatting options.
+ toString: function ( formatString, itemObject ) {
+ var calendar = this
+ return calendar.formats.toArray( formatString ).map( function( label ) {
+ return _.trigger( calendar.formats[ label ], calendar, [ 0, itemObject ] ) || label.replace( /^!/, '' )
+ }).join( '' )
+ }
+ }
+})() //DatePicker.prototype.formats
+
+
+
+
+/**
+ * Check if two date units are the exact.
+ */
+DatePicker.prototype.isDateExact = function( one, two ) {
+
+ var calendar = this
+
+ // When we’re working with weekdays, do a direct comparison.
+ if (
+ ( _.isInteger( one ) && _.isInteger( two ) ) ||
+ ( typeof one == 'boolean' && typeof two == 'boolean' )
+ ) {
+ return one === two
+ }
+
+ // When we’re working with date representations, compare the “pick” value.
+ if (
+ ( _.isDate( one ) || $.isArray( one ) ) &&
+ ( _.isDate( two ) || $.isArray( two ) )
+ ) {
+ return calendar.create( one ).pick === calendar.create( two ).pick
+ }
+
+ // When we’re working with range objects, compare the “from” and “to”.
+ if ( $.isPlainObject( one ) && $.isPlainObject( two ) ) {
+ return calendar.isDateExact( one.from, two.from ) && calendar.isDateExact( one.to, two.to )
+ }
+
+ return false
+}
+
+
+/**
+ * Check if two date units overlap.
+ */
+DatePicker.prototype.isDateOverlap = function( one, two ) {
+
+ var calendar = this,
+ firstDay = calendar.settings.firstDay ? 1 : 0
+
+ // When we’re working with a weekday index, compare the days.
+ if ( _.isInteger( one ) && ( _.isDate( two ) || $.isArray( two ) ) ) {
+ one = one % 7 + firstDay
+ return one === calendar.create( two ).day + 1
+ }
+ if ( _.isInteger( two ) && ( _.isDate( one ) || $.isArray( one ) ) ) {
+ two = two % 7 + firstDay
+ return two === calendar.create( one ).day + 1
+ }
+
+ // When we’re working with range objects, check if the ranges overlap.
+ if ( $.isPlainObject( one ) && $.isPlainObject( two ) ) {
+ return calendar.overlapRanges( one, two )
+ }
+
+ return false
+}
+
+
+/**
+ * Flip the “enabled” state.
+ */
+DatePicker.prototype.flipEnable = function(val) {
+ var itemObject = this.item
+ itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1)
+}
+
+
+/**
+ * Mark a collection of dates as “disabled”.
+ */
+DatePicker.prototype.deactivate = function( type, datesToDisable ) {
+
+ var calendar = this,
+ disabledItems = calendar.item.disable.slice(0)
+
+
+ // If we’re flipping, that’s all we need to do.
+ if ( datesToDisable == 'flip' ) {
+ calendar.flipEnable()
+ }
+
+ else if ( datesToDisable === false ) {
+ calendar.flipEnable(1)
+ disabledItems = []
+ }
+
+ else if ( datesToDisable === true ) {
+ calendar.flipEnable(-1)
+ disabledItems = []
+ }
+
+ // Otherwise go through the dates to disable.
+ else {
+
+ datesToDisable.map(function( unitToDisable ) {
+
+ var matchFound
+
+ // When we have disabled items, check for matches.
+ // If something is matched, immediately break out.
+ for ( var index = 0; index < disabledItems.length; index += 1 ) {
+ if ( calendar.isDateExact( unitToDisable, disabledItems[index] ) ) {
+ matchFound = true
+ break
+ }
+ }
+
+ // If nothing was found, add the validated unit to the collection.
+ if ( !matchFound ) {
+ if (
+ _.isInteger( unitToDisable ) ||
+ _.isDate( unitToDisable ) ||
+ $.isArray( unitToDisable ) ||
+ ( $.isPlainObject( unitToDisable ) && unitToDisable.from && unitToDisable.to )
+ ) {
+ disabledItems.push( unitToDisable )
+ }
+ }
+ })
+ }
+
+ // Return the updated collection.
+ return disabledItems
+} //DatePicker.prototype.deactivate
+
+
+/**
+ * Mark a collection of dates as “enabled”.
+ */
+DatePicker.prototype.activate = function( type, datesToEnable ) {
+
+ var calendar = this,
+ disabledItems = calendar.item.disable,
+ disabledItemsCount = disabledItems.length
+
+ // If we’re flipping, that’s all we need to do.
+ if ( datesToEnable == 'flip' ) {
+ calendar.flipEnable()
+ }
+
+ else if ( datesToEnable === true ) {
+ calendar.flipEnable(1)
+ disabledItems = []
+ }
+
+ else if ( datesToEnable === false ) {
+ calendar.flipEnable(-1)
+ disabledItems = []
+ }
+
+ // Otherwise go through the disabled dates.
+ else {
+
+ datesToEnable.map(function( unitToEnable ) {
+
+ var matchFound,
+ disabledUnit,
+ index,
+ isExactRange
+
+ // Go through the disabled items and try to find a match.
+ for ( index = 0; index < disabledItemsCount; index += 1 ) {
+
+ disabledUnit = disabledItems[index]
+
+ // When an exact match is found, remove it from the collection.
+ if ( calendar.isDateExact( disabledUnit, unitToEnable ) ) {
+ matchFound = disabledItems[index] = null
+ isExactRange = true
+ break
+ }
+
+ // When an overlapped match is found, add the “inverted” state to it.
+ else if ( calendar.isDateOverlap( disabledUnit, unitToEnable ) ) {
+ if ( $.isPlainObject( unitToEnable ) ) {
+ unitToEnable.inverted = true
+ matchFound = unitToEnable
+ }
+ else if ( $.isArray( unitToEnable ) ) {
+ matchFound = unitToEnable
+ if ( !matchFound[3] ) matchFound.push( 'inverted' )
+ }
+ else if ( _.isDate( unitToEnable ) ) {
+ matchFound = [ unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted' ]
+ }
+ break
+ }
+ }
+
+ // If a match was found, remove a previous duplicate entry.
+ if ( matchFound ) for ( index = 0; index < disabledItemsCount; index += 1 ) {
+ if ( calendar.isDateExact( disabledItems[index], unitToEnable ) ) {
+ disabledItems[index] = null
+ break
+ }
+ }
+
+ // In the event that we’re dealing with an exact range of dates,
+ // make sure there are no “inverted” dates because of it.
+ if ( isExactRange ) for ( index = 0; index < disabledItemsCount; index += 1 ) {
+ if ( calendar.isDateOverlap( disabledItems[index], unitToEnable ) ) {
+ disabledItems[index] = null
+ break
+ }
+ }
+
+ // If something is still matched, add it into the collection.
+ if ( matchFound ) {
+ disabledItems.push( matchFound )
+ }
+ })
+ }
+
+ // Return the updated collection.
+ return disabledItems.filter(function( val ) { return val != null })
+} //DatePicker.prototype.activate
+
+
+/**
+ * Create a string for the nodes in the picker.
+ */
+DatePicker.prototype.nodes = function( isOpen ) {
+
+ var
+ calendar = this,
+ settings = calendar.settings,
+ calendarItem = calendar.item,
+ nowObject = calendarItem.now,
+ selectedObject = calendarItem.select,
+ highlightedObject = calendarItem.highlight,
+ viewsetObject = calendarItem.view,
+ disabledCollection = calendarItem.disable,
+ minLimitObject = calendarItem.min,
+ maxLimitObject = calendarItem.max,
+
+
+ // Create the calendar table head using a copy of weekday labels collection.
+ // * We do a copy so we don't mutate the original array.
+ tableHead = (function( collection, fullCollection ) {
+
+ // If the first day should be Monday, move Sunday to the end.
+ if ( settings.firstDay ) {
+ collection.push( collection.shift() )
+ fullCollection.push( fullCollection.shift() )
+ }
+
+ // Create and return the table head group.
+ return _.node(
+ 'thead',
+ _.node(
+ 'tr',
+ _.group({
+ min: 0,
+ max: DAYS_IN_WEEK - 1,
+ i: 1,
+ node: 'th',
+ item: function( counter ) {
+ return [
+ collection[ counter ],
+ settings.klass.weekdays,
+ 'scope=col title="' + fullCollection[ counter ] + '"'
+ ]
+ }
+ })
+ )
+ ) //endreturn
+
+ // Materialize modified
+ })( ( settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter ).slice( 0 ), settings.weekdaysFull.slice( 0 ) ), //tableHead
+
+
+ // Create the nav for next/prev month.
+ createMonthNav = function( next ) {
+
+ // Otherwise, return the created month tag.
+ return _.node(
+ 'div',
+ ' ',
+ settings.klass[ 'nav' + ( next ? 'Next' : 'Prev' ) ] + (
+
+ // If the focused month is outside the range, disabled the button.
+ ( next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month ) ||
+ ( !next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month ) ?
+ ' ' + settings.klass.navDisabled : ''
+ ),
+ 'data-nav=' + ( next || -1 ) + ' ' +
+ _.ariaAttr({
+ role: 'button',
+ controls: calendar.$node[0].id + '_table'
+ }) + ' ' +
+ 'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev ) + '"'
+ ) //endreturn
+ }, //createMonthNav
+
+
+ // Create the month label.
+ //Materialize modified
+ createMonthLabel = function(override) {
+
+ var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull
+
+ // Materialize modified
+ if (override == "short_months") {
+ monthsCollection = settings.monthsShort;
+ }
+
+ // If there are months to select, add a dropdown menu.
+ if ( settings.selectMonths && override == undefined) {
+
+ return _.node( 'select',
+ _.group({
+ min: 0,
+ max: 11,
+ i: 1,
+ node: 'option',
+ item: function( loopedMonth ) {
+
+ return [
+
+ // The looped month and no classes.
+ monthsCollection[ loopedMonth ], 0,
+
+ // Set the value and selected index.
+ 'value=' + loopedMonth +
+ ( viewsetObject.month == loopedMonth ? ' selected' : '' ) +
+ (
+ (
+ ( viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month ) ||
+ ( viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month )
+ ) ?
+ ' disabled' : ''
+ )
+ ]
+ }
+ }),
+ settings.klass.selectMonth + ' browser-default',
+ ( isOpen ? '' : 'disabled' ) + ' ' +
+ _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' +
+ 'title="' + settings.labelMonthSelect + '"'
+ )
+ }
+
+ // Materialize modified
+ if (override == "short_months")
+ if (selectedObject != null)
+ return monthsCollection[ selectedObject.month ];
+ else return monthsCollection[ viewsetObject.month ];
+
+ // If there's a need for a month selector
+ return _.node( 'div', monthsCollection[ viewsetObject.month ], settings.klass.month )
+ }, //createMonthLabel
+
+
+ // Create the year label.
+ // Materialize modified
+ createYearLabel = function(override) {
+
+ var focusedYear = viewsetObject.year,
+
+ // If years selector is set to a literal "true", set it to 5. Otherwise
+ // divide in half to get half before and half after focused year.
+ numberYears = settings.selectYears === true ? 5 : ~~( settings.selectYears / 2 )
+
+
+ // If there are years to select, add a dropdown menu.
+ if ( numberYears ) {
+
+ var
+ minYear = minLimitObject.year,
+ maxYear = maxLimitObject.year,
+ lowestYear = focusedYear - numberYears,
+ highestYear = focusedYear + numberYears
+
+ // If the min year is greater than the lowest year, increase the highest year
+ // by the difference and set the lowest year to the min year.
+ if ( minYear > lowestYear ) {
+ highestYear += minYear - lowestYear
+ lowestYear = minYear
+ }
+
+ // If the max year is less than the highest year, decrease the lowest year
+ // by the lower of the two: available and needed years. Then set the
+ // highest year to the max year.
+ if ( maxYear < highestYear ) {
+
+ var availableYears = lowestYear - minYear,
+ neededYears = highestYear - maxYear
+
+ lowestYear -= availableYears > neededYears ? neededYears : availableYears
+ highestYear = maxYear
+ }
+
+ if ( settings.selectYears && override == undefined ) {
+ return _.node( 'select',
+ _.group({
+ min: lowestYear,
+ max: highestYear,
+ i: 1,
+ node: 'option',
+ item: function( loopedYear ) {
+ return [
+
+ // The looped year and no classes.
+ loopedYear, 0,
+
+ // Set the value and selected index.
+ 'value=' + loopedYear + ( focusedYear == loopedYear ? ' selected' : '' )
+ ]
+ }
+ }),
+ settings.klass.selectYear + ' browser-default',
+ ( isOpen ? '' : 'disabled' ) + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' +
+ 'title="' + settings.labelYearSelect + '"'
+ )
+ }
+ }
+
+
+ // Materialize modified
+ if (override === 'raw' && selectedObject != null) {
+ return _.node( 'div', selectedObject.year )
+ }
+
+
+
+ // Otherwise just return the year focused
+ return _.node( 'div', focusedYear, settings.klass.year )
+ } //createYearLabel
+
+
+ // Materialize modified
+ createDayLabel = function() {
+ if (selectedObject != null)
+ return selectedObject.date
+ else return nowObject.date
+ }
+ createWeekdayLabel = function() {
+ var display_day;
+
+ if (selectedObject != null)
+ display_day = selectedObject.day;
+ else
+ display_day = nowObject.day;
+ var weekday = settings.weekdaysShort[ display_day ];
+ return weekday
+ }
+
+
+ // Create and return the entire calendar.
+
+return _.node(
+ // Date presentation View
+ 'div',
+ _.node(
+ // Div for Year
+ 'div',
+ createYearLabel("raw") ,
+ settings.klass.year_display
+ )+
+ _.node(
+ 'span',
+ createWeekdayLabel() + ', ',
+ "picker__weekday-display"
+ )+
+ _.node(
+ // Div for short Month
+ 'span',
+ createMonthLabel("short_months") + ' ',
+ settings.klass.month_display
+ )+
+ _.node(
+ // Div for Day
+ 'span',
+ createDayLabel() ,
+ settings.klass.day_display
+ ),
+ settings.klass.date_display
+ )+
+ // Calendar container
+ _.node('div',
+ _.node('div',
+ _.node('div',
+ ( settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel() ) +
+ createMonthNav() + createMonthNav( 1 ),
+ settings.klass.header
+ ) + _.node(
+ 'table',
+ tableHead +
+ _.node(
+ 'tbody',
+ _.group({
+ min: 0,
+ max: WEEKS_IN_CALENDAR - 1,
+ i: 1,
+ node: 'tr',
+ item: function( rowCounter ) {
+
+ // If Monday is the first day and the month starts on Sunday, shift the date back a week.
+ var shiftDateBy = settings.firstDay && calendar.create([ viewsetObject.year, viewsetObject.month, 1 ]).day === 0 ? -7 : 0
+
+ return [
+ _.group({
+ min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index
+ max: function() {
+ return this.min + DAYS_IN_WEEK - 1
+ },
+ i: 1,
+ node: 'td',
+ item: function( targetDate ) {
+
+ // Convert the time date from a relative date to a target date.
+ targetDate = calendar.create([ viewsetObject.year, viewsetObject.month, targetDate + ( settings.firstDay ? 1 : 0 ) ])
+
+ var isSelected = selectedObject && selectedObject.pick == targetDate.pick,
+ isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick,
+ isDisabled = disabledCollection && calendar.disabled( targetDate ) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick,
+ formattedDate = _.trigger( calendar.formats.toString, calendar, [ settings.format, targetDate ] )
+
+ return [
+ _.node(
+ 'div',
+ targetDate.date,
+ (function( klasses ) {
+
+ // Add the `infocus` or `outfocus` classes based on month in view.
+ klasses.push( viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus )
+
+ // Add the `today` class if needed.
+ if ( nowObject.pick == targetDate.pick ) {
+ klasses.push( settings.klass.now )
+ }
+
+ // Add the `selected` class if something's selected and the time matches.
+ if ( isSelected ) {
+ klasses.push( settings.klass.selected )
+ }
+
+ // Add the `highlighted` class if something's highlighted and the time matches.
+ if ( isHighlighted ) {
+ klasses.push( settings.klass.highlighted )
+ }
+
+ // Add the `disabled` class if something's disabled and the object matches.
+ if ( isDisabled ) {
+ klasses.push( settings.klass.disabled )
+ }
+
+ return klasses.join( ' ' )
+ })([ settings.klass.day ]),
+ 'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({
+ role: 'gridcell',
+ label: formattedDate,
+ selected: isSelected && calendar.$node.val() === formattedDate ? true : null,
+ activedescendant: isHighlighted ? true : null,
+ disabled: isDisabled ? true : null
+ }) + ' ' + (isDisabled ? '' : 'tabindex="0"')
+ ),
+ '',
+ _.ariaAttr({ role: 'presentation' })
+ ] //endreturn
+ }
+ })
+ ] //endreturn
+ }
+ })
+ ),
+ settings.klass.table,
+ 'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({
+ role: 'grid',
+ controls: calendar.$node[0].id,
+ readonly: true
+ })
+ )
+ , settings.klass.calendar_container) // end calendar
+
+ +
+
+ // * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”.
+ _.node(
+ 'div',
+ _.node( 'button', settings.today, "btn-flat picker__today waves-effect",
+ 'type=button data-pick=' + nowObject.pick +
+ ( isOpen && !calendar.disabled(nowObject) ? '' : ' disabled' ) + ' ' +
+ _.ariaAttr({ controls: calendar.$node[0].id }) ) +
+ _.node( 'button', settings.clear, "btn-flat picker__clear waves-effect",
+ 'type=button data-clear=1' +
+ ( isOpen ? '' : ' disabled' ) + ' ' +
+ _.ariaAttr({ controls: calendar.$node[0].id }) ) +
+ _.node('button', settings.close, "btn-flat picker__close waves-effect",
+ 'type=button data-close=true ' +
+ ( isOpen ? '' : ' disabled' ) + ' ' +
+ _.ariaAttr({ controls: calendar.$node[0].id }) ),
+ settings.klass.footer
+ ), 'picker__container__wrapper'
+ ) //endreturn
+} //DatePicker.prototype.nodes
+
+
+
+
+/**
+ * The date picker defaults.
+ */
+DatePicker.defaults = (function( prefix ) {
+
+ return {
+
+ // The title label to use for the month nav buttons
+ labelMonthNext: 'Next month',
+ labelMonthPrev: 'Previous month',
+
+ // The title label to use for the dropdown selectors
+ labelMonthSelect: 'Select a month',
+ labelYearSelect: 'Select a year',
+
+ // Months and weekdays
+ monthsFull: [ 'January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December' ],
+ monthsShort: [ 'Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec' ],
+ weekdaysFull: [ 'Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday' ],
+ weekdaysShort: [ 'Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat' ],
+
+ // Materialize modified
+ weekdaysLetter: [ 'S', 'M', 'T', 'W', 'T', 'F', 'S' ],
+
+ // Today and clear
+ today: 'Today',
+ clear: 'Clear',
+ close: 'Ok',
+
+ // Picker close behavior (Prevent a change in behaviour for backwards compatibility)
+ closeOnSelect: false,
+
+ // The format to show on the `input` element
+ format: 'd mmmm, yyyy',
+
+ // Classes
+ klass: {
+
+ table: prefix + 'table',
+
+ header: prefix + 'header',
+
+
+ // Materialize Added klasses
+ date_display: prefix + 'date-display',
+ day_display: prefix + 'day-display',
+ month_display: prefix + 'month-display',
+ year_display: prefix + 'year-display',
+ calendar_container: prefix + 'calendar-container',
+ // end
+
+
+
+ navPrev: prefix + 'nav--prev',
+ navNext: prefix + 'nav--next',
+ navDisabled: prefix + 'nav--disabled',
+
+ month: prefix + 'month',
+ year: prefix + 'year',
+
+ selectMonth: prefix + 'select--month',
+ selectYear: prefix + 'select--year',
+
+ weekdays: prefix + 'weekday',
+
+ day: prefix + 'day',
+ disabled: prefix + 'day--disabled',
+ selected: prefix + 'day--selected',
+ highlighted: prefix + 'day--highlighted',
+ now: prefix + 'day--today',
+ infocus: prefix + 'day--infocus',
+ outfocus: prefix + 'day--outfocus',
+
+ footer: prefix + 'footer',
+
+ buttonClear: prefix + 'button--clear',
+ buttonToday: prefix + 'button--today',
+ buttonClose: prefix + 'button--close'
+ }
+ }
+})( Picker.klasses().picker + '__' )
+
+
+
+
+
+/**
+ * Extend the picker to add the date picker.
+ */
+Picker.extend( 'pickadate', DatePicker )
+
+
+}));
diff --git a/app/dispatch/static/materialize/js/date_picker/picker.js b/app/dispatch/static/materialize/js/date_picker/picker.js new file mode 100644 index 0000000..b2baf00 --- /dev/null +++ b/app/dispatch/static/materialize/js/date_picker/picker.js @@ -0,0 +1,1121 @@ +/*!
+ * pickadate.js v3.5.0, 2014/04/13
+ * By Amsul, http://amsul.ca
+ * Hosted on http://amsul.github.io/pickadate.js
+ * Licensed under MIT
+ */
+
+(function ( factory ) {
+
+ Materialize.Picker = factory( jQuery )
+
+}(function( $ ) {
+
+var $window = $( window )
+var $document = $( document )
+var $html = $( document.documentElement )
+
+
+/**
+ * The picker constructor that creates a blank picker.
+ */
+function PickerConstructor( ELEMENT, NAME, COMPONENT, OPTIONS ) {
+
+ // If there’s no element, return the picker constructor.
+ if ( !ELEMENT ) return PickerConstructor
+
+
+ var
+ IS_DEFAULT_THEME = false,
+
+
+ // The state of the picker.
+ STATE = {
+ id: ELEMENT.id || 'P' + Math.abs( ~~(Math.random() * new Date()) )
+ },
+
+
+ // Merge the defaults and options passed.
+ SETTINGS = COMPONENT ? $.extend( true, {}, COMPONENT.defaults, OPTIONS ) : OPTIONS || {},
+
+
+ // Merge the default classes with the settings classes.
+ CLASSES = $.extend( {}, PickerConstructor.klasses(), SETTINGS.klass ),
+
+
+ // The element node wrapper into a jQuery object.
+ $ELEMENT = $( ELEMENT ),
+
+
+ // Pseudo picker constructor.
+ PickerInstance = function() {
+ return this.start()
+ },
+
+
+ // The picker prototype.
+ P = PickerInstance.prototype = {
+
+ constructor: PickerInstance,
+
+ $node: $ELEMENT,
+
+
+ /**
+ * Initialize everything
+ */
+ start: function() {
+
+ // If it’s already started, do nothing.
+ if ( STATE && STATE.start ) return P
+
+
+ // Update the picker states.
+ STATE.methods = {}
+ STATE.start = true
+ STATE.open = false
+ STATE.type = ELEMENT.type
+
+
+ // Confirm focus state, convert into text input to remove UA stylings,
+ // and set as readonly to prevent keyboard popup.
+ ELEMENT.autofocus = ELEMENT == getActiveElement()
+ ELEMENT.readOnly = !SETTINGS.editable
+ ELEMENT.id = ELEMENT.id || STATE.id
+ if ( ELEMENT.type != 'text' ) {
+ ELEMENT.type = 'text'
+ }
+
+
+ // Create a new picker component with the settings.
+ P.component = new COMPONENT(P, SETTINGS)
+
+
+ // Create the picker root with a holder and then prepare it.
+ P.$root = $( PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"') )
+ prepareElementRoot()
+
+
+ // If there’s a format for the hidden input element, create the element.
+ if ( SETTINGS.formatSubmit ) {
+ prepareElementHidden()
+ }
+
+
+ // Prepare the input element.
+ prepareElement()
+
+
+ // Insert the root as specified in the settings.
+ if ( SETTINGS.container ) $( SETTINGS.container ).append( P.$root )
+ else $ELEMENT.before( P.$root )
+
+
+ // Bind the default component and settings events.
+ P.on({
+ start: P.component.onStart,
+ render: P.component.onRender,
+ stop: P.component.onStop,
+ open: P.component.onOpen,
+ close: P.component.onClose,
+ set: P.component.onSet
+ }).on({
+ start: SETTINGS.onStart,
+ render: SETTINGS.onRender,
+ stop: SETTINGS.onStop,
+ open: SETTINGS.onOpen,
+ close: SETTINGS.onClose,
+ set: SETTINGS.onSet
+ })
+
+
+ // Once we’re all set, check the theme in use.
+ IS_DEFAULT_THEME = isUsingDefaultTheme( P.$root.children()[ 0 ] )
+
+
+ // If the element has autofocus, open the picker.
+ if ( ELEMENT.autofocus ) {
+ P.open()
+ }
+
+
+ // Trigger queued the “start” and “render” events.
+ return P.trigger( 'start' ).trigger( 'render' )
+ }, //start
+
+
+ /**
+ * Render a new picker
+ */
+ render: function( entireComponent ) {
+
+ // Insert a new component holder in the root or box.
+ if ( entireComponent ) P.$root.html( createWrappedComponent() )
+ else P.$root.find( '.' + CLASSES.box ).html( P.component.nodes( STATE.open ) )
+
+ // Trigger the queued “render” events.
+ return P.trigger( 'render' )
+ }, //render
+
+
+ /**
+ * Destroy everything
+ */
+ stop: function() {
+
+ // If it’s already stopped, do nothing.
+ if ( !STATE.start ) return P
+
+ // Then close the picker.
+ P.close()
+
+ // Remove the hidden field.
+ if ( P._hidden ) {
+ P._hidden.parentNode.removeChild( P._hidden )
+ }
+
+ // Remove the root.
+ P.$root.remove()
+
+ // Remove the input class, remove the stored data, and unbind
+ // the events (after a tick for IE - see `P.close`).
+ $ELEMENT.removeClass( CLASSES.input ).removeData( NAME )
+ setTimeout( function() {
+ $ELEMENT.off( '.' + STATE.id )
+ }, 0)
+
+ // Restore the element state
+ ELEMENT.type = STATE.type
+ ELEMENT.readOnly = false
+
+ // Trigger the queued “stop” events.
+ P.trigger( 'stop' )
+
+ // Reset the picker states.
+ STATE.methods = {}
+ STATE.start = false
+
+ return P
+ }, //stop
+
+
+ /**
+ * Open up the picker
+ */
+ open: function( dontGiveFocus ) {
+
+ // If it’s already open, do nothing.
+ if ( STATE.open ) return P
+
+ // Add the “active” class.
+ $ELEMENT.addClass( CLASSES.active )
+ aria( ELEMENT, 'expanded', true )
+
+ // * A Firefox bug, when `html` has `overflow:hidden`, results in
+ // killing transitions :(. So add the “opened” state on the next tick.
+ // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
+ setTimeout( function() {
+
+ // Add the “opened” class to the picker root.
+ P.$root.addClass( CLASSES.opened )
+ aria( P.$root[0], 'hidden', false )
+
+ }, 0 )
+
+ // If we have to give focus, bind the element and doc events.
+ if ( dontGiveFocus !== false ) {
+
+ // Set it as open.
+ STATE.open = true
+
+ // Prevent the page from scrolling.
+ if ( IS_DEFAULT_THEME ) {
+ $html.
+ css( 'overflow', 'hidden' ).
+ css( 'padding-right', '+=' + getScrollbarWidth() )
+ }
+
+ // Pass focus to the root element’s jQuery object.
+ // * Workaround for iOS8 to bring the picker’s root into view.
+ P.$root.eq(0).focus()
+
+ // Bind the document events.
+ $document.on( 'click.' + STATE.id + ' focusin.' + STATE.id, function( event ) {
+
+ var target = event.target
+
+ // If the target of the event is not the element, close the picker picker.
+ // * Don’t worry about clicks or focusins on the root because those don’t bubble up.
+ // Also, for Firefox, a click on an `option` element bubbles up directly
+ // to the doc. So make sure the target wasn't the doc.
+ // * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling,
+ // which causes the picker to unexpectedly close when right-clicking it. So make
+ // sure the event wasn’t a right-click.
+ if ( target != ELEMENT && target != document && event.which != 3 ) {
+
+ // If the target was the holder that covers the screen,
+ // keep the element focused to maintain tabindex.
+ P.close( target === P.$root.children()[0] )
+ }
+
+ }).on( 'keydown.' + STATE.id, function( event ) {
+
+ var
+ // Get the keycode.
+ keycode = event.keyCode,
+
+ // Translate that to a selection change.
+ keycodeToMove = P.component.key[ keycode ],
+
+ // Grab the target.
+ target = event.target
+
+
+ // On escape, close the picker and give focus.
+ if ( keycode == 27 ) {
+ P.close( true )
+ }
+
+
+ // Check if there is a key movement or “enter” keypress on the element.
+ else if ( target == P.$root[0] && ( keycodeToMove || keycode == 13 ) ) {
+
+ // Prevent the default action to stop page movement.
+ event.preventDefault()
+
+ // Trigger the key movement action.
+ if ( keycodeToMove ) {
+ PickerConstructor._.trigger( P.component.key.go, P, [ PickerConstructor._.trigger( keycodeToMove ) ] )
+ }
+
+ // On “enter”, if the highlighted item isn’t disabled, set the value and close.
+ else if ( !P.$root.find( '.' + CLASSES.highlighted ).hasClass( CLASSES.disabled ) ) {
+ P.set( 'select', P.component.item.highlight )
+ if ( SETTINGS.closeOnSelect ) {
+ P.close( true )
+ }
+ }
+ }
+
+
+ // If the target is within the root and “enter” is pressed,
+ // prevent the default action and trigger a click on the target instead.
+ else if ( $.contains( P.$root[0], target ) && keycode == 13 ) {
+ event.preventDefault()
+ target.click()
+ }
+ })
+ }
+
+ // Trigger the queued “open” events.
+ return P.trigger( 'open' )
+ }, //open
+
+
+ /**
+ * Close the picker
+ */
+ close: function( giveFocus ) {
+
+ // If we need to give focus, do it before changing states.
+ if ( giveFocus ) {
+ // ....ah yes! It would’ve been incomplete without a crazy workaround for IE :|
+ // The focus is triggered *after* the close has completed - causing it
+ // to open again. So unbind and rebind the event at the next tick.
+ P.$root.off( 'focus.toOpen' ).eq(0).focus()
+ setTimeout( function() {
+ P.$root.on( 'focus.toOpen', handleFocusToOpenEvent )
+ }, 0 )
+ }
+
+ // Remove the “active” class.
+ $ELEMENT.removeClass( CLASSES.active )
+ aria( ELEMENT, 'expanded', false )
+
+ // * A Firefox bug, when `html` has `overflow:hidden`, results in
+ // killing transitions :(. So remove the “opened” state on the next tick.
+ // Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
+ setTimeout( function() {
+
+ // Remove the “opened” and “focused” class from the picker root.
+ P.$root.removeClass( CLASSES.opened + ' ' + CLASSES.focused )
+ aria( P.$root[0], 'hidden', true )
+
+ }, 0 )
+
+ // If it’s already closed, do nothing more.
+ if ( !STATE.open ) return P
+
+ // Set it as closed.
+ STATE.open = false
+
+ // Allow the page to scroll.
+ if ( IS_DEFAULT_THEME ) {
+ $html.
+ css( 'overflow', '' ).
+ css( 'padding-right', '-=' + getScrollbarWidth() )
+ }
+
+ // Unbind the document events.
+ $document.off( '.' + STATE.id )
+
+ // Trigger the queued “close” events.
+ return P.trigger( 'close' )
+ }, //close
+
+
+ /**
+ * Clear the values
+ */
+ clear: function( options ) {
+ return P.set( 'clear', null, options )
+ }, //clear
+
+
+ /**
+ * Set something
+ */
+ set: function( thing, value, options ) {
+
+ var thingItem, thingValue,
+ thingIsObject = $.isPlainObject( thing ),
+ thingObject = thingIsObject ? thing : {}
+
+ // Make sure we have usable options.
+ options = thingIsObject && $.isPlainObject( value ) ? value : options || {}
+
+ if ( thing ) {
+
+ // If the thing isn’t an object, make it one.
+ if ( !thingIsObject ) {
+ thingObject[ thing ] = value
+ }
+
+ // Go through the things of items to set.
+ for ( thingItem in thingObject ) {
+
+ // Grab the value of the thing.
+ thingValue = thingObject[ thingItem ]
+
+ // First, if the item exists and there’s a value, set it.
+ if ( thingItem in P.component.item ) {
+ if ( thingValue === undefined ) thingValue = null
+ P.component.set( thingItem, thingValue, options )
+ }
+
+ // Then, check to update the element value and broadcast a change.
+ if ( thingItem == 'select' || thingItem == 'clear' ) {
+ $ELEMENT.
+ val( thingItem == 'clear' ? '' : P.get( thingItem, SETTINGS.format ) ).
+ trigger( 'change' )
+ }
+ }
+
+ // Render a new picker.
+ P.render()
+ }
+
+ // When the method isn’t muted, trigger queued “set” events and pass the `thingObject`.
+ return options.muted ? P : P.trigger( 'set', thingObject )
+ }, //set
+
+
+ /**
+ * Get something
+ */
+ get: function( thing, format ) {
+
+ // Make sure there’s something to get.
+ thing = thing || 'value'
+
+ // If a picker state exists, return that.
+ if ( STATE[ thing ] != null ) {
+ return STATE[ thing ]
+ }
+
+ // Return the submission value, if that.
+ if ( thing == 'valueSubmit' ) {
+ if ( P._hidden ) {
+ return P._hidden.value
+ }
+ thing = 'value'
+ }
+
+ // Return the value, if that.
+ if ( thing == 'value' ) {
+ return ELEMENT.value
+ }
+
+ // Check if a component item exists, return that.
+ if ( thing in P.component.item ) {
+ if ( typeof format == 'string' ) {
+ var thingValue = P.component.get( thing )
+ return thingValue ?
+ PickerConstructor._.trigger(
+ P.component.formats.toString,
+ P.component,
+ [ format, thingValue ]
+ ) : ''
+ }
+ return P.component.get( thing )
+ }
+ }, //get
+
+
+
+ /**
+ * Bind events on the things.
+ */
+ on: function( thing, method, internal ) {
+
+ var thingName, thingMethod,
+ thingIsObject = $.isPlainObject( thing ),
+ thingObject = thingIsObject ? thing : {}
+
+ if ( thing ) {
+
+ // If the thing isn’t an object, make it one.
+ if ( !thingIsObject ) {
+ thingObject[ thing ] = method
+ }
+
+ // Go through the things to bind to.
+ for ( thingName in thingObject ) {
+
+ // Grab the method of the thing.
+ thingMethod = thingObject[ thingName ]
+
+ // If it was an internal binding, prefix it.
+ if ( internal ) {
+ thingName = '_' + thingName
+ }
+
+ // Make sure the thing methods collection exists.
+ STATE.methods[ thingName ] = STATE.methods[ thingName ] || []
+
+ // Add the method to the relative method collection.
+ STATE.methods[ thingName ].push( thingMethod )
+ }
+ }
+
+ return P
+ }, //on
+
+
+
+ /**
+ * Unbind events on the things.
+ */
+ off: function() {
+ var i, thingName,
+ names = arguments;
+ for ( i = 0, namesCount = names.length; i < namesCount; i += 1 ) {
+ thingName = names[i]
+ if ( thingName in STATE.methods ) {
+ delete STATE.methods[thingName]
+ }
+ }
+ return P
+ },
+
+
+ /**
+ * Fire off method events.
+ */
+ trigger: function( name, data ) {
+ var _trigger = function( name ) {
+ var methodList = STATE.methods[ name ]
+ if ( methodList ) {
+ methodList.map( function( method ) {
+ PickerConstructor._.trigger( method, P, [ data ] )
+ })
+ }
+ }
+ _trigger( '_' + name )
+ _trigger( name )
+ return P
+ } //trigger
+ } //PickerInstance.prototype
+
+
+ /**
+ * Wrap the picker holder components together.
+ */
+ function createWrappedComponent() {
+
+ // Create a picker wrapper holder
+ return PickerConstructor._.node( 'div',
+
+ // Create a picker wrapper node
+ PickerConstructor._.node( 'div',
+
+ // Create a picker frame
+ PickerConstructor._.node( 'div',
+
+ // Create a picker box node
+ PickerConstructor._.node( 'div',
+
+ // Create the components nodes.
+ P.component.nodes( STATE.open ),
+
+ // The picker box class
+ CLASSES.box
+ ),
+
+ // Picker wrap class
+ CLASSES.wrap
+ ),
+
+ // Picker frame class
+ CLASSES.frame
+ ),
+
+ // Picker holder class
+ CLASSES.holder
+ ) //endreturn
+ } //createWrappedComponent
+
+
+
+ /**
+ * Prepare the input element with all bindings.
+ */
+ function prepareElement() {
+
+ $ELEMENT.
+
+ // Store the picker data by component name.
+ data(NAME, P).
+
+ // Add the “input” class name.
+ addClass(CLASSES.input).
+
+ // Remove the tabindex.
+ attr('tabindex', -1).
+
+ // If there’s a `data-value`, update the value of the element.
+ val( $ELEMENT.data('value') ?
+ P.get('select', SETTINGS.format) :
+ ELEMENT.value
+ )
+
+
+ // Only bind keydown events if the element isn’t editable.
+ if ( !SETTINGS.editable ) {
+
+ $ELEMENT.
+
+ // On focus/click, focus onto the root to open it up.
+ on( 'focus.' + STATE.id + ' click.' + STATE.id, function( event ) {
+ event.preventDefault()
+ P.$root.eq(0).focus()
+ }).
+
+ // Handle keyboard event based on the picker being opened or not.
+ on( 'keydown.' + STATE.id, handleKeydownEvent )
+ }
+
+
+ // Update the aria attributes.
+ aria(ELEMENT, {
+ haspopup: true,
+ expanded: false,
+ readonly: false,
+ owns: ELEMENT.id + '_root'
+ })
+ }
+
+
+ /**
+ * Prepare the root picker element with all bindings.
+ */
+ function prepareElementRoot() {
+
+ P.$root.
+
+ on({
+
+ // For iOS8.
+ keydown: handleKeydownEvent,
+
+ // When something within the root is focused, stop from bubbling
+ // to the doc and remove the “focused” state from the root.
+ focusin: function( event ) {
+ P.$root.removeClass( CLASSES.focused )
+ event.stopPropagation()
+ },
+
+ // When something within the root holder is clicked, stop it
+ // from bubbling to the doc.
+ 'mousedown click': function( event ) {
+
+ var target = event.target
+
+ // Make sure the target isn’t the root holder so it can bubble up.
+ if ( target != P.$root.children()[ 0 ] ) {
+
+ event.stopPropagation()
+
+ // * For mousedown events, cancel the default action in order to
+ // prevent cases where focus is shifted onto external elements
+ // when using things like jQuery mobile or MagnificPopup (ref: #249 & #120).
+ // Also, for Firefox, don’t prevent action on the `option` element.
+ if ( event.type == 'mousedown' && !$( target ).is( 'input, select, textarea, button, option' )) {
+
+ event.preventDefault()
+
+ // Re-focus onto the root so that users can click away
+ // from elements focused within the picker.
+ P.$root.eq(0).focus()
+ }
+ }
+ }
+ }).
+
+ // Add/remove the “target” class on focus and blur.
+ on({
+ focus: function() {
+ $ELEMENT.addClass( CLASSES.target )
+ },
+ blur: function() {
+ $ELEMENT.removeClass( CLASSES.target )
+ }
+ }).
+
+ // Open the picker and adjust the root “focused” state
+ on( 'focus.toOpen', handleFocusToOpenEvent ).
+
+ // If there’s a click on an actionable element, carry out the actions.
+ on( 'click', '[data-pick], [data-nav], [data-clear], [data-close]', function() {
+
+ var $target = $( this ),
+ targetData = $target.data(),
+ targetDisabled = $target.hasClass( CLASSES.navDisabled ) || $target.hasClass( CLASSES.disabled ),
+
+ // * For IE, non-focusable elements can be active elements as well
+ // (http://stackoverflow.com/a/2684561).
+ activeElement = getActiveElement();
+ activeElement = activeElement && ( activeElement.type || activeElement.href ) && activeElement;
+
+ // If it’s disabled or nothing inside is actively focused, re-focus the element.
+ if ( targetDisabled || activeElement && !$.contains( P.$root[0], activeElement ) ) {
+ P.$root.eq(0).focus()
+ }
+
+ // If something is superficially changed, update the `highlight` based on the `nav`.
+ if ( !targetDisabled && targetData.nav ) {
+ P.set( 'highlight', P.component.item.highlight, { nav: targetData.nav } )
+ }
+
+ // If something is picked, set `select` then close with focus.
+ else if ( !targetDisabled && 'pick' in targetData ) {
+ P.set( 'select', targetData.pick )
+ if ( SETTINGS.closeOnSelect ) {
+ P.close( true )
+ }
+ }
+
+ // If a “clear” button is pressed, empty the values and close with focus.
+ else if ( targetData.clear ) {
+ P.clear()
+ if ( SETTINGS.closeOnSelect ) {
+ P.close( true )
+ }
+ }
+
+ else if ( targetData.close ) {
+ P.close( true )
+ }
+
+ }) //P.$root
+
+ aria( P.$root[0], 'hidden', true )
+ }
+
+
+ /**
+ * Prepare the hidden input element along with all bindings.
+ */
+ function prepareElementHidden() {
+
+ var name
+
+ if ( SETTINGS.hiddenName === true ) {
+ name = ELEMENT.name
+ ELEMENT.name = ''
+ }
+ else {
+ name = [
+ typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : '',
+ typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit'
+ ]
+ name = name[0] + ELEMENT.name + name[1]
+ }
+
+ P._hidden = $(
+ '<input ' +
+ 'type=hidden ' +
+
+ // Create the name using the original input’s with a prefix and suffix.
+ 'name="' + name + '"' +
+
+ // If the element has a value, set the hidden value as well.
+ (
+ $ELEMENT.data('value') || ELEMENT.value ?
+ ' value="' + P.get('select', SETTINGS.formatSubmit) + '"' :
+ ''
+ ) +
+ '>'
+ )[0]
+
+ $ELEMENT.
+
+ // If the value changes, update the hidden input with the correct format.
+ on('change.' + STATE.id, function() {
+ P._hidden.value = ELEMENT.value ?
+ P.get('select', SETTINGS.formatSubmit) :
+ ''
+ })
+
+
+ // Insert the hidden input as specified in the settings.
+ if ( SETTINGS.container ) $( SETTINGS.container ).append( P._hidden )
+ else $ELEMENT.before( P._hidden )
+ }
+
+
+ // For iOS8.
+ function handleKeydownEvent( event ) {
+
+ var keycode = event.keyCode,
+
+ // Check if one of the delete keys was pressed.
+ isKeycodeDelete = /^(8|46)$/.test(keycode)
+
+ // For some reason IE clears the input value on “escape”.
+ if ( keycode == 27 ) {
+ P.close()
+ return false
+ }
+
+ // Check if `space` or `delete` was pressed or the picker is closed with a key movement.
+ if ( keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode] ) {
+
+ // Prevent it from moving the page and bubbling to doc.
+ event.preventDefault()
+ event.stopPropagation()
+
+ // If `delete` was pressed, clear the values and close the picker.
+ // Otherwise open the picker.
+ if ( isKeycodeDelete ) { P.clear().close() }
+ else { P.open() }
+ }
+ }
+
+
+ // Separated for IE
+ function handleFocusToOpenEvent( event ) {
+
+ // Stop the event from propagating to the doc.
+ event.stopPropagation()
+
+ // If it’s a focus event, add the “focused” class to the root.
+ if ( event.type == 'focus' ) {
+ P.$root.addClass( CLASSES.focused )
+ }
+
+ // And then finally open the picker.
+ P.open()
+ }
+
+
+ // Return a new picker instance.
+ return new PickerInstance()
+} //PickerConstructor
+
+
+
+/**
+ * The default classes and prefix to use for the HTML classes.
+ */
+PickerConstructor.klasses = function( prefix ) {
+ prefix = prefix || 'picker'
+ return {
+
+ picker: prefix,
+ opened: prefix + '--opened',
+ focused: prefix + '--focused',
+
+ input: prefix + '__input',
+ active: prefix + '__input--active',
+ target: prefix + '__input--target',
+
+ holder: prefix + '__holder',
+
+ frame: prefix + '__frame',
+ wrap: prefix + '__wrap',
+
+ box: prefix + '__box'
+ }
+} //PickerConstructor.klasses
+
+
+
+/**
+ * Check if the default theme is being used.
+ */
+function isUsingDefaultTheme( element ) {
+
+ var theme,
+ prop = 'position'
+
+ // For IE.
+ if ( element.currentStyle ) {
+ theme = element.currentStyle[prop]
+ }
+
+ // For normal browsers.
+ else if ( window.getComputedStyle ) {
+ theme = getComputedStyle( element )[prop]
+ }
+
+ return theme == 'fixed'
+}
+
+
+
+/**
+ * Get the width of the browser’s scrollbar.
+ * Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js
+ */
+function getScrollbarWidth() {
+
+ if ( $html.height() <= $window.height() ) {
+ return 0
+ }
+
+ var $outer = $( '<div style="visibility:hidden;width:100px" />' ).
+ appendTo( 'body' )
+
+ // Get the width without scrollbars.
+ var widthWithoutScroll = $outer[0].offsetWidth
+
+ // Force adding scrollbars.
+ $outer.css( 'overflow', 'scroll' )
+
+ // Add the inner div.
+ var $inner = $( '<div style="width:100%" />' ).appendTo( $outer )
+
+ // Get the width with scrollbars.
+ var widthWithScroll = $inner[0].offsetWidth
+
+ // Remove the divs.
+ $outer.remove()
+
+ // Return the difference between the widths.
+ return widthWithoutScroll - widthWithScroll
+}
+
+
+
+/**
+ * PickerConstructor helper methods.
+ */
+PickerConstructor._ = {
+
+ /**
+ * Create a group of nodes. Expects:
+ * `
+ {
+ min: {Integer},
+ max: {Integer},
+ i: {Integer},
+ node: {String},
+ item: {Function}
+ }
+ * `
+ */
+ group: function( groupObject ) {
+
+ var
+ // Scope for the looped object
+ loopObjectScope,
+
+ // Create the nodes list
+ nodesList = '',
+
+ // The counter starts from the `min`
+ counter = PickerConstructor._.trigger( groupObject.min, groupObject )
+
+
+ // Loop from the `min` to `max`, incrementing by `i`
+ for ( ; counter <= PickerConstructor._.trigger( groupObject.max, groupObject, [ counter ] ); counter += groupObject.i ) {
+
+ // Trigger the `item` function within scope of the object
+ loopObjectScope = PickerConstructor._.trigger( groupObject.item, groupObject, [ counter ] )
+
+ // Splice the subgroup and create nodes out of the sub nodes
+ nodesList += PickerConstructor._.node(
+ groupObject.node,
+ loopObjectScope[ 0 ], // the node
+ loopObjectScope[ 1 ], // the classes
+ loopObjectScope[ 2 ] // the attributes
+ )
+ }
+
+ // Return the list of nodes
+ return nodesList
+ }, //group
+
+
+ /**
+ * Create a dom node string
+ */
+ node: function( wrapper, item, klass, attribute ) {
+
+ // If the item is false-y, just return an empty string
+ if ( !item ) return ''
+
+ // If the item is an array, do a join
+ item = $.isArray( item ) ? item.join( '' ) : item
+
+ // Check for the class
+ klass = klass ? ' class="' + klass + '"' : ''
+
+ // Check for any attributes
+ attribute = attribute ? ' ' + attribute : ''
+
+ // Return the wrapped item
+ return '<' + wrapper + klass + attribute + '>' + item + '</' + wrapper + '>'
+ }, //node
+
+
+ /**
+ * Lead numbers below 10 with a zero.
+ */
+ lead: function( number ) {
+ return ( number < 10 ? '0': '' ) + number
+ },
+
+
+ /**
+ * Trigger a function otherwise return the value.
+ */
+ trigger: function( callback, scope, args ) {
+ return typeof callback == 'function' ? callback.apply( scope, args || [] ) : callback
+ },
+
+
+ /**
+ * If the second character is a digit, length is 2 otherwise 1.
+ */
+ digits: function( string ) {
+ return ( /\d/ ).test( string[ 1 ] ) ? 2 : 1
+ },
+
+
+ /**
+ * Tell if something is a date object.
+ */
+ isDate: function( value ) {
+ return {}.toString.call( value ).indexOf( 'Date' ) > -1 && this.isInteger( value.getDate() )
+ },
+
+
+ /**
+ * Tell if something is an integer.
+ */
+ isInteger: function( value ) {
+ return {}.toString.call( value ).indexOf( 'Number' ) > -1 && value % 1 === 0
+ },
+
+
+ /**
+ * Create ARIA attribute strings.
+ */
+ ariaAttr: ariaAttr
+} //PickerConstructor._
+
+
+
+/**
+ * Extend the picker with a component and defaults.
+ */
+PickerConstructor.extend = function( name, Component ) {
+
+ // Extend jQuery.
+ $.fn[ name ] = function( options, action ) {
+
+ // Grab the component data.
+ var componentData = this.data( name )
+
+ // If the picker is requested, return the data object.
+ if ( options == 'picker' ) {
+ return componentData
+ }
+
+ // If the component data exists and `options` is a string, carry out the action.
+ if ( componentData && typeof options == 'string' ) {
+ return PickerConstructor._.trigger( componentData[ options ], componentData, [ action ] )
+ }
+
+ // Otherwise go through each matched element and if the component
+ // doesn’t exist, create a new picker using `this` element
+ // and merging the defaults and options with a deep copy.
+ return this.each( function() {
+ var $this = $( this )
+ if ( !$this.data( name ) ) {
+ new PickerConstructor( this, name, Component, options )
+ }
+ })
+ }
+
+ // Set the defaults.
+ $.fn[ name ].defaults = Component.defaults
+} //PickerConstructor.extend
+
+
+
+function aria(element, attribute, value) {
+ if ( $.isPlainObject(attribute) ) {
+ for ( var key in attribute ) {
+ ariaSet(element, key, attribute[key])
+ }
+ }
+ else {
+ ariaSet(element, attribute, value)
+ }
+}
+function ariaSet(element, attribute, value) {
+ element.setAttribute(
+ (attribute == 'role' ? '' : 'aria-') + attribute,
+ value
+ )
+}
+function ariaAttr(attribute, data) {
+ if ( !$.isPlainObject(attribute) ) {
+ attribute = { attribute: data }
+ }
+ data = ''
+ for ( var key in attribute ) {
+ var attr = (key == 'role' ? '' : 'aria-') + key,
+ attrVal = attribute[key]
+ data += attrVal == null ? '' : attr + '="' + attribute[key] + '"'
+ }
+ return data
+}
+
+// IE8 bug throws an error for activeElements within iframes.
+function getActiveElement() {
+ try {
+ return document.activeElement
+ } catch ( err ) { }
+}
+
+
+
+// Expose the picker constructor.
+return PickerConstructor
+
+
+}));
diff --git a/app/dispatch/static/materialize/js/date_picker/picker.time.js b/app/dispatch/static/materialize/js/date_picker/picker.time.js new file mode 100644 index 0000000..7379529 --- /dev/null +++ b/app/dispatch/static/materialize/js/date_picker/picker.time.js @@ -0,0 +1,695 @@ +/*!
+ * ClockPicker v0.0.7 (http://weareoutman.github.io/clockpicker/)
+ * Copyright 2014 Wang Shenwei.
+ * Licensed under MIT (https://github.com/weareoutman/clockpicker/blob/gh-pages/LICENSE)
+ *
+ * Further modified
+ * Copyright 2015 Ching Yaw Hao.
+ */
+
+(function($){
+ var $win = $(window),
+ $doc = $(document);
+
+ // Can I use inline svg ?
+ var svgNS = 'http://www.w3.org/2000/svg',
+ svgSupported = 'SVGAngle' in window && (function() {
+ var supported,
+ el = document.createElement('div');
+ el.innerHTML = '<svg/>';
+ supported = (el.firstChild && el.firstChild.namespaceURI) == svgNS;
+ el.innerHTML = '';
+ return supported;
+ })();
+
+ // Can I use transition ?
+ var transitionSupported = (function() {
+ var style = document.createElement('div').style;
+ return 'transition' in style ||
+ 'WebkitTransition' in style ||
+ 'MozTransition' in style ||
+ 'msTransition' in style ||
+ 'OTransition' in style;
+ })();
+
+ // Listen touch events in touch screen device, instead of mouse events in desktop.
+ var touchSupported = 'ontouchstart' in window,
+ mousedownEvent = 'mousedown' + ( touchSupported ? ' touchstart' : ''),
+ mousemoveEvent = 'mousemove.clockpicker' + ( touchSupported ? ' touchmove.clockpicker' : ''),
+ mouseupEvent = 'mouseup.clockpicker' + ( touchSupported ? ' touchend.clockpicker' : '');
+
+ // Vibrate the device if supported
+ var vibrate = navigator.vibrate ? 'vibrate' : navigator.webkitVibrate ? 'webkitVibrate' : null;
+
+ function createSvgElement(name) {
+ return document.createElementNS(svgNS, name);
+ }
+
+ function leadingZero(num) {
+ return (num < 10 ? '0' : '') + num;
+ }
+
+ // Get a unique id
+ var idCounter = 0;
+ function uniqueId(prefix) {
+ var id = ++idCounter + '';
+ return prefix ? prefix + id : id;
+ }
+
+ // Clock size
+ var dialRadius = 135,
+ outerRadius = 105,
+ // innerRadius = 80 on 12 hour clock
+ innerRadius = 70,
+ tickRadius = 20,
+ diameter = dialRadius * 2,
+ duration = transitionSupported ? 350 : 1;
+
+ // Popover template
+ var tpl = [
+ '<div class="clockpicker picker">',
+ '<div class="picker__holder">',
+ '<div class="picker__frame">',
+ '<div class="picker__wrap">',
+ '<div class="picker__box">',
+ '<div class="picker__date-display">',
+ '<div class="clockpicker-display">',
+ '<div class="clockpicker-display-column">',
+ '<span class="clockpicker-span-hours text-primary"></span>',
+ ':',
+ '<span class="clockpicker-span-minutes"></span>',
+ '</div>',
+ '<div class="clockpicker-display-column clockpicker-display-am-pm">',
+ '<div class="clockpicker-span-am-pm"></div>',
+ '</div>',
+ '</div>',
+ '</div>',
+ '<div class="picker__container__wrapper">',
+ '<div class="picker__calendar-container">',
+ '<div class="clockpicker-plate">',
+ '<div class="clockpicker-canvas"></div>',
+ '<div class="clockpicker-dial clockpicker-hours"></div>',
+ '<div class="clockpicker-dial clockpicker-minutes clockpicker-dial-out"></div>',
+ '</div>',
+ '<div class="clockpicker-am-pm-block">',
+ '</div>',
+ '</div>',
+ '<div class="picker__footer">',
+ '</div>',
+ '</div>',
+ '</div>',
+ '</div>',
+ '</div>',
+ '</div>',
+ '</div>'
+ ].join('');
+
+ // ClockPicker
+ function ClockPicker(element, options) {
+ var popover = $(tpl),
+ plate = popover.find('.clockpicker-plate'),
+ holder = popover.find('.picker__holder'),
+ hoursView = popover.find('.clockpicker-hours'),
+ minutesView = popover.find('.clockpicker-minutes'),
+ amPmBlock = popover.find('.clockpicker-am-pm-block'),
+ isInput = element.prop('tagName') === 'INPUT',
+ input = isInput ? element : element.find('input'),
+ label = $("label[for=" + input.attr("id") + "]"),
+ self = this;
+
+ this.id = uniqueId('cp');
+ this.element = element;
+ this.holder = holder;
+ this.options = options;
+ this.isAppended = false;
+ this.isShown = false;
+ this.currentView = 'hours';
+ this.isInput = isInput;
+ this.input = input;
+ this.label = label;
+ this.popover = popover;
+ this.plate = plate;
+ this.hoursView = hoursView;
+ this.minutesView = minutesView;
+ this.amPmBlock = amPmBlock;
+ this.spanHours = popover.find('.clockpicker-span-hours');
+ this.spanMinutes = popover.find('.clockpicker-span-minutes');
+ this.spanAmPm = popover.find('.clockpicker-span-am-pm');
+ this.footer = popover.find('.picker__footer');
+ this.amOrPm = "PM";
+
+ // Setup for for 12 hour clock if option is selected
+ if (options.twelvehour) {
+ if (!options.ampmclickable) {
+ this.spanAmPm.empty();
+ $('<div id="click-am">AM</div>').appendTo(this.spanAmPm);
+ $('<div id="click-pm">PM</div>').appendTo(this.spanAmPm);
+ }
+ else {
+ this.spanAmPm.empty();
+ $('<div id="click-am">AM</div>').on("click", function() {
+ self.spanAmPm.children('#click-am').addClass("text-primary");
+ self.spanAmPm.children('#click-pm').removeClass("text-primary");
+ self.amOrPm = "AM";
+ }).appendTo(this.spanAmPm);
+ $('<div id="click-pm">PM</div>').on("click", function() {
+ self.spanAmPm.children('#click-pm').addClass("text-primary");
+ self.spanAmPm.children('#click-am').removeClass("text-primary");
+ self.amOrPm = 'PM';
+ }).appendTo(this.spanAmPm);
+ }
+ }
+
+ // Add buttons to footer
+ $('<button type="button" class="btn-flat picker__clear" tabindex="' + (options.twelvehour? '3' : '1') + '">' + options.cleartext + '</button>').click($.proxy(this.clear, this)).appendTo(this.footer);
+ $('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour? '3' : '1') + '">' + options.canceltext + '</button>').click($.proxy(this.hide, this)).appendTo(this.footer);
+ $('<button type="button" class="btn-flat picker__close" tabindex="' + (options.twelvehour? '3' : '1') + '">' + options.donetext + '</button>').click($.proxy(this.done, this)).appendTo(this.footer);
+
+ this.spanHours.click($.proxy(this.toggleView, this, 'hours'));
+ this.spanMinutes.click($.proxy(this.toggleView, this, 'minutes'));
+
+ // Show or toggle
+ input.on('focus.clockpicker click.clockpicker', $.proxy(this.show, this));
+
+ // Build ticks
+ var tickTpl = $('<div class="clockpicker-tick"></div>'),
+ i, tick, radian, radius;
+
+ // Hours view
+ if (options.twelvehour) {
+ for (i = 1; i < 13; i += 1) {
+ tick = tickTpl.clone();
+ radian = i / 6 * Math.PI;
+ radius = outerRadius;
+ tick.css({
+ left: dialRadius + Math.sin(radian) * radius - tickRadius,
+ top: dialRadius - Math.cos(radian) * radius - tickRadius
+ });
+ tick.html(i === 0 ? '00' : i);
+ hoursView.append(tick);
+ tick.on(mousedownEvent, mousedown);
+ }
+ } else {
+ for (i = 0; i < 24; i += 1) {
+ tick = tickTpl.clone();
+ radian = i / 6 * Math.PI;
+ var inner = i > 0 && i < 13;
+ radius = inner ? innerRadius : outerRadius;
+ tick.css({
+ left: dialRadius + Math.sin(radian) * radius - tickRadius,
+ top: dialRadius - Math.cos(radian) * radius - tickRadius
+ });
+ tick.html(i === 0 ? '00' : i);
+ hoursView.append(tick);
+ tick.on(mousedownEvent, mousedown);
+ }
+ }
+
+ // Minutes view
+ for (i = 0; i < 60; i += 5) {
+ tick = tickTpl.clone();
+ radian = i / 30 * Math.PI;
+ tick.css({
+ left: dialRadius + Math.sin(radian) * outerRadius - tickRadius,
+ top: dialRadius - Math.cos(radian) * outerRadius - tickRadius
+ });
+ tick.html(leadingZero(i));
+ minutesView.append(tick);
+ tick.on(mousedownEvent, mousedown);
+ }
+
+ // Clicking on minutes view space
+ plate.on(mousedownEvent, function(e) {
+ if ($(e.target).closest('.clockpicker-tick').length === 0) {
+ mousedown(e, true);
+ }
+ });
+
+ // Mousedown or touchstart
+ function mousedown(e, space) {
+ var offset = plate.offset(),
+ isTouch = /^touch/.test(e.type),
+ x0 = offset.left + dialRadius,
+ y0 = offset.top + dialRadius,
+ dx = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
+ dy = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0,
+ z = Math.sqrt(dx * dx + dy * dy),
+ moved = false;
+
+ // When clicking on minutes view space, check the mouse position
+ if (space && (z < outerRadius - tickRadius || z > outerRadius + tickRadius)) {
+ return;
+ }
+ e.preventDefault();
+
+ // Set cursor style of body after 200ms
+ var movingTimer = setTimeout(function(){
+ self.popover.addClass('clockpicker-moving');
+ }, 200);
+
+ // Clock
+ self.setHand(dx, dy, !space, true);
+
+ // Mousemove on document
+ $doc.off(mousemoveEvent).on(mousemoveEvent, function(e){
+ e.preventDefault();
+ var isTouch = /^touch/.test(e.type),
+ x = (isTouch ? e.originalEvent.touches[0] : e).pageX - x0,
+ y = (isTouch ? e.originalEvent.touches[0] : e).pageY - y0;
+ if (! moved && x === dx && y === dy) {
+ // Clicking in chrome on windows will trigger a mousemove event
+ return;
+ }
+ moved = true;
+ self.setHand(x, y, false, true);
+ });
+
+ // Mouseup on document
+ $doc.off(mouseupEvent).on(mouseupEvent, function(e) {
+ $doc.off(mouseupEvent);
+ e.preventDefault();
+ var isTouch = /^touch/.test(e.type),
+ x = (isTouch ? e.originalEvent.changedTouches[0] : e).pageX - x0,
+ y = (isTouch ? e.originalEvent.changedTouches[0] : e).pageY - y0;
+ if ((space || moved) && x === dx && y === dy) {
+ self.setHand(x, y);
+ }
+
+ if (self.currentView === 'hours') {
+ self.toggleView('minutes', duration / 2);
+ } else if (options.autoclose) {
+ self.minutesView.addClass('clockpicker-dial-out');
+ setTimeout(function(){
+ self.done();
+ }, duration / 2);
+ }
+ plate.prepend(canvas);
+
+ // Reset cursor style of body
+ clearTimeout(movingTimer);
+ self.popover.removeClass('clockpicker-moving');
+
+ // Unbind mousemove event
+ $doc.off(mousemoveEvent);
+ });
+ }
+
+ if (svgSupported) {
+ // Draw clock hands and others
+ var canvas = popover.find('.clockpicker-canvas'),
+ svg = createSvgElement('svg');
+ svg.setAttribute('class', 'clockpicker-svg');
+ svg.setAttribute('width', diameter);
+ svg.setAttribute('height', diameter);
+ var g = createSvgElement('g');
+ g.setAttribute('transform', 'translate(' + dialRadius + ',' + dialRadius + ')');
+ var bearing = createSvgElement('circle');
+ bearing.setAttribute('class', 'clockpicker-canvas-bearing');
+ bearing.setAttribute('cx', 0);
+ bearing.setAttribute('cy', 0);
+ bearing.setAttribute('r', 4);
+ var hand = createSvgElement('line');
+ hand.setAttribute('x1', 0);
+ hand.setAttribute('y1', 0);
+ var bg = createSvgElement('circle');
+ bg.setAttribute('class', 'clockpicker-canvas-bg');
+ bg.setAttribute('r', tickRadius);
+ g.appendChild(hand);
+ g.appendChild(bg);
+ g.appendChild(bearing);
+ svg.appendChild(g);
+ canvas.append(svg);
+
+ this.hand = hand;
+ this.bg = bg;
+ this.bearing = bearing;
+ this.g = g;
+ this.canvas = canvas;
+ }
+
+ raiseCallback(this.options.init);
+ }
+
+ function raiseCallback(callbackFunction) {
+ if (callbackFunction && typeof callbackFunction === "function")
+ callbackFunction();
+ }
+
+ // Default options
+ ClockPicker.DEFAULTS = {
+ 'default': '', // default time, 'now' or '13:14' e.g.
+ fromnow: 0, // set default time to * milliseconds from now (using with default = 'now')
+ donetext: 'Ok', // done button text
+ cleartext: 'Clear',
+ canceltext: 'Cancel',
+ autoclose: false, // auto close when minute is selected
+ ampmclickable: true, // set am/pm button on itself
+ darktheme: false, // set to dark theme
+ twelvehour: true, // change to 12 hour AM/PM clock from 24 hour
+ vibrate: true // vibrate the device when dragging clock hand
+ };
+
+ // Show or hide popover
+ ClockPicker.prototype.toggle = function() {
+ this[this.isShown ? 'hide' : 'show']();
+ };
+
+ // Set popover position
+ ClockPicker.prototype.locate = function() {
+ var element = this.element,
+ popover = this.popover,
+ offset = element.offset(),
+ width = element.outerWidth(),
+ height = element.outerHeight(),
+ align = this.options.align,
+ self = this;
+
+ popover.show();
+ };
+
+ // Show popover
+ ClockPicker.prototype.show = function(e){
+ // Not show again
+ if (this.isShown) {
+ return;
+ }
+ raiseCallback(this.options.beforeShow);
+ $(':input').each(function() {
+ $(this).attr('tabindex', -1);
+ })
+ var self = this;
+ // Initialize
+ this.input.blur();
+ this.popover.addClass('picker--opened');
+ this.input.addClass('picker__input picker__input--active');
+ $(document.body).css('overflow', 'hidden');
+ // Get the time
+ var value = ((this.input.prop('value') || this.options['default'] || '') + '').split(':');
+ if (this.options.twelvehour && !(typeof value[1] === 'undefined')) {
+ if (value[1].indexOf("AM") > 0){
+ this.amOrPm = 'AM';
+ } else {
+ this.amOrPm = 'PM';
+ }
+ value[1] = value[1].replace("AM", "").replace("PM", "");
+ }
+ if (value[0] === 'now') {
+ var now = new Date(+ new Date() + this.options.fromnow);
+ value = [
+ now.getHours(),
+ now.getMinutes()
+ ];
+ if (this.options.twelvehour) {
+ this.amOrPm = value[0] >= 12 && value[0] < 24 ? 'PM' : 'AM';
+ }
+ }
+ this.hours = + value[0] || 0;
+ this.minutes = + value[1] || 0;
+ this.spanHours.html(this.hours);
+ this.spanMinutes.html(leadingZero(this.minutes));
+ if (!this.isAppended) {
+
+ // Append popover to input by default
+ var containerEl = document.querySelector(this.options.container);
+ if (this.options.container && containerEl) {
+ containerEl.appendChild(this.popover[0]);
+ } else {
+ this.popover.insertAfter(this.input);
+ }
+
+ if (this.options.twelvehour) {
+ if (this.amOrPm === 'PM'){
+ this.spanAmPm.children('#click-pm').addClass("text-primary");
+ this.spanAmPm.children('#click-am').removeClass("text-primary");
+ } else {
+ this.spanAmPm.children('#click-am').addClass("text-primary");
+ this.spanAmPm.children('#click-pm').removeClass("text-primary");
+ }
+ }
+ // Reset position when resize
+ $win.on('resize.clockpicker' + this.id, function() {
+ if (self.isShown) {
+ self.locate();
+ }
+ });
+ this.isAppended = true;
+ }
+ // Toggle to hours view
+ this.toggleView('hours');
+ // Set position
+ this.locate();
+ this.isShown = true;
+ // Hide when clicking or tabbing on any element except the clock and input
+ $doc.on('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id, function(e) {
+ var target = $(e.target);
+ if (target.closest(self.popover.find('.picker__wrap')).length === 0 && target.closest(self.input).length === 0) {
+ self.hide();
+ }
+ });
+ // Hide when ESC is pressed
+ $doc.on('keyup.clockpicker.' + this.id, function(e){
+ if (e.keyCode === 27) {
+ self.hide();
+ }
+ });
+ raiseCallback(this.options.afterShow);
+ };
+ // Hide popover
+ ClockPicker.prototype.hide = function() {
+ raiseCallback(this.options.beforeHide);
+ this.input.removeClass('picker__input picker__input--active');
+ this.popover.removeClass('picker--opened');
+ $(document.body).css('overflow', 'visible');
+ this.isShown = false;
+ $(':input').each(function(index) {
+ $(this).attr('tabindex', index + 1);
+ });
+ // Unbinding events on document
+ $doc.off('click.clockpicker.' + this.id + ' focusin.clockpicker.' + this.id);
+ $doc.off('keyup.clockpicker.' + this.id);
+ this.popover.hide();
+ raiseCallback(this.options.afterHide);
+ };
+ // Toggle to hours or minutes view
+ ClockPicker.prototype.toggleView = function(view, delay) {
+ var raiseAfterHourSelect = false;
+ if (view === 'minutes' && $(this.hoursView).css("visibility") === "visible") {
+ raiseCallback(this.options.beforeHourSelect);
+ raiseAfterHourSelect = true;
+ }
+ var isHours = view === 'hours',
+ nextView = isHours ? this.hoursView : this.minutesView,
+ hideView = isHours ? this.minutesView : this.hoursView;
+ this.currentView = view;
+
+ this.spanHours.toggleClass('text-primary', isHours);
+ this.spanMinutes.toggleClass('text-primary', ! isHours);
+
+ // Let's make transitions
+ hideView.addClass('clockpicker-dial-out');
+ nextView.css('visibility', 'visible').removeClass('clockpicker-dial-out');
+
+ // Reset clock hand
+ this.resetClock(delay);
+
+ // After transitions ended
+ clearTimeout(this.toggleViewTimer);
+ this.toggleViewTimer = setTimeout(function() {
+ hideView.css('visibility', 'hidden');
+ }, duration);
+
+ if (raiseAfterHourSelect) {
+ raiseCallback(this.options.afterHourSelect);
+ }
+ };
+
+ // Reset clock hand
+ ClockPicker.prototype.resetClock = function(delay) {
+ var view = this.currentView,
+ value = this[view],
+ isHours = view === 'hours',
+ unit = Math.PI / (isHours ? 6 : 30),
+ radian = value * unit,
+ radius = isHours && value > 0 && value < 13 ? innerRadius : outerRadius,
+ x = Math.sin(radian) * radius,
+ y = - Math.cos(radian) * radius,
+ self = this;
+
+ if (svgSupported && delay) {
+ self.canvas.addClass('clockpicker-canvas-out');
+ setTimeout(function(){
+ self.canvas.removeClass('clockpicker-canvas-out');
+ self.setHand(x, y);
+ }, delay);
+ } else
+ this.setHand(x, y);
+ };
+
+ // Set clock hand to (x, y)
+ ClockPicker.prototype.setHand = function(x, y, roundBy5, dragging) {
+ var radian = Math.atan2(x, - y),
+ isHours = this.currentView === 'hours',
+ unit = Math.PI / (isHours || roundBy5? 6 : 30),
+ z = Math.sqrt(x * x + y * y),
+ options = this.options,
+ inner = isHours && z < (outerRadius + innerRadius) / 2,
+ radius = inner ? innerRadius : outerRadius,
+ value;
+
+ if (options.twelvehour) {
+ radius = outerRadius;
+ }
+
+ // Radian should in range [0, 2PI]
+ if (radian < 0) {
+ radian = Math.PI * 2 + radian;
+ }
+
+ // Get the round value
+ value = Math.round(radian / unit);
+
+ // Get the round radian
+ radian = value * unit;
+
+ // Correct the hours or minutes
+ if (options.twelvehour) {
+ if (isHours) {
+ if (value === 0)
+ value = 12;
+ } else {
+ if (roundBy5)
+ value *= 5;
+ if (value === 60)
+ value = 0;
+ }
+ } else {
+ if (isHours) {
+ if (value === 12)
+ value = 0;
+ value = inner ? (value === 0 ? 12 : value) : value === 0 ? 0 : value + 12;
+ } else {
+ if (roundBy5)
+ value *= 5;
+ if (value === 60)
+ value = 0;
+ }
+ }
+
+ // Once hours or minutes changed, vibrate the device
+ if (this[this.currentView] !== value) {
+ if (vibrate && this.options.vibrate) {
+ // Do not vibrate too frequently
+ if (!this.vibrateTimer) {
+ navigator[vibrate](10);
+ this.vibrateTimer = setTimeout($.proxy(function(){
+ this.vibrateTimer = null;
+ }, this), 100);
+ }
+ }
+ }
+
+ this[this.currentView] = value;
+ if (isHours) {
+ this['spanHours'].html(value);
+ } else {
+ this['spanMinutes'].html(leadingZero(value));
+ }
+
+ // If svg is not supported, just add an active class to the tick
+ if (!svgSupported) {
+ this[isHours ? 'hoursView' : 'minutesView'].find('.clockpicker-tick').each(function(){
+ var tick = $(this);
+ tick.toggleClass('active', value === + tick.html());
+ });
+ return;
+ }
+
+ // Set clock hand and others' position
+ var cx1 = Math.sin(radian) * (radius - tickRadius),
+ cy1 = - Math.cos(radian) * (radius - tickRadius),
+ cx2 = Math.sin(radian) * radius,
+ cy2 = - Math.cos(radian) * radius;
+ this.hand.setAttribute('x2', cx1);
+ this.hand.setAttribute('y2', cy1);
+ this.bg.setAttribute('cx', cx2);
+ this.bg.setAttribute('cy', cy2);
+ };
+
+ // Hours and minutes are selected
+ ClockPicker.prototype.done = function() {
+ raiseCallback(this.options.beforeDone);
+ this.hide();
+ this.label.addClass('active');
+
+ var last = this.input.prop('value'),
+ value = leadingZero(this.hours) + ':' + leadingZero(this.minutes);
+ if (this.options.twelvehour) {
+ value = value + this.amOrPm;
+ }
+
+ this.input.prop('value', value);
+ if (value !== last) {
+ this.input.triggerHandler('change');
+ if (!this.isInput) {
+ this.element.trigger('change');
+ }
+ }
+
+ if (this.options.autoclose)
+ this.input.trigger('blur');
+
+ raiseCallback(this.options.afterDone);
+ };
+
+ // Clear input field
+ ClockPicker.prototype.clear = function() {
+ this.hide();
+ this.label.removeClass('active');
+
+ var last = this.input.prop('value'),
+ value = '';
+
+ this.input.prop('value', value);
+ if (value !== last) {
+ this.input.triggerHandler('change');
+ if (! this.isInput) {
+ this.element.trigger('change');
+ }
+ }
+
+ if (this.options.autoclose) {
+ this.input.trigger('blur');
+ }
+ };
+
+ // Remove clockpicker from input
+ ClockPicker.prototype.remove = function() {
+ this.element.removeData('clockpicker');
+ this.input.off('focus.clockpicker click.clockpicker');
+ if (this.isShown) {
+ this.hide();
+ }
+ if (this.isAppended) {
+ $win.off('resize.clockpicker' + this.id);
+ this.popover.remove();
+ }
+ };
+
+ // Extends $.fn.clockpicker
+ $.fn.pickatime = function(option){
+ var args = Array.prototype.slice.call(arguments, 1);
+ return this.each(function(){
+ var $this = $(this),
+ data = $this.data('clockpicker');
+ if (!data) {
+ var options = $.extend({}, ClockPicker.DEFAULTS, $this.data(), typeof option == 'object' && option);
+ $this.data('clockpicker', new ClockPicker($this, options));
+ } else {
+ // Manual operatsions. show, hide, remove, e.g.
+ if (typeof data[option] === 'function') {
+ data[option].apply(data, args);
+ }
+ }
+ });
+ };
+})(jQuery);
diff --git a/app/dispatch/static/materialize/js/dropdown.js b/app/dispatch/static/materialize/js/dropdown.js new file mode 100644 index 0000000..6627e45 --- /dev/null +++ b/app/dispatch/static/materialize/js/dropdown.js @@ -0,0 +1,274 @@ +(function ($) {
+
+ // Add posibility to scroll to selected option
+ // usefull for select for example
+ $.fn.scrollTo = function(elem) {
+ $(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top);
+ return this;
+ };
+
+ $.fn.dropdown = function (options) {
+ var defaults = {
+ inDuration: 300,
+ outDuration: 225,
+ constrainWidth: true, // Constrains width of dropdown to the activator
+ hover: false,
+ gutter: 0, // Spacing from edge
+ belowOrigin: false,
+ alignment: 'left',
+ stopPropagation: false
+ };
+
+ // Open dropdown.
+ if (options === "open") {
+ this.each(function() {
+ $(this).trigger('open');
+ });
+ return false;
+ }
+
+ // Close dropdown.
+ if (options === "close") {
+ this.each(function() {
+ $(this).trigger('close');
+ });
+ return false;
+ }
+
+ this.each(function(){
+ var origin = $(this);
+ var curr_options = $.extend({}, defaults, options);
+ var isFocused = false;
+
+ // Dropdown menu
+ var activates = $("#"+ origin.attr('data-activates'));
+
+ function updateOptions() {
+ if (origin.data('induration') !== undefined)
+ curr_options.inDuration = origin.data('induration');
+ if (origin.data('outduration') !== undefined)
+ curr_options.outDuration = origin.data('outduration');
+ if (origin.data('constrainwidth') !== undefined)
+ curr_options.constrainWidth = origin.data('constrainwidth');
+ if (origin.data('hover') !== undefined)
+ curr_options.hover = origin.data('hover');
+ if (origin.data('gutter') !== undefined)
+ curr_options.gutter = origin.data('gutter');
+ if (origin.data('beloworigin') !== undefined)
+ curr_options.belowOrigin = origin.data('beloworigin');
+ if (origin.data('alignment') !== undefined)
+ curr_options.alignment = origin.data('alignment');
+ if (origin.data('stoppropagation') !== undefined)
+ curr_options.stopPropagation = origin.data('stoppropagation');
+ }
+
+ updateOptions();
+
+ // Attach dropdown to its activator
+ origin.after(activates);
+
+ /*
+ Helper function to position and resize dropdown.
+ Used in hover and click handler.
+ */
+ function placeDropdown(eventType) {
+ // Check for simultaneous focus and click events.
+ if (eventType === 'focus') {
+ isFocused = true;
+ }
+
+ // Check html data attributes
+ updateOptions();
+
+ // Set Dropdown state
+ activates.addClass('active');
+ origin.addClass('active');
+
+ var originWidth = origin[0].getBoundingClientRect().width;
+
+ // Constrain width
+ if (curr_options.constrainWidth === true) {
+ activates.css('width', originWidth);
+
+ } else {
+ activates.css('white-space', 'nowrap');
+ }
+
+ // Offscreen detection
+ var windowHeight = window.innerHeight;
+ var originHeight = origin.innerHeight();
+ var offsetLeft = origin.offset().left;
+ var offsetTop = origin.offset().top - $(window).scrollTop();
+ var currAlignment = curr_options.alignment;
+ var gutterSpacing = 0;
+ var leftPosition = 0;
+
+ // Below Origin
+ var verticalOffset = 0;
+ if (curr_options.belowOrigin === true) {
+ verticalOffset = originHeight;
+ }
+
+ // Check for scrolling positioned container.
+ var scrollYOffset = 0;
+ var scrollXOffset = 0;
+ var wrapper = origin.parent();
+ if (!wrapper.is('body')) {
+ if (wrapper[0].scrollHeight > wrapper[0].clientHeight) {
+ scrollYOffset = wrapper[0].scrollTop;
+ }
+ if (wrapper[0].scrollWidth > wrapper[0].clientWidth) {
+ scrollXOffset = wrapper[0].scrollLeft;
+ }
+ }
+
+
+ if (offsetLeft + activates.innerWidth() > $(window).width()) {
+ // Dropdown goes past screen on right, force right alignment
+ currAlignment = 'right';
+
+ } else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) {
+ // Dropdown goes past screen on left, force left alignment
+ currAlignment = 'left';
+ }
+ // Vertical bottom offscreen detection
+ if (offsetTop + activates.innerHeight() > windowHeight) {
+ // If going upwards still goes offscreen, just crop height of dropdown.
+ if (offsetTop + originHeight - activates.innerHeight() < 0) {
+ var adjustedHeight = windowHeight - offsetTop - verticalOffset;
+ activates.css('max-height', adjustedHeight);
+ } else {
+ // Flow upwards.
+ if (!verticalOffset) {
+ verticalOffset += originHeight;
+ }
+ verticalOffset -= activates.innerHeight();
+ }
+ }
+
+ // Handle edge alignment
+ if (currAlignment === 'left') {
+ gutterSpacing = curr_options.gutter;
+ leftPosition = origin.position().left + gutterSpacing;
+ }
+ else if (currAlignment === 'right') {
+ // Material icons fix
+ activates
+ .stop(true, true)
+ .css({
+ opacity: 0,
+ left: 0
+ })
+
+ var offsetRight = origin.position().left + originWidth - activates.width();
+ gutterSpacing = -curr_options.gutter;
+ leftPosition = offsetRight + gutterSpacing;
+ }
+
+ // Position dropdown
+ activates.css({
+ position: 'absolute',
+ top: origin.position().top + verticalOffset + scrollYOffset,
+ left: leftPosition + scrollXOffset
+ });
+
+ // Show dropdown
+ activates
+ .slideDown({
+ queue: false,
+ duration: curr_options.inDuration,
+ easing: 'easeOutCubic',
+ complete: function() {
+ $(this).css('height', '');
+ }
+ })
+ .animate( {opacity: 1}, {queue: false, duration: curr_options.inDuration, easing: 'easeOutSine'});
+
+ // Add click close handler to document
+ setTimeout(function() {
+ $(document).on('click.'+ activates.attr('id'), function (e) {
+ hideDropdown();
+ $(document).off('click.'+ activates.attr('id'));
+ });
+ }, 0);
+ }
+
+ function hideDropdown() {
+ // Check for simultaneous focus and click events.
+ isFocused = false;
+ activates.fadeOut(curr_options.outDuration);
+ activates.removeClass('active');
+ origin.removeClass('active');
+ $(document).off('click.'+ activates.attr('id'));
+ setTimeout(function() { activates.css('max-height', ''); }, curr_options.outDuration);
+ }
+
+ // Hover
+ if (curr_options.hover) {
+ var open = false;
+ origin.off('click.' + origin.attr('id'));
+ // Hover handler to show dropdown
+ origin.on('mouseenter', function(e){ // Mouse over
+ if (open === false) {
+ placeDropdown();
+ open = true;
+ }
+ });
+ origin.on('mouseleave', function(e){
+ // If hover on origin then to something other than dropdown content, then close
+ var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element
+ if(!$(toEl).closest('.dropdown-content').is(activates)) {
+ activates.stop(true, true);
+ hideDropdown();
+ open = false;
+ }
+ });
+
+ activates.on('mouseleave', function(e){ // Mouse out
+ var toEl = e.toElement || e.relatedTarget;
+ if(!$(toEl).closest('.dropdown-button').is(origin)) {
+ activates.stop(true, true);
+ hideDropdown();
+ open = false;
+ }
+ });
+
+ // Click
+ } else {
+ // Click handler to show dropdown
+ origin.off('click.' + origin.attr('id'));
+ origin.on('click.'+origin.attr('id'), function(e){
+ if (!isFocused) {
+ if ( origin[0] == e.currentTarget &&
+ !origin.hasClass('active') &&
+ ($(e.target).closest('.dropdown-content').length === 0)) {
+ e.preventDefault(); // Prevents button click from moving window
+ if (curr_options.stopPropagation) {
+ e.stopPropagation();
+ }
+ placeDropdown('click');
+ }
+ // If origin is clicked and menu is open, close menu
+ else if (origin.hasClass('active')) {
+ hideDropdown();
+ $(document).off('click.'+ activates.attr('id'));
+ }
+ }
+ });
+
+ } // End else
+
+ // Listen to open and close event - useful for select component
+ origin.on('open', function(e, eventType) {
+ placeDropdown(eventType);
+ });
+ origin.on('close', hideDropdown);
+
+
+ });
+ }; // End dropdown plugin
+
+ $(document).ready(function(){
+ $('.dropdown-button').dropdown();
+ });
+}( jQuery ));
diff --git a/app/dispatch/static/materialize/js/forms.js b/app/dispatch/static/materialize/js/forms.js new file mode 100644 index 0000000..cda137e --- /dev/null +++ b/app/dispatch/static/materialize/js/forms.js @@ -0,0 +1,811 @@ +(function ($) {
+ $(document).ready(function() {
+
+ // Function to update labels of text fields
+ Materialize.updateTextFields = function() {
+ var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
+ $(input_selector).each(function(index, element) {
+ var $this = $(this);
+ if ($(element).val().length > 0 || $(element).is(':focus') || element.autofocus || $this.attr('placeholder') !== undefined) {
+ $this.siblings('label').addClass('active');
+ } else if ($(element)[0].validity) {
+ $this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true);
+ } else {
+ $this.siblings('label').removeClass('active');
+ }
+ });
+ };
+
+ // Text based inputs
+ var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
+
+ // Add active if form auto complete
+ $(document).on('change', input_selector, function () {
+ if($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) {
+ $(this).siblings('label').addClass('active');
+ }
+ validate_field($(this));
+ });
+
+ // Add active if input element has been pre-populated on document ready
+ $(document).ready(function() {
+ Materialize.updateTextFields();
+ });
+
+ // HTML DOM FORM RESET handling
+ $(document).on('reset', function(e) {
+ var formReset = $(e.target);
+ if (formReset.is('form')) {
+ formReset.find(input_selector).removeClass('valid').removeClass('invalid');
+ formReset.find(input_selector).each(function () {
+ if ($(this).attr('value') === '') {
+ $(this).siblings('label').removeClass('active');
+ }
+ });
+
+ // Reset select
+ formReset.find('select.initialized').each(function () {
+ var reset_text = formReset.find('option[selected]').text();
+ formReset.siblings('input.select-dropdown').val(reset_text);
+ });
+ }
+ });
+
+ // Add active when element has focus
+ $(document).on('focus', input_selector, function () {
+ $(this).siblings('label, .prefix').addClass('active');
+ });
+
+ $(document).on('blur', input_selector, function () {
+ var $inputElement = $(this);
+ var selector = ".prefix";
+
+ if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) {
+ selector += ", label";
+ }
+
+ $inputElement.siblings(selector).removeClass('active');
+
+ validate_field($inputElement);
+ });
+
+ window.validate_field = function(object) {
+ var hasLength = object.attr('data-length') !== undefined;
+ var lenAttr = parseInt(object.attr('data-length'));
+ var len = object.val().length;
+
+ if (object.val().length === 0 && object[0].validity.badInput === false && !object.is(':required')) {
+ if (object.hasClass('validate')) {
+ object.removeClass('valid');
+ object.removeClass('invalid');
+ }
+ }
+ else {
+ if (object.hasClass('validate')) {
+ // Check for character counter attributes
+ if ((object.is(':valid') && hasLength && (len <= lenAttr)) || (object.is(':valid') && !hasLength)) {
+ object.removeClass('invalid');
+ object.addClass('valid');
+ }
+ else {
+ object.removeClass('valid');
+ object.addClass('invalid');
+ }
+ }
+ }
+ };
+
+ // Radio and Checkbox focus class
+ var radio_checkbox = 'input[type=radio], input[type=checkbox]';
+ $(document).on('keyup.radio', radio_checkbox, function(e) {
+ // TAB, check if tabbing to radio or checkbox.
+ if (e.which === 9) {
+ $(this).addClass('tabbed');
+ var $this = $(this);
+ $this.one('blur', function(e) {
+
+ $(this).removeClass('tabbed');
+ });
+ return;
+ }
+ });
+
+ // Textarea Auto Resize
+ var hiddenDiv = $('.hiddendiv').first();
+ if (!hiddenDiv.length) {
+ hiddenDiv = $('<div class="hiddendiv common"></div>');
+ $('body').append(hiddenDiv);
+ }
+ var text_area_selector = '.materialize-textarea';
+
+ function textareaAutoResize($textarea) {
+ // Set font properties of hiddenDiv
+
+ var fontFamily = $textarea.css('font-family');
+ var fontSize = $textarea.css('font-size');
+ var lineHeight = $textarea.css('line-height');
+ var padding = $textarea.css('padding');
+
+ if (fontSize) { hiddenDiv.css('font-size', fontSize); }
+ if (fontFamily) { hiddenDiv.css('font-family', fontFamily); }
+ if (lineHeight) { hiddenDiv.css('line-height', lineHeight); }
+ if (padding) { hiddenDiv.css('padding', padding); }
+
+ // Set original-height, if none
+ if (!$textarea.data('original-height')) {
+ $textarea.data('original-height', $textarea.height());
+ }
+
+ if ($textarea.attr('wrap') === 'off') {
+ hiddenDiv.css('overflow-wrap', 'normal')
+ .css('white-space', 'pre');
+ }
+
+ hiddenDiv.text($textarea.val() + '\n');
+ var content = hiddenDiv.html().replace(/\n/g, '<br>');
+ hiddenDiv.html(content);
+
+
+ // When textarea is hidden, width goes crazy.
+ // Approximate with half of window size
+
+ if ($textarea.is(':visible')) {
+ hiddenDiv.css('width', $textarea.width());
+ }
+ else {
+ hiddenDiv.css('width', $(window).width()/2);
+ }
+
+
+ /**
+ * Resize if the new height is greater than the
+ * original height of the textarea
+ */
+ if ($textarea.data('original-height') <= hiddenDiv.height()) {
+ $textarea.css('height', hiddenDiv.height());
+ } else if ($textarea.val().length < $textarea.data('previous-length')) {
+ /**
+ * In case the new height is less than original height, it
+ * means the textarea has less text than before
+ * So we set the height to the original one
+ */
+ $textarea.css('height', $textarea.data('original-height'));
+ }
+ $textarea.data('previous-length', $textarea.val().length);
+ }
+
+ $(text_area_selector).each(function () {
+ var $textarea = $(this);
+ /**
+ * Instead of resizing textarea on document load,
+ * store the original height and the original length
+ */
+ $textarea.data('original-height', $textarea.height());
+ $textarea.data('previous-length', $textarea.val().length);
+ });
+
+ $('body').on('keyup keydown autoresize', text_area_selector, function () {
+ textareaAutoResize($(this));
+ });
+
+ // File Input Path
+ $(document).on('change', '.file-field input[type="file"]', function () {
+ var file_field = $(this).closest('.file-field');
+ var path_input = file_field.find('input.file-path');
+ var files = $(this)[0].files;
+ var file_names = [];
+ for (var i = 0; i < files.length; i++) {
+ file_names.push(files[i].name);
+ }
+ path_input.val(file_names.join(", "));
+ path_input.trigger('change');
+ });
+
+ /****************
+ * Range Input *
+ ****************/
+
+ var range_type = 'input[type=range]';
+ var range_mousedown = false;
+ var left;
+
+ $(range_type).each(function () {
+ var thumb = $('<span class="thumb"><span class="value"></span></span>');
+ $(this).after(thumb);
+ });
+
+ var showRangeBubble = function(thumb) {
+ var paddingLeft = parseInt(thumb.parent().css('padding-left'));
+ var marginLeft = (-7 + paddingLeft) + 'px';
+ thumb.velocity({ height: "30px", width: "30px", top: "-30px", marginLeft: marginLeft}, { duration: 300, easing: 'easeOutExpo' });
+ };
+
+ var calcRangeOffset = function(range) {
+ var width = range.width() - 15;
+ var max = parseFloat(range.attr('max'));
+ var min = parseFloat(range.attr('min'));
+ var percent = (parseFloat(range.val()) - min) / (max - min);
+ return percent * width;
+ }
+
+ var range_wrapper = '.range-field';
+ $(document).on('change', range_type, function(e) {
+ var thumb = $(this).siblings('.thumb');
+ thumb.find('.value').html($(this).val());
+
+ if (!thumb.hasClass('active')) {
+ showRangeBubble(thumb);
+ }
+
+ var offsetLeft = calcRangeOffset($(this));
+ thumb.addClass('active').css('left', offsetLeft);
+ });
+
+ $(document).on('mousedown touchstart', range_type, function(e) {
+ var thumb = $(this).siblings('.thumb');
+
+ // If thumb indicator does not exist yet, create it
+ if (thumb.length <= 0) {
+ thumb = $('<span class="thumb"><span class="value"></span></span>');
+ $(this).after(thumb);
+ }
+
+ // Set indicator value
+ thumb.find('.value').html($(this).val());
+
+ range_mousedown = true;
+ $(this).addClass('active');
+
+ if (!thumb.hasClass('active')) {
+ showRangeBubble(thumb);
+ }
+
+ if (e.type !== 'input') {
+ var offsetLeft = calcRangeOffset($(this));
+ thumb.addClass('active').css('left', offsetLeft);
+ }
+ });
+
+ $(document).on('mouseup touchend', range_wrapper, function() {
+ range_mousedown = false;
+ $(this).removeClass('active');
+ });
+
+ $(document).on('input mousemove touchmove', range_wrapper, function(e) {
+ var thumb = $(this).children('.thumb');
+ var left;
+ var input = $(this).find(range_type);
+
+ if (range_mousedown) {
+ if (!thumb.hasClass('active')) {
+ showRangeBubble(thumb);
+ }
+
+ var offsetLeft = calcRangeOffset(input);
+ thumb.addClass('active').css('left', offsetLeft);
+ thumb.find('.value').html(thumb.siblings(range_type).val());
+ }
+ });
+
+ $(document).on('mouseout touchleave', range_wrapper, function() {
+ if (!range_mousedown) {
+
+ var thumb = $(this).children('.thumb');
+ var paddingLeft = parseInt($(this).css('padding-left'));
+ var marginLeft = (7 + paddingLeft) + 'px';
+
+ if (thumb.hasClass('active')) {
+ thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: marginLeft}, { duration: 100 });
+ }
+ thumb.removeClass('active');
+ }
+ });
+
+ /**************************
+ * Auto complete plugin *
+ *************************/
+ $.fn.autocomplete = function (options) {
+ // Defaults
+ var defaults = {
+ data: {},
+ limit: Infinity,
+ onAutocomplete: null,
+ minLength: 1
+ };
+
+ options = $.extend(defaults, options);
+
+ return this.each(function() {
+ var $input = $(this);
+ var data = options.data,
+ count = 0,
+ activeIndex = -1,
+ oldVal,
+ $inputDiv = $input.closest('.input-field'); // Div to append on
+
+ // Check if data isn't empty
+ if (!$.isEmptyObject(data)) {
+ var $autocomplete = $('<ul class="autocomplete-content dropdown-content"></ul>');
+ var $oldAutocomplete;
+
+ // Append autocomplete element.
+ // Prevent double structure init.
+ if ($inputDiv.length) {
+ $oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first();
+ if (!$oldAutocomplete.length) {
+ $inputDiv.append($autocomplete); // Set ul in body
+ }
+ } else {
+ $oldAutocomplete = $input.next('.autocomplete-content.dropdown-content');
+ if (!$oldAutocomplete.length) {
+ $input.after($autocomplete);
+ }
+ }
+ if ($oldAutocomplete.length) {
+ $autocomplete = $oldAutocomplete;
+ }
+
+ // Highlight partial match.
+ var highlight = function(string, $el) {
+ var img = $el.find('img');
+ var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""),
+ matchEnd = matchStart + string.length - 1,
+ beforeMatch = $el.text().slice(0, matchStart),
+ matchText = $el.text().slice(matchStart, matchEnd + 1),
+ afterMatch = $el.text().slice(matchEnd + 1);
+ $el.html("<span>" + beforeMatch + "<span class='highlight'>" + matchText + "</span>" + afterMatch + "</span>");
+ if (img.length) {
+ $el.prepend(img);
+ }
+ };
+
+ // Reset current element position
+ var resetCurrentElement = function() {
+ activeIndex = -1;
+ $autocomplete.find('.active').removeClass('active');
+ }
+
+ // Remove autocomplete elements
+ var removeAutocomplete = function() {
+ $autocomplete.empty();
+ resetCurrentElement();
+ oldVal = undefined;
+ };
+
+ $input.off('blur.autocomplete').on('blur.autocomplete', function() {
+ removeAutocomplete();
+ });
+
+ // Perform search
+ $input.off('keyup.autocomplete focus.autocomplete').on('keyup.autocomplete focus.autocomplete', function (e) {
+ // Reset count.
+ count = 0;
+ var val = $input.val().toLowerCase();
+
+ // Don't capture enter or arrow key usage.
+ if (e.which === 13 ||
+ e.which === 38 ||
+ e.which === 40) {
+ return;
+ }
+
+
+ // Check if the input isn't empty
+ if (oldVal !== val) {
+ removeAutocomplete();
+
+ if (val.length >= options.minLength) {
+ for(var key in data) {
+ if (data.hasOwnProperty(key) &&
+ key.toLowerCase().indexOf(val) !== -1) {
+ // Break if past limit
+ if (count >= options.limit) {
+ break;
+ }
+
+ var autocompleteOption = $('<li></li>');
+ if (!!data[key]) {
+ autocompleteOption.append('<img src="'+ data[key] +'" class="right circle"><span>'+ key +'</span>');
+ } else {
+ autocompleteOption.append('<span>'+ key +'</span>');
+ }
+
+ $autocomplete.append(autocompleteOption);
+ highlight(val, autocompleteOption);
+ count++;
+ }
+ }
+ }
+ }
+
+ // Update oldVal
+ oldVal = val;
+ });
+
+ $input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) {
+ // Arrow keys and enter key usage
+ var keyCode = e.which,
+ liElement,
+ numItems = $autocomplete.children('li').length,
+ $active = $autocomplete.children('.active').first();
+
+ // select element on Enter
+ if (keyCode === 13 && activeIndex >= 0) {
+ liElement = $autocomplete.children('li').eq(activeIndex);
+ if (liElement.length) {
+ liElement.trigger('mousedown.autocomplete');
+ e.preventDefault();
+ }
+ return;
+ }
+
+ // Capture up and down key
+ if ( keyCode === 38 || keyCode === 40 ) {
+ e.preventDefault();
+
+ if (keyCode === 38 &&
+ activeIndex > 0) {
+ activeIndex--;
+ }
+
+ if (keyCode === 40 &&
+ activeIndex < (numItems - 1)) {
+ activeIndex++;
+ }
+
+ $active.removeClass('active');
+ if (activeIndex >= 0) {
+ $autocomplete.children('li').eq(activeIndex).addClass('active');
+ }
+ }
+ });
+
+ // Set input value
+ $autocomplete.off('mousedown.autocomplete touchstart.autocomplete').on('mousedown.autocomplete touchstart.autocomplete', 'li', function () {
+ var text = $(this).text().trim();
+ $input.val(text);
+ $input.trigger('change');
+ removeAutocomplete();
+
+ // Handle onAutocomplete callback.
+ if (typeof(options.onAutocomplete) === "function") {
+ options.onAutocomplete.call(this, text);
+ }
+ });
+
+ // Empty data
+ } else {
+ $input.off('keyup.autocomplete focus.autocomplete');
+ }
+ });
+ };
+
+ }); // End of $(document).ready
+
+ /*******************
+ * Select Plugin *
+ ******************/
+ $.fn.material_select = function (callback) {
+ $(this).each(function(){
+ var $select = $(this);
+
+ if ($select.hasClass('browser-default')) {
+ return; // Continue to next (return false breaks out of entire loop)
+ }
+
+ var multiple = $select.attr('multiple') ? true : false,
+ lastID = $select.attr('data-select-id'); // Tear down structure if Select needs to be rebuilt
+
+ if (lastID) {
+ $select.parent().find('span.caret').remove();
+ $select.parent().find('input').remove();
+
+ $select.unwrap();
+ $('ul#select-options-'+lastID).remove();
+ }
+
+ // If destroying the select, remove the selelct-id and reset it to it's uninitialized state.
+ if(callback === 'destroy') {
+ $select.removeAttr('data-select-id').removeClass('initialized');
+ $(window).off('click.select');
+ return;
+ }
+
+ var uniqueID = Materialize.guid();
+ $select.attr('data-select-id', uniqueID);
+ var wrapper = $('<div class="select-wrapper"></div>');
+ wrapper.addClass($select.attr('class'));
+ if ($select.is(':disabled'))
+ wrapper.addClass('disabled');
+ var options = $('<ul id="select-options-' + uniqueID +'" class="dropdown-content select-dropdown ' + (multiple ? 'multiple-select-dropdown' : '') + '"></ul>'),
+ selectChildren = $select.children('option, optgroup'),
+ valuesSelected = [],
+ optionsHover = false;
+
+ var label = $select.find('option:selected').html() || $select.find('option:first').html() || "";
+
+ // Function that renders and appends the option taking into
+ // account type and possible image icon.
+ var appendOptionWithIcon = function(select, option, type) {
+ // Add disabled attr if disabled
+ var disabledClass = (option.is(':disabled')) ? 'disabled ' : '';
+ var optgroupClass = (type === 'optgroup-option') ? 'optgroup-option ' : '';
+ var multipleCheckbox = multiple ? '<input type="checkbox"' + disabledClass + '/><label></label>' : '';
+
+ // add icons
+ var icon_url = option.data('icon');
+ var classes = option.attr('class');
+ if (!!icon_url) {
+ var classString = '';
+ if (!!classes) classString = ' class="' + classes + '"';
+
+ // Check for multiple type.
+ options.append($('<li class="' + disabledClass + optgroupClass + '"><img alt="" src="' + icon_url + '"' + classString + '><span>' + multipleCheckbox + option.html() + '</span></li>'));
+ return true;
+ }
+
+ // Check for multiple type.
+ options.append($('<li class="' + disabledClass + optgroupClass + '"><span>' + multipleCheckbox + option.html() + '</span></li>'));
+ };
+
+ /* Create dropdown structure. */
+ if (selectChildren.length) {
+ selectChildren.each(function() {
+ if ($(this).is('option')) {
+ // Direct descendant option.
+ if (multiple) {
+ appendOptionWithIcon($select, $(this), 'multiple');
+
+ } else {
+ appendOptionWithIcon($select, $(this));
+ }
+ } else if ($(this).is('optgroup')) {
+ // Optgroup.
+ var selectOptions = $(this).children('option');
+ options.append($('<li class="optgroup"><span>' + $(this).attr('label') + '</span></li>'));
+
+ selectOptions.each(function() {
+ appendOptionWithIcon($select, $(this), 'optgroup-option');
+ });
+ }
+ });
+ }
+
+ options.find('li:not(.optgroup)').each(function (i) {
+ $(this).click(function (e) {
+ // Check if option element is disabled
+ if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) {
+ var selected = true;
+
+ if (multiple) {
+ $('input[type="checkbox"]', this).prop('checked', function(i, v) { return !v; });
+ selected = toggleEntryFromArray(valuesSelected, i, $select);
+ $newSelect.trigger('focus');
+ } else {
+ options.find('li').removeClass('active');
+ $(this).toggleClass('active');
+ $newSelect.val($(this).text());
+ }
+
+ activateOption(options, $(this));
+ $select.find('option').eq(i).prop('selected', selected);
+ // Trigger onchange() event
+ $select.trigger('change');
+ if (typeof callback !== 'undefined') callback();
+ }
+
+ e.stopPropagation();
+ });
+ });
+
+ // Wrap Elements
+ $select.wrap(wrapper);
+ // Add Select Display Element
+ var dropdownIcon = $('<span class="caret">▼</span>');
+
+ // escape double quotes
+ var sanitizedLabelHtml = label.replace(/"/g, '"');
+
+ var $newSelect = $('<input type="text" class="select-dropdown" readonly="true" ' + (($select.is(':disabled')) ? 'disabled' : '') + ' data-activates="select-options-' + uniqueID +'" value="'+ sanitizedLabelHtml +'"/>');
+ $select.before($newSelect);
+ $newSelect.before(dropdownIcon);
+
+ $newSelect.after(options);
+ // Check if section element is disabled
+ if (!$select.is(':disabled')) {
+ $newSelect.dropdown({'hover': false});
+ }
+
+ // Copy tabindex
+ if ($select.attr('tabindex')) {
+ $($newSelect[0]).attr('tabindex', $select.attr('tabindex'));
+ }
+
+ $select.addClass('initialized');
+
+ $newSelect.on({
+ 'focus': function (){
+ if ($('ul.select-dropdown').not(options[0]).is(':visible')) {
+ $('input.select-dropdown').trigger('close');
+ $(window).off('click.select');
+ }
+ if (!options.is(':visible')) {
+ $(this).trigger('open', ['focus']);
+ var label = $(this).val();
+ if (multiple && label.indexOf(',') >= 0) {
+ label = label.split(',')[0];
+ }
+
+ var selectedOption = options.find('li').filter(function() {
+ return $(this).text().toLowerCase() === label.toLowerCase();
+ })[0];
+ activateOption(options, selectedOption, true);
+
+ $(window).off('click.select').on('click.select', function () {
+ multiple && (optionsHover || $newSelect.trigger('close'));
+ $(window).off('click.select');
+ });
+ }
+ },
+ 'click': function (e){
+ e.stopPropagation();
+ }
+ });
+
+ $newSelect.on('blur', function() {
+ if (!multiple) {
+ $(this).trigger('close');
+ $(window).off('click.select');
+ }
+ options.find('li.selected').removeClass('selected');
+ });
+
+ options.hover(function() {
+ optionsHover = true;
+ }, function () {
+ optionsHover = false;
+ });
+
+ // Add initial multiple selections.
+ if (multiple) {
+ $select.find("option:selected:not(:disabled)").each(function () {
+ var index = this.index;
+
+ toggleEntryFromArray(valuesSelected, index, $select);
+ options.find("li:not(.optgroup)").eq(index).find(":checkbox").prop("checked", true);
+ });
+ }
+
+ /**
+ * Make option as selected and scroll to selected position
+ * @param {jQuery} collection Select options jQuery element
+ * @param {Element} newOption element of the new option
+ * @param {Boolean} firstActivation If on first activation of select
+ */
+ var activateOption = function(collection, newOption, firstActivation) {
+ if (newOption) {
+ collection.find('li.selected').removeClass('selected');
+ var option = $(newOption);
+ option.addClass('selected');
+ if (!multiple || !!firstActivation) {
+ options.scrollTo(option);
+ }
+ }
+ };
+
+ // Allow user to search by typing
+ // this array is cleared after 1 second
+ var filterQuery = [],
+ onKeyDown = function(e){
+ // TAB - switch to another input
+ if(e.which == 9){
+ $newSelect.trigger('close');
+ return;
+ }
+
+ // ARROW DOWN WHEN SELECT IS CLOSED - open select options
+ if(e.which == 40 && !options.is(':visible')){
+ $newSelect.trigger('open');
+ return;
+ }
+
+ // ENTER WHEN SELECT IS CLOSED - submit form
+ if(e.which == 13 && !options.is(':visible')){
+ return;
+ }
+
+ e.preventDefault();
+
+ // CASE WHEN USER TYPE LETTERS
+ var letter = String.fromCharCode(e.which).toLowerCase(),
+ nonLetters = [9,13,27,38,40];
+ if (letter && (nonLetters.indexOf(e.which) === -1)) {
+ filterQuery.push(letter);
+
+ var string = filterQuery.join(''),
+ newOption = options.find('li').filter(function() {
+ return $(this).text().toLowerCase().indexOf(string) === 0;
+ })[0];
+
+ if (newOption) {
+ activateOption(options, newOption);
+ }
+ }
+
+ // ENTER - select option and close when select options are opened
+ if (e.which == 13) {
+ var activeOption = options.find('li.selected:not(.disabled)')[0];
+ if(activeOption){
+ $(activeOption).trigger('click');
+ if (!multiple) {
+ $newSelect.trigger('close');
+ }
+ }
+ }
+
+ // ARROW DOWN - move to next not disabled option
+ if (e.which == 40) {
+ if (options.find('li.selected').length) {
+ newOption = options.find('li.selected').next('li:not(.disabled)')[0];
+ } else {
+ newOption = options.find('li:not(.disabled)')[0];
+ }
+ activateOption(options, newOption);
+ }
+
+ // ESC - close options
+ if (e.which == 27) {
+ $newSelect.trigger('close');
+ }
+
+ // ARROW UP - move to previous not disabled option
+ if (e.which == 38) {
+ newOption = options.find('li.selected').prev('li:not(.disabled)')[0];
+ if(newOption)
+ activateOption(options, newOption);
+ }
+
+ // Automaticaly clean filter query so user can search again by starting letters
+ setTimeout(function(){ filterQuery = []; }, 1000);
+ };
+
+ $newSelect.on('keydown', onKeyDown);
+ });
+
+ function toggleEntryFromArray(entriesArray, entryIndex, select) {
+ var index = entriesArray.indexOf(entryIndex),
+ notAdded = index === -1;
+
+ if (notAdded) {
+ entriesArray.push(entryIndex);
+ } else {
+ entriesArray.splice(index, 1);
+ }
+
+ select.siblings('ul.dropdown-content').find('li:not(.optgroup)').eq(entryIndex).toggleClass('active');
+
+ // use notAdded instead of true (to detect if the option is selected or not)
+ select.find('option').eq(entryIndex).prop('selected', notAdded);
+ setValueToInput(entriesArray, select);
+
+ return notAdded;
+ }
+
+ function setValueToInput(entriesArray, select) {
+ var value = '';
+
+ for (var i = 0, count = entriesArray.length; i < count; i++) {
+ var text = select.find('option').eq(entriesArray[i]).text();
+
+ i === 0 ? value += text : value += ', ' + text;
+ }
+
+ if (value === '') {
+ value = select.find('option:disabled').eq(0).text();
+ }
+
+ select.siblings('input.select-dropdown').val(value);
+ }
+ };
+
+}( jQuery ));
diff --git a/app/dispatch/static/materialize/js/global.js b/app/dispatch/static/materialize/js/global.js new file mode 100644 index 0000000..db5437b --- /dev/null +++ b/app/dispatch/static/materialize/js/global.js @@ -0,0 +1,177 @@ +// Required for Meteor package, the use of window prevents export by Meteor
+(function(window){
+ if(window.Package){
+ Materialize = {};
+ } else {
+ window.Materialize = {};
+ }
+})(window);
+
+if (typeof exports !== 'undefined' && !exports.nodeType) {
+ if (typeof module !== 'undefined' && !module.nodeType && module.exports) {
+ exports = module.exports = Materialize;
+ }
+ exports.default = Materialize;
+}
+
+/*
+ * raf.js
+ * https://github.com/ngryman/raf.js
+ *
+ * original requestAnimationFrame polyfill by Erik Möller
+ * inspired from paul_irish gist and post
+ *
+ * Copyright (c) 2013 ngryman
+ * Licensed under the MIT license.
+ */
+(function(window) {
+ var lastTime = 0,
+ vendors = ['webkit', 'moz'],
+ requestAnimationFrame = window.requestAnimationFrame,
+ cancelAnimationFrame = window.cancelAnimationFrame,
+ i = vendors.length;
+
+ // try to un-prefix existing raf
+ while (--i >= 0 && !requestAnimationFrame) {
+ requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame'];
+ cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame'];
+ }
+
+ // polyfill with setTimeout fallback
+ // heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945
+ if (!requestAnimationFrame || !cancelAnimationFrame) {
+ requestAnimationFrame = function(callback) {
+ var now = +Date.now(),
+ nextTime = Math.max(lastTime + 16, now);
+ return setTimeout(function() {
+ callback(lastTime = nextTime);
+ }, nextTime - now);
+ };
+
+ cancelAnimationFrame = clearTimeout;
+ }
+
+ // export to window
+ window.requestAnimationFrame = requestAnimationFrame;
+ window.cancelAnimationFrame = cancelAnimationFrame;
+}(window));
+
+/**
+ * Generate approximated selector string for a jQuery object
+ * @param {jQuery} obj jQuery object to be parsed
+ * @returns {string}
+ */
+Materialize.objectSelectorString = function(obj) {
+ var tagStr = obj.prop('tagName') || '';
+ var idStr = obj.attr('id') || '';
+ var classStr = obj.attr('class') || '';
+ return (tagStr + idStr + classStr).replace(/\s/g,'');
+};
+
+
+// Unique Random ID
+Materialize.guid = (function() {
+ function s4() {
+ return Math.floor((1 + Math.random()) * 0x10000)
+ .toString(16)
+ .substring(1);
+ }
+ return function() {
+ return s4() + s4() + '-' + s4() + '-' + s4() + '-' +
+ s4() + '-' + s4() + s4() + s4();
+ };
+})();
+
+/**
+ * Escapes hash from special characters
+ * @param {string} hash String returned from this.hash
+ * @returns {string}
+ */
+Materialize.escapeHash = function(hash) {
+ return hash.replace( /(:|\.|\[|\]|,|=)/g, "\\$1" );
+};
+
+Materialize.elementOrParentIsFixed = function(element) {
+ var $element = $(element);
+ var $checkElements = $element.add($element.parents());
+ var isFixed = false;
+ $checkElements.each(function(){
+ if ($(this).css("position") === "fixed") {
+ isFixed = true;
+ return false;
+ }
+ });
+ return isFixed;
+};
+
+
+/**
+ * Get time in ms
+ * @license https://raw.github.com/jashkenas/underscore/master/LICENSE
+ * @type {function}
+ * @return {number}
+ */
+var getTime = (Date.now || function () {
+ return new Date().getTime();
+});
+
+
+/**
+ * Returns a function, that, when invoked, will only be triggered at most once
+ * during a given window of time. Normally, the throttled function will run
+ * as much as it can, without ever going more than once per `wait` duration;
+ * but if you'd like to disable the execution on the leading edge, pass
+ * `{leading: false}`. To disable execution on the trailing edge, ditto.
+ * @license https://raw.github.com/jashkenas/underscore/master/LICENSE
+ * @param {function} func
+ * @param {number} wait
+ * @param {Object=} options
+ * @returns {Function}
+ */
+Materialize.throttle = function(func, wait, options) {
+ var context, args, result;
+ var timeout = null;
+ var previous = 0;
+ options || (options = {});
+ var later = function () {
+ previous = options.leading === false ? 0 : getTime();
+ timeout = null;
+ result = func.apply(context, args);
+ context = args = null;
+ };
+ return function () {
+ var now = getTime();
+ if (!previous && options.leading === false) previous = now;
+ var remaining = wait - (now - previous);
+ context = this;
+ args = arguments;
+ if (remaining <= 0) {
+ clearTimeout(timeout);
+ timeout = null;
+ previous = now;
+ result = func.apply(context, args);
+ context = args = null;
+ } else if (!timeout && options.trailing !== false) {
+ timeout = setTimeout(later, remaining);
+ }
+ return result;
+ };
+};
+
+
+// Velocity has conflicts when loaded with jQuery, this will check for it
+// First, check if in noConflict mode
+var Vel;
+if (jQuery) {
+ Vel = jQuery.Velocity;
+} else if ($) {
+ Vel = $.Velocity;
+} else {
+ Vel = Velocity;
+}
+
+if (Vel) {
+ Materialize.Vel = Vel;
+} else {
+ Materialize.Vel = Velocity;
+}
diff --git a/app/dispatch/static/materialize/js/hammer.min.js b/app/dispatch/static/materialize/js/hammer.min.js new file mode 100644 index 0000000..6c232c8 --- /dev/null +++ b/app/dispatch/static/materialize/js/hammer.min.js @@ -0,0 +1 @@ +!function(a,b,c,d){"use strict";function k(a,b,c){return setTimeout(q(a,c),b)}function l(a,b,c){return Array.isArray(a)?(m(a,c[b],c),!0):!1}function m(a,b,c){var e;if(a)if(a.forEach)a.forEach(b,c);else if(a.length!==d)for(e=0;e<a.length;)b.call(c,a[e],e,a),e++;else for(e in a)a.hasOwnProperty(e)&&b.call(c,a[e],e,a)}function n(a,b,c){for(var e=Object.keys(b),f=0;f<e.length;)(!c||c&&a[e[f]]===d)&&(a[e[f]]=b[e[f]]),f++;return a}function o(a,b){return n(a,b,!0)}function p(a,b,c){var e,d=b.prototype;e=a.prototype=Object.create(d),e.constructor=a,e._super=d,c&&n(e,c)}function q(a,b){return function(){return a.apply(b,arguments)}}function r(a,b){return typeof a==g?a.apply(b?b[0]||d:d,b):a}function s(a,b){return a===d?b:a}function t(a,b,c){m(x(b),function(b){a.addEventListener(b,c,!1)})}function u(a,b,c){m(x(b),function(b){a.removeEventListener(b,c,!1)})}function v(a,b){for(;a;){if(a==b)return!0;a=a.parentNode}return!1}function w(a,b){return a.indexOf(b)>-1}function x(a){return a.trim().split(/\s+/g)}function y(a,b,c){if(a.indexOf&&!c)return a.indexOf(b);for(var d=0;d<a.length;){if(c&&a[d][c]==b||!c&&a[d]===b)return d;d++}return-1}function z(a){return Array.prototype.slice.call(a,0)}function A(a,b,c){for(var d=[],e=[],f=0;f<a.length;){var g=b?a[f][b]:a[f];y(e,g)<0&&d.push(a[f]),e[f]=g,f++}return c&&(d=b?d.sort(function(a,c){return a[b]>c[b]}):d.sort()),d}function B(a,b){for(var c,f,g=b[0].toUpperCase()+b.slice(1),h=0;h<e.length;){if(c=e[h],f=c?c+g:b,f in a)return f;h++}return d}function D(){return C++}function E(a){var b=a.ownerDocument;return b.defaultView||b.parentWindow}function ab(a,b){var c=this;this.manager=a,this.callback=b,this.element=a.element,this.target=a.options.inputTarget,this.domHandler=function(b){r(a.options.enable,[a])&&c.handler(b)},this.init()}function bb(a){var b,c=a.options.inputClass;return b=c?c:H?wb:I?Eb:G?Gb:rb,new b(a,cb)}function cb(a,b,c){var d=c.pointers.length,e=c.changedPointers.length,f=b&O&&0===d-e,g=b&(Q|R)&&0===d-e;c.isFirst=!!f,c.isFinal=!!g,f&&(a.session={}),c.eventType=b,db(a,c),a.emit("hammer.input",c),a.recognize(c),a.session.prevInput=c}function db(a,b){var c=a.session,d=b.pointers,e=d.length;c.firstInput||(c.firstInput=gb(b)),e>1&&!c.firstMultiple?c.firstMultiple=gb(b):1===e&&(c.firstMultiple=!1);var f=c.firstInput,g=c.firstMultiple,h=g?g.center:f.center,i=b.center=hb(d);b.timeStamp=j(),b.deltaTime=b.timeStamp-f.timeStamp,b.angle=lb(h,i),b.distance=kb(h,i),eb(c,b),b.offsetDirection=jb(b.deltaX,b.deltaY),b.scale=g?nb(g.pointers,d):1,b.rotation=g?mb(g.pointers,d):0,fb(c,b);var k=a.element;v(b.srcEvent.target,k)&&(k=b.srcEvent.target),b.target=k}function eb(a,b){var c=b.center,d=a.offsetDelta||{},e=a.prevDelta||{},f=a.prevInput||{};(b.eventType===O||f.eventType===Q)&&(e=a.prevDelta={x:f.deltaX||0,y:f.deltaY||0},d=a.offsetDelta={x:c.x,y:c.y}),b.deltaX=e.x+(c.x-d.x),b.deltaY=e.y+(c.y-d.y)}function fb(a,b){var f,g,h,j,c=a.lastInterval||b,e=b.timeStamp-c.timeStamp;if(b.eventType!=R&&(e>N||c.velocity===d)){var k=c.deltaX-b.deltaX,l=c.deltaY-b.deltaY,m=ib(e,k,l);g=m.x,h=m.y,f=i(m.x)>i(m.y)?m.x:m.y,j=jb(k,l),a.lastInterval=b}else f=c.velocity,g=c.velocityX,h=c.velocityY,j=c.direction;b.velocity=f,b.velocityX=g,b.velocityY=h,b.direction=j}function gb(a){for(var b=[],c=0;c<a.pointers.length;)b[c]={clientX:h(a.pointers[c].clientX),clientY:h(a.pointers[c].clientY)},c++;return{timeStamp:j(),pointers:b,center:hb(b),deltaX:a.deltaX,deltaY:a.deltaY}}function hb(a){var b=a.length;if(1===b)return{x:h(a[0].clientX),y:h(a[0].clientY)};for(var c=0,d=0,e=0;b>e;)c+=a[e].clientX,d+=a[e].clientY,e++;return{x:h(c/b),y:h(d/b)}}function ib(a,b,c){return{x:b/a||0,y:c/a||0}}function jb(a,b){return a===b?S:i(a)>=i(b)?a>0?T:U:b>0?V:W}function kb(a,b,c){c||(c=$);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return Math.sqrt(d*d+e*e)}function lb(a,b,c){c||(c=$);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return 180*Math.atan2(e,d)/Math.PI}function mb(a,b){return lb(b[1],b[0],_)-lb(a[1],a[0],_)}function nb(a,b){return kb(b[0],b[1],_)/kb(a[0],a[1],_)}function rb(){this.evEl=pb,this.evWin=qb,this.allow=!0,this.pressed=!1,ab.apply(this,arguments)}function wb(){this.evEl=ub,this.evWin=vb,ab.apply(this,arguments),this.store=this.manager.session.pointerEvents=[]}function Ab(){this.evTarget=yb,this.evWin=zb,this.started=!1,ab.apply(this,arguments)}function Bb(a,b){var c=z(a.touches),d=z(a.changedTouches);return b&(Q|R)&&(c=A(c.concat(d),"identifier",!0)),[c,d]}function Eb(){this.evTarget=Db,this.targetIds={},ab.apply(this,arguments)}function Fb(a,b){var c=z(a.touches),d=this.targetIds;if(b&(O|P)&&1===c.length)return d[c[0].identifier]=!0,[c,c];var e,f,g=z(a.changedTouches),h=[],i=this.target;if(f=c.filter(function(a){return v(a.target,i)}),b===O)for(e=0;e<f.length;)d[f[e].identifier]=!0,e++;for(e=0;e<g.length;)d[g[e].identifier]&&h.push(g[e]),b&(Q|R)&&delete d[g[e].identifier],e++;return h.length?[A(f.concat(h),"identifier",!0),h]:void 0}function Gb(){ab.apply(this,arguments);var a=q(this.handler,this);this.touch=new Eb(this.manager,a),this.mouse=new rb(this.manager,a)}function Pb(a,b){this.manager=a,this.set(b)}function Qb(a){if(w(a,Mb))return Mb;var b=w(a,Nb),c=w(a,Ob);return b&&c?Nb+" "+Ob:b||c?b?Nb:Ob:w(a,Lb)?Lb:Kb}function Yb(a){this.id=D(),this.manager=null,this.options=o(a||{},this.defaults),this.options.enable=s(this.options.enable,!0),this.state=Rb,this.simultaneous={},this.requireFail=[]}function Zb(a){return a&Wb?"cancel":a&Ub?"end":a&Tb?"move":a&Sb?"start":""}function $b(a){return a==W?"down":a==V?"up":a==T?"left":a==U?"right":""}function _b(a,b){var c=b.manager;return c?c.get(a):a}function ac(){Yb.apply(this,arguments)}function bc(){ac.apply(this,arguments),this.pX=null,this.pY=null}function cc(){ac.apply(this,arguments)}function dc(){Yb.apply(this,arguments),this._timer=null,this._input=null}function ec(){ac.apply(this,arguments)}function fc(){ac.apply(this,arguments)}function gc(){Yb.apply(this,arguments),this.pTime=!1,this.pCenter=!1,this._timer=null,this._input=null,this.count=0}function hc(a,b){return b=b||{},b.recognizers=s(b.recognizers,hc.defaults.preset),new kc(a,b)}function kc(a,b){b=b||{},this.options=o(b,hc.defaults),this.options.inputTarget=this.options.inputTarget||a,this.handlers={},this.session={},this.recognizers=[],this.element=a,this.input=bb(this),this.touchAction=new Pb(this,this.options.touchAction),lc(this,!0),m(b.recognizers,function(a){var b=this.add(new a[0](a[1]));a[2]&&b.recognizeWith(a[2]),a[3]&&b.requireFailure(a[3])},this)}function lc(a,b){var c=a.element;m(a.options.cssProps,function(a,d){c.style[B(c.style,d)]=b?a:""})}function mc(a,c){var d=b.createEvent("Event");d.initEvent(a,!0,!0),d.gesture=c,c.target.dispatchEvent(d)}var e=["","webkit","moz","MS","ms","o"],f=b.createElement("div"),g="function",h=Math.round,i=Math.abs,j=Date.now,C=1,F=/mobile|tablet|ip(ad|hone|od)|android/i,G="ontouchstart"in a,H=B(a,"PointerEvent")!==d,I=G&&F.test(navigator.userAgent),J="touch",K="pen",L="mouse",M="kinect",N=25,O=1,P=2,Q=4,R=8,S=1,T=2,U=4,V=8,W=16,X=T|U,Y=V|W,Z=X|Y,$=["x","y"],_=["clientX","clientY"];ab.prototype={handler:function(){},init:function(){this.evEl&&t(this.element,this.evEl,this.domHandler),this.evTarget&&t(this.target,this.evTarget,this.domHandler),this.evWin&&t(E(this.element),this.evWin,this.domHandler)},destroy:function(){this.evEl&&u(this.element,this.evEl,this.domHandler),this.evTarget&&u(this.target,this.evTarget,this.domHandler),this.evWin&&u(E(this.element),this.evWin,this.domHandler)}};var ob={mousedown:O,mousemove:P,mouseup:Q},pb="mousedown",qb="mousemove mouseup";p(rb,ab,{handler:function(a){var b=ob[a.type];b&O&&0===a.button&&(this.pressed=!0),b&P&&1!==a.which&&(b=Q),this.pressed&&this.allow&&(b&Q&&(this.pressed=!1),this.callback(this.manager,b,{pointers:[a],changedPointers:[a],pointerType:L,srcEvent:a}))}});var sb={pointerdown:O,pointermove:P,pointerup:Q,pointercancel:R,pointerout:R},tb={2:J,3:K,4:L,5:M},ub="pointerdown",vb="pointermove pointerup pointercancel";a.MSPointerEvent&&(ub="MSPointerDown",vb="MSPointerMove MSPointerUp MSPointerCancel"),p(wb,ab,{handler:function(a){var b=this.store,c=!1,d=a.type.toLowerCase().replace("ms",""),e=sb[d],f=tb[a.pointerType]||a.pointerType,g=f==J,h=y(b,a.pointerId,"pointerId");e&O&&(0===a.button||g)?0>h&&(b.push(a),h=b.length-1):e&(Q|R)&&(c=!0),0>h||(b[h]=a,this.callback(this.manager,e,{pointers:b,changedPointers:[a],pointerType:f,srcEvent:a}),c&&b.splice(h,1))}});var xb={touchstart:O,touchmove:P,touchend:Q,touchcancel:R},yb="touchstart",zb="touchstart touchmove touchend touchcancel";p(Ab,ab,{handler:function(a){var b=xb[a.type];if(b===O&&(this.started=!0),this.started){var c=Bb.call(this,a,b);b&(Q|R)&&0===c[0].length-c[1].length&&(this.started=!1),this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:J,srcEvent:a})}}});var Cb={touchstart:O,touchmove:P,touchend:Q,touchcancel:R},Db="touchstart touchmove touchend touchcancel";p(Eb,ab,{handler:function(a){var b=Cb[a.type],c=Fb.call(this,a,b);c&&this.callback(this.manager,b,{pointers:c[0],changedPointers:c[1],pointerType:J,srcEvent:a})}}),p(Gb,ab,{handler:function(a,b,c){var d=c.pointerType==J,e=c.pointerType==L;if(d)this.mouse.allow=!1;else if(e&&!this.mouse.allow)return;b&(Q|R)&&(this.mouse.allow=!0),this.callback(a,b,c)},destroy:function(){this.touch.destroy(),this.mouse.destroy()}});var Hb=B(f.style,"touchAction"),Ib=Hb!==d,Jb="compute",Kb="auto",Lb="manipulation",Mb="none",Nb="pan-x",Ob="pan-y";Pb.prototype={set:function(a){a==Jb&&(a=this.compute()),Ib&&(this.manager.element.style[Hb]=a),this.actions=a.toLowerCase().trim()},update:function(){this.set(this.manager.options.touchAction)},compute:function(){var a=[];return m(this.manager.recognizers,function(b){r(b.options.enable,[b])&&(a=a.concat(b.getTouchAction()))}),Qb(a.join(" "))},preventDefaults:function(a){if(!Ib){var b=a.srcEvent,c=a.offsetDirection;if(this.manager.session.prevented)return b.preventDefault(),void 0;var d=this.actions,e=w(d,Mb),f=w(d,Ob),g=w(d,Nb);return e||f&&c&X||g&&c&Y?this.preventSrc(b):void 0}},preventSrc:function(a){this.manager.session.prevented=!0,a.preventDefault()}};var Rb=1,Sb=2,Tb=4,Ub=8,Vb=Ub,Wb=16,Xb=32;Yb.prototype={defaults:{},set:function(a){return n(this.options,a),this.manager&&this.manager.touchAction.update(),this},recognizeWith:function(a){if(l(a,"recognizeWith",this))return this;var b=this.simultaneous;return a=_b(a,this),b[a.id]||(b[a.id]=a,a.recognizeWith(this)),this},dropRecognizeWith:function(a){return l(a,"dropRecognizeWith",this)?this:(a=_b(a,this),delete this.simultaneous[a.id],this)},requireFailure:function(a){if(l(a,"requireFailure",this))return this;var b=this.requireFail;return a=_b(a,this),-1===y(b,a)&&(b.push(a),a.requireFailure(this)),this},dropRequireFailure:function(a){if(l(a,"dropRequireFailure",this))return this;a=_b(a,this);var b=y(this.requireFail,a);return b>-1&&this.requireFail.splice(b,1),this},hasRequireFailures:function(){return this.requireFail.length>0},canRecognizeWith:function(a){return!!this.simultaneous[a.id]},emit:function(a){function d(d){b.manager.emit(b.options.event+(d?Zb(c):""),a)}var b=this,c=this.state;Ub>c&&d(!0),d(),c>=Ub&&d(!0)},tryEmit:function(a){return this.canEmit()?this.emit(a):(this.state=Xb,void 0)},canEmit:function(){for(var a=0;a<this.requireFail.length;){if(!(this.requireFail[a].state&(Xb|Rb)))return!1;a++}return!0},recognize:function(a){var b=n({},a);return r(this.options.enable,[this,b])?(this.state&(Vb|Wb|Xb)&&(this.state=Rb),this.state=this.process(b),this.state&(Sb|Tb|Ub|Wb)&&this.tryEmit(b),void 0):(this.reset(),this.state=Xb,void 0)},process:function(){},getTouchAction:function(){},reset:function(){}},p(ac,Yb,{defaults:{pointers:1},attrTest:function(a){var b=this.options.pointers;return 0===b||a.pointers.length===b},process:function(a){var b=this.state,c=a.eventType,d=b&(Sb|Tb),e=this.attrTest(a);return d&&(c&R||!e)?b|Wb:d||e?c&Q?b|Ub:b&Sb?b|Tb:Sb:Xb}}),p(bc,ac,{defaults:{event:"pan",threshold:10,pointers:1,direction:Z},getTouchAction:function(){var a=this.options.direction,b=[];return a&X&&b.push(Ob),a&Y&&b.push(Nb),b},directionTest:function(a){var b=this.options,c=!0,d=a.distance,e=a.direction,f=a.deltaX,g=a.deltaY;return e&b.direction||(b.direction&X?(e=0===f?S:0>f?T:U,c=f!=this.pX,d=Math.abs(a.deltaX)):(e=0===g?S:0>g?V:W,c=g!=this.pY,d=Math.abs(a.deltaY))),a.direction=e,c&&d>b.threshold&&e&b.direction},attrTest:function(a){return ac.prototype.attrTest.call(this,a)&&(this.state&Sb||!(this.state&Sb)&&this.directionTest(a))},emit:function(a){this.pX=a.deltaX,this.pY=a.deltaY;var b=$b(a.direction);b&&this.manager.emit(this.options.event+b,a),this._super.emit.call(this,a)}}),p(cc,ac,{defaults:{event:"pinch",threshold:0,pointers:2},getTouchAction:function(){return[Mb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.scale-1)>this.options.threshold||this.state&Sb)},emit:function(a){if(this._super.emit.call(this,a),1!==a.scale){var b=a.scale<1?"in":"out";this.manager.emit(this.options.event+b,a)}}}),p(dc,Yb,{defaults:{event:"press",pointers:1,time:500,threshold:5},getTouchAction:function(){return[Kb]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance<b.threshold,e=a.deltaTime>b.time;if(this._input=a,!d||!c||a.eventType&(Q|R)&&!e)this.reset();else if(a.eventType&O)this.reset(),this._timer=k(function(){this.state=Vb,this.tryEmit()},b.time,this);else if(a.eventType&Q)return Vb;return Xb},reset:function(){clearTimeout(this._timer)},emit:function(a){this.state===Vb&&(a&&a.eventType&Q?this.manager.emit(this.options.event+"up",a):(this._input.timeStamp=j(),this.manager.emit(this.options.event,this._input)))}}),p(ec,ac,{defaults:{event:"rotate",threshold:0,pointers:2},getTouchAction:function(){return[Mb]},attrTest:function(a){return this._super.attrTest.call(this,a)&&(Math.abs(a.rotation)>this.options.threshold||this.state&Sb)}}),p(fc,ac,{defaults:{event:"swipe",threshold:10,velocity:.65,direction:X|Y,pointers:1},getTouchAction:function(){return bc.prototype.getTouchAction.call(this)},attrTest:function(a){var c,b=this.options.direction;return b&(X|Y)?c=a.velocity:b&X?c=a.velocityX:b&Y&&(c=a.velocityY),this._super.attrTest.call(this,a)&&b&a.direction&&a.distance>this.options.threshold&&i(c)>this.options.velocity&&a.eventType&Q},emit:function(a){var b=$b(a.direction);b&&this.manager.emit(this.options.event+b,a),this.manager.emit(this.options.event,a)}}),p(gc,Yb,{defaults:{event:"tap",pointers:1,taps:1,interval:300,time:250,threshold:2,posThreshold:10},getTouchAction:function(){return[Lb]},process:function(a){var b=this.options,c=a.pointers.length===b.pointers,d=a.distance<b.threshold,e=a.deltaTime<b.time;if(this.reset(),a.eventType&O&&0===this.count)return this.failTimeout();if(d&&e&&c){if(a.eventType!=Q)return this.failTimeout();var f=this.pTime?a.timeStamp-this.pTime<b.interval:!0,g=!this.pCenter||kb(this.pCenter,a.center)<b.posThreshold;this.pTime=a.timeStamp,this.pCenter=a.center,g&&f?this.count+=1:this.count=1,this._input=a;var h=this.count%b.taps;if(0===h)return this.hasRequireFailures()?(this._timer=k(function(){this.state=Vb,this.tryEmit()},b.interval,this),Sb):Vb}return Xb},failTimeout:function(){return this._timer=k(function(){this.state=Xb},this.options.interval,this),Xb},reset:function(){clearTimeout(this._timer)},emit:function(){this.state==Vb&&(this._input.tapCount=this.count,this.manager.emit(this.options.event,this._input))}}),hc.VERSION="2.0.4",hc.defaults={domEvents:!1,touchAction:Jb,enable:!0,inputTarget:null,inputClass:null,preset:[[ec,{enable:!1}],[cc,{enable:!1},["rotate"]],[fc,{direction:X}],[bc,{direction:X},["swipe"]],[gc],[gc,{event:"doubletap",taps:2},["tap"]],[dc]],cssProps:{userSelect:"default",touchSelect:"none",touchCallout:"none",contentZooming:"none",userDrag:"none",tapHighlightColor:"rgba(0,0,0,0)"}};var ic=1,jc=2;kc.prototype={set:function(a){return n(this.options,a),a.touchAction&&this.touchAction.update(),a.inputTarget&&(this.input.destroy(),this.input.target=a.inputTarget,this.input.init()),this},stop:function(a){this.session.stopped=a?jc:ic},recognize:function(a){var b=this.session;if(!b.stopped){this.touchAction.preventDefaults(a);var c,d=this.recognizers,e=b.curRecognizer;(!e||e&&e.state&Vb)&&(e=b.curRecognizer=null);for(var f=0;f<d.length;)c=d[f],b.stopped===jc||e&&c!=e&&!c.canRecognizeWith(e)?c.reset():c.recognize(a),!e&&c.state&(Sb|Tb|Ub)&&(e=b.curRecognizer=c),f++}},get:function(a){if(a instanceof Yb)return a;for(var b=this.recognizers,c=0;c<b.length;c++)if(b[c].options.event==a)return b[c];return null},add:function(a){if(l(a,"add",this))return this;var b=this.get(a.options.event);return b&&this.remove(b),this.recognizers.push(a),a.manager=this,this.touchAction.update(),a},remove:function(a){if(l(a,"remove",this))return this;var b=this.recognizers;return a=this.get(a),b.splice(y(b,a),1),this.touchAction.update(),this},on:function(a,b){var c=this.handlers;return m(x(a),function(a){c[a]=c[a]||[],c[a].push(b)}),this},off:function(a,b){var c=this.handlers;return m(x(a),function(a){b?c[a].splice(y(c[a],b),1):delete c[a]}),this},emit:function(a,b){this.options.domEvents&&mc(a,b);var c=this.handlers[a]&&this.handlers[a].slice();if(c&&c.length){b.type=a,b.preventDefault=function(){b.srcEvent.preventDefault()};for(var d=0;d<c.length;)c[d](b),d++}},destroy:function(){this.element&&lc(this,!1),this.handlers={},this.session={},this.input.destroy(),this.element=null}},n(hc,{INPUT_START:O,INPUT_MOVE:P,INPUT_END:Q,INPUT_CANCEL:R,STATE_POSSIBLE:Rb,STATE_BEGAN:Sb,STATE_CHANGED:Tb,STATE_ENDED:Ub,STATE_RECOGNIZED:Vb,STATE_CANCELLED:Wb,STATE_FAILED:Xb,DIRECTION_NONE:S,DIRECTION_LEFT:T,DIRECTION_RIGHT:U,DIRECTION_UP:V,DIRECTION_DOWN:W,DIRECTION_HORIZONTAL:X,DIRECTION_VERTICAL:Y,DIRECTION_ALL:Z,Manager:kc,Input:ab,TouchAction:Pb,TouchInput:Eb,MouseInput:rb,PointerEventInput:wb,TouchMouseInput:Gb,SingleTouchInput:Ab,Recognizer:Yb,AttrRecognizer:ac,Tap:gc,Pan:bc,Swipe:fc,Pinch:cc,Rotate:ec,Press:dc,on:t,off:u,each:m,merge:o,extend:n,inherit:p,bindFn:q,prefixed:B}),typeof define==g&&define.amd?define(function(){return hc}):"undefined"!=typeof module&&module.exports?module.exports=hc:a[c]=hc}(window,document,"Hammer");
\ No newline at end of file diff --git a/app/dispatch/static/materialize/js/initial.js b/app/dispatch/static/materialize/js/initial.js new file mode 100644 index 0000000..db436f4 --- /dev/null +++ b/app/dispatch/static/materialize/js/initial.js @@ -0,0 +1,10 @@ +// Check for jQuery.
+if (typeof(jQuery) === 'undefined') {
+ // Check if require is a defined function.
+ if (typeof(require) === 'function') {
+ jQuery = $ = require('jquery');
+ // Else use the dollar sign alias.
+ } else {
+ jQuery = $;
+ }
+}
diff --git a/app/dispatch/static/materialize/js/jquery.easing.1.4.js b/app/dispatch/static/materialize/js/jquery.easing.1.4.js new file mode 100644 index 0000000..72952e9 --- /dev/null +++ b/app/dispatch/static/materialize/js/jquery.easing.1.4.js @@ -0,0 +1,166 @@ +/*
+ * jQuery Easing v1.4.0 - http://gsgd.co.uk/sandbox/jquery/easing/
+ * Open source under the BSD License.
+ * Copyright © 2008 George McGinley Smith
+ * All rights reserved.
+ * https://raw.github.com/gdsmith/jquery-easing/master/LICENSE
+*/
+
+(function (factory) {
+ if (typeof define === "function" && define.amd) {
+ define(['jquery'], function ($) {
+ return factory($);
+ });
+ } else if (typeof module === "object" && typeof module.exports === "object") {
+ exports = factory(require('jquery'));
+ } else {
+ factory(jQuery);
+ }
+})(function($){
+
+// Preserve the original jQuery "swing" easing as "jswing"
+$.easing['jswing'] = $.easing['swing'];
+
+var pow = Math.pow,
+ sqrt = Math.sqrt,
+ sin = Math.sin,
+ cos = Math.cos,
+ PI = Math.PI,
+ c1 = 1.70158,
+ c2 = c1 * 1.525,
+ c3 = c1 + 1,
+ c4 = ( 2 * PI ) / 3,
+ c5 = ( 2 * PI ) / 4.5;
+
+// x is the fraction of animation progress, in the range 0..1
+function bounceOut(x) {
+ var n1 = 7.5625,
+ d1 = 2.75;
+ if ( x < 1/d1 ) {
+ return n1*x*x;
+ } else if ( x < 2/d1 ) {
+ return n1*(x-=(1.5/d1))*x + .75;
+ } else if ( x < 2.5/d1 ) {
+ return n1*(x-=(2.25/d1))*x + .9375;
+ } else {
+ return n1*(x-=(2.625/d1))*x + .984375;
+ }
+}
+
+$.extend( $.easing,
+{
+ def: 'easeOutQuad',
+ swing: function (x) {
+ return $.easing[$.easing.def](x);
+ },
+ easeInQuad: function (x) {
+ return x * x;
+ },
+ easeOutQuad: function (x) {
+ return 1 - ( 1 - x ) * ( 1 - x );
+ },
+ easeInOutQuad: function (x) {
+ return x < 0.5 ?
+ 2 * x * x :
+ 1 - pow( -2 * x + 2, 2 ) / 2;
+ },
+ easeInCubic: function (x) {
+ return x * x * x;
+ },
+ easeOutCubic: function (x) {
+ return 1 - pow( 1 - x, 3 );
+ },
+ easeInOutCubic: function (x) {
+ return x < 0.5 ?
+ 4 * x * x * x :
+ 1 - pow( -2 * x + 2, 3 ) / 2;
+ },
+ easeInQuart: function (x) {
+ return x * x * x * x;
+ },
+ easeOutQuart: function (x) {
+ return 1 - pow( 1 - x, 4 );
+ },
+ easeInOutQuart: function (x) {
+ return x < 0.5 ?
+ 8 * x * x * x * x :
+ 1 - pow( -2 * x + 2, 4 ) / 2;
+ },
+ easeInQuint: function (x) {
+ return x * x * x * x * x;
+ },
+ easeOutQuint: function (x) {
+ return 1 - pow( 1 - x, 5 );
+ },
+ easeInOutQuint: function (x) {
+ return x < 0.5 ?
+ 16 * x * x * x * x * x :
+ 1 - pow( -2 * x + 2, 5 ) / 2;
+ },
+ easeInSine: function (x) {
+ return 1 - cos( x * PI/2 );
+ },
+ easeOutSine: function (x) {
+ return sin( x * PI/2 );
+ },
+ easeInOutSine: function (x) {
+ return -( cos( PI * x ) - 1 ) / 2;
+ },
+ easeInExpo: function (x) {
+ return x === 0 ? 0 : pow( 2, 10 * x - 10 );
+ },
+ easeOutExpo: function (x) {
+ return x === 1 ? 1 : 1 - pow( 2, -10 * x );
+ },
+ easeInOutExpo: function (x) {
+ return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ?
+ pow( 2, 20 * x - 10 ) / 2 :
+ ( 2 - pow( 2, -20 * x + 10 ) ) / 2;
+ },
+ easeInCirc: function (x) {
+ return 1 - sqrt( 1 - pow( x, 2 ) );
+ },
+ easeOutCirc: function (x) {
+ return sqrt( 1 - pow( x - 1, 2 ) );
+ },
+ easeInOutCirc: function (x) {
+ return x < 0.5 ?
+ ( 1 - sqrt( 1 - pow( 2 * x, 2 ) ) ) / 2 :
+ ( sqrt( 1 - pow( -2 * x + 2, 2 ) ) + 1 ) / 2;
+ },
+ easeInElastic: function (x) {
+ return x === 0 ? 0 : x === 1 ? 1 :
+ -pow( 2, 10 * x - 10 ) * sin( ( x * 10 - 10.75 ) * c4 );
+ },
+ easeOutElastic: function (x) {
+ return x === 0 ? 0 : x === 1 ? 1 :
+ pow( 2, -10 * x ) * sin( ( x * 10 - 0.75 ) * c4 ) + 1;
+ },
+ easeInOutElastic: function (x) {
+ return x === 0 ? 0 : x === 1 ? 1 : x < 0.5 ?
+ -( pow( 2, 20 * x - 10 ) * sin( ( 20 * x - 11.125 ) * c5 )) / 2 :
+ pow( 2, -20 * x + 10 ) * sin( ( 20 * x - 11.125 ) * c5 ) / 2 + 1;
+ },
+ easeInBack: function (x) {
+ return c3 * x * x * x - c1 * x * x;
+ },
+ easeOutBack: function (x) {
+ return 1 + c3 * pow( x - 1, 3 ) + c1 * pow( x - 1, 2 );
+ },
+ easeInOutBack: function (x) {
+ return x < 0.5 ?
+ ( pow( 2 * x, 2 ) * ( ( c2 + 1 ) * 2 * x - c2 ) ) / 2 :
+ ( pow( 2 * x - 2, 2 ) *( ( c2 + 1 ) * ( x * 2 - 2 ) + c2 ) + 2 ) / 2;
+ },
+ easeInBounce: function (x) {
+ return 1 - bounceOut( 1 - x );
+ },
+ easeOutBounce: bounceOut,
+ easeInOutBounce: function (x) {
+ return x < 0.5 ?
+ ( 1 - bounceOut( 1 - 2 * x ) ) / 2 :
+ ( 1 + bounceOut( 2 * x - 1 ) ) / 2;
+ }
+});
+
+});
\ No newline at end of file diff --git a/app/dispatch/static/materialize/js/jquery.hammer.js b/app/dispatch/static/materialize/js/jquery.hammer.js new file mode 100644 index 0000000..43e4db5 --- /dev/null +++ b/app/dispatch/static/materialize/js/jquery.hammer.js @@ -0,0 +1,33 @@ +(function(factory) {
+ if (typeof define === 'function' && define.amd) {
+ define(['jquery', 'hammerjs'], factory);
+ } else if (typeof exports === 'object') {
+ factory(require('jquery'), require('hammerjs'));
+ } else {
+ factory(jQuery, Hammer);
+ }
+}(function($, Hammer) {
+ function hammerify(el, options) {
+ var $el = $(el);
+ if(!$el.data("hammer")) {
+ $el.data("hammer", new Hammer($el[0], options));
+ }
+ }
+
+ $.fn.hammer = function(options) {
+ return this.each(function() {
+ hammerify(this, options);
+ });
+ };
+
+ // extend the emit method to also trigger jQuery events
+ Hammer.Manager.prototype.emit = (function(originalEmit) {
+ return function(type, data) {
+ originalEmit.call(this, type, data);
+ $(this.element).trigger({
+ type: type,
+ gesture: data
+ });
+ };
+ })(Hammer.Manager.prototype.emit);
+}));
diff --git a/app/dispatch/static/materialize/js/materialbox.js b/app/dispatch/static/materialize/js/materialbox.js new file mode 100644 index 0000000..5523fb1 --- /dev/null +++ b/app/dispatch/static/materialize/js/materialbox.js @@ -0,0 +1,289 @@ +(function ($) {
+
+ $.fn.materialbox = function () {
+
+ return this.each(function() {
+
+ if ($(this).hasClass('initialized')) {
+ return;
+ }
+
+ $(this).addClass('initialized');
+
+ var overlayActive = false;
+ var doneAnimating = true;
+ var inDuration = 275;
+ var outDuration = 200;
+ var origin = $(this);
+ var placeholder = $('<div></div>').addClass('material-placeholder');
+ var originalWidth = 0;
+ var originalHeight = 0;
+ var ancestorsChanged;
+ var ancestor;
+ var originInlineStyles = origin.attr('style');
+ origin.wrap(placeholder);
+
+
+ // Start click handler
+ origin.on('click', function() {
+ var placeholder = origin.parent('.material-placeholder');
+ var windowWidth = window.innerWidth;
+ var windowHeight = window.innerHeight;
+ var originalWidth = origin.width();
+ var originalHeight = origin.height();
+
+
+ // If already modal, return to original
+ if (doneAnimating === false) {
+ returnToOriginal();
+ return false;
+ }
+ else if (overlayActive && doneAnimating===true) {
+ returnToOriginal();
+ return false;
+ }
+
+
+ // Set states
+ doneAnimating = false;
+ origin.addClass('active');
+ overlayActive = true;
+
+ // Set positioning for placeholder
+ placeholder.css({
+ width: placeholder[0].getBoundingClientRect().width,
+ height: placeholder[0].getBoundingClientRect().height,
+ position: 'relative',
+ top: 0,
+ left: 0
+ });
+
+ // Find ancestor with overflow: hidden; and remove it
+ ancestorsChanged = undefined;
+ ancestor = placeholder[0].parentNode;
+ var count = 0;
+ while (ancestor !== null && !$(ancestor).is(document)) {
+ var curr = $(ancestor);
+ if (curr.css('overflow') !== 'visible') {
+ curr.css('overflow', 'visible');
+ if (ancestorsChanged === undefined) {
+ ancestorsChanged = curr;
+ }
+ else {
+ ancestorsChanged = ancestorsChanged.add(curr);
+ }
+ }
+ ancestor = ancestor.parentNode;
+ }
+
+ // Set css on origin
+ origin.css({
+ position: 'absolute',
+ 'z-index': 1000,
+ 'will-change': 'left, top, width, height'
+ })
+ .data('width', originalWidth)
+ .data('height', originalHeight);
+
+ // Add overlay
+ var overlay = $('<div id="materialbox-overlay"></div>')
+ .css({
+ opacity: 0
+ })
+ .click(function(){
+ if (doneAnimating === true)
+ returnToOriginal();
+ });
+
+ // Put before in origin image to preserve z-index layering.
+ origin.before(overlay);
+
+ // Set dimensions if needed
+ var overlayOffset = overlay[0].getBoundingClientRect();
+ overlay.css({
+ width: windowWidth,
+ height: windowHeight,
+ left: -1 * overlayOffset.left,
+ top: -1 * overlayOffset.top
+ })
+
+ // Animate Overlay
+ overlay.velocity({opacity: 1},
+ {duration: inDuration, queue: false, easing: 'easeOutQuad'} );
+
+ // Add and animate caption if it exists
+ if (origin.data('caption') !== "") {
+ var $photo_caption = $('<div class="materialbox-caption"></div>');
+ $photo_caption.text(origin.data('caption'));
+ $('body').append($photo_caption);
+ $photo_caption.css({ "display": "inline" });
+ $photo_caption.velocity({opacity: 1}, {duration: inDuration, queue: false, easing: 'easeOutQuad'});
+ }
+
+ // Resize Image
+ var ratio = 0;
+ var widthPercent = originalWidth / windowWidth;
+ var heightPercent = originalHeight / windowHeight;
+ var newWidth = 0;
+ var newHeight = 0;
+
+ if (widthPercent > heightPercent) {
+ ratio = originalHeight / originalWidth;
+ newWidth = windowWidth * 0.9;
+ newHeight = windowWidth * 0.9 * ratio;
+ }
+ else {
+ ratio = originalWidth / originalHeight;
+ newWidth = (windowHeight * 0.9) * ratio;
+ newHeight = windowHeight * 0.9;
+ }
+
+ // Animate image + set z-index
+ if(origin.hasClass('responsive-img')) {
+ origin.velocity({'max-width': newWidth, 'width': originalWidth}, {duration: 0, queue: false,
+ complete: function(){
+ origin.css({left: 0, top: 0})
+ .velocity(
+ {
+ height: newHeight,
+ width: newWidth,
+ left: $(document).scrollLeft() + windowWidth/2 - origin.parent('.material-placeholder').offset().left - newWidth/2,
+ top: $(document).scrollTop() + windowHeight/2 - origin.parent('.material-placeholder').offset().top - newHeight/ 2
+ },
+ {
+ duration: inDuration,
+ queue: false,
+ easing: 'easeOutQuad',
+ complete: function(){doneAnimating = true;}
+ }
+ );
+ } // End Complete
+ }); // End Velocity
+ }
+ else {
+ origin.css('left', 0)
+ .css('top', 0)
+ .velocity(
+ {
+ height: newHeight,
+ width: newWidth,
+ left: $(document).scrollLeft() + windowWidth/2 - origin.parent('.material-placeholder').offset().left - newWidth/2,
+ top: $(document).scrollTop() + windowHeight/2 - origin.parent('.material-placeholder').offset().top - newHeight/ 2
+ },
+ {
+ duration: inDuration,
+ queue: false,
+ easing: 'easeOutQuad',
+ complete: function(){doneAnimating = true;}
+ }
+ ); // End Velocity
+ }
+
+ // Handle Exit triggers
+ $(window).on('scroll.materialbox', function() {
+ if (overlayActive) {
+ returnToOriginal();
+ }
+ });
+
+ $(window).on('resize.materialbox', function() {
+ if (overlayActive) {
+ returnToOriginal();
+ }
+ });
+
+ $(document).on('keyup.materialbox', function(e) {
+ // ESC key
+ if (e.keyCode === 27 &&
+ doneAnimating === true &&
+ overlayActive) {
+ returnToOriginal();
+ }
+ });
+
+ }); // End click handler
+
+
+ // This function returns the modaled image to the original spot
+ function returnToOriginal() {
+
+ doneAnimating = false;
+
+ var placeholder = origin.parent('.material-placeholder');
+ var windowWidth = window.innerWidth;
+ var windowHeight = window.innerHeight;
+ var originalWidth = origin.data('width');
+ var originalHeight = origin.data('height');
+
+ origin.velocity("stop", true);
+ $('#materialbox-overlay').velocity("stop", true);
+ $('.materialbox-caption').velocity("stop", true);
+
+ // disable exit handlers
+ $(window).off('scroll.materialbox');
+ $(document).off('keyup.materialbox');
+ $(window).off('resize.materialbox');
+
+ $('#materialbox-overlay').velocity({opacity: 0}, {
+ duration: outDuration, // Delay prevents animation overlapping
+ queue: false, easing: 'easeOutQuad',
+ complete: function(){
+ // Remove Overlay
+ overlayActive = false;
+ $(this).remove();
+ }
+ });
+
+ // Resize Image
+ origin.velocity(
+ {
+ width: originalWidth,
+ height: originalHeight,
+ left: 0,
+ top: 0
+ },
+ {
+ duration: outDuration,
+ queue: false, easing: 'easeOutQuad',
+ complete: function() {
+ placeholder.css({
+ height: '',
+ width: '',
+ position: '',
+ top: '',
+ left: ''
+ });
+
+ origin.removeAttr('style');
+ origin.attr('style', originInlineStyles);
+
+ // Remove class
+ origin.removeClass('active');
+ doneAnimating = true;
+
+ // Remove overflow overrides on ancestors
+ if (ancestorsChanged) {
+ ancestorsChanged.css('overflow', '');
+ }
+ }
+ }
+ );
+
+ // Remove Caption + reset css settings on image
+ $('.materialbox-caption').velocity({opacity: 0}, {
+ duration: outDuration, // Delay prevents animation overlapping
+ queue: false, easing: 'easeOutQuad',
+ complete: function(){
+ $(this).remove();
+ }
+ });
+
+ }
+ });
+ };
+
+ $(document).ready(function(){
+ $('.materialboxed').materialbox();
+ });
+
+}( jQuery ));
diff --git a/app/dispatch/static/materialize/js/modal.js b/app/dispatch/static/materialize/js/modal.js new file mode 100644 index 0000000..fb182d7 --- /dev/null +++ b/app/dispatch/static/materialize/js/modal.js @@ -0,0 +1,371 @@ +(function($, Vel) {
+ 'use strict';
+
+ let _defaults = {
+ opacity: 0.5,
+ inDuration: 250,
+ outDuration: 250,
+ ready: undefined,
+ complete: undefined,
+ dismissible: true,
+ startingTop: '4%',
+ endingTop: '10%'
+ };
+
+
+ /**
+ * @class
+ *
+ */
+ class Modal {
+ /**
+ * Construct Modal instance and set up overlay
+ * @constructor
+ * @param {jQuery} $el
+ * @param {Object} options
+ */
+ constructor($el, options) {
+
+ // If exists, destroy and reinitialize
+ if (!!$el[0].M_Modal) {
+ $el[0].M_Modal.destroy();
+ }
+
+ /**
+ * The jQuery element
+ * @type {jQuery}
+ */
+ this.$el = $el;
+
+ /**
+ * Options for the modal
+ * @member Modal#options
+ * @prop {Number} [opacity=0.5] - Opacity of the modal overlay
+ * @prop {Number} [inDuration=250] - Length in ms of enter transition
+ * @prop {Number} [outDuration=250] - Length in ms of exit transition
+ * @prop {Function} ready - Callback function called when modal is finished entering
+ * @prop {Function} complete - Callback function called when modal is finished exiting
+ * @prop {Boolean} [dismissible=true] - Allow modal to be dismissed by keyboard or overlay click
+ * @prop {String} [startingTop='4%'] - startingTop
+ * @prop {String} [endingTop='10%'] - endingTop
+ */
+ this.options = $.extend({}, Modal.defaults, options);
+
+ /**
+ * Describes open/close state of modal
+ * @type {Boolean}
+ */
+ this.isOpen = false;
+
+ this.$el[0].M_Modal = this;
+ this.id = $el.attr('id');
+ this.openingTrigger = undefined;
+ this.$overlay = $('<div class="modal-overlay"></div>');
+
+ Modal._increment++;
+ Modal._count++;
+ this.$overlay[0].style.zIndex = 1000 + Modal._increment * 2;
+ this.$el[0].style.zIndex = 1000 + Modal._increment * 2 + 1;
+ this.setupEventHandlers();
+ }
+
+ static get defaults() {
+ return _defaults;
+ }
+
+ static init($els, options) {
+ let arr = [];
+ $els.each(function() {
+ arr.push(new Modal($(this), options));
+ });
+ return arr;
+ }
+
+ /**
+ * Get Instance
+ */
+ getInstance() {
+ return this;
+ }
+
+ /**
+ * Teardown component
+ */
+ destroy() {
+ this.removeEventHandlers();
+ this.$el[0].removeAttribute('style')
+ if (!!this.$overlay[0].parentNode) {
+ this.$overlay[0].parentNode.removeChild(this.$overlay[0]);
+ }
+ this.$el[0].M_Modal = undefined;
+ Modal._count--;
+ }
+
+ /**
+ * Setup Event Handlers
+ */
+ setupEventHandlers() {
+ this.handleOverlayClickBound = this.handleOverlayClick.bind(this);
+ this.handleModalCloseClickBound = this.handleModalCloseClick.bind(this);
+
+ if (Modal._count === 1) {
+ document.body.addEventListener('click', this.handleTriggerClick);
+ }
+ this.$overlay[0].addEventListener('click', this.handleOverlayClickBound);
+ this.$el[0].addEventListener('click', this.handleModalCloseClickBound);
+ }
+
+ /**
+ * Remove Event Handlers
+ */
+ removeEventHandlers() {
+ if (Modal._count === 0) {
+ document.body.removeEventListener('click', this.handleTriggerClick);
+ }
+ this.$overlay[0].removeEventListener('click', this.handleOverlayClickBound);
+ this.$el[0].removeEventListener('click', this.handleModalCloseClickBound);
+ }
+
+ /**
+ * Handle Trigger Click
+ * @param {Event} e
+ */
+ handleTriggerClick(e) {
+ let $trigger = $(e.target).closest('.modal-trigger');
+ if (e.target && $trigger.length) {
+ let modalId = $trigger[0].getAttribute('href');
+ if (modalId) {
+ modalId = modalId.slice(1);
+ } else {
+ modalId = $trigger[0].getAttribute('data-target');
+ }
+ let modalInstance = document.getElementById(modalId).M_Modal;
+ if (modalInstance) {
+ modalInstance.open($trigger);
+ }
+ e.preventDefault();
+ }
+ }
+
+ /**
+ * Handle Overlay Click
+ */
+ handleOverlayClick() {
+ if (this.options.dismissible) {
+ this.close();
+ }
+ }
+
+ /**
+ * Handle Modal Close Click
+ * @param {Event} e
+ */
+ handleModalCloseClick(e) {
+ let $closeTrigger = $(e.target).closest('.modal-close');
+ if (e.target && $closeTrigger.length) {
+ this.close();
+ }
+ }
+
+ /**
+ * Handle Keydown
+ * @param {Event} e
+ */
+ handleKeydown(e) {
+ // ESC key
+ if (e.keyCode === 27 && this.options.dismissible) {
+ this.close();
+ }
+ }
+
+ /**
+ * Animate in modal
+ */
+ animateIn() {
+ // Set initial styles
+ $.extend(this.$el[0].style, {
+ display: 'block',
+ opacity: 0
+ });
+ $.extend(this.$overlay[0].style, {
+ display: 'block',
+ opacity: 0
+ });
+
+ // Animate overlay
+ Vel(
+ this.$overlay[0],
+ {opacity: this.options.opacity},
+ {duration: this.options.inDuration, queue: false, ease: 'easeOutCubic'}
+ );
+
+
+ // Define modal animation options
+ let enterVelocityOptions = {
+ duration: this.options.inDuration,
+ queue: false,
+ ease: 'easeOutCubic',
+ // Handle modal ready callback
+ complete: () => {
+ if (typeof(this.options.ready) === 'function') {
+ this.options.ready.call(this, this.$el, this.openingTrigger);
+ }
+ }
+ };
+
+ // Bottom sheet animation
+ if (this.$el[0].classList.contains('bottom-sheet')) {
+ Vel(
+ this.$el[0],
+ {bottom: 0, opacity: 1},
+ enterVelocityOptions);
+
+ // Normal modal animation
+ } else {
+ Vel.hook(this.$el[0], 'scaleX', 0.7);
+ this.$el[0].style.top = this.options.startingTop;
+ Vel(
+ this.$el[0],
+ {top: this.options.endingTop, opacity: 1, scaleX: 1},
+ enterVelocityOptions
+ );
+ }
+ }
+
+ /**
+ * Animate out modal
+ */
+ animateOut() {
+ // Animate overlay
+ Vel(
+ this.$overlay[0],
+ { opacity: 0},
+ {duration: this.options.outDuration, queue: false, ease: 'easeOutQuart'}
+ );
+
+ // Define modal animation options
+ var exitVelocityOptions = {
+ duration: this.options.outDuration,
+ queue: false,
+ ease: 'easeOutCubic',
+ // Handle modal ready callback
+ complete: () => {
+ this.$el[0].style.display = 'none';
+ // Call complete callback
+ if (typeof(this.options.complete) === 'function') {
+ this.options.complete.call(this, this.$el);
+ }
+ this.$overlay[0].parentNode.removeChild(this.$overlay[0]);
+ }
+ };
+
+ // Bottom sheet animation
+ if (this.$el[0].classList.contains('bottom-sheet')) {
+ Vel(
+ this.$el[0],
+ {bottom: '-100%', opacity: 0},
+ exitVelocityOptions
+ );
+
+ // Normal modal animation
+ } else {
+ Vel(
+ this.$el[0],
+ {top: this.options.startingTop, opacity: 0, scaleX: 0.7},
+ exitVelocityOptions
+ );
+ }
+ }
+
+
+ /**
+ * Open Modal
+ * @param {jQuery} [$trigger]
+ */
+ open($trigger) {
+ if (this.isOpen) {
+ return;
+ }
+
+ this.isOpen = true;
+ let body = document.body;
+ body.style.overflow = 'hidden';
+ this.$el[0].classList.add('open');
+ body.appendChild(this.$overlay[0]);
+
+ // Set opening trigger, undefined indicates modal was opened by javascript
+ this.openingTrigger = !!$trigger ? $trigger : undefined;
+
+
+ if (this.options.dismissible) {
+ this.handleKeydownBound = this.handleKeydown.bind(this);
+ document.addEventListener('keydown', this.handleKeydownBound);
+ }
+
+ this.animateIn();
+
+ return this;
+ }
+
+ /**
+ * Close Modal
+ */
+ close() {
+ if (!this.isOpen) {
+ return;
+ }
+
+ this.isOpen = false;
+ this.$el[0].classList.remove('open');
+ document.body.style.overflow = '';
+
+ if (this.options.dismissible) {
+ document.removeEventListener('keydown', this.handleKeydownBound);
+ }
+
+ this.animateOut();
+
+ return this;
+ }
+ }
+
+ /**
+ * @static
+ * @memberof Modal
+ */
+ Modal._increment = 0;
+
+ /**
+ * @static
+ * @memberof Modal
+ */
+ Modal._count = 0;
+
+ Materialize.Modal = Modal;
+
+ $.fn.modal = function(methodOrOptions) {
+ // Call plugin method if valid method name is passed in
+ if (Modal.prototype[methodOrOptions]) {
+ // Getter methods
+ if (methodOrOptions.slice(0,3) === 'get') {
+ return this.first()[0].M_Modal[methodOrOptions]();
+
+ // Void methods
+ } else {
+ return this.each(function() {
+ this.M_Modal[methodOrOptions]();
+ });
+ }
+
+ // Initialize plugin if options or no argument is passed in
+ } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
+ Modal.init(this, arguments[0]);
+ return this;
+
+ // Return error if an unrecognized method name is passed in
+ } else {
+ $.error(`Method ${methodOrOptions} does not exist on jQuery.modal`);
+ }
+ };
+
+})(jQuery, Materialize.Vel);
diff --git a/app/dispatch/static/materialize/js/parallax.js b/app/dispatch/static/materialize/js/parallax.js new file mode 100644 index 0000000..529210d --- /dev/null +++ b/app/dispatch/static/materialize/js/parallax.js @@ -0,0 +1,58 @@ +(function ($) {
+
+ $.fn.parallax = function () {
+ var window_width = $(window).width();
+ // Parallax Scripts
+ return this.each(function(i) {
+ var $this = $(this);
+ $this.addClass('parallax');
+
+ function updateParallax(initial) {
+ var container_height;
+ if (window_width < 601) {
+ container_height = ($this.height() > 0) ? $this.height() : $this.children("img").height();
+ }
+ else {
+ container_height = ($this.height() > 0) ? $this.height() : 500;
+ }
+ var $img = $this.children("img").first();
+ var img_height = $img.height();
+ var parallax_dist = img_height - container_height;
+ var bottom = $this.offset().top + container_height;
+ var top = $this.offset().top;
+ var scrollTop = $(window).scrollTop();
+ var windowHeight = window.innerHeight;
+ var windowBottom = scrollTop + windowHeight;
+ var percentScrolled = (windowBottom - top) / (container_height + windowHeight);
+ var parallax = Math.round((parallax_dist * percentScrolled));
+
+ if (initial) {
+ $img.css('display', 'block');
+ }
+ if ((bottom > scrollTop) && (top < (scrollTop + windowHeight))) {
+ $img.css('transform', "translate3D(-50%," + parallax + "px, 0)");
+ }
+
+ }
+
+ // Wait for image load
+ $this.children("img").one("load", function() {
+ updateParallax(true);
+ }).each(function() {
+ if (this.complete) $(this).trigger("load");
+ });
+
+ $(window).scroll(function() {
+ window_width = $(window).width();
+ updateParallax(false);
+ });
+
+ $(window).resize(function() {
+ window_width = $(window).width();
+ updateParallax(false);
+ });
+
+ });
+
+ };
+}( jQuery ));
diff --git a/app/dispatch/static/materialize/js/pushpin.js b/app/dispatch/static/materialize/js/pushpin.js new file mode 100644 index 0000000..4fef6c3 --- /dev/null +++ b/app/dispatch/static/materialize/js/pushpin.js @@ -0,0 +1,71 @@ +(function ($) {
+ $.fn.pushpin = function (options) {
+ // Defaults
+ var defaults = {
+ top: 0,
+ bottom: Infinity,
+ offset: 0
+ };
+
+ // Remove pushpin event and classes
+ if (options === "remove") {
+ this.each(function () {
+ if (id = $(this).data('pushpin-id')) {
+ $(window).off('scroll.' + id);
+ $(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style');
+ }
+ });
+ return false;
+ }
+
+ options = $.extend(defaults, options);
+
+
+ $index = 0;
+ return this.each(function() {
+ var $uniqueId = Materialize.guid(),
+ $this = $(this),
+ $original_offset = $(this).offset().top;
+
+ function removePinClasses(object) {
+ object.removeClass('pin-top');
+ object.removeClass('pinned');
+ object.removeClass('pin-bottom');
+ }
+
+ function updateElements(objects, scrolled) {
+ objects.each(function () {
+ // Add position fixed (because its between top and bottom)
+ if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) {
+ removePinClasses($(this));
+ $(this).css('top', options.offset);
+ $(this).addClass('pinned');
+ }
+
+ // Add pin-top (when scrolled position is above top)
+ if (scrolled < options.top && !$(this).hasClass('pin-top')) {
+ removePinClasses($(this));
+ $(this).css('top', 0);
+ $(this).addClass('pin-top');
+ }
+
+ // Add pin-bottom (when scrolled position is below bottom)
+ if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) {
+ removePinClasses($(this));
+ $(this).addClass('pin-bottom');
+ $(this).css('top', options.bottom - $original_offset);
+ }
+ });
+ }
+
+ $(this).data('pushpin-id', $uniqueId);
+ updateElements($this, $(window).scrollTop());
+ $(window).on('scroll.' + $uniqueId, function () {
+ var $scrolled = $(window).scrollTop() + options.offset;
+ updateElements($this, $scrolled);
+ });
+
+ });
+
+ };
+}( jQuery ));
\ No newline at end of file diff --git a/app/dispatch/static/materialize/js/scrollFire.js b/app/dispatch/static/materialize/js/scrollFire.js new file mode 100644 index 0000000..37750cb --- /dev/null +++ b/app/dispatch/static/materialize/js/scrollFire.js @@ -0,0 +1,51 @@ +(function($) {
+
+ var scrollFireEventsHandled = false;
+
+ // Input: Array of JSON objects {selector, offset, callback}
+ Materialize.scrollFire = function(options) {
+ var onScroll = function() {
+ var windowScroll = window.pageYOffset + window.innerHeight;
+
+ for (var i = 0 ; i < options.length; i++) {
+ // Get options from each line
+ var value = options[i];
+ var selector = value.selector,
+ offset = value.offset,
+ callback = value.callback;
+
+ var currentElement = document.querySelector(selector);
+ if ( currentElement !== null) {
+ var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset;
+
+ if (windowScroll > (elementOffset + offset)) {
+ if (value.done !== true) {
+ if (typeof(callback) === 'function') {
+ callback.call(this, currentElement);
+ } else if (typeof(callback) === 'string') {
+ var callbackFunc = new Function(callback);
+ callbackFunc(currentElement);
+ }
+ value.done = true;
+ }
+ }
+ }
+ }
+ };
+
+
+ var throttledScroll = Materialize.throttle(function() {
+ onScroll();
+ }, options.throttle || 100);
+
+ if (!scrollFireEventsHandled) {
+ window.addEventListener("scroll", throttledScroll);
+ window.addEventListener("resize", throttledScroll);
+ scrollFireEventsHandled = true;
+ }
+
+ // perform a scan once, after current execution context, and after dom is ready
+ setTimeout(throttledScroll, 0);
+ };
+
+})(jQuery);
diff --git a/app/dispatch/static/materialize/js/scrollspy.js b/app/dispatch/static/materialize/js/scrollspy.js new file mode 100644 index 0000000..52cc875 --- /dev/null +++ b/app/dispatch/static/materialize/js/scrollspy.js @@ -0,0 +1,238 @@ +/**
+ * Extend jquery with a scrollspy plugin.
+ * This watches the window scroll and fires events when elements are scrolled into viewport.
+ *
+ * throttle() and getTime() taken from Underscore.js
+ * https://github.com/jashkenas/underscore
+ *
+ * @author Copyright 2013 John Smart
+ * @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE
+ * @see https://github.com/thesmart
+ * @version 0.1.2
+ */
+(function($) {
+
+ var jWindow = $(window);
+ var elements = [];
+ var elementsInView = [];
+ var isSpying = false;
+ var ticks = 0;
+ var unique_id = 1;
+ var offset = {
+ top : 0,
+ right : 0,
+ bottom : 0,
+ left : 0,
+ }
+
+ /**
+ * Find elements that are within the boundary
+ * @param {number} top
+ * @param {number} right
+ * @param {number} bottom
+ * @param {number} left
+ * @return {jQuery} A collection of elements
+ */
+ function findElements(top, right, bottom, left) {
+ var hits = $();
+ $.each(elements, function(i, element) {
+ if (element.height() > 0) {
+ var elTop = element.offset().top,
+ elLeft = element.offset().left,
+ elRight = elLeft + element.width(),
+ elBottom = elTop + element.height();
+
+ var isIntersect = !(elLeft > right ||
+ elRight < left ||
+ elTop > bottom ||
+ elBottom < top);
+
+ if (isIntersect) {
+ hits.push(element);
+ }
+ }
+ });
+
+ return hits;
+ }
+
+
+ /**
+ * Called when the user scrolls the window
+ */
+ function onScroll(scrollOffset) {
+ // unique tick id
+ ++ticks;
+
+ // viewport rectangle
+ var top = jWindow.scrollTop(),
+ left = jWindow.scrollLeft(),
+ right = left + jWindow.width(),
+ bottom = top + jWindow.height();
+
+ // determine which elements are in view
+ var intersections = findElements(top+offset.top + scrollOffset || 200, right+offset.right, bottom+offset.bottom, left+offset.left);
+ $.each(intersections, function(i, element) {
+
+ var lastTick = element.data('scrollSpy:ticks');
+ if (typeof lastTick != 'number') {
+ // entered into view
+ element.triggerHandler('scrollSpy:enter');
+ }
+
+ // update tick id
+ element.data('scrollSpy:ticks', ticks);
+ });
+
+ // determine which elements are no longer in view
+ $.each(elementsInView, function(i, element) {
+ var lastTick = element.data('scrollSpy:ticks');
+ if (typeof lastTick == 'number' && lastTick !== ticks) {
+ // exited from view
+ element.triggerHandler('scrollSpy:exit');
+ element.data('scrollSpy:ticks', null);
+ }
+ });
+
+ // remember elements in view for next tick
+ elementsInView = intersections;
+ }
+
+ /**
+ * Called when window is resized
+ */
+ function onWinSize() {
+ jWindow.trigger('scrollSpy:winSize');
+ }
+
+
+ /**
+ * Enables ScrollSpy using a selector
+ * @param {jQuery|string} selector The elements collection, or a selector
+ * @param {Object=} options Optional.
+ throttle : number -> scrollspy throttling. Default: 100 ms
+ offsetTop : number -> offset from top. Default: 0
+ offsetRight : number -> offset from right. Default: 0
+ offsetBottom : number -> offset from bottom. Default: 0
+ offsetLeft : number -> offset from left. Default: 0
+ activeClass : string -> Class name to be added to the active link. Default: active
+ * @returns {jQuery}
+ */
+ $.scrollSpy = function(selector, options) {
+ var defaults = {
+ throttle: 100,
+ scrollOffset: 200, // offset - 200 allows elements near bottom of page to scroll
+ activeClass: 'active',
+ getActiveElement: function(id) {
+ return 'a[href="#' + id + '"]';
+ }
+ };
+ options = $.extend(defaults, options);
+
+ var visible = [];
+ selector = $(selector);
+ selector.each(function(i, element) {
+ elements.push($(element));
+ $(element).data("scrollSpy:id", i);
+ // Smooth scroll to section
+ $('a[href="#' + $(element).attr('id') + '"]').click(function(e) {
+ e.preventDefault();
+ var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1;
+ $('html, body').animate({ scrollTop: offset - options.scrollOffset }, {duration: 400, queue: false, easing: 'easeOutCubic'});
+ });
+ });
+
+ offset.top = options.offsetTop || 0;
+ offset.right = options.offsetRight || 0;
+ offset.bottom = options.offsetBottom || 0;
+ offset.left = options.offsetLeft || 0;
+
+ var throttledScroll = Materialize.throttle(function() {
+ onScroll(options.scrollOffset);
+ }, options.throttle || 100);
+ var readyScroll = function(){
+ $(document).ready(throttledScroll);
+ };
+
+ if (!isSpying) {
+ jWindow.on('scroll', readyScroll);
+ jWindow.on('resize', readyScroll);
+ isSpying = true;
+ }
+
+ // perform a scan once, after current execution context, and after dom is ready
+ setTimeout(readyScroll, 0);
+
+
+ selector.on('scrollSpy:enter', function() {
+ visible = $.grep(visible, function(value) {
+ return value.height() != 0;
+ });
+
+ var $this = $(this);
+
+ if (visible[0]) {
+ $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
+ if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) {
+ visible.unshift($(this));
+ }
+ else {
+ visible.push($(this));
+ }
+ }
+ else {
+ visible.push($(this));
+ }
+
+
+ $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
+ });
+ selector.on('scrollSpy:exit', function() {
+ visible = $.grep(visible, function(value) {
+ return value.height() != 0;
+ });
+
+ if (visible[0]) {
+ $(options.getActiveElement(visible[0].attr('id'))).removeClass(options.activeClass);
+ var $this = $(this);
+ visible = $.grep(visible, function(value) {
+ return value.attr('id') != $this.attr('id');
+ });
+ if (visible[0]) { // Check if empty
+ $(options.getActiveElement(visible[0].attr('id'))).addClass(options.activeClass);
+ }
+ }
+ });
+
+ return selector;
+ };
+
+ /**
+ * Listen for window resize events
+ * @param {Object=} options Optional. Set { throttle: number } to change throttling. Default: 100 ms
+ * @returns {jQuery} $(window)
+ */
+ $.winSizeSpy = function(options) {
+ $.winSizeSpy = function() { return jWindow; }; // lock from multiple calls
+ options = options || {
+ throttle: 100
+ };
+ return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100));
+ };
+
+ /**
+ * Enables ScrollSpy on a collection of elements
+ * e.g. $('.scrollSpy').scrollSpy()
+ * @param {Object=} options Optional.
+ throttle : number -> scrollspy throttling. Default: 100 ms
+ offsetTop : number -> offset from top. Default: 0
+ offsetRight : number -> offset from right. Default: 0
+ offsetBottom : number -> offset from bottom. Default: 0
+ offsetLeft : number -> offset from left. Default: 0
+ * @returns {jQuery}
+ */
+ $.fn.scrollSpy = function(options) {
+ return $.scrollSpy($(this), options);
+ };
+
+})(jQuery);
diff --git a/app/dispatch/static/materialize/js/sideNav.js b/app/dispatch/static/materialize/js/sideNav.js new file mode 100644 index 0000000..bfda17a --- /dev/null +++ b/app/dispatch/static/materialize/js/sideNav.js @@ -0,0 +1,414 @@ +(function ($) {
+
+ var methods = {
+ init : function(options) {
+ var defaults = {
+ menuWidth: 300,
+ edge: 'left',
+ closeOnClick: false,
+ draggable: true,
+ onOpen: null,
+ onClose: null
+ };
+ options = $.extend(defaults, options);
+
+ $(this).each(function(){
+ var $this = $(this);
+ var menuId = $this.attr('data-activates');
+ var menu = $("#"+ menuId);
+
+ // Set to width
+ if (options.menuWidth != 300) {
+ menu.css('width', options.menuWidth);
+ }
+
+ // Add Touch Area
+ var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]');
+ if (options.draggable) {
+ // Regenerate dragTarget
+ if ($dragTarget.length) {
+ $dragTarget.remove();
+ }
+
+ $dragTarget = $('<div class="drag-target"></div>').attr('data-sidenav', menuId);
+ $('body').append($dragTarget);
+ } else {
+ $dragTarget = $();
+ }
+
+ if (options.edge == 'left') {
+ menu.css('transform', 'translateX(-100%)');
+ $dragTarget.css({'left': 0}); // Add Touch Area
+ }
+ else {
+ menu.addClass('right-aligned') // Change text-alignment to right
+ .css('transform', 'translateX(100%)');
+ $dragTarget.css({'right': 0}); // Add Touch Area
+ }
+
+ // If fixed sidenav, bring menu out
+ if (menu.hasClass('fixed')) {
+ if (window.innerWidth > 992) {
+ menu.css('transform', 'translateX(0)');
+ }
+ }
+
+ // Window resize to reset on large screens fixed
+ if (menu.hasClass('fixed')) {
+ $(window).resize( function() {
+ if (window.innerWidth > 992) {
+ // Close menu if window is resized bigger than 992 and user has fixed sidenav
+ if ($('#sidenav-overlay').length !== 0 && menuOut) {
+ removeMenu(true);
+ }
+ else {
+ // menu.removeAttr('style');
+ menu.css('transform', 'translateX(0%)');
+ // menu.css('width', options.menuWidth);
+ }
+ }
+ else if (menuOut === false){
+ if (options.edge === 'left') {
+ menu.css('transform', 'translateX(-100%)');
+ } else {
+ menu.css('transform', 'translateX(100%)');
+ }
+
+ }
+
+ });
+ }
+
+ // if closeOnClick, then add close event for all a tags in side sideNav
+ if (options.closeOnClick === true) {
+ menu.on("click.itemclick", "a:not(.collapsible-header)", function(){
+ if (!(window.innerWidth > 992 && menu.hasClass('fixed'))){
+ removeMenu();
+ }
+ });
+ }
+
+ var removeMenu = function(restoreNav) {
+ panning = false;
+ menuOut = false;
+ // Reenable scrolling
+ $('body').css({
+ overflow: '',
+ width: ''
+ });
+
+ $('#sidenav-overlay').velocity({opacity: 0}, {duration: 200,
+ queue: false, easing: 'easeOutQuad',
+ complete: function() {
+ $(this).remove();
+ } });
+ if (options.edge === 'left') {
+ // Reset phantom div
+ $dragTarget.css({width: '', right: '', left: '0'});
+ menu.velocity(
+ {'translateX': '-100%'},
+ { duration: 200,
+ queue: false,
+ easing: 'easeOutCubic',
+ complete: function() {
+ if (restoreNav === true) {
+ // Restore Fixed sidenav
+ menu.removeAttr('style');
+ menu.css('width', options.menuWidth);
+ }
+ }
+
+ });
+ }
+ else {
+ // Reset phantom div
+ $dragTarget.css({width: '', right: '0', left: ''});
+ menu.velocity(
+ {'translateX': '100%'},
+ { duration: 200,
+ queue: false,
+ easing: 'easeOutCubic',
+ complete: function() {
+ if (restoreNav === true) {
+ // Restore Fixed sidenav
+ menu.removeAttr('style');
+ menu.css('width', options.menuWidth);
+ }
+ }
+ });
+ }
+
+ // Callback
+ if (typeof(options.onClose) === 'function') {
+ options.onClose.call(this, menu);
+ }
+ }
+
+
+
+ // Touch Event
+ var panning = false;
+ var menuOut = false;
+
+ if (options.draggable) {
+ $dragTarget.on('click', function(){
+ if (menuOut) {
+ removeMenu();
+ }
+ });
+
+ $dragTarget.hammer({
+ prevent_default: false
+ }).on('pan', function(e) {
+
+ if (e.gesture.pointerType == "touch") {
+
+ var direction = e.gesture.direction;
+ var x = e.gesture.center.x;
+ var y = e.gesture.center.y;
+ var velocityX = e.gesture.velocityX;
+
+ // Vertical scroll bugfix
+ if (x === 0 && y === 0) {
+ return;
+ }
+
+ // Disable Scrolling
+ var $body = $('body');
+ var $overlay = $('#sidenav-overlay');
+ var oldWidth = $body.innerWidth();
+ $body.css('overflow', 'hidden');
+ $body.width(oldWidth);
+
+ // If overlay does not exist, create one and if it is clicked, close menu
+ if ($overlay.length === 0) {
+ $overlay = $('<div id="sidenav-overlay"></div>');
+ $overlay.css('opacity', 0).click( function(){
+ removeMenu();
+ });
+
+ // Run 'onOpen' when sidenav is opened via touch/swipe if applicable
+ if (typeof(options.onOpen) === 'function') {
+ options.onOpen.call(this, menu);
+ }
+
+ $('body').append($overlay);
+ }
+
+ // Keep within boundaries
+ if (options.edge === 'left') {
+ if (x > options.menuWidth) { x = options.menuWidth; }
+ else if (x < 0) { x = 0; }
+ }
+
+ if (options.edge === 'left') {
+ // Left Direction
+ if (x < (options.menuWidth / 2)) { menuOut = false; }
+ // Right Direction
+ else if (x >= (options.menuWidth / 2)) { menuOut = true; }
+ menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)');
+ }
+ else {
+ // Left Direction
+ if (x < (window.innerWidth - options.menuWidth / 2)) {
+ menuOut = true;
+ }
+ // Right Direction
+ else if (x >= (window.innerWidth - options.menuWidth / 2)) {
+ menuOut = false;
+ }
+ var rightPos = (x - options.menuWidth / 2);
+ if (rightPos < 0) {
+ rightPos = 0;
+ }
+
+ menu.css('transform', 'translateX(' + rightPos + 'px)');
+ }
+
+
+ // Percentage overlay
+ var overlayPerc;
+ if (options.edge === 'left') {
+ overlayPerc = x / options.menuWidth;
+ $overlay.velocity({opacity: overlayPerc }, {duration: 10, queue: false, easing: 'easeOutQuad'});
+ }
+ else {
+ overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth);
+ $overlay.velocity({opacity: overlayPerc }, {duration: 10, queue: false, easing: 'easeOutQuad'});
+ }
+ }
+
+ }).on('panend', function(e) {
+
+ if (e.gesture.pointerType == "touch") {
+ var $overlay = $('#sidenav-overlay');
+ var velocityX = e.gesture.velocityX;
+ var x = e.gesture.center.x;
+ var leftPos = x - options.menuWidth;
+ var rightPos = x - options.menuWidth / 2;
+ if (leftPos > 0 ) {
+ leftPos = 0;
+ }
+ if (rightPos < 0) {
+ rightPos = 0;
+ }
+ panning = false;
+
+ if (options.edge === 'left') {
+ // If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut
+ if ((menuOut && velocityX <= 0.3) || velocityX < -0.5) {
+ // Return menu to open
+ if (leftPos !== 0) {
+ menu.velocity({'translateX': [0, leftPos]}, {duration: 300, queue: false, easing: 'easeOutQuad'});
+ }
+
+ $overlay.velocity({opacity: 1 }, {duration: 50, queue: false, easing: 'easeOutQuad'});
+ $dragTarget.css({width: '50%', right: 0, left: ''});
+ menuOut = true;
+ }
+ else if (!menuOut || velocityX > 0.3) {
+ // Enable Scrolling
+ $('body').css({
+ overflow: '',
+ width: ''
+ });
+ // Slide menu closed
+ menu.velocity({'translateX': [-1 * options.menuWidth - 10, leftPos]}, {duration: 200, queue: false, easing: 'easeOutQuad'});
+ $overlay.velocity({opacity: 0 }, {duration: 200, queue: false, easing: 'easeOutQuad',
+ complete: function () {
+ // Run 'onClose' when sidenav is closed via touch/swipe if applicable
+ if (typeof(options.onClose) === 'function') {
+ options.onClose.call(this, menu);
+ }
+
+ $(this).remove();
+ }});
+ $dragTarget.css({width: '10px', right: '', left: 0});
+ }
+ }
+ else {
+ if ((menuOut && velocityX >= -0.3) || velocityX > 0.5) {
+ // Return menu to open
+ if (rightPos !== 0) {
+ menu.velocity({'translateX': [0, rightPos]}, {duration: 300, queue: false, easing: 'easeOutQuad'});
+ }
+
+ $overlay.velocity({opacity: 1 }, {duration: 50, queue: false, easing: 'easeOutQuad'});
+ $dragTarget.css({width: '50%', right: '', left: 0});
+ menuOut = true;
+ }
+ else if (!menuOut || velocityX < -0.3) {
+ // Enable Scrolling
+ $('body').css({
+ overflow: '',
+ width: ''
+ });
+
+ // Slide menu closed
+ menu.velocity({'translateX': [options.menuWidth + 10, rightPos]}, {duration: 200, queue: false, easing: 'easeOutQuad'});
+ $overlay.velocity({opacity: 0 }, {duration: 200, queue: false, easing: 'easeOutQuad',
+ complete: function () {
+ // Run 'onClose' when sidenav is closed via touch/swipe if applicable
+ if (typeof(options.onClose) === 'function') {
+ options.onClose.call(this, menu);
+ }
+
+ $(this).remove();
+ }});
+ $dragTarget.css({width: '10px', right: 0, left: ''});
+ }
+ }
+
+ }
+ });
+ }
+
+ $this.off('click.sidenav').on('click.sidenav', function() {
+ if (menuOut === true) {
+ menuOut = false;
+ panning = false;
+ removeMenu();
+ }
+ else {
+
+ // Disable Scrolling
+ var $body = $('body');
+ var $overlay = $('<div id="sidenav-overlay"></div>');
+ var oldWidth = $body.innerWidth();
+ $body.css('overflow', 'hidden');
+ $body.width(oldWidth);
+
+ // Push current drag target on top of DOM tree
+ $('body').append($dragTarget);
+
+ if (options.edge === 'left') {
+ $dragTarget.css({width: '50%', right: 0, left: ''});
+ menu.velocity({'translateX': [0, -1 * options.menuWidth]}, {duration: 300, queue: false, easing: 'easeOutQuad'});
+ }
+ else {
+ $dragTarget.css({width: '50%', right: '', left: 0});
+ menu.velocity({'translateX': [0, options.menuWidth]}, {duration: 300, queue: false, easing: 'easeOutQuad'});
+ }
+
+ // Overlay close on click
+ $overlay.css('opacity', 0)
+ .click(function() {
+ menuOut = false;
+ panning = false;
+ removeMenu();
+ $overlay.velocity({opacity: 0}, {duration: 300, queue: false, easing: 'easeOutQuad',
+ complete: function() {
+ $(this).remove();
+ }
+ });
+ });
+
+ // Append body
+ $('body').append($overlay);
+ $overlay.velocity({opacity: 1}, {duration: 300, queue: false, easing: 'easeOutQuad',
+ complete: function () {
+ menuOut = true;
+ panning = false;
+ }
+ });
+
+ // Callback
+ if (typeof(options.onOpen) === 'function') {
+ options.onOpen.call(this, menu);
+ }
+ }
+
+ return false;
+ });
+ });
+
+
+ },
+ destroy: function () {
+ var $overlay = $('#sidenav-overlay');
+ var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]');
+ $overlay.trigger('click');
+ $dragTarget.remove();
+ $(this).off('click');
+ $overlay.remove();
+ },
+ show : function() {
+ this.trigger('click');
+ },
+ hide : function() {
+ $('#sidenav-overlay').trigger('click');
+ }
+ };
+
+
+ $.fn.sideNav = function(methodOrOptions) {
+ if ( methods[methodOrOptions] ) {
+ return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
+ } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
+ // Default to "init"
+ return methods.init.apply( this, arguments );
+ } else {
+ $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.sideNav' );
+ }
+ }; // Plugin end
+}( jQuery ));
diff --git a/app/dispatch/static/materialize/js/slider.js b/app/dispatch/static/materialize/js/slider.js new file mode 100644 index 0000000..37ba6e6 --- /dev/null +++ b/app/dispatch/static/materialize/js/slider.js @@ -0,0 +1,324 @@ +(function ($) {
+
+ var methods = {
+
+ init : function(options) {
+ var defaults = {
+ indicators: true,
+ height: 400,
+ transition: 500,
+ interval: 6000
+ };
+ options = $.extend(defaults, options);
+
+ return this.each(function() {
+
+ // For each slider, we want to keep track of
+ // which slide is active and its associated content
+ var $this = $(this);
+ var $slider = $this.find('ul.slides').first();
+ var $slides = $slider.find('> li');
+ var $active_index = $slider.find('.active').index();
+ var $active, $indicators, $interval;
+ if ($active_index != -1) { $active = $slides.eq($active_index); }
+
+ // Transitions the caption depending on alignment
+ function captionTransition(caption, duration) {
+ if (caption.hasClass("center-align")) {
+ caption.velocity({opacity: 0, translateY: -100}, {duration: duration, queue: false});
+ }
+ else if (caption.hasClass("right-align")) {
+ caption.velocity({opacity: 0, translateX: 100}, {duration: duration, queue: false});
+ }
+ else if (caption.hasClass("left-align")) {
+ caption.velocity({opacity: 0, translateX: -100}, {duration: duration, queue: false});
+ }
+ }
+
+ // This function will transition the slide to any index of the next slide
+ function moveToSlide(index) {
+ // Wrap around indices.
+ if (index >= $slides.length) index = 0;
+ else if (index < 0) index = $slides.length -1;
+
+ $active_index = $slider.find('.active').index();
+
+ // Only do if index changes
+ if ($active_index != index) {
+ $active = $slides.eq($active_index);
+ $caption = $active.find('.caption');
+
+ $active.removeClass('active');
+ $active.velocity({opacity: 0}, {duration: options.transition, queue: false, easing: 'easeOutQuad',
+ complete: function() {
+ $slides.not('.active').velocity({opacity: 0, translateX: 0, translateY: 0}, {duration: 0, queue: false});
+ } });
+ captionTransition($caption, options.transition);
+
+
+ // Update indicators
+ if (options.indicators) {
+ $indicators.eq($active_index).removeClass('active');
+ }
+
+ $slides.eq(index).velocity({opacity: 1}, {duration: options.transition, queue: false, easing: 'easeOutQuad'});
+ $slides.eq(index).find('.caption').velocity({opacity: 1, translateX: 0, translateY: 0}, {duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad'});
+ $slides.eq(index).addClass('active');
+
+
+ // Update indicators
+ if (options.indicators) {
+ $indicators.eq(index).addClass('active');
+ }
+ }
+ }
+
+ // Set height of slider
+ // If fullscreen, do nothing
+ if (!$this.hasClass('fullscreen')) {
+ if (options.indicators) {
+ // Add height if indicators are present
+ $this.height(options.height + 40);
+ }
+ else {
+ $this.height(options.height);
+ }
+ $slider.height(options.height);
+ }
+
+
+ // Set initial positions of captions
+ $slides.find('.caption').each(function () {
+ captionTransition($(this), 0);
+ });
+
+ // Move img src into background-image
+ $slides.find('img').each(function () {
+ var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==';
+ if ($(this).attr('src') !== placeholderBase64) {
+ $(this).css('background-image', 'url("' + $(this).attr('src') + '")' );
+ $(this).attr('src', placeholderBase64);
+ }
+ });
+
+ // dynamically add indicators
+ if (options.indicators) {
+ $indicators = $('<ul class="indicators"></ul>');
+ $slides.each(function( index ) {
+ var $indicator = $('<li class="indicator-item"></li>');
+
+ // Handle clicks on indicators
+ $indicator.click(function () {
+ var $parent = $slider.parent();
+ var curr_index = $parent.find($(this)).index();
+ moveToSlide(curr_index);
+
+ // reset interval
+ clearInterval($interval);
+ $interval = setInterval(
+ function(){
+ $active_index = $slider.find('.active').index();
+ if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
+ else $active_index += 1;
+
+ moveToSlide($active_index);
+
+ }, options.transition + options.interval
+ );
+ });
+ $indicators.append($indicator);
+ });
+ $this.append($indicators);
+ $indicators = $this.find('ul.indicators').find('li.indicator-item');
+ }
+
+ if ($active) {
+ $active.show();
+ }
+ else {
+ $slides.first().addClass('active').velocity({opacity: 1}, {duration: options.transition, queue: false, easing: 'easeOutQuad'});
+
+ $active_index = 0;
+ $active = $slides.eq($active_index);
+
+ // Update indicators
+ if (options.indicators) {
+ $indicators.eq($active_index).addClass('active');
+ }
+ }
+
+ // Adjust height to current slide
+ $active.find('img').each(function() {
+ $active.find('.caption').velocity({opacity: 1, translateX: 0, translateY: 0}, {duration: options.transition, queue: false, easing: 'easeOutQuad'});
+ });
+
+ // auto scroll
+ $interval = setInterval(
+ function(){
+ $active_index = $slider.find('.active').index();
+ moveToSlide($active_index + 1);
+
+ }, options.transition + options.interval
+ );
+
+
+ // HammerJS, Swipe navigation
+
+ // Touch Event
+ var panning = false;
+ var swipeLeft = false;
+ var swipeRight = false;
+
+ $this.hammer({
+ prevent_default: false
+ }).on('pan', function(e) {
+ if (e.gesture.pointerType === "touch") {
+
+ // reset interval
+ clearInterval($interval);
+
+ var direction = e.gesture.direction;
+ var x = e.gesture.deltaX;
+ var velocityX = e.gesture.velocityX;
+ var velocityY = e.gesture.velocityY;
+
+ $curr_slide = $slider.find('.active');
+ if (Math.abs(velocityX) > Math.abs(velocityY)) {
+ $curr_slide.velocity({ translateX: x
+ }, {duration: 50, queue: false, easing: 'easeOutQuad'});
+ }
+
+ // Swipe Left
+ if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.65)) {
+ swipeRight = true;
+ }
+ // Swipe Right
+ else if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.65)) {
+ swipeLeft = true;
+ }
+
+ // Make Slide Behind active slide visible
+ var next_slide;
+ if (swipeLeft) {
+ next_slide = $curr_slide.next();
+ if (next_slide.length === 0) {
+ next_slide = $slides.first();
+ }
+ next_slide.velocity({ opacity: 1
+ }, {duration: 300, queue: false, easing: 'easeOutQuad'});
+ }
+ if (swipeRight) {
+ next_slide = $curr_slide.prev();
+ if (next_slide.length === 0) {
+ next_slide = $slides.last();
+ }
+ next_slide.velocity({ opacity: 1
+ }, {duration: 300, queue: false, easing: 'easeOutQuad'});
+ }
+
+
+ }
+
+ }).on('panend', function(e) {
+ if (e.gesture.pointerType === "touch") {
+
+ $curr_slide = $slider.find('.active');
+ panning = false;
+ curr_index = $slider.find('.active').index();
+
+ if (!swipeRight && !swipeLeft || $slides.length <=1) {
+ // Return to original spot
+ $curr_slide.velocity({ translateX: 0
+ }, {duration: 300, queue: false, easing: 'easeOutQuad'});
+ }
+ else if (swipeLeft) {
+ moveToSlide(curr_index + 1);
+ $curr_slide.velocity({translateX: -1 * $this.innerWidth() }, {duration: 300, queue: false, easing: 'easeOutQuad',
+ complete: function() {
+ $curr_slide.velocity({opacity: 0, translateX: 0}, {duration: 0, queue: false});
+ } });
+ }
+ else if (swipeRight) {
+ moveToSlide(curr_index - 1);
+ $curr_slide.velocity({translateX: $this.innerWidth() }, {duration: 300, queue: false, easing: 'easeOutQuad',
+ complete: function() {
+ $curr_slide.velocity({opacity: 0, translateX: 0}, {duration: 0, queue: false});
+ } });
+ }
+ swipeLeft = false;
+ swipeRight = false;
+
+ // Restart interval
+ clearInterval($interval);
+ $interval = setInterval(
+ function(){
+ $active_index = $slider.find('.active').index();
+ if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
+ else $active_index += 1;
+
+ moveToSlide($active_index);
+
+ }, options.transition + options.interval
+ );
+ }
+ });
+
+ $this.on('sliderPause', function() {
+ clearInterval($interval);
+ });
+
+ $this.on('sliderStart', function() {
+ clearInterval($interval);
+ $interval = setInterval(
+ function(){
+ $active_index = $slider.find('.active').index();
+ if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
+ else $active_index += 1;
+
+ moveToSlide($active_index);
+
+ }, options.transition + options.interval
+ );
+ });
+
+ $this.on('sliderNext', function() {
+ $active_index = $slider.find('.active').index();
+ moveToSlide($active_index + 1);
+ });
+
+ $this.on('sliderPrev', function() {
+ $active_index = $slider.find('.active').index();
+ moveToSlide($active_index - 1);
+ });
+
+ });
+
+
+
+ },
+ pause : function() {
+ $(this).trigger('sliderPause');
+ },
+ start : function() {
+ $(this).trigger('sliderStart');
+ },
+ next : function() {
+ $(this).trigger('sliderNext');
+ },
+ prev : function() {
+ $(this).trigger('sliderPrev');
+ }
+ };
+
+
+ $.fn.slider = function(methodOrOptions) {
+ if ( methods[methodOrOptions] ) {
+ return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
+ } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
+ // Default to "init"
+ return methods.init.apply( this, arguments );
+ } else {
+ $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.tooltip' );
+ }
+ }; // Plugin end
+}( jQuery ));
diff --git a/app/dispatch/static/materialize/js/tabs.js b/app/dispatch/static/materialize/js/tabs.js new file mode 100644 index 0000000..2631134 --- /dev/null +++ b/app/dispatch/static/materialize/js/tabs.js @@ -0,0 +1,246 @@ +(function ($) {
+
+ var methods = {
+ init : function(options) {
+ var defaults = {
+ onShow: null,
+ swipeable: false,
+ responsiveThreshold: Infinity, // breakpoint for swipeable
+ };
+ options = $.extend(defaults, options);
+ var namespace = Materialize.objectSelectorString($(this));
+
+ return this.each(function(i) {
+
+ var uniqueNamespace = namespace+i;
+
+ // For each set of tabs, we want to keep track of
+ // which tab is active and its associated content
+ var $this = $(this),
+ window_width = $(window).width();
+
+ var $active, $content, $links = $this.find('li.tab a'),
+ $tabs_width = $this.width(),
+ $tabs_content = $(),
+ $tabs_wrapper,
+ $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length,
+ $indicator,
+ index = 0,
+ prev_index = 0,
+ clicked = false,
+ clickedTimeout,
+ transition = 300;
+
+
+ // Finds right attribute for indicator based on active tab.
+ // el: jQuery Object
+ var calcRightPos = function(el) {
+ return Math.ceil($tabs_width - el.position().left - el[0].getBoundingClientRect().width - $this.scrollLeft());
+ };
+
+ // Finds left attribute for indicator based on active tab.
+ // el: jQuery Object
+ var calcLeftPos = function(el) {
+ return Math.floor(el.position().left + $this.scrollLeft());
+ };
+
+ // Animates Indicator to active tab.
+ // prev_index: Number
+ var animateIndicator = function(prev_index) {
+ if ((index - prev_index) >= 0) {
+ $indicator.velocity({"right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad'});
+ $indicator.velocity({"left": calcLeftPos($active) }, {duration: transition, queue: false, easing: 'easeOutQuad', delay: 90});
+
+ } else {
+ $indicator.velocity({"left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad'});
+ $indicator.velocity({"right": calcRightPos($active) }, {duration: transition, queue: false, easing: 'easeOutQuad', delay: 90});
+ }
+ };
+
+ // Change swipeable according to responsive threshold
+ if (options.swipeable) {
+ if (window_width > options.responsiveThreshold) {
+ options.swipeable = false;
+ }
+ }
+
+
+ // If the location.hash matches one of the links, use that as the active tab.
+ $active = $($links.filter('[href="'+location.hash+'"]'));
+
+ // If no match is found, use the first link or any with class 'active' as the initial active tab.
+ if ($active.length === 0) {
+ $active = $(this).find('li.tab a.active').first();
+ }
+ if ($active.length === 0) {
+ $active = $(this).find('li.tab a').first();
+ }
+
+ $active.addClass('active');
+ index = $links.index($active);
+ if (index < 0) {
+ index = 0;
+ }
+
+ if ($active[0] !== undefined) {
+ $content = $($active[0].hash);
+ $content.addClass('active');
+ }
+
+ // append indicator then set indicator width to tab width
+ if (!$this.find('.indicator').length) {
+ $this.append('<li class="indicator"></li>');
+ }
+ $indicator = $this.find('.indicator');
+
+ // we make sure that the indicator is at the end of the tabs
+ $this.append($indicator);
+
+ if ($this.is(":visible")) {
+ // $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)});
+ // $indicator.css({"left": index * $tab_width});
+ setTimeout(function() {
+ $indicator.css({"right": calcRightPos($active) });
+ $indicator.css({"left": calcLeftPos($active) });
+ }, 0);
+ }
+ $(window).off('resize.tabs-'+uniqueNamespace).on('resize.tabs-'+uniqueNamespace, function () {
+ $tabs_width = $this.width();
+ $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
+ if (index < 0) {
+ index = 0;
+ }
+ if ($tab_width !== 0 && $tabs_width !== 0) {
+ $indicator.css({"right": calcRightPos($active) });
+ $indicator.css({"left": calcLeftPos($active) });
+ }
+ });
+
+ // Initialize Tabs Content.
+ if (options.swipeable) {
+ // TODO: Duplicate calls with swipeable? handle multiple div wrapping.
+ $links.each(function () {
+ var $curr_content = $(Materialize.escapeHash(this.hash));
+ $curr_content.addClass('carousel-item');
+ $tabs_content = $tabs_content.add($curr_content);
+ });
+ $tabs_wrapper = $tabs_content.wrapAll('<div class="tabs-content carousel"></div>');
+ $tabs_content.css('display', '');
+ $('.tabs-content.carousel').carousel({
+ fullWidth: true,
+ noWrap: true,
+ onCycleTo: function(item) {
+ if (!clicked) {
+ var prev_index = index;
+ index = $tabs_wrapper.index(item);
+ $active.removeClass('active');
+ $active = $links.eq(index);
+ $active.addClass('active');
+ animateIndicator(prev_index);
+ if (typeof(options.onShow) === "function") {
+ options.onShow.call($this[0], $content);
+ }
+ }
+ },
+ });
+ } else {
+ // Hide the remaining content
+ $links.not($active).each(function () {
+ $(Materialize.escapeHash(this.hash)).hide();
+ });
+ }
+
+
+ // Bind the click event handler
+ $this.off('click.tabs').on('click.tabs', 'a', function(e) {
+ if ($(this).parent().hasClass('disabled')) {
+ e.preventDefault();
+ return;
+ }
+
+ // Act as regular link if target attribute is specified.
+ if (!!$(this).attr("target")) {
+ return;
+ }
+
+ clicked = true;
+ $tabs_width = $this.width();
+ $tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
+
+ // Make the old tab inactive.
+ $active.removeClass('active');
+ var $oldContent = $content
+
+ // Update the variables with the new link and content
+ $active = $(this);
+ $content = $(Materialize.escapeHash(this.hash));
+ $links = $this.find('li.tab a');
+ var activeRect = $active.position();
+
+ // Make the tab active.
+ $active.addClass('active');
+ prev_index = index;
+ index = $links.index($(this));
+ if (index < 0) {
+ index = 0;
+ }
+ // Change url to current tab
+ // window.location.hash = $active.attr('href');
+
+ // Swap content
+ if (options.swipeable) {
+ if ($tabs_content.length) {
+ $tabs_content.carousel('set', index, function() {
+ if (typeof(options.onShow) === "function") {
+ options.onShow.call($this[0], $content);
+ }
+ });
+ }
+ } else {
+ if ($content !== undefined) {
+ $content.show();
+ $content.addClass('active');
+ if (typeof(options.onShow) === "function") {
+ options.onShow.call(this, $content);
+ }
+ }
+
+ if ($oldContent !== undefined &&
+ !$oldContent.is($content)) {
+ $oldContent.hide();
+ $oldContent.removeClass('active');
+ }
+ }
+
+ // Reset clicked state
+ clickedTimeout = setTimeout(function(){ clicked = false; }, transition);
+
+ // Update indicator
+ animateIndicator(prev_index);
+
+ // Prevent the anchor's default click action
+ e.preventDefault();
+ });
+ });
+
+ },
+ select_tab : function( id ) {
+ this.find('a[href="#' + id + '"]').trigger('click');
+ }
+ };
+
+ $.fn.tabs = function(methodOrOptions) {
+ if ( methods[methodOrOptions] ) {
+ return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
+ } else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
+ // Default to "init"
+ return methods.init.apply( this, arguments );
+ } else {
+ $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.tabs' );
+ }
+ };
+
+ $(document).ready(function(){
+ $('ul.tabs').tabs();
+ });
+}( jQuery ));
diff --git a/app/dispatch/static/materialize/js/tapTarget.js b/app/dispatch/static/materialize/js/tapTarget.js new file mode 100644 index 0000000..33ed757 --- /dev/null +++ b/app/dispatch/static/materialize/js/tapTarget.js @@ -0,0 +1,187 @@ +(function ($) {
+
+ var methods = {
+ init: function (options) {
+ return this.each(function() {
+ var origin = $('#'+$(this).attr('data-activates'));
+ var screen = $('body');
+
+ // Creating tap target
+ var tapTargetEl = $(this);
+ var tapTargetWrapper = tapTargetEl.parent('.tap-target-wrapper');
+ var tapTargetWave = tapTargetWrapper.find('.tap-target-wave');
+ var tapTargetOriginEl = tapTargetWrapper.find('.tap-target-origin');
+ var tapTargetContentEl = tapTargetEl.find('.tap-target-content');
+
+ // Creating wrapper
+ if (!tapTargetWrapper.length) {
+ tapTargetWrapper = tapTargetEl.wrap($('<div class="tap-target-wrapper"></div>')).parent();
+ }
+
+ // Creating content
+ if (!tapTargetContentEl.length) {
+ tapTargetContentEl = $('<div class="tap-target-content"></div>');
+ tapTargetEl.append(tapTargetContentEl);
+ }
+
+ // Creating foreground wave
+ if (!tapTargetWave.length) {
+ tapTargetWave = $('<div class="tap-target-wave"></div>');
+
+ // Creating origin
+ if (!tapTargetOriginEl.length) {
+ tapTargetOriginEl = origin.clone(true, true);
+ tapTargetOriginEl.addClass('tap-target-origin');
+ tapTargetOriginEl.removeAttr('id');
+ tapTargetOriginEl.removeAttr('style');
+ tapTargetWave.append(tapTargetOriginEl);
+ }
+
+ tapTargetWrapper.append(tapTargetWave);
+ }
+
+ // Open
+ var openTapTarget = function() {
+ if (tapTargetWrapper.is('.open')) {
+ return;
+ }
+
+ // Adding open class
+ tapTargetWrapper.addClass('open');
+
+ setTimeout(function() {
+ tapTargetOriginEl.off('click.tapTarget').on('click.tapTarget', function(e) {
+ closeTapTarget();
+ tapTargetOriginEl.off('click.tapTarget');
+ });
+
+ $(document).off('click.tapTarget').on('click.tapTarget', function(e) {
+ closeTapTarget();
+ $(document).off('click.tapTarget');
+ });
+
+ var throttledCalc = Materialize.throttle(function() {
+ calculateTapTarget();
+ }, 200);
+ $(window).off('resize.tapTarget').on('resize.tapTarget', throttledCalc);
+ }, 0);
+ };
+
+ // Close
+ var closeTapTarget = function(){
+ if (!tapTargetWrapper.is('.open')) {
+ return;
+ }
+
+ tapTargetWrapper.removeClass('open');
+ tapTargetOriginEl.off('click.tapTarget')
+ $(document).off('click.tapTarget');
+ $(window).off('resize.tapTarget');
+ };
+
+ // Pre calculate
+ var calculateTapTarget = function() {
+ // Element or parent is fixed position?
+ var isFixed = origin.css('position') === 'fixed';
+ if (!isFixed) {
+ var parents = origin.parents();
+ for(var i = 0; i < parents.length; i++) {
+ isFixed = $(parents[i]).css('position') == 'fixed';
+ if (isFixed) {
+ break;
+ }
+ }
+ }
+
+ // Calculating origin
+ var originWidth = origin.outerWidth();
+ var originHeight = origin.outerHeight();
+ var originTop = isFixed ? origin.offset().top - $(document).scrollTop() : origin.offset().top;
+ var originLeft = isFixed ? origin.offset().left - $(document).scrollLeft() : origin.offset().left;
+
+ // Calculating screen
+ var windowWidth = $(window).width();
+ var windowHeight = $(window).height();
+ var centerX = windowWidth / 2;
+ var centerY = windowHeight / 2;
+ var isLeft = originLeft <= centerX;
+ var isRight = originLeft > centerX;
+ var isTop = originTop <= centerY;
+ var isBottom = originTop > centerY;
+ var isCenterX = originLeft >= windowWidth*0.25 && originLeft <= windowWidth*0.75;
+ var isCenterY = originTop >= windowHeight*0.25 && originTop <= windowHeight*0.75;
+
+ // Calculating tap target
+ var tapTargetWidth = tapTargetEl.outerWidth();
+ var tapTargetHeight = tapTargetEl.outerHeight();
+ var tapTargetTop = originTop + originHeight/2 - tapTargetHeight/2;
+ var tapTargetLeft = originLeft + originWidth/2 - tapTargetWidth/2;
+ var tapTargetPosition = isFixed ? 'fixed' : 'absolute';
+
+ // Calculating content
+ var tapTargetTextWidth = isCenterX ? tapTargetWidth : tapTargetWidth/2 + originWidth;
+ var tapTargetTextHeight = tapTargetHeight/2;
+ var tapTargetTextTop = isTop ? tapTargetHeight/2 : 0;
+ var tapTargetTextBottom = 0;
+ var tapTargetTextLeft = isLeft && !isCenterX ? tapTargetWidth/2 - originWidth : 0;
+ var tapTargetTextRight = 0;
+ var tapTargetTextPadding = originWidth;
+ var tapTargetTextAlign = isBottom ? 'bottom' : 'top';
+
+ // Calculating wave
+ var tapTargetWaveWidth = originWidth > originHeight ? originWidth*2 : originWidth*2;
+ var tapTargetWaveHeight = tapTargetWaveWidth;
+ var tapTargetWaveTop = tapTargetHeight/2 - tapTargetWaveHeight/2;
+ var tapTargetWaveLeft = tapTargetWidth/2 - tapTargetWaveWidth/2;
+
+ // Setting tap target
+ var tapTargetWrapperCssObj = {};
+ tapTargetWrapperCssObj.top = isTop ? tapTargetTop : '';
+ tapTargetWrapperCssObj.right = isRight ? windowWidth - tapTargetLeft - tapTargetWidth : '';
+ tapTargetWrapperCssObj.bottom = isBottom ? windowHeight - tapTargetTop - tapTargetHeight : '';
+ tapTargetWrapperCssObj.left = isLeft ? tapTargetLeft : '';
+ tapTargetWrapperCssObj.position = tapTargetPosition;
+ tapTargetWrapper.css(tapTargetWrapperCssObj);
+
+ // Setting content
+ tapTargetContentEl.css({
+ width: tapTargetTextWidth,
+ height: tapTargetTextHeight,
+ top: tapTargetTextTop,
+ right: tapTargetTextRight,
+ bottom: tapTargetTextBottom,
+ left: tapTargetTextLeft,
+ padding: tapTargetTextPadding,
+ verticalAlign: tapTargetTextAlign
+ });
+
+ // Setting wave
+ tapTargetWave.css({
+ top: tapTargetWaveTop,
+ left: tapTargetWaveLeft,
+ width: tapTargetWaveWidth,
+ height: tapTargetWaveHeight
+ });
+ }
+
+ if (options == 'open') {
+ calculateTapTarget();
+ openTapTarget();
+ }
+
+ if (options == 'close')
+ closeTapTarget();
+ });
+ },
+ open: function() {},
+ close: function() {}
+ };
+
+ $.fn.tapTarget = function(methodOrOptions) {
+ if (methods[methodOrOptions] || typeof methodOrOptions === 'object')
+ return methods.init.apply( this, arguments );
+
+ $.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.tap-target' );
+ };
+
+}( jQuery ));
diff --git a/app/dispatch/static/materialize/js/toasts.js b/app/dispatch/static/materialize/js/toasts.js new file mode 100644 index 0000000..70abed8 --- /dev/null +++ b/app/dispatch/static/materialize/js/toasts.js @@ -0,0 +1,320 @@ +(function($, Vel) {
+ 'use strict';
+
+ let _defaults = {
+ displayLength: Infinity,
+ inDuration: 300,
+ outDuration: 375,
+ className: undefined,
+ completeCallback: undefined,
+ activationPercent: 0.8
+ };
+
+ class Toast {
+ constructor(message, displayLength, className, completeCallback) {
+ if (!message) {
+ return;
+ }
+
+
+ /**
+ * Options for the toast
+ * @member Toast#options
+ */
+ this.options = {
+ displayLength: displayLength,
+ className: className,
+ completeCallback: completeCallback
+ };
+
+ this.options = $.extend({}, Toast.defaults, this.options);
+ this.message = message;
+
+ /**
+ * Describes current pan state toast
+ * @type {Boolean}
+ */
+ this.panning = false;
+
+ /**
+ * Time remaining until toast is removed
+ */
+ this.timeRemaining = this.options.displayLength;
+
+ if (Toast._toasts.length === 0) {
+ Toast._createContainer();
+ }
+
+ // Create new toast
+ Toast._toasts.push(this);
+ let toastElement = this.createToast();
+ toastElement.M_Toast = this;
+ this.el = toastElement;
+ this._animateIn();
+ this.setTimer();
+ }
+
+ static get defaults() {
+ return _defaults;
+ }
+
+ /**
+ * Append toast container and add event handlers
+ */
+ static _createContainer() {
+ let container = document.createElement('div');
+ container.setAttribute('id', 'toast-container');
+
+ // Add event handler
+ container.addEventListener('touchstart', Toast._onDragStart);
+ container.addEventListener('touchmove', Toast._onDragMove);
+ container.addEventListener('touchend', Toast._onDragEnd);
+
+ container.addEventListener('mousedown', Toast._onDragStart);
+ document.addEventListener('mousemove', Toast._onDragMove);
+ document.addEventListener('mouseup', Toast._onDragEnd);
+
+ document.body.appendChild(container);
+ Toast._container = container;
+ }
+
+ /**
+ * Remove toast container and event handlers
+ */
+ static _removeContainer() {
+ // Add event handler
+ document.removeEventListener('mousemove', Toast._onDragMove);
+ document.removeEventListener('mouseup', Toast._onDragEnd);
+
+ Toast._container.parentNode.removeChild(Toast._container);
+ Toast._container = null;
+ }
+
+ /**
+ * Begin drag handler
+ * @param {Event} e
+ */
+ static _onDragStart(e) {
+ if (e.target && $(e.target).closest('.toast').length) {
+ let $toast = $(e.target).closest('.toast');
+ let toast = $toast[0].M_Toast;
+ toast.panning = true;
+ Toast._draggedToast = toast;
+ toast.el.classList.add('panning');
+ toast.el.style.transition = '';
+ toast.startingXPos = Toast._xPos(e);
+ toast.time = Date.now();
+ toast.xPos = Toast._xPos(e);
+ }
+ }
+
+ /**
+ * Drag move handler
+ * @param {Event} e
+ */
+ static _onDragMove(e) {
+ if (!!Toast._draggedToast) {
+ e.preventDefault();
+ let toast = Toast._draggedToast;
+ toast.deltaX = Math.abs(toast.xPos - Toast._xPos(e));
+ toast.xPos = Toast._xPos(e);
+ toast.velocityX = toast.deltaX / (Date.now() - toast.time);
+ toast.time = Date.now();
+
+ let totalDeltaX = toast.xPos - toast.startingXPos;
+ let activationDistance =
+ toast.el.offsetWidth * toast.options.activationPercent;
+ toast.el.style.transform = `translateX(${totalDeltaX}px)`;
+ toast.el.style.opacity = 1-Math.abs(totalDeltaX / activationDistance);
+ }
+ }
+
+ /**
+ * End drag handler
+ * @param {Event} e
+ */
+ static _onDragEnd(e) {
+ if (!!Toast._draggedToast) {
+ let toast = Toast._draggedToast;
+ toast.panning = false;
+ toast.el.classList.remove('panning');
+
+ let totalDeltaX = toast.xPos - toast.startingXPos;
+ let activationDistance =
+ toast.el.offsetWidth * toast.options.activationPercent;
+ let shouldBeDismissed = Math.abs(totalDeltaX) > activationDistance ||
+ toast.velocityX > 1;
+
+ // Remove toast
+ if (shouldBeDismissed) {
+ toast.wasSwiped = true;
+ toast.remove();
+
+ // Animate toast back to original position
+ } else {
+ toast.el.style.transition = 'transform .2s, opacity .2s';
+ toast.el.style.transform = '';
+ toast.el.style.opacity = '';
+ }
+ Toast._draggedToast = null;
+ }
+ }
+
+ /**
+ * Get x position of mouse or touch event
+ * @param {Event} e
+ */
+ static _xPos(e) {
+ if (e.targetTouches && (e.targetTouches.length >= 1)) {
+ return e.targetTouches[0].clientX;
+ }
+ // mouse event
+ return e.clientX;
+ }
+
+ /**
+ * Remove all toasts
+ */
+ static removeAll() {
+ for(let toastIndex in Toast._toasts) {
+ Toast._toasts[toastIndex].remove();
+ }
+ }
+
+
+ /**
+ * Create toast and append it to toast container
+ */
+ createToast() {
+ let toast = document.createElement('div');
+ toast.classList.add('toast');
+
+ // Add custom classes onto toast
+ if (this.options.className) {
+ let classes = this.options.className.split(' ');
+ let i, count;
+ for (i = 0, count = classes.length; i < count; i++) {
+ toast.classList.add(classes[i]);
+ }
+ }
+
+ // Set content
+ if ( typeof HTMLElement === 'object' ?
+ this.message instanceof HTMLElement :
+ this.message && typeof this.message === 'object' &&
+ this.message !== null && this.message.nodeType === 1 &&
+ typeof this.message.nodeName==='string'
+ ) {
+ toast.appendChild(this.message);
+
+ // Check if it is jQuery object
+ } else if (this.message instanceof jQuery) {
+ $(toast).append(this.message);
+
+ // Insert as text;
+ } else {
+ toast.innerHTML = this.message;
+ }
+
+ // Append toasft
+ Toast._container.appendChild(toast);
+ return toast;
+ }
+
+ /**
+ * Animate in toast
+ */
+ _animateIn() {
+ // Animate toast in
+ Vel(this.el, {top: 0, opacity: 1 }, {
+ duration: 300,
+ easing: 'easeOutCubic',
+ queue: false
+ });
+ }
+
+
+ /**
+ * Create setInterval which automatically removes toast when timeRemaining >= 0
+ * has been reached
+ */
+ setTimer() {
+ if (this.timeRemaining !== Infinity) {
+ this.counterInterval = setInterval(() => {
+ // If toast is not being dragged, decrease its time remaining
+ if (!this.panning) {
+ this.timeRemaining -= 20;
+ }
+
+ // Animate toast out
+ if (this.timeRemaining <= 0) {
+ this.remove();
+ }
+ }, 20);
+ }
+ }
+
+
+ /**
+ * Dismiss toast with animation
+ */
+ remove() {
+ window.clearInterval(this.counterInterval);
+ let activationDistance =
+ this.el.offsetWidth * this.options.activationPercent;
+
+ if(this.wasSwiped) {
+ this.el.style.transition = 'transform .05s, opacity .05s';
+ this.el.style.transform = `translateX(${activationDistance}px)`;
+ this.el.style.opacity = 0;
+ }
+
+ Vel(
+ this.el,
+ {opacity: 0, marginTop: '-40px'},
+ {
+ duration: this.options.outDuration,
+ easing: 'easeOutExpo',
+ queue: false,
+ complete: () => {
+ // Call the optional callback
+ if(typeof(this.options.completeCallback) === 'function') {
+ this.options.completeCallback();
+ }
+ // Remove toast from DOM
+ this.el.parentNode.removeChild(this.el);
+ Toast._toasts.splice(Toast._toasts.indexOf(this), 1);
+ if (Toast._toasts.length === 0) {
+ Toast._removeContainer();
+ }
+ }
+ }
+ );
+ }
+ }
+
+ /**
+ * @static
+ * @memberof Toast
+ * @type {Array.<Toast>}
+ */
+ Toast._toasts = [];
+
+ /**
+ * @static
+ * @memberof Toast
+ */
+ Toast._container = null;
+
+ /**
+ * @static
+ * @memberof Toast
+ * @type {Toast}
+ */
+ Toast._draggedToast = null;
+
+ Materialize.Toast = Toast;
+ Materialize.toast = function(message, displayLength, className, completeCallback) {
+ return new Toast(message, displayLength, className, completeCallback);
+ };
+})(jQuery, Materialize.Vel);
diff --git a/app/dispatch/static/materialize/js/tooltip.js b/app/dispatch/static/materialize/js/tooltip.js new file mode 100644 index 0000000..c75ddd0 --- /dev/null +++ b/app/dispatch/static/materialize/js/tooltip.js @@ -0,0 +1,239 @@ +(function ($) {
+ $.fn.tooltip = function (options) {
+ var timeout = null,
+ margin = 5;
+
+ // Defaults
+ var defaults = {
+ delay: 350,
+ tooltip: '',
+ position: 'bottom',
+ html: false
+ };
+
+ // Remove tooltip from the activator
+ if (options === "remove") {
+ this.each(function() {
+ $('#' + $(this).attr('data-tooltip-id')).remove();
+ $(this).removeAttr('data-tooltip-id');
+ $(this).off('mouseenter.tooltip mouseleave.tooltip');
+ });
+ return false;
+ }
+
+ options = $.extend(defaults, options);
+
+ return this.each(function() {
+ var tooltipId = Materialize.guid();
+ var origin = $(this);
+
+ // Destroy old tooltip
+ if (origin.attr('data-tooltip-id')) {
+ $('#' + origin.attr('data-tooltip-id')).remove();
+ }
+
+ origin.attr('data-tooltip-id', tooltipId);
+
+ // Get attributes.
+ var allowHtml,
+ tooltipDelay,
+ tooltipPosition,
+ tooltipText,
+ tooltipEl,
+ backdrop;
+ var setAttributes = function() {
+ allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html;
+ tooltipDelay = origin.attr('data-delay');
+ tooltipDelay = (tooltipDelay === undefined || tooltipDelay === '') ?
+ options.delay : tooltipDelay;
+ tooltipPosition = origin.attr('data-position');
+ tooltipPosition = (tooltipPosition === undefined || tooltipPosition === '') ?
+ options.position : tooltipPosition;
+ tooltipText = origin.attr('data-tooltip');
+ tooltipText = (tooltipText === undefined || tooltipText === '') ?
+ options.tooltip : tooltipText;
+ };
+ setAttributes();
+
+ var renderTooltipEl = function() {
+ var tooltip = $('<div class="material-tooltip"></div>');
+
+ // Create Text span
+ if (allowHtml) {
+ tooltipText = $('<span></span>').html(tooltipText);
+ } else{
+ tooltipText = $('<span></span>').text(tooltipText);
+ }
+
+ // Create tooltip
+ tooltip.append(tooltipText)
+ .appendTo($('body'))
+ .attr('id', tooltipId);
+
+ // Create backdrop
+ backdrop = $('<div class="backdrop"></div>');
+ backdrop.appendTo(tooltip);
+ return tooltip;
+ };
+ tooltipEl = renderTooltipEl();
+
+ // Destroy previously binded events
+ origin.off('mouseenter.tooltip mouseleave.tooltip');
+ // Mouse In
+ var started = false, timeoutRef;
+ origin.on({'mouseenter.tooltip': function(e) {
+ var showTooltip = function() {
+ setAttributes();
+ started = true;
+ tooltipEl.velocity('stop');
+ backdrop.velocity('stop');
+ tooltipEl.css({ visibility: 'visible', left: '0px', top: '0px' });
+
+ // Tooltip positioning
+ var originWidth = origin.outerWidth();
+ var originHeight = origin.outerHeight();
+ var tooltipHeight = tooltipEl.outerHeight();
+ var tooltipWidth = tooltipEl.outerWidth();
+ var tooltipVerticalMovement = '0px';
+ var tooltipHorizontalMovement = '0px';
+ var backdropOffsetWidth = backdrop[0].offsetWidth;
+ var backdropOffsetHeight = backdrop[0].offsetHeight;
+ var scaleXFactor = 8;
+ var scaleYFactor = 8;
+ var scaleFactor = 0;
+ var targetTop, targetLeft, newCoordinates;
+
+ if (tooltipPosition === "top") {
+ // Top Position
+ targetTop = origin.offset().top - tooltipHeight - margin;
+ targetLeft = origin.offset().left + originWidth/2 - tooltipWidth/2;
+ newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+ tooltipVerticalMovement = '-10px';
+ backdrop.css({
+ bottom: 0,
+ left: 0,
+ borderRadius: '14px 14px 0 0',
+ transformOrigin: '50% 100%',
+ marginTop: tooltipHeight,
+ marginLeft: (tooltipWidth/2) - (backdropOffsetWidth/2)
+ });
+ }
+ // Left Position
+ else if (tooltipPosition === "left") {
+ targetTop = origin.offset().top + originHeight/2 - tooltipHeight/2;
+ targetLeft = origin.offset().left - tooltipWidth - margin;
+ newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+
+ tooltipHorizontalMovement = '-10px';
+ backdrop.css({
+ top: '-7px',
+ right: 0,
+ width: '14px',
+ height: '14px',
+ borderRadius: '14px 0 0 14px',
+ transformOrigin: '95% 50%',
+ marginTop: tooltipHeight/2,
+ marginLeft: tooltipWidth
+ });
+ }
+ // Right Position
+ else if (tooltipPosition === "right") {
+ targetTop = origin.offset().top + originHeight/2 - tooltipHeight/2;
+ targetLeft = origin.offset().left + originWidth + margin;
+ newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+
+ tooltipHorizontalMovement = '+10px';
+ backdrop.css({
+ top: '-7px',
+ left: 0,
+ width: '14px',
+ height: '14px',
+ borderRadius: '0 14px 14px 0',
+ transformOrigin: '5% 50%',
+ marginTop: tooltipHeight/2,
+ marginLeft: '0px'
+ });
+ }
+ else {
+ // Bottom Position
+ targetTop = origin.offset().top + origin.outerHeight() + margin;
+ targetLeft = origin.offset().left + originWidth/2 - tooltipWidth/2;
+ newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
+ tooltipVerticalMovement = '+10px';
+ backdrop.css({
+ top: 0,
+ left: 0,
+ marginLeft: (tooltipWidth/2) - (backdropOffsetWidth/2)
+ });
+ }
+
+ // Set tooptip css placement
+ tooltipEl.css({
+ top: newCoordinates.y,
+ left: newCoordinates.x
+ });
+
+ // Calculate Scale to fill
+ scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth);
+ scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight);
+ scaleFactor = Math.max(scaleXFactor, scaleYFactor);
+
+ tooltipEl.velocity({ translateY: tooltipVerticalMovement, translateX: tooltipHorizontalMovement}, { duration: 350, queue: false })
+ .velocity({opacity: 1}, {duration: 300, delay: 50, queue: false});
+ backdrop.css({ visibility: 'visible' })
+ .velocity({opacity:1},{duration: 55, delay: 0, queue: false})
+ .velocity({scaleX: scaleFactor, scaleY: scaleFactor}, {duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad'});
+ };
+
+ timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval
+
+ // Mouse Out
+ },
+ 'mouseleave.tooltip': function(){
+ // Reset State
+ started = false;
+ clearTimeout(timeoutRef);
+
+ // Animate back
+ setTimeout(function() {
+ if (started !== true) {
+ tooltipEl.velocity({
+ opacity: 0, translateY: 0, translateX: 0}, { duration: 225, queue: false});
+ backdrop.velocity({opacity: 0, scaleX: 1, scaleY: 1}, {
+ duration:225,
+ queue: false,
+ complete: function(){
+ backdrop.css({ visibility: 'hidden' });
+ tooltipEl.css({ visibility: 'hidden' });
+ started = false;}
+ });
+ }
+ },225);
+ }
+ });
+ });
+ };
+
+ var repositionWithinScreen = function(x, y, width, height) {
+ var newX = x;
+ var newY = y;
+
+ if (newX < 0) {
+ newX = 4;
+ } else if (newX + width > window.innerWidth) {
+ newX -= newX + width - window.innerWidth;
+ }
+
+ if (newY < 0) {
+ newY = 4;
+ } else if (newY + height > window.innerHeight + $(window).scrollTop) {
+ newY -= newY + height - window.innerHeight;
+ }
+
+ return {x: newX, y: newY};
+ };
+
+ $(document).ready(function(){
+ $('.tooltipped').tooltip();
+ });
+}( jQuery ));
diff --git a/app/dispatch/static/materialize/js/transitions.js b/app/dispatch/static/materialize/js/transitions.js new file mode 100644 index 0000000..5460279 --- /dev/null +++ b/app/dispatch/static/materialize/js/transitions.js @@ -0,0 +1,169 @@ +(function ($) {
+ // Image transition function
+ Materialize.fadeInImage = function(selectorOrEl) {
+ var element;
+ if (typeof(selectorOrEl) === 'string') {
+ element = $(selectorOrEl);
+ } else if (typeof(selectorOrEl) === 'object') {
+ element = selectorOrEl;
+ } else {
+ return;
+ }
+ element.css({opacity: 0});
+ $(element).velocity({opacity: 1}, {
+ duration: 650,
+ queue: false,
+ easing: 'easeOutSine'
+ });
+ $(element).velocity({opacity: 1}, {
+ duration: 1300,
+ queue: false,
+ easing: 'swing',
+ step: function(now, fx) {
+ fx.start = 100;
+ var grayscale_setting = now/100;
+ var brightness_setting = 150 - (100 - now)/1.75;
+
+ if (brightness_setting < 100) {
+ brightness_setting = 100;
+ }
+ if (now >= 0) {
+ $(this).css({
+ "-webkit-filter": "grayscale("+grayscale_setting+")" + "brightness("+brightness_setting+"%)",
+ "filter": "grayscale("+grayscale_setting+")" + "brightness("+brightness_setting+"%)"
+ });
+ }
+ }
+ });
+ };
+
+ // Horizontal staggered list
+ Materialize.showStaggeredList = function(selectorOrEl) {
+ var element;
+ if (typeof(selectorOrEl) === 'string') {
+ element = $(selectorOrEl);
+ } else if (typeof(selectorOrEl) === 'object') {
+ element = selectorOrEl;
+ } else {
+ return;
+ }
+ var time = 0;
+ element.find('li').velocity(
+ { translateX: "-100px"},
+ { duration: 0 });
+
+ element.find('li').each(function() {
+ $(this).velocity(
+ { opacity: "1", translateX: "0"},
+ { duration: 800, delay: time, easing: [60, 10] });
+ time += 120;
+ });
+ };
+
+
+ $(document).ready(function() {
+ // Hardcoded .staggered-list scrollFire
+ // var staggeredListOptions = [];
+ // $('ul.staggered-list').each(function (i) {
+
+ // var label = 'scrollFire-' + i;
+ // $(this).addClass(label);
+ // staggeredListOptions.push(
+ // {selector: 'ul.staggered-list.' + label,
+ // offset: 200,
+ // callback: 'showStaggeredList("ul.staggered-list.' + label + '")'});
+ // });
+ // scrollFire(staggeredListOptions);
+
+ // HammerJS, Swipe navigation
+
+ // Touch Event
+ var swipeLeft = false;
+ var swipeRight = false;
+
+
+ // Dismissible Collections
+ $('.dismissable').each(function() {
+ $(this).hammer({
+ prevent_default: false
+ }).on('pan', function(e) {
+ if (e.gesture.pointerType === "touch") {
+ var $this = $(this);
+ var direction = e.gesture.direction;
+ var x = e.gesture.deltaX;
+ var velocityX = e.gesture.velocityX;
+
+ $this.velocity({ translateX: x
+ }, {duration: 50, queue: false, easing: 'easeOutQuad'});
+
+ // Swipe Left
+ if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.75)) {
+ swipeLeft = true;
+ }
+
+ // Swipe Right
+ if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.75)) {
+ swipeRight = true;
+ }
+ }
+ }).on('panend', function(e) {
+ // Reset if collection is moved back into original position
+ if (Math.abs(e.gesture.deltaX) < ($(this).innerWidth() / 2)) {
+ swipeRight = false;
+ swipeLeft = false;
+ }
+
+ if (e.gesture.pointerType === "touch") {
+ var $this = $(this);
+ if (swipeLeft || swipeRight) {
+ var fullWidth;
+ if (swipeLeft) { fullWidth = $this.innerWidth(); }
+ else { fullWidth = -1 * $this.innerWidth(); }
+
+ $this.velocity({ translateX: fullWidth,
+ }, {duration: 100, queue: false, easing: 'easeOutQuad', complete:
+ function() {
+ $this.css('border', 'none');
+ $this.velocity({ height: 0, padding: 0,
+ }, {duration: 200, queue: false, easing: 'easeOutQuad', complete:
+ function() { $this.remove(); }
+ });
+ }
+ });
+ }
+ else {
+ $this.velocity({ translateX: 0,
+ }, {duration: 100, queue: false, easing: 'easeOutQuad'});
+ }
+ swipeLeft = false;
+ swipeRight = false;
+ }
+ });
+
+ });
+
+
+ // time = 0
+ // // Vertical Staggered list
+ // $('ul.staggered-list.vertical li').velocity(
+ // { translateY: "100px"},
+ // { duration: 0 });
+
+ // $('ul.staggered-list.vertical li').each(function() {
+ // $(this).velocity(
+ // { opacity: "1", translateY: "0"},
+ // { duration: 800, delay: time, easing: [60, 25] });
+ // time += 120;
+ // });
+
+ // // Fade in and Scale
+ // $('.fade-in.scale').velocity(
+ // { scaleX: .4, scaleY: .4, translateX: -600},
+ // { duration: 0});
+ // $('.fade-in').each(function() {
+ // $(this).velocity(
+ // { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0},
+ // { duration: 800, easing: [60, 10] });
+ // });
+ });
+}( jQuery ));
diff --git a/app/dispatch/static/materialize/js/velocity.min.js b/app/dispatch/static/materialize/js/velocity.min.js new file mode 100644 index 0000000..b4a3de4 --- /dev/null +++ b/app/dispatch/static/materialize/js/velocity.min.js @@ -0,0 +1,5 @@ +/*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */
+/*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */
+/*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */
+jQuery.Velocity?console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity."):(!function(e){function t(e){var t=e.length,a=r.type(e);return"function"===a||r.isWindow(e)?!1:1===e.nodeType&&t?!0:"array"===a||0===t||"number"==typeof t&&t>0&&t-1 in e}if(!e.jQuery){var r=function(e,t){return new r.fn.init(e,t)};r.isWindow=function(e){return null!=e&&e==e.window},r.type=function(e){return null==e?e+"":"object"==typeof e||"function"==typeof e?n[i.call(e)]||"object":typeof e},r.isArray=Array.isArray||function(e){return"array"===r.type(e)},r.isPlainObject=function(e){var t;if(!e||"object"!==r.type(e)||e.nodeType||r.isWindow(e))return!1;try{if(e.constructor&&!o.call(e,"constructor")&&!o.call(e.constructor.prototype,"isPrototypeOf"))return!1}catch(a){return!1}for(t in e);return void 0===t||o.call(e,t)},r.each=function(e,r,a){var n,o=0,i=e.length,s=t(e);if(a){if(s)for(;i>o&&(n=r.apply(e[o],a),n!==!1);o++);else for(o in e)if(n=r.apply(e[o],a),n===!1)break}else if(s)for(;i>o&&(n=r.call(e[o],o,e[o]),n!==!1);o++);else for(o in e)if(n=r.call(e[o],o,e[o]),n===!1)break;return e},r.data=function(e,t,n){if(void 0===n){var o=e[r.expando],i=o&&a[o];if(void 0===t)return i;if(i&&t in i)return i[t]}else if(void 0!==t){var o=e[r.expando]||(e[r.expando]=++r.uuid);return a[o]=a[o]||{},a[o][t]=n,n}},r.removeData=function(e,t){var n=e[r.expando],o=n&&a[n];o&&r.each(t,function(e,t){delete o[t]})},r.extend=function(){var e,t,a,n,o,i,s=arguments[0]||{},l=1,u=arguments.length,c=!1;for("boolean"==typeof s&&(c=s,s=arguments[l]||{},l++),"object"!=typeof s&&"function"!==r.type(s)&&(s={}),l===u&&(s=this,l--);u>l;l++)if(null!=(o=arguments[l]))for(n in o)e=s[n],a=o[n],s!==a&&(c&&a&&(r.isPlainObject(a)||(t=r.isArray(a)))?(t?(t=!1,i=e&&r.isArray(e)?e:[]):i=e&&r.isPlainObject(e)?e:{},s[n]=r.extend(c,i,a)):void 0!==a&&(s[n]=a));return s},r.queue=function(e,a,n){function o(e,r){var a=r||[];return null!=e&&(t(Object(e))?!function(e,t){for(var r=+t.length,a=0,n=e.length;r>a;)e[n++]=t[a++];if(r!==r)for(;void 0!==t[a];)e[n++]=t[a++];return e.length=n,e}(a,"string"==typeof e?[e]:e):[].push.call(a,e)),a}if(e){a=(a||"fx")+"queue";var i=r.data(e,a);return n?(!i||r.isArray(n)?i=r.data(e,a,o(n)):i.push(n),i):i||[]}},r.dequeue=function(e,t){r.each(e.nodeType?[e]:e,function(e,a){t=t||"fx";var n=r.queue(a,t),o=n.shift();"inprogress"===o&&(o=n.shift()),o&&("fx"===t&&n.unshift("inprogress"),o.call(a,function(){r.dequeue(a,t)}))})},r.fn=r.prototype={init:function(e){if(e.nodeType)return this[0]=e,this;throw new Error("Not a DOM node.")},offset:function(){var t=this[0].getBoundingClientRect?this[0].getBoundingClientRect():{top:0,left:0};return{top:t.top+(e.pageYOffset||document.scrollTop||0)-(document.clientTop||0),left:t.left+(e.pageXOffset||document.scrollLeft||0)-(document.clientLeft||0)}},position:function(){function e(){for(var e=this.offsetParent||document;e&&"html"===!e.nodeType.toLowerCase&&"static"===e.style.position;)e=e.offsetParent;return e||document}var t=this[0],e=e.apply(t),a=this.offset(),n=/^(?:body|html)$/i.test(e.nodeName)?{top:0,left:0}:r(e).offset();return a.top-=parseFloat(t.style.marginTop)||0,a.left-=parseFloat(t.style.marginLeft)||0,e.style&&(n.top+=parseFloat(e.style.borderTopWidth)||0,n.left+=parseFloat(e.style.borderLeftWidth)||0),{top:a.top-n.top,left:a.left-n.left}}};var a={};r.expando="velocity"+(new Date).getTime(),r.uuid=0;for(var n={},o=n.hasOwnProperty,i=n.toString,s="Boolean Number String Function Array Date RegExp Object Error".split(" "),l=0;l<s.length;l++)n["[object "+s[l]+"]"]=s[l].toLowerCase();r.fn.init.prototype=r.fn,e.Velocity={Utilities:r}}}(window),function(e){"object"==typeof module&&"object"==typeof module.exports?module.exports=e():"function"==typeof define&&define.amd?define(e):e()}(function(){return function(e,t,r,a){function n(e){for(var t=-1,r=e?e.length:0,a=[];++t<r;){var n=e[t];n&&a.push(n)}return a}function o(e){return m.isWrapped(e)?e=[].slice.call(e):m.isNode(e)&&(e=[e]),e}function i(e){var t=f.data(e,"velocity");return null===t?a:t}function s(e){return function(t){return Math.round(t*e)*(1/e)}}function l(e,r,a,n){function o(e,t){return 1-3*t+3*e}function i(e,t){return 3*t-6*e}function s(e){return 3*e}function l(e,t,r){return((o(t,r)*e+i(t,r))*e+s(t))*e}function u(e,t,r){return 3*o(t,r)*e*e+2*i(t,r)*e+s(t)}function c(t,r){for(var n=0;m>n;++n){var o=u(r,e,a);if(0===o)return r;var i=l(r,e,a)-t;r-=i/o}return r}function p(){for(var t=0;b>t;++t)w[t]=l(t*x,e,a)}function f(t,r,n){var o,i,s=0;do i=r+(n-r)/2,o=l(i,e,a)-t,o>0?n=i:r=i;while(Math.abs(o)>h&&++s<v);return i}function d(t){for(var r=0,n=1,o=b-1;n!=o&&w[n]<=t;++n)r+=x;--n;var i=(t-w[n])/(w[n+1]-w[n]),s=r+i*x,l=u(s,e,a);return l>=y?c(t,s):0==l?s:f(t,r,r+x)}function g(){V=!0,(e!=r||a!=n)&&p()}var m=4,y=.001,h=1e-7,v=10,b=11,x=1/(b-1),S="Float32Array"in t;if(4!==arguments.length)return!1;for(var P=0;4>P;++P)if("number"!=typeof arguments[P]||isNaN(arguments[P])||!isFinite(arguments[P]))return!1;e=Math.min(e,1),a=Math.min(a,1),e=Math.max(e,0),a=Math.max(a,0);var w=S?new Float32Array(b):new Array(b),V=!1,C=function(t){return V||g(),e===r&&a===n?t:0===t?0:1===t?1:l(d(t),r,n)};C.getControlPoints=function(){return[{x:e,y:r},{x:a,y:n}]};var T="generateBezier("+[e,r,a,n]+")";return C.toString=function(){return T},C}function u(e,t){var r=e;return m.isString(e)?b.Easings[e]||(r=!1):r=m.isArray(e)&&1===e.length?s.apply(null,e):m.isArray(e)&&2===e.length?x.apply(null,e.concat([t])):m.isArray(e)&&4===e.length?l.apply(null,e):!1,r===!1&&(r=b.Easings[b.defaults.easing]?b.defaults.easing:v),r}function c(e){if(e){var t=(new Date).getTime(),r=b.State.calls.length;r>1e4&&(b.State.calls=n(b.State.calls));for(var o=0;r>o;o++)if(b.State.calls[o]){var s=b.State.calls[o],l=s[0],u=s[2],d=s[3],g=!!d,y=null;d||(d=b.State.calls[o][3]=t-16);for(var h=Math.min((t-d)/u.duration,1),v=0,x=l.length;x>v;v++){var P=l[v],V=P.element;if(i(V)){var C=!1;if(u.display!==a&&null!==u.display&&"none"!==u.display){if("flex"===u.display){var T=["-webkit-box","-moz-box","-ms-flexbox","-webkit-flex"];f.each(T,function(e,t){S.setPropertyValue(V,"display",t)})}S.setPropertyValue(V,"display",u.display)}u.visibility!==a&&"hidden"!==u.visibility&&S.setPropertyValue(V,"visibility",u.visibility);for(var k in P)if("element"!==k){var A,F=P[k],j=m.isString(F.easing)?b.Easings[F.easing]:F.easing;if(1===h)A=F.endValue;else{var E=F.endValue-F.startValue;if(A=F.startValue+E*j(h,u,E),!g&&A===F.currentValue)continue}if(F.currentValue=A,"tween"===k)y=A;else{if(S.Hooks.registered[k]){var H=S.Hooks.getRoot(k),N=i(V).rootPropertyValueCache[H];N&&(F.rootPropertyValue=N)}var L=S.setPropertyValue(V,k,F.currentValue+(0===parseFloat(A)?"":F.unitType),F.rootPropertyValue,F.scrollData);S.Hooks.registered[k]&&(i(V).rootPropertyValueCache[H]=S.Normalizations.registered[H]?S.Normalizations.registered[H]("extract",null,L[1]):L[1]),"transform"===L[0]&&(C=!0)}}u.mobileHA&&i(V).transformCache.translate3d===a&&(i(V).transformCache.translate3d="(0px, 0px, 0px)",C=!0),C&&S.flushTransformCache(V)}}u.display!==a&&"none"!==u.display&&(b.State.calls[o][2].display=!1),u.visibility!==a&&"hidden"!==u.visibility&&(b.State.calls[o][2].visibility=!1),u.progress&&u.progress.call(s[1],s[1],h,Math.max(0,d+u.duration-t),d,y),1===h&&p(o)}}b.State.isTicking&&w(c)}function p(e,t){if(!b.State.calls[e])return!1;for(var r=b.State.calls[e][0],n=b.State.calls[e][1],o=b.State.calls[e][2],s=b.State.calls[e][4],l=!1,u=0,c=r.length;c>u;u++){var p=r[u].element;if(t||o.loop||("none"===o.display&&S.setPropertyValue(p,"display",o.display),"hidden"===o.visibility&&S.setPropertyValue(p,"visibility",o.visibility)),o.loop!==!0&&(f.queue(p)[1]===a||!/\.velocityQueueEntryFlag/i.test(f.queue(p)[1]))&&i(p)){i(p).isAnimating=!1,i(p).rootPropertyValueCache={};var d=!1;f.each(S.Lists.transforms3D,function(e,t){var r=/^scale/.test(t)?1:0,n=i(p).transformCache[t];i(p).transformCache[t]!==a&&new RegExp("^\\("+r+"[^.]").test(n)&&(d=!0,delete i(p).transformCache[t])}),o.mobileHA&&(d=!0,delete i(p).transformCache.translate3d),d&&S.flushTransformCache(p),S.Values.removeClass(p,"velocity-animating")}if(!t&&o.complete&&!o.loop&&u===c-1)try{o.complete.call(n,n)}catch(g){setTimeout(function(){throw g},1)}s&&o.loop!==!0&&s(n),i(p)&&o.loop===!0&&!t&&(f.each(i(p).tweensContainer,function(e,t){/^rotate/.test(e)&&360===parseFloat(t.endValue)&&(t.endValue=0,t.startValue=360),/^backgroundPosition/.test(e)&&100===parseFloat(t.endValue)&&"%"===t.unitType&&(t.endValue=0,t.startValue=100)}),b(p,"reverse",{loop:!0,delay:o.delay})),o.queue!==!1&&f.dequeue(p,o.queue)}b.State.calls[e]=!1;for(var m=0,y=b.State.calls.length;y>m;m++)if(b.State.calls[m]!==!1){l=!0;break}l===!1&&(b.State.isTicking=!1,delete b.State.calls,b.State.calls=[])}var f,d=function(){if(r.documentMode)return r.documentMode;for(var e=7;e>4;e--){var t=r.createElement("div");if(t.innerHTML="<!--[if IE "+e+"]><span></span><![endif]-->",t.getElementsByTagName("span").length)return t=null,e}return a}(),g=function(){var e=0;return t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||function(t){var r,a=(new Date).getTime();return r=Math.max(0,16-(a-e)),e=a+r,setTimeout(function(){t(a+r)},r)}}(),m={isString:function(e){return"string"==typeof e},isArray:Array.isArray||function(e){return"[object Array]"===Object.prototype.toString.call(e)},isFunction:function(e){return"[object Function]"===Object.prototype.toString.call(e)},isNode:function(e){return e&&e.nodeType},isNodeList:function(e){return"object"==typeof e&&/^\[object (HTMLCollection|NodeList|Object)\]$/.test(Object.prototype.toString.call(e))&&e.length!==a&&(0===e.length||"object"==typeof e[0]&&e[0].nodeType>0)},isWrapped:function(e){return e&&(e.jquery||t.Zepto&&t.Zepto.zepto.isZ(e))},isSVG:function(e){return t.SVGElement&&e instanceof t.SVGElement},isEmptyObject:function(e){for(var t in e)return!1;return!0}},y=!1;if(e.fn&&e.fn.jquery?(f=e,y=!0):f=t.Velocity.Utilities,8>=d&&!y)throw new Error("Velocity: IE8 and below require jQuery to be loaded before Velocity.");if(7>=d)return void(jQuery.fn.velocity=jQuery.fn.animate);var h=400,v="swing",b={State:{isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),isAndroid:/Android/i.test(navigator.userAgent),isGingerbread:/Android 2\.3\.[3-7]/i.test(navigator.userAgent),isChrome:t.chrome,isFirefox:/Firefox/i.test(navigator.userAgent),prefixElement:r.createElement("div"),prefixMatches:{},scrollAnchor:null,scrollPropertyLeft:null,scrollPropertyTop:null,isTicking:!1,calls:[]},CSS:{},Utilities:f,Redirects:{},Easings:{},Promise:t.Promise,defaults:{queue:"",duration:h,easing:v,begin:a,complete:a,progress:a,display:a,visibility:a,loop:!1,delay:!1,mobileHA:!0,_cacheValues:!0},init:function(e){f.data(e,"velocity",{isSVG:m.isSVG(e),isAnimating:!1,computedStyle:null,tweensContainer:null,rootPropertyValueCache:{},transformCache:{}})},hook:null,mock:!1,version:{major:1,minor:2,patch:2},debug:!1};t.pageYOffset!==a?(b.State.scrollAnchor=t,b.State.scrollPropertyLeft="pageXOffset",b.State.scrollPropertyTop="pageYOffset"):(b.State.scrollAnchor=r.documentElement||r.body.parentNode||r.body,b.State.scrollPropertyLeft="scrollLeft",b.State.scrollPropertyTop="scrollTop");var x=function(){function e(e){return-e.tension*e.x-e.friction*e.v}function t(t,r,a){var n={x:t.x+a.dx*r,v:t.v+a.dv*r,tension:t.tension,friction:t.friction};return{dx:n.v,dv:e(n)}}function r(r,a){var n={dx:r.v,dv:e(r)},o=t(r,.5*a,n),i=t(r,.5*a,o),s=t(r,a,i),l=1/6*(n.dx+2*(o.dx+i.dx)+s.dx),u=1/6*(n.dv+2*(o.dv+i.dv)+s.dv);return r.x=r.x+l*a,r.v=r.v+u*a,r}return function a(e,t,n){var o,i,s,l={x:-1,v:0,tension:null,friction:null},u=[0],c=0,p=1e-4,f=.016;for(e=parseFloat(e)||500,t=parseFloat(t)||20,n=n||null,l.tension=e,l.friction=t,o=null!==n,o?(c=a(e,t),i=c/n*f):i=f;s=r(s||l,i),u.push(1+s.x),c+=16,Math.abs(s.x)>p&&Math.abs(s.v)>p;);return o?function(e){return u[e*(u.length-1)|0]}:c}}();b.Easings={linear:function(e){return e},swing:function(e){return.5-Math.cos(e*Math.PI)/2},spring:function(e){return 1-Math.cos(4.5*e*Math.PI)*Math.exp(6*-e)}},f.each([["ease",[.25,.1,.25,1]],["ease-in",[.42,0,1,1]],["ease-out",[0,0,.58,1]],["ease-in-out",[.42,0,.58,1]],["easeInSine",[.47,0,.745,.715]],["easeOutSine",[.39,.575,.565,1]],["easeInOutSine",[.445,.05,.55,.95]],["easeInQuad",[.55,.085,.68,.53]],["easeOutQuad",[.25,.46,.45,.94]],["easeInOutQuad",[.455,.03,.515,.955]],["easeInCubic",[.55,.055,.675,.19]],["easeOutCubic",[.215,.61,.355,1]],["easeInOutCubic",[.645,.045,.355,1]],["easeInQuart",[.895,.03,.685,.22]],["easeOutQuart",[.165,.84,.44,1]],["easeInOutQuart",[.77,0,.175,1]],["easeInQuint",[.755,.05,.855,.06]],["easeOutQuint",[.23,1,.32,1]],["easeInOutQuint",[.86,0,.07,1]],["easeInExpo",[.95,.05,.795,.035]],["easeOutExpo",[.19,1,.22,1]],["easeInOutExpo",[1,0,0,1]],["easeInCirc",[.6,.04,.98,.335]],["easeOutCirc",[.075,.82,.165,1]],["easeInOutCirc",[.785,.135,.15,.86]]],function(e,t){b.Easings[t[0]]=l.apply(null,t[1])});var S=b.CSS={RegEx:{isHex:/^#([A-f\d]{3}){1,2}$/i,valueUnwrap:/^[A-z]+\((.*)\)$/i,wrappedValueAlreadyExtracted:/[0-9.]+ [0-9.]+ [0-9.]+( [0-9.]+)?/,valueSplit:/([A-z]+\(.+\))|(([A-z0-9#-.]+?)(?=\s|$))/gi},Lists:{colors:["fill","stroke","stopColor","color","backgroundColor","borderColor","borderTopColor","borderRightColor","borderBottomColor","borderLeftColor","outlineColor"],transformsBase:["translateX","translateY","scale","scaleX","scaleY","skewX","skewY","rotateZ"],transforms3D:["transformPerspective","translateZ","scaleZ","rotateX","rotateY"]},Hooks:{templates:{textShadow:["Color X Y Blur","black 0px 0px 0px"],boxShadow:["Color X Y Blur Spread","black 0px 0px 0px 0px"],clip:["Top Right Bottom Left","0px 0px 0px 0px"],backgroundPosition:["X Y","0% 0%"],transformOrigin:["X Y Z","50% 50% 0px"],perspectiveOrigin:["X Y","50% 50%"]},registered:{},register:function(){for(var e=0;e<S.Lists.colors.length;e++){var t="color"===S.Lists.colors[e]?"0 0 0 1":"255 255 255 1";S.Hooks.templates[S.Lists.colors[e]]=["Red Green Blue Alpha",t]}var r,a,n;if(d)for(r in S.Hooks.templates){a=S.Hooks.templates[r],n=a[0].split(" ");var o=a[1].match(S.RegEx.valueSplit);"Color"===n[0]&&(n.push(n.shift()),o.push(o.shift()),S.Hooks.templates[r]=[n.join(" "),o.join(" ")])}for(r in S.Hooks.templates){a=S.Hooks.templates[r],n=a[0].split(" ");for(var e in n){var i=r+n[e],s=e;S.Hooks.registered[i]=[r,s]}}},getRoot:function(e){var t=S.Hooks.registered[e];return t?t[0]:e},cleanRootPropertyValue:function(e,t){return S.RegEx.valueUnwrap.test(t)&&(t=t.match(S.RegEx.valueUnwrap)[1]),S.Values.isCSSNullValue(t)&&(t=S.Hooks.templates[e][1]),t},extractValue:function(e,t){var r=S.Hooks.registered[e];if(r){var a=r[0],n=r[1];return t=S.Hooks.cleanRootPropertyValue(a,t),t.toString().match(S.RegEx.valueSplit)[n]}return t},injectValue:function(e,t,r){var a=S.Hooks.registered[e];if(a){var n,o,i=a[0],s=a[1];return r=S.Hooks.cleanRootPropertyValue(i,r),n=r.toString().match(S.RegEx.valueSplit),n[s]=t,o=n.join(" ")}return r}},Normalizations:{registered:{clip:function(e,t,r){switch(e){case"name":return"clip";case"extract":var a;return S.RegEx.wrappedValueAlreadyExtracted.test(r)?a=r:(a=r.toString().match(S.RegEx.valueUnwrap),a=a?a[1].replace(/,(\s+)?/g," "):r),a;case"inject":return"rect("+r+")"}},blur:function(e,t,r){switch(e){case"name":return b.State.isFirefox?"filter":"-webkit-filter";case"extract":var a=parseFloat(r);if(!a&&0!==a){var n=r.toString().match(/blur\(([0-9]+[A-z]+)\)/i);a=n?n[1]:0}return a;case"inject":return parseFloat(r)?"blur("+r+")":"none"}},opacity:function(e,t,r){if(8>=d)switch(e){case"name":return"filter";case"extract":var a=r.toString().match(/alpha\(opacity=(.*)\)/i);return r=a?a[1]/100:1;case"inject":return t.style.zoom=1,parseFloat(r)>=1?"":"alpha(opacity="+parseInt(100*parseFloat(r),10)+")"}else switch(e){case"name":return"opacity";case"extract":return r;case"inject":return r}}},register:function(){9>=d||b.State.isGingerbread||(S.Lists.transformsBase=S.Lists.transformsBase.concat(S.Lists.transforms3D));for(var e=0;e<S.Lists.transformsBase.length;e++)!function(){var t=S.Lists.transformsBase[e];S.Normalizations.registered[t]=function(e,r,n){switch(e){case"name":return"transform";case"extract":return i(r)===a||i(r).transformCache[t]===a?/^scale/i.test(t)?1:0:i(r).transformCache[t].replace(/[()]/g,"");case"inject":var o=!1;switch(t.substr(0,t.length-1)){case"translate":o=!/(%|px|em|rem|vw|vh|\d)$/i.test(n);break;case"scal":case"scale":b.State.isAndroid&&i(r).transformCache[t]===a&&1>n&&(n=1),o=!/(\d)$/i.test(n);break;case"skew":o=!/(deg|\d)$/i.test(n);break;case"rotate":o=!/(deg|\d)$/i.test(n)}return o||(i(r).transformCache[t]="("+n+")"),i(r).transformCache[t]}}}();for(var e=0;e<S.Lists.colors.length;e++)!function(){var t=S.Lists.colors[e];S.Normalizations.registered[t]=function(e,r,n){switch(e){case"name":return t;case"extract":var o;if(S.RegEx.wrappedValueAlreadyExtracted.test(n))o=n;else{var i,s={black:"rgb(0, 0, 0)",blue:"rgb(0, 0, 255)",gray:"rgb(128, 128, 128)",green:"rgb(0, 128, 0)",red:"rgb(255, 0, 0)",white:"rgb(255, 255, 255)"};/^[A-z]+$/i.test(n)?i=s[n]!==a?s[n]:s.black:S.RegEx.isHex.test(n)?i="rgb("+S.Values.hexToRgb(n).join(" ")+")":/^rgba?\(/i.test(n)||(i=s.black),o=(i||n).toString().match(S.RegEx.valueUnwrap)[1].replace(/,(\s+)?/g," ")}return 8>=d||3!==o.split(" ").length||(o+=" 1"),o;case"inject":return 8>=d?4===n.split(" ").length&&(n=n.split(/\s+/).slice(0,3).join(" ")):3===n.split(" ").length&&(n+=" 1"),(8>=d?"rgb":"rgba")+"("+n.replace(/\s+/g,",").replace(/\.(\d)+(?=,)/g,"")+")"}}}()}},Names:{camelCase:function(e){return e.replace(/-(\w)/g,function(e,t){return t.toUpperCase()})},SVGAttribute:function(e){var t="width|height|x|y|cx|cy|r|rx|ry|x1|x2|y1|y2";return(d||b.State.isAndroid&&!b.State.isChrome)&&(t+="|transform"),new RegExp("^("+t+")$","i").test(e)},prefixCheck:function(e){if(b.State.prefixMatches[e])return[b.State.prefixMatches[e],!0];for(var t=["","Webkit","Moz","ms","O"],r=0,a=t.length;a>r;r++){var n;if(n=0===r?e:t[r]+e.replace(/^\w/,function(e){return e.toUpperCase()}),m.isString(b.State.prefixElement.style[n]))return b.State.prefixMatches[e]=n,[n,!0]}return[e,!1]}},Values:{hexToRgb:function(e){var t,r=/^#?([a-f\d])([a-f\d])([a-f\d])$/i,a=/^#?([a-f\d]{2})([a-f\d]{2})([a-f\d]{2})$/i;return e=e.replace(r,function(e,t,r,a){return t+t+r+r+a+a}),t=a.exec(e),t?[parseInt(t[1],16),parseInt(t[2],16),parseInt(t[3],16)]:[0,0,0]},isCSSNullValue:function(e){return 0==e||/^(none|auto|transparent|(rgba\(0, ?0, ?0, ?0\)))$/i.test(e)},getUnitType:function(e){return/^(rotate|skew)/i.test(e)?"deg":/(^(scale|scaleX|scaleY|scaleZ|alpha|flexGrow|flexHeight|zIndex|fontWeight)$)|((opacity|red|green|blue|alpha)$)/i.test(e)?"":"px"},getDisplayType:function(e){var t=e&&e.tagName.toString().toLowerCase();return/^(b|big|i|small|tt|abbr|acronym|cite|code|dfn|em|kbd|strong|samp|var|a|bdo|br|img|map|object|q|script|span|sub|sup|button|input|label|select|textarea)$/i.test(t)?"inline":/^(li)$/i.test(t)?"list-item":/^(tr)$/i.test(t)?"table-row":/^(table)$/i.test(t)?"table":/^(tbody)$/i.test(t)?"table-row-group":"block"},addClass:function(e,t){e.classList?e.classList.add(t):e.className+=(e.className.length?" ":"")+t},removeClass:function(e,t){e.classList?e.classList.remove(t):e.className=e.className.toString().replace(new RegExp("(^|\\s)"+t.split(" ").join("|")+"(\\s|$)","gi")," ")}},getPropertyValue:function(e,r,n,o){function s(e,r){function n(){u&&S.setPropertyValue(e,"display","none")}var l=0;if(8>=d)l=f.css(e,r);else{var u=!1;if(/^(width|height)$/.test(r)&&0===S.getPropertyValue(e,"display")&&(u=!0,S.setPropertyValue(e,"display",S.Values.getDisplayType(e))),!o){if("height"===r&&"border-box"!==S.getPropertyValue(e,"boxSizing").toString().toLowerCase()){var c=e.offsetHeight-(parseFloat(S.getPropertyValue(e,"borderTopWidth"))||0)-(parseFloat(S.getPropertyValue(e,"borderBottomWidth"))||0)-(parseFloat(S.getPropertyValue(e,"paddingTop"))||0)-(parseFloat(S.getPropertyValue(e,"paddingBottom"))||0);return n(),c}if("width"===r&&"border-box"!==S.getPropertyValue(e,"boxSizing").toString().toLowerCase()){var p=e.offsetWidth-(parseFloat(S.getPropertyValue(e,"borderLeftWidth"))||0)-(parseFloat(S.getPropertyValue(e,"borderRightWidth"))||0)-(parseFloat(S.getPropertyValue(e,"paddingLeft"))||0)-(parseFloat(S.getPropertyValue(e,"paddingRight"))||0);return n(),p}}var g;g=i(e)===a?t.getComputedStyle(e,null):i(e).computedStyle?i(e).computedStyle:i(e).computedStyle=t.getComputedStyle(e,null),"borderColor"===r&&(r="borderTopColor"),l=9===d&&"filter"===r?g.getPropertyValue(r):g[r],(""===l||null===l)&&(l=e.style[r]),n()}if("auto"===l&&/^(top|right|bottom|left)$/i.test(r)){var m=s(e,"position");("fixed"===m||"absolute"===m&&/top|left/i.test(r))&&(l=f(e).position()[r]+"px")}return l}var l;if(S.Hooks.registered[r]){var u=r,c=S.Hooks.getRoot(u);n===a&&(n=S.getPropertyValue(e,S.Names.prefixCheck(c)[0])),S.Normalizations.registered[c]&&(n=S.Normalizations.registered[c]("extract",e,n)),l=S.Hooks.extractValue(u,n)}else if(S.Normalizations.registered[r]){var p,g;p=S.Normalizations.registered[r]("name",e),"transform"!==p&&(g=s(e,S.Names.prefixCheck(p)[0]),S.Values.isCSSNullValue(g)&&S.Hooks.templates[r]&&(g=S.Hooks.templates[r][1])),l=S.Normalizations.registered[r]("extract",e,g)}if(!/^[\d-]/.test(l))if(i(e)&&i(e).isSVG&&S.Names.SVGAttribute(r))if(/^(height|width)$/i.test(r))try{l=e.getBBox()[r]}catch(m){l=0}else l=e.getAttribute(r);else l=s(e,S.Names.prefixCheck(r)[0]);return S.Values.isCSSNullValue(l)&&(l=0),b.debug>=2&&console.log("Get "+r+": "+l),l},setPropertyValue:function(e,r,a,n,o){var s=r;if("scroll"===r)o.container?o.container["scroll"+o.direction]=a:"Left"===o.direction?t.scrollTo(a,o.alternateValue):t.scrollTo(o.alternateValue,a);else if(S.Normalizations.registered[r]&&"transform"===S.Normalizations.registered[r]("name",e))S.Normalizations.registered[r]("inject",e,a),s="transform",a=i(e).transformCache[r];else{if(S.Hooks.registered[r]){var l=r,u=S.Hooks.getRoot(r);n=n||S.getPropertyValue(e,u),a=S.Hooks.injectValue(l,a,n),r=u}if(S.Normalizations.registered[r]&&(a=S.Normalizations.registered[r]("inject",e,a),r=S.Normalizations.registered[r]("name",e)),s=S.Names.prefixCheck(r)[0],8>=d)try{e.style[s]=a}catch(c){b.debug&&console.log("Browser does not support ["+a+"] for ["+s+"]")}else i(e)&&i(e).isSVG&&S.Names.SVGAttribute(r)?e.setAttribute(r,a):e.style[s]=a;b.debug>=2&&console.log("Set "+r+" ("+s+"): "+a)}return[s,a]},flushTransformCache:function(e){function t(t){return parseFloat(S.getPropertyValue(e,t))}var r="";if((d||b.State.isAndroid&&!b.State.isChrome)&&i(e).isSVG){var a={translate:[t("translateX"),t("translateY")],skewX:[t("skewX")],skewY:[t("skewY")],scale:1!==t("scale")?[t("scale"),t("scale")]:[t("scaleX"),t("scaleY")],rotate:[t("rotateZ"),0,0]};f.each(i(e).transformCache,function(e){/^translate/i.test(e)?e="translate":/^scale/i.test(e)?e="scale":/^rotate/i.test(e)&&(e="rotate"),a[e]&&(r+=e+"("+a[e].join(" ")+") ",delete a[e])})}else{var n,o;f.each(i(e).transformCache,function(t){return n=i(e).transformCache[t],"transformPerspective"===t?(o=n,!0):(9===d&&"rotateZ"===t&&(t="rotate"),void(r+=t+n+" "))}),o&&(r="perspective"+o+" "+r)}S.setPropertyValue(e,"transform",r)}};S.Hooks.register(),S.Normalizations.register(),b.hook=function(e,t,r){var n=a;return e=o(e),f.each(e,function(e,o){if(i(o)===a&&b.init(o),r===a)n===a&&(n=b.CSS.getPropertyValue(o,t));else{var s=b.CSS.setPropertyValue(o,t,r);"transform"===s[0]&&b.CSS.flushTransformCache(o),n=s}}),n};var P=function(){function e(){return s?k.promise||null:l}function n(){function e(e){function p(e,t){var r=a,n=a,i=a;return m.isArray(e)?(r=e[0],!m.isArray(e[1])&&/^[\d-]/.test(e[1])||m.isFunction(e[1])||S.RegEx.isHex.test(e[1])?i=e[1]:(m.isString(e[1])&&!S.RegEx.isHex.test(e[1])||m.isArray(e[1]))&&(n=t?e[1]:u(e[1],s.duration),e[2]!==a&&(i=e[2]))):r=e,t||(n=n||s.easing),m.isFunction(r)&&(r=r.call(o,V,w)),m.isFunction(i)&&(i=i.call(o,V,w)),[r||0,n,i]}function d(e,t){var r,a;return a=(t||"0").toString().toLowerCase().replace(/[%A-z]+$/,function(e){return r=e,""}),r||(r=S.Values.getUnitType(e)),[a,r]}function h(){var e={myParent:o.parentNode||r.body,position:S.getPropertyValue(o,"position"),fontSize:S.getPropertyValue(o,"fontSize")},a=e.position===L.lastPosition&&e.myParent===L.lastParent,n=e.fontSize===L.lastFontSize;L.lastParent=e.myParent,L.lastPosition=e.position,L.lastFontSize=e.fontSize;var s=100,l={};if(n&&a)l.emToPx=L.lastEmToPx,l.percentToPxWidth=L.lastPercentToPxWidth,l.percentToPxHeight=L.lastPercentToPxHeight;else{var u=i(o).isSVG?r.createElementNS("http://www.w3.org/2000/svg","rect"):r.createElement("div");b.init(u),e.myParent.appendChild(u),f.each(["overflow","overflowX","overflowY"],function(e,t){b.CSS.setPropertyValue(u,t,"hidden")}),b.CSS.setPropertyValue(u,"position",e.position),b.CSS.setPropertyValue(u,"fontSize",e.fontSize),b.CSS.setPropertyValue(u,"boxSizing","content-box"),f.each(["minWidth","maxWidth","width","minHeight","maxHeight","height"],function(e,t){b.CSS.setPropertyValue(u,t,s+"%")}),b.CSS.setPropertyValue(u,"paddingLeft",s+"em"),l.percentToPxWidth=L.lastPercentToPxWidth=(parseFloat(S.getPropertyValue(u,"width",null,!0))||1)/s,l.percentToPxHeight=L.lastPercentToPxHeight=(parseFloat(S.getPropertyValue(u,"height",null,!0))||1)/s,l.emToPx=L.lastEmToPx=(parseFloat(S.getPropertyValue(u,"paddingLeft"))||1)/s,e.myParent.removeChild(u)}return null===L.remToPx&&(L.remToPx=parseFloat(S.getPropertyValue(r.body,"fontSize"))||16),null===L.vwToPx&&(L.vwToPx=parseFloat(t.innerWidth)/100,L.vhToPx=parseFloat(t.innerHeight)/100),l.remToPx=L.remToPx,l.vwToPx=L.vwToPx,l.vhToPx=L.vhToPx,b.debug>=1&&console.log("Unit ratios: "+JSON.stringify(l),o),l}if(s.begin&&0===V)try{s.begin.call(g,g)}catch(x){setTimeout(function(){throw x},1)}if("scroll"===A){var P,C,T,F=/^x$/i.test(s.axis)?"Left":"Top",j=parseFloat(s.offset)||0;s.container?m.isWrapped(s.container)||m.isNode(s.container)?(s.container=s.container[0]||s.container,P=s.container["scroll"+F],T=P+f(o).position()[F.toLowerCase()]+j):s.container=null:(P=b.State.scrollAnchor[b.State["scrollProperty"+F]],C=b.State.scrollAnchor[b.State["scrollProperty"+("Left"===F?"Top":"Left")]],T=f(o).offset()[F.toLowerCase()]+j),l={scroll:{rootPropertyValue:!1,startValue:P,currentValue:P,endValue:T,unitType:"",easing:s.easing,scrollData:{container:s.container,direction:F,alternateValue:C}},element:o},b.debug&&console.log("tweensContainer (scroll): ",l.scroll,o)}else if("reverse"===A){if(!i(o).tweensContainer)return void f.dequeue(o,s.queue);"none"===i(o).opts.display&&(i(o).opts.display="auto"),"hidden"===i(o).opts.visibility&&(i(o).opts.visibility="visible"),i(o).opts.loop=!1,i(o).opts.begin=null,i(o).opts.complete=null,v.easing||delete s.easing,v.duration||delete s.duration,s=f.extend({},i(o).opts,s);var E=f.extend(!0,{},i(o).tweensContainer);for(var H in E)if("element"!==H){var N=E[H].startValue;E[H].startValue=E[H].currentValue=E[H].endValue,E[H].endValue=N,m.isEmptyObject(v)||(E[H].easing=s.easing),b.debug&&console.log("reverse tweensContainer ("+H+"): "+JSON.stringify(E[H]),o)}l=E}else if("start"===A){var E;i(o).tweensContainer&&i(o).isAnimating===!0&&(E=i(o).tweensContainer),f.each(y,function(e,t){if(RegExp("^"+S.Lists.colors.join("$|^")+"$").test(e)){var r=p(t,!0),n=r[0],o=r[1],i=r[2];if(S.RegEx.isHex.test(n)){for(var s=["Red","Green","Blue"],l=S.Values.hexToRgb(n),u=i?S.Values.hexToRgb(i):a,c=0;c<s.length;c++){var f=[l[c]];o&&f.push(o),u!==a&&f.push(u[c]),y[e+s[c]]=f}delete y[e]}}});for(var z in y){var O=p(y[z]),q=O[0],$=O[1],M=O[2];z=S.Names.camelCase(z);var I=S.Hooks.getRoot(z),B=!1;if(i(o).isSVG||"tween"===I||S.Names.prefixCheck(I)[1]!==!1||S.Normalizations.registered[I]!==a){(s.display!==a&&null!==s.display&&"none"!==s.display||s.visibility!==a&&"hidden"!==s.visibility)&&/opacity|filter/.test(z)&&!M&&0!==q&&(M=0),s._cacheValues&&E&&E[z]?(M===a&&(M=E[z].endValue+E[z].unitType),B=i(o).rootPropertyValueCache[I]):S.Hooks.registered[z]?M===a?(B=S.getPropertyValue(o,I),M=S.getPropertyValue(o,z,B)):B=S.Hooks.templates[I][1]:M===a&&(M=S.getPropertyValue(o,z));var W,G,Y,D=!1;if(W=d(z,M),M=W[0],Y=W[1],W=d(z,q),q=W[0].replace(/^([+-\/*])=/,function(e,t){return D=t,""}),G=W[1],M=parseFloat(M)||0,q=parseFloat(q)||0,"%"===G&&(/^(fontSize|lineHeight)$/.test(z)?(q/=100,G="em"):/^scale/.test(z)?(q/=100,G=""):/(Red|Green|Blue)$/i.test(z)&&(q=q/100*255,G="")),/[\/*]/.test(D))G=Y;else if(Y!==G&&0!==M)if(0===q)G=Y;else{n=n||h();var Q=/margin|padding|left|right|width|text|word|letter/i.test(z)||/X$/.test(z)||"x"===z?"x":"y";switch(Y){case"%":M*="x"===Q?n.percentToPxWidth:n.percentToPxHeight;break;case"px":break;default:M*=n[Y+"ToPx"]}switch(G){case"%":M*=1/("x"===Q?n.percentToPxWidth:n.percentToPxHeight);break;case"px":break;default:M*=1/n[G+"ToPx"]}}switch(D){case"+":q=M+q;break;case"-":q=M-q;break;case"*":q=M*q;break;case"/":q=M/q}l[z]={rootPropertyValue:B,startValue:M,currentValue:M,endValue:q,unitType:G,easing:$},b.debug&&console.log("tweensContainer ("+z+"): "+JSON.stringify(l[z]),o)}else b.debug&&console.log("Skipping ["+I+"] due to a lack of browser support.")}l.element=o}l.element&&(S.Values.addClass(o,"velocity-animating"),R.push(l),""===s.queue&&(i(o).tweensContainer=l,i(o).opts=s),i(o).isAnimating=!0,V===w-1?(b.State.calls.push([R,g,s,null,k.resolver]),b.State.isTicking===!1&&(b.State.isTicking=!0,c())):V++)}var n,o=this,s=f.extend({},b.defaults,v),l={};switch(i(o)===a&&b.init(o),parseFloat(s.delay)&&s.queue!==!1&&f.queue(o,s.queue,function(e){b.velocityQueueEntryFlag=!0,i(o).delayTimer={setTimeout:setTimeout(e,parseFloat(s.delay)),next:e}}),s.duration.toString().toLowerCase()){case"fast":s.duration=200;break;case"normal":s.duration=h;break;case"slow":s.duration=600;break;default:s.duration=parseFloat(s.duration)||1}b.mock!==!1&&(b.mock===!0?s.duration=s.delay=1:(s.duration*=parseFloat(b.mock)||1,s.delay*=parseFloat(b.mock)||1)),s.easing=u(s.easing,s.duration),s.begin&&!m.isFunction(s.begin)&&(s.begin=null),s.progress&&!m.isFunction(s.progress)&&(s.progress=null),s.complete&&!m.isFunction(s.complete)&&(s.complete=null),s.display!==a&&null!==s.display&&(s.display=s.display.toString().toLowerCase(),"auto"===s.display&&(s.display=b.CSS.Values.getDisplayType(o))),s.visibility!==a&&null!==s.visibility&&(s.visibility=s.visibility.toString().toLowerCase()),s.mobileHA=s.mobileHA&&b.State.isMobile&&!b.State.isGingerbread,s.queue===!1?s.delay?setTimeout(e,s.delay):e():f.queue(o,s.queue,function(t,r){return r===!0?(k.promise&&k.resolver(g),!0):(b.velocityQueueEntryFlag=!0,void e(t))}),""!==s.queue&&"fx"!==s.queue||"inprogress"===f.queue(o)[0]||f.dequeue(o)}var s,l,d,g,y,v,x=arguments[0]&&(arguments[0].p||f.isPlainObject(arguments[0].properties)&&!arguments[0].properties.names||m.isString(arguments[0].properties));if(m.isWrapped(this)?(s=!1,d=0,g=this,l=this):(s=!0,d=1,g=x?arguments[0].elements||arguments[0].e:arguments[0]),g=o(g)){x?(y=arguments[0].properties||arguments[0].p,v=arguments[0].options||arguments[0].o):(y=arguments[d],v=arguments[d+1]);var w=g.length,V=0;if(!/^(stop|finish)$/i.test(y)&&!f.isPlainObject(v)){var C=d+1;v={};for(var T=C;T<arguments.length;T++)m.isArray(arguments[T])||!/^(fast|normal|slow)$/i.test(arguments[T])&&!/^\d/.test(arguments[T])?m.isString(arguments[T])||m.isArray(arguments[T])?v.easing=arguments[T]:m.isFunction(arguments[T])&&(v.complete=arguments[T]):v.duration=arguments[T]}var k={promise:null,resolver:null,rejecter:null};s&&b.Promise&&(k.promise=new b.Promise(function(e,t){k.resolver=e,k.rejecter=t}));var A;switch(y){case"scroll":A="scroll";break;case"reverse":A="reverse";break;case"finish":case"stop":f.each(g,function(e,t){i(t)&&i(t).delayTimer&&(clearTimeout(i(t).delayTimer.setTimeout),i(t).delayTimer.next&&i(t).delayTimer.next(),delete i(t).delayTimer)});var F=[];return f.each(b.State.calls,function(e,t){t&&f.each(t[1],function(r,n){var o=v===a?"":v;return o===!0||t[2].queue===o||v===a&&t[2].queue===!1?void f.each(g,function(r,a){a===n&&((v===!0||m.isString(v))&&(f.each(f.queue(a,m.isString(v)?v:""),function(e,t){
+m.isFunction(t)&&t(null,!0)}),f.queue(a,m.isString(v)?v:"",[])),"stop"===y?(i(a)&&i(a).tweensContainer&&o!==!1&&f.each(i(a).tweensContainer,function(e,t){t.endValue=t.currentValue}),F.push(e)):"finish"===y&&(t[2].duration=1))}):!0})}),"stop"===y&&(f.each(F,function(e,t){p(t,!0)}),k.promise&&k.resolver(g)),e();default:if(!f.isPlainObject(y)||m.isEmptyObject(y)){if(m.isString(y)&&b.Redirects[y]){var j=f.extend({},v),E=j.duration,H=j.delay||0;return j.backwards===!0&&(g=f.extend(!0,[],g).reverse()),f.each(g,function(e,t){parseFloat(j.stagger)?j.delay=H+parseFloat(j.stagger)*e:m.isFunction(j.stagger)&&(j.delay=H+j.stagger.call(t,e,w)),j.drag&&(j.duration=parseFloat(E)||(/^(callout|transition)/.test(y)?1e3:h),j.duration=Math.max(j.duration*(j.backwards?1-e/w:(e+1)/w),.75*j.duration,200)),b.Redirects[y].call(t,t,j||{},e,w,g,k.promise?k:a)}),e()}var N="Velocity: First argument ("+y+") was not a property map, a known action, or a registered redirect. Aborting.";return k.promise?k.rejecter(new Error(N)):console.log(N),e()}A="start"}var L={lastParent:null,lastPosition:null,lastFontSize:null,lastPercentToPxWidth:null,lastPercentToPxHeight:null,lastEmToPx:null,remToPx:null,vwToPx:null,vhToPx:null},R=[];f.each(g,function(e,t){m.isNode(t)&&n.call(t)});var z,j=f.extend({},b.defaults,v);if(j.loop=parseInt(j.loop),z=2*j.loop-1,j.loop)for(var O=0;z>O;O++){var q={delay:j.delay,progress:j.progress};O===z-1&&(q.display=j.display,q.visibility=j.visibility,q.complete=j.complete),P(g,"reverse",q)}return e()}};b=f.extend(P,b),b.animate=P;var w=t.requestAnimationFrame||g;return b.State.isMobile||r.hidden===a||r.addEventListener("visibilitychange",function(){r.hidden?(w=function(e){return setTimeout(function(){e(!0)},16)},c()):w=t.requestAnimationFrame||g}),e.Velocity=b,e!==t&&(e.fn.velocity=P,e.fn.velocity.defaults=b.defaults),f.each(["Down","Up"],function(e,t){b.Redirects["slide"+t]=function(e,r,n,o,i,s){var l=f.extend({},r),u=l.begin,c=l.complete,p={height:"",marginTop:"",marginBottom:"",paddingTop:"",paddingBottom:""},d={};l.display===a&&(l.display="Down"===t?"inline"===b.CSS.Values.getDisplayType(e)?"inline-block":"block":"none"),l.begin=function(){u&&u.call(i,i);for(var r in p){d[r]=e.style[r];var a=b.CSS.getPropertyValue(e,r);p[r]="Down"===t?[a,0]:[0,a]}d.overflow=e.style.overflow,e.style.overflow="hidden"},l.complete=function(){for(var t in d)e.style[t]=d[t];c&&c.call(i,i),s&&s.resolver(i)},b(e,p,l)}}),f.each(["In","Out"],function(e,t){b.Redirects["fade"+t]=function(e,r,n,o,i,s){var l=f.extend({},r),u={opacity:"In"===t?1:0},c=l.complete;l.complete=n!==o-1?l.begin=null:function(){c&&c.call(i,i),s&&s.resolver(i)},l.display===a&&(l.display="In"===t?"auto":"none"),b(this,u,l)}}),b}(window.jQuery||window.Zepto||window,window,document)}));
diff --git a/app/dispatch/static/materialize/js/waves.js b/app/dispatch/static/materialize/js/waves.js new file mode 100644 index 0000000..b56cc2c --- /dev/null +++ b/app/dispatch/static/materialize/js/waves.js @@ -0,0 +1,335 @@ +/*!
+ * Waves v0.6.4
+ * http://fian.my.id/Waves
+ *
+ * Copyright 2014 Alfiana E. Sibuea and other contributors
+ * Released under the MIT license
+ * https://github.com/fians/Waves/blob/master/LICENSE
+ */
+
+;(function(window) {
+ 'use strict';
+
+ var Waves = Waves || {};
+ var $$ = document.querySelectorAll.bind(document);
+
+ // Find exact position of element
+ function isWindow(obj) {
+ return obj !== null && obj === obj.window;
+ }
+
+ function getWindow(elem) {
+ return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView;
+ }
+
+ function offset(elem) {
+ var docElem, win,
+ box = {top: 0, left: 0},
+ doc = elem && elem.ownerDocument;
+
+ docElem = doc.documentElement;
+
+ if (typeof elem.getBoundingClientRect !== typeof undefined) {
+ box = elem.getBoundingClientRect();
+ }
+ win = getWindow(doc);
+ return {
+ top: box.top + win.pageYOffset - docElem.clientTop,
+ left: box.left + win.pageXOffset - docElem.clientLeft
+ };
+ }
+
+ function convertStyle(obj) {
+ var style = '';
+
+ for (var a in obj) {
+ if (obj.hasOwnProperty(a)) {
+ style += (a + ':' + obj[a] + ';');
+ }
+ }
+
+ return style;
+ }
+
+ var Effect = {
+
+ // Effect delay
+ duration: 750,
+
+ show: function(e, element) {
+
+ // Disable right click
+ if (e.button === 2) {
+ return false;
+ }
+
+ var el = element || this;
+
+ // Create ripple
+ var ripple = document.createElement('div');
+ ripple.className = 'waves-ripple';
+ el.appendChild(ripple);
+
+ // Get click coordinate and element witdh
+ var pos = offset(el);
+ var relativeY = (e.pageY - pos.top);
+ var relativeX = (e.pageX - pos.left);
+ var scale = 'scale('+((el.clientWidth / 100) * 10)+')';
+
+ // Support for touch devices
+ if ('touches' in e) {
+ relativeY = (e.touches[0].pageY - pos.top);
+ relativeX = (e.touches[0].pageX - pos.left);
+ }
+
+ // Attach data to element
+ ripple.setAttribute('data-hold', Date.now());
+ ripple.setAttribute('data-scale', scale);
+ ripple.setAttribute('data-x', relativeX);
+ ripple.setAttribute('data-y', relativeY);
+
+ // Set ripple position
+ var rippleStyle = {
+ 'top': relativeY+'px',
+ 'left': relativeX+'px'
+ };
+
+ ripple.className = ripple.className + ' waves-notransition';
+ ripple.setAttribute('style', convertStyle(rippleStyle));
+ ripple.className = ripple.className.replace('waves-notransition', '');
+
+ // Scale the ripple
+ rippleStyle['-webkit-transform'] = scale;
+ rippleStyle['-moz-transform'] = scale;
+ rippleStyle['-ms-transform'] = scale;
+ rippleStyle['-o-transform'] = scale;
+ rippleStyle.transform = scale;
+ rippleStyle.opacity = '1';
+
+ rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms';
+ rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms';
+ rippleStyle['-o-transition-duration'] = Effect.duration + 'ms';
+ rippleStyle['transition-duration'] = Effect.duration + 'ms';
+
+ rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+ rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+ rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+ rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
+
+ ripple.setAttribute('style', convertStyle(rippleStyle));
+ },
+
+ hide: function(e) {
+ TouchHandler.touchup(e);
+
+ var el = this;
+ var width = el.clientWidth * 1.4;
+
+ // Get first ripple
+ var ripple = null;
+ var ripples = el.getElementsByClassName('waves-ripple');
+ if (ripples.length > 0) {
+ ripple = ripples[ripples.length - 1];
+ } else {
+ return false;
+ }
+
+ var relativeX = ripple.getAttribute('data-x');
+ var relativeY = ripple.getAttribute('data-y');
+ var scale = ripple.getAttribute('data-scale');
+
+ // Get delay beetween mousedown and mouse leave
+ var diff = Date.now() - Number(ripple.getAttribute('data-hold'));
+ var delay = 350 - diff;
+
+ if (delay < 0) {
+ delay = 0;
+ }
+
+ // Fade out ripple after delay
+ setTimeout(function() {
+ var style = {
+ 'top': relativeY+'px',
+ 'left': relativeX+'px',
+ 'opacity': '0',
+
+ // Duration
+ '-webkit-transition-duration': Effect.duration + 'ms',
+ '-moz-transition-duration': Effect.duration + 'ms',
+ '-o-transition-duration': Effect.duration + 'ms',
+ 'transition-duration': Effect.duration + 'ms',
+ '-webkit-transform': scale,
+ '-moz-transform': scale,
+ '-ms-transform': scale,
+ '-o-transform': scale,
+ 'transform': scale,
+ };
+
+ ripple.setAttribute('style', convertStyle(style));
+
+ setTimeout(function() {
+ try {
+ el.removeChild(ripple);
+ } catch(e) {
+ return false;
+ }
+ }, Effect.duration);
+ }, delay);
+ },
+
+ // Little hack to make <input> can perform waves effect
+ wrapInput: function(elements) {
+ for (var a = 0; a < elements.length; a++) {
+ var el = elements[a];
+
+ if (el.tagName.toLowerCase() === 'input') {
+ var parent = el.parentNode;
+
+ // If input already have parent just pass through
+ if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) {
+ continue;
+ }
+
+ // Put element class and style to the specified parent
+ var wrapper = document.createElement('i');
+ wrapper.className = el.className + ' waves-input-wrapper';
+
+ var elementStyle = el.getAttribute('style');
+
+ if (!elementStyle) {
+ elementStyle = '';
+ }
+
+ wrapper.setAttribute('style', elementStyle);
+
+ el.className = 'waves-button-input';
+ el.removeAttribute('style');
+
+ // Put element as child
+ parent.replaceChild(wrapper, el);
+ wrapper.appendChild(el);
+ }
+ }
+ }
+ };
+
+
+ /**
+ * Disable mousedown event for 500ms during and after touch
+ */
+ var TouchHandler = {
+ /* uses an integer rather than bool so there's no issues with
+ * needing to clear timeouts if another touch event occurred
+ * within the 500ms. Cannot mouseup between touchstart and
+ * touchend, nor in the 500ms after touchend. */
+ touches: 0,
+ allowEvent: function(e) {
+ var allow = true;
+
+ if (e.type === 'touchstart') {
+ TouchHandler.touches += 1; //push
+ } else if (e.type === 'touchend' || e.type === 'touchcancel') {
+ setTimeout(function() {
+ if (TouchHandler.touches > 0) {
+ TouchHandler.touches -= 1; //pop after 500ms
+ }
+ }, 500);
+ } else if (e.type === 'mousedown' && TouchHandler.touches > 0) {
+ allow = false;
+ }
+
+ return allow;
+ },
+ touchup: function(e) {
+ TouchHandler.allowEvent(e);
+ }
+ };
+
+
+ /**
+ * Delegated click handler for .waves-effect element.
+ * returns null when .waves-effect element not in "click tree"
+ */
+ function getWavesEffectElement(e) {
+ if (TouchHandler.allowEvent(e) === false) {
+ return null;
+ }
+
+ var element = null;
+ var target = e.target || e.srcElement;
+
+ while (target.parentNode !== null) {
+ if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) {
+ element = target;
+ break;
+ }
+ target = target.parentNode;
+ }
+ return element;
+ }
+
+ /**
+ * Bubble the click and show effect if .waves-effect elem was found
+ */
+ function showEffect(e) {
+ var element = getWavesEffectElement(e);
+
+ if (element !== null) {
+ Effect.show(e, element);
+
+ if ('ontouchstart' in window) {
+ element.addEventListener('touchend', Effect.hide, false);
+ element.addEventListener('touchcancel', Effect.hide, false);
+ }
+
+ element.addEventListener('mouseup', Effect.hide, false);
+ element.addEventListener('mouseleave', Effect.hide, false);
+ element.addEventListener('dragend', Effect.hide, false);
+ }
+ }
+
+ Waves.displayEffect = function(options) {
+ options = options || {};
+
+ if ('duration' in options) {
+ Effect.duration = options.duration;
+ }
+
+ //Wrap input inside <i> tag
+ Effect.wrapInput($$('.waves-effect'));
+
+ if ('ontouchstart' in window) {
+ document.body.addEventListener('touchstart', showEffect, false);
+ }
+
+ document.body.addEventListener('mousedown', showEffect, false);
+ };
+
+ /**
+ * Attach Waves to an input element (or any element which doesn't
+ * bubble mouseup/mousedown events).
+ * Intended to be used with dynamically loaded forms/inputs, or
+ * where the user doesn't want a delegated click handler.
+ */
+ Waves.attach = function(element) {
+ //FUTURE: automatically add waves classes and allow users
+ // to specify them with an options param? Eg. light/classic/button
+ if (element.tagName.toLowerCase() === 'input') {
+ Effect.wrapInput([element]);
+ element = element.parentNode;
+ }
+
+ if ('ontouchstart' in window) {
+ element.addEventListener('touchstart', showEffect, false);
+ }
+
+ element.addEventListener('mousedown', showEffect, false);
+ };
+
+ window.Waves = Waves;
+
+ document.addEventListener('DOMContentLoaded', function() {
+ Waves.displayEffect();
+ }, false);
+
+})(window);
diff --git a/app/dispatch/static/materialize/sass/.sass-cache/219915314f96ba592393ee0f91ebc5ca040988d6/materialize.scssc b/app/dispatch/static/materialize/sass/.sass-cache/219915314f96ba592393ee0f91ebc5ca040988d6/materialize.scssc Binary files differnew file mode 100644 index 0000000..e6019a1 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/219915314f96ba592393ee0f91ebc5ca040988d6/materialize.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_badges.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_badges.scssc Binary files differnew file mode 100644 index 0000000..52d5398 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_badges.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_buttons.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_buttons.scssc Binary files differnew file mode 100644 index 0000000..973967a --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_buttons.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_cards.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_cards.scssc Binary files differnew file mode 100644 index 0000000..41f89d0 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_cards.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_carousel.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_carousel.scssc Binary files differnew file mode 100644 index 0000000..a1b1b0e --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_carousel.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_chips.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_chips.scssc Binary files differnew file mode 100644 index 0000000..4a6b423 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_chips.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_collapsible.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_collapsible.scssc Binary files differnew file mode 100644 index 0000000..2be8526 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_collapsible.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_color.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_color.scssc Binary files differnew file mode 100644 index 0000000..a23f441 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_color.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_dropdown.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_dropdown.scssc Binary files differnew file mode 100644 index 0000000..1801314 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_dropdown.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_global.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_global.scssc Binary files differnew file mode 100644 index 0000000..746886f --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_global.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_grid.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_grid.scssc Binary files differnew file mode 100644 index 0000000..aacd3dc --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_grid.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_icons-material-design.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_icons-material-design.scssc Binary files differnew file mode 100644 index 0000000..72cbc7a --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_icons-material-design.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_materialbox.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_materialbox.scssc Binary files differnew file mode 100644 index 0000000..0fdedbc --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_materialbox.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_modal.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_modal.scssc Binary files differnew file mode 100644 index 0000000..ac1a7a7 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_modal.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_navbar.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_navbar.scssc Binary files differnew file mode 100644 index 0000000..3d2fc63 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_navbar.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_normalize.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_normalize.scssc Binary files differnew file mode 100644 index 0000000..785d767 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_normalize.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_preloader.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_preloader.scssc Binary files differnew file mode 100644 index 0000000..7b0cc05 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_preloader.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_pulse.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_pulse.scssc Binary files differnew file mode 100644 index 0000000..2e1c01d --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_pulse.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_roboto.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_roboto.scssc Binary files differnew file mode 100644 index 0000000..1a21d7e --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_roboto.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_sideNav.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_sideNav.scssc Binary files differnew file mode 100644 index 0000000..0acb5af --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_sideNav.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_slider.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_slider.scssc Binary files differnew file mode 100644 index 0000000..67982c4 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_slider.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_table_of_contents.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_table_of_contents.scssc Binary files differnew file mode 100644 index 0000000..aa18a43 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_table_of_contents.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tabs.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tabs.scssc Binary files differnew file mode 100644 index 0000000..e626372 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tabs.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tapTarget.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tapTarget.scssc Binary files differnew file mode 100644 index 0000000..751bfa7 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tapTarget.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_toast.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_toast.scssc Binary files differnew file mode 100644 index 0000000..b1b9ff8 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_toast.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tooltip.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tooltip.scssc Binary files differnew file mode 100644 index 0000000..e613511 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_tooltip.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_transitions.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_transitions.scssc Binary files differnew file mode 100644 index 0000000..7e789b8 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_transitions.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_typography.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_typography.scssc Binary files differnew file mode 100644 index 0000000..f59df2c --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_typography.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_variables.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_variables.scssc Binary files differnew file mode 100644 index 0000000..9cd75cd --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_variables.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_waves.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_waves.scssc Binary files differnew file mode 100644 index 0000000..802d462 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c522ec0bcae4f1e3f64a0b94f19496ba10ebb5e3/_waves.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_checkboxes.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_checkboxes.scssc Binary files differnew file mode 100644 index 0000000..ec1450f --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_checkboxes.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_file-input.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_file-input.scssc Binary files differnew file mode 100644 index 0000000..f1ced8f --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_file-input.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_forms.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_forms.scssc Binary files differnew file mode 100644 index 0000000..5972264 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_forms.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_input-fields.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_input-fields.scssc Binary files differnew file mode 100644 index 0000000..c8a71bd --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_input-fields.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_radio-buttons.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_radio-buttons.scssc Binary files differnew file mode 100644 index 0000000..9914aa5 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_radio-buttons.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_range.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_range.scssc Binary files differnew file mode 100644 index 0000000..bbe3f8b --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_range.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_select.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_select.scssc Binary files differnew file mode 100644 index 0000000..134a162 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_select.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_switches.scssc b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_switches.scssc Binary files differnew file mode 100644 index 0000000..22f59dc --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/c5fe6b1ff8ebce8ce8ec438cba3aee9dc1dabb9a/_switches.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.date.scssc b/app/dispatch/static/materialize/sass/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.date.scssc Binary files differnew file mode 100644 index 0000000..70279c6 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.date.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.scssc b/app/dispatch/static/materialize/sass/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.scssc Binary files differnew file mode 100644 index 0000000..1d1ce58 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.scssc diff --git a/app/dispatch/static/materialize/sass/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.time.scssc b/app/dispatch/static/materialize/sass/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.time.scssc Binary files differnew file mode 100644 index 0000000..bdbaf39 --- /dev/null +++ b/app/dispatch/static/materialize/sass/.sass-cache/e0864ff7f170a251ba7aabdfd152ea3a177e4500/_default.time.scssc diff --git a/app/dispatch/static/materialize/sass/components/_badges.scss b/app/dispatch/static/materialize/sass/components/_badges.scss new file mode 100644 index 0000000..ed8f185 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_badges.scss @@ -0,0 +1,47 @@ +// Badges
+span.badge {
+ min-width: 3rem;
+ padding: 0 6px;
+ margin-left: 14px;
+ text-align: center;
+ font-size: 1rem;
+ line-height: $badge-height;
+ height: $badge-height;
+ color: color('grey', 'darken-1');
+ float: right;
+ box-sizing: border-box;
+
+ &.new {
+ font-weight: 300;
+ font-size: 0.8rem;
+ color: #fff;
+ background-color: $badge-bg-color;
+ border-radius: 2px;
+ }
+ &.new:after {
+ content: " new";
+ }
+
+ &[data-badge-caption]::after {
+ content: " " attr(data-badge-caption);
+ }
+}
+nav ul a span.badge {
+ display: inline-block;
+ float: none;
+ margin-left: 4px;
+ line-height: $badge-height;
+ height: $badge-height;
+ -webkit-font-smoothing: auto;
+}
+
+// Line height centering
+.collection-item span.badge {
+ margin-top: calc(#{$collection-line-height / 2} - #{$badge-height / 2});
+}
+.collapsible span.badge {
+ margin-left: auto;
+}
+.side-nav span.badge {
+ margin-top: calc(#{$sidenav-line-height / 2} - #{$badge-height / 2});
+}
diff --git a/app/dispatch/static/materialize/sass/components/_buttons.scss b/app/dispatch/static/materialize/sass/components/_buttons.scss new file mode 100644 index 0000000..42730dd --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_buttons.scss @@ -0,0 +1,291 @@ +// shared styles
+.btn,
+.btn-flat {
+ border: $button-border;
+ border-radius: $button-radius;
+ display: inline-block;
+ height: $button-height;
+ line-height: $button-height;
+ padding: $button-padding;
+ text-transform: uppercase;
+ vertical-align: middle;
+ // Gets rid of tap active state
+ -webkit-tap-highlight-color: transparent;
+}
+
+// Disabled shared style
+.btn.disabled,
+.btn-floating.disabled,
+.btn-large.disabled,
+.btn-flat.disabled,
+.btn:disabled,
+.btn-floating:disabled,
+.btn-large:disabled,
+.btn-flat:disabled,
+.btn[disabled],
+.btn-floating[disabled],
+.btn-large[disabled],
+.btn-flat[disabled] {
+ pointer-events: none;
+ background-color: $button-disabled-background !important;
+ box-shadow: none;
+ color: $button-disabled-color !important;
+ cursor: default;
+
+ &:hover {
+ background-color: $button-disabled-background !important;
+ color: $button-disabled-color !important;
+ }
+}
+
+// Shared icon styles
+.btn,
+.btn-floating,
+.btn-large,
+.btn-flat {
+ font-size: $button-font-size;
+ outline: 0;
+
+ i {
+ font-size: $button-icon-font-size;
+ line-height: inherit;
+ }
+}
+
+// Shared focus button style
+.btn,
+.btn-floating {
+ &:focus {
+ background-color: darken($button-raised-background, 10%);
+ }
+}
+
+// Raised Button
+.btn {
+ text-decoration: none;
+ color: $button-raised-color;
+ background-color: $button-raised-background;
+ text-align: center;
+ letter-spacing: .5px;
+ @extend .z-depth-1;
+ transition: .2s ease-out;
+ cursor: pointer;
+
+ &:hover {
+ background-color: $button-raised-background-hover;
+ @extend .z-depth-1-half;
+ }
+}
+
+// Floating button
+.btn-floating {
+ &:hover {
+ background-color: $button-floating-background-hover;
+ @extend .z-depth-1-half;
+ }
+
+ &:before {
+ border-radius: 0;
+ }
+
+ &.btn-large {
+ &.halfway-fab {
+ bottom: -$button-floating-large-size / 2;
+ }
+
+ width: $button-floating-large-size;
+ height: $button-floating-large-size;
+ i {
+ line-height: $button-floating-large-size;
+ }
+ }
+
+ &.halfway-fab {
+ &.left {
+ right: auto;
+ left: 24px;
+ }
+
+ position: absolute;
+ right: 24px;
+ bottom: -$button-floating-size / 2;
+ }
+
+ display: inline-block;
+ color: $button-floating-color;
+ position: relative;
+ overflow: hidden;
+ z-index: 1;
+ width: $button-floating-size;
+ height: $button-floating-size;
+ line-height: $button-floating-size;
+ padding: 0;
+ background-color: $button-floating-background;
+ border-radius: $button-floating-radius;
+ @extend .z-depth-1;
+ transition: .3s;
+ cursor: pointer;
+ vertical-align: middle;
+
+ i {
+ width: inherit;
+ display: inline-block;
+ text-align: center;
+ color: $button-floating-color;
+ font-size: $button-large-icon-font-size;
+ line-height: $button-floating-size;
+ }
+}
+
+// button fix
+button.btn-floating {
+ border: $button-border;
+}
+
+// Fixed Action Button
+.fixed-action-btn {
+ &.active {
+ ul {
+ visibility: visible;
+ }
+ }
+
+ &.horizontal {
+ padding: 0 0 0 15px;
+
+ ul {
+ text-align: right;
+ right: 64px;
+ top: 50%;
+ transform: translateY(-50%);
+ height: 100%;
+ left: auto;
+ width: 500px; /*width 100% only goes to width of button container */
+
+ li {
+ display: inline-block;
+ margin: 15px 15px 0 0;
+ }
+ }
+ }
+
+ &.toolbar {
+ &.active {
+ & > a i {
+ opacity: 0;
+ }
+ }
+
+ padding: 0;
+ height: $button-floating-large-size;
+
+ ul {
+ display: flex;
+ top: 0;
+ bottom: 0;
+ z-index: 1;
+
+ li {
+ flex: 1;
+ display: inline-block;
+ margin: 0;
+ height: 100%;
+ transition: none;
+
+ a {
+ display: block;
+ overflow: hidden;
+ position: relative;
+ width: 100%;
+ height: 100%;
+ background-color: transparent;
+ box-shadow: none;
+ color: #fff;
+ line-height: $button-floating-large-size;
+ z-index: 1;
+
+ i {
+ line-height: inherit;
+ }
+ }
+ }
+ }
+ }
+
+ position: fixed;
+ right: 23px;
+ bottom: 23px;
+ padding-top: 15px;
+ margin-bottom: 0;
+ z-index: 997;
+
+ ul {
+ left: 0;
+ right: 0;
+ text-align: center;
+ position: absolute;
+ bottom: 64px;
+ margin: 0;
+ visibility: hidden;
+
+ li {
+ margin-bottom: 15px;
+ }
+
+ a.btn-floating {
+ opacity: 0;
+ }
+ }
+
+ .fab-backdrop {
+ position: absolute;
+ top: 0;
+ left: 0;
+ z-index: -1;
+ width: $button-floating-size;
+ height: $button-floating-size;
+ background-color: $button-floating-background;
+ border-radius: $button-floating-radius;
+ transform: scale(0);
+ }
+}
+
+// Flat button
+.btn-flat {
+ box-shadow: none;
+ background-color: transparent;
+ color: $button-flat-color;
+ cursor: pointer;
+ transition: background-color .2s;
+
+ &:focus,
+ &:hover {
+ box-shadow: none;
+ }
+
+ &:focus {
+ background-color: rgba(0,0,0,.1);
+ }
+
+ &.disabled {
+ background-color: transparent !important;
+ color: $button-flat-disabled-color !important;
+ cursor: default;
+ }
+}
+
+// Large button
+.btn-large {
+ @extend .btn;
+ height: $button-large-height;
+ line-height: $button-large-height;
+
+ i {
+ font-size: $button-large-icon-font-size;
+ }
+}
+
+// Block button
+.btn-block {
+ display: block;
+}
diff --git a/app/dispatch/static/materialize/sass/components/_cards.scss b/app/dispatch/static/materialize/sass/components/_cards.scss new file mode 100644 index 0000000..c9b0216 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_cards.scss @@ -0,0 +1,196 @@ +
+
+.card-panel {
+ transition: box-shadow .25s;
+ padding: $card-padding;
+ margin: $element-top-margin 0 $element-bottom-margin 0;
+ border-radius: 2px;
+ @extend .z-depth-1;
+ background-color: $card-bg-color;
+}
+
+.card {
+ position: relative;
+ margin: $element-top-margin 0 $element-bottom-margin 0;
+ background-color: $card-bg-color;
+ transition: box-shadow .25s;
+ border-radius: 2px;
+ @extend .z-depth-1;
+
+
+ .card-title {
+ font-size: 24px;
+ font-weight: 300;
+ &.activator {
+ cursor: pointer;
+ }
+ }
+
+ // Card Sizes
+ &.small, &.medium, &.large {
+ position: relative;
+
+ .card-image {
+ max-height: 60%;
+ overflow: hidden;
+ }
+ .card-image + .card-content {
+ max-height: 40%;
+ }
+ .card-content {
+ max-height: 100%;
+ overflow: hidden;
+ }
+ .card-action {
+ position: absolute;
+ bottom: 0;
+ left: 0;
+ right: 0;
+ }
+ }
+
+ &.small {
+ height: 300px;
+ }
+
+ &.medium {
+ height: 400px;
+ }
+
+ &.large {
+ height: 500px;
+ }
+
+ // Horizontal Cards
+ &.horizontal {
+ &.small, &.medium, &.large {
+ .card-image {
+ height: 100%;
+ max-height: none;
+ overflow: visible;
+
+ img {
+ height: 100%;
+ }
+ }
+ }
+
+ display: flex;
+
+ .card-image {
+ max-width: 50%;
+ img {
+ border-radius: 2px 0 0 2px;
+ max-width: 100%;
+ width: auto;
+ }
+ }
+
+ .card-stacked {
+ display: flex;
+ flex-direction: column;
+ flex: 1;
+ position: relative;
+
+ .card-content {
+ flex-grow: 1;
+ }
+ }
+ }
+
+ // Sticky Action Section
+ &.sticky-action {
+ .card-action {
+ z-index: 2;
+ }
+
+ .card-reveal {
+ z-index: 1;
+ padding-bottom: 64px;
+ }
+ }
+
+
+
+
+ .card-image {
+ position: relative;
+
+ // Image background for content
+ img {
+ display: block;
+ border-radius: 2px 2px 0 0;
+ position: relative;
+ left: 0;
+ right: 0;
+ top: 0;
+ bottom: 0;
+ width: 100%;
+ }
+
+ .card-title {
+ color: $card-bg-color;
+ position: absolute;
+ bottom: 0;
+ left: 0;
+ max-width: 100%;
+ padding: $card-padding;
+ }
+ }
+
+ .card-content {
+ padding: $card-padding;
+ border-radius: 0 0 2px 2px;
+
+ p {
+ margin: 0;
+ color: inherit;
+ }
+ .card-title {
+ display: block;
+ line-height: 32px;
+ margin-bottom: 8px;
+
+ i {
+ line-height: 32px;
+ }
+ }
+ }
+
+ .card-action {
+ &:last-child {
+ border-radius: 0 0 2px 2px;
+ }
+ position: relative;
+ background-color: inherit;
+ border-top: 1px solid rgba(160,160,160,.2);
+ padding: 16px $card-padding;
+
+ a:not(.btn):not(.btn-large):not(.btn-floating) {
+ color: $card-link-color;
+ margin-right: $card-padding;
+ transition: color .3s ease;
+ text-transform: uppercase;
+
+ &:hover { color: $card-link-color-light; }
+ }
+ }
+
+ .card-reveal {
+ padding: $card-padding;
+ position: absolute;
+ background-color: $card-bg-color;
+ width: 100%;
+ overflow-y: auto;
+ left: 0;
+ top: 100%;
+ height: 100%;
+ z-index: 3;
+ display: none;
+
+ .card-title {
+ cursor: pointer;
+ display: block;
+ }
+ }
+}
diff --git a/app/dispatch/static/materialize/sass/components/_carousel.scss b/app/dispatch/static/materialize/sass/components/_carousel.scss new file mode 100644 index 0000000..fccdc82 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_carousel.scss @@ -0,0 +1,90 @@ +.carousel {
+ &.carousel-slider {
+ top: 0;
+ left: 0;
+
+ .carousel-fixed-item {
+ &.with-indicators {
+ bottom: 68px;
+ }
+
+ position: absolute;
+ left: 0;
+ right: 0;
+ bottom: 20px;
+ z-index: 1;
+ }
+
+ .carousel-item {
+ width: 100%;
+ height: 100%;
+ min-height: $carousel-height;
+ position: absolute;
+ top: 0;
+ left: 0;
+
+ h2 {
+ font-size: 24px;
+ font-weight: 500;
+ line-height: 32px;
+ }
+
+ p {
+ font-size: 15px;
+ }
+ }
+ }
+
+ overflow: hidden;
+ position: relative;
+ width: 100%;
+ height: $carousel-height;
+ perspective: 500px;
+ transform-style: preserve-3d;
+ transform-origin: 0% 50%;
+
+ .carousel-item {
+ display: none;
+ width: $carousel-item-width;
+ height: $carousel-item-height;
+ position: absolute;
+ top: 0;
+ left: 0;
+
+ & > img {
+ width: 100%;
+ }
+ }
+
+ .indicators {
+ position: absolute;
+ text-align: center;
+ left: 0;
+ right: 0;
+ bottom: 0;
+ margin: 0;
+
+ .indicator-item {
+ &.active {
+ background-color: #fff;
+ }
+
+ display: inline-block;
+ position: relative;
+ cursor: pointer;
+ height: 8px;
+ width: 8px;
+ margin: 24px 4px;
+ background-color: rgba(255,255,255,.5);
+
+ transition: background-color .3s;
+ border-radius: 50%;
+ }
+ }
+
+ // Materialbox compatibility
+ &.scrolling .carousel-item .materialboxed,
+ .carousel-item:not(.active) .materialboxed {
+ pointer-events: none;
+ }
+}
diff --git a/app/dispatch/static/materialize/sass/components/_chips.scss b/app/dispatch/static/materialize/sass/components/_chips.scss new file mode 100644 index 0000000..c291578 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_chips.scss @@ -0,0 +1,89 @@ +.chip {
+ display: inline-block;
+ height: 32px;
+ font-size: 13px;
+ font-weight: 500;
+ color: rgba(0,0,0,.6);
+ line-height: 32px;
+ padding: 0 12px;
+ border-radius: 16px;
+ background-color: $chip-bg-color;
+ margin-bottom: $chip-margin;
+ margin-right: $chip-margin;
+
+ > img {
+ float: left;
+ margin: 0 8px 0 -12px;
+ height: 32px;
+ width: 32px;
+ border-radius: 50%;
+ }
+
+ .close {
+ cursor: pointer;
+ float: right;
+ font-size: 16px;
+ line-height: 32px;
+ padding-left: 8px;
+ }
+}
+
+.chips {
+ border: none;
+ border-bottom: 1px solid $chip-border-color;
+ box-shadow: none;
+ margin: $input-margin;
+ min-height: 45px;
+ outline: none;
+ transition: all .3s;
+
+ &.focus {
+ border-bottom: 1px solid $chip-selected-color;
+ box-shadow: 0 1px 0 0 $chip-selected-color;
+ }
+
+ &:hover {
+ cursor: text;
+ }
+
+ .chip.selected {
+ background-color: $chip-selected-color;
+ color: #fff;
+ }
+
+ .input {
+ background: none;
+ border: 0;
+ color: rgba(0,0,0,.6);
+ display: inline-block;
+ font-size: $input-font-size;
+ height: $input-height;
+ line-height: 32px;
+ outline: 0;
+ margin: 0;
+ padding: 0 !important;
+ width: 120px !important;
+ }
+
+ .input:focus {
+ border: 0 !important;
+ box-shadow: none !important;
+ }
+
+ // Autocomplete
+ .autocomplete-content {
+ margin-top: 0;
+ margin-bottom: 0;
+ }
+}
+
+// Form prefix
+.prefix ~ .chips {
+ margin-left: 3rem;
+ width: 92%;
+ width: calc(100% - 3rem);
+}
+.chips:empty ~ label {
+ font-size: 0.8rem;
+ transform: translateY(-140%);
+}
diff --git a/app/dispatch/static/materialize/sass/components/_collapsible.scss b/app/dispatch/static/materialize/sass/components/_collapsible.scss new file mode 100644 index 0000000..ef59d96 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_collapsible.scss @@ -0,0 +1,84 @@ +.collapsible {
+ border-top: 1px solid $collapsible-border-color;
+ border-right: 1px solid $collapsible-border-color;
+ border-left: 1px solid $collapsible-border-color;
+ margin: $element-top-margin 0 $element-bottom-margin 0;
+ @extend .z-depth-1;
+}
+
+.collapsible-header {
+ display: flex;
+ cursor: pointer;
+ -webkit-tap-highlight-color: transparent;
+ line-height: 1.5;
+ padding: 1rem;
+ background-color: $collapsible-header-color;
+ border-bottom: 1px solid $collapsible-border-color;
+
+ i {
+ width: 2rem;
+ font-size: 1.6rem;
+ display: inline-block;
+ text-align: center;
+ margin-right: 1rem;
+ }
+}
+
+.collapsible-body {
+ display: none;
+ border-bottom: 1px solid $collapsible-border-color;
+ box-sizing: border-box;
+ padding: 2rem;
+}
+
+// sideNav collapsible styling
+.side-nav,
+.side-nav.fixed {
+
+ .collapsible {
+ border: none;
+ box-shadow: none;
+
+ li { padding: 0; }
+ }
+
+ .collapsible-header {
+ background-color: transparent;
+ border: none;
+ line-height: inherit;
+ height: inherit;
+ padding: 0 $sidenav-padding;
+
+ &:hover { background-color: rgba(0,0,0,.05); }
+ i { line-height: inherit; }
+ }
+
+ .collapsible-body {
+ border: 0;
+ background-color: $collapsible-header-color;
+
+ li a {
+ padding: 0 (7.5px + $sidenav-padding)
+ 0 (15px + $sidenav-padding);
+ }
+ }
+
+}
+
+// Popout Collapsible
+
+.collapsible.popout {
+ border: none;
+ box-shadow: none;
+ > li {
+ box-shadow: 0 2px 5px 0 rgba(0, 0, 0, 0.16), 0 2px 10px 0 rgba(0, 0, 0, 0.12);
+ // transform: scaleX(.92);
+ margin: 0 24px;
+ transition: margin .35s cubic-bezier(0.250, 0.460, 0.450, 0.940);
+ }
+ > li.active {
+ box-shadow: 0 5px 11px 0 rgba(0, 0, 0, 0.18), 0 4px 15px 0 rgba(0, 0, 0, 0.15);
+ margin: 16px 0;
+ // transform: scaleX(1);
+ }
+}
diff --git a/app/dispatch/static/materialize/sass/components/_color.scss b/app/dispatch/static/materialize/sass/components/_color.scss new file mode 100644 index 0000000..bf4b123 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_color.scss @@ -0,0 +1,412 @@ +// Utility Color Classes
+
+//.success {
+//
+//}
+
+// Google Color Palette defined: http://www.google.com/design/spec/style/color.html
+
+
+$materialize-red: (
+ "base": #e51c23,
+ "lighten-5": #fdeaeb,
+ "lighten-4": #f8c1c3,
+ "lighten-3": #f3989b,
+ "lighten-2": #ee6e73,
+ "lighten-1": #ea454b,
+ "darken-1": #d0181e,
+ "darken-2": #b9151b,
+ "darken-3": #a21318,
+ "darken-4": #8b1014,
+);
+
+$red: (
+ "base": #F44336,
+ "lighten-5": #FFEBEE,
+ "lighten-4": #FFCDD2,
+ "lighten-3": #EF9A9A,
+ "lighten-2": #E57373,
+ "lighten-1": #EF5350,
+ "darken-1": #E53935,
+ "darken-2": #D32F2F,
+ "darken-3": #C62828,
+ "darken-4": #B71C1C,
+ "accent-1": #FF8A80,
+ "accent-2": #FF5252,
+ "accent-3": #FF1744,
+ "accent-4": #D50000
+);
+
+$pink: (
+ "base": #e91e63,
+ "lighten-5": #fce4ec,
+ "lighten-4": #f8bbd0,
+ "lighten-3": #f48fb1,
+ "lighten-2": #f06292,
+ "lighten-1": #ec407a,
+ "darken-1": #d81b60,
+ "darken-2": #c2185b,
+ "darken-3": #ad1457,
+ "darken-4": #880e4f,
+ "accent-1": #ff80ab,
+ "accent-2": #ff4081,
+ "accent-3": #f50057,
+ "accent-4": #c51162
+);
+
+$purple: (
+ "base": #9c27b0,
+ "lighten-5": #f3e5f5,
+ "lighten-4": #e1bee7,
+ "lighten-3": #ce93d8,
+ "lighten-2": #ba68c8,
+ "lighten-1": #ab47bc,
+ "darken-1": #8e24aa,
+ "darken-2": #7b1fa2,
+ "darken-3": #6a1b9a,
+ "darken-4": #4a148c,
+ "accent-1": #ea80fc,
+ "accent-2": #e040fb,
+ "accent-3": #d500f9,
+ "accent-4": #aa00ff
+);
+
+$deep-purple: (
+ "base": #673ab7,
+ "lighten-5": #ede7f6,
+ "lighten-4": #d1c4e9,
+ "lighten-3": #b39ddb,
+ "lighten-2": #9575cd,
+ "lighten-1": #7e57c2,
+ "darken-1": #5e35b1,
+ "darken-2": #512da8,
+ "darken-3": #4527a0,
+ "darken-4": #311b92,
+ "accent-1": #b388ff,
+ "accent-2": #7c4dff,
+ "accent-3": #651fff,
+ "accent-4": #6200ea
+);
+
+$indigo: (
+ "base": #3f51b5,
+ "lighten-5": #e8eaf6,
+ "lighten-4": #c5cae9,
+ "lighten-3": #9fa8da,
+ "lighten-2": #7986cb,
+ "lighten-1": #5c6bc0,
+ "darken-1": #3949ab,
+ "darken-2": #303f9f,
+ "darken-3": #283593,
+ "darken-4": #1a237e,
+ "accent-1": #8c9eff,
+ "accent-2": #536dfe,
+ "accent-3": #3d5afe,
+ "accent-4": #304ffe
+);
+
+$blue: (
+ "base": #2196F3,
+ "lighten-5": #E3F2FD,
+ "lighten-4": #BBDEFB,
+ "lighten-3": #90CAF9,
+ "lighten-2": #64B5F6,
+ "lighten-1": #42A5F5,
+ "darken-1": #1E88E5,
+ "darken-2": #1976D2,
+ "darken-3": #1565C0,
+ "darken-4": #0D47A1,
+ "accent-1": #82B1FF,
+ "accent-2": #448AFF,
+ "accent-3": #2979FF,
+ "accent-4": #2962FF
+);
+
+$light-blue: (
+ "base": #03a9f4,
+ "lighten-5": #e1f5fe,
+ "lighten-4": #b3e5fc,
+ "lighten-3": #81d4fa,
+ "lighten-2": #4fc3f7,
+ "lighten-1": #29b6f6,
+ "darken-1": #039be5,
+ "darken-2": #0288d1,
+ "darken-3": #0277bd,
+ "darken-4": #01579b,
+ "accent-1": #80d8ff,
+ "accent-2": #40c4ff,
+ "accent-3": #00b0ff,
+ "accent-4": #0091ea
+);
+
+$cyan: (
+ "base": #00bcd4,
+ "lighten-5": #e0f7fa,
+ "lighten-4": #b2ebf2,
+ "lighten-3": #80deea,
+ "lighten-2": #4dd0e1,
+ "lighten-1": #26c6da,
+ "darken-1": #00acc1,
+ "darken-2": #0097a7,
+ "darken-3": #00838f,
+ "darken-4": #006064,
+ "accent-1": #84ffff,
+ "accent-2": #18ffff,
+ "accent-3": #00e5ff,
+ "accent-4": #00b8d4
+);
+
+$teal: (
+ "base": #009688,
+ "lighten-5": #e0f2f1,
+ "lighten-4": #b2dfdb,
+ "lighten-3": #80cbc4,
+ "lighten-2": #4db6ac,
+ "lighten-1": #26a69a,
+ "darken-1": #00897b,
+ "darken-2": #00796b,
+ "darken-3": #00695c,
+ "darken-4": #004d40,
+ "accent-1": #a7ffeb,
+ "accent-2": #64ffda,
+ "accent-3": #1de9b6,
+ "accent-4": #00bfa5
+);
+
+$green: (
+ "base": #4CAF50,
+ "lighten-5": #E8F5E9,
+ "lighten-4": #C8E6C9,
+ "lighten-3": #A5D6A7,
+ "lighten-2": #81C784,
+ "lighten-1": #66BB6A,
+ "darken-1": #43A047,
+ "darken-2": #388E3C,
+ "darken-3": #2E7D32,
+ "darken-4": #1B5E20,
+ "accent-1": #B9F6CA,
+ "accent-2": #69F0AE,
+ "accent-3": #00E676,
+ "accent-4": #00C853
+);
+
+$light-green: (
+ "base": #8bc34a,
+ "lighten-5": #f1f8e9,
+ "lighten-4": #dcedc8,
+ "lighten-3": #c5e1a5,
+ "lighten-2": #aed581,
+ "lighten-1": #9ccc65,
+ "darken-1": #7cb342,
+ "darken-2": #689f38,
+ "darken-3": #558b2f,
+ "darken-4": #33691e,
+ "accent-1": #ccff90,
+ "accent-2": #b2ff59,
+ "accent-3": #76ff03,
+ "accent-4": #64dd17
+);
+
+$lime: (
+ "base": #cddc39,
+ "lighten-5": #f9fbe7,
+ "lighten-4": #f0f4c3,
+ "lighten-3": #e6ee9c,
+ "lighten-2": #dce775,
+ "lighten-1": #d4e157,
+ "darken-1": #c0ca33,
+ "darken-2": #afb42b,
+ "darken-3": #9e9d24,
+ "darken-4": #827717,
+ "accent-1": #f4ff81,
+ "accent-2": #eeff41,
+ "accent-3": #c6ff00,
+ "accent-4": #aeea00
+);
+
+$yellow: (
+ "base": #ffeb3b,
+ "lighten-5": #fffde7,
+ "lighten-4": #fff9c4,
+ "lighten-3": #fff59d,
+ "lighten-2": #fff176,
+ "lighten-1": #ffee58,
+ "darken-1": #fdd835,
+ "darken-2": #fbc02d,
+ "darken-3": #f9a825,
+ "darken-4": #f57f17,
+ "accent-1": #ffff8d,
+ "accent-2": #ffff00,
+ "accent-3": #ffea00,
+ "accent-4": #ffd600
+);
+
+$amber: (
+ "base": #ffc107,
+ "lighten-5": #fff8e1,
+ "lighten-4": #ffecb3,
+ "lighten-3": #ffe082,
+ "lighten-2": #ffd54f,
+ "lighten-1": #ffca28,
+ "darken-1": #ffb300,
+ "darken-2": #ffa000,
+ "darken-3": #ff8f00,
+ "darken-4": #ff6f00,
+ "accent-1": #ffe57f,
+ "accent-2": #ffd740,
+ "accent-3": #ffc400,
+ "accent-4": #ffab00
+);
+
+$orange: (
+ "base": #ff9800,
+ "lighten-5": #fff3e0,
+ "lighten-4": #ffe0b2,
+ "lighten-3": #ffcc80,
+ "lighten-2": #ffb74d,
+ "lighten-1": #ffa726,
+ "darken-1": #fb8c00,
+ "darken-2": #f57c00,
+ "darken-3": #ef6c00,
+ "darken-4": #e65100,
+ "accent-1": #ffd180,
+ "accent-2": #ffab40,
+ "accent-3": #ff9100,
+ "accent-4": #ff6d00
+);
+
+$deep-orange: (
+ "base": #ff5722,
+ "lighten-5": #fbe9e7,
+ "lighten-4": #ffccbc,
+ "lighten-3": #ffab91,
+ "lighten-2": #ff8a65,
+ "lighten-1": #ff7043,
+ "darken-1": #f4511e,
+ "darken-2": #e64a19,
+ "darken-3": #d84315,
+ "darken-4": #bf360c,
+ "accent-1": #ff9e80,
+ "accent-2": #ff6e40,
+ "accent-3": #ff3d00,
+ "accent-4": #dd2c00
+);
+
+$brown: (
+ "base": #795548,
+ "lighten-5": #efebe9,
+ "lighten-4": #d7ccc8,
+ "lighten-3": #bcaaa4,
+ "lighten-2": #a1887f,
+ "lighten-1": #8d6e63,
+ "darken-1": #6d4c41,
+ "darken-2": #5d4037,
+ "darken-3": #4e342e,
+ "darken-4": #3e2723
+);
+
+$blue-grey: (
+ "base": #607d8b,
+ "lighten-5": #eceff1,
+ "lighten-4": #cfd8dc,
+ "lighten-3": #b0bec5,
+ "lighten-2": #90a4ae,
+ "lighten-1": #78909c,
+ "darken-1": #546e7a,
+ "darken-2": #455a64,
+ "darken-3": #37474f,
+ "darken-4": #263238
+);
+
+$grey: (
+ "base": #9e9e9e,
+ "lighten-5": #fafafa,
+ "lighten-4": #f5f5f5,
+ "lighten-3": #eeeeee,
+ "lighten-2": #e0e0e0,
+ "lighten-1": #bdbdbd,
+ "darken-1": #757575,
+ "darken-2": #616161,
+ "darken-3": #424242,
+ "darken-4": #212121
+);
+
+$shades: (
+ "black": #000000,
+ "white": #FFFFFF,
+ "transparent": transparent
+);
+
+$colors: (
+ "materialize-red": $materialize-red,
+ "red": $red,
+ "pink": $pink,
+ "purple": $purple,
+ "deep-purple": $deep-purple,
+ "indigo": $indigo,
+ "blue": $blue,
+ "light-blue": $light-blue,
+ "cyan": $cyan,
+ "teal": $teal,
+ "green": $green,
+ "light-green": $light-green,
+ "lime": $lime,
+ "yellow": $yellow,
+ "amber": $amber,
+ "orange": $orange,
+ "deep-orange": $deep-orange,
+ "brown": $brown,
+ "blue-grey": $blue-grey,
+ "grey": $grey,
+ "shades": $shades
+) !default;
+
+
+// Color Classes
+
+@each $color_name, $color in $colors {
+ @each $color_type, $color_value in $color {
+ @if $color_type == "base" {
+ .#{$color_name} {
+ background-color: $color_value !important;
+ }
+ .#{$color_name}-text {
+ color: $color_value !important;
+ }
+ }
+ @else if $color_name != "shades" {
+ .#{$color_name}.#{$color_type} {
+ background-color: $color_value !important;
+ }
+ .#{$color_name}-text.text-#{$color_type} {
+ color: $color_value !important;
+ }
+ }
+ }
+}
+
+// Shade classes
+@each $color, $color_value in $shades {
+ .#{$color} {
+ background-color: $color_value !important;
+ }
+ .#{$color}-text {
+ color: $color_value !important;
+ }
+}
+
+
+// usage: color("name_of_color", "type_of_color")
+// to avoid to repeating map-get($colors, ...)
+
+@function color($color, $type) {
+ @if map-has-key($colors, $color) {
+ $curr_color: map-get($colors, $color);
+ @if map-has-key($curr_color, $type) {
+ @return map-get($curr_color, $type);
+ }
+ }
+ @warn "Unknown `#{$color}` - `#{$type}` in $colors.";
+ @return null;
+}
+
diff --git a/app/dispatch/static/materialize/sass/components/_dropdown.scss b/app/dispatch/static/materialize/sass/components/_dropdown.scss new file mode 100644 index 0000000..27131b5 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_dropdown.scss @@ -0,0 +1,68 @@ +.dropdown-content {
+ @extend .z-depth-1;
+ background-color: $dropdown-bg-color;
+ margin: 0;
+ display: none;
+ min-width: 100px;
+ max-height: 650px;
+ overflow-y: auto;
+ opacity: 0;
+ position: absolute;
+ z-index: 999;
+ will-change: width, height;
+
+ li {
+ clear: both;
+ color: $off-black;
+ cursor: pointer;
+ min-height: $dropdown-item-height;
+ line-height: 1.5rem;
+ width: 100%;
+ text-align: left;
+ text-transform: none;
+
+ &:hover, &.active, &.selected {
+ background-color: $dropdown-hover-bg-color;
+ }
+
+ &.active.selected {
+ background-color: darken($dropdown-hover-bg-color, 5%);
+ }
+
+ &.divider {
+ min-height: 0;
+ height: 1px;
+ }
+
+ & > a, & > span {
+ font-size: 16px;
+ color: $dropdown-color;
+ display: block;
+ line-height: 22px;
+ padding: (($dropdown-item-height - 22) / 2) 16px;
+ }
+
+ & > span > label {
+ top: 1px;
+ left: 0;
+ height: 18px;
+ }
+
+ // Icon alignment override
+ & > a > i {
+ height: inherit;
+ line-height: inherit;
+ float: left;
+ margin: 0 24px 0 0;
+ width: 24px;
+ }
+ }
+}
+
+// Input field specificity bugfix
+.input-field.col .dropdown-content [type="checkbox"] + label {
+ top: 1px;
+ left: 0;
+ height: 18px;
+}
+
diff --git a/app/dispatch/static/materialize/sass/components/_global.scss b/app/dispatch/static/materialize/sass/components/_global.scss new file mode 100644 index 0000000..5a7709f --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_global.scss @@ -0,0 +1,734 @@ +//Default styles
+
+html {
+ box-sizing: border-box;
+}
+*, *:before, *:after {
+ box-sizing: inherit;
+}
+
+body {
+ // display: flex;
+ // min-height: 100vh;
+ // flex-direction: column;
+}
+
+main {
+ // flex: 1 0 auto;
+}
+
+ul {
+ &:not(.browser-default) {
+ padding-left: 0;
+ list-style-type: none;
+
+ & > li {
+ list-style-type: none;
+ }
+ }
+}
+
+a {
+ color: $link-color;
+ text-decoration: none;
+
+ // Gets rid of tap active state
+ -webkit-tap-highlight-color: transparent;
+}
+
+
+// Positioning
+.valign-wrapper {
+ display: flex;
+ align-items: center;
+}
+
+
+// classic clearfix
+.clearfix {
+ clear: both;
+}
+
+
+// Z-levels
+.z-depth-0 {
+ box-shadow: none !important;
+}
+.z-depth-1 {
+ box-shadow: 0 2px 2px 0 rgba(0, 0, 0, 0.14), 0 1px 5px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -2px rgba(0, 0, 0, 0.2);
+}
+.z-depth-1-half {
+ box-shadow: 0 3px 3px 0 rgba(0, 0, 0, 0.14), 0 1px 7px 0 rgba(0, 0, 0, 0.12), 0 3px 1px -1px rgba(0, 0, 0, 0.2);
+}
+.z-depth-2 {
+ box-shadow: 0 4px 5px 0 rgba(0, 0, 0, 0.14), 0 1px 10px 0 rgba(0, 0, 0, 0.12), 0 2px 4px -1px rgba(0, 0, 0, 0.3);
+}
+.z-depth-3 {
+ box-shadow: 0 6px 10px 0 rgba(0, 0, 0, 0.14), 0 1px 18px 0 rgba(0, 0, 0, 0.12), 0 3px 5px -1px rgba(0, 0, 0, 0.3);
+}
+.z-depth-4 {
+ box-shadow: 0 8px 10px 1px rgba(0, 0, 0, 0.14), 0 3px 14px 2px rgba(0, 0, 0, 0.12), 0 5px 5px -3px rgba(0, 0, 0, 0.3);
+}
+.z-depth-5 {
+ box-shadow: 0 16px 24px 2px rgba(0, 0, 0, 0.14), 0 6px 30px 5px rgba(0, 0, 0, 0.12), 0 8px 10px -5px rgba(0, 0, 0, 0.3);
+}
+
+.hoverable {
+ transition: box-shadow .25s;
+
+ &:hover {
+ box-shadow: 0 8px 17px 0 rgba(0, 0, 0, 0.2), 0 6px 20px 0 rgba(0, 0, 0, 0.19);
+ }
+}
+
+// Dividers
+
+.divider {
+ height: 1px;
+ overflow: hidden;
+ background-color: color("grey", "lighten-2");
+}
+
+
+// Blockquote
+
+blockquote {
+ margin: 20px 0;
+ padding-left: 1.5rem;
+ border-left: 5px solid $primary-color;
+}
+
+// Icon Styles
+
+i {
+ line-height: inherit;
+
+ &.left {
+ float: left;
+ margin-right: 15px;
+ }
+ &.right {
+ float: right;
+ margin-left: 15px;
+ }
+ &.tiny {
+ font-size: 1rem;
+ }
+ &.small {
+ font-size: 2rem;
+ }
+ &.medium {
+ font-size: 4rem;
+ }
+ &.large {
+ font-size: 6rem;
+ }
+}
+
+// Images
+img.responsive-img,
+video.responsive-video {
+ max-width: 100%;
+ height: auto;
+}
+
+
+// Pagination
+
+.pagination {
+
+ li {
+ display: inline-block;
+ border-radius: 2px;
+ text-align: center;
+ vertical-align: top;
+ height: 30px;
+
+ a {
+ color: #444;
+ display: inline-block;
+ font-size: 1.2rem;
+ padding: 0 10px;
+ line-height: 30px;
+ }
+
+ &.active a { color: #fff; }
+
+ &.active { background-color: $primary-color; }
+
+ &.disabled a {
+ cursor: default;
+ color: #999;
+ }
+
+ i {
+ font-size: 2rem;
+ }
+ }
+
+
+ li.pages ul li {
+ display: inline-block;
+ float: none;
+ }
+}
+@media #{$medium-and-down} {
+ .pagination {
+ width: 100%;
+
+ li.prev,
+ li.next {
+ width: 10%;
+ }
+
+ li.pages {
+ width: 80%;
+ overflow: hidden;
+ white-space: nowrap;
+ }
+ }
+}
+
+// Breadcrumbs
+.breadcrumb {
+ font-size: 18px;
+ color: rgba(255,255,255, .7);
+
+ i,
+ [class^="mdi-"], [class*="mdi-"],
+ i.material-icons {
+ display: inline-block;
+ float: left;
+ font-size: 24px;
+ }
+
+ &:before {
+ content: '\E5CC';
+ color: rgba(255,255,255, .7);
+ vertical-align: top;
+ display: inline-block;
+ font-family: 'Material Icons';
+ font-weight: normal;
+ font-style: normal;
+ font-size: 25px;
+ margin: 0 10px 0 8px;
+ -webkit-font-smoothing: antialiased;
+ }
+
+ &:first-child:before {
+ display: none;
+ }
+
+ &:last-child {
+ color: #fff;
+ }
+}
+
+// Parallax
+.parallax-container {
+ position: relative;
+ overflow: hidden;
+ height: 500px;
+
+ .parallax {
+ position: absolute;
+ top: 0;
+ left: 0;
+ right: 0;
+ bottom: 0;
+ z-index: -1;
+
+ img {
+ display: none;
+ position: absolute;
+ left: 50%;
+ bottom: 0;
+ min-width: 100%;
+ min-height: 100%;
+ transform: translate3d(0,0,0);
+ transform: translateX(-50%);
+ }
+ }
+}
+
+// Pushpin
+.pin-top, .pin-bottom {
+ position: relative;
+}
+.pinned {
+ position: fixed !important;
+}
+
+/*********************
+ Transition Classes
+**********************/
+
+ul.staggered-list li {
+ opacity: 0;
+}
+
+.fade-in {
+ opacity: 0;
+ transform-origin: 0 50%;
+}
+
+
+/*********************
+ Media Query Classes
+**********************/
+.hide-on-small-only, .hide-on-small-and-down {
+ @media #{$small-and-down} {
+ display: none !important;
+ }
+}
+.hide-on-med-and-down {
+ @media #{$medium-and-down} {
+ display: none !important;
+ }
+}
+.hide-on-med-and-up {
+ @media #{$medium-and-up} {
+ display: none !important;
+ }
+}
+.hide-on-med-only {
+ @media only screen and (min-width: $small-screen) and (max-width: $medium-screen) {
+ display: none !important;
+ }
+}
+.hide-on-large-only {
+ @media #{$large-and-up} {
+ display: none !important;
+ }
+}
+.show-on-large {
+ @media #{$large-and-up} {
+ display: block !important;
+ }
+}
+.show-on-medium {
+ @media only screen and (min-width: $small-screen) and (max-width: $medium-screen) {
+ display: block !important;
+ }
+}
+.show-on-small {
+ @media #{$small-and-down} {
+ display: block !important;
+ }
+}
+.show-on-medium-and-up {
+ @media #{$medium-and-up} {
+ display: block !important;
+ }
+}
+.show-on-medium-and-down {
+ @media #{$medium-and-down} {
+ display: block !important;
+ }
+}
+
+
+// Center text on mobile
+.center-on-small-only {
+ @media #{$small-and-down} {
+ text-align: center;
+ }
+}
+
+// Footer
+.page-footer {
+ padding-top: 20px;
+ color: $footer-font-color;
+ background-color: $footer-bg-color;
+
+ .footer-copyright {
+ overflow: hidden;
+ min-height: 50px;
+ display: flex;
+ align-items: center;
+ padding: 10px 0px;
+ color: $footer-copyright-font-color;
+ background-color: $footer-copyright-bg-color;
+ @extend .light;
+ }
+}
+
+// Tables
+table, th, td {
+ border: none;
+}
+
+table {
+ width:100%;
+ display: table;
+
+ &.bordered > thead > tr,
+ &.bordered > tbody > tr {
+ border-bottom: 1px solid $table-border-color;
+ }
+
+ &.striped > tbody {
+ > tr:nth-child(odd) {
+ background-color: $table-striped-color;
+ }
+
+ > tr > td {
+ border-radius: 0;
+ }
+ }
+
+ &.highlight > tbody > tr {
+ transition: background-color .25s ease;
+ &:hover {
+ background-color: $table-striped-color;
+ }
+ }
+
+ &.centered {
+ thead tr th, tbody tr td {
+ text-align: center;
+ }
+ }
+
+}
+
+thead {
+ border-bottom: 1px solid $table-border-color;
+}
+
+td, th{
+ padding: 15px 5px;
+ display: table-cell;
+ text-align: left;
+ vertical-align: middle;
+ border-radius: 2px;
+}
+
+// Responsive Table
+@media #{$medium-and-down} {
+
+ table.responsive-table {
+ width: 100%;
+ border-collapse: collapse;
+ border-spacing: 0;
+ display: block;
+ position: relative;
+
+ td:empty:before {
+ content: '\00a0';
+ }
+
+ th,
+ td {
+ margin: 0;
+ vertical-align: top;
+ }
+
+ th { text-align: left; }
+ thead {
+ display: block;
+ float: left;
+
+ tr {
+ display: block;
+ padding: 0 10px 0 0;
+
+ th::before {
+ content: "\00a0";
+ }
+ }
+ }
+ tbody {
+ display: block;
+ width: auto;
+ position: relative;
+ overflow-x: auto;
+ white-space: nowrap;
+
+ tr {
+ display: inline-block;
+ vertical-align: top;
+ }
+ }
+ th {
+ display: block;
+ text-align: right;
+ }
+ td {
+ display: block;
+ min-height: 1.25em;
+ text-align: left;
+ }
+ tr { padding: 0 10px; }
+
+ /* sort out borders */
+ thead {
+ border: 0;
+ border-right: 1px solid $table-border-color;
+ }
+
+ &.bordered {
+ th { border-bottom: 0; border-left: 0; }
+ td { border-left: 0; border-right: 0; border-bottom: 0; }
+ tr { border: 0; }
+ tbody tr { border-right: 1px solid $table-border-color; }
+ }
+
+ }
+
+}
+
+
+// Collections
+.collection {
+ margin: $element-top-margin 0 $element-bottom-margin 0;
+ border: 1px solid $collection-border-color;
+ border-radius: 2px;
+ overflow: hidden;
+ position: relative;
+
+ .collection-item {
+ background-color: $collection-bg-color;
+ line-height: $collection-line-height;
+ padding: 10px 20px;
+ margin: 0;
+ border-bottom: 1px solid $collection-border-color;
+
+ // Avatar Collection
+ &.avatar {
+ min-height: 84px;
+ padding-left: 72px;
+ position: relative;
+
+ // Don't style circles inside preloader classes.
+ &:not(.circle-clipper) > .circle,
+ :not(.circle-clipper) > .circle {
+ position: absolute;
+ width: 42px;
+ height: 42px;
+ overflow: hidden;
+ left: 15px;
+ display: inline-block;
+ vertical-align: middle;
+ }
+ i.circle {
+ font-size: 18px;
+ line-height: 42px;
+ color: #fff;
+ background-color: #999;
+ text-align: center;
+ }
+
+
+ .title {
+ font-size: 16px;
+ }
+
+ p {
+ margin: 0;
+ }
+
+ .secondary-content {
+ position: absolute;
+ top: 16px;
+ right: 16px;
+ }
+
+ }
+
+
+ &:last-child {
+ border-bottom: none;
+ }
+
+ &.active {
+ background-color: $collection-active-bg-color;
+ color: $collection-active-color;
+
+ .secondary-content {
+ color: #fff;
+ }
+ }
+ }
+ a.collection-item{
+ display: block;
+ transition: .25s;
+ color: $collection-link-color;
+ &:not(.active) {
+ &:hover {
+ background-color: $collection-hover-bg-color;
+ }
+ }
+ }
+
+ &.with-header {
+ .collection-header {
+ background-color: $collection-bg-color;
+ border-bottom: 1px solid $collection-border-color;
+ padding: 10px 20px;
+ }
+ .collection-item {
+ padding-left: 30px;
+ }
+ .collection-item.avatar {
+ padding-left: 72px;
+ }
+ }
+
+}
+// Made less specific to allow easier overriding
+.secondary-content {
+ float: right;
+ color: $secondary-color;
+}
+.collapsible .collection {
+ margin: 0;
+ border: none;
+}
+
+
+
+// Responsive Videos
+.video-container {
+ position: relative;
+ padding-bottom: 56.25%;
+ height: 0;
+ overflow: hidden;
+
+ iframe, object, embed {
+ position: absolute;
+ top: 0;
+ left: 0;
+ width: 100%;
+ height: 100%;
+ }
+}
+
+// Progress Bar
+.progress {
+ position: relative;
+ height: 4px;
+ display: block;
+ width: 100%;
+ background-color: lighten($progress-bar-color, 40%);
+ border-radius: 2px;
+ margin: $element-top-margin 0 $element-bottom-margin 0;
+ overflow: hidden;
+ .determinate {
+ position: absolute;
+ top: 0;
+ left: 0;
+ bottom: 0;
+ background-color: $progress-bar-color;
+ transition: width .3s linear;
+ }
+ .indeterminate {
+ background-color: $progress-bar-color;
+ &:before {
+ content: '';
+ position: absolute;
+ background-color: inherit;
+ top: 0;
+ left:0;
+ bottom: 0;
+ will-change: left, right;
+ // Custom bezier
+ animation: indeterminate 2.1s cubic-bezier(0.650, 0.815, 0.735, 0.395) infinite;
+
+ }
+ &:after {
+ content: '';
+ position: absolute;
+ background-color: inherit;
+ top: 0;
+ left:0;
+ bottom: 0;
+ will-change: left, right;
+ // Custom bezier
+ animation: indeterminate-short 2.1s cubic-bezier(0.165, 0.840, 0.440, 1.000) infinite;
+ animation-delay: 1.15s;
+ }
+ }
+}
+@keyframes indeterminate {
+ 0% {
+ left: -35%;
+ right:100%;
+ }
+ 60% {
+ left: 100%;
+ right: -90%;
+ }
+ 100% {
+ left: 100%;
+ right: -90%;
+ }
+}
+
+@keyframes indeterminate-short {
+ 0% {
+ left: -200%;
+ right: 100%;
+ }
+ 60% {
+ left: 107%;
+ right: -8%;
+ }
+ 100% {
+ left: 107%;
+ right: -8%;
+ }
+}
+
+
+/*******************
+ Utility Classes
+*******************/
+
+.hide {
+ display: none !important;
+}
+
+// Text Align
+.left-align {
+ text-align: left;
+}
+.right-align {
+ text-align: right
+}
+.center, .center-align {
+ text-align: center;
+}
+
+.left {
+ float: left !important;
+}
+.right {
+ float: right !important;
+}
+
+// No Text Select
+.no-select {
+ user-select: none;
+}
+
+.circle {
+ border-radius: 50%;
+}
+
+.center-block {
+ display: block;
+ margin-left: auto;
+ margin-right: auto;
+}
+
+.truncate {
+ display: block;
+ white-space: nowrap;
+ overflow: hidden;
+ text-overflow: ellipsis;
+}
+
+.no-padding {
+ padding: 0 !important;
+}
diff --git a/app/dispatch/static/materialize/sass/components/_grid.scss b/app/dispatch/static/materialize/sass/components/_grid.scss new file mode 100644 index 0000000..7aa9e8f --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_grid.scss @@ -0,0 +1,156 @@ +.container {
+ margin: 0 auto;
+ max-width: 1280px;
+ width: 90%;
+}
+@media #{$medium-and-up} {
+ .container {
+ width: 85%;
+ }
+}
+@media #{$large-and-up} {
+ .container {
+ width: 70%;
+ }
+}
+.container .row {
+ margin-left: (-1 * $gutter-width / 2);
+ margin-right: (-1 * $gutter-width / 2);
+}
+
+.section {
+ padding-top: 1rem;
+ padding-bottom: 1rem;
+
+ &.no-pad {
+ padding: 0;
+ }
+ &.no-pad-bot {
+ padding-bottom: 0;
+ }
+ &.no-pad-top {
+ padding-top: 0;
+ }
+}
+
+
+// Mixins to eliminate code repitition
+@mixin reset-offset {
+ margin-left: auto;
+ left: auto;
+ right: auto;
+}
+@mixin grid-classes($size, $i, $perc) {
+ &.offset-#{$size}#{$i} {
+ margin-left: $perc;
+ }
+ &.pull-#{$size}#{$i} {
+ right: $perc;
+ }
+ &.push-#{$size}#{$i} {
+ left: $perc;
+ }
+}
+
+
+.row {
+ margin-left: auto;
+ margin-right: auto;
+ margin-bottom: 20px;
+
+ // Clear floating children
+ &:after {
+ content: "";
+ display: table;
+ clear: both;
+ }
+
+ .col {
+ float: left;
+ box-sizing: border-box;
+ padding: 0 $gutter-width / 2;
+ min-height: 1px;
+
+ &[class*="push-"],
+ &[class*="pull-"] {
+ position: relative;
+ }
+
+ $i: 1;
+ @while $i <= $num-cols {
+ $perc: unquote((100 / ($num-cols / $i)) + "%");
+ &.s#{$i} {
+ width: $perc;
+ @include reset-offset;
+ }
+ $i: $i + 1;
+ }
+
+ $i: 1;
+ @while $i <= $num-cols {
+ $perc: unquote((100 / ($num-cols / $i)) + "%");
+ @include grid-classes("s", $i, $perc);
+ $i: $i + 1;
+ }
+
+ @media #{$medium-and-up} {
+
+ $i: 1;
+ @while $i <= $num-cols {
+ $perc: unquote((100 / ($num-cols / $i)) + "%");
+ &.m#{$i} {
+ width: $perc;
+ @include reset-offset;
+ }
+ $i: $i + 1
+ }
+
+ $i: 1;
+ @while $i <= $num-cols {
+ $perc: unquote((100 / ($num-cols / $i)) + "%");
+ @include grid-classes("m", $i, $perc);
+ $i: $i + 1;
+ }
+ }
+
+ @media #{$large-and-up} {
+
+ $i: 1;
+ @while $i <= $num-cols {
+ $perc: unquote((100 / ($num-cols / $i)) + "%");
+ &.l#{$i} {
+ width: $perc;
+ @include reset-offset;
+ }
+ $i: $i + 1;
+ }
+
+ $i: 1;
+ @while $i <= $num-cols {
+ $perc: unquote((100 / ($num-cols / $i)) + "%");
+ @include grid-classes("l", $i, $perc);
+ $i: $i + 1;
+ }
+ }
+
+ @media #{$extra-large-and-up} {
+
+ $i: 1;
+ @while $i <= $num-cols {
+ $perc: unquote((100 / ($num-cols / $i)) + "%");
+ &.xl#{$i} {
+ width: $perc;
+ @include reset-offset;
+ }
+ $i: $i + 1;
+ }
+
+ $i: 1;
+ @while $i <= $num-cols {
+ $perc: unquote((100 / ($num-cols / $i)) + "%");
+ @include grid-classes("xl", $i, $perc);
+ $i: $i + 1;
+ }
+ }
+ }
+}
diff --git a/app/dispatch/static/materialize/sass/components/_icons-material-design.scss b/app/dispatch/static/materialize/sass/components/_icons-material-design.scss new file mode 100644 index 0000000..2aa6a4a --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_icons-material-design.scss @@ -0,0 +1,5 @@ +/* This is needed for some mobile phones to display the Google Icon font properly */
+.material-icons {
+ text-rendering: optimizeLegibility;
+ font-feature-settings: 'liga';
+}
diff --git a/app/dispatch/static/materialize/sass/components/_materialbox.scss b/app/dispatch/static/materialize/sass/components/_materialbox.scss new file mode 100644 index 0000000..3027667 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_materialbox.scss @@ -0,0 +1,43 @@ +.materialboxed {
+ &:hover {
+ &:not(.active) {
+ opacity: .8;
+ }
+ }
+
+ display: block;
+ cursor: zoom-in;
+ position: relative;
+ transition: opacity .4s;
+ -webkit-backface-visibility: hidden;
+
+ &.active {
+ cursor: zoom-out;
+ }
+}
+
+#materialbox-overlay {
+ position:fixed;
+ top: 0;
+ right: 0;
+ bottom: 0;
+ left: 0;
+ background-color: #292929;
+ z-index: 1000;
+ will-change: opacity;
+}
+
+.materialbox-caption {
+ position: fixed;
+ display: none;
+ color: #fff;
+ line-height: 50px;
+ bottom: 0;
+ left: 0;
+ width: 100%;
+ text-align: center;
+ padding: 0% 15%;
+ height: 50px;
+ z-index: 1000;
+ -webkit-font-smoothing: antialiased;
+}
\ No newline at end of file diff --git a/app/dispatch/static/materialize/sass/components/_modal.scss b/app/dispatch/static/materialize/sass/components/_modal.scss new file mode 100644 index 0000000..82445b4 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_modal.scss @@ -0,0 +1,90 @@ +.modal {
+ @extend .z-depth-4;
+
+ display: none;
+ position: fixed;
+ left: 0;
+ right: 0;
+ background-color: #fafafa;
+ padding: 0;
+ max-height: 70%;
+ width: 55%;
+ margin: auto;
+ overflow-y: auto;
+
+ border-radius: 2px;
+ will-change: top, opacity;
+
+ @media #{$medium-and-down} {
+ width: 80%;
+ }
+
+ h1,h2,h3,h4 {
+ margin-top: 0;
+ }
+
+ .modal-content {
+ padding: 24px;
+ }
+ .modal-close {
+ cursor: pointer;
+ }
+
+ .modal-footer {
+ border-radius: 0 0 2px 2px;
+ background-color: #fafafa;
+ padding: 4px 6px;
+ height: 56px;
+ width: 100%;
+ text-align: right;
+
+ .btn, .btn-flat {
+ margin: 6px 0;
+ }
+ }
+}
+.modal-overlay {
+ position: fixed;
+ z-index: 999;
+ top: -25%;
+ left: 0;
+ bottom: 0;
+ right: 0;
+ height: 125%;
+ width: 100%;
+ background: #000;
+ display: none;
+
+ will-change: opacity;
+}
+
+// Modal with fixed action footer
+.modal.modal-fixed-footer {
+ padding: 0;
+ height: 70%;
+
+ .modal-content {
+ position: absolute;
+ height: calc(100% - 56px);
+ max-height: 100%;
+ width: 100%;
+ overflow-y: auto;
+ }
+
+ .modal-footer {
+ border-top: 1px solid rgba(0,0,0,.1);
+ position: absolute;
+ bottom: 0;
+ }
+}
+
+// Modal Bottom Sheet Style
+.modal.bottom-sheet {
+ top: auto;
+ bottom: -100%;
+ margin: 0;
+ width: 100%;
+ max-height: 45%;
+ border-radius: 0;
+ will-change: bottom, opacity;
+}
diff --git a/app/dispatch/static/materialize/sass/components/_navbar.scss b/app/dispatch/static/materialize/sass/components/_navbar.scss new file mode 100644 index 0000000..d6fb2f1 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_navbar.scss @@ -0,0 +1,208 @@ +nav {
+ &.nav-extended {
+ height: auto;
+
+ .nav-wrapper {
+ min-height: $navbar-height-mobile;
+ height: auto;
+ }
+
+ .nav-content {
+ position: relative;
+ line-height: normal;
+ }
+ }
+
+ color: $navbar-font-color;
+ @extend .z-depth-1;
+ background-color: $primary-color;
+ width: 100%;
+ height: $navbar-height-mobile;
+ line-height: $navbar-line-height-mobile;
+
+ a { color: $navbar-font-color; }
+
+ i,
+ [class^="mdi-"], [class*="mdi-"],
+ i.material-icons {
+ display: block;
+ font-size: 24px;
+ height: $navbar-height-mobile;
+ line-height: $navbar-line-height-mobile;
+ }
+
+ .nav-wrapper {
+ position: relative;
+ height: 100%;
+ }
+
+ @media #{$large-and-up} {
+ a.button-collapse { display: none; }
+ }
+
+
+ // Collapse button
+ .button-collapse {
+ float: left;
+ position: relative;
+ z-index: 1;
+ height: $navbar-height-mobile;
+ margin: 0 18px;
+
+ i {
+ height: $navbar-height-mobile;
+ line-height: $navbar-line-height-mobile;
+ }
+ }
+
+
+ // Logo
+ .brand-logo {
+ position: absolute;
+ color: $navbar-font-color;
+ display: inline-block;
+ font-size: $navbar-brand-font-size;
+ padding: 0;
+
+ &.center {
+ left: 50%;
+ transform: translateX(-50%);
+ }
+
+ @media #{$medium-and-down} {
+ left: 50%;
+ transform: translateX(-50%);
+
+ &.left, &.right {
+ padding: 0;
+ transform: none;
+ }
+
+ &.left { left: 0.5rem; }
+ &.right {
+ right: 0.5rem;
+ left: auto;
+ }
+ }
+
+ &.right {
+ right: 0.5rem;
+ padding: 0;
+ }
+
+ i,
+ [class^="mdi-"], [class*="mdi-"],
+ i.material-icons {
+ float: left;
+ margin-right: 15px;
+ }
+ }
+
+
+ // Title
+ .nav-title {
+ display: inline-block;
+ font-size: 32px;
+ padding: 28px 0;
+ }
+
+
+ // Navbar Links
+ ul {
+ margin: 0;
+
+ li {
+ transition: background-color .3s;
+ float: left;
+ padding: 0;
+
+ &.active {
+ background-color: rgba(0,0,0,.1);
+ }
+ }
+ a {
+ transition: background-color .3s;
+ font-size: $navbar-font-size;
+ color: $navbar-font-color;
+ display: block;
+ padding: 0 15px;
+ cursor: pointer;
+
+ &.btn, &.btn-large, &.btn-flat, &.btn-floating {
+ margin-top: -2px;
+ margin-left: 15px;
+ margin-right: 15px;
+
+ & > .material-icons {
+ height: inherit;
+ line-height: inherit;
+ }
+ }
+
+ &:hover {
+ background-color: rgba(0,0,0,.1);
+ }
+ }
+
+ &.left {
+ float: left;
+ }
+ }
+
+ // Navbar Search Form
+ form {
+ height: 100%;
+ }
+
+ .input-field {
+ margin: 0;
+ height: 100%;
+
+ input {
+ height: 100%;
+ font-size: 1.2rem;
+ border: none;
+ padding-left: 2rem;
+
+ &:focus, &[type=text]:valid, &[type=password]:valid,
+ &[type=email]:valid, &[type=url]:valid, &[type=date]:valid {
+ border: none;
+ box-shadow: none;
+ }
+ }
+
+ label {
+ top: 0;
+ left: 0;
+
+ i {
+ color: rgba(255,255,255,.7);
+ transition: color .3s;
+ }
+ &.active i { color: $navbar-font-color; }
+ }
+ }
+}
+
+// Fixed Navbar
+.navbar-fixed {
+ position: relative;
+ height: $navbar-height-mobile;
+ z-index: 997;
+
+ nav {
+ position: fixed;
+ }
+}
+@media #{$medium-and-up} {
+ nav.nav-extended .nav-wrapper {
+ min-height: $navbar-height;
+ }
+ nav, nav .nav-wrapper i, nav a.button-collapse, nav a.button-collapse i {
+ height: $navbar-height;
+ line-height: $navbar-line-height;
+ }
+ .navbar-fixed {
+ height: $navbar-height;
+ }
+}
diff --git a/app/dispatch/static/materialize/sass/components/_normalize.scss b/app/dispatch/static/materialize/sass/components/_normalize.scss new file mode 100644 index 0000000..d6d3c19 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_normalize.scss @@ -0,0 +1,424 @@ +/*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */
+
+/**
+ * 1. Set default font family to sans-serif.
+ * 2. Prevent iOS and IE text size adjust after device orientation change,
+ * without disabling user zoom.
+ */
+
+html {
+ font-family: sans-serif; /* 1 */
+ -ms-text-size-adjust: 100%; /* 2 */
+ -webkit-text-size-adjust: 100%; /* 2 */
+}
+
+/**
+ * Remove default margin.
+ */
+
+body {
+ margin: 0;
+}
+
+/* HTML5 display definitions
+ ========================================================================== */
+
+/**
+ * Correct `block` display not defined for any HTML5 element in IE 8/9.
+ * Correct `block` display not defined for `details` or `summary` in IE 10/11
+ * and Firefox.
+ * Correct `block` display not defined for `main` in IE 11.
+ */
+
+article,
+aside,
+details,
+figcaption,
+figure,
+footer,
+header,
+hgroup,
+main,
+menu,
+nav,
+section,
+summary {
+ display: block;
+}
+
+/**
+ * 1. Correct `inline-block` display not defined in IE 8/9.
+ * 2. Normalize vertical alignment of `progress` in Chrome, Firefox, and Opera.
+ */
+
+audio,
+canvas,
+progress,
+video {
+ display: inline-block; /* 1 */
+ vertical-align: baseline; /* 2 */
+}
+
+/**
+ * Prevent modern browsers from displaying `audio` without controls.
+ * Remove excess height in iOS 5 devices.
+ */
+
+audio:not([controls]) {
+ display: none;
+ height: 0;
+}
+
+/**
+ * Address `[hidden]` styling not present in IE 8/9/10.
+ * Hide the `template` element in IE 8/9/10/11, Safari, and Firefox < 22.
+ */
+
+[hidden],
+template {
+ display: none;
+}
+
+/* Links
+ ========================================================================== */
+
+/**
+ * Remove the gray background color from active links in IE 10.
+ */
+
+a {
+ background-color: transparent;
+}
+
+/**
+ * Improve readability of focused elements when they are also in an
+ * active/hover state.
+ */
+
+a:active,
+a:hover {
+ outline: 0;
+}
+
+/* Text-level semantics
+ ========================================================================== */
+
+/**
+ * Address styling not present in IE 8/9/10/11, Safari, and Chrome.
+ */
+
+abbr[title] {
+ border-bottom: 1px dotted;
+}
+
+/**
+ * Address style set to `bolder` in Firefox 4+, Safari, and Chrome.
+ */
+
+b,
+strong {
+ font-weight: bold;
+}
+
+/**
+ * Address styling not present in Safari and Chrome.
+ */
+
+dfn {
+ font-style: italic;
+}
+
+/**
+ * Address variable `h1` font-size and margin within `section` and `article`
+ * contexts in Firefox 4+, Safari, and Chrome.
+ */
+
+h1 {
+ font-size: 2em;
+ margin: 0.67em 0;
+}
+
+/**
+ * Address styling not present in IE 8/9.
+ */
+
+mark {
+ background: #ff0;
+ color: #000;
+}
+
+/**
+ * Address inconsistent and variable font size in all browsers.
+ */
+
+small {
+ font-size: 80%;
+}
+
+/**
+ * Prevent `sub` and `sup` affecting `line-height` in all browsers.
+ */
+
+sub,
+sup {
+ font-size: 75%;
+ line-height: 0;
+ position: relative;
+ vertical-align: baseline;
+}
+
+sup {
+ top: -0.5em;
+}
+
+sub {
+ bottom: -0.25em;
+}
+
+/* Embedded content
+ ========================================================================== */
+
+/**
+ * Remove border when inside `a` element in IE 8/9/10.
+ */
+
+img {
+ border: 0;
+}
+
+/**
+ * Correct overflow not hidden in IE 9/10/11.
+ */
+
+svg:not(:root) {
+ overflow: hidden;
+}
+
+/* Grouping content
+ ========================================================================== */
+
+/**
+ * Address margin not present in IE 8/9 and Safari.
+ */
+
+figure {
+ margin: 1em 40px;
+}
+
+/**
+ * Address differences between Firefox and other browsers.
+ */
+
+hr {
+ box-sizing: content-box;
+ height: 0;
+}
+
+/**
+ * Contain overflow in all browsers.
+ */
+
+pre {
+ overflow: auto;
+}
+
+/**
+ * Address odd `em`-unit font size rendering in all browsers.
+ */
+
+code,
+kbd,
+pre,
+samp {
+ font-family: monospace, monospace;
+ font-size: 1em;
+}
+
+/* Forms
+ ========================================================================== */
+
+/**
+ * Known limitation: by default, Chrome and Safari on OS X allow very limited
+ * styling of `select`, unless a `border` property is set.
+ */
+
+/**
+ * 1. Correct color not being inherited.
+ * Known issue: affects color of disabled elements.
+ * 2. Correct font properties not being inherited.
+ * 3. Address margins set differently in Firefox 4+, Safari, and Chrome.
+ */
+
+button,
+input,
+optgroup,
+select,
+textarea {
+ color: inherit; /* 1 */
+ font: inherit; /* 2 */
+ margin: 0; /* 3 */
+}
+
+/**
+ * Address `overflow` set to `hidden` in IE 8/9/10/11.
+ */
+
+button {
+ overflow: visible;
+}
+
+/**
+ * Address inconsistent `text-transform` inheritance for `button` and `select`.
+ * All other form control elements do not inherit `text-transform` values.
+ * Correct `button` style inheritance in Firefox, IE 8/9/10/11, and Opera.
+ * Correct `select` style inheritance in Firefox.
+ */
+
+button,
+select {
+ text-transform: none;
+}
+
+/**
+ * 1. Avoid the WebKit bug in Android 4.0.* where (2) destroys native `audio`
+ * and `video` controls.
+ * 2. Correct inability to style clickable `input` types in iOS.
+ * 3. Improve usability and consistency of cursor style between image-type
+ * `input` and others.
+ */
+
+button,
+html input[type="button"], /* 1 */
+input[type="reset"],
+input[type="submit"] {
+ -webkit-appearance: button; /* 2 */
+ cursor: pointer; /* 3 */
+}
+
+/**
+ * Re-set default cursor for disabled elements.
+ */
+
+button[disabled],
+html input[disabled] {
+ cursor: default;
+}
+
+/**
+ * Remove inner padding and border in Firefox 4+.
+ */
+
+button::-moz-focus-inner,
+input::-moz-focus-inner {
+ border: 0;
+ padding: 0;
+}
+
+/**
+ * Address Firefox 4+ setting `line-height` on `input` using `!important` in
+ * the UA stylesheet.
+ */
+
+input {
+ line-height: normal;
+}
+
+/**
+ * It's recommended that you don't attempt to style these elements.
+ * Firefox's implementation doesn't respect box-sizing, padding, or width.
+ *
+ * 1. Address box sizing set to `content-box` in IE 8/9/10.
+ * 2. Remove excess padding in IE 8/9/10.
+ */
+
+input[type="checkbox"],
+input[type="radio"] {
+ box-sizing: border-box; /* 1 */
+ padding: 0; /* 2 */
+}
+
+/**
+ * Fix the cursor style for Chrome's increment/decrement buttons. For certain
+ * `font-size` values of the `input`, it causes the cursor style of the
+ * decrement button to change from `default` to `text`.
+ */
+
+input[type="number"]::-webkit-inner-spin-button,
+input[type="number"]::-webkit-outer-spin-button {
+ height: auto;
+}
+
+/**
+ * 1. Address `appearance` set to `searchfield` in Safari and Chrome.
+ * 2. Address `box-sizing` set to `border-box` in Safari and Chrome.
+ */
+
+input[type="search"] {
+ -webkit-appearance: textfield; /* 1 */
+ box-sizing: content-box; /* 2 */
+}
+
+/**
+ * Remove inner padding and search cancel button in Safari and Chrome on OS X.
+ * Safari (but not Chrome) clips the cancel button when the search input has
+ * padding (and `textfield` appearance).
+ */
+
+input[type="search"]::-webkit-search-cancel-button,
+input[type="search"]::-webkit-search-decoration {
+ -webkit-appearance: none;
+}
+
+/**
+ * Define consistent border, margin, and padding.
+ */
+
+fieldset {
+ border: 1px solid #c0c0c0;
+ margin: 0 2px;
+ padding: 0.35em 0.625em 0.75em;
+}
+
+/**
+ * 1. Correct `color` not being inherited in IE 8/9/10/11.
+ * 2. Remove padding so people aren't caught out if they zero out fieldsets.
+ */
+
+legend {
+ border: 0; /* 1 */
+ padding: 0; /* 2 */
+}
+
+/**
+ * Remove default vertical scrollbar in IE 8/9/10/11.
+ */
+
+textarea {
+ overflow: auto;
+}
+
+/**
+ * Don't inherit the `font-weight` (applied by a rule above).
+ * NOTE: the default cannot safely be changed in Chrome and Safari on OS X.
+ */
+
+optgroup {
+ font-weight: bold;
+}
+
+/* Tables
+ ========================================================================== */
+
+/**
+ * Remove most spacing between table cells.
+ */
+
+table {
+ border-collapse: collapse;
+ border-spacing: 0;
+}
+
+td,
+th {
+ padding: 0;
+}
diff --git a/app/dispatch/static/materialize/sass/components/_preloader.scss b/app/dispatch/static/materialize/sass/components/_preloader.scss new file mode 100644 index 0000000..cfe2993 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_preloader.scss @@ -0,0 +1,334 @@ +/*
+ @license
+ Copyright (c) 2014 The Polymer Project Authors. All rights reserved.
+ This code may only be used under the BSD style license found at http://polymer.github.io/LICENSE.txt
+ The complete set of authors may be found at http://polymer.github.io/AUTHORS.txt
+ The complete set of contributors may be found at http://polymer.github.io/CONTRIBUTORS.txt
+ Code distributed by Google as part of the polymer project is also
+ subject to an additional IP rights grant found at http://polymer.github.io/PATENTS.txt
+ */
+
+/**************************/
+/* STYLES FOR THE SPINNER */
+/**************************/
+
+/*
+ * Constants:
+ * STROKEWIDTH = 3px
+ * ARCSIZE = 270 degrees (amount of circle the arc takes up)
+ * ARCTIME = 1333ms (time it takes to expand and contract arc)
+ * ARCSTARTROT = 216 degrees (how much the start location of the arc
+ * should rotate each time, 216 gives us a
+ * 5 pointed star shape (it's 360/5 * 3).
+ * For a 7 pointed star, we might do
+ * 360/7 * 3 = 154.286)
+ * CONTAINERWIDTH = 28px
+ * SHRINK_TIME = 400ms
+ */
+
+
+.preloader-wrapper {
+ display: inline-block;
+ position: relative;
+ width: 50px;
+ height: 50px;
+
+ &.small {
+ width: 36px;
+ height: 36px;
+ }
+
+ &.big {
+ width: 64px;
+ height: 64px;
+ }
+
+ &.active {
+ /* duration: 360 * ARCTIME / (ARCSTARTROT + (360-ARCSIZE)) */
+ -webkit-animation: container-rotate 1568ms linear infinite;
+ animation: container-rotate 1568ms linear infinite;
+ }
+}
+
+@-webkit-keyframes container-rotate {
+ to { -webkit-transform: rotate(360deg) }
+}
+
+@keyframes container-rotate {
+ to { transform: rotate(360deg) }
+}
+
+.spinner-layer {
+ position: absolute;
+ width: 100%;
+ height: 100%;
+ opacity: 0;
+ border-color: $spinner-default-color;
+}
+
+.spinner-blue,
+.spinner-blue-only {
+ border-color: #4285f4;
+}
+
+.spinner-red,
+.spinner-red-only {
+ border-color: #db4437;
+}
+
+.spinner-yellow,
+.spinner-yellow-only {
+ border-color: #f4b400;
+}
+
+.spinner-green,
+.spinner-green-only {
+ border-color: #0f9d58;
+}
+
+/**
+ * IMPORTANT NOTE ABOUT CSS ANIMATION PROPERTIES (keanulee):
+ *
+ * iOS Safari (tested on iOS 8.1) does not handle animation-delay very well - it doesn't
+ * guarantee that the animation will start _exactly_ after that value. So we avoid using
+ * animation-delay and instead set custom keyframes for each color (as redundant as it
+ * seems).
+ *
+ * We write out each animation in full (instead of separating animation-name,
+ * animation-duration, etc.) because under the polyfill, Safari does not recognize those
+ * specific properties properly, treats them as -webkit-animation, and overrides the
+ * other animation rules. See https://github.com/Polymer/platform/issues/53.
+ */
+.active .spinner-layer.spinner-blue {
+ /* durations: 4 * ARCTIME */
+ -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both, blue-fade-in-out 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both;
+ animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both, blue-fade-in-out 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both;
+}
+
+.active .spinner-layer.spinner-red {
+ /* durations: 4 * ARCTIME */
+ -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both, red-fade-in-out 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both;
+ animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both, red-fade-in-out 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both;
+}
+
+.active .spinner-layer.spinner-yellow {
+ /* durations: 4 * ARCTIME */
+ -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both, yellow-fade-in-out 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both;
+ animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both, yellow-fade-in-out 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both;
+}
+
+.active .spinner-layer.spinner-green {
+ /* durations: 4 * ARCTIME */
+ -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both, green-fade-in-out 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both;
+ animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both, green-fade-in-out 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both;
+}
+
+.active .spinner-layer,
+.active .spinner-layer.spinner-blue-only,
+.active .spinner-layer.spinner-red-only,
+.active .spinner-layer.spinner-yellow-only,
+.active .spinner-layer.spinner-green-only {
+ /* durations: 4 * ARCTIME */
+ opacity: 1;
+ -webkit-animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both;
+ animation: fill-unfill-rotate 5332ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both;
+}
+
+@-webkit-keyframes fill-unfill-rotate {
+ 12.5% { -webkit-transform: rotate(135deg); } /* 0.5 * ARCSIZE */
+ 25% { -webkit-transform: rotate(270deg); } /* 1 * ARCSIZE */
+ 37.5% { -webkit-transform: rotate(405deg); } /* 1.5 * ARCSIZE */
+ 50% { -webkit-transform: rotate(540deg); } /* 2 * ARCSIZE */
+ 62.5% { -webkit-transform: rotate(675deg); } /* 2.5 * ARCSIZE */
+ 75% { -webkit-transform: rotate(810deg); } /* 3 * ARCSIZE */
+ 87.5% { -webkit-transform: rotate(945deg); } /* 3.5 * ARCSIZE */
+ to { -webkit-transform: rotate(1080deg); } /* 4 * ARCSIZE */
+}
+
+@keyframes fill-unfill-rotate {
+ 12.5% { transform: rotate(135deg); } /* 0.5 * ARCSIZE */
+ 25% { transform: rotate(270deg); } /* 1 * ARCSIZE */
+ 37.5% { transform: rotate(405deg); } /* 1.5 * ARCSIZE */
+ 50% { transform: rotate(540deg); } /* 2 * ARCSIZE */
+ 62.5% { transform: rotate(675deg); } /* 2.5 * ARCSIZE */
+ 75% { transform: rotate(810deg); } /* 3 * ARCSIZE */
+ 87.5% { transform: rotate(945deg); } /* 3.5 * ARCSIZE */
+ to { transform: rotate(1080deg); } /* 4 * ARCSIZE */
+}
+
+@-webkit-keyframes blue-fade-in-out {
+ from { opacity: 1; }
+ 25% { opacity: 1; }
+ 26% { opacity: 0; }
+ 89% { opacity: 0; }
+ 90% { opacity: 1; }
+ 100% { opacity: 1; }
+}
+
+@keyframes blue-fade-in-out {
+ from { opacity: 1; }
+ 25% { opacity: 1; }
+ 26% { opacity: 0; }
+ 89% { opacity: 0; }
+ 90% { opacity: 1; }
+ 100% { opacity: 1; }
+}
+
+@-webkit-keyframes red-fade-in-out {
+ from { opacity: 0; }
+ 15% { opacity: 0; }
+ 25% { opacity: 1; }
+ 50% { opacity: 1; }
+ 51% { opacity: 0; }
+}
+
+@keyframes red-fade-in-out {
+ from { opacity: 0; }
+ 15% { opacity: 0; }
+ 25% { opacity: 1; }
+ 50% { opacity: 1; }
+ 51% { opacity: 0; }
+}
+
+@-webkit-keyframes yellow-fade-in-out {
+ from { opacity: 0; }
+ 40% { opacity: 0; }
+ 50% { opacity: 1; }
+ 75% { opacity: 1; }
+ 76% { opacity: 0; }
+}
+
+@keyframes yellow-fade-in-out {
+ from { opacity: 0; }
+ 40% { opacity: 0; }
+ 50% { opacity: 1; }
+ 75% { opacity: 1; }
+ 76% { opacity: 0; }
+}
+
+@-webkit-keyframes green-fade-in-out {
+ from { opacity: 0; }
+ 65% { opacity: 0; }
+ 75% { opacity: 1; }
+ 90% { opacity: 1; }
+ 100% { opacity: 0; }
+}
+
+@keyframes green-fade-in-out {
+ from { opacity: 0; }
+ 65% { opacity: 0; }
+ 75% { opacity: 1; }
+ 90% { opacity: 1; }
+ 100% { opacity: 0; }
+}
+
+/**
+ * Patch the gap that appear between the two adjacent div.circle-clipper while the
+ * spinner is rotating (appears on Chrome 38, Safari 7.1, and IE 11).
+ */
+.gap-patch {
+ position: absolute;
+ top: 0;
+ left: 45%;
+ width: 10%;
+ height: 100%;
+ overflow: hidden;
+ border-color: inherit;
+}
+
+.gap-patch .circle {
+ width: 1000%;
+ left: -450%;
+}
+
+.circle-clipper {
+ display: inline-block;
+ position: relative;
+ width: 50%;
+ height: 100%;
+ overflow: hidden;
+ border-color: inherit;
+
+ .circle {
+ width: 200%;
+ height: 100%;
+ border-width: 3px; /* STROKEWIDTH */
+ border-style: solid;
+ border-color: inherit;
+ border-bottom-color: transparent !important;
+ border-radius: 50%;
+ -webkit-animation: none;
+ animation: none;
+ position: absolute;
+ top: 0;
+ right: 0;
+ bottom: 0;
+ }
+
+ &.left .circle {
+ left: 0;
+ border-right-color: transparent !important;
+ -webkit-transform: rotate(129deg);
+ transform: rotate(129deg);
+ }
+ &.right .circle {
+ left: -100%;
+ border-left-color: transparent !important;
+ -webkit-transform: rotate(-129deg);
+ transform: rotate(-129deg);
+ }
+}
+
+
+
+.active .circle-clipper.left .circle {
+ /* duration: ARCTIME */
+ -webkit-animation: left-spin 1333ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both;
+ animation: left-spin 1333ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both;
+}
+
+.active .circle-clipper.right .circle {
+ /* duration: ARCTIME */
+ -webkit-animation: right-spin 1333ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both;
+ animation: right-spin 1333ms cubic-bezier(0.4, 0.0, 0.2, 1) infinite both;
+}
+
+@-webkit-keyframes left-spin {
+ from { -webkit-transform: rotate(130deg); }
+ 50% { -webkit-transform: rotate(-5deg); }
+ to { -webkit-transform: rotate(130deg); }
+}
+
+@keyframes left-spin {
+ from { transform: rotate(130deg); }
+ 50% { transform: rotate(-5deg); }
+ to { transform: rotate(130deg); }
+}
+
+@-webkit-keyframes right-spin {
+ from { -webkit-transform: rotate(-130deg); }
+ 50% { -webkit-transform: rotate(5deg); }
+ to { -webkit-transform: rotate(-130deg); }
+}
+
+@keyframes right-spin {
+ from { transform: rotate(-130deg); }
+ 50% { transform: rotate(5deg); }
+ to { transform: rotate(-130deg); }
+}
+
+#spinnerContainer.cooldown {
+ /* duration: SHRINK_TIME */
+ -webkit-animation: container-rotate 1568ms linear infinite, fade-out 400ms cubic-bezier(0.4, 0.0, 0.2, 1);
+ animation: container-rotate 1568ms linear infinite, fade-out 400ms cubic-bezier(0.4, 0.0, 0.2, 1);
+}
+
+@-webkit-keyframes fade-out {
+ from { opacity: 1; }
+ to { opacity: 0; }
+}
+
+@keyframes fade-out {
+ from { opacity: 1; }
+ to { opacity: 0; }
+}
diff --git a/app/dispatch/static/materialize/sass/components/_pulse.scss b/app/dispatch/static/materialize/sass/components/_pulse.scss new file mode 100644 index 0000000..a3b7d9f --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_pulse.scss @@ -0,0 +1,34 @@ +.pulse {
+ &::before {
+ content: '';
+ display: block;
+ position: absolute;
+ width: 100%;
+ height: 100%;
+ top: 0;
+ left: 0;
+ background-color: inherit;
+ border-radius: inherit;
+ transition: opacity .3s, transform .3s;
+ animation: pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite;
+ z-index: -1;
+ }
+
+ overflow: initial;
+ position: relative;
+}
+
+@keyframes pulse-animation {
+ 0% {
+ opacity: 1;
+ transform: scale(1);
+ }
+ 50% {
+ opacity: 0;
+ transform: scale(1.5);
+ }
+ 100% {
+ opacity: 0;
+ transform: scale(1.5);
+ }
+}
diff --git a/app/dispatch/static/materialize/sass/components/_roboto.scss b/app/dispatch/static/materialize/sass/components/_roboto.scss new file mode 100644 index 0000000..a4ec3cb --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_roboto.scss @@ -0,0 +1,39 @@ +@font-face {
+ font-family: "Roboto";
+ src: local(Roboto Thin),
+ url("#{$roboto-font-path}Roboto-Thin.woff2") format("woff2"),
+ url("#{$roboto-font-path}Roboto-Thin.woff") format("woff");
+
+ font-weight: 100;
+}
+@font-face {
+ font-family: "Roboto";
+ src: local(Roboto Light),
+ url("#{$roboto-font-path}Roboto-Light.woff2") format("woff2"),
+ url("#{$roboto-font-path}Roboto-Light.woff") format("woff");
+ font-weight: 300;
+}
+
+@font-face {
+ font-family: "Roboto";
+ src: local(Roboto Regular),
+ url("#{$roboto-font-path}Roboto-Regular.woff2") format("woff2"),
+ url("#{$roboto-font-path}Roboto-Regular.woff") format("woff");
+ font-weight: 400;
+}
+
+@font-face {
+ font-family: "Roboto";
+ src: local(Roboto Medium),
+ url("#{$roboto-font-path}Roboto-Medium.woff2") format("woff2"),
+ url("#{$roboto-font-path}Roboto-Medium.woff") format("woff");
+ font-weight: 500;
+}
+
+@font-face {
+ font-family: "Roboto";
+ src: local(Roboto Bold),
+ url("#{$roboto-font-path}Roboto-Bold.woff2") format("woff2"),
+ url("#{$roboto-font-path}Roboto-Bold.woff") format("woff");
+ font-weight: 700;
+}
diff --git a/app/dispatch/static/materialize/sass/components/_sideNav.scss b/app/dispatch/static/materialize/sass/components/_sideNav.scss new file mode 100644 index 0000000..051e1f3 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_sideNav.scss @@ -0,0 +1,214 @@ +.side-nav {
+ position: fixed;
+ width: 300px;
+ left: 0;
+ top: 0;
+ margin: 0;
+ transform: translateX(-100%);
+ height: 100%;
+ height: calc(100% + 60px);
+ height: -moz-calc(100%); //Temporary Firefox Fix
+ padding-bottom: 60px;
+ background-color: $sidenav-bg-color;
+ z-index: 999;
+ overflow-y: auto;
+ will-change: transform;
+ backface-visibility: hidden;
+ transform: translateX(-105%);
+
+ @extend .z-depth-1;
+
+ // Right Align
+ &.right-aligned {
+ right: 0;
+ transform: translateX(105%);
+ left: auto;
+ transform: translateX(100%);
+ }
+
+ .collapsible {
+ margin: 0;
+ }
+
+
+ li {
+ float: none;
+ line-height: $sidenav-line-height;
+
+ &.active { background-color: rgba(0,0,0,.05); }
+ }
+
+ li > a {
+ color: $sidenav-font-color;
+ display: block;
+ font-size: $sidenav-font-size;
+ font-weight: 500;
+ height: $sidenav-item-height;
+ line-height: $sidenav-line-height;
+ padding: 0 ($sidenav-padding * 2);
+
+ &:hover { background-color: rgba(0,0,0,.05);}
+
+ &.btn, &.btn-large, &.btn-flat, &.btn-floating {
+ margin: 10px 15px;
+ }
+
+ &.btn,
+ &.btn-large,
+ &.btn-floating { color: $button-raised-color; }
+ &.btn-flat { color: $button-flat-color; }
+
+ &.btn:hover,
+ &.btn-large:hover { background-color: lighten($button-raised-background, 5%); }
+ &.btn-floating:hover { background-color: $button-raised-background; }
+
+ & > i,
+ & > [class^="mdi-"], li > a > [class*="mdi-"],
+ & > i.material-icons {
+ float: left;
+ height: $sidenav-item-height;
+ line-height: $sidenav-line-height;
+ margin: 0 ($sidenav-padding * 2) 0 0;
+ width: $sidenav-item-height / 2;
+ color: rgba(0,0,0,.54);
+ }
+ }
+
+
+ .divider {
+ margin: ($sidenav-padding / 2) 0 0 0;
+ }
+
+ .subheader {
+ &:hover {
+ background-color: transparent;
+ }
+
+ cursor: initial;
+ pointer-events: none;
+ color: rgba(0,0,0,.54);
+ font-size: $sidenav-font-size;
+ font-weight: 500;
+ line-height: $sidenav-line-height;
+ }
+
+ .user-view,
+ .userView {
+ position: relative;
+ padding: ($sidenav-padding * 2) ($sidenav-padding * 2) 0;
+ margin-bottom: $sidenav-padding / 2;
+
+ & > a {
+ &:hover { background-color: transparent; }
+ height: auto;
+ padding: 0;
+ }
+
+ .background {
+ overflow: hidden;
+ position: absolute;
+ top: 0;
+ right: 0;
+ bottom: 0;
+ left: 0;
+ z-index: -1;
+ }
+
+ .circle, .name, .email {
+ display: block;
+ }
+
+ .circle {
+ height: 64px;
+ width: 64px;
+ }
+
+ .name,
+ .email {
+ font-size: $sidenav-font-size;
+ line-height: $sidenav-line-height / 2;
+ }
+
+ .name {
+ margin-top: 16px;
+ font-weight: 500;
+ }
+
+ .email {
+ padding-bottom: 16px;
+ font-weight: 400;
+ }
+ }
+}
+
+
+// Touch interaction
+.drag-target {
+ height: 100%;
+ width: 10px;
+ position: fixed;
+ top: 0;
+ z-index: 998;
+}
+
+
+// Fixed side-nav shown
+.side-nav.fixed {
+ left: 0;
+ transform: translateX(0);
+ position: fixed;
+
+ // Right Align
+ &.right-aligned {
+ right: 0;
+ left: auto;
+ }
+}
+
+// Fixed sideNav hide on smaller
+@media #{$medium-and-down} {
+ .side-nav {
+ &.fixed {
+ transform: translateX(-105%);
+
+ &.right-aligned {
+ transform: translateX(105%);
+ }
+ }
+
+ a {
+ padding: 0 $sidenav-padding;
+ }
+
+ .user-view,
+ .userView {
+ padding: $sidenav-padding $sidenav-padding 0;
+ }
+ }
+}
+
+
+.side-nav .collapsible-body > ul:not(.collapsible) > li.active,
+.side-nav.fixed .collapsible-body > ul:not(.collapsible) > li.active {
+ background-color: $primary-color;
+ a {
+ color: $sidenav-bg-color;
+ }
+}
+.side-nav .collapsible-body {
+ padding: 0;
+}
+
+
+#sidenav-overlay {
+ position: fixed;
+ top: 0;
+ left: 0;
+ right: 0;
+
+ height: 120vh;
+ background-color: rgba(0,0,0,.5);
+ z-index: 997;
+
+ will-change: opacity;
+}
diff --git a/app/dispatch/static/materialize/sass/components/_slider.scss b/app/dispatch/static/materialize/sass/components/_slider.scss new file mode 100644 index 0000000..5d7c27e --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_slider.scss @@ -0,0 +1,92 @@ +.slider {
+ position: relative;
+ height: 400px;
+ width: 100%;
+
+ // Fullscreen slider
+ &.fullscreen {
+ height: 100%;
+ width: 100%;
+ position: absolute;
+ top: 0;
+ left: 0;
+ right: 0;
+ bottom: 0;
+
+ ul.slides {
+ height: 100%;
+ }
+
+ ul.indicators {
+ z-index: 2;
+ bottom: 30px;
+ }
+ }
+
+ .slides {
+ background-color: $slider-bg-color;
+ margin: 0;
+ height: 400px;
+
+ li {
+ opacity: 0;
+ position: absolute;
+ top: 0;
+ left: 0;
+ z-index: 1;
+ width: 100%;
+ height: inherit;
+ overflow: hidden;
+
+ img {
+ height: 100%;
+ width: 100%;
+ background-size: cover;
+ background-position: center;
+ }
+
+ .caption {
+ color: #fff;
+ position: absolute;
+ top: 15%;
+ left: 15%;
+ width: 70%;
+ opacity: 0;
+
+ p { color: $slider-bg-color-light; }
+ }
+
+ &.active {
+ z-index: 2;
+ }
+ }
+ }
+
+
+ .indicators {
+ position: absolute;
+ text-align: center;
+ left: 0;
+ right: 0;
+ bottom: 0;
+ margin: 0;
+
+ .indicator-item {
+ display: inline-block;
+ position: relative;
+ cursor: pointer;
+ height: 16px;
+ width: 16px;
+ margin: 0 12px;
+ background-color: $slider-bg-color-light;
+
+ transition: background-color .3s;
+ border-radius: 50%;
+
+ &.active {
+ background-color: $slider-indicator-color;
+ }
+ }
+ }
+
+}
\ No newline at end of file diff --git a/app/dispatch/static/materialize/sass/components/_table_of_contents.scss b/app/dispatch/static/materialize/sass/components/_table_of_contents.scss new file mode 100644 index 0000000..dde6090 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_table_of_contents.scss @@ -0,0 +1,33 @@ +/***************
+ Nav List
+***************/
+.table-of-contents {
+ &.fixed {
+ position: fixed;
+ }
+
+ li {
+ padding: 2px 0;
+ }
+ a {
+ display: inline-block;
+ font-weight: 300;
+ color: #757575;
+ padding-left: 20px;
+ height: 1.5rem;
+ line-height: 1.5rem;
+ letter-spacing: .4;
+ display: inline-block;
+
+ &:hover {
+ color: lighten(#757575, 20%);
+ padding-left: 19px;
+ border-left: 1px solid $primary-color;
+ }
+ &.active {
+ font-weight: 500;
+ padding-left: 18px;
+ border-left: 2px solid $primary-color;
+ }
+ }
+}
diff --git a/app/dispatch/static/materialize/sass/components/_tabs.scss b/app/dispatch/static/materialize/sass/components/_tabs.scss new file mode 100644 index 0000000..5a1a459 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_tabs.scss @@ -0,0 +1,93 @@ +.tabs {
+ &.tabs-transparent {
+ background-color: transparent;
+
+ .tab a,
+ .tab.disabled a,
+ .tab.disabled a:hover {
+ color: rgba(255,255,255,0.7);
+ }
+
+ .tab a:hover,
+ .tab a.active {
+ color: #fff;
+ }
+
+ .indicator {
+ background-color: #fff;
+ }
+ }
+
+ &.tabs-fixed-width {
+ display: flex;
+
+ .tab {
+ flex-grow: 1;
+ }
+ }
+
+ position: relative;
+ overflow-x: auto;
+ overflow-y: hidden;
+ height: 48px;
+ width: 100%;
+ background-color: $tabs-bg-color;
+ margin: 0 auto;
+ white-space: nowrap;
+
+ .tab {
+ display: inline-block;
+ text-align: center;
+ line-height: 48px;
+ height: 48px;
+ padding: 0;
+ margin: 0;
+ text-transform: uppercase;
+
+ a {
+ &:hover,
+ &.active {
+ background-color: transparent;
+ color: $tabs-text-color;
+ }
+
+ color: rgba($tabs-text-color, .7);
+ display: block;
+ width: 100%;
+ height: 100%;
+ padding: 0 24px;
+ font-size: 14px;
+ text-overflow: ellipsis;
+ overflow: hidden;
+ transition: color .28s ease;
+ }
+
+ &.disabled a,
+ &.disabled a:hover {
+ color: rgba($tabs-text-color, .7);
+ cursor: default;
+ }
+ }
+ .indicator {
+ position: absolute;
+ bottom: 0;
+ height: 2px;
+ background-color: $tabs-underline-color;
+ will-change: left, right;
+ }
+}
+
+// Fixed sideNav hide on smaller
+@media #{$medium-and-down} {
+ .tabs {
+ display: flex;
+
+ .tab {
+ flex-grow: 1;
+
+ a {
+ padding: 0 12px;
+ }
+ }
+ }
+}
diff --git a/app/dispatch/static/materialize/sass/components/_tapTarget.scss b/app/dispatch/static/materialize/sass/components/_tapTarget.scss new file mode 100644 index 0000000..49aecd5 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_tapTarget.scss @@ -0,0 +1,103 @@ +.tap-target-wrapper {
+ width: 800px;
+ height: 800px;
+ position: fixed;
+ z-index: 1000;
+ visibility: hidden;
+ transition: visibility 0s .3s;
+}
+
+.tap-target-wrapper.open {
+ visibility: visible;
+ transition: visibility 0s;
+
+ .tap-target {
+ transform: scale(1);
+ opacity: .95;
+ transition:
+ transform .3s cubic-bezier(.42,0,.58,1),
+ opacity .3s cubic-bezier(.42,0,.58,1);
+ }
+
+ .tap-target-wave::before {
+ transform: scale(1);
+ }
+ .tap-target-wave::after {
+ visibility: visible;
+ animation: pulse-animation 1s cubic-bezier(0.24, 0, 0.38, 1) infinite;
+ transition:
+ opacity .3s,
+ transform .3s,
+ visibility 0s 1s;
+ }
+}
+
+.tap-target {
+ position: absolute;
+ font-size: 1rem;
+ border-radius: 50%;
+ background-color: $primary-color;
+ box-shadow: 0 20px 20px 0 rgba(0,0,0,0.14), 0 10px 50px 0 rgba(0,0,0,0.12), 0 30px 10px -20px rgba(0,0,0,0.2);
+ width: 100%;
+ height: 100%;
+ opacity: 0;
+ transform: scale(0);
+ transition:
+ transform .3s cubic-bezier(.42,0,.58,1),
+ opacity .3s cubic-bezier(.42,0,.58,1);
+}
+
+.tap-target-content {
+ position: relative;
+ display: table-cell;
+}
+
+.tap-target-wave {
+ &::before,
+ &::after {
+ content: '';
+ display: block;
+ position: absolute;
+ width: 100%;
+ height: 100%;
+ border-radius: 50%;
+ background-color: #ffffff;
+ }
+ &::before {
+ transform: scale(0);
+ transition: transform .3s;
+ }
+ &::after {
+ visibility: hidden;
+ transition:
+ opacity .3s,
+ transform .3s,
+ visibility 0s;
+ z-index: -1;
+ }
+
+ position: absolute;
+ border-radius: 50%;
+ z-index: 10001;
+}
+
+.tap-target-origin {
+ &:not(.btn),
+ &:not(.btn):hover {
+ background: none;
+ }
+
+ top: 50%;
+ left: 50%;
+ transform: translate(-50%,-50%);
+
+ z-index: 10002;
+ position: absolute !important;
+}
+
+@media only screen and (max-width: 600px) {
+ .tap-target, .tap-target-wrapper {
+ width: 600px;
+ height: 600px;
+ }
+}
diff --git a/app/dispatch/static/materialize/sass/components/_toast.scss b/app/dispatch/static/materialize/sass/components/_toast.scss new file mode 100644 index 0000000..3772d44 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_toast.scss @@ -0,0 +1,59 @@ +#toast-container {
+ display:block;
+ position: fixed;
+ z-index: 10000;
+
+ @media #{$small-and-down} {
+ min-width: 100%;
+ bottom: 0%;
+ }
+ @media #{$medium-only} {
+ left: 5%;
+ bottom: 7%;
+ max-width: 90%;
+ }
+ @media #{$large-and-up} {
+ top: 10%;
+ right: 7%;
+ max-width: 86%;
+ }
+}
+
+.toast {
+ @extend .z-depth-1;
+ border-radius: 2px;
+ top: 35px;
+ width: auto;
+ margin-top: 10px;
+ position: relative;
+ max-width:100%;
+ height: auto;
+ min-height: $toast-height;
+ line-height: 1.5em;
+ word-break: break-all;
+ background-color: $toast-color;
+ padding: 10px 25px;
+ font-size: 1.1rem;
+ font-weight: 300;
+ color: $toast-text-color;
+ display: flex;
+ align-items: center;
+ justify-content: space-between;
+ cursor: default;
+
+ .toast-action {
+ color: $toast-action-color;
+ font-weight: 500;
+ margin-right: -25px;
+ margin-left: 3rem;
+ }
+
+ &.rounded{
+ border-radius: 24px;
+ }
+
+ @media #{$small-and-down} {
+ width: 100%;
+ border-radius: 0;
+ }
+}
diff --git a/app/dispatch/static/materialize/sass/components/_tooltip.scss b/app/dispatch/static/materialize/sass/components/_tooltip.scss new file mode 100644 index 0000000..21ea6a7 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_tooltip.scss @@ -0,0 +1,31 @@ +.material-tooltip {
+ padding: 10px 8px;
+ font-size: 1rem;
+ z-index: 2000;
+ background-color: transparent;
+ border-radius: 2px;
+ color: #fff;
+ min-height: 36px;
+ line-height: 120%;
+ opacity: 0;
+ position: absolute;
+ text-align: center;
+ max-width: calc(100% - 4px);
+ overflow: hidden;
+ left: 0;
+ top: 0;
+ pointer-events: none;
+ visibility: hidden;
+}
+
+.backdrop {
+ position: absolute;
+ opacity: 0;
+ height: 7px;
+ width: 14px;
+ border-radius: 0 0 50% 50%;
+ background-color: #323232;
+ z-index: -1;
+ transform-origin: 50% 0%;
+ visibility: hidden;
+}
diff --git a/app/dispatch/static/materialize/sass/components/_transitions.scss b/app/dispatch/static/materialize/sass/components/_transitions.scss new file mode 100644 index 0000000..cb9f60d --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_transitions.scss @@ -0,0 +1,13 @@ +// Scale transition
+.scale-transition {
+ &.scale-out {
+ transform: scale(0);
+ transition: transform .2s !important;
+ }
+
+ &.scale-in {
+ transform: scale(1);
+ }
+
+ transition: transform .3s cubic-bezier(0.53, 0.01, 0.36, 1.63) !important;
+}
\ No newline at end of file diff --git a/app/dispatch/static/materialize/sass/components/_typography.scss b/app/dispatch/static/materialize/sass/components/_typography.scss new file mode 100644 index 0000000..a773afd --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_typography.scss @@ -0,0 +1,61 @@ +
+a {
+ text-decoration: none;
+}
+
+html{
+ line-height: 1.5;
+
+ @media only screen and (min-width: 0) {
+ font-size: 14px;
+ }
+
+ @media only screen and (min-width: $medium-screen) {
+ font-size: 14.5px;
+ }
+
+ @media only screen and (min-width: $large-screen) {
+ font-size: 15px;
+ }
+
+ font-family: "Roboto", sans-serif;
+ font-weight: normal;
+ color: $off-black;
+}
+h1, h2, h3, h4, h5, h6 {
+ font-weight: 400;
+ line-height: 1.1;
+}
+
+// Header Styles
+h1 a, h2 a, h3 a, h4 a, h5 a, h6 a { font-weight: inherit; }
+h1 { font-size: $h1-fontsize; line-height: 110%; margin: ($h1-fontsize / 2) 0 ($h1-fontsize / 2.5) 0;}
+h2 { font-size: $h2-fontsize; line-height: 110%; margin: ($h2-fontsize / 2) 0 ($h2-fontsize / 2.5) 0;}
+h3 { font-size: $h3-fontsize; line-height: 110%; margin: ($h3-fontsize / 2) 0 ($h3-fontsize / 2.5) 0;}
+h4 { font-size: $h4-fontsize; line-height: 110%; margin: ($h4-fontsize / 2) 0 ($h4-fontsize / 2.5) 0;}
+h5 { font-size: $h5-fontsize; line-height: 110%; margin: ($h5-fontsize / 2) 0 ($h5-fontsize / 2.5) 0;}
+h6 { font-size: $h6-fontsize; line-height: 110%; margin: ($h6-fontsize / 2) 0 ($h6-fontsize / 2.5) 0;}
+
+// Text Styles
+em { font-style: italic; }
+strong { font-weight: 500; }
+small { font-size: 75%; }
+.light { font-weight: 300; }
+.thin { font-weight: 200; }
+
+
+.flow-text{
+ font-weight: 300;
+ $i: 0;
+ @while $i <= $intervals {
+ @media only screen and (min-width : 360 + ($i * $interval-size)) {
+ font-size: 1.2rem * (1 + (.02 * $i));
+ }
+ $i: $i + 1;
+ }
+
+ // Handle below 360px screen
+ @media only screen and (max-width: 360px) {
+ font-size: 1.2rem;
+ }
+}
\ No newline at end of file diff --git a/app/dispatch/static/materialize/sass/components/_variables.scss b/app/dispatch/static/materialize/sass/components/_variables.scss new file mode 100644 index 0000000..297191a --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_variables.scss @@ -0,0 +1,353 @@ +// ==========================================================================
+// Materialize variables
+// ==========================================================================
+//
+// Table of Contents:
+//
+// 1. Colors
+// 2. Badges
+// 3. Buttons
+// 4. Cards
+// 5. Carousel
+// 6. Collapsible
+// 7. Chips
+// 8. Date + Time Picker
+// 9. Dropdown
+// 10. Fonts
+// 11. Forms
+// 12. Global
+// 13. Grid
+// 14. Navigation Bar
+// 15. Side Navigation
+// 16. Photo Slider
+// 17. Spinners | Loaders
+// 18. Tabs
+// 19. Tables
+// 20. Toasts
+// 21. Typography
+// 22. Footer
+// 23. Flow Text
+// 24. Collections
+// 25. Progress Bar
+
+
+
+// 1. Colors
+// ==========================================================================
+
+$primary-color: color("materialize-red", "lighten-2") !default;
+$primary-color-light: lighten($primary-color, 15%) !default;
+$primary-color-dark: darken($primary-color, 15%) !default;
+
+$secondary-color: color("teal", "lighten-1") !default;
+$success-color: color("green", "base") !default;
+$error-color: color("red", "base") !default;
+$link-color: color("light-blue", "darken-1") !default;
+
+
+// 2. Badges
+// ==========================================================================
+
+$badge-bg-color: $secondary-color !default;
+$badge-height: 22px !default;
+
+
+// 3. Buttons
+// ==========================================================================
+
+// Shared styles
+$button-border: none !default;
+$button-background-focus: lighten($secondary-color, 4%) !default;
+$button-font-size: 1rem !default;
+$button-icon-font-size: 1.3rem !default;
+$button-height: 36px !default;
+$button-padding: 0 2rem !default;
+$button-radius: 2px !default;
+
+// Disabled styles
+$button-disabled-background: #DFDFDF !default;
+$button-disabled-color: #9F9F9F !default;
+
+// Raised buttons
+$button-raised-background: $secondary-color !default;
+$button-raised-background-hover: lighten($button-raised-background, 5%) !default;
+$button-raised-color: #fff !default;
+
+// Large buttons
+$button-large-icon-font-size: 1.6rem !default;
+$button-large-height: $button-height * 1.5 !default;
+
+// Flat buttons
+$button-flat-color: #343434 !default;
+$button-flat-disabled-color: lighten(#999, 10%) !default;
+
+// Floating buttons
+$button-floating-background: $secondary-color !default;
+$button-floating-background-hover: $button-floating-background !default;
+$button-floating-color: #fff !default;
+$button-floating-size: 40px !default;
+$button-floating-large-size: 56px !default;
+$button-floating-radius: 50% !default;
+
+
+// 4. Cards
+// ==========================================================================
+
+$card-padding: 24px !default;
+$card-bg-color: #fff !default;
+$card-link-color: color("orange", "accent-2") !default;
+$card-link-color-light: lighten($card-link-color, 20%) !default;
+
+
+// 5. Carousel
+// ==========================================================================
+
+$carousel-height: 400px !default;
+$carousel-item-height: $carousel-height / 2 !default;
+$carousel-item-width: $carousel-item-height !default;
+
+
+// 6. Collapsible
+// ==========================================================================
+
+$collapsible-height: 3rem !default;
+$collapsible-line-height: $collapsible-height !default;
+$collapsible-header-color: #fff !default;
+$collapsible-border-color: #ddd !default;
+
+
+// 7. Chips
+// ==========================================================================
+
+$chip-bg-color: #e4e4e4 !default;
+$chip-border-color: #9e9e9e !default;
+$chip-selected-color: #26a69a !default;
+$chip-margin: 5px !default;
+
+
+// 8. Date + Time Picker
+// ==========================================================================
+
+$datepicker-display-font-size: 2.8rem;
+$datepicker-weekday-color: rgba(0, 0, 0, .87) !default;
+$datepicker-weekday-bg: darken($secondary-color, 7%) !default;
+$datepicker-date-bg: $secondary-color !default;
+$datepicker-year: rgba(255, 255, 255, .7) !default;
+$datepicker-focus: rgba(0,0,0, .05) !default;
+$datepicker-selected: $secondary-color !default;
+$datepicker-selected-outfocus: desaturate(lighten($secondary-color, 35%), 15%) !default;
+
+$timepicker-clock-color: rgba(0, 0, 0, .87) !default;
+$timepicker-clock-plate-bg: #eee;
+
+
+// 9. Dropdown
+// ==========================================================================
+
+$dropdown-bg-color: #fff !default;
+$dropdown-hover-bg-color: #eee !default;
+$dropdown-color: $secondary-color !default;
+$dropdown-item-height: 50px !default;
+
+
+// 10. Fonts
+// ==========================================================================
+
+$roboto-font-path: "../fonts/roboto/" !default;
+
+
+// 11. Forms
+// ==========================================================================
+
+// Text Inputs + Textarea
+$input-height: 3rem !default;
+$input-border-color: color("grey", "base") !default;
+$input-border: 1px solid $input-border-color !default;
+$input-background: #fff !default;
+$input-error-color: $error-color !default;
+$input-success-color: $success-color !default;
+$input-focus-color: $secondary-color !default;
+$input-font-size: 1rem !default;
+$input-margin-bottom: 20px;
+$input-margin: 0 0 $input-margin-bottom 0 !default;
+$input-padding: 0 !default;
+$input-transition: all .3s !default;
+$label-font-size: .8rem !default;
+$input-disabled-color: rgba(0,0,0, .42) !default;
+$input-disabled-solid-color: #949494 !default;
+$input-disabled-border: 1px dotted $input-disabled-color !default;
+$input-invalid-border: 1px solid $input-error-color !default;
+$placeholder-text-color: lighten($input-border-color, 20%) !default;
+
+// Radio Buttons
+$radio-fill-color: $secondary-color !default;
+$radio-empty-color: #5a5a5a !default;
+$radio-border: 2px solid $radio-fill-color !default;
+
+// Range
+$range-height: 14px !default;
+$range-width: 14px !default;
+$track-height: 3px !default;
+
+// Select
+$select-border: 1px solid #f2f2f2 !default;
+$select-background: rgba(255, 255, 255, 0.90) !default;
+$select-focus: 1px solid lighten($secondary-color, 47%) !default;
+$select-option-hover: rgba(0,0,0,.06) !default;
+$select-option-focus: rgba(0,0,0,.03) !default;
+$select-padding: 5px !default;
+$select-radius: 2px !default;
+$select-disabled-color: rgba(0,0,0,.3) !default;
+
+// Switches
+$switch-bg-color: $secondary-color !default;
+$switch-checked-lever-bg: desaturate(lighten($switch-bg-color, 25%), 25%) !default;
+$switch-unchecked-bg: #F1F1F1 !default;
+$switch-unchecked-lever-bg: rgba(0,0,0,.38) !default;
+$switch-radius: 15px !default;
+
+
+// 12. Global
+// ==========================================================================
+
+// Media Query Ranges
+$small-screen-up: 601px !default;
+$medium-screen-up: 993px !default;
+$large-screen-up: 1201px !default;
+$small-screen: 600px !default;
+$medium-screen: 992px !default;
+$large-screen: 1200px !default;
+
+/*
+$medium-and-up: "only screen and (min-width : #{$small-screen-up})" !default;
+$large-and-up: "only screen and (min-width : #{$medium-screen-up})" !default;
+$extra-large-and-up: "only screen and (min-width : #{$large-screen-up})" !default;
+$small-and-down: "only screen and (max-width : #{$small-screen})" !default;
+$medium-and-down: "only screen and (max-width : #{$medium-screen})" !default;
+$medium-only: "only screen and (min-width : #{$small-screen-up}) and (max-width : #{$medium-screen})" !default;
+*/
+
+$medium-and-up: "(min-width : #{$small-screen-up})" !default;
+$large-and-up: "(min-width : #{$medium-screen-up})" !default;
+$extra-large-and-up: "(min-width : #{$large-screen-up})" !default;
+$small-and-down: "(max-width : #{$small-screen})" !default;
+$medium-and-down: "(max-width : #{$medium-screen})" !default;
+$medium-only: "(min-width : #{$small-screen-up}) and (max-width : #{$medium-screen})" !default;
+
+
+
+// 13. Grid
+// ==========================================================================
+
+$num-cols: 12 !default;
+$gutter-width: 1.5rem !default;
+$element-top-margin: $gutter-width/3 !default;
+$element-bottom-margin: ($gutter-width*2)/3 !default;
+
+
+// 14. Navigation Bar
+// ==========================================================================
+
+$navbar-height: 64px !default;
+$navbar-line-height: $navbar-height !default;
+$navbar-height-mobile: 56px !default;
+$navbar-line-height-mobile: $navbar-height-mobile !default;
+$navbar-font-size: 1rem !default;
+$navbar-font-color: #fff !default;
+$navbar-brand-font-size: 2.1rem !default;
+
+// 15. Side Navigation
+// ==========================================================================
+
+$sidenav-font-size: 14px !default;
+$sidenav-font-color: rgba(0,0,0,.87) !default;
+$sidenav-bg-color: #fff !default;
+$sidenav-padding: 16px !default;
+$sidenav-item-height: 48px !default;
+$sidenav-line-height: $sidenav-item-height !default;
+
+
+// 16. Photo Slider
+// ==========================================================================
+
+$slider-bg-color: color('grey', 'base') !default;
+$slider-bg-color-light: color('grey', 'lighten-2') !default;
+$slider-indicator-color: color('green', 'base') !default;
+
+
+// 17. Spinners | Loaders
+// ==========================================================================
+
+$spinner-default-color: $secondary-color !default;
+
+
+// 18. Tabs
+// ==========================================================================
+
+$tabs-underline-color: $primary-color-light !default;
+$tabs-text-color: $primary-color !default;
+$tabs-bg-color: #fff !default;
+
+
+// 19. Tables
+// ==========================================================================
+
+$table-border-color: #d0d0d0 !default;
+$table-striped-color: #f2f2f2 !default;
+
+
+// 20. Toasts
+// ==========================================================================
+
+$toast-height: 48px !default;
+$toast-color: #323232 !default;
+$toast-text-color: #fff !default;
+$toast-action-color: #eeff41;
+
+
+// 21. Typography
+// ==========================================================================
+
+$off-black: rgba(0, 0, 0, 0.87) !default;
+// Header Styles
+$h1-fontsize: 4.2rem !default;
+$h2-fontsize: 3.56rem !default;
+$h3-fontsize: 2.92rem !default;
+$h4-fontsize: 2.28rem !default;
+$h5-fontsize: 1.64rem !default;
+$h6-fontsize: 1rem !default;
+
+
+// 22. Footer
+// ==========================================================================
+
+$footer-font-color: #fff !default;
+$footer-bg-color: $primary-color !default;
+$footer-copyright-font-color: rgba(255,255,255,.8) !default;
+$footer-copyright-bg-color: rgba(51,51,51,.08) !default;
+
+
+// 23. Flow Text
+// ==========================================================================
+
+$range : $large-screen - $small-screen !default;
+$intervals: 20 !default;
+$interval-size: $range / $intervals !default;
+
+
+// 24. Collections
+// ==========================================================================
+
+$collection-border-color: #e0e0e0 !default;
+$collection-bg-color: #fff !default;
+$collection-active-bg-color: $secondary-color !default;
+$collection-active-color: lighten($secondary-color, 55%) !default;
+$collection-hover-bg-color: #ddd !default;
+$collection-link-color: $secondary-color !default;
+$collection-line-height: 1.5rem !default;
+
+
+// 25. Progress Bar
+// ==========================================================================
+
+$progress-bar-color: $secondary-color !default;
diff --git a/app/dispatch/static/materialize/sass/components/_waves.scss b/app/dispatch/static/materialize/sass/components/_waves.scss new file mode 100644 index 0000000..b36c718 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/_waves.scss @@ -0,0 +1,114 @@ +
+/*!
+ * Waves v0.6.0
+ * http://fian.my.id/Waves
+ *
+ * Copyright 2014 Alfiana E. Sibuea and other contributors
+ * Released under the MIT license
+ * https://github.com/fians/Waves/blob/master/LICENSE
+ */
+
+
+.waves-effect {
+ position: relative;
+ cursor: pointer;
+ display: inline-block;
+ overflow: hidden;
+ user-select: none;
+ -webkit-tap-highlight-color: transparent;
+ vertical-align: middle;
+ z-index: 1;
+ transition: .3s ease-out;
+
+ .waves-ripple {
+ position: absolute;
+ border-radius: 50%;
+ width: 20px;
+ height: 20px;
+ margin-top:-10px;
+ margin-left:-10px;
+ opacity: 0;
+
+ background: rgba(0,0,0,0.2);
+ transition: all 0.7s ease-out;
+ transition-property: transform, opacity;
+ transform: scale(0);
+ pointer-events: none;
+ }
+
+ // Waves Colors
+ &.waves-light .waves-ripple {
+ background-color: rgba(255, 255, 255, 0.45);
+ }
+ &.waves-red .waves-ripple {
+ background-color: rgba(244, 67, 54, .70);
+ }
+ &.waves-yellow .waves-ripple {
+ background-color: rgba(255, 235, 59, .70);
+ }
+ &.waves-orange .waves-ripple {
+ background-color: rgba(255, 152, 0, .70);
+ }
+ &.waves-purple .waves-ripple {
+ background-color: rgba(156, 39, 176, 0.70);
+ }
+ &.waves-green .waves-ripple {
+ background-color: rgba(76, 175, 80, 0.70);
+ }
+ &.waves-teal .waves-ripple {
+ background-color: rgba(0, 150, 136, 0.70);
+ }
+
+ // Style input button bug.
+ input[type="button"], input[type="reset"], input[type="submit"] {
+ border: 0;
+ font-style: normal;
+ font-size: inherit;
+ text-transform: inherit;
+ background: none;
+ }
+
+ img {
+ position: relative;
+ z-index: -1;
+ }
+}
+
+.waves-notransition {
+ transition: none #{"!important"};
+}
+
+.waves-circle {
+ transform: translateZ(0);
+ -webkit-mask-image: -webkit-radial-gradient(circle, white 100%, black 100%);
+}
+
+.waves-input-wrapper {
+ border-radius: 0.2em;
+ vertical-align: bottom;
+
+ .waves-button-input {
+ position: relative;
+ top: 0;
+ left: 0;
+ z-index: 1;
+ }
+}
+
+.waves-circle {
+ text-align: center;
+ width: 2.5em;
+ height: 2.5em;
+ line-height: 2.5em;
+ border-radius: 50%;
+ -webkit-mask-image: none;
+}
+
+.waves-block {
+ display: block;
+}
+
+/* Firefox Bug: link not triggered */
+.waves-effect .waves-ripple {
+ z-index: -1;
+}
\ No newline at end of file diff --git a/app/dispatch/static/materialize/sass/components/date_picker/_default.date.scss b/app/dispatch/static/materialize/sass/components/date_picker/_default.date.scss new file mode 100644 index 0000000..39ca1f2 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/date_picker/_default.date.scss @@ -0,0 +1,456 @@ +/* ==========================================================================
+ $BASE-DATE-PICKER
+ ========================================================================== */
+/**
+ * The picker box.
+ */
+.picker__box {
+ padding: 0;
+ border-radius: 2px;
+ overflow: hidden;
+}
+/**
+ * The header containing the month and year stuff.
+ */
+.picker__header {
+ text-align: center;
+ position: relative;
+ margin-top: .75em;
+}
+/**
+ * The month and year labels.
+ */
+.picker__month,
+.picker__year {
+// font-weight: 500;
+ display: inline-block;
+ margin-left: .25em;
+ margin-right: .25em;
+}
+/**
+ * The month and year selectors.
+ */
+.picker__select--month,
+.picker__select--year {
+
+ height: 2em;
+ padding: 0;
+ margin-left: .25em;
+ margin-right: .25em;
+}
+
+// Modified
+.picker__select--month.browser-default {
+ display: inline;
+ background-color: #FFFFFF;
+ width: 40%;
+}
+.picker__select--year.browser-default {
+ display: inline;
+ background-color: #FFFFFF;
+ width: 26%;
+}
+.picker__select--month:focus,
+.picker__select--year:focus {
+ border-color: $datepicker-focus;
+}
+/**
+ * The month navigation buttons.
+ */
+.picker__nav--prev,
+.picker__nav--next {
+ position: absolute;
+ padding: .5em 1.25em;
+ width: 1em;
+ height: 1em;
+ box-sizing: content-box;
+ top: -0.25em;
+}
+//@media (min-width: 24.5em) {
+// .picker__nav--prev,
+// .picker__nav--next {
+// top: -0.33em;
+// }
+//}
+.picker__nav--prev {
+ left: -1em;
+ padding-right: 1.25em;
+}
+//@media (min-width: 24.5em) {
+// .picker__nav--prev {
+// padding-right: 1.5em;
+// }
+//}
+.picker__nav--next {
+ right: -1em;
+ padding-left: 1.25em;
+}
+//@media (min-width: 24.5em) {
+// .picker__nav--next {
+// padding-left: 1.5em;
+// }
+//}
+
+.picker__nav--disabled,
+.picker__nav--disabled:hover,
+.picker__nav--disabled:before,
+.picker__nav--disabled:before:hover {
+ cursor: default;
+ background: none;
+ border-right-color: #f5f5f5;
+ border-left-color: #f5f5f5;
+}
+/**
+ * The calendar table of dates
+ */
+.picker__table {
+ text-align: center;
+ border-collapse: collapse;
+ border-spacing: 0;
+ table-layout: fixed;
+ font-size: 1rem;
+ width: 100%;
+ margin-top: .75em;
+ margin-bottom: .5em;
+}
+
+
+
+.picker__table th, .picker__table td {
+ text-align: center;
+}
+
+
+
+
+
+
+.picker__table td {
+ margin: 0;
+ padding: 0;
+}
+/**
+ * The weekday labels
+ */
+.picker__weekday {
+ width: 14.285714286%;
+ font-size: .75em;
+ padding-bottom: .25em;
+ color: #999999;
+ font-weight: 500;
+ /* Increase the spacing a tad */
+}
+@media (min-height: 33.875em) {
+ .picker__weekday {
+ padding-bottom: .5em;
+ }
+}
+/**
+ * The days on the calendar
+ */
+
+.picker__day--today {
+ position: relative;
+ color: #595959;
+ letter-spacing: -.3;
+ padding: .75rem 0;
+ font-weight: 400;
+ border: 1px solid transparent;
+
+}
+
+//.picker__day--today:before {
+// content: " ";
+// position: absolute;
+// top: 2px;
+// right: 2px;
+// width: 0;
+// height: 0;
+// border-top: 0.5em solid #0059bc;
+// border-left: .5em solid transparent;
+//}
+.picker__day--disabled:before {
+ border-top-color: #aaaaaa;
+}
+
+
+.picker__day--infocus:hover{
+ cursor: pointer;
+ color: #000;
+ font-weight: 500;
+}
+
+.picker__day--outfocus {
+ display: none;
+ padding: .75rem 0;
+ color: #fff;
+
+}
+.picker__day--outfocus:hover {
+ cursor: pointer;
+ color: #dddddd;
+// background: #b1dcfb;
+ font-weight: 500;
+}
+
+
+.picker__day--highlighted {
+// border-color: #0089ec;
+}
+.picker__day--highlighted:hover,
+.picker--focused .picker__day--highlighted {
+ cursor: pointer;
+// color: #000000;
+// background: #b1dcfb;
+// font-weight: 500;
+}
+.picker__day--selected,
+.picker__day--selected:hover,
+.picker--focused .picker__day--selected {
+
+
+// Circle background
+ border-radius: 50%;
+ transform: scale(.75);
+ background: #0089ec;
+ color: #ffffff;
+}
+.picker__day--disabled,
+.picker__day--disabled:hover,
+.picker--focused .picker__day--disabled {
+ background: #f5f5f5;
+ border-color: #f5f5f5;
+ color: #dddddd;
+ cursor: default;
+}
+.picker__day--highlighted.picker__day--disabled,
+.picker__day--highlighted.picker__day--disabled:hover {
+ background: #bbbbbb;
+}
+/**
+ * The footer containing the "today", "clear", and "close" buttons.
+ */
+.picker__footer {
+ text-align: right;
+}
+.picker__button--today,
+.picker__button--clear,
+.picker__button--close {
+ border: 1px solid #ffffff;
+ background: #ffffff;
+ font-size: .8em;
+ padding: .66em 0;
+ font-weight: bold;
+ width: 33%;
+ display: inline-block;
+ vertical-align: bottom;
+}
+.picker__button--today:hover,
+.picker__button--clear:hover,
+.picker__button--close:hover {
+ cursor: pointer;
+ color: #000000;
+ background: #b1dcfb;
+ border-bottom-color: #b1dcfb;
+}
+.picker__button--today:focus,
+.picker__button--clear:focus,
+.picker__button--close:focus {
+ background: #b1dcfb;
+ border-color: $datepicker-focus;
+ outline: none;
+}
+.picker__button--today:before,
+.picker__button--clear:before,
+.picker__button--close:before {
+ position: relative;
+ display: inline-block;
+ height: 0;
+}
+.picker__button--today:before,
+.picker__button--clear:before {
+ content: " ";
+ margin-right: .45em;
+}
+.picker__button--today:before {
+ top: -0.05em;
+ width: 0;
+ border-top: 0.66em solid #0059bc;
+ border-left: .66em solid transparent;
+}
+.picker__button--clear:before {
+ top: -0.25em;
+ width: .66em;
+ border-top: 3px solid #ee2200;
+}
+.picker__button--close:before {
+ content: "\D7";
+ top: -0.1em;
+ vertical-align: top;
+ font-size: 1.1em;
+ margin-right: .35em;
+ color: #777777;
+}
+.picker__button--today[disabled],
+.picker__button--today[disabled]:hover {
+ background: #f5f5f5;
+ border-color: #f5f5f5;
+ color: #dddddd;
+ cursor: default;
+}
+.picker__button--today[disabled]:before {
+ border-top-color: #aaaaaa;
+}
+
+/* ==========================================================================
+ CUSTOM MATERIALIZE STYLES
+ ========================================================================== */
+/*.picker__box {
+ border-radius: 2px;
+ overflow: hidden;
+}*/
+
+.picker__date-display {
+ text-align: left;
+ background-color: $datepicker-date-bg;
+ color: #fff;
+ padding: 18px;
+ font-weight: 300;
+}
+
+@media only screen and (min-width: 601px) {
+ .picker__date-display {
+ flex:1;
+ }
+ .picker__weekday-display {
+ display:block;
+ }
+ .picker__container__wrapper {
+ flex:2
+ }
+}
+
+.picker__nav--prev:hover,
+.picker__nav--next:hover {
+ cursor: pointer;
+ color: #000000;
+ background: $datepicker-selected-outfocus;
+}
+
+.picker__weekday-display {
+ font-weight: 500;
+ font-size: $datepicker-display-font-size;
+ margin-right: 5px;
+ margin-top: 4px;
+}
+
+.picker__month-display {
+ //text-transform: uppercase;
+ font-size: $datepicker-display-font-size;
+ font-weight: 500;
+}
+.picker__day-display {
+ font-size: $datepicker-display-font-size;
+ font-weight: 500;
+ margin-right: 5px;
+}
+.picker__year-display {
+ font-size: 1.5rem;
+ font-weight: 500;
+ color: $datepicker-year;
+}
+
+/*.picker__box {
+ padding: 0;
+}*/
+.picker__calendar-container {
+ padding: 0 1rem;
+
+ thead {
+ border: none;
+ }
+}
+
+// Calendar
+.picker__table {
+ margin-top: 0;
+ margin-bottom: .5em;
+}
+
+.picker__day--infocus {
+ color: $datepicker-weekday-color;
+ letter-spacing: -.3px;
+ padding: 0.75rem 0;
+ font-weight: 400;
+ border: 1px solid transparent;
+}
+@media only screen and (min-width: 601px) {
+ .picker__day--infocus {
+ padding: 1.1rem 0;
+ }
+}
+
+
+//Today style
+.picker__day.picker__day--today {
+ color: $datepicker-selected;
+}
+
+.picker__day.picker__day--today.picker__day--selected {
+ color: #fff;
+}
+
+// Table Header
+.picker__weekday {
+ font-size: .9rem;
+}
+
+
+.picker__day--selected,
+.picker__day--selected:hover,
+.picker--focused .picker__day--selected {
+ // Circle background
+ border-radius: 50%;
+ transform: scale(.9);
+ background-color: $datepicker-selected;
+ &.picker__day--outfocus {
+ background-color: $datepicker-selected-outfocus;
+ }
+ color: #ffffff;
+}
+
+.picker__footer {
+ text-align: right;
+ padding: 5px 10px;
+}
+
+// Materialize modified
+.picker__close, .picker__today, .picker__clear {
+ font-size: 1.1rem;
+ padding: 0 1rem;
+ color: $datepicker-selected;
+}
+.picker__clear {
+ color:#f44336;
+ float:left;
+}
+
+//month nav buttons
+.picker__nav--prev:before,
+.picker__nav--next:before {
+ content: " ";
+ border-top: .5em solid transparent;
+ border-bottom: .5em solid transparent;
+ border-right: 0.75em solid #676767;
+ width: 0;
+ height: 0;
+ display: block;
+ margin: 0 auto;
+}
+.picker__nav--next:before {
+ border-right: 0;
+ border-left: 0.75em solid #676767;
+}
+button.picker__today:focus, button.picker__clear:focus, button.picker__close:focus {
+ background-color: $datepicker-selected-outfocus;
+}
diff --git a/app/dispatch/static/materialize/sass/components/date_picker/_default.scss b/app/dispatch/static/materialize/sass/components/date_picker/_default.scss new file mode 100644 index 0000000..b091e55 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/date_picker/_default.scss @@ -0,0 +1,212 @@ +/* ==========================================================================
+ $BASE-PICKER
+ ========================================================================== */
+/**
+ * Note: the root picker element should *NOT* be styled more than what's here.
+ */
+.picker {
+ font-size: 16px;
+ text-align: left;
+ line-height: 1.2;
+ color: #000000;
+ position: absolute;
+ z-index: 10000;
+ -webkit-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+ outline: none;
+}
+/**
+ * The picker input element.
+ */
+.picker__input {
+ cursor: default;
+}
+/**
+ * When the picker is opened, the input element is "activated".
+ */
+.picker__input.picker__input--active {
+ border-color: #0089ec;
+}
+/**
+ * The holder is the only "scrollable" top-level container element.
+ */
+.picker__holder {
+ width: 100%;
+ overflow-y: auto;
+ -webkit-overflow-scrolling: touch;
+}
+
+/*!
+ * Default mobile-first, responsive styling for pickadate.js
+ * Demo: http://amsul.github.io/pickadate.js
+ */
+/**
+ * Note: the root picker element should *NOT* be styled more than what's here.
+ */
+/**
+ * Make the holder and frame fullscreen.
+ */
+.picker__holder,
+.picker__frame {
+ bottom: 0;
+ left: 0;
+ right: 0;
+ top: 100%;
+}
+/**
+ * The holder should overlay the entire screen.
+ */
+.picker__holder {
+ position: fixed;
+ -webkit-transition: background 0.15s ease-out, top 0s 0.15s;
+ -moz-transition: background 0.15s ease-out, top 0s 0.15s;
+ transition: background 0.15s ease-out, top 0s 0.15s;
+ -webkit-backface-visibility: hidden;
+}
+/**
+ * The frame that bounds the box contents of the picker.
+ */
+.picker__frame {
+ position: absolute;
+ margin: 0 auto;
+ min-width: 256px;
+
+// picker width
+ width: 300px;
+ max-height: 350px;
+
+ -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)";
+ filter: alpha(opacity=0);
+ -moz-opacity: 0;
+ opacity: 0;
+ -webkit-transition: all 0.15s ease-out;
+ -moz-transition: all 0.15s ease-out;
+ transition: all 0.15s ease-out;
+}
+@media (min-height: 28.875em) {
+ .picker__frame {
+ overflow: visible;
+ top: auto;
+ bottom: -100%;
+ max-height: 80%;
+ }
+}
+@media (min-height: 40.125em) {
+ .picker__frame {
+ margin-bottom: 7.5%;
+ }
+}
+/**
+ * The wrapper sets the stage to vertically align the box contents.
+ */
+.picker__wrap {
+ display: table;
+ width: 100%;
+ height: 100%;
+}
+@media (min-height: 28.875em) {
+ .picker__wrap {
+ display: block;
+ }
+}
+/**
+ * The box contains all the picker contents.
+ */
+.picker__box {
+ background: #ffffff;
+ display: table-cell;
+ vertical-align: middle;
+}
+//@media (min-height: 26.5em) {
+// .picker__box {
+//// font-size: 1.25em;
+// }
+//}
+@media (min-height: 28.875em) {
+ .picker__box {
+ display: block;
+
+// picker header font-size
+// font-size: 1rem;
+
+ border: 1px solid #777777;
+ border-top-color: #898989;
+ border-bottom-width: 0;
+ -webkit-border-radius: 5px 5px 0 0;
+ -moz-border-radius: 5px 5px 0 0;
+ border-radius: 5px 5px 0 0;
+ -webkit-box-shadow: 0 12px 36px 16px rgba(0, 0, 0, 0.24);
+ -moz-box-shadow: 0 12px 36px 16px rgba(0, 0, 0, 0.24);
+ box-shadow: 0 12px 36px 16px rgba(0, 0, 0, 0.24);
+ }
+}
+//@media (min-height: 40.125em) {
+// .picker__box {
+// font-size: 1.1rem;
+// border-bottom-width: 1px;
+// -webkit-border-radius: 5px;
+// -moz-border-radius: 5px;
+// border-radius: 5px;
+// }
+//}
+/**
+ * When the picker opens...
+ */
+.picker--opened .picker__holder {
+ top: 0;
+ background: transparent;
+ -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorstr=#1E000000,endColorstr=#1E000000)";
+ zoom: 1;
+ background: rgba(0, 0, 0, 0.32);
+ -webkit-transition: background 0.15s ease-out;
+ -moz-transition: background 0.15s ease-out;
+ transition: background 0.15s ease-out;
+}
+.picker--opened .picker__frame {
+ top: 0;
+ -ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=100)";
+ filter: alpha(opacity=100);
+ -moz-opacity: 1;
+ opacity: 1;
+}
+@media (min-height: 35.875em) {
+ .picker--opened .picker__frame {
+ top: 10%;
+ bottom: auto;
+ }
+}
+/**
+ * For `large` screens, transform into an inline picker.
+ */
+
+/* ==========================================================================
+ CUSTOM MATERIALIZE STYLES
+ ========================================================================== */
+
+.picker__input.picker__input--active {
+ border-color: color("blue", "lighten-5");
+}
+
+.picker__frame {
+ margin: 0 auto;
+ max-width: 325px;
+}
+
+@media (min-height: 38.875em) {
+ .picker--opened .picker__frame {
+ top: 10%;
+ bottom: auto;
+ }
+}
+
+@media only screen and (min-width: 601px) {
+ .picker__box {
+ display:flex;
+ }
+ .picker__frame {
+ width: 80%;
+ max-width:600px;
+ }
+}
diff --git a/app/dispatch/static/materialize/sass/components/date_picker/_default.time.scss b/app/dispatch/static/materialize/sass/components/date_picker/_default.time.scss new file mode 100644 index 0000000..ae0b778 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/date_picker/_default.time.scss @@ -0,0 +1,267 @@ +/* ==========================================================================
+ $BASE-TIME-PICKER
+ ========================================================================== */
+/**
+ * The list of times.
+ */
+.picker__list {
+ list-style: none;
+ padding: 0.75em 0 4.2em;
+ margin: 0;
+}
+/**
+ * The times on the clock.
+ */
+.picker__list-item {
+ border-bottom: 1px solid #ddd;
+ border-top: 1px solid #ddd;
+ margin-bottom: -1px;
+ position: relative;
+ background: #fff;
+ padding: .75em 1.25em;
+}
+@media (min-height: 46.75em) {
+ .picker__list-item {
+ padding: .5em 1em;
+ }
+}
+/* Hovered time */
+.picker__list-item:hover {
+ cursor: pointer;
+ color: #000;
+ background: #b1dcfb;
+ border-color: #0089ec;
+ z-index: 10;
+}
+/* Highlighted and hovered/focused time */
+.picker__list-item--highlighted {
+ border-color: #0089ec;
+ z-index: 10;
+}
+.picker__list-item--highlighted:hover,
+.picker--focused .picker__list-item--highlighted {
+ cursor: pointer;
+ color: #000;
+ background: #b1dcfb;
+}
+/* Selected and hovered/focused time */
+.picker__list-item--selected,
+.picker__list-item--selected:hover,
+.picker--focused .picker__list-item--selected {
+ background: #0089ec;
+ color: #fff;
+ z-index: 10;
+}
+/* Disabled time */
+.picker__list-item--disabled,
+.picker__list-item--disabled:hover,
+.picker--focused .picker__list-item--disabled {
+ background: #f5f5f5;
+ border-color: #f5f5f5;
+ color: #ddd;
+ cursor: default;
+ border-color: #ddd;
+ z-index: auto;
+}
+/**
+ * The clear button
+ */
+.picker--time .picker__button--clear {
+ display: block;
+ width: 80%;
+ margin: 1em auto 0;
+ padding: 1em 1.25em;
+ background: none;
+ border: 0;
+ font-weight: 500;
+ font-size: .67em;
+ text-align: center;
+ text-transform: uppercase;
+ color: $timepicker-clock-color;
+}
+.picker--time .picker__button--clear:hover,
+.picker--time .picker__button--clear:focus {
+ color: #000;
+ background: #b1dcfb;
+ background: #ee2200;
+ border-color: #ee2200;
+ cursor: pointer;
+ color: #fff;
+ outline: none;
+}
+.picker--time .picker__button--clear:before {
+ top: -0.25em;
+ color: $timepicker-clock-color;
+ font-size: 1.25em;
+ font-weight: bold;
+}
+.picker--time .picker__button--clear:hover:before,
+.picker--time .picker__button--clear:focus:before {
+ color: #fff;
+}
+
+/* ==========================================================================
+ $DEFAULT-TIME-PICKER
+ ========================================================================== */
+/**
+ * The frame the bounds the time picker.
+ */
+.picker--time .picker__frame {
+ min-width: 256px;
+ max-width: 320px;
+}
+/**
+ * The picker box.
+ */
+.picker--time .picker__box {
+ font-size: 1em;
+ background: #f2f2f2;
+ padding: 0;
+}
+@media (min-height: 40.125em) {
+ .picker--time .picker__box {
+ margin-bottom: 5em;
+ }
+}
+
+/* ==========================================================================
+ $DEFAULT-TIME-PICKER
+ ========================================================================== */
+.clockpicker-display {
+ font-size: 4rem;
+ font-weight: bold;
+ text-align: center;
+ color: rgba(255, 255, 255, 0.6);
+ font-weight: 400;
+ clear: both;
+ position: relative;
+}
+
+.clockpicker-span-am-pm {
+ font-size: 1.3rem;
+ position: absolute;
+ right: 1rem;
+ bottom: 0.3rem;
+ line-height: 2rem;
+ font-weight: 500;
+}
+@media only screen and (min-width: 601px) {
+ .clockpicker-display {
+ top: 32%;
+ }
+ .clockpicker-span-am-pm {
+ position: relative;
+ right: auto;
+ bottom: auto;
+ text-align: center;
+ margin-top: 1.2rem;
+ }
+}
+
+
+.text-primary{
+ color: rgba(255, 255, 255, 1)
+}
+.clockpicker-span-hours {
+ margin-right: 3px;
+}
+.clockpicker-span-minutes {
+ margin-left: 3px;
+}
+
+.clockpicker-span-hours,
+.clockpicker-span-minutes,
+.clockpicker-span-am-pm div {
+ cursor: pointer;
+}
+.clockpicker-moving {
+ cursor: move;
+}
+.clockpicker-plate {
+ background-color: $timepicker-clock-plate-bg;
+ border-radius: 50%;
+ width: 270px;
+ height: 270px;
+ overflow: visible;
+ position: relative;
+ margin: auto;
+ margin-top: 25px;
+ margin-bottom: 5px;
+ user-select: none;
+}
+.clockpicker-canvas,
+.clockpicker-dial {
+ width: 270px;
+ height: 270px;
+ position: absolute;
+ left: -1px;
+ top: -1px;
+}
+.clockpicker-minutes {
+ visibility: hidden;
+}
+.clockpicker-tick {
+ border-radius: 50%;
+ color: $timepicker-clock-color;
+ line-height: 40px;
+ text-align: center;
+ width: 40px;
+ height: 40px;
+ position: absolute;
+ cursor: pointer;
+}
+.clockpicker-tick.active,
+.clockpicker-tick:hover {
+ background-color: transparentize($secondary-color, .75);
+}
+.clockpicker-dial {
+ -webkit-transition: -webkit-transform 350ms, opacity 350ms;
+ -moz-transition: -moz-transform 350ms, opacity 350ms;
+ -ms-transition: -ms-transform 350ms, opacity 350ms;
+ -o-transition: -o-transform 350ms, opacity 350ms;
+ transition: transform 350ms, opacity 350ms;
+}
+.clockpicker-dial-out {
+ opacity: 0;
+}
+.clockpicker-hours.clockpicker-dial-out {
+ -webkit-transform: scale(1.2, 1.2);
+ -moz-transform: scale(1.2, 1.2);
+ -ms-transform: scale(1.2, 1.2);
+ -o-transform: scale(1.2, 1.2);
+ transform: scale(1.2, 1.2);
+}
+.clockpicker-minutes.clockpicker-dial-out {
+ -webkit-transform: scale(.8, .8);
+ -moz-transform: scale(.8, .8);
+ -ms-transform: scale(.8, .8);
+ -o-transform: scale(.8, .8);
+ transform: scale(.8, .8);
+}
+.clockpicker-canvas {
+ -webkit-transition: opacity 175ms;
+ -moz-transition: opacity 175ms;
+ -ms-transition: opacity 175ms;
+ -o-transition: opacity 175ms;
+ transition: opacity 175ms;
+}
+.clockpicker-canvas-out {
+ opacity: 0.25;
+}
+.clockpicker-canvas-bearing {
+ stroke: none;
+ fill: $secondary-color;
+}
+.clockpicker-canvas-bg {
+ stroke: none;
+ fill: $secondary-color;
+}
+.clockpicker-canvas-bg-trans {
+ fill: $secondary-color;
+}
+.clockpicker-canvas line {
+ stroke: $secondary-color;
+ stroke-width: 4;
+ stroke-linecap: round;
+ /*shape-rendering: crispEdges;*/
+}
diff --git a/app/dispatch/static/materialize/sass/components/forms/_checkboxes.scss b/app/dispatch/static/materialize/sass/components/forms/_checkboxes.scss new file mode 100644 index 0000000..60334b2 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/forms/_checkboxes.scss @@ -0,0 +1,210 @@ +/* Checkboxes
+ ========================================================================== */
+
+/* CUSTOM CSS CHECKBOXES */
+form p {
+ margin-bottom: 10px;
+ text-align: left;
+}
+
+form p:last-child {
+ margin-bottom: 0;
+}
+
+/* Remove default checkbox */
+[type="checkbox"]:not(:checked),
+[type="checkbox"]:checked {
+ position: absolute;
+ opacity: 0;
+ pointer-events: none;
+}
+
+// Checkbox Styles
+[type="checkbox"] {
+ // Text Label Style
+ + label {
+ position: relative;
+ padding-left: 35px;
+ cursor: pointer;
+ display: inline-block;
+ height: 25px;
+ line-height: 25px;
+ font-size: 1rem;
+ user-select: none;
+ }
+
+ /* checkbox aspect */
+ + label:before,
+ &:not(.filled-in) + label:after {
+ content: '';
+ position: absolute;
+ top: 0;
+ left: 0;
+ width: 18px;
+ height: 18px;
+ z-index: 0;
+ border: 2px solid $radio-empty-color;
+ border-radius: 1px;
+ margin-top: 2px;
+ transition: .2s;
+ }
+
+ &:not(.filled-in) + label:after {
+ border: 0;
+ transform: scale(0);
+ }
+
+ &:not(:checked):disabled + label:before {
+ border: none;
+ background-color: $input-disabled-color;
+ }
+
+ // Focused styles
+ &.tabbed:focus + label:after {
+ transform: scale(1);
+ border: 0;
+ border-radius: 50%;
+ box-shadow: 0 0 0 10px rgba(0,0,0,.1);
+ background-color: rgba(0,0,0,.1);
+ }
+}
+
+[type="checkbox"]:checked {
+ + label:before {
+ top: -4px;
+ left: -5px;
+ width: 12px;
+ height: 22px;
+ border-top: 2px solid transparent;
+ border-left: 2px solid transparent;
+ border-right: $radio-border;
+ border-bottom: $radio-border;
+ transform: rotate(40deg);
+ backface-visibility: hidden;
+ transform-origin: 100% 100%;
+ }
+
+ &:disabled + label:before {
+ border-right: 2px solid $input-disabled-color;
+ border-bottom: 2px solid $input-disabled-color;
+ }
+}
+
+/* Indeterminate checkbox */
+[type="checkbox"]:indeterminate {
+ +label:before {
+ top: -11px;
+ left: -12px;
+ width: 10px;
+ height: 22px;
+ border-top: none;
+ border-left: none;
+ border-right: $radio-border;
+ border-bottom: none;
+ transform: rotate(90deg);
+ backface-visibility: hidden;
+ transform-origin: 100% 100%;
+ }
+
+ // Disabled indeterminate
+ &:disabled + label:before {
+ border-right: 2px solid $input-disabled-color;
+ background-color: transparent;
+ }
+}
+
+// Filled in Style
+[type="checkbox"].filled-in {
+ // General
+ + label:after {
+ border-radius: 2px;
+ }
+
+ + label:before,
+ + label:after {
+ content: '';
+ left: 0;
+ position: absolute;
+ /* .1s delay is for check animation */
+ transition: border .25s, background-color .25s, width .20s .1s, height .20s .1s, top .20s .1s, left .20s .1s;
+ z-index: 1;
+ }
+
+ // Unchecked style
+ &:not(:checked) + label:before {
+ width: 0;
+ height: 0;
+ border: 3px solid transparent;
+ left: 6px;
+ top: 10px;
+ transform: rotateZ(37deg);
+ transform-origin: 100% 100%;
+ }
+
+ &:not(:checked) + label:after {
+ height: 20px;
+ width: 20px;
+ background-color: transparent;
+ border: 2px solid $radio-empty-color;
+ top: 0px;
+ z-index: 0;
+ }
+
+ // Checked style
+ &:checked {
+ + label:before {
+ top: 0;
+ left: 1px;
+ width: 8px;
+ height: 13px;
+ border-top: 2px solid transparent;
+ border-left: 2px solid transparent;
+ border-right: 2px solid $input-background;
+ border-bottom: 2px solid $input-background;
+ transform: rotateZ(37deg);
+ transform-origin: 100% 100%;
+ }
+
+ + label:after {
+ top: 0;
+ width: 20px;
+ height: 20px;
+ border: 2px solid $secondary-color;
+ background-color: $secondary-color;
+ z-index: 0;
+ }
+ }
+
+ // Focused styles
+ &.tabbed:focus + label:after {
+ border-radius: 2px;
+ border-color: $radio-empty-color;
+ background-color: rgba(0,0,0,.1);
+ }
+
+ &.tabbed:checked:focus + label:after {
+ border-radius: 2px;
+ background-color: $secondary-color;
+ border-color: $secondary-color;
+ }
+
+ // Disabled style
+ &:disabled:not(:checked) + label:before {
+ background-color: transparent;
+ border: 2px solid transparent;
+ }
+
+ &:disabled:not(:checked) + label:after {
+ border-color: transparent;
+ background-color: $input-disabled-solid-color;
+ }
+
+ &:disabled:checked + label:before {
+ background-color: transparent;
+ }
+
+ &:disabled:checked + label:after {
+ background-color: $input-disabled-solid-color;
+ border-color: $input-disabled-solid-color;
+ }
+}
diff --git a/app/dispatch/static/materialize/sass/components/forms/_file-input.scss b/app/dispatch/static/materialize/sass/components/forms/_file-input.scss new file mode 100644 index 0000000..e0f7ef7 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/forms/_file-input.scss @@ -0,0 +1,44 @@ +/* File Input
+ ========================================================================== */
+
+.file-field {
+ position: relative;
+
+ .file-path-wrapper {
+ overflow: hidden;
+ padding-left: 10px;
+ }
+
+ input.file-path { width: 100%; }
+
+ .btn {
+ float: left;
+ height: $input-height;
+ line-height: $input-height;
+ }
+
+ span {
+ cursor: pointer;
+ }
+
+ input[type=file] {
+
+ // Needed to override webkit button
+ &::-webkit-file-upload-button {
+ display: none;
+ }
+
+ position: absolute;
+ top: 0;
+ right: 0;
+ left: 0;
+ bottom: 0;
+ width: 100%;
+ margin: 0;
+ padding: 0;
+ font-size: 20px;
+ cursor: pointer;
+ opacity: 0;
+ filter: alpha(opacity=0);
+ }
+}
diff --git a/app/dispatch/static/materialize/sass/components/forms/_forms.scss b/app/dispatch/static/materialize/sass/components/forms/_forms.scss new file mode 100644 index 0000000..4c19f4c --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/forms/_forms.scss @@ -0,0 +1,22 @@ +// Remove Focus Boxes
+select:focus {
+ outline: $select-focus;
+}
+
+button:focus {
+ outline: none;
+ background-color: $button-background-focus;
+}
+
+label {
+ font-size: $label-font-size;
+ color: $input-border-color;
+}
+
+@import 'input-fields';
+@import 'radio-buttons';
+@import 'checkboxes';
+@import 'switches';
+@import 'select';
+@import 'file-input';
+@import 'range';
diff --git a/app/dispatch/static/materialize/sass/components/forms/_input-fields.scss b/app/dispatch/static/materialize/sass/components/forms/_input-fields.scss new file mode 100644 index 0000000..ffdf522 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/forms/_input-fields.scss @@ -0,0 +1,333 @@ +/* Text Inputs + Textarea
+ ========================================================================== */
+
+/* Style Placeholders */
+
+::placeholder {
+ color: $placeholder-text-color;
+}
+
+/* Text inputs */
+
+input:not([type]),
+input[type=text]:not(.browser-default),
+input[type=password]:not(.browser-default),
+input[type=email]:not(.browser-default),
+input[type=url]:not(.browser-default),
+input[type=time]:not(.browser-default),
+input[type=date]:not(.browser-default),
+input[type=datetime]:not(.browser-default),
+input[type=datetime-local]:not(.browser-default),
+input[type=tel]:not(.browser-default),
+input[type=number]:not(.browser-default),
+input[type=search]:not(.browser-default),
+textarea.materialize-textarea {
+
+ // General Styles
+ background-color: transparent;
+ border: none;
+ border-bottom: $input-border;
+ border-radius: 0;
+ outline: none;
+ height: $input-height;
+ width: 100%;
+ font-size: $input-font-size;
+ margin: $input-margin;
+ padding: $input-padding;
+ box-shadow: none;
+ box-sizing: content-box;
+ transition: $input-transition;
+
+ // Disabled input style
+ &:disabled,
+ &[readonly="readonly"] {
+ color: $input-disabled-color;
+ border-bottom: $input-disabled-border;
+ }
+
+ // Disabled label style
+ &:disabled+label,
+ &[readonly="readonly"]+label {
+ color: $input-disabled-color;
+ }
+
+ // Focused input style
+ &:focus:not([readonly]) {
+ border-bottom: 1px solid $input-focus-color;
+ box-shadow: 0 1px 0 0 $input-focus-color;
+ }
+
+ // Focused label style
+ &:focus:not([readonly])+label {
+ color: $input-focus-color;
+ }
+
+ // Valid Input Style
+ &.valid,
+ &:focus.valid {
+ @extend %valid-input-style;
+ }
+
+ // Custom Success Message
+ &.valid + label:after,
+ &:focus.valid + label:after {
+ @extend %custom-success-message;
+ }
+
+ // Invalid Input Style
+ &.invalid,
+ &:focus.invalid {
+ @extend %invalid-input-style;
+ }
+
+ // Custom Error message
+ &.invalid + label:after,
+ &:focus.invalid + label:after {
+ @extend %custom-error-message;
+ }
+
+ // Full width label when using validate for error messages
+ &.validate + label {
+ width: 100%;
+ }
+
+ // Form Message Shared Styles
+ & + label:after {
+ @extend %input-after-style;
+ }
+
+ // TODO: Remove once input fields are reworked to support validation messages better
+ &.invalid + label:after,
+ &.valid + label:after{
+ display: none;
+ }
+
+ &.invalid + label.active:after,
+ &.valid + label.active:after{
+ display: block;
+ }
+}
+
+
+/* Validation Sass Placeholders */
+%valid-input-style {
+ border-bottom: 1px solid $input-success-color;
+ box-shadow: 0 1px 0 0 $input-success-color;
+}
+%invalid-input-style {
+ border-bottom: $input-invalid-border;
+ box-shadow: 0 1px 0 0 $input-error-color;
+}
+%custom-success-message {
+ content: attr(data-success);
+ color: $input-success-color;
+ opacity: 1;
+ transform: translateY(9px);
+}
+%custom-error-message {
+ content: attr(data-error);
+ color: $input-error-color;
+ opacity: 1;
+ transform: translateY(9px);
+}
+%input-after-style {
+ display: block;
+ content: "";
+ position: absolute;
+ top: 100%;
+ left: 0;
+ opacity: 0;
+ transition: .2s opacity ease-out, .2s color ease-out;
+}
+
+
+// Styling for input field wrapper
+.input-field {
+ // Inline styles
+ &.inline {
+ display: inline-block;
+ vertical-align: middle;
+ margin-left: 5px;
+
+ input,
+ .select-dropdown {
+ margin-bottom: 1rem;
+ }
+ }
+
+ // Gutter spacing
+ &.col {
+ label {
+ left: $gutter-width / 2;
+ }
+
+ .prefix ~ label,
+ .prefix ~ .validate ~ label {
+ width: calc(100% - 3rem - #{$gutter-width});
+ }
+ }
+
+ position: relative;
+ margin-top: 1rem;
+
+ label {
+ color: $input-border-color;
+ position: absolute;
+ top: 0;
+ left: 0;
+ height: 100%;
+ font-size: 1rem;
+ cursor: text;
+ transition: transform .2s ease-out;
+ transform-origin: 0% 100%;
+ text-align: initial;
+ transform: translateY(12px);
+ pointer-events: none;
+
+ &:not(.label-icon).active {
+ transform: translateY(-14px) scale(.8);
+ transform-origin: 0 0;
+ }
+ }
+
+ // Prefix Icons
+ .prefix {
+ position: absolute;
+ width: $input-height;
+ font-size: 2rem;
+ transition: color .2s;
+
+ &.active { color: $input-focus-color; }
+ }
+
+ .prefix ~ input,
+ .prefix ~ textarea,
+ .prefix ~ label,
+ .prefix ~ .validate ~ label,
+ .prefix ~ .autocomplete-content {
+ margin-left: 3rem;
+ width: 92%;
+ width: calc(100% - 3rem);
+ }
+
+ .prefix ~ label { margin-left: 3rem; }
+
+ @media #{$medium-and-down} {
+ .prefix ~ input {
+ width: 86%;
+ width: calc(100% - 3rem);
+ }
+ }
+
+ @media #{$small-and-down} {
+ .prefix ~ input {
+ width: 80%;
+ width: calc(100% - 3rem);
+ }
+ }
+}
+
+
+/* Search Field */
+
+.input-field input[type=search] {
+ display: block;
+ line-height: inherit;
+
+ .nav-wrapper & {
+ height: inherit;
+ padding-left: 4rem;
+ width: calc(100% - 4rem);
+ border: 0;
+ box-shadow: none;
+ }
+
+ &:focus {
+ background-color: $input-background;
+ border: 0;
+ box-shadow: none;
+ color: #444;
+
+ & + label i,
+ & ~ .mdi-navigation-close,
+ & ~ .material-icons {
+ color: #444;
+ }
+ }
+
+ & + label {
+ left: 1rem;
+ }
+
+ & ~ .mdi-navigation-close,
+ & ~ .material-icons {
+ position: absolute;
+ top: 0;
+ right: 1rem;
+ color: transparent;
+ cursor: pointer;
+ font-size: 2rem;
+ transition: .3s color;
+ }
+}
+
+
+/* Textarea */
+
+// Default textarea
+textarea {
+ width: 100%;
+ height: $input-height;
+ background-color: transparent;
+
+ &.materialize-textarea {
+ // Fixes validation messages for dynamic textareas
+ &.validate + label {
+ &::after {
+ top: calc(100% - 12px);
+ }
+ &:not(.label-icon).active {
+ transform: translateY(-25px);
+ }
+ height: 100%;
+ }
+
+ overflow-y: hidden; /* prevents scroll bar flash */
+ padding: .8rem 0 1.6rem 0; /* prevents text jump on Enter keypress */
+ resize: none;
+ min-height: $input-height;
+ }
+}
+
+// For textarea autoresize
+.hiddendiv {
+ display: none;
+ white-space: pre-wrap;
+ word-wrap: break-word;
+ overflow-wrap: break-word; /* future version of deprecated 'word-wrap' */
+ padding-top: 1.2rem; /* prevents text jump on Enter keypress */
+
+ // Reduces repaints
+ position: absolute;
+ top: 0;
+}
+
+
+/* Autocomplete */
+.autocomplete-content {
+ margin-top: -1 * $input-margin-bottom;
+ margin-bottom: $input-margin-bottom;
+ display: block;
+ opacity: 1;
+ position: static;
+
+ li {
+ .highlight { color: #444; }
+
+ img {
+ height: $dropdown-item-height - 10;
+ width: $dropdown-item-height - 10;
+ margin: 5px 15px;
+ }
+ }
+}
diff --git a/app/dispatch/static/materialize/sass/components/forms/_radio-buttons.scss b/app/dispatch/static/materialize/sass/components/forms/_radio-buttons.scss new file mode 100644 index 0000000..ca82a96 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/forms/_radio-buttons.scss @@ -0,0 +1,115 @@ +/* Radio Buttons
+ ========================================================================== */
+
+// Remove default Radio Buttons
+[type="radio"]:not(:checked),
+[type="radio"]:checked {
+ position: absolute;
+ opacity: 0;
+ pointer-events: none;
+}
+
+[type="radio"]:not(:checked) + label,
+[type="radio"]:checked + label {
+ position: relative;
+ padding-left: 35px;
+ cursor: pointer;
+ display: inline-block;
+ height: 25px;
+ line-height: 25px;
+ font-size: 1rem;
+ transition: .28s ease;
+ user-select: none;
+}
+
+[type="radio"] + label:before,
+[type="radio"] + label:after {
+ content: '';
+ position: absolute;
+ left: 0;
+ top: 0;
+ margin: 4px;
+ width: 16px;
+ height: 16px;
+ z-index: 0;
+ transition: .28s ease;
+}
+
+/* Unchecked styles */
+[type="radio"]:not(:checked) + label:before,
+[type="radio"]:not(:checked) + label:after,
+[type="radio"]:checked + label:before,
+[type="radio"]:checked + label:after,
+[type="radio"].with-gap:checked + label:before,
+[type="radio"].with-gap:checked + label:after {
+ border-radius: 50%;
+}
+
+[type="radio"]:not(:checked) + label:before,
+[type="radio"]:not(:checked) + label:after {
+ border: 2px solid $radio-empty-color;
+}
+
+[type="radio"]:not(:checked) + label:after {
+ transform: scale(0);
+}
+
+/* Checked styles */
+[type="radio"]:checked + label:before {
+ border: 2px solid transparent;
+}
+
+[type="radio"]:checked + label:after,
+[type="radio"].with-gap:checked + label:before,
+[type="radio"].with-gap:checked + label:after {
+ border: $radio-border;
+}
+
+[type="radio"]:checked + label:after,
+[type="radio"].with-gap:checked + label:after {
+ background-color: $radio-fill-color;
+}
+
+[type="radio"]:checked + label:after {
+ transform: scale(1.02);
+}
+
+/* Radio With gap */
+[type="radio"].with-gap:checked + label:after {
+ transform: scale(.5);
+}
+
+/* Focused styles */
+[type="radio"].tabbed:focus + label:before {
+ box-shadow: 0 0 0 10px rgba(0,0,0,.1);
+}
+
+/* Disabled Radio With gap */
+[type="radio"].with-gap:disabled:checked + label:before {
+ border: 2px solid $input-disabled-color;
+}
+
+[type="radio"].with-gap:disabled:checked + label:after {
+ border: none;
+ background-color: $input-disabled-color;
+}
+
+/* Disabled style */
+[type="radio"]:disabled:not(:checked) + label:before,
+[type="radio"]:disabled:checked + label:before {
+ background-color: transparent;
+ border-color: $input-disabled-color;
+}
+
+[type="radio"]:disabled + label {
+ color: $input-disabled-color;
+}
+
+[type="radio"]:disabled:not(:checked) + label:before {
+ border-color: $input-disabled-color;
+}
+
+[type="radio"]:disabled:checked + label:after {
+ background-color: $input-disabled-color;
+ border-color: $input-disabled-solid-color;
+}
diff --git a/app/dispatch/static/materialize/sass/components/forms/_range.scss b/app/dispatch/static/materialize/sass/components/forms/_range.scss new file mode 100644 index 0000000..d37ff7e --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/forms/_range.scss @@ -0,0 +1,160 @@ +/* Range
+ ========================================================================== */
+
+.range-field {
+ position: relative;
+}
+
+input[type=range],
+input[type=range] + .thumb {
+ @extend .no-select;
+ cursor: pointer;
+}
+
+input[type=range] {
+ position: relative;
+ background-color: transparent;
+ border: none;
+ outline: none;
+ width: 100%;
+ margin: 15px 0;
+ padding: 0;
+
+ &:focus {
+ outline: none;
+ }
+}
+
+input[type=range] + .thumb {
+ position: absolute;
+ top: 10px;
+ left: 0;
+ border: none;
+ height: 0;
+ width: 0;
+ border-radius: 50%;
+ background-color: $radio-fill-color;
+ margin-left: 7px;
+
+ transform-origin: 50% 50%;
+ transform: rotate(-45deg);
+
+ .value {
+ display: block;
+ width: 30px;
+ text-align: center;
+ color: $radio-fill-color;
+ font-size: 0;
+ transform: rotate(45deg);
+ }
+
+ &.active {
+ border-radius: 50% 50% 50% 0;
+
+ .value {
+ color: $input-background;
+ margin-left: -1px;
+ margin-top: 8px;
+ font-size: 10px;
+ }
+ }
+}
+
+// WebKit
+input[type=range] {
+ -webkit-appearance: none;
+}
+
+input[type=range]::-webkit-slider-runnable-track {
+ height: $track-height;
+ background: #c2c0c2;
+ border: none;
+}
+
+input[type=range]::-webkit-slider-thumb {
+ -webkit-appearance: none;
+ border: none;
+ height: $range-height;
+ width: $range-width;
+ border-radius: 50%;
+ background-color: $radio-fill-color;
+ transform-origin: 50% 50%;
+ margin: -5px 0 0 0;
+ transition: .3s;
+}
+
+input[type=range]:focus::-webkit-slider-runnable-track {
+ background: #ccc;
+}
+
+// FireFox
+input[type=range] {
+ /* fix for FF unable to apply focus style bug */
+ border: 1px solid white;
+
+ /*required for proper track sizing in FF*/
+}
+
+input[type=range]::-moz-range-track {
+ height: $track-height;
+ background: #ddd;
+ border: none;
+}
+
+input[type=range]::-moz-range-thumb {
+ border: none;
+ height: $range-height;
+ width: $range-width;
+ border-radius: 50%;
+ background: $radio-fill-color;
+ margin-top: -5px;
+}
+
+// hide the outline behind the border
+input[type=range]:-moz-focusring {
+ outline: 1px solid #fff;
+ outline-offset: -1px;
+}
+
+input[type=range]:focus::-moz-range-track {
+ background: #ccc;
+}
+
+// IE 10+
+input[type=range]::-ms-track {
+ height: $track-height;
+
+ // remove bg colour from the track, we'll use ms-fill-lower and ms-fill-upper instead
+ background: transparent;
+
+ // leave room for the larger thumb to overflow with a transparent border */
+ border-color: transparent;
+ border-width: 6px 0;
+
+ /*remove default tick marks*/
+ color: transparent;
+}
+
+input[type=range]::-ms-fill-lower {
+ background: #777;
+}
+
+input[type=range]::-ms-fill-upper {
+ background: #ddd;
+}
+
+input[type=range]::-ms-thumb {
+ border: none;
+ height: $range-height;
+ width: $range-width;
+ border-radius: 50%;
+ background: $radio-fill-color;
+}
+
+input[type=range]:focus::-ms-fill-lower {
+ background: #888;
+}
+
+input[type=range]:focus::-ms-fill-upper {
+ background: #ccc;
+}
diff --git a/app/dispatch/static/materialize/sass/components/forms/_select.scss b/app/dispatch/static/materialize/sass/components/forms/_select.scss new file mode 100644 index 0000000..bc7208e --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/forms/_select.scss @@ -0,0 +1,182 @@ +/* Select Field
+ ========================================================================== */
+
+select { display: none; }
+select.browser-default { display: block; }
+
+select {
+ background-color: $select-background;
+ width: 100%;
+ padding: $select-padding;
+ border: $select-border;
+ border-radius: $select-radius;
+ height: $input-height;
+}
+
+
+.input-field {
+ & > select {
+ display: block;
+ position: absolute;
+ width: 0;
+ pointer-events: none;
+ height: 0;
+ top: 0;
+ left: 0;
+ opacity: 0;
+ }
+}
+
+.select-label {
+ position: absolute;
+}
+
+.select-wrapper {
+ &.valid {
+ & > input.select-dropdown {
+ @extend %valid-input-style;
+ }
+
+ & + label:after {
+ @extend %custom-success-message;
+ }
+ }
+
+ &.invalid {
+ & > input.select-dropdown {
+ @extend %invalid-input-style;
+ }
+
+ & + label:after {
+ @extend %custom-error-message;
+ }
+ }
+
+ &.valid + label,
+ &.invalid + label {
+ width: 100%;
+ pointer-events: none;
+ }
+
+ & + label:after {
+ @extend %input-after-style;
+ }
+
+ position: relative;
+
+ input.select-dropdown {
+ position: relative;
+ cursor: pointer;
+ background-color: transparent;
+ border: none;
+ border-bottom: $input-border;
+ outline: none;
+ height: $input-height;
+ line-height: $input-height;
+ width: 100%;
+ font-size: $input-font-size;
+ margin: $input-margin;
+ padding: 0;
+ display: block;
+ user-select:none;
+ }
+
+ span.caret {
+ color: initial;
+ position: absolute;
+ right: 0;
+ top: 0;
+ bottom: 0;
+ height: 10px;
+ margin: auto 0;
+ font-size: 10px;
+ line-height: 10px;
+ }
+
+ & + label {
+ position: absolute;
+ top: -26px;
+ font-size: $label-font-size;
+ }
+}
+
+// Disabled styles
+select:disabled {
+ color: $input-disabled-color;
+}
+
+.select-wrapper.disabled {
+ span.caret,
+ & + label {
+ color: $input-disabled-color;
+ }
+}
+
+.select-wrapper input.select-dropdown:disabled {
+ color: $input-disabled-color;
+ cursor: default;
+ user-select: none;
+}
+
+.select-wrapper i {
+ color: $select-disabled-color;
+}
+
+.select-dropdown li.disabled,
+.select-dropdown li.disabled > span,
+.select-dropdown li.optgroup {
+ color: $select-disabled-color;
+ background-color: transparent;
+}
+
+.select-dropdown.dropdown-content {
+ li {
+ &.active {
+ background-color: transparent;
+ }
+
+ &:hover {
+ background-color: $select-option-hover;
+ }
+
+ &.selected {
+ background-color: $select-option-focus;
+ }
+ }
+}
+
+// Prefix Icons
+.prefix ~ .select-wrapper {
+ margin-left: 3rem;
+ width: 92%;
+ width: calc(100% - 3rem);
+}
+
+.prefix ~ label { margin-left: 3rem; }
+
+// Icons
+.select-dropdown li {
+ img {
+ height: $dropdown-item-height - 10;
+ width: $dropdown-item-height - 10;
+ margin: 5px 15px;
+ float: right;
+ }
+}
+
+// Optgroup styles
+.select-dropdown li.optgroup {
+ border-top: 1px solid $dropdown-hover-bg-color;
+
+ &.selected > span {
+ color: rgba(0, 0, 0, .7);
+ }
+
+ & > span {
+ color: rgba(0, 0, 0, .4);
+ }
+
+ & ~ li.optgroup-option {
+ padding-left: 1rem;
+ }
+}
diff --git a/app/dispatch/static/materialize/sass/components/forms/_switches.scss b/app/dispatch/static/materialize/sass/components/forms/_switches.scss new file mode 100644 index 0000000..3296b12 --- /dev/null +++ b/app/dispatch/static/materialize/sass/components/forms/_switches.scss @@ -0,0 +1,89 @@ +/* Switch
+ ========================================================================== */
+
+.switch,
+.switch * {
+ -webkit-tap-highlight-color: transparent;
+ user-select: none;
+}
+
+.switch label {
+ cursor: pointer;
+}
+
+.switch label input[type=checkbox] {
+ opacity: 0;
+ width: 0;
+ height: 0;
+
+ &:checked + .lever {
+ background-color: $switch-checked-lever-bg;
+
+ &:before, &:after {
+ left: 18px;
+ }
+
+ &:after {
+ background-color: $switch-bg-color;
+ }
+ }
+}
+
+.switch label .lever {
+ content: "";
+ display: inline-block;
+ position: relative;
+ width: 36px;
+ height: 14px;
+ background-color: $switch-unchecked-lever-bg;
+ border-radius: $switch-radius;
+ margin-right: 10px;
+ transition: background 0.3s ease;
+ vertical-align: middle;
+ margin: 0 16px;
+
+ &:before, &:after {
+ content: "";
+ position: absolute;
+ display: inline-block;
+ width: 20px;
+ height: 20px;
+ border-radius: 50%;
+ left: 0;
+ top: -3px;
+ transition: left 0.3s ease, background .3s ease, box-shadow 0.1s ease, transform .1s ease;
+ }
+
+ &:before {
+ background-color: transparentize($switch-bg-color, .85);
+ }
+
+ &:after {
+ background-color: $switch-unchecked-bg;
+ box-shadow: 0px 3px 1px -2px rgba(0, 0, 0, 0.2), 0px 2px 2px 0px rgba(0, 0, 0, 0.14), 0px 1px 5px 0px rgba(0, 0, 0, 0.12);
+ }
+}
+
+// Switch active style
+input[type=checkbox]:checked:not(:disabled) ~ .lever:active::before,
+input[type=checkbox]:checked:not(:disabled).tabbed:focus ~ .lever::before {
+ transform: scale(2.4);
+ background-color: transparentize($switch-bg-color, .85);
+}
+
+input[type=checkbox]:not(:disabled) ~ .lever:active:before,
+input[type=checkbox]:not(:disabled).tabbed:focus ~ .lever::before {
+ transform: scale(2.4);
+ background-color: rgba(0,0,0,.08);
+}
+
+// Disabled Styles
+.switch input[type=checkbox][disabled] + .lever {
+ cursor: default;
+ background-color: rgba(0,0,0,.12);
+}
+
+.switch label input[type=checkbox][disabled] + .lever:after,
+.switch label input[type=checkbox][disabled]:checked + .lever:after {
+ background-color: $input-disabled-solid-color;
+}
diff --git a/app/dispatch/static/materialize/sass/materialize.scss b/app/dispatch/static/materialize/sass/materialize.scss new file mode 100644 index 0000000..8eafa35 --- /dev/null +++ b/app/dispatch/static/materialize/sass/materialize.scss @@ -0,0 +1,42 @@ +@charset "UTF-8";
+
+// Colors
+@import "components/color";
+
+// Variables;
+@import "components/variables";
+
+// Reset
+@import "components/normalize";
+
+// components
+@import "components/global";
+@import "components/badges";
+@import "components/icons-material-design";
+@import "components/grid";
+@import "components/navbar";
+@import "components/roboto";
+@import "components/typography";
+@import "components/transitions";
+@import "components/cards";
+@import "components/toast";
+@import "components/tabs";
+@import "components/tooltip";
+@import "components/buttons";
+@import "components/dropdown";
+@import "components/waves";
+@import "components/modal";
+@import "components/collapsible";
+@import "components/chips";
+@import "components/materialbox";
+@import "components/forms/forms";
+@import "components/table_of_contents";
+@import "components/sideNav";
+@import "components/preloader";
+@import "components/slider";
+@import "components/carousel";
+@import "components/tapTarget";
+@import "components/pulse";
+@import "components/date_picker/default";
+@import "components/date_picker/default.date";
+@import "components/date_picker/default.time";
diff --git a/app/dispatch/static/print.css b/app/dispatch/static/print.css new file mode 100644 index 0000000..6fc7ed3 --- /dev/null +++ b/app/dispatch/static/print.css @@ -0,0 +1,18 @@ +footer, nav, .hide-print { display: none !important; } + +.padding-30 { + padding: none !important; +} + +.z-depth-3 { + box-shadow: none !important; +} + + + +@page { + /*size: 29.7cm 42cm; -> that would be a regular A4 page */ + /* size: 35cm 49.5cm; */ + /* size: 8.5in 11in; */ +} + diff --git a/app/dispatch/templates/dispatch/invoice/detail-table.html b/app/dispatch/templates/dispatch/invoice/detail-table.html new file mode 100644 index 0000000..acb6e01 --- /dev/null +++ b/app/dispatch/templates/dispatch/invoice/detail-table.html @@ -0,0 +1,89 @@ + <div class="row"> + <div class="col s6"> + <h4> + Invoice #{{object.invoice_id}} + </h4> + </div> + </div> + <div class="row"> + <div class="col s6"> + <table> + <tr> + <th> + Invoice Date: + <br> + Due Date: + </th> + <td> + {{object.invoice_date}} + <br> + {{object.due_date}} + </td> + </tr> + </table> + </div> + <div class="col s6 right-align"> + {{object.owner.name}} + <br> + {{object.owner.address}} + <br> + {{object.owner.city}}, {{object.owner.state}} {{object.owner.zip_code}} + </div> + </div> + <div class="row"> + <div class="col s6"> + {{object.bill_to.name}} + <br> + {{object.bill_to.address}} + <br> + {{object.bill_to.city}}, {{object.bill_to.state}} {{object.bill_to.zip_code}} + </div> + </div> + + <div class="row"> + <div class="col s12"> + <table class="bordered striped invoice-table"> + <thead> + <th>Date</th> + <th>Description</th> + <th>Total</th> + </thead> + <tbody> + {% for item in object.items %} + <tr> + <td>{{item.date|date:"m/d/Y"}}</td> + <td>{{item.description}}</td> + <td>{{item.total}}</td> + </tr> + {% endfor %} + <tr> + <td></td> + <td></td> + <td></td> + </tr> + <tr> + <td><b>Total Price:</b></td> + <td></td> + <td>{{object.total}}</td> + </tr> + <tr> + <td><b>Amount Due:</b></td> + <td></td> + <td><b>{{object.total}}</b></td> + </tr> + </tbody> + </table> + </div> + </div> + +<style> +.invoice-table table { + border-collapse: collapse; +} +.invoice-table th, .invoice-table td, .invoice-table table { + border: 1px solid black; +} +.invoice-table tr { + height: 52px; +} +</style> diff --git a/app/dispatch/templates/dispatch/invoice/detail.html b/app/dispatch/templates/dispatch/invoice/detail.html new file mode 100644 index 0000000..d7b30f6 --- /dev/null +++ b/app/dispatch/templates/dispatch/invoice/detail.html @@ -0,0 +1,38 @@ +{% extends 'dispatch/base.html' %} + +{% block title %}Invoice for {{object.invoice_date}} by {{object.owner}}{% endblock %} + +{% block content %} +<div class="row hide-print"> + <div class="col s12"> + <h1>Invoice for {{object.invoice_date}} by {{object.owner}}</h1> + </div> +</div> + +<div style="padding-top:30px;" class="hide-print"></div> + +<div class="z-depth-3 padding-30"> +{% include "dispatch/invoice/detail-table.html" %} +</div> + +<div class="row hide-print" style="padding-top: 20px;"> + + <div class="col s12"> + <div class="right-align"> + <a class="btn red" href="{% url 'invoice_delete' object.pk%}">Delete</a> + <a class="btn green" href="#" onClick="window.print()">Print</a> + </div> + </div> + +</div> + +<style> +.padding-30 { + padding: 30px; +} +</style> + +<link rel="stylesheet" href="/static/print.css" media="print"> +<link rel="stylesheet" href="/static/materialize/css/materialize.min.css" media="print"> + +{%endblock%} diff --git a/app/dispatch/templates/dispatch/invoice/list.html b/app/dispatch/templates/dispatch/invoice/list.html new file mode 100644 index 0000000..292edd7 --- /dev/null +++ b/app/dispatch/templates/dispatch/invoice/list.html @@ -0,0 +1,41 @@ +{% extends 'dispatch/base.html' %} + +{% block title %}Invoices{% endblock %} + +{% block content %} +<div class="row"> + <div class="col s12 m6"> + <h1>Invoices</h1> + </div> +</div> +<table class="striped bordered"> + <thead> + <tr> + <th>User</th> + <th>Owner</th> + <th>Bill To</th> + <th>Invoice ID</th> + <th>Invoice Date</th> + <th>Due Date</th> + <th>Amount</th> + <th></th> + </tr> + </thead> + <tbody> + {{object_list}} + {% for invoice in object_list %} + <tr> + <td>{{invoice.user}}</td> + <td>{{invoice.owner}}</td> + <td>{{invoice.bill_to}}</td> + <td>{{invoice.invoice_id}}</td> + <td>{{invoice.invoice_date}}</td> + <td>{{invoice.due_date}}</td> + <td>{{invoice.total}}</td> + <td><a class="btn green" href="{% url 'invoice_detail' invoice.pk %}">View</a></td> + </tr> + {% endfor %} + + </tbody> +</table> +{% endblock %} diff --git a/app/dispatch/templates/dispatch/printable.html b/app/dispatch/templates/dispatch/printable.html new file mode 100644 index 0000000..9f9a181 --- /dev/null +++ b/app/dispatch/templates/dispatch/printable.html @@ -0,0 +1,112 @@ +{% load static %} +{% load custom_tags %} +<!DOCTYPE html> +<html lang="en"> +<head> + <meta charset="UTF-8"> + <title>{% block title %}{% endblock %}</title> + <!--Import Google Icon Font--> + <link href="https://fonts.googleapis.com/icon?family=Material+Icons" rel="stylesheet"> + <link type="text/css" rel="stylesheet" href="{% static 'style.css' %}" media="screen,projection"/> + + <!--Let browser know website is optimized for mobile--> + <meta name="viewport" content="width=device-width, initial-scale=1.0"/> + <style> + html, body, div, span, applet, object, iframe, +h1, h2, h3, h4, h5, h6, p, blockquote, pre, +a, abbr, acronym, address, big, cite, code, +del, dfn, em, img, ins, kbd, q, s, samp, +small, strike, strong, sub, sup, tt, var, +b, u, i, center, +dl, dt, dd, ol, ul, li, +fieldset, form, label, legend, +table, caption, tbody, tfoot, thead, tr, th, td, +article, aside, canvas, details, embed, +figure, figcaption, footer, header, hgroup, +menu, nav, output, ruby, section, summary, +time, mark, audio, video { + margin: 0; + padding: 0; + border: 0; + font-size: 100%; + font: inherit; + vertical-align: baseline; +} +/* HTML5 display-role reset for older browsers */ +article, aside, details, figcaption, figure, +footer, header, hgroup, menu, nav, section { + display: block; +} +body { + line-height: 1; +} +ol, ul { + list-style: none; +} +blockquote, q { + quotes: none; +} +blockquote:before, blockquote:after, +q:before, q:after { + content: ''; + content: none; +} +table { + border-collapse: collapse; + border-spacing: 0; +} + </style> + <style> + h1 { + font-size: 2rem; + margin: 0; + } + h2 { + font-size: 1.75rem; + + } + main { + padding: 16px; + } + .helptext{ + display: none; + } + </style> +</head> +<body> + + <main> + <div class="container"> + {% block content %} + {% endblock %} + </div> + </main> + + <style> +@media print{ + body{ background-color:#FFFFFF; background-image:none; color:#000000 } +} + </style> + + <!--Import jQuery before materialize.js--> + <script type="text/javascript" src="https://code.jquery.com/jquery-2.1.1.min.js"></script> + <script type="text/javascript" src="{% static 'materialize/js/materialize.min.js' %}"></script> + <script type="text/javascript" src="{% static 'base.js' %}"></script> + + <script> + $(".button-collapse").sideNav(); + + $('select').material_select(); + $(document).ready(function() { + $('input[type=checkbox]').each(function() { + $(this).addClass('filled-in'); + if(this.nextSibling.nodeName != 'label') { + $(this).after('<label for="'+this.id+'">' + jQuery(this).prev().html().replace(':','') + '</label>') ; + jQuery(this).prev().remove(); + } + }) + }) + $('nav li').find('a[href="' + window.location.pathname +'"]').parent().addClass('active'); + </script> +</body> +</html> |
